.github/utils/.gitignore

@@ -1,2 +0,0 @@
-.env
-__pycache__/

.github/utils/_get_password.py

@@ -1,57 +0,0 @@
-import base64
-import secrets
-from hashlib import sha256
-from typing import Tuple
-
-import mysql.connector as mysql
-from Crypto.Cipher import AES
-
-
-def get_password(
-    version_name: str,
-    version_code: int,
-    db_host: str,
-    db_user: str,
-    db_pass: str,
-    db_name: str,
-) -> Tuple[str, bytes]:
-    db = mysql.connect(
-        host=db_host,
-        user=db_user,
-        password=db_pass,
-        database=db_name,
-        auth_plugin="mysql_native_password",
-    )
-
-    print(f"Generating passwords for version {version_name} ({version_code})")
-
-    password = base64.b64encode(secrets.token_bytes(16)).decode()
-    iv = secrets.token_bytes(16)
-
-    key = f"{version_name}.{password}.{version_code}"
-    key = sha256(key.encode()).digest()
-    data = "ThisIsOurHardWorkPleaseDoNotCopyOrSteal(c)2019.KubaSz"
-    data = sha256(data.encode()).digest()
-    data = data + (chr(16) * 16).encode()
-
-    aes = AES.new(key=key, mode=AES.MODE_CBC, iv=iv)
-
-    app_password = base64.b64encode(aes.encrypt(data)).decode()
-
-    c = db.cursor()
-    c.execute(
-        "INSERT IGNORE INTO _appPasswords (versionCode, appPassword, password, iv) VALUES (%s, %s, %s, %s);",
-        (version_code, app_password, password, iv),
-    )
-    db.commit()
-
-    c = db.cursor()
-    c.execute(
-        "SELECT password, iv FROM _appPasswords WHERE versionCode = %s;",
-        (version_code,),
-    )
-    row = c.fetchone()
-
-    db.close()
-
-    return (row[0], row[1])

.github/utils/_utils.py

@@ -1,142 +0,0 @@
-import re
-import subprocess
-import sys
-from datetime import datetime
-from typing import Tuple
-
-VERSION_NAME_REGEX = r'versionName: "(.+?)"'
-VERSION_CODE_REGEX = r"versionCode: ([0-9]+)"
-VERSION_NAME_FORMAT = 'versionName: "{}"'
-VERSION_CODE_FORMAT = "versionCode: {}"
-
-
-def get_project_dir() -> str:
-    project_dir = sys.argv[1]
-    if project_dir[-1:] == "/" or project_dir[-1:] == "\\":
-        project_dir = project_dir[:-1]
-    return project_dir
-
-
-def read_gradle_version(project_dir: str) -> Tuple[int, str]:
-    GRADLE_PATH = f"{project_dir}/build.gradle"
-
-    with open(GRADLE_PATH, "r") as f:
-        gradle = f.read()
-
-    version_name = re.search(VERSION_NAME_REGEX, gradle).group(1)
-    version_code = int(re.search(VERSION_CODE_REGEX, gradle).group(1))
-
-    return (version_code, version_name)
-
-
-def write_gradle_version(project_dir: str, version_code: int, version_name: str):
-    GRADLE_PATH = f"{project_dir}/build.gradle"
-
-    with open(GRADLE_PATH, "r") as f:
-        gradle = f.read()
-
-    gradle = re.sub(
-        VERSION_NAME_REGEX, VERSION_NAME_FORMAT.format(version_name), gradle
-    )
-    gradle = re.sub(
-        VERSION_CODE_REGEX, VERSION_CODE_FORMAT.format(version_code), gradle
-    )
-
-    with open(GRADLE_PATH, "w") as f:
-        f.write(gradle)
-
-
-def build_version_code(version_name: str) -> int:
-    version = version_name.split("+")[0].split("-")
-    version_base = version[0]
-    version_suffix = version[1] if len(version) == 2 else ""
-
-    base_parts = version_base.split(".")
-    major = int(base_parts[0]) or 0
-    minor = int(base_parts[1]) if len(base_parts) > 1 else 0
-    patch = int(base_parts[2]) if len(base_parts) > 2 else 0
-
-    beta = 9
-    rc = 9
-    if "dev" in version_suffix:
-        beta = 0
-        rc = 0
-    elif "beta." in version_suffix:
-        beta = int(version_suffix.split(".")[1])
-        rc = 0
-    elif "rc." in version_suffix:
-        beta = 0
-        rc = int(version_suffix.split(".")[1])
-
-    version_code = beta + rc * 10 + patch * 100 + minor * 10000 + major * 1000000
-    return version_code
-
-
-def get_changelog(project_dir: str, format: str) -> Tuple[str, str]:
-    with open(
-        f"{project_dir}/app/src/main/assets/pl-changelog.html", "r", encoding="utf-8"
-    ) as f:
-        changelog = f.read()
-
-    title = re.search(r"<h3>(.+?)</h3>", changelog).group(1)
-    content = re.search(r"(?s)<ul>(.+)</ul>", changelog).group(1).strip()
-    content = "\n".join(line.strip() for line in content.split("\n"))
-
-    if format != "html":
-        content = content.replace("<li>", "- ")
-        content = content.replace("<br>", "\n")
-        if format == "markdown":
-            content = re.sub(r"<u>(.+?)</u>", "__\\1__", content)
-            content = re.sub(r"<i>(.+?)</i>", "*\\1*", content)
-            content = re.sub(r"<b>(.+?)</b>", "**\\1**", content)
-        content = re.sub(r"</?.+?>", "", content)
-
-    return (title, content)
-
-
-def get_commit_log(project_dir: str, format: str, max_lines: int = None) -> str:
-    last_tag = (
-        subprocess.check_output("git describe --tags --abbrev=0".split(" "))
-        .decode()
-        .strip()
-    )
-
-    log = subprocess.run(
-        args=f"git log {last_tag}..HEAD --format=%an%x00%at%x00%h%x00%s%x00%D".split(" "),
-        cwd=project_dir,
-        stdout=subprocess.PIPE,
-    )
-    log = log.stdout.strip().decode()
-
-    commits = [line.split("\x00") for line in log.split("\n")]
-    if max_lines:
-        commits = commits[:max_lines]
-
-    output = []
-    valid = False
-
-    for commit in commits:
-        if not commit[0]:
-            continue
-        if "origin/" in commit[4]:
-            valid = True
-        if not valid:
-            continue
-        date = datetime.fromtimestamp(float(commit[1]))
-        date = date.strftime("%Y-%m-%d %H:%M:%S")
-        if format == "html":
-            output.append(f"<li>{commit[3]} <i> - {commit[0]}</i></li>")
-        elif format == "markdown":
-            output.append(f"[{date}] {commit[0]}\n    {commit[3]}")
-        elif format == "markdown_full":
-            output.append(
-                f"_[{date}] {commit[0]}_\n`    `__`{commit[2]}`__  **{commit[3]}**"
-            )
-        elif format == "plain":
-            output.append(f"- {commit[3]}")
-
-    if format == "markdown":
-        output.insert(0, "```")
-        output.append("```")
-
-    return "\n".join(output)

.github/utils/bump_nightly.py

@@ -1,69 +0,0 @@
-import json
-import os
-import re
-import sys
-from datetime import datetime, timedelta
-
-import requests
-
-from _utils import (
-    get_commit_log,
-    get_project_dir,
-    read_gradle_version,
-    write_gradle_version,
-)
-
-if __name__ == "__main__":
-    if len(sys.argv) < 2:
-        print("usage: bump_nightly.py <project dir>")
-        exit(-1)
-
-    repo = os.getenv("GITHUB_REPOSITORY")
-    sha = os.getenv("GITHUB_SHA")
-
-    if not repo or not sha:
-        print("Missing GitHub environment variables.")
-        exit(-1)
-
-    with requests.get(
-        f"https://api.github.com/repos/{repo}/actions/runs?per_page=5&status=success"
-    ) as r:
-        data = json.loads(r.text)
-        runs = [run for run in data["workflow_runs"] if run["head_sha"] == sha]
-        if runs:
-            print("::set-output name=hasNewChanges::false")
-            exit(0)
-
-    print("::set-output name=hasNewChanges::true")
-
-    project_dir = get_project_dir()
-
-    (version_code, version_name) = read_gradle_version(project_dir)
-    version_name = version_name.split("+")[0]
-
-    date = datetime.now()
-    if date.hour > 6:
-        version_name += "+daily." + date.strftime("%Y%m%d-%H%M")
-    else:
-        date -= timedelta(days=1)
-        version_name += "+nightly." + date.strftime("%Y%m%d")
-
-    print("::set-output name=appVersionName::" + version_name)
-    print("::set-output name=appVersionCode::" + str(version_code))
-
-    write_gradle_version(project_dir, version_code, version_name)
-
-    commit_log = get_commit_log(project_dir, format="html", max_lines=10)
-
-    with open(
-        f"{project_dir}/app/src/main/assets/pl-changelog.html", "r", encoding="utf-8"
-    ) as f:
-        changelog = f.read()
-
-    changelog = re.sub(r"<h3>(.+?)</h3>", f"<h3>{version_name}</h3>", changelog)
-    changelog = re.sub(r"(?s)<ul>(.+)</ul>", f"<ul>\n{commit_log}\n</ul>", changelog)
-
-    with open(
-        f"{project_dir}/app/src/main/assets/pl-changelog.html", "w", encoding="utf-8"
-    ) as f:
-        f.write(changelog)

.github/utils/bump_version.py

@@ -1,41 +0,0 @@
-import os
-
-from dotenv import load_dotenv
-
-from _get_password import get_password
-from _utils import build_version_code, write_gradle_version
-from sign import sign
-
-if __name__ == "__main__":
-    version_name = input("Enter version name: ")
-    version_code = build_version_code(version_name)
-
-    print(f"Bumping version to {version_name} ({version_code})")
-
-    project_dir = "../.."
-
-    load_dotenv()
-    DB_HOST = os.getenv("DB_HOST")
-    DB_USER = os.getenv("DB_USER")
-    DB_PASS = os.getenv("DB_PASS")
-    DB_NAME = os.getenv("DB_NAME")
-
-    write_gradle_version(project_dir, version_code, version_name)
-    (password, iv) = get_password(
-        version_name, version_code, DB_HOST, DB_USER, DB_PASS, DB_NAME
-    )
-
-    sign(project_dir, version_name, version_code, password, iv, commit=False)
-
-    print("Writing mock passwords")
-    os.chdir(project_dir)
-    os.system(
-        "sed -i -E 's/\/\*([0-9a-f]{2} ?){16}\*\//\/*secret password - removed for source code publication*\//g' app/src/main/cpp/szkolny-signing.cpp"
-    )
-    os.system(
-        "sed -i -E 's/\\t0x.., 0x(.)., 0x.(.), 0x.(.), 0x.., 0x.., 0x.., 0x.(.), 0x.., 0x.(.), 0x(.)., 0x(.)., 0x.., 0x.., 0x.., 0x.(.)/\\t0x\\3\\6, 0x\\7\\4, 0x\\1\\8, 0x\\2\\5, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff /g' app/src/main/cpp/szkolny-signing.cpp"
-    )
-    os.system(
-        "sed -i -E 's/param1\..(.).(.).(.).(.)..(.)..(.)..(.)..(.).../param1.MTIzNDU2Nzg5MD\\5\\2\\7\\6\\1\\3\\4\8==/g' app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/interceptor/Signing.kt"
-    )
-    input("Press any key to finish")

.github/utils/extract_changelogs.py

@@ -1,72 +0,0 @@
-import os
-import sys
-
-from _utils import get_changelog, get_commit_log, get_project_dir, read_gradle_version
-
-if __name__ == "__main__":
-    if len(sys.argv) < 2:
-        print("usage: extract_changelogs.py <project dir>")
-        exit(-1)
-
-    project_dir = get_project_dir()
-
-    (version_code, version_name) = read_gradle_version(project_dir)
-
-    print("::set-output name=appVersionName::" + version_name)
-    print("::set-output name=appVersionCode::" + str(version_code))
-
-    dir = f"{project_dir}/app/release/whatsnew-{version_name}/"
-    os.makedirs(dir, exist_ok=True)
-
-    print("::set-output name=changelogDir::" + dir)
-
-    (title, changelog) = get_changelog(project_dir, format="plain")
-
-    # plain text changelog - Firebase App Distribution
-    with open(dir + "whatsnew_titled.txt", "w", encoding="utf-8") as f:
-        f.write(title)
-        f.write("\n")
-        f.write(changelog)
-    print("::set-output name=changelogPlainTitledFile::" + dir + "whatsnew_titled.txt")
-
-    print("::set-output name=changelogTitle::" + title)
-
-    # plain text changelog, max 500 chars - Google Play
-    with open(dir + "whatsnew-pl-PL", "w", encoding="utf-8") as f:
-        changelog_lines = changelog.split("\n")
-        changelog = ""
-        for line in changelog_lines:
-            if len(changelog) + len(line) < 500:
-                changelog += "\n" + line
-        changelog = changelog.strip()
-        f.write(changelog)
-
-    print("::set-output name=changelogPlainFile::" + dir + "whatsnew-pl-PL")
-
-    # markdown changelog - Discord webhook
-    (_, changelog) = get_changelog(project_dir, format="markdown")
-    with open(dir + "whatsnew.md", "w", encoding="utf-8") as f:
-        f.write(changelog)
-    print("::set-output name=changelogMarkdownFile::" + dir + "whatsnew.md")
-
-    # html changelog - version info in DB
-    (_, changelog) = get_changelog(project_dir, format="html")
-    with open(dir + "whatsnew.html", "w", encoding="utf-8") as f:
-        f.write(changelog)
-    print("::set-output name=changelogHtmlFile::" + dir + "whatsnew.html")
-
-
-    changelog = get_commit_log(project_dir, format="plain", max_lines=10)
-    with open(dir + "commit_log.txt", "w", encoding="utf-8") as f:
-        f.write(changelog)
-    print("::set-output name=commitLogPlainFile::" + dir + "commit_log.txt")
-
-    changelog = get_commit_log(project_dir, format="markdown", max_lines=10)
-    with open(dir + "commit_log.md", "w", encoding="utf-8") as f:
-        f.write(changelog)
-    print("::set-output name=commitLogMarkdownFile::" + dir + "commit_log.md")
-
-    changelog = get_commit_log(project_dir, format="html", max_lines=10)
-    with open(dir + "commit_log.html", "w", encoding="utf-8") as f:
-        f.write(changelog)
-    print("::set-output name=commitLogHtmlFile::" + dir + "commit_log.html")

.github/utils/rename_artifacts.py

@@ -1,26 +0,0 @@
-import glob
-import os
-import sys
-
-from _utils import get_project_dir
-
-if __name__ == "__main__":
-    if len(sys.argv) < 2:
-        print("usage: rename_artifacts.py <project dir>")
-        exit(-1)
-
-    project_dir = get_project_dir()
-
-    files = glob.glob(f"{project_dir}/app/release/*.*")
-    for file in files:
-        file_relative = file.replace(os.getenv("GITHUB_WORKSPACE") + "/", "")
-        if "-aligned.apk" in file:
-            os.unlink(file)
-        elif "-signed.apk" in file:
-            new_file = file.replace("-signed.apk", ".apk")
-            if os.path.isfile(new_file):
-                os.unlink(new_file)
-            os.rename(file, new_file)
-        elif ".apk" in file or ".aab" in file:
-            print("::set-output name=signedReleaseFile::" + file)
-            print("::set-output name=signedReleaseFileRelative::" + file_relative)

.github/utils/save_version.py

@@ -1,122 +0,0 @@
-import glob
-import os
-import sys
-from datetime import datetime
-from time import time
-
-import mysql.connector as mysql
-from dotenv import load_dotenv
-
-from _utils import get_changelog, get_commit_log, get_project_dir, read_gradle_version
-
-
-def save_version(
-    project_dir: str,
-    db_host: str,
-    db_user: str,
-    db_pass: str,
-    db_name: str,
-    apk_server_release: str,
-    apk_server_nightly: str,
-):
-    db = mysql.connect(
-        host=db_host,
-        user=db_user,
-        password=db_pass,
-        database=db_name,
-        auth_plugin="mysql_native_password",
-    )
-
-    (version_code, version_name) = read_gradle_version(project_dir)
-    (_, changelog) = get_changelog(project_dir, format="html")
-
-    types = ["dev", "beta", "nightly", "daily", "rc", "release"]
-    build_type = [x for x in types if x in version_name]
-    build_type = build_type[0] if build_type else "release"
-
-    if "+nightly." in version_name or "+daily." in version_name:
-        changelog = get_commit_log(project_dir, format="html")
-        build_type = "nightly"
-    elif "-dev" in version_name:
-        build_type = "dev"
-    elif "-beta." in version_name:
-        build_type = "beta"
-    elif "-rc." in version_name:
-        build_type = "rc"
-
-    build_date = int(time())
-    apk_name = None
-    bundle_name_play = None
-
-    files = glob.glob(f"{project_dir}/app/release/*.*")
-    output_apk = f"Edziennik_{version_name}_official.apk"
-    output_aab_play = f"Edziennik_{version_name}_play.aab"
-    for file in files:
-        if output_apk in file:
-            build_date = int(os.stat(file).st_mtime)
-            apk_name = output_apk
-        if output_aab_play in file:
-            build_date = int(os.stat(file).st_mtime)
-            bundle_name_play = output_aab_play
-
-    build_date = datetime.fromtimestamp(build_date).strftime("%Y-%m-%d %H:%M:%S")
-
-    if build_type in ["nightly", "daily"]:
-        download_url = apk_server_nightly + apk_name if apk_name else None
-    else:
-        download_url = apk_server_release + apk_name if apk_name else None
-
-    cols = [
-        "versionCode",
-        "versionName",
-        "releaseDate",
-        "releaseNotes",
-        "releaseType",
-        "downloadUrl",
-        "apkName",
-        "bundleNamePlay",
-    ]
-    updated = {
-        "versionCode": version_code,
-        "downloadUrl": download_url,
-        "apkName": apk_name,
-        "bundleNamePlay": bundle_name_play,
-    }
-
-    values = [
-        version_code,
-        version_name,
-        build_date,
-        changelog,
-        build_type,
-        download_url,
-        apk_name,
-        bundle_name_play,
-    ]
-    values.extend(val for val in updated.values() if val)
-
-    updated = ", ".join(f"{col} = %s" for (col, val) in updated.items() if val)
-
-    sql = f"INSERT INTO updates ({', '.join(cols)}) VALUES ({'%s, ' * (len(cols) - 1)}%s) ON DUPLICATE KEY UPDATE {updated};"
-
-    c = db.cursor()
-    c.execute(sql, tuple(values))
-    db.commit()
-
-
-if __name__ == "__main__":
-    if len(sys.argv) < 2:
-        print("usage: save_version.py <project dir>")
-        exit(-1)
-
-    project_dir = get_project_dir()
-
-    load_dotenv()
-    DB_HOST = os.getenv("DB_HOST")
-    DB_USER = os.getenv("DB_USER")
-    DB_PASS = os.getenv("DB_PASS")
-    DB_NAME = os.getenv("DB_NAME")
-    APK_SERVER_RELEASE = os.getenv("APK_SERVER_RELEASE")
-    APK_SERVER_NIGHTLY = os.getenv("APK_SERVER_NIGHTLY")
-
-    save_version(project_dir, DB_HOST, DB_USER, DB_PASS, DB_NAME, APK_SERVER_RELEASE, APK_SERVER_NIGHTLY)

.github/utils/sign.py

@@ -1,84 +0,0 @@
-import os
-import re
-import sys
-
-from dotenv import load_dotenv
-
-from _get_password import get_password
-from _utils import get_project_dir, read_gradle_version
-
-
-def sign(
-    project_dir: str,
-    version_name: str,
-    version_code: int,
-    password: str,
-    iv: bytes,
-    commit: bool = False,
-):
-    SIGNING_PATH = f"{project_dir}/app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/interceptor/Signing.kt"
-    CPP_PATH = f"{project_dir}/app/src/main/cpp/szkolny-signing.cpp"
-
-    with open(SIGNING_PATH, "r") as f:
-        signing = f.read()
-
-    with open(CPP_PATH, "r") as f:
-        cpp = f.read()
-
-    SIGNING_REGEX = r"\$param1\..*\.\$param2"
-    CPP_REGEX = r"(?s)/\*.+?toys AES_IV\[16\] = {.+?};"
-
-    SIGNING_FORMAT = "$param1.{}.$param2"
-    CPP_FORMAT = "/*{}*/\nstatic toys AES_IV[16] = {{\n\t{} }};"
-
-    print(f"Writing passwords for version {version_name} ({version_code})")
-
-    iv_hex = " ".join(["{:02x}".format(x) for x in iv])
-    iv_cpp = ", ".join(["0x{:02x}".format(x) for x in iv])
-
-    signing = re.sub(SIGNING_REGEX, SIGNING_FORMAT.format(password), signing)
-    cpp = re.sub(CPP_REGEX, CPP_FORMAT.format(iv_hex, iv_cpp), cpp)
-
-    with open(SIGNING_PATH, "w") as f:
-        f.write(signing)
-
-    with open(CPP_PATH, "w") as f:
-        f.write(cpp)
-
-    if commit:
-        os.chdir(project_dir)
-        os.system("git add .")
-        os.system(
-            f'git commit -m "[{version_name}] Update build.gradle, signing and changelog."'
-        )
-
-
-if __name__ == "__main__":
-    if len(sys.argv) < 2:
-        print("usage: sign.py <project dir> [commit]")
-        exit(-1)
-
-    project_dir = get_project_dir()
-
-    load_dotenv()
-    DB_HOST = os.getenv("DB_HOST")
-    DB_USER = os.getenv("DB_USER")
-    DB_PASS = os.getenv("DB_PASS")
-    DB_NAME = os.getenv("DB_NAME")
-
-    (version_code, version_name) = read_gradle_version(project_dir)
-    (password, iv) = get_password(
-        version_name, version_code, DB_HOST, DB_USER, DB_PASS, DB_NAME
-    )
-
-    print("::set-output name=appVersionName::" + version_name)
-    print("::set-output name=appVersionCode::" + str(version_code))
-
-    sign(
-        project_dir,
-        version_name,
-        version_code,
-        password,
-        iv,
-        commit="commit" in sys.argv,
-    )

.github/utils/webhook_discord.py

@@ -1,118 +0,0 @@
-import os
-import sys
-from datetime import datetime
-
-import requests
-from dotenv import load_dotenv
-
-from _utils import get_changelog, get_commit_log, get_project_dir, read_gradle_version
-
-
-def post_webhook(
-    project_dir: str,
-    apk_file: str,
-    apk_server_release: str,
-    apk_server_nightly: str,
-    webhook_release: str,
-    webhook_testing: str,
-):
-    (_, version_name) = read_gradle_version(project_dir)
-
-    types = ["dev", "beta", "nightly", "daily", "rc", "release"]
-    build_type = [x for x in types if x in version_name]
-    build_type = build_type[0] if build_type else None
-
-    testing = ["dev", "beta", "nightly", "daily"]
-    testing = build_type in testing
-
-    apk_name = os.path.basename(apk_file)
-    if build_type in ["nightly", "daily"]:
-        download_url = apk_server_nightly + apk_name
-    else:
-        download_url = apk_server_release + apk_name
-
-    if testing:
-        build_date = int(os.stat(apk_file).st_mtime)
-        if build_date:
-            build_date = datetime.fromtimestamp(build_date).strftime("%Y-%m-%d %H:%M")
-
-        # untagged release, get commit log
-        if build_type in ["nightly", "daily"]:
-            changelog = get_commit_log(project_dir, format="markdown", max_lines=5)
-        else:
-            changelog = get_changelog(project_dir, format="markdown")
-
-        webhook = get_webhook_testing(
-            version_name, build_type, changelog, download_url, build_date
-        )
-        requests.post(url=webhook_testing, json=webhook)
-    else:
-        changelog = get_changelog(project_dir, format="markdown")
-        webhook = get_webhook_release(changelog, download_url)
-        requests.post(url=webhook_release, json=webhook)
-
-
-def get_webhook_release(changelog: str, download_url: str):
-    (title, content) = changelog
-    return {"content": f"__**{title}**__\n{content}\n{download_url}"}
-
-
-def get_webhook_testing(
-    version_name: str,
-    build_type: str,
-    changelog: str,
-    download_url: str,
-    build_date: str,
-):
-    return {
-        "embeds": [
-            {
-                "title": f"Nowa wersja {build_type} aplikacji Szkolny.eu",
-                "description": f"Dostępna jest nowa wersja testowa **{build_type}**.",
-                "color": 2201331,
-                "fields": [
-                    {
-                        "name": f"Wersja `{version_name}`",
-                        "value": f"[Pobierz .APK]({download_url})"
-                        if download_url
-                        else "*Pobieranie niedostępne*",
-                        "inline": False,
-                    },
-                    {
-                        "name": "Data kompilacji",
-                        "value": build_date or "-",
-                        "inline": False,
-                    },
-                    {
-                        "name": "Ostatnie zmiany",
-                        "value": changelog or "-",
-                        "inline": False,
-                    },
-                ],
-            }
-        ]
-    }
-
-
-if __name__ == "__main__":
-    if len(sys.argv) < 2:
-        print("usage: webhook_discord.py <project dir>")
-        exit(-1)
-
-    project_dir = get_project_dir()
-
-    load_dotenv()
-    APK_FILE = os.getenv("APK_FILE")
-    APK_SERVER_RELEASE = os.getenv("APK_SERVER_RELEASE")
-    APK_SERVER_NIGHTLY = os.getenv("APK_SERVER_NIGHTLY")
-    WEBHOOK_RELEASE = os.getenv("WEBHOOK_RELEASE")
-    WEBHOOK_TESTING = os.getenv("WEBHOOK_TESTING")
-
-    post_webhook(
-        project_dir,
-        APK_FILE,
-        APK_SERVER_RELEASE,
-        APK_SERVER_NIGHTLY,
-        WEBHOOK_RELEASE,
-        WEBHOOK_TESTING,
-    )

.github/workflows/build-nightly-apk.yml

@@ -1,154 +0,0 @@
-name: Nightly build
-
-on:
-  schedule:
-    # 23:30 UTC, 0:30 or 1:30 CET/CEST
-    - cron: "30 23 * * *"
-  workflow_dispatch:
-
-jobs:
-  prepare:
-    name: Prepare build environment
-    runs-on: self-hosted
-    outputs:
-      hasNewChanges: ${{ steps.nightly.outputs.hasNewChanges }}
-    steps:
-      - name: Checkout repository
-        uses: actions/checkout@v2
-        with:
-          fetch-depth: 0
-          clean: false
-      - name: Set executable permissions to gradlew
-        run: chmod +x ./gradlew
-      - name: Setup Python
-        uses: actions/setup-python@v2
-      - name: Install packages
-        uses: BSFishy/pip-action@v1
-        with:
-          packages: |
-            python-dotenv
-            pycryptodome
-            mysql-connector-python
-            requests
-      - name: Bump nightly version
-        id: nightly
-        run: python $GITHUB_WORKSPACE/.github/utils/bump_nightly.py $GITHUB_WORKSPACE
-      - name: Write signing passwords
-        if: steps.nightly.outputs.hasNewChanges
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-        run: python $GITHUB_WORKSPACE/.github/utils/sign.py $GITHUB_WORKSPACE commit
-  build:
-    name: Build APK
-    runs-on: self-hosted
-    needs:
-      - prepare
-    if: ${{ needs.prepare.outputs.hasNewChanges == 'true' }}
-    outputs:
-      androidHome: ${{ env.ANDROID_HOME }}
-      androidSdkRoot: ${{ env.ANDROID_SDK_ROOT }}
-    steps:
-      - name: Setup JDK 11
-        uses: actions/setup-java@v2
-        with:
-          distribution: 'temurin'
-          java-version: '11'
-      - name: Setup Android SDK
-        uses: android-actions/setup-android@v2
-      - name: Clean build artifacts
-        run: |
-          rm -rf app/release/*
-          rm -rf app/build/outputs/apk/*
-          rm -rf app/build/outputs/bundle/*
-      - name: Assemble official release with Gradle
-        uses: gradle/gradle-build-action@v2
-        with:
-          arguments: assembleOfficialRelease
-  sign:
-    name: Sign APK
-    runs-on: self-hosted
-    needs:
-      - build
-    outputs:
-      signedReleaseFile: ${{ steps.artifacts.outputs.signedReleaseFile }}
-      signedReleaseFileRelative: ${{ steps.artifacts.outputs.signedReleaseFileRelative }}
-    steps:
-      - name: Sign build artifacts
-        id: sign_app
-        uses: r0adkll/sign-android-release@v1
-        with:
-          releaseDirectory: app/release
-          signingKeyBase64: ${{ secrets.KEY_STORE }}
-          alias: ${{ secrets.KEY_ALIAS }}
-          keyStorePassword: ${{ secrets.KEY_STORE_PASSWORD }}
-          keyPassword: ${{ secrets.KEY_ALIAS_PASSWORD }}
-        env:
-          ANDROID_HOME: ${{ needs.build.outputs.androidHome }}
-          ANDROID_SDK_ROOT: ${{ needs.build.outputs.androidSdkRoot }}
-          BUILD_TOOLS_VERSION: "30.0.2"
-      - name: Rename signed artifacts
-        id: artifacts
-        run: python $GITHUB_WORKSPACE/.github/utils/rename_artifacts.py $GITHUB_WORKSPACE
-  publish:
-    name: Publish APK
-    runs-on: self-hosted
-    needs:
-      - sign
-    steps:
-      - name: Setup Python
-        uses: actions/setup-python@v2
-
-      - name: Extract changelogs
-        id: changelog
-        run: python $GITHUB_WORKSPACE/.github/utils/extract_changelogs.py $GITHUB_WORKSPACE
-
-      - name: Upload APK to SFTP
-        uses: easingthemes/ssh-deploy@v2.1.6
-        env:
-          REMOTE_HOST: ${{ secrets.SSH_IP }}
-          REMOTE_USER: ${{ secrets.SSH_USERNAME }}
-          SSH_PRIVATE_KEY: ${{ secrets.SSH_KEY }}
-          SOURCE: ${{ needs.sign.outputs.signedReleaseFileRelative }}
-          TARGET: ${{ secrets.SSH_PATH_NIGHTLY }}
-      - name: Save version metadata
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
-          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
-        run: python $GITHUB_WORKSPACE/.github/utils/save_version.py $GITHUB_WORKSPACE
-
-      - name: Distribute to App Distribution
-        uses: wzieba/Firebase-Distribution-Github-Action@v1
-        with:
-          appId: ${{ secrets.FIREBASE_APP_ID }}
-          token: ${{ secrets.FIREBASE_TOKEN }}
-          groups: ${{ secrets.FIREBASE_GROUPS_NIGHTLY }}
-          file: ${{ needs.sign.outputs.signedReleaseFile }}
-          releaseNotesFile: ${{ steps.changelog.outputs.commitLogPlainFile }}
-
-      - name: Post Discord webhook
-        env:
-          APK_FILE: ${{ needs.sign.outputs.signedReleaseFile }}
-          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
-          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
-          WEBHOOK_RELEASE: ${{ secrets.WEBHOOK_RELEASE }}
-          WEBHOOK_TESTING: ${{ secrets.WEBHOOK_TESTING }}
-        run: python $GITHUB_WORKSPACE/.github/utils/webhook_discord.py $GITHUB_WORKSPACE
-
-      - name: Upload workflow artifact
-        uses: actions/upload-artifact@v2
-        if: true
-        with:
-          name: ${{ steps.changelog.outputs.appVersionName }}
-          path: |
-            app/release/whatsnew*/
-            app/release/*.apk
-            app/release/*.aab
-            app/release/*.json
-            app/release/*.txt

.github/workflows/build-release-aab-play.yml

@@ -1,132 +0,0 @@
-name: Release build - Google Play [AAB]
-
-on:
-  push:
-    branches:
-      - "master"
-
-jobs:
-  prepare:
-    name: Prepare build environment
-    runs-on: self-hosted
-    steps:
-      - name: Checkout repository
-        uses: actions/checkout@v2
-        with:
-          fetch-depth: 0
-          clean: false
-      - name: Set executable permissions to gradlew
-        run: chmod +x ./gradlew
-      - name: Setup Python
-        uses: actions/setup-python@v2
-      - name: Install packages
-        uses: BSFishy/pip-action@v1
-        with:
-          packages: |
-            python-dotenv
-            pycryptodome
-            mysql-connector-python
-            requests
-      - name: Write signing passwords
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-        run: python $GITHUB_WORKSPACE/.github/utils/sign.py $GITHUB_WORKSPACE commit
-  build:
-    name: Build App Bundle
-    runs-on: self-hosted
-    needs:
-      - prepare
-    outputs:
-      androidHome: ${{ env.ANDROID_HOME }}
-      androidSdkRoot: ${{ env.ANDROID_SDK_ROOT }}
-    steps:
-      - name: Setup JDK 11
-        uses: actions/setup-java@v2
-        with:
-          distribution: 'temurin'
-          java-version: '11'
-      - name: Setup Android SDK
-        uses: android-actions/setup-android@v2
-      - name: Clean build artifacts
-        run: |
-          rm -rf app/release/*
-          rm -rf app/build/outputs/apk/*
-          rm -rf app/build/outputs/bundle/*
-      - name: Bundle play release with Gradle
-        uses: gradle/gradle-build-action@v2
-        with:
-          arguments: bundlePlayRelease
-  sign:
-    name: Sign App Bundle
-    runs-on: self-hosted
-    needs:
-      - build
-    outputs:
-      signedReleaseFile: ${{ steps.artifacts.outputs.signedReleaseFile }}
-      signedReleaseFileRelative: ${{ steps.artifacts.outputs.signedReleaseFileRelative }}
-    steps:
-      - name: Sign build artifacts
-        id: sign_app
-        uses: r0adkll/sign-android-release@v1
-        with:
-          releaseDirectory: app/release
-          signingKeyBase64: ${{ secrets.KEY_STORE }}
-          alias: ${{ secrets.KEY_ALIAS }}
-          keyStorePassword: ${{ secrets.KEY_STORE_PASSWORD }}
-          keyPassword: ${{ secrets.KEY_ALIAS_PASSWORD }}
-        env:
-          ANDROID_HOME: ${{ needs.build.outputs.androidHome }}
-          ANDROID_SDK_ROOT: ${{ needs.build.outputs.androidSdkRoot }}
-          BUILD_TOOLS_VERSION: "30.0.2"
-      - name: Rename signed artifacts
-        id: artifacts
-        run: python $GITHUB_WORKSPACE/.github/utils/rename_artifacts.py $GITHUB_WORKSPACE
-  publish:
-    name: Publish App Bundle
-    runs-on: self-hosted
-    needs:
-      - sign
-    steps:
-      - name: Setup Python
-        uses: actions/setup-python@v2
-
-      - name: Extract changelogs
-        id: changelog
-        run: python $GITHUB_WORKSPACE/.github/utils/extract_changelogs.py $GITHUB_WORKSPACE
-
-      - name: Save version metadata
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
-          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
-        run: python $GITHUB_WORKSPACE/.github/utils/save_version.py $GITHUB_WORKSPACE
-
-      - name: Publish AAB to Google Play
-        uses: r0adkll/upload-google-play@v1
-        if: ${{ endsWith(needs.sign.outputs.signedReleaseFile, '.aab') }}
-        with:
-          serviceAccountJsonPlainText: ${{ secrets.PLAY_SERVICE_ACCOUNT_JSON }}
-          packageName: pl.szczodrzynski.edziennik
-          releaseFiles: ${{ needs.sign.outputs.signedReleaseFile }}
-          releaseName: ${{ steps.changelog.outputs.appVersionName }}
-          track: ${{ secrets.PLAY_RELEASE_TRACK }}
-          whatsNewDirectory: ${{ steps.changelog.outputs.changelogDir }}
-          status: completed
-
-      - name: Upload workflow artifact
-        uses: actions/upload-artifact@v2
-        if: always()
-        with:
-          name: ${{ steps.changelog.outputs.appVersionName }}
-          path: |
-            app/release/whatsnew*/
-            app/release/*.apk
-            app/release/*.aab
-            app/release/*.json
-            app/release/*.txt

.github/workflows/build-release-apk.yml

@@ -1,154 +0,0 @@
-name: Release build - official
-
-on:
-  push:
-    tags:
-      - "*"
-
-jobs:
-  prepare:
-    name: Prepare build environment
-    runs-on: self-hosted
-    steps:
-      - name: Checkout repository
-        uses: actions/checkout@v2
-        with:
-          fetch-depth: 0
-          clean: false
-      - name: Set executable permissions to gradlew
-        run: chmod +x ./gradlew
-      - name: Setup Python
-        uses: actions/setup-python@v2
-      - name: Install packages
-        uses: BSFishy/pip-action@v1
-        with:
-          packages: |
-            python-dotenv
-            pycryptodome
-            mysql-connector-python
-            requests
-      - name: Write signing passwords
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-        run: python $GITHUB_WORKSPACE/.github/utils/sign.py $GITHUB_WORKSPACE commit
-  build:
-    name: Build APK
-    runs-on: self-hosted
-    needs:
-      - prepare
-    outputs:
-      androidHome: ${{ env.ANDROID_HOME }}
-      androidSdkRoot: ${{ env.ANDROID_SDK_ROOT }}
-    steps:
-      - name: Setup JDK 11
-        uses: actions/setup-java@v2
-        with:
-          distribution: 'temurin'
-          java-version: '11'
-      - name: Setup Android SDK
-        uses: android-actions/setup-android@v2
-      - name: Clean build artifacts
-        run: |
-          rm -rf app/release/*
-          rm -rf app/build/outputs/apk/*
-          rm -rf app/build/outputs/bundle/*
-      - name: Assemble official release with Gradle
-        uses: gradle/gradle-build-action@v2
-        with:
-          arguments: assembleOfficialRelease
-  sign:
-    name: Sign APK
-    runs-on: self-hosted
-    needs:
-      - build
-    outputs:
-      signedReleaseFile: ${{ steps.artifacts.outputs.signedReleaseFile }}
-      signedReleaseFileRelative: ${{ steps.artifacts.outputs.signedReleaseFileRelative }}
-    steps:
-      - name: Sign build artifacts
-        id: sign_app
-        uses: r0adkll/sign-android-release@v1
-        with:
-          releaseDirectory: app/release
-          signingKeyBase64: ${{ secrets.KEY_STORE }}
-          alias: ${{ secrets.KEY_ALIAS }}
-          keyStorePassword: ${{ secrets.KEY_STORE_PASSWORD }}
-          keyPassword: ${{ secrets.KEY_ALIAS_PASSWORD }}
-        env:
-          ANDROID_HOME: ${{ needs.build.outputs.androidHome }}
-          ANDROID_SDK_ROOT: ${{ needs.build.outputs.androidSdkRoot }}
-          BUILD_TOOLS_VERSION: "30.0.2"
-      - name: Rename signed artifacts
-        id: artifacts
-        run: python $GITHUB_WORKSPACE/.github/utils/rename_artifacts.py $GITHUB_WORKSPACE
-  publish:
-    name: Publish APK
-    runs-on: self-hosted
-    needs:
-      - sign
-    steps:
-      - name: Setup Python
-        uses: actions/setup-python@v2
-
-      - name: Extract changelogs
-        id: changelog
-        run: python $GITHUB_WORKSPACE/.github/utils/extract_changelogs.py $GITHUB_WORKSPACE
-
-      - name: Upload APK to SFTP
-        uses: easingthemes/ssh-deploy@v2.1.6
-        env:
-          REMOTE_HOST: ${{ secrets.SSH_IP }}
-          REMOTE_USER: ${{ secrets.SSH_USERNAME }}
-          SSH_PRIVATE_KEY: ${{ secrets.SSH_KEY }}
-          SOURCE: ${{ needs.sign.outputs.signedReleaseFileRelative }}
-          TARGET: ${{ secrets.SSH_PATH_RELEASE }}
-      - name: Save version metadata
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
-          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
-        run: python $GITHUB_WORKSPACE/.github/utils/save_version.py $GITHUB_WORKSPACE
-
-      - name: Distribute to App Distribution
-        uses: wzieba/Firebase-Distribution-Github-Action@v1
-        with:
-          appId: ${{ secrets.FIREBASE_APP_ID }}
-          token: ${{ secrets.FIREBASE_TOKEN }}
-          groups: ${{ secrets.FIREBASE_GROUPS_RELEASE }}
-          file: ${{ needs.sign.outputs.signedReleaseFile }}
-          releaseNotesFile: ${{ steps.changelog.outputs.changelogPlainTitledFile }}
-      - name: Release on GitHub
-        uses: softprops/action-gh-release@v1
-        with:
-          name: ${{ steps.changelog.outputs.changelogTitle }}
-          body_path: ${{ steps.changelog.outputs.changelogMarkdownFile }}
-          files: ${{ needs.sign.outputs.signedReleaseFile }}
-        env:
-          GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
-
-      - name: Post Discord webhook
-        env:
-          APK_FILE: ${{ needs.sign.outputs.signedReleaseFile }}
-          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
-          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
-          WEBHOOK_RELEASE: ${{ secrets.WEBHOOK_RELEASE }}
-          WEBHOOK_TESTING: ${{ secrets.WEBHOOK_TESTING }}
-        run: python $GITHUB_WORKSPACE/.github/utils/webhook_discord.py $GITHUB_WORKSPACE
-
-      - name: Upload workflow artifact
-        uses: actions/upload-artifact@v2
-        if: true
-        with:
-          name: ${{ steps.changelog.outputs.appVersionName }}
-          path: |
-            app/release/whatsnew*/
-            app/release/*.apk
-            app/release/*.aab
-            app/release/*.json
-            app/release/*.txt

.gitignore

@@ -1,11 +1,5 @@
-
-# Created by https://www.toptal.com/developers/gitignore/api/android,androidstudio,gradle,java,kotlin
-# Edit at https://www.toptal.com/developers/gitignore?templates=android,androidstudio,gradle,java,kotlin
-
-### Android ###
 # Built application files
 *.apk
-*.aar
 *.ap_
 *.aab
 
@@ -29,7 +23,7 @@ build/
 local.properties
 
 # Proguard folder generated by Eclipse
-# proguard/
+proguard/
 
 # Log Files
 *.log
@@ -46,7 +40,7 @@ captures/
 .idea/tasks.xml
 .idea/gradle.xml
 .idea/assetWizardSettings.xml
-#.idea/dictionaries
+.idea/dictionaries
 .idea/libraries
 # Android Studio 3 in .gitignore file.
 .idea/caches
@@ -56,12 +50,11 @@ captures/
 
 # Keystore files
 # Uncomment the following lines if you do not want to check your keystore files in.
-#*.jks
-#*.keystore
+*.jks
+*.keystore
 
 # External native build folder generated in Android Studio 2.2 and later
 .externalNativeBuild
-.cxx/
 
 # Google Services (e.g. APIs or Firebase)
 # google-services.json
@@ -87,182 +80,3 @@ lint/generated/
 lint/outputs/
 lint/tmp/
 # lint/reports/
-
-### Android Patch ###
-gen-external-apklibs
-output-metadata.json
-
-# Replacement of .externalNativeBuild directories introduced
-# with Android Studio 3.5.
-
-### Java ###
-# Compiled class file
-
-# Log file
-
-# BlueJ files
-*.ctxt
-
-# Mobile Tools for Java (J2ME)
-.mtj.tmp/
-
-# Package Files #
-*.jar
-*.war
-*.nar
-*.ear
-*.zip
-*.tar.gz
-*.rar
-
-# virtual machine crash logs, see http://www.java.com/en/download/help/error_hotspot.xml
-hs_err_pid*
-
-!/*/libs/*.jar
-
-### Kotlin ###
-# Compiled class file
-
-# Log file
-
-# BlueJ files
-
-# Mobile Tools for Java (J2ME)
-
-# Package Files #
-
-# virtual machine crash logs, see http://www.java.com/en/download/help/error_hotspot.xml
-
-### Gradle ###
-.gradle
-
-# Ignore Gradle GUI config
-gradle-app.setting
-
-# Avoid ignoring Gradle wrapper jar file (.jar files are usually ignored)
-!gradle-wrapper.jar
-
-# Cache of project
-.gradletasknamecache
-
-# # Work around https://youtrack.jetbrains.com/issue/IDEA-116898
-# gradle/wrapper/gradle-wrapper.properties
-
-### Gradle Patch ###
-**/build/
-
-### AndroidStudio ###
-# Covers files to be ignored for android development using Android Studio.
-
-# Built application files
-
-# Files for the ART/Dalvik VM
-
-# Java class files
-
-# Generated files
-
-# Gradle files
-
-# Signing files
-.signing/
-
-# Local configuration file (sdk path, etc)
-
-# Proguard folder generated by Eclipse
-
-# Log Files
-
-# Android Studio
-/*/build/
-/*/local.properties
-/*/out
-/*/*/build
-/*/*/production
-*.ipr
-*~
-*.swp
-
-# Keystore files
-*.jks
-*.keystore
-
-# Google Services (e.g. APIs or Firebase)
-# google-services.json
-
-# Android Patch
-
-# External native build folder generated in Android Studio 2.2 and later
-
-# NDK
-obj/
-
-# IntelliJ IDEA
-*.iws
-/out/
-
-# User-specific configurations
-.idea/caches/
-.idea/libraries/
-.idea/shelf/
-.idea/.name
-.idea/compiler.xml
-.idea/copyright/profiles_settings.xml
-.idea/encodings.xml
-.idea/misc.xml
-.idea/scopes/scope_settings.xml
-.idea/vcs.xml
-.idea/jsLibraryMappings.xml
-.idea/datasources.xml
-.idea/dataSources.ids
-.idea/sqlDataSources.xml
-.idea/dynamic.xml
-.idea/uiDesigner.xml
-.idea/jarRepositories.xml
-
-# OS-specific files
-.DS_Store
-.DS_Store?
-._*
-.Spotlight-V100
-.Trashes
-ehthumbs.db
-Thumbs.db
-
-# Legacy Eclipse project files
-.classpath
-.project
-.cproject
-.settings/
-
-# Mobile Tools for Java (J2ME)
-
-# Package Files #
-
-# virtual machine crash logs (Reference: http://www.java.com/en/download/help/error_hotspot.xml)
-
-## Plugin-specific files:
-
-# mpeltonen/sbt-idea plugin
-.idea_modules/
-
-# JIRA plugin
-atlassian-ide-plugin.xml
-
-# Mongo Explorer plugin
-.idea/mongoSettings.xml
-
-# Crashlytics plugin (for Android Studio and IntelliJ)
-com_crashlytics_export_strings.xml
-crashlytics.properties
-crashlytics-build.properties
-fabric.properties
-
-### AndroidStudio Patch ###
-
-!/gradle/wrapper/gradle-wrapper.jar
-
-# End of https://www.toptal.com/developers/gitignore/api/android,androidstudio,gradle,java,kotlin
-
-signatures/
-.idea/*.xml

.idea/codeStyles/Project.xml

@@ -1,19 +1,6 @@
 <component name="ProjectCodeStyleConfiguration">
   <code_scheme name="Project" version="173">
-    <JetCodeStyleSettings>
-      <option name="NAME_COUNT_TO_USE_STAR_IMPORT" value="2147483647" />
-      <option name="ALLOW_TRAILING_COMMA" value="true" />
-      <option name="CODE_STYLE_DEFAULTS" value="KOTLIN_OFFICIAL" />
-    </JetCodeStyleSettings>
-    <codeStyleSettings language="JSON">
-      <indentOptions>
-        <option name="INDENT_SIZE" value="4" />
-        <option name="USE_TAB_CHARACTER" value="true" />
-        <option name="SMART_TABS" value="true" />
-      </indentOptions>
-    </codeStyleSettings>
     <codeStyleSettings language="XML">
-      <option name="FORCE_REARRANGE_MODE" value="1" />
       <indentOptions>
         <option name="CONTINUATION_INDENT_SIZE" value="4" />
       </indentOptions>
@@ -125,8 +112,5 @@
         </rules>
       </arrangement>
     </codeStyleSettings>
-    <codeStyleSettings language="kotlin">
-      <option name="CODE_STYLE_DEFAULTS" value="KOTLIN_OFFICIAL" />
-    </codeStyleSettings>
   </code_scheme>
 </component>

.idea/codeStyles/codeStyleConfig.xml

@@ -1,5 +0,0 @@
-<component name="ProjectCodeStyleConfiguration">
-  <state>
-    <option name="USE_PER_PROJECT_SETTINGS" value="true" />
-  </state>
-</component>

.idea/copyright/Antoni.xml

@@ -1,6 +0,0 @@
-<component name="CopyrightManager">
-  <copyright>
-    <option name="notice" value="Copyright (c) Antoni Czaplicki &amp;#36;{today.year}-&amp;#36;{today.month}-&amp;#36;{today.day}. " />
-    <option name="myName" value="Antoni" />
-  </copyright>
-</component>

.idea/copyright/Kacper.xml

@@ -1,6 +0,0 @@
-<component name="CopyrightManager">
-  <copyright>
-    <option name="notice" value="Copyright (c) Kacper Ziubryniewicz &amp;#36;{today.year}-&amp;#36;{today.month}-&amp;#36;{today.day}" />
-    <option name="myName" value="Kacper" />
-  </copyright>
-</component>

.idea/copyright/kubasz.xml

@@ -1,6 +0,0 @@
-<component name="CopyrightManager">
-  <copyright>
-    <option name="notice" value="Copyright (c) Kuba Szczodrzyński &amp;#36;{today.year}-&amp;#36;{today.month}-&amp;#36;{today.day}. " />
-    <option name="myName" value="kubasz" />
-  </copyright>
-</component>

.idea/dictionaries/Kuba.xml

@@ -1,20 +0,0 @@
-<component name="ProjectDictionaryState">
-  <dictionary name="Kuba">
-    <words>
-      <w>autoryzacji</w>
-      <w>ciasteczko</w>
-      <w>csrf</w>
-      <w>edziennik</w>
-      <w>eggfall</w>
-      <w>elearning</w>
-      <w>gson</w>
-      <w>hebe</w>
-      <w>idziennik</w>
-      <w>kuba</w>
-      <w>synergia</w>
-      <w>szczodrzyński</w>
-      <w>szkolny</w>
-      <w>usos</w>
-    </words>
-  </dictionary>
-</component>

.idea/discord.xml

@@ -0,0 +1,9 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="DiscordProjectSettings">
+    <option name="show" value="true" />
+  </component>
+  <component name="ProjectNotificationSettings">
+    <option name="askShowProject" value="false" />
+  </component>
+</project>

.idea/encodings.xml

@@ -0,0 +1,4 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="Encoding" addBOMForNewFiles="with NO BOM" />
+</project>

.idea/kotlinc.xml

@@ -0,0 +1,6 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="Kotlin2JvmCompilerArguments">
+    <option name="jvmTarget" value="1.8" />
+  </component>
+</project>

.idea/misc.xml

@@ -0,0 +1,49 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="CMakeSettings">
+    <configurations>
+      <configuration PROFILE_NAME="Debug" CONFIG_NAME="Debug" />
+    </configurations>
+  </component>
+  <component name="NullableNotNullManager">
+    <option name="myDefaultNullable" value="org.jetbrains.annotations.Nullable" />
+    <option name="myDefaultNotNull" value="androidx.annotation.RecentlyNonNull" />
+    <option name="myNullables">
+      <value>
+        <list size="10">
+          <item index="0" class="java.lang.String" itemvalue="org.jetbrains.annotations.Nullable" />
+          <item index="1" class="java.lang.String" itemvalue="javax.annotation.Nullable" />
+          <item index="2" class="java.lang.String" itemvalue="javax.annotation.CheckForNull" />
+          <item index="3" class="java.lang.String" itemvalue="edu.umd.cs.findbugs.annotations.Nullable" />
+          <item index="4" class="java.lang.String" itemvalue="android.support.annotation.Nullable" />
+          <item index="5" class="java.lang.String" itemvalue="androidx.annotation.Nullable" />
+          <item index="6" class="java.lang.String" itemvalue="androidx.annotation.RecentlyNullable" />
+          <item index="7" class="java.lang.String" itemvalue="org.checkerframework.checker.nullness.qual.Nullable" />
+          <item index="8" class="java.lang.String" itemvalue="org.checkerframework.checker.nullness.compatqual.NullableDecl" />
+          <item index="9" class="java.lang.String" itemvalue="org.checkerframework.checker.nullness.compatqual.NullableType" />
+        </list>
+      </value>
+    </option>
+    <option name="myNotNulls">
+      <value>
+        <list size="9">
+          <item index="0" class="java.lang.String" itemvalue="org.jetbrains.annotations.NotNull" />
+          <item index="1" class="java.lang.String" itemvalue="javax.annotation.Nonnull" />
+          <item index="2" class="java.lang.String" itemvalue="edu.umd.cs.findbugs.annotations.NonNull" />
+          <item index="3" class="java.lang.String" itemvalue="android.support.annotation.NonNull" />
+          <item index="4" class="java.lang.String" itemvalue="androidx.annotation.NonNull" />
+          <item index="5" class="java.lang.String" itemvalue="androidx.annotation.RecentlyNonNull" />
+          <item index="6" class="java.lang.String" itemvalue="org.checkerframework.checker.nullness.qual.NonNull" />
+          <item index="7" class="java.lang.String" itemvalue="org.checkerframework.checker.nullness.compatqual.NonNullDecl" />
+          <item index="8" class="java.lang.String" itemvalue="org.checkerframework.checker.nullness.compatqual.NonNullType" />
+        </list>
+      </value>
+    </option>
+  </component>
+  <component name="ProjectRootManager" version="2" languageLevel="JDK_1_8" project-jdk-name="JDK" project-jdk-type="JavaSDK">
+    <output url="file://$PROJECT_DIR$/build/classes" />
+  </component>
+  <component name="ProjectType">
+    <option name="id" value="Android" />
+  </component>
+</project>

.idea/runConfigurations.xml

@@ -0,0 +1,12 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="RunConfigurationProducerService">
+    <option name="ignoredProducers">
+      <set>
+        <option value="org.jetbrains.plugins.gradle.execution.test.runner.AllInPackageGradleConfigurationProducer" />
+        <option value="org.jetbrains.plugins.gradle.execution.test.runner.TestClassGradleConfigurationProducer" />
+        <option value="org.jetbrains.plugins.gradle.execution.test.runner.TestMethodGradleConfigurationProducer" />
+      </set>
+    </option>
+  </component>
+</project>

LICENSE

@@ -1,621 +0,0 @@
-                    GNU GENERAL PUBLIC LICENSE
-                       Version 3, 29 June 2007
-
- Copyright (C) 2007 Free Software Foundation, Inc. <https://fsf.org/>
- Everyone is permitted to copy and distribute verbatim copies
- of this license document, but changing it is not allowed.
-
-                            Preamble
-
-  The GNU General Public License is a free, copyleft license for
-software and other kinds of works.
-
-  The licenses for most software and other practical works are designed
-to take away your freedom to share and change the works.  By contrast,
-the GNU General Public License is intended to guarantee your freedom to
-share and change all versions of a program--to make sure it remains free
-software for all its users.  We, the Free Software Foundation, use the
-GNU General Public License for most of our software; it applies also to
-any other work released this way by its authors.  You can apply it to
-your programs, too.
-
-  When we speak of free software, we are referring to freedom, not
-price.  Our General Public Licenses are designed to make sure that you
-have the freedom to distribute copies of free software (and charge for
-them if you wish), that you receive source code or can get it if you
-want it, that you can change the software or use pieces of it in new
-free programs, and that you know you can do these things.
-
-  To protect your rights, we need to prevent others from denying you
-these rights or asking you to surrender the rights.  Therefore, you have
-certain responsibilities if you distribute copies of the software, or if
-you modify it: responsibilities to respect the freedom of others.
-
-  For example, if you distribute copies of such a program, whether
-gratis or for a fee, you must pass on to the recipients the same
-freedoms that you received.  You must make sure that they, too, receive
-or can get the source code.  And you must show them these terms so they
-know their rights.
-
-  Developers that use the GNU GPL protect your rights with two steps:
-(1) assert copyright on the software, and (2) offer you this License
-giving you legal permission to copy, distribute and/or modify it.
-
-  For the developers' and authors' protection, the GPL clearly explains
-that there is no warranty for this free software.  For both users' and
-authors' sake, the GPL requires that modified versions be marked as
-changed, so that their problems will not be attributed erroneously to
-authors of previous versions.
-
-  Some devices are designed to deny users access to install or run
-modified versions of the software inside them, although the manufacturer
-can do so.  This is fundamentally incompatible with the aim of
-protecting users' freedom to change the software.  The systematic
-pattern of such abuse occurs in the area of products for individuals to
-use, which is precisely where it is most unacceptable.  Therefore, we
-have designed this version of the GPL to prohibit the practice for those
-products.  If such problems arise substantially in other domains, we
-stand ready to extend this provision to those domains in future versions
-of the GPL, as needed to protect the freedom of users.
-
-  Finally, every program is threatened constantly by software patents.
-States should not allow patents to restrict development and use of
-software on general-purpose computers, but in those that do, we wish to
-avoid the special danger that patents applied to a free program could
-make it effectively proprietary.  To prevent this, the GPL assures that
-patents cannot be used to render the program non-free.
-
-  The precise terms and conditions for copying, distribution and
-modification follow.
-
-                       TERMS AND CONDITIONS
-
-  0. Definitions.
-
-  "This License" refers to version 3 of the GNU General Public License.
-
-  "Copyright" also means copyright-like laws that apply to other kinds of
-works, such as semiconductor masks.
-
-  "The Program" refers to any copyrightable work licensed under this
-License.  Each licensee is addressed as "you".  "Licensees" and
-"recipients" may be individuals or organizations.
-
-  To "modify" a work means to copy from or adapt all or part of the work
-in a fashion requiring copyright permission, other than the making of an
-exact copy.  The resulting work is called a "modified version" of the
-earlier work or a work "based on" the earlier work.
-
-  A "covered work" means either the unmodified Program or a work based
-on the Program.
-
-  To "propagate" a work means to do anything with it that, without
-permission, would make you directly or secondarily liable for
-infringement under applicable copyright law, except executing it on a
-computer or modifying a private copy.  Propagation includes copying,
-distribution (with or without modification), making available to the
-public, and in some countries other activities as well.
-
-  To "convey" a work means any kind of propagation that enables other
-parties to make or receive copies.  Mere interaction with a user through
-a computer network, with no transfer of a copy, is not conveying.
-
-  An interactive user interface displays "Appropriate Legal Notices"
-to the extent that it includes a convenient and prominently visible
-feature that (1) displays an appropriate copyright notice, and (2)
-tells the user that there is no warranty for the work (except to the
-extent that warranties are provided), that licensees may convey the
-work under this License, and how to view a copy of this License.  If
-the interface presents a list of user commands or options, such as a
-menu, a prominent item in the list meets this criterion.
-
-  1. Source Code.
-
-  The "source code" for a work means the preferred form of the work
-for making modifications to it.  "Object code" means any non-source
-form of a work.
-
-  A "Standard Interface" means an interface that either is an official
-standard defined by a recognized standards body, or, in the case of
-interfaces specified for a particular programming language, one that
-is widely used among developers working in that language.
-
-  The "System Libraries" of an executable work include anything, other
-than the work as a whole, that (a) is included in the normal form of
-packaging a Major Component, but which is not part of that Major
-Component, and (b) serves only to enable use of the work with that
-Major Component, or to implement a Standard Interface for which an
-implementation is available to the public in source code form.  A
-"Major Component", in this context, means a major essential component
-(kernel, window system, and so on) of the specific operating system
-(if any) on which the executable work runs, or a compiler used to
-produce the work, or an object code interpreter used to run it.
-
-  The "Corresponding Source" for a work in object code form means all
-the source code needed to generate, install, and (for an executable
-work) run the object code and to modify the work, including scripts to
-control those activities.  However, it does not include the work's
-System Libraries, or general-purpose tools or generally available free
-programs which are used unmodified in performing those activities but
-which are not part of the work.  For example, Corresponding Source
-includes interface definition files associated with source files for
-the work, and the source code for shared libraries and dynamically
-linked subprograms that the work is specifically designed to require,
-such as by intimate data communication or control flow between those
-subprograms and other parts of the work.
-
-  The Corresponding Source need not include anything that users
-can regenerate automatically from other parts of the Corresponding
-Source.
-
-  The Corresponding Source for a work in source code form is that
-same work.
-
-  2. Basic Permissions.
-
-  All rights granted under this License are granted for the term of
-copyright on the Program, and are irrevocable provided the stated
-conditions are met.  This License explicitly affirms your unlimited
-permission to run the unmodified Program.  The output from running a
-covered work is covered by this License only if the output, given its
-content, constitutes a covered work.  This License acknowledges your
-rights of fair use or other equivalent, as provided by copyright law.
-
-  You may make, run and propagate covered works that you do not
-convey, without conditions so long as your license otherwise remains
-in force.  You may convey covered works to others for the sole purpose
-of having them make modifications exclusively for you, or provide you
-with facilities for running those works, provided that you comply with
-the terms of this License in conveying all material for which you do
-not control copyright.  Those thus making or running the covered works
-for you must do so exclusively on your behalf, under your direction
-and control, on terms that prohibit them from making any copies of
-your copyrighted material outside their relationship with you.
-
-  Conveying under any other circumstances is permitted solely under
-the conditions stated below.  Sublicensing is not allowed; section 10
-makes it unnecessary.
-
-  3. Protecting Users' Legal Rights From Anti-Circumvention Law.
-
-  No covered work shall be deemed part of an effective technological
-measure under any applicable law fulfilling obligations under article
-11 of the WIPO copyright treaty adopted on 20 December 1996, or
-similar laws prohibiting or restricting circumvention of such
-measures.
-
-  When you convey a covered work, you waive any legal power to forbid
-circumvention of technological measures to the extent such circumvention
-is effected by exercising rights under this License with respect to
-the covered work, and you disclaim any intention to limit operation or
-modification of the work as a means of enforcing, against the work's
-users, your or third parties' legal rights to forbid circumvention of
-technological measures.
-
-  4. Conveying Verbatim Copies.
-
-  You may convey verbatim copies of the Program's source code as you
-receive it, in any medium, provided that you conspicuously and
-appropriately publish on each copy an appropriate copyright notice;
-keep intact all notices stating that this License and any
-non-permissive terms added in accord with section 7 apply to the code;
-keep intact all notices of the absence of any warranty; and give all
-recipients a copy of this License along with the Program.
-
-  You may charge any price or no price for each copy that you convey,
-and you may offer support or warranty protection for a fee.
-
-  5. Conveying Modified Source Versions.
-
-  You may convey a work based on the Program, or the modifications to
-produce it from the Program, in the form of source code under the
-terms of section 4, provided that you also meet all of these conditions:
-
-    a) The work must carry prominent notices stating that you modified
-    it, and giving a relevant date.
-
-    b) The work must carry prominent notices stating that it is
-    released under this License and any conditions added under section
-    7.  This requirement modifies the requirement in section 4 to
-    "keep intact all notices".
-
-    c) You must license the entire work, as a whole, under this
-    License to anyone who comes into possession of a copy.  This
-    License will therefore apply, along with any applicable section 7
-    additional terms, to the whole of the work, and all its parts,
-    regardless of how they are packaged.  This License gives no
-    permission to license the work in any other way, but it does not
-    invalidate such permission if you have separately received it.
-
-    d) If the work has interactive user interfaces, each must display
-    Appropriate Legal Notices; however, if the Program has interactive
-    interfaces that do not display Appropriate Legal Notices, your
-    work need not make them do so.
-
-  A compilation of a covered work with other separate and independent
-works, which are not by their nature extensions of the covered work,
-and which are not combined with it such as to form a larger program,
-in or on a volume of a storage or distribution medium, is called an
-"aggregate" if the compilation and its resulting copyright are not
-used to limit the access or legal rights of the compilation's users
-beyond what the individual works permit.  Inclusion of a covered work
-in an aggregate does not cause this License to apply to the other
-parts of the aggregate.
-
-  6. Conveying Non-Source Forms.
-
-  You may convey a covered work in object code form under the terms
-of sections 4 and 5, provided that you also convey the
-machine-readable Corresponding Source under the terms of this License,
-in one of these ways:
-
-    a) Convey the object code in, or embodied in, a physical product
-    (including a physical distribution medium), accompanied by the
-    Corresponding Source fixed on a durable physical medium
-    customarily used for software interchange.
-
-    b) Convey the object code in, or embodied in, a physical product
-    (including a physical distribution medium), accompanied by a
-    written offer, valid for at least three years and valid for as
-    long as you offer spare parts or customer support for that product
-    model, to give anyone who possesses the object code either (1) a
-    copy of the Corresponding Source for all the software in the
-    product that is covered by this License, on a durable physical
-    medium customarily used for software interchange, for a price no
-    more than your reasonable cost of physically performing this
-    conveying of source, or (2) access to copy the
-    Corresponding Source from a network server at no charge.
-
-    c) Convey individual copies of the object code with a copy of the
-    written offer to provide the Corresponding Source.  This
-    alternative is allowed only occasionally and noncommercially, and
-    only if you received the object code with such an offer, in accord
-    with subsection 6b.
-
-    d) Convey the object code by offering access from a designated
-    place (gratis or for a charge), and offer equivalent access to the
-    Corresponding Source in the same way through the same place at no
-    further charge.  You need not require recipients to copy the
-    Corresponding Source along with the object code.  If the place to
-    copy the object code is a network server, the Corresponding Source
-    may be on a different server (operated by you or a third party)
-    that supports equivalent copying facilities, provided you maintain
-    clear directions next to the object code saying where to find the
-    Corresponding Source.  Regardless of what server hosts the
-    Corresponding Source, you remain obligated to ensure that it is
-    available for as long as needed to satisfy these requirements.
-
-    e) Convey the object code using peer-to-peer transmission, provided
-    you inform other peers where the object code and Corresponding
-    Source of the work are being offered to the general public at no
-    charge under subsection 6d.
-
-  A separable portion of the object code, whose source code is excluded
-from the Corresponding Source as a System Library, need not be
-included in conveying the object code work.
-
-  A "User Product" is either (1) a "consumer product", which means any
-tangible personal property which is normally used for personal, family,
-or household purposes, or (2) anything designed or sold for incorporation
-into a dwelling.  In determining whether a product is a consumer product,
-doubtful cases shall be resolved in favor of coverage.  For a particular
-product received by a particular user, "normally used" refers to a
-typical or common use of that class of product, regardless of the status
-of the particular user or of the way in which the particular user
-actually uses, or expects or is expected to use, the product.  A product
-is a consumer product regardless of whether the product has substantial
-commercial, industrial or non-consumer uses, unless such uses represent
-the only significant mode of use of the product.
-
-  "Installation Information" for a User Product means any methods,
-procedures, authorization keys, or other information required to install
-and execute modified versions of a covered work in that User Product from
-a modified version of its Corresponding Source.  The information must
-suffice to ensure that the continued functioning of the modified object
-code is in no case prevented or interfered with solely because
-modification has been made.
-
-  If you convey an object code work under this section in, or with, or
-specifically for use in, a User Product, and the conveying occurs as
-part of a transaction in which the right of possession and use of the
-User Product is transferred to the recipient in perpetuity or for a
-fixed term (regardless of how the transaction is characterized), the
-Corresponding Source conveyed under this section must be accompanied
-by the Installation Information.  But this requirement does not apply
-if neither you nor any third party retains the ability to install
-modified object code on the User Product (for example, the work has
-been installed in ROM).
-
-  The requirement to provide Installation Information does not include a
-requirement to continue to provide support service, warranty, or updates
-for a work that has been modified or installed by the recipient, or for
-the User Product in which it has been modified or installed.  Access to a
-network may be denied when the modification itself materially and
-adversely affects the operation of the network or violates the rules and
-protocols for communication across the network.
-
-  Corresponding Source conveyed, and Installation Information provided,
-in accord with this section must be in a format that is publicly
-documented (and with an implementation available to the public in
-source code form), and must require no special password or key for
-unpacking, reading or copying.
-
-  7. Additional Terms.
-
-  "Additional permissions" are terms that supplement the terms of this
-License by making exceptions from one or more of its conditions.
-Additional permissions that are applicable to the entire Program shall
-be treated as though they were included in this License, to the extent
-that they are valid under applicable law.  If additional permissions
-apply only to part of the Program, that part may be used separately
-under those permissions, but the entire Program remains governed by
-this License without regard to the additional permissions.
-
-  When you convey a copy of a covered work, you may at your option
-remove any additional permissions from that copy, or from any part of
-it.  (Additional permissions may be written to require their own
-removal in certain cases when you modify the work.)  You may place
-additional permissions on material, added by you to a covered work,
-for which you have or can give appropriate copyright permission.
-
-  Notwithstanding any other provision of this License, for material you
-add to a covered work, you may (if authorized by the copyright holders of
-that material) supplement the terms of this License with terms:
-
-    a) Disclaiming warranty or limiting liability differently from the
-    terms of sections 15 and 16 of this License; or
-
-    b) Requiring preservation of specified reasonable legal notices or
-    author attributions in that material or in the Appropriate Legal
-    Notices displayed by works containing it; or
-
-    c) Prohibiting misrepresentation of the origin of that material, or
-    requiring that modified versions of such material be marked in
-    reasonable ways as different from the original version; or
-
-    d) Limiting the use for publicity purposes of names of licensors or
-    authors of the material; or
-
-    e) Declining to grant rights under trademark law for use of some
-    trade names, trademarks, or service marks; or
-
-    f) Requiring indemnification of licensors and authors of that
-    material by anyone who conveys the material (or modified versions of
-    it) with contractual assumptions of liability to the recipient, for
-    any liability that these contractual assumptions directly impose on
-    those licensors and authors.
-
-  All other non-permissive additional terms are considered "further
-restrictions" within the meaning of section 10.  If the Program as you
-received it, or any part of it, contains a notice stating that it is
-governed by this License along with a term that is a further
-restriction, you may remove that term.  If a license document contains
-a further restriction but permits relicensing or conveying under this
-License, you may add to a covered work material governed by the terms
-of that license document, provided that the further restriction does
-not survive such relicensing or conveying.
-
-  If you add terms to a covered work in accord with this section, you
-must place, in the relevant source files, a statement of the
-additional terms that apply to those files, or a notice indicating
-where to find the applicable terms.
-
-  Additional terms, permissive or non-permissive, may be stated in the
-form of a separately written license, or stated as exceptions;
-the above requirements apply either way.
-
-  8. Termination.
-
-  You may not propagate or modify a covered work except as expressly
-provided under this License.  Any attempt otherwise to propagate or
-modify it is void, and will automatically terminate your rights under
-this License (including any patent licenses granted under the third
-paragraph of section 11).
-
-  However, if you cease all violation of this License, then your
-license from a particular copyright holder is reinstated (a)
-provisionally, unless and until the copyright holder explicitly and
-finally terminates your license, and (b) permanently, if the copyright
-holder fails to notify you of the violation by some reasonable means
-prior to 60 days after the cessation.
-
-  Moreover, your license from a particular copyright holder is
-reinstated permanently if the copyright holder notifies you of the
-violation by some reasonable means, this is the first time you have
-received notice of violation of this License (for any work) from that
-copyright holder, and you cure the violation prior to 30 days after
-your receipt of the notice.
-
-  Termination of your rights under this section does not terminate the
-licenses of parties who have received copies or rights from you under
-this License.  If your rights have been terminated and not permanently
-reinstated, you do not qualify to receive new licenses for the same
-material under section 10.
-
-  9. Acceptance Not Required for Having Copies.
-
-  You are not required to accept this License in order to receive or
-run a copy of the Program.  Ancillary propagation of a covered work
-occurring solely as a consequence of using peer-to-peer transmission
-to receive a copy likewise does not require acceptance.  However,
-nothing other than this License grants you permission to propagate or
-modify any covered work.  These actions infringe copyright if you do
-not accept this License.  Therefore, by modifying or propagating a
-covered work, you indicate your acceptance of this License to do so.
-
-  10. Automatic Licensing of Downstream Recipients.
-
-  Each time you convey a covered work, the recipient automatically
-receives a license from the original licensors, to run, modify and
-propagate that work, subject to this License.  You are not responsible
-for enforcing compliance by third parties with this License.
-
-  An "entity transaction" is a transaction transferring control of an
-organization, or substantially all assets of one, or subdividing an
-organization, or merging organizations.  If propagation of a covered
-work results from an entity transaction, each party to that
-transaction who receives a copy of the work also receives whatever
-licenses to the work the party's predecessor in interest had or could
-give under the previous paragraph, plus a right to possession of the
-Corresponding Source of the work from the predecessor in interest, if
-the predecessor has it or can get it with reasonable efforts.
-
-  You may not impose any further restrictions on the exercise of the
-rights granted or affirmed under this License.  For example, you may
-not impose a license fee, royalty, or other charge for exercise of
-rights granted under this License, and you may not initiate litigation
-(including a cross-claim or counterclaim in a lawsuit) alleging that
-any patent claim is infringed by making, using, selling, offering for
-sale, or importing the Program or any portion of it.
-
-  11. Patents.
-
-  A "contributor" is a copyright holder who authorizes use under this
-License of the Program or a work on which the Program is based.  The
-work thus licensed is called the contributor's "contributor version".
-
-  A contributor's "essential patent claims" are all patent claims
-owned or controlled by the contributor, whether already acquired or
-hereafter acquired, that would be infringed by some manner, permitted
-by this License, of making, using, or selling its contributor version,
-but do not include claims that would be infringed only as a
-consequence of further modification of the contributor version.  For
-purposes of this definition, "control" includes the right to grant
-patent sublicenses in a manner consistent with the requirements of
-this License.
-
-  Each contributor grants you a non-exclusive, worldwide, royalty-free
-patent license under the contributor's essential patent claims, to
-make, use, sell, offer for sale, import and otherwise run, modify and
-propagate the contents of its contributor version.
-
-  In the following three paragraphs, a "patent license" is any express
-agreement or commitment, however denominated, not to enforce a patent
-(such as an express permission to practice a patent or covenant not to
-sue for patent infringement).  To "grant" such a patent license to a
-party means to make such an agreement or commitment not to enforce a
-patent against the party.
-
-  If you convey a covered work, knowingly relying on a patent license,
-and the Corresponding Source of the work is not available for anyone
-to copy, free of charge and under the terms of this License, through a
-publicly available network server or other readily accessible means,
-then you must either (1) cause the Corresponding Source to be so
-available, or (2) arrange to deprive yourself of the benefit of the
-patent license for this particular work, or (3) arrange, in a manner
-consistent with the requirements of this License, to extend the patent
-license to downstream recipients.  "Knowingly relying" means you have
-actual knowledge that, but for the patent license, your conveying the
-covered work in a country, or your recipient's use of the covered work
-in a country, would infringe one or more identifiable patents in that
-country that you have reason to believe are valid.
-
-  If, pursuant to or in connection with a single transaction or
-arrangement, you convey, or propagate by procuring conveyance of, a
-covered work, and grant a patent license to some of the parties
-receiving the covered work authorizing them to use, propagate, modify
-or convey a specific copy of the covered work, then the patent license
-you grant is automatically extended to all recipients of the covered
-work and works based on it.
-
-  A patent license is "discriminatory" if it does not include within
-the scope of its coverage, prohibits the exercise of, or is
-conditioned on the non-exercise of one or more of the rights that are
-specifically granted under this License.  You may not convey a covered
-work if you are a party to an arrangement with a third party that is
-in the business of distributing software, under which you make payment
-to the third party based on the extent of your activity of conveying
-the work, and under which the third party grants, to any of the
-parties who would receive the covered work from you, a discriminatory
-patent license (a) in connection with copies of the covered work
-conveyed by you (or copies made from those copies), or (b) primarily
-for and in connection with specific products or compilations that
-contain the covered work, unless you entered into that arrangement,
-or that patent license was granted, prior to 28 March 2007.
-
-  Nothing in this License shall be construed as excluding or limiting
-any implied license or other defenses to infringement that may
-otherwise be available to you under applicable patent law.
-
-  12. No Surrender of Others' Freedom.
-
-  If conditions are imposed on you (whether by court order, agreement or
-otherwise) that contradict the conditions of this License, they do not
-excuse you from the conditions of this License.  If you cannot convey a
-covered work so as to satisfy simultaneously your obligations under this
-License and any other pertinent obligations, then as a consequence you may
-not convey it at all.  For example, if you agree to terms that obligate you
-to collect a royalty for further conveying from those to whom you convey
-the Program, the only way you could satisfy both those terms and this
-License would be to refrain entirely from conveying the Program.
-
-  13. Use with the GNU Affero General Public License.
-
-  Notwithstanding any other provision of this License, you have
-permission to link or combine any covered work with a work licensed
-under version 3 of the GNU Affero General Public License into a single
-combined work, and to convey the resulting work.  The terms of this
-License will continue to apply to the part which is the covered work,
-but the special requirements of the GNU Affero General Public License,
-section 13, concerning interaction through a network will apply to the
-combination as such.
-
-  14. Revised Versions of this License.
-
-  The Free Software Foundation may publish revised and/or new versions of
-the GNU General Public License from time to time.  Such new versions will
-be similar in spirit to the present version, but may differ in detail to
-address new problems or concerns.
-
-  Each version is given a distinguishing version number.  If the
-Program specifies that a certain numbered version of the GNU General
-Public License "or any later version" applies to it, you have the
-option of following the terms and conditions either of that numbered
-version or of any later version published by the Free Software
-Foundation.  If the Program does not specify a version number of the
-GNU General Public License, you may choose any version ever published
-by the Free Software Foundation.
-
-  If the Program specifies that a proxy can decide which future
-versions of the GNU General Public License can be used, that proxy's
-public statement of acceptance of a version permanently authorizes you
-to choose that version for the Program.
-
-  Later license versions may give you additional or different
-permissions.  However, no additional obligations are imposed on any
-author or copyright holder as a result of your choosing to follow a
-later version.
-
-  15. Disclaimer of Warranty.
-
-  THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY
-APPLICABLE LAW.  EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT
-HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY
-OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO,
-THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
-PURPOSE.  THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM
-IS WITH YOU.  SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF
-ALL NECESSARY SERVICING, REPAIR OR CORRECTION.
-
-  16. Limitation of Liability.
-
-  IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
-WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS
-THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY
-GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE
-USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF
-DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD
-PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS),
-EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF
-SUCH DAMAGES.
-
-  17. Interpretation of Sections 15 and 16.
-
-  If the disclaimer of warranty and limitation of liability provided
-above cannot be given local legal effect according to their terms,
-reviewing courts shall apply local law that most closely approximates
-an absolute waiver of all civil liability in connection with the
-Program, unless a warranty or assumption of liability accompanies a
-copy of the Program in return for a fee.
-
-                     END OF TERMS AND CONDITIONS

MaterialDrawer/build.gradle

@@ -0,0 +1,59 @@
+apply plugin: 'com.android.library'
+
+android {
+    compileSdkVersion rootProject.ext.compileSdkVersion
+    buildToolsVersion "28.0.3"
+
+    defaultConfig {
+        minSdkVersion 14
+        targetSdkVersion rootProject.ext.targetSdkVersion
+        versionCode 6102
+        versionName "6.1.2"
+
+        resValue "string", "materialdrawer_lib_version", "6.1.2"
+    }
+    buildTypes {
+        release {
+            minifyEnabled false
+            proguardFiles getDefaultProguardFile('proguard-android.txt'), 'proguard-rules.txt'
+        }
+        debugMinify {
+            debuggable = true
+            minifyEnabled = true
+            proguardFiles 'proguard-android.txt'
+        }
+    }
+    productFlavors {
+    }
+    lintOptions {
+        abortOnError false
+    }
+}
+
+dependencies {
+    implementation "androidx.appcompat:appcompat:${androidXAppCompat}"
+    implementation "androidx.recyclerview:recyclerview:${androidXRecyclerView}"
+    implementation "androidx.annotation:annotation:1.0.2"
+    implementation "com.google.android.material:material:${googleMaterial}"
+    implementation 'pl.droidsonroids.gif:android-gif-drawable:1.2.15'
+
+    // add the constraintLayout used to create the items and headers
+    implementation "androidx.constraintlayout:constraintlayout:1.1.3"
+
+    // used to base on some backwards compatible themes
+    // contains util classes to support various android versions, and clean up code
+    // comes with the awesome "Holder"-Pattern
+    // https://github.com/mikepenz/Materialize
+    api 'com.mikepenz:materialize:1.2.0'
+
+    // used to provide out of the box icon font support. simplifies development,
+    // and provides scalable icons. the core is very very light
+    // https://github.com/mikepenz/Android-Iconics
+    api "com.mikepenz:iconics-core:${iconics}"
+
+    // used to fill the RecyclerView with the DrawerItems
+    // and provides single and multi selection, expandable items
+    // https://github.com/mikepenz/FastAdapter
+    api 'com.mikepenz:fastadapter:3.3.0'
+    api 'com.mikepenz:fastadapter-extensions-expandable:3.3.0'
+}

MaterialDrawer/gradle.properties

@@ -0,0 +1,4 @@
+POM_NAME=MaterialDrawer Library
+POM_DESCRIPTION=The flexible, easy to use, all in one drawer library for your Android project.
+POM_ARTIFACT_ID=materialdrawer
+POM_PACKAGING=aar

MaterialDrawer/src/main/AndroidManifest.xml

@@ -0,0 +1,2 @@
+<?xml version="1.0" encoding="utf-8"?>
+<manifest package="com.mikepenz.materialdrawer" />

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/AccountHeader.java

@@ -0,0 +1,455 @@
+package com.mikepenz.materialdrawer;
+
+import android.content.Context;
+import android.graphics.drawable.Drawable;
+import android.net.Uri;
+import android.os.Bundle;
+import androidx.annotation.DrawableRes;
+import androidx.annotation.NonNull;
+import pl.droidsonroids.gif.GifDrawable;
+import pl.droidsonroids.gif.GifImageView;
+
+import android.view.View;
+import android.widget.ImageView;
+
+import com.mikepenz.materialdrawer.holder.ImageHolder;
+import com.mikepenz.materialdrawer.model.interfaces.IProfile;
+
+import java.io.IOException;
+import java.util.ArrayList;
+import java.util.Collections;
+import java.util.List;
+
+/**
+ * Created by mikepenz on 27.02.15.
+ */
+public class AccountHeader {
+    protected final static double NAVIGATION_DRAWER_ACCOUNT_ASPECT_RATIO = 9d / 16d;
+
+    protected static final String BUNDLE_SELECTION_HEADER = "bundle_selection_header";
+
+
+    protected final AccountHeaderBuilder mAccountHeaderBuilder;
+
+    protected AccountHeader(AccountHeaderBuilder accountHeaderBuilder) {
+        this.mAccountHeaderBuilder = accountHeaderBuilder;
+    }
+
+    /**
+     * the protected getter for the AccountHeaderBuilder
+     *
+     * @return the AccountHeaderBuilder
+     */
+    protected AccountHeaderBuilder getAccountHeaderBuilder() {
+        return mAccountHeaderBuilder;
+    }
+
+    /**
+     * Get the Root view for the Header
+     *
+     * @return
+     */
+    public View getView() {
+        return mAccountHeaderBuilder.mAccountHeaderContainer;
+    }
+
+    /**
+     * Set the drawer for the AccountHeader so we can use it for the select
+     *
+     * @param drawer
+     */
+    public void setDrawer(Drawer drawer) {
+        mAccountHeaderBuilder.mDrawer = drawer;
+    }
+
+    /**
+     * Returns the header background view so the dev can set everything on it
+     *
+     * @return
+     */
+    public GifImageView getHeaderBackgroundView() {
+        return mAccountHeaderBuilder.mAccountHeaderBackground;
+    }
+
+    /**
+     * set the background for the header via the ImageHolder class
+     *
+     * @param imageHolder
+     */
+    public void setHeaderBackground(ImageHolder imageHolder) {
+        ImageHolder.applyTo(imageHolder, mAccountHeaderBuilder.mAccountHeaderBackground);
+    }
+
+    /**
+     * Set the background for the Header
+     *
+     * @param headerBackground
+     */
+    public void setBackground(Drawable headerBackground) {
+        mAccountHeaderBuilder.mAccountHeaderBackground.setImageDrawable(headerBackground);
+    }
+
+    /**
+     * set the background for the header as file name
+     *
+     * @param headerBackgroundPath
+     * @return
+     */
+    public void setBackground(String headerBackgroundPath) {
+        try {
+            if (headerBackgroundPath.endsWith(".gif")) {
+                setHeaderBackground(new ImageHolder(new GifDrawable(headerBackgroundPath)));
+            }
+            else {
+                setHeaderBackground(new ImageHolder(Uri.parse(headerBackgroundPath)));
+            }
+
+        } catch (IOException e) {
+            e.printStackTrace();
+        }
+    }
+
+    /**
+     * Set the background for the Header as resource
+     *
+     * @param headerBackgroundRes
+     */
+    public void setBackgroundRes(@DrawableRes int headerBackgroundRes) {
+        mAccountHeaderBuilder.mAccountHeaderBackground.setImageResource(headerBackgroundRes);
+    }
+
+    /**
+     * Toggle the selection list (show or hide it)
+     *
+     * @param ctx
+     */
+    public void toggleSelectionList(Context ctx) {
+        mAccountHeaderBuilder.toggleSelectionList(ctx);
+    }
+
+    /**
+     * returns if the selection list is currently shown
+     *
+     * @return
+     */
+    public boolean isSelectionListShown() {
+        return mAccountHeaderBuilder.mSelectionListShown;
+    }
+
+
+    /**
+     * set this to false if you want to hide the first line of the selection box in the header (first line would be the name)
+     *
+     * @param selectionFirstLineShown
+     */
+    public void setSelectionFirstLineShown(boolean selectionFirstLineShown) {
+        mAccountHeaderBuilder.mSelectionFirstLineShown = selectionFirstLineShown;
+        mAccountHeaderBuilder.updateHeaderAndList();
+    }
+
+    /**
+     * set this to false if you want to hide the second line of the selection box in the header (second line would be the e-mail)
+     *
+     * @param selectionSecondLineShown
+     */
+    public void setSelectionSecondLineShown(boolean selectionSecondLineShown) {
+        mAccountHeaderBuilder.mSelectionSecondLineShown = selectionSecondLineShown;
+        mAccountHeaderBuilder.updateHeaderAndList();
+    }
+
+    /**
+     * set this to define the first line in the selection area if there is no profile
+     * note this will block any values from profiles!
+     *
+     * @param selectionFirstLine
+     */
+    public void setSelectionFirstLine(String selectionFirstLine) {
+        mAccountHeaderBuilder.mSelectionFirstLine = selectionFirstLine;
+        mAccountHeaderBuilder.updateHeaderAndList();
+    }
+
+    /**
+     * set this to define the second line in the selection area if there is no profile
+     * note this will block any values from profiles!
+     *
+     * @param selectionSecondLine
+     */
+    public void setSelectionSecondLine(String selectionSecondLine) {
+        mAccountHeaderBuilder.mSelectionSecondLine = selectionSecondLine;
+        mAccountHeaderBuilder.updateHeaderAndList();
+    }
+
+    /**
+     * returns the current list of profiles set for this header
+     *
+     * @return
+     */
+    public List<IProfile> getProfiles() {
+        return mAccountHeaderBuilder.mProfiles;
+    }
+
+    /**
+     * Set a new list of profiles for the header
+     *
+     * @param profiles
+     */
+    public void setProfiles(List<IProfile> profiles) {
+        mAccountHeaderBuilder.mProfiles = profiles;
+        mAccountHeaderBuilder.updateHeaderAndList();
+    }
+
+    /**
+     * Selects the given profile and sets it to the new active profile
+     *
+     * @param profile
+     */
+    public void setActiveProfile(IProfile profile) {
+        setActiveProfile(profile, false);
+    }
+
+    /**
+     * Selects the given profile and sets it to the new active profile
+     *
+     * @param profile
+     */
+    public void setActiveProfile(IProfile profile, boolean fireOnProfileChanged) {
+        final boolean isCurrentSelectedProfile = mAccountHeaderBuilder.switchProfiles(profile);
+        //if the selectionList is shown we should also update the current selected profile in the list
+        if (mAccountHeaderBuilder.mDrawer != null && isSelectionListShown()) {
+            mAccountHeaderBuilder.mDrawer.setSelection(profile.getIdentifier(), false);
+        }
+        //fire the event if enabled and a listener is set
+        if (fireOnProfileChanged && mAccountHeaderBuilder.mOnAccountHeaderListener != null) {
+            mAccountHeaderBuilder.mOnAccountHeaderListener.onProfileChanged(null, profile, isCurrentSelectedProfile);
+        }
+    }
+
+    /**
+     * Selects a profile by its identifier
+     *
+     * @param identifier
+     */
+    public void setActiveProfile(long identifier) {
+        setActiveProfile(identifier, false);
+    }
+
+    /**
+     * Selects a profile by its identifier
+     *
+     * @param identifier
+     */
+    public void setActiveProfile(long identifier, boolean fireOnProfileChanged) {
+        if (mAccountHeaderBuilder.mProfiles != null) {
+            for (IProfile profile : mAccountHeaderBuilder.mProfiles) {
+                if (profile != null) {
+                    if (profile.getIdentifier() == identifier) {
+                        setActiveProfile(profile, fireOnProfileChanged);
+                        return;
+                    }
+                }
+            }
+        }
+    }
+
+    /**
+     * get the current active profile
+     *
+     * @return
+     */
+    public IProfile getActiveProfile() {
+        return mAccountHeaderBuilder.mCurrentProfile;
+    }
+
+
+    /**
+     * Helper method to update a profile using it's identifier
+     *
+     * @param newProfile
+     */
+    public void updateProfile(@NonNull IProfile newProfile) {
+        updateProfileByIdentifier(newProfile);
+    }
+
+    /**
+     * Helper method to update a profile using it's identifier
+     *
+     * @param newProfile
+     */
+    @Deprecated
+    public void updateProfileByIdentifier(@NonNull IProfile newProfile) {
+        int found = getPositionByIdentifier(newProfile.getIdentifier());
+        if (found > -1) {
+            mAccountHeaderBuilder.mProfiles.set(found, newProfile);
+            mAccountHeaderBuilder.updateHeaderAndList();
+        }
+    }
+
+
+    /**
+     * Add new profiles to the existing list of profiles
+     *
+     * @param profiles
+     */
+    public void addProfiles(@NonNull IProfile... profiles) {
+        if (mAccountHeaderBuilder.mProfiles == null) {
+            mAccountHeaderBuilder.mProfiles = new ArrayList<>();
+        }
+
+        Collections.addAll(mAccountHeaderBuilder.mProfiles, profiles);
+
+        mAccountHeaderBuilder.updateHeaderAndList();
+    }
+
+    /**
+     * Add a new profile at a specific position to the list
+     *
+     * @param profile
+     * @param position
+     */
+    public void addProfile(@NonNull IProfile profile, int position) {
+        if (mAccountHeaderBuilder.mProfiles == null) {
+            mAccountHeaderBuilder.mProfiles = new ArrayList<>();
+        }
+        mAccountHeaderBuilder.mProfiles.add(position, profile);
+
+        mAccountHeaderBuilder.updateHeaderAndList();
+    }
+
+    /**
+     * remove a profile from the given position
+     *
+     * @param position
+     */
+    public void removeProfile(int position) {
+        if (mAccountHeaderBuilder.mProfiles != null && mAccountHeaderBuilder.mProfiles.size() > position) {
+            mAccountHeaderBuilder.mProfiles.remove(position);
+        }
+
+        mAccountHeaderBuilder.updateHeaderAndList();
+    }
+
+    /**
+     * remove the profile with the given identifier
+     *
+     * @param identifier
+     */
+    public void removeProfileByIdentifier(long identifier) {
+        int found = getPositionByIdentifier(identifier);
+        if (found > -1) {
+            mAccountHeaderBuilder.mProfiles.remove(found);
+        }
+
+        mAccountHeaderBuilder.updateHeaderAndList();
+    }
+
+    /**
+     * try to remove the given profile
+     *
+     * @param profile
+     */
+    public void removeProfile(@NonNull IProfile profile) {
+        removeProfileByIdentifier(profile.getIdentifier());
+    }
+
+    /**
+     * Clear the header
+     */
+    public void clear() {
+        mAccountHeaderBuilder.mProfiles = null;
+
+        //calculate the profiles to set
+        mAccountHeaderBuilder.calculateProfiles();
+
+        //process and build the profiles
+        mAccountHeaderBuilder.buildProfiles();
+    }
+
+    /**
+     * gets the position of a profile by it's identifier
+     *
+     * @param identifier
+     * @return
+     */
+    private int getPositionByIdentifier(long identifier) {
+        int found = -1;
+        if (mAccountHeaderBuilder.mProfiles != null && identifier != -1) {
+            for (int i = 0; i < mAccountHeaderBuilder.mProfiles.size(); i++) {
+                if (mAccountHeaderBuilder.mProfiles.get(i) != null) {
+                    if (mAccountHeaderBuilder.mProfiles.get(i).getIdentifier() == identifier) {
+                        found = i;
+                        break;
+                    }
+                }
+            }
+        }
+        return found;
+    }
+
+    /**
+     * add the values to the bundle for saveInstanceState
+     *
+     * @param savedInstanceState
+     * @return
+     */
+    public Bundle saveInstanceState(Bundle savedInstanceState) {
+        if (savedInstanceState != null) {
+            savedInstanceState.putInt(BUNDLE_SELECTION_HEADER, mAccountHeaderBuilder.getCurrentSelection());
+        }
+        return savedInstanceState;
+    }
+
+
+    public interface OnAccountHeaderListener {
+        /**
+         * the event when the profile changes
+         *
+         * @param view
+         * @param profile
+         * @return if the event was consumed
+         */
+        boolean onProfileChanged(View view, IProfile profile, boolean current);
+    }
+
+    public interface OnAccountHeaderItemLongClickListener {
+        /**
+         * the event when the profile item is longClicked inside the list
+         *
+         * @param view
+         * @param profile
+         * @param current
+         * @return if the event was consumed
+         */
+        boolean onProfileLongClick(View view, IProfile profile, boolean current);
+    }
+
+    public interface OnAccountHeaderProfileImageListener {
+        /**
+         * the event when the profile image is clicked
+         *
+         * @param view
+         * @param profile
+         * @return if the event was consumed
+         */
+        boolean onProfileImageClick(View view, IProfile profile, boolean current);
+
+        /**
+         * the event when the profile image is long clicked
+         *
+         * @param view
+         * @param profile
+         * @return if the event was consumed
+         */
+        boolean onProfileImageLongClick(View view, IProfile profile, boolean current);
+    }
+
+    public interface OnAccountHeaderSelectionViewClickListener {
+        /**
+         * the event when the user clicks the selection list under the profile icons
+         *
+         * @param view
+         * @param profile
+         * @return if the event was consumed
+         */
+        boolean onClick(View view, IProfile profile);
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/DrawerUtils.java

@@ -0,0 +1,447 @@
+package com.mikepenz.materialdrawer;
+
+import android.content.Context;
+import android.os.Build;
+import android.view.Gravity;
+import android.view.View;
+import android.view.ViewGroup;
+import android.widget.LinearLayout;
+import android.widget.RelativeLayout;
+
+import com.mikepenz.materialdrawer.model.AbstractDrawerItem;
+import com.mikepenz.materialdrawer.model.ContainerDrawerItem;
+import com.mikepenz.materialdrawer.model.interfaces.IDrawerItem;
+import com.mikepenz.materialdrawer.model.interfaces.Selectable;
+import com.mikepenz.materialdrawer.util.DrawerUIUtils;
+import com.mikepenz.materialize.util.UIUtils;
+
+import java.util.List;
+
+import androidx.drawerlayout.widget.DrawerLayout;
+
+/**
+ * Created by mikepenz on 23.05.15.
+ */
+class DrawerUtils {
+    /**
+     * helper method to handle the onClick of the footer
+     *
+     * @param drawer
+     * @param drawerItem
+     * @param v
+     * @param fireOnClick true if we should call the listener, false if not, null to not call the listener and not close the drawer
+     */
+    public static void onFooterDrawerItemClick(DrawerBuilder drawer, IDrawerItem drawerItem, View v, Boolean fireOnClick) {
+        boolean checkable = !(drawerItem != null && drawerItem instanceof Selectable && !drawerItem.isSelectable());
+        if (checkable) {
+            drawer.resetStickyFooterSelection();
+
+            v.setActivated(true);
+            v.setSelected(true);
+
+            //remove the selection in the list
+            drawer.getAdapter().deselect();
+
+            //find the position of the clicked footer item
+            if (drawer.mStickyFooterView != null && drawer.mStickyFooterView instanceof LinearLayout) {
+                LinearLayout footer = (LinearLayout) drawer.mStickyFooterView;
+                for (int i = 0; i < footer.getChildCount(); i++) {
+                    if (footer.getChildAt(i) == v) {
+                        drawer.mCurrentStickyFooterSelection = i;
+                        break;
+                    }
+                }
+            }
+        }
+
+
+        if (fireOnClick != null) {
+            boolean consumed = false;
+
+            if (fireOnClick) {
+                if (drawerItem instanceof AbstractDrawerItem && ((AbstractDrawerItem) drawerItem).getOnDrawerItemClickListener() != null) {
+                    consumed = ((AbstractDrawerItem) drawerItem).getOnDrawerItemClickListener().onItemClick(v, -1, drawerItem);
+                }
+
+                if (drawer.mOnDrawerItemClickListener != null) {
+                    consumed = drawer.mOnDrawerItemClickListener.onItemClick(v, -1, drawerItem);
+                }
+            }
+
+            if (!consumed) {
+                //close the drawer after click
+                drawer.closeDrawerDelayed();
+            }
+        }
+    }
+
+    /**
+     * helper method to set the selection of the footer
+     *
+     * @param drawer
+     * @param position
+     * @param fireOnClick
+     */
+    public static void setStickyFooterSelection(DrawerBuilder drawer, int position, Boolean fireOnClick) {
+        if (position > -1) {
+            if (drawer.mStickyFooterView != null && drawer.mStickyFooterView instanceof LinearLayout) {
+                LinearLayout footer = (LinearLayout) drawer.mStickyFooterView;
+                if (drawer.mStickyFooterDivider) {
+                    position = position + 1;
+                }
+                if (footer.getChildCount() > position && position >= 0) {
+                    IDrawerItem drawerItem = (IDrawerItem) footer.getChildAt(position).getTag(R.id.material_drawer_item);
+                    onFooterDrawerItemClick(drawer, drawerItem, footer.getChildAt(position), fireOnClick);
+                }
+            }
+        }
+    }
+
+    /**
+     * calculates the position of an drawerItem. searching by it's identifier
+     *
+     * @param identifier
+     * @return
+     */
+    public static int getPositionByIdentifier(DrawerBuilder drawer, long identifier) {
+        if (identifier != -1) {
+            for (int i = 0; i < drawer.getAdapter().getItemCount(); i++) {
+                if (drawer.getAdapter().getItem(i).getIdentifier() == identifier) {
+                    return i;
+                }
+            }
+        }
+
+        return -1;
+    }
+
+    /**
+     * gets the drawerItem with the specific identifier from a drawerItem list
+     *
+     * @param drawerItems
+     * @param identifier
+     * @return
+     */
+    public static IDrawerItem getDrawerItem(List<IDrawerItem> drawerItems, long identifier) {
+        if (identifier != -1) {
+            for (IDrawerItem drawerItem : drawerItems) {
+                if (drawerItem.getIdentifier() == identifier) {
+                    return drawerItem;
+                }
+            }
+        }
+        return null;
+    }
+
+    /**
+     * gets the drawerItem by a defined tag from a drawerItem list
+     *
+     * @param drawerItems
+     * @param tag
+     * @return
+     */
+    public static IDrawerItem getDrawerItem(List<IDrawerItem> drawerItems, Object tag) {
+        if (tag != null) {
+            for (IDrawerItem drawerItem : drawerItems) {
+                if (tag.equals(drawerItem.getTag())) {
+                    return drawerItem;
+                }
+            }
+        }
+        return null;
+    }
+
+    /**
+     * calculates the position of an drawerItem inside the footer. searching by it's identifier
+     *
+     * @param identifier
+     * @return
+     */
+    public static int getStickyFooterPositionByIdentifier(DrawerBuilder drawer, long identifier) {
+        if (identifier != -1) {
+            if (drawer.mStickyFooterView != null && drawer.mStickyFooterView instanceof LinearLayout) {
+                LinearLayout footer = (LinearLayout) drawer.mStickyFooterView;
+
+                int shadowOffset = 0;
+                for (int i = 0; i < footer.getChildCount(); i++) {
+                    Object o = footer.getChildAt(i).getTag(R.id.material_drawer_item);
+
+                    //count up the shadowOffset to return the correct position of the given item
+                    if (o == null && drawer.mStickyFooterDivider) {
+                        shadowOffset = shadowOffset + 1;
+                    }
+
+                    if (o != null && o instanceof IDrawerItem && ((IDrawerItem) o).getIdentifier() == identifier) {
+                        return i - shadowOffset;
+                    }
+                }
+            }
+        }
+
+        return -1;
+    }
+
+    /**
+     * helper method to handle the headerView
+     *
+     * @param drawer
+     */
+    public static void handleHeaderView(DrawerBuilder drawer) {
+        //use the AccountHeader if set
+        if (drawer.mAccountHeader != null) {
+            if (drawer.mAccountHeaderSticky) {
+                drawer.mStickyHeaderView = drawer.mAccountHeader.getView();
+            } else {
+                drawer.mHeaderView = drawer.mAccountHeader.getView();
+                drawer.mHeaderDivider = drawer.mAccountHeader.mAccountHeaderBuilder.mDividerBelowHeader;
+                drawer.mHeaderPadding = drawer.mAccountHeader.mAccountHeaderBuilder.mPaddingBelowHeader;
+            }
+        }
+
+        //sticky header view
+        if (drawer.mStickyHeaderView != null) {
+            //add the sticky footer view and align it to the bottom
+            RelativeLayout.LayoutParams layoutParams = new RelativeLayout.LayoutParams(RelativeLayout.LayoutParams.MATCH_PARENT, RelativeLayout.LayoutParams.WRAP_CONTENT);
+            layoutParams.addRule(RelativeLayout.ALIGN_PARENT_TOP, 1);
+            drawer.mStickyHeaderView.setId(R.id.material_drawer_sticky_header);
+            drawer.mSliderLayout.addView(drawer.mStickyHeaderView, 0, layoutParams);
+
+            //now align the recyclerView below the stickyFooterView ;)
+            RelativeLayout.LayoutParams layoutParamsListView = (RelativeLayout.LayoutParams) drawer.mRecyclerView.getLayoutParams();
+            layoutParamsListView.addRule(RelativeLayout.BELOW, R.id.material_drawer_sticky_header);
+            drawer.mRecyclerView.setLayoutParams(layoutParamsListView);
+
+            //set a background color or the elevation will not work
+            drawer.mStickyHeaderView.setBackgroundColor(UIUtils.getThemeColorFromAttrOrRes(drawer.mActivity, R.attr.material_drawer_background, R.color.material_drawer_background));
+
+            if (drawer.mStickyHeaderShadow) {
+                //add a shadow
+                if (Build.VERSION.SDK_INT >= 21) {
+                    drawer.mStickyHeaderView.setElevation(UIUtils.convertDpToPixel(4, drawer.mActivity));
+                } else {
+                    View view = new View(drawer.mActivity);
+                    view.setBackgroundResource(R.drawable.material_drawer_shadow_bottom);
+                    drawer.mSliderLayout.addView(view, RelativeLayout.LayoutParams.MATCH_PARENT, (int) UIUtils.convertDpToPixel(4, drawer.mActivity));
+                    //now align the shadow below the stickyHeader ;)
+                    RelativeLayout.LayoutParams lps = (RelativeLayout.LayoutParams) view.getLayoutParams();
+                    lps.addRule(RelativeLayout.BELOW, R.id.material_drawer_sticky_header);
+                    view.setLayoutParams(lps);
+                }
+            }
+
+            //remove the padding of the recyclerView again we have the header on top of it
+            drawer.mRecyclerView.setPadding(0, 0, 0, 0);
+        }
+
+        // set the header (do this before the setAdapter because some devices will crash else
+        if (drawer.mHeaderView != null) {
+            if (drawer.mRecyclerView == null) {
+                throw new RuntimeException("can't use a headerView without a recyclerView");
+            }
+
+            if (drawer.mHeaderPadding) {
+                drawer.getHeaderAdapter().add(new ContainerDrawerItem().withView(drawer.mHeaderView).withHeight(drawer.mHeiderHeight).withDivider(drawer.mHeaderDivider).withViewPosition(ContainerDrawerItem.Position.TOP));
+            } else {
+                drawer.getHeaderAdapter().add(new ContainerDrawerItem().withView(drawer.mHeaderView).withHeight(drawer.mHeiderHeight).withDivider(drawer.mHeaderDivider).withViewPosition(ContainerDrawerItem.Position.NONE));
+            }
+            //set the padding on the top to 0
+            drawer.mRecyclerView.setPadding(drawer.mRecyclerView.getPaddingLeft(), 0, drawer.mRecyclerView.getPaddingRight(), drawer.mRecyclerView.getPaddingBottom());
+        }
+    }
+
+    /**
+     * small helper to rebuild the FooterView
+     *
+     * @param drawer
+     */
+    public static void rebuildStickyFooterView(final DrawerBuilder drawer) {
+        if (drawer.mSliderLayout != null) {
+            if (drawer.mStickyFooterView != null) {
+                drawer.mStickyFooterView.removeAllViews();
+
+                //create the divider
+                if (drawer.mStickyFooterDivider) {
+                    addStickyFooterDivider(drawer.mStickyFooterView.getContext(), drawer.mStickyFooterView);
+                }
+
+                //fill the footer with items
+                DrawerUtils.fillStickyDrawerItemFooter(drawer, drawer.mStickyFooterView, new View.OnClickListener() {
+                    @Override
+                    public void onClick(View v) {
+                        IDrawerItem drawerItem = (IDrawerItem) v.getTag(R.id.material_drawer_item);
+                        com.mikepenz.materialdrawer.DrawerUtils.onFooterDrawerItemClick(drawer, drawerItem, v, true);
+                    }
+                });
+
+                drawer.mStickyFooterView.setVisibility(View.VISIBLE);
+            } else {
+                //there was no footer yet. now just create one
+                DrawerUtils.handleFooterView(drawer, new View.OnClickListener() {
+                    @Override
+                    public void onClick(View v) {
+                        IDrawerItem drawerItem = (IDrawerItem) v.getTag(R.id.material_drawer_item);
+                        DrawerUtils.onFooterDrawerItemClick(drawer, drawerItem, v, true);
+                    }
+                });
+            }
+
+            setStickyFooterSelection(drawer, drawer.mCurrentStickyFooterSelection, false);
+        }
+    }
+
+    /**
+     * helper method to handle the footerView
+     *
+     * @param drawer
+     */
+    public static void handleFooterView(DrawerBuilder drawer, View.OnClickListener onClickListener) {
+        Context ctx = drawer.mSliderLayout.getContext();
+
+        //use the StickyDrawerItems if set
+        if (drawer.mStickyDrawerItems != null && drawer.mStickyDrawerItems.size() > 0) {
+            drawer.mStickyFooterView = DrawerUtils.buildStickyDrawerItemFooter(ctx, drawer, onClickListener);
+        }
+
+        //sticky footer view
+        if (drawer.mStickyFooterView != null) {
+            //add the sticky footer view and align it to the bottom
+            RelativeLayout.LayoutParams layoutParams = new RelativeLayout.LayoutParams(RelativeLayout.LayoutParams.MATCH_PARENT, RelativeLayout.LayoutParams.WRAP_CONTENT);
+            layoutParams.addRule(RelativeLayout.ALIGN_PARENT_BOTTOM, 1);
+            drawer.mStickyFooterView.setId(R.id.material_drawer_sticky_footer);
+            drawer.mSliderLayout.addView(drawer.mStickyFooterView, layoutParams);
+
+            if ((drawer.mTranslucentNavigationBar || drawer.mFullscreen) && Build.VERSION.SDK_INT >= 19) {
+                drawer.mStickyFooterView.setPadding(0, 0, 0, UIUtils.getNavigationBarHeight(ctx));
+            }
+
+            //now align the recyclerView above the stickyFooterView ;)
+            RelativeLayout.LayoutParams layoutParamsListView = (RelativeLayout.LayoutParams) drawer.mRecyclerView.getLayoutParams();
+            layoutParamsListView.addRule(RelativeLayout.ABOVE, R.id.material_drawer_sticky_footer);
+            drawer.mRecyclerView.setLayoutParams(layoutParamsListView);
+
+            //handle shadow on top of the sticky footer
+            if (drawer.mStickyFooterShadow) {
+                drawer.mStickyFooterShadowView = new View(ctx);
+                drawer.mStickyFooterShadowView.setBackgroundResource(R.drawable.material_drawer_shadow_top);
+                drawer.mSliderLayout.addView(drawer.mStickyFooterShadowView, RelativeLayout.LayoutParams.MATCH_PARENT, ctx.getResources().getDimensionPixelSize(R.dimen.material_drawer_sticky_footer_elevation));
+                //now align the shadow below the stickyHeader ;)
+                RelativeLayout.LayoutParams lps = (RelativeLayout.LayoutParams) drawer.mStickyFooterShadowView.getLayoutParams();
+                lps.addRule(RelativeLayout.ABOVE, R.id.material_drawer_sticky_footer);
+                drawer.mStickyFooterShadowView.setLayoutParams(lps);
+            }
+
+            //remove the padding of the recyclerView again we have the footer below it
+            drawer.mRecyclerView.setPadding(drawer.mRecyclerView.getPaddingLeft(), drawer.mRecyclerView.getPaddingTop(), drawer.mRecyclerView.getPaddingRight(), ctx.getResources().getDimensionPixelSize(R.dimen.material_drawer_padding));
+        }
+
+        // set the footer (do this before the setAdapter because some devices will crash else
+        if (drawer.mFooterView != null) {
+            if (drawer.mRecyclerView == null) {
+                throw new RuntimeException("can't use a footerView without a recyclerView");
+            }
+
+            if (drawer.mFooterDivider) {
+                drawer.getFooterAdapter().add(new ContainerDrawerItem().withView(drawer.mFooterView).withViewPosition(ContainerDrawerItem.Position.BOTTOM));
+            } else {
+                drawer.getFooterAdapter().add(new ContainerDrawerItem().withView(drawer.mFooterView).withViewPosition(ContainerDrawerItem.Position.NONE));
+            }
+        }
+    }
+
+
+    /**
+     * build the sticky footer item view
+     *
+     * @return
+     */
+    public static ViewGroup buildStickyDrawerItemFooter(Context ctx, DrawerBuilder drawer, View.OnClickListener onClickListener) {
+        //create the container view
+        final LinearLayout linearLayout = new LinearLayout(ctx);
+        linearLayout.setLayoutParams(new LinearLayout.LayoutParams(ViewGroup.LayoutParams.MATCH_PARENT, ViewGroup.LayoutParams.WRAP_CONTENT));
+        linearLayout.setOrientation(LinearLayout.VERTICAL);
+        //set the background color to the drawer background color (if it has alpha the shadow won't be visible)
+        linearLayout.setBackgroundColor(UIUtils.getThemeColorFromAttrOrRes(ctx, R.attr.material_drawer_background, R.color.material_drawer_background));
+
+        //create the divider
+        if (drawer.mStickyFooterDivider) {
+            addStickyFooterDivider(ctx, linearLayout);
+        }
+
+        fillStickyDrawerItemFooter(drawer, linearLayout, onClickListener);
+
+        return linearLayout;
+    }
+
+    /**
+     * adds the shadow to the stickyFooter
+     *
+     * @param ctx
+     * @param footerView
+     */
+    private static void addStickyFooterDivider(Context ctx, ViewGroup footerView) {
+        LinearLayout divider = new LinearLayout(ctx);
+        LinearLayout.LayoutParams dividerParams = new LinearLayout.LayoutParams(ViewGroup.LayoutParams.MATCH_PARENT, ViewGroup.LayoutParams.WRAP_CONTENT);
+        divider.setMinimumHeight((int) UIUtils.convertDpToPixel(1, ctx));
+        divider.setOrientation(LinearLayout.VERTICAL);
+        divider.setBackgroundColor(UIUtils.getThemeColorFromAttrOrRes(ctx, R.attr.material_drawer_divider, R.color.material_drawer_divider));
+        footerView.addView(divider, dividerParams);
+    }
+
+    /**
+     * helper method to fill the sticky footer with it's elements
+     *
+     * @param drawer
+     * @param container
+     * @param onClickListener
+     */
+    public static void fillStickyDrawerItemFooter(DrawerBuilder drawer, ViewGroup container, View.OnClickListener onClickListener) {
+        //add all drawer items
+        for (IDrawerItem drawerItem : drawer.mStickyDrawerItems) {
+            View view = drawerItem.generateView(container.getContext(), container);
+            view.setTag(drawerItem);
+
+            if (drawerItem.isEnabled()) {
+                //UIUtils.setBackground(view, UIUtils.getSelectableBackground(container.getContext(), selected_color, drawerItem.isSelectedBackgroundAnimated()));
+                view.setOnClickListener(onClickListener);
+            }
+
+            container.addView(view);
+
+            //for android API 17 --> Padding not applied via xml
+            DrawerUIUtils.setDrawerVerticalPadding(view);
+        }
+        //and really. don't ask about this. it won't set the padding if i don't set the padding for the container
+        container.setPadding(0, 0, 0, 0);
+    }
+
+
+    /**
+     * helper to extend the layoutParams of the drawer
+     *
+     * @param params
+     * @return
+     */
+    public static DrawerLayout.LayoutParams processDrawerLayoutParams(DrawerBuilder drawer, DrawerLayout.LayoutParams params) {
+        if (params != null) {
+            if (drawer.mDrawerGravity != null && (drawer.mDrawerGravity == Gravity.RIGHT || drawer.mDrawerGravity == Gravity.END)) {
+                params.rightMargin = 0;
+                if (Build.VERSION.SDK_INT >= 17) {
+                    params.setMarginEnd(0);
+                }
+
+                params.leftMargin = drawer.mActivity.getResources().getDimensionPixelSize(R.dimen.material_drawer_margin);
+                if (Build.VERSION.SDK_INT >= 17) {
+                    params.setMarginEnd(drawer.mActivity.getResources().getDimensionPixelSize(R.dimen.material_drawer_margin));
+                }
+            }
+
+            if (drawer.mDrawerWidth > -1) {
+                params.width = drawer.mDrawerWidth;
+            } else {
+                params.width = DrawerUIUtils.getOptimalDrawerWidth(drawer.mActivity);
+            }
+        }
+
+        return params;
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/MiniDrawer.java

@@ -0,0 +1,544 @@
+package com.mikepenz.materialdrawer;
+
+import android.content.Context;
+import android.content.res.Configuration;
+import androidx.annotation.NonNull;
+import androidx.recyclerview.widget.DefaultItemAnimator;
+import androidx.recyclerview.widget.LinearLayoutManager;
+import androidx.recyclerview.widget.RecyclerView;
+import android.view.View;
+import android.view.ViewGroup;
+import android.widget.LinearLayout;
+
+import com.mikepenz.fastadapter.FastAdapter;
+import com.mikepenz.fastadapter.IAdapter;
+import com.mikepenz.fastadapter.adapters.ItemAdapter;
+import com.mikepenz.fastadapter.listeners.OnClickListener;
+import com.mikepenz.fastadapter.listeners.OnLongClickListener;
+import com.mikepenz.materialdrawer.interfaces.ICrossfader;
+import com.mikepenz.materialdrawer.model.MiniDrawerItem;
+import com.mikepenz.materialdrawer.model.MiniProfileDrawerItem;
+import com.mikepenz.materialdrawer.model.PrimaryDrawerItem;
+import com.mikepenz.materialdrawer.model.ProfileDrawerItem;
+import com.mikepenz.materialdrawer.model.SecondaryDrawerItem;
+import com.mikepenz.materialdrawer.model.interfaces.IDrawerItem;
+import com.mikepenz.materialdrawer.model.interfaces.IProfile;
+import com.mikepenz.materialize.util.UIUtils;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 15.07.15.
+ * Don't count this for real yet. it's just a quick try on creating a Gmail like panel
+ */
+public class MiniDrawer {
+    public static final int PROFILE = 1;
+    public static final int ITEM = 2;
+
+    private LinearLayout mContainer;
+    private RecyclerView mRecyclerView;
+    protected FastAdapter<IDrawerItem> mAdapter;
+    protected ItemAdapter<IDrawerItem> mItemAdapter;
+
+    private Drawer mDrawer;
+
+    /**
+     * Provide the Drawer which will be used as dataSource for the drawerItems
+     *
+     * @param drawer
+     * @return
+     */
+    public MiniDrawer withDrawer(@NonNull Drawer drawer) {
+        this.mDrawer = drawer;
+        return this;
+    }
+
+    private AccountHeader mAccountHeader;
+
+    /**
+     * Provide the AccountHeader which will be used as the dataSource for the profiles
+     *
+     * @param accountHeader
+     * @return
+     */
+    public MiniDrawer withAccountHeader(@NonNull AccountHeader accountHeader) {
+        this.mAccountHeader = accountHeader;
+        return this;
+    }
+
+    private ICrossfader mCrossFader;
+
+    /**
+     * Provide the Crossfader implementation which is used with this MiniDrawer
+     *
+     * @param crossFader
+     * @return
+     */
+    public MiniDrawer withCrossFader(@NonNull ICrossfader crossFader) {
+        this.mCrossFader = crossFader;
+        return this;
+    }
+
+    private boolean mInnerShadow = false;
+
+    /**
+     * set to true if you want to show the innerShadow on the MiniDrawer
+     *
+     * @param innerShadow
+     * @return
+     */
+    public MiniDrawer withInnerShadow(boolean innerShadow) {
+        this.mInnerShadow = innerShadow;
+        return this;
+    }
+
+    private boolean mInRTL = false;
+
+    /**
+     * set to true if you want the MiniDrawer in RTL mode
+     *
+     * @param inRTL
+     * @return
+     */
+    public MiniDrawer withInRTL(boolean inRTL) {
+        this.mInRTL = inRTL;
+        return this;
+    }
+
+    private boolean mIncludeSecondaryDrawerItems = false;
+
+    /**
+     * set to true if you also want to display secondaryDrawerItems
+     *
+     * @param includeSecondaryDrawerItems
+     * @return
+     */
+    public MiniDrawer withIncludeSecondaryDrawerItems(boolean includeSecondaryDrawerItems) {
+        this.mIncludeSecondaryDrawerItems = includeSecondaryDrawerItems;
+        return this;
+    }
+
+    private boolean mEnableSelectedMiniDrawerItemBackground = false;
+
+    /**
+     * set to true if you want to display the background for the miniDrawerItem
+     *
+     * @param enableSelectedMiniDrawerItemBackground
+     * @return
+     */
+    public MiniDrawer withEnableSelectedMiniDrawerItemBackground(boolean enableSelectedMiniDrawerItemBackground) {
+        this.mEnableSelectedMiniDrawerItemBackground = enableSelectedMiniDrawerItemBackground;
+        return this;
+    }
+
+    private boolean mEnableProfileClick = true;
+
+    /**
+     * set to false if you do not want the profile image to toggle to the normal drawers profile selection
+     *
+     * @param enableProfileClick
+     * @return this
+     */
+    public MiniDrawer withEnableProfileClick(boolean enableProfileClick) {
+        this.mEnableProfileClick = enableProfileClick;
+        return this;
+    }
+
+    private OnMiniDrawerItemClickListener mOnMiniDrawerItemClickListener;
+
+    /**
+     * Define the onMiniDrawerItemClickListener called before any logic in the MiniDrawer is run, allows you to intercept the default behavior
+     *
+     * @param onMiniDrawerItemClickListener
+     * @return this
+     */
+    public MiniDrawer withOnMiniDrawerItemClickListener(OnMiniDrawerItemClickListener onMiniDrawerItemClickListener) {
+        this.mOnMiniDrawerItemClickListener = onMiniDrawerItemClickListener;
+        return this;
+    }
+
+
+    private OnClickListener<IDrawerItem> mOnMiniDrawerItemOnClickListener;
+
+    /**
+     * Define an onClickListener for the MiniDrawer item adapter. WARNING: this will completely overwrite the default behavior
+     * You may want to check the `OnMiniDrawerItemClickListener` (withOnMiniDrawerItemClickListener) which just hooks into the default behavior
+     *
+     * @param onMiniDrawerItemOnClickListener
+     * @return this
+     */
+    public MiniDrawer withOnMiniDrawerItemOnClickListener(OnClickListener<IDrawerItem> onMiniDrawerItemOnClickListener) {
+        this.mOnMiniDrawerItemOnClickListener = onMiniDrawerItemOnClickListener;
+        return this;
+    }
+
+
+    private OnLongClickListener<IDrawerItem> mOnMiniDrawerItemLongClickListener;
+
+    /**
+     * Define an onLongClickListener for the MiniDrawer item adapter
+     *
+     * @param onMiniDrawerItemLongClickListener
+     * @return
+     */
+    public MiniDrawer withOnMiniDrawerItemLongClickListener(OnLongClickListener<IDrawerItem> onMiniDrawerItemLongClickListener) {
+        this.mOnMiniDrawerItemLongClickListener = onMiniDrawerItemLongClickListener;
+        return this;
+    }
+
+    /**
+     * get the RecyclerView of this MiniDrawer
+     *
+     * @return
+     */
+    public RecyclerView getRecyclerView() {
+        return mRecyclerView;
+    }
+
+    /**
+     * get the FastAdapter of this MiniDrawer
+     *
+     * @return
+     */
+    public FastAdapter<IDrawerItem> getAdapter() {
+        return mAdapter;
+    }
+
+    /**
+     * get the ItemAdapter of this MiniDrawer
+     *
+     * @return
+     */
+    public ItemAdapter<IDrawerItem> getItemAdapter() {
+        return mItemAdapter;
+    }
+
+    /**
+     * get the Drawer used to fill this MiniDrawer
+     *
+     * @return
+     */
+    public Drawer getDrawer() {
+        return mDrawer;
+    }
+
+    /**
+     * get the AccountHeader used to fill the this MiniDrawer
+     *
+     * @return
+     */
+    public AccountHeader getAccountHeader() {
+        return mAccountHeader;
+    }
+
+    /**
+     * get the Crossfader used for this MiniDrawer
+     *
+     * @return
+     */
+    public ICrossfader getCrossFader() {
+        return mCrossFader;
+    }
+
+
+    /**
+     * the defined FastAdapter.OnClickListener which completely replaces the original behavior
+     *
+     * @return
+     */
+    public OnClickListener getOnMiniDrawerItemOnClickListener() {
+        return mOnMiniDrawerItemOnClickListener;
+    }
+
+    /**
+     * @return
+     */
+    public OnLongClickListener getOnMiniDrawerItemLongClickListener() {
+        return mOnMiniDrawerItemLongClickListener;
+    }
+
+
+    /**
+     * generates a MiniDrawerItem from a IDrawerItem
+     *
+     * @param drawerItem
+     * @return
+     */
+    public IDrawerItem generateMiniDrawerItem(IDrawerItem drawerItem) {
+        if (drawerItem instanceof SecondaryDrawerItem) {
+            if (drawerItem.isExcludeFromMiniDrawer()) {
+                return null;
+            }
+            return mIncludeSecondaryDrawerItems ? new MiniDrawerItem((SecondaryDrawerItem) drawerItem).withEnableSelectedBackground(mEnableSelectedMiniDrawerItemBackground).withSelectedBackgroundAnimated(false) : null;
+        } else if (drawerItem instanceof PrimaryDrawerItem) {
+            if (drawerItem.isExcludeFromMiniDrawer()) {
+                return null;
+            }
+            return new MiniDrawerItem((PrimaryDrawerItem) drawerItem).withEnableSelectedBackground(mEnableSelectedMiniDrawerItemBackground).withSelectedBackgroundAnimated(false);
+        } else if (drawerItem instanceof ProfileDrawerItem) {
+            if (drawerItem.isExcludeFromMiniDrawer()) {
+                return null;
+            }
+            MiniProfileDrawerItem mpdi = new MiniProfileDrawerItem((ProfileDrawerItem) drawerItem);
+            mpdi.withEnabled(mEnableProfileClick);
+            return mpdi;
+        }
+        return null;
+    }
+
+    /**
+     * gets the type of a IDrawerItem
+     *
+     * @param drawerItem
+     * @return
+     */
+    public int getMiniDrawerType(IDrawerItem drawerItem) {
+        if (drawerItem instanceof MiniProfileDrawerItem) {
+            return PROFILE;
+        } else if (drawerItem instanceof MiniDrawerItem) {
+            return ITEM;
+        }
+        return -1;
+    }
+
+    /**
+     * build the MiniDrawer
+     *
+     * @param ctx
+     * @return
+     */
+    public View build(Context ctx) {
+        mContainer = new LinearLayout(ctx);
+        if (mInnerShadow) {
+            if (!mInRTL) {
+                mContainer.setBackgroundResource(R.drawable.material_drawer_shadow_left);
+            } else {
+                mContainer.setBackgroundResource(R.drawable.material_drawer_shadow_right);
+            }
+        }
+
+        //create and append recyclerView
+        mRecyclerView = new RecyclerView(ctx);
+        mContainer.addView(mRecyclerView, ViewGroup.LayoutParams.MATCH_PARENT, ViewGroup.LayoutParams.MATCH_PARENT);
+
+        //set the itemAnimator
+        mRecyclerView.setItemAnimator(new DefaultItemAnimator());
+        //some style improvements on older devices
+        mRecyclerView.setFadingEdgeLength(0);
+        //set the drawing cache background to the same color as the slider to improve performance
+        //mRecyclerView.setDrawingCacheBackgroundColor(UIUtils.getThemeColorFromAttrOrRes(mActivity, R.attr.material_drawer_background, R.color.material_drawer_background));
+        mRecyclerView.setClipToPadding(false);
+        //additional stuff
+        mRecyclerView.setLayoutManager(new LinearLayoutManager(ctx));
+        //adapter
+        mItemAdapter = new ItemAdapter<>();
+        mAdapter = FastAdapter.with(mItemAdapter);
+        mAdapter.withSelectable(true);
+        mAdapter.withAllowDeselection(false);
+        mRecyclerView.setAdapter(mAdapter);
+
+        //if the activity with the drawer should be fullscreen add the padding for the statusbar
+        if (mDrawer != null && mDrawer.mDrawerBuilder != null && (mDrawer.mDrawerBuilder.mFullscreen || mDrawer.mDrawerBuilder.mTranslucentStatusBar)) {
+            mRecyclerView.setPadding(mRecyclerView.getPaddingLeft(), UIUtils.getStatusBarHeight(ctx), mRecyclerView.getPaddingRight(), mRecyclerView.getPaddingBottom());
+        }
+
+        //if the activity with the drawer should be fullscreen add the padding for the navigationBar
+        if (mDrawer != null && mDrawer.mDrawerBuilder != null && (mDrawer.mDrawerBuilder.mFullscreen || mDrawer.mDrawerBuilder.mTranslucentNavigationBar) && ctx.getResources().getConfiguration().orientation == Configuration.ORIENTATION_PORTRAIT) {
+            mRecyclerView.setPadding(mRecyclerView.getPaddingLeft(), mRecyclerView.getPaddingTop(), mRecyclerView.getPaddingRight(), UIUtils.getNavigationBarHeight(ctx));
+        }
+
+        //set the adapter with the items
+        createItems();
+
+        return mContainer;
+    }
+
+    /**
+     * call this method to trigger the onProfileClick on the MiniDrawer
+     */
+    public void onProfileClick() {
+        //crossfade if we are cross faded
+        if (mCrossFader != null) {
+            if (mCrossFader.isCrossfaded()) {
+                mCrossFader.crossfade();
+            }
+        }
+
+        //update the current profile
+        if (mAccountHeader != null) {
+            IProfile profile = mAccountHeader.getActiveProfile();
+            if (profile instanceof IDrawerItem) {
+                mItemAdapter.set(0, generateMiniDrawerItem((IDrawerItem) profile));
+            }
+        }
+    }
+
+    /**
+     * call this method to trigger the onItemClick on the MiniDrawer
+     *
+     * @param selectedDrawerItem
+     * @return
+     */
+    public boolean onItemClick(IDrawerItem selectedDrawerItem) {
+        //We only need to clear if the new item is selectable
+        if (selectedDrawerItem.isSelectable()) {
+            //crossfade if we are cross faded
+            if (mCrossFader != null) {
+                if (mCrossFader.isCrossfaded()) {
+                    mCrossFader.crossfade();
+                }
+            }
+            //update everything
+            setSelection(selectedDrawerItem.getIdentifier());
+
+            return false;
+        } else {
+            return true;
+        }
+    }
+
+    /**
+     * set the selection of the MiniDrawer
+     *
+     * @param identifier the identifier of the item which should be selected (-1 for none)
+     */
+    public void setSelection(long identifier) {
+        if (identifier == -1) {
+            mAdapter.deselect();
+        }
+        int count = mAdapter.getItemCount();
+        for (int i = 0; i < count; i++) {
+            IDrawerItem item = mAdapter.getItem(i);
+            if (item.getIdentifier() == identifier && !item.isSelected()) {
+                mAdapter.deselect();
+                mAdapter.select(i);
+            }
+        }
+    }
+
+    /**
+     * update a MiniDrawerItem (after updating the main Drawer) via its identifier
+     *
+     * @param identifier the identifier of the item which was updated
+     */
+    public void updateItem(long identifier) {
+        if (mDrawer != null && mAdapter != null && mItemAdapter.getAdapterItems() != null && identifier != -1) {
+            IDrawerItem drawerItem = DrawerUtils.getDrawerItem(getDrawerItems(), identifier);
+            for (int i = 0; i < mItemAdapter.getAdapterItems().size(); i++) {
+                if (mItemAdapter.getAdapterItems().get(i).getIdentifier() == drawerItem.getIdentifier()) {
+                    IDrawerItem miniDrawerItem = generateMiniDrawerItem(drawerItem);
+                    if (miniDrawerItem != null) {
+                        mItemAdapter.set(i, miniDrawerItem);
+                    }
+                }
+            }
+        }
+    }
+
+    /**
+     * creates the items for the MiniDrawer
+     */
+    public void createItems() {
+        mItemAdapter.clear();
+
+        int profileOffset = 0;
+        if (mAccountHeader != null && mAccountHeader.getAccountHeaderBuilder().mProfileImagesVisible) {
+            IProfile profile = mAccountHeader.getActiveProfile();
+            if (profile instanceof IDrawerItem) {
+                mItemAdapter.add(generateMiniDrawerItem((IDrawerItem) profile));
+                profileOffset = 1;
+            }
+        }
+
+        int select = -1;
+        if (mDrawer != null) {
+            if (getDrawerItems() != null) {
+                //migrate to miniDrawerItems
+                int length = getDrawerItems().size();
+
+                int position = 0;
+                for (int i = 0; i < length; i++) {
+                    IDrawerItem miniDrawerItem = generateMiniDrawerItem(getDrawerItems().get(i));
+                    if (miniDrawerItem != null) {
+                        if (miniDrawerItem.isSelected()) {
+                            select = position;
+                        }
+                        mItemAdapter.add(miniDrawerItem);
+                        position = position + 1;
+                    }
+                }
+
+                if (select >= 0) {
+                    //+1 because of the profile
+                    mAdapter.select(select + profileOffset);
+                }
+            }
+        }
+
+        //listener
+        if (mOnMiniDrawerItemOnClickListener != null) {
+            mAdapter.withOnClickListener(mOnMiniDrawerItemOnClickListener);
+        } else {
+            mAdapter.withOnClickListener(new OnClickListener<IDrawerItem>() {
+                @Override
+                public boolean onClick(View v, IAdapter<IDrawerItem> adapter, final IDrawerItem item, final int position) {
+                    int type = getMiniDrawerType(item);
+
+                    //if a listener is defined and we consume the event return
+                    if (mOnMiniDrawerItemClickListener != null && mOnMiniDrawerItemClickListener.onItemClick(v, position, item, type)) {
+                        return false;
+                    }
+
+                    if (type == ITEM) {
+                        //fire the onClickListener also if the specific drawerItem is not Selectable
+                        if (item.isSelectable()) {
+                            //make sure we are on the original drawerItemList
+                            if (mAccountHeader != null && mAccountHeader.isSelectionListShown()) {
+                                mAccountHeader.toggleSelectionList(v.getContext());
+                            }
+                            IDrawerItem drawerItem = mDrawer.getDrawerItem(item.getIdentifier());
+                            if (drawerItem != null && !drawerItem.isSelected()) {
+                                //set the selection
+                                mDrawer.setSelection(item, true);
+                            }
+                        } else if (mDrawer.getOnDrawerItemClickListener() != null) {
+                            //get the original `DrawerItem` from the Drawer as this one will contain all information
+                            mDrawer.getOnDrawerItemClickListener().onItemClick(v, position, DrawerUtils.getDrawerItem(getDrawerItems(), item.getIdentifier()));
+                        }
+                    } else if (type == PROFILE) {
+                        if (mAccountHeader != null && !mAccountHeader.isSelectionListShown()) {
+                            mAccountHeader.toggleSelectionList(v.getContext());
+                        }
+                        if (mCrossFader != null) {
+                            mCrossFader.crossfade();
+                        }
+                    }
+                    return false;
+                }
+            });
+        }
+        mAdapter.withOnLongClickListener(mOnMiniDrawerItemLongClickListener);
+        mRecyclerView.scrollToPosition(0);
+    }
+
+    /**
+     * returns always the original drawerItems and not the switched content
+     *
+     * @return
+     */
+    private List<IDrawerItem> getDrawerItems() {
+        return mDrawer.getOriginalDrawerItems() != null ? mDrawer.getOriginalDrawerItems() : mDrawer.getDrawerItems();
+    }
+
+
+    public interface OnMiniDrawerItemClickListener {
+        /**
+         * @param view
+         * @param position
+         * @param drawerItem
+         * @param type       either MiniDrawer.PROFILE or MiniDrawer.ITEM
+         * @return true if the event was consumed
+         */
+        boolean onItemClick(View view, int position, IDrawerItem drawerItem, int type);
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/holder/BadgeStyle.java

@@ -0,0 +1,232 @@
+package com.mikepenz.materialdrawer.holder;
+
+import android.content.Context;
+import android.content.res.ColorStateList;
+import android.graphics.drawable.Drawable;
+import android.widget.TextView;
+
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.model.utils.BadgeDrawableBuilder;
+
+import androidx.annotation.ColorInt;
+import androidx.annotation.ColorRes;
+import androidx.annotation.DimenRes;
+import androidx.annotation.Dimension;
+import androidx.annotation.DrawableRes;
+import androidx.core.view.ViewCompat;
+
+import static androidx.annotation.Dimension.DP;
+import static androidx.annotation.Dimension.PX;
+
+/**
+ * Class to allow defining a BadgeStyle for the `BadgeDrawerItem`
+ */
+public class BadgeStyle {
+    private int mGradientDrawable = R.drawable.material_drawer_badge;
+    private Drawable mBadgeBackground;
+    private ColorHolder mColor;
+    private ColorHolder mColorPressed;
+    private ColorHolder mTextColor;
+    private ColorStateList mTextColorStateList;
+    private DimenHolder mCorners;
+    private DimenHolder mPaddingTopBottom = DimenHolder.fromDp(2); //2 looks best
+    private DimenHolder mPaddingLeftRight = DimenHolder.fromDp(3); //3 looks best
+    private DimenHolder mMinWidth = DimenHolder.fromDp(20); //20 looks nice
+
+    public int getGradientDrawable() {
+        return mGradientDrawable;
+    }
+
+    public BadgeStyle withGradientDrawable(@DrawableRes int gradientDrawable) {
+        this.mGradientDrawable = gradientDrawable;
+        this.mBadgeBackground = null;
+        return this;
+    }
+
+    public Drawable getBadgeBackground() {
+        return mBadgeBackground;
+    }
+
+    public BadgeStyle withBadgeBackground(Drawable badgeBackground) {
+        this.mBadgeBackground = badgeBackground;
+        this.mGradientDrawable = -1;
+        return this;
+    }
+
+    public ColorHolder getColor() {
+        return mColor;
+    }
+
+    public BadgeStyle withColor(@ColorInt int color) {
+        this.mColor = ColorHolder.fromColor(color);
+        return this;
+    }
+
+    public BadgeStyle withColorRes(@ColorRes int color) {
+        this.mColor = ColorHolder.fromColorRes(color);
+        return this;
+    }
+
+    public ColorHolder getColorPressed() {
+        return mColorPressed;
+    }
+
+    public BadgeStyle withColorPressed(@ColorInt int colorPressed) {
+        this.mColorPressed = ColorHolder.fromColor(colorPressed);
+        return this;
+    }
+
+    public BadgeStyle withColorPressedRes(@ColorRes int colorPressed) {
+        this.mColorPressed = ColorHolder.fromColorRes(colorPressed);
+        return this;
+    }
+
+    public ColorHolder getTextColor() {
+        return mTextColor;
+    }
+
+    public BadgeStyle withTextColor(@ColorInt int textColor) {
+        this.mTextColor = ColorHolder.fromColor(textColor);
+        return this;
+    }
+
+    public BadgeStyle withTextColorRes(@ColorRes int textColor) {
+        this.mTextColor = ColorHolder.fromColorRes(textColor);
+        return this;
+    }
+
+    public BadgeStyle withTextColorStateList(ColorStateList textColorStateList) {
+        this.mTextColor = null;
+        this.mTextColorStateList = textColorStateList;
+        return this;
+    }
+
+    public DimenHolder getCorners() {
+        return mCorners;
+    }
+
+    public BadgeStyle withCorners(@Dimension(unit = PX) int cornersPx) {
+        this.mCorners = DimenHolder.fromPixel(cornersPx);
+        return this;
+    }
+
+    public BadgeStyle withCornersDp(@Dimension(unit = DP) int corners) {
+        this.mCorners = DimenHolder.fromDp(corners);
+        return this;
+    }
+
+    public BadgeStyle withCorners(DimenHolder corners) {
+        this.mCorners = corners;
+        return this;
+    }
+
+    public DimenHolder getPaddingLeftRight() {
+        return mPaddingLeftRight;
+    }
+
+    public BadgeStyle withPaddingLeftRightPx(@Dimension(unit = PX) int paddingLeftRight) {
+        this.mPaddingLeftRight = DimenHolder.fromPixel(paddingLeftRight);
+        return this;
+    }
+
+    public BadgeStyle withPaddingLeftRightDp(@Dimension(unit = DP) int paddingLeftRight) {
+        this.mPaddingLeftRight = DimenHolder.fromDp(paddingLeftRight);
+        return this;
+    }
+
+    public BadgeStyle withPaddingLeftRightRes(@DimenRes int paddingLeftRight) {
+        this.mPaddingLeftRight = DimenHolder.fromResource(paddingLeftRight);
+        return this;
+    }
+
+    public DimenHolder getPaddingTopBottom() {
+        return mPaddingTopBottom;
+    }
+
+    public BadgeStyle withPaddingTopBottomPx(@Dimension(unit = PX) int paddingTopBottom) {
+        this.mPaddingTopBottom = DimenHolder.fromPixel(paddingTopBottom);
+        return this;
+    }
+
+    public BadgeStyle withPaddingTopBottomDp(@Dimension(unit = DP) int paddingTopBottom) {
+        this.mPaddingTopBottom = DimenHolder.fromDp(paddingTopBottom);
+        return this;
+    }
+
+    public BadgeStyle withPaddingTopBottomRes(@DimenRes int paddingTopBottom) {
+        this.mPaddingTopBottom = DimenHolder.fromResource(paddingTopBottom);
+        return this;
+    }
+
+    public BadgeStyle withPadding(@Dimension(unit = PX) int padding) {
+        this.mPaddingLeftRight = DimenHolder.fromPixel(padding);
+        this.mPaddingTopBottom = DimenHolder.fromPixel(padding);
+        return this;
+    }
+
+    public BadgeStyle withPadding(DimenHolder padding) {
+        this.mPaddingLeftRight = padding;
+        this.mPaddingTopBottom = padding;
+        return this;
+    }
+
+    public DimenHolder getMinWidth() {
+        return mMinWidth;
+    }
+
+    public BadgeStyle withMinWidth(@Dimension(unit = PX) int minWidth) {
+        this.mMinWidth = DimenHolder.fromPixel(minWidth);
+        return this;
+    }
+
+    public BadgeStyle withMinWidth(DimenHolder minWidth) {
+        this.mMinWidth = minWidth;
+        return this;
+    }
+
+    public BadgeStyle() {
+    }
+
+    public BadgeStyle(@ColorInt int color, @ColorInt int colorPressed) {
+        this.mColor = ColorHolder.fromColor(color);
+        this.mColorPressed = ColorHolder.fromColor(colorPressed);
+    }
+
+    public BadgeStyle(@DrawableRes int gradientDrawable, @ColorInt int color, @ColorInt int colorPressed, @ColorInt int textColor) {
+        this.mGradientDrawable = gradientDrawable;
+        this.mColor = ColorHolder.fromColor(color);
+        this.mColorPressed = ColorHolder.fromColor(colorPressed);
+        this.mTextColor = ColorHolder.fromColor(textColor);
+    }
+
+    public void style(TextView badgeTextView) {
+        style(badgeTextView, null);
+    }
+
+    public void style(TextView badgeTextView, ColorStateList colorStateList) {
+        Context ctx = badgeTextView.getContext();
+        //set background for badge
+        if (mBadgeBackground == null) {
+            ViewCompat.setBackground(badgeTextView, new BadgeDrawableBuilder(this).build(ctx));
+        } else {
+            ViewCompat.setBackground(badgeTextView, mBadgeBackground);
+        }
+
+        //set the badge text color
+        if (mTextColor != null) {
+            ColorHolder.applyToOr(mTextColor, badgeTextView, null);
+        } else if (mTextColorStateList != null) {
+            badgeTextView.setTextColor(mTextColorStateList);
+        } else if (colorStateList != null) {
+            badgeTextView.setTextColor(colorStateList);
+        }
+
+        //set the padding
+        int paddingLeftRight = mPaddingLeftRight.asPixel(ctx);
+        int paddingTopBottom = mPaddingTopBottom.asPixel(ctx);
+        badgeTextView.setPadding(paddingLeftRight, paddingTopBottom, paddingLeftRight, paddingTopBottom);
+
+        //set the min width
+        badgeTextView.setMinWidth(mMinWidth.asPixel(ctx));
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/holder/ColorHolder.java

@@ -0,0 +1,25 @@
+package com.mikepenz.materialdrawer.holder;
+
+import androidx.annotation.ColorInt;
+import androidx.annotation.ColorRes;
+
+/**
+ * Created by mikepenz on 13.07.15.
+ */
+public class ColorHolder extends com.mikepenz.materialize.holder.ColorHolder {
+    public ColorHolder() {
+    }
+
+    public static ColorHolder fromColorRes(@ColorRes int colorRes) {
+        ColorHolder colorHolder = new ColorHolder();
+        colorHolder.setColorRes(colorRes);
+        return colorHolder;
+    }
+
+    public static ColorHolder fromColor(@ColorInt int colorInt) {
+        ColorHolder colorHolder = new ColorHolder();
+        colorHolder.setColorInt(colorInt);
+        return colorHolder;
+    }
+
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/holder/DimenHolder.java

@@ -0,0 +1,34 @@
+package com.mikepenz.materialdrawer.holder;
+
+import androidx.annotation.DimenRes;
+import androidx.annotation.Dimension;
+
+import static androidx.annotation.Dimension.DP;
+import static androidx.annotation.Dimension.PX;
+
+/**
+ * Created by mikepenz on 13.07.15.
+ */
+public class DimenHolder extends com.mikepenz.materialize.holder.DimenHolder {
+    public DimenHolder() {
+
+    }
+
+    public static DimenHolder fromPixel(@Dimension(unit = PX) int pixel) {
+        DimenHolder dimenHolder = new DimenHolder();
+        dimenHolder.setPixel(pixel);
+        return dimenHolder;
+    }
+
+    public static DimenHolder fromDp(@Dimension(unit = DP) int dp) {
+        DimenHolder dimenHolder = new DimenHolder();
+        dimenHolder.setDp(dp);
+        return dimenHolder;
+    }
+
+    public static DimenHolder fromResource(@DimenRes int resource) {
+        DimenHolder dimenHolder = new DimenHolder();
+        dimenHolder.setResource(resource);
+        return dimenHolder;
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/holder/ImageHolder.java

@@ -0,0 +1,165 @@
+package com.mikepenz.materialdrawer.holder;
+
+import android.content.Context;
+import android.graphics.Bitmap;
+import android.graphics.PorterDuff;
+import android.graphics.drawable.Drawable;
+import android.net.Uri;
+import androidx.annotation.DrawableRes;
+import androidx.appcompat.content.res.AppCompatResources;
+import android.view.View;
+import android.widget.ImageView;
+
+import com.mikepenz.iconics.IconicsDrawable;
+import com.mikepenz.iconics.typeface.IIcon;
+import com.mikepenz.materialdrawer.util.DrawerImageLoader;
+
+import java.io.FileNotFoundException;
+import java.io.InputStream;
+
+/**
+ * Created by mikepenz on 13.07.15.
+ */
+
+public class ImageHolder extends com.mikepenz.materialize.holder.ImageHolder {
+    private IIcon mIIcon;
+
+    public ImageHolder(String url) {
+        super(url);
+    }
+
+    public ImageHolder(Uri uri) {
+        super(uri);
+    }
+
+    public ImageHolder(Drawable icon) {
+        super(icon);
+    }
+
+    public ImageHolder(Bitmap bitmap) {
+        super(bitmap);
+    }
+
+    public ImageHolder(@DrawableRes int iconRes) {
+        super(iconRes);
+    }
+
+    public ImageHolder(IIcon iicon) {
+        super((Bitmap) null);
+        this.mIIcon = iicon;
+    }
+
+    public IIcon getIIcon() {
+        return mIIcon;
+    }
+
+    public void setIIcon(IIcon mIIcon) {
+        this.mIIcon = mIIcon;
+    }
+
+    /**
+     * sets an existing image to the imageView
+     *
+     * @param imageView
+     * @param tag       used to identify imageViews and define different placeholders
+     * @return true if an image was set
+     */
+    @Override
+    public boolean applyTo(ImageView imageView, String tag) {
+        if (getUri() != null) {
+            boolean consumed = DrawerImageLoader.getInstance().setImage(imageView, getUri(), tag);
+            if (!consumed) {
+                imageView.setImageURI(getUri());
+            }
+        } else if (getIcon() != null) {
+            imageView.setImageDrawable(getIcon());
+        } else if (getBitmap() != null) {
+            imageView.setImageBitmap(getBitmap());
+        } else if (getIconRes() != -1) {
+            imageView.setImageResource(getIconRes());
+        } else if (mIIcon != null) {
+            imageView.setImageDrawable(new IconicsDrawable(imageView.getContext(), mIIcon).actionBar());
+        } else {
+            imageView.setImageBitmap(null);
+            return false;
+        }
+        return true;
+    }
+
+    /**
+     * this only handles Drawables
+     *
+     * @param ctx
+     * @param iconColor
+     * @param tint
+     * @return
+     */
+    public Drawable decideIcon(Context ctx, int iconColor, boolean tint, int paddingDp) {
+        Drawable icon = getIcon();
+
+        if (mIIcon != null) {
+            icon = new IconicsDrawable(ctx, mIIcon).color(iconColor).sizeDp(24).paddingDp(paddingDp);
+        } else if (getIconRes() != -1) {
+            icon = AppCompatResources.getDrawable(ctx, getIconRes());
+        } else if (getUri() != null) {
+            try {
+                InputStream inputStream = ctx.getContentResolver().openInputStream(getUri());
+                icon = Drawable.createFromStream(inputStream, getUri().toString());
+            } catch (FileNotFoundException e) {
+                //no need to handle this
+            }
+        }
+
+        //if we got an icon AND we have auto tinting enabled AND it is no IIcon, tint it ;)
+        if (icon != null && tint && mIIcon == null) {
+            icon = icon.mutate();
+            icon.setColorFilter(iconColor, PorterDuff.Mode.SRC_IN);
+        }
+
+        return icon;
+    }
+
+    /**
+     * a small static helper which catches nulls for us
+     *
+     * @param imageHolder
+     * @param ctx
+     * @param iconColor
+     * @param tint
+     * @return
+     */
+    public static Drawable decideIcon(ImageHolder imageHolder, Context ctx, int iconColor, boolean tint, int paddingDp) {
+        if (imageHolder == null) {
+            return null;
+        } else {
+            return imageHolder.decideIcon(ctx, iconColor, tint, paddingDp);
+        }
+    }
+
+    /**
+     * decides which icon to apply or hide this view
+     *
+     * @param imageHolder
+     * @param imageView
+     * @param iconColor
+     * @param tint
+     * @param paddingDp
+     */
+    public static void applyDecidedIconOrSetGone(ImageHolder imageHolder, ImageView imageView, int iconColor, boolean tint, int paddingDp) {
+        if (imageHolder != null && imageView != null) {
+            Drawable drawable = ImageHolder.decideIcon(imageHolder, imageView.getContext(), iconColor, tint, paddingDp);
+            if (drawable != null) {
+                imageView.setImageDrawable(drawable);
+                imageView.setVisibility(View.VISIBLE);
+            } else if (imageHolder.getBitmap() != null) {
+                imageView.setImageBitmap(imageHolder.getBitmap());
+                imageView.setVisibility(View.VISIBLE);
+            } else {
+                imageView.setVisibility(View.GONE);
+            }
+        } else if (imageView != null) {
+            imageView.setVisibility(View.GONE);
+        }
+    }
+
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/holder/StringHolder.java

@@ -0,0 +1,16 @@
+package com.mikepenz.materialdrawer.holder;
+
+import androidx.annotation.StringRes;
+
+/**
+ * Created by mikepenz on 13.07.15.
+ */
+public class StringHolder extends com.mikepenz.materialize.holder.StringHolder {
+    public StringHolder(CharSequence text) {
+        super(text);
+    }
+
+    public StringHolder(@StringRes int textRes) {
+        super(textRes);
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/icons/MaterialDrawerFont.java

@@ -0,0 +1,145 @@
+package com.mikepenz.materialdrawer.icons;
+
+import android.content.Context;
+import android.graphics.Typeface;
+
+import com.mikepenz.iconics.typeface.IIcon;
+import com.mikepenz.iconics.typeface.ITypeface;
+
+import java.util.Collection;
+import java.util.HashMap;
+import java.util.LinkedList;
+
+/**
+ * Created by mikepenz on 01.11.14.
+ */
+public class MaterialDrawerFont implements ITypeface {
+    private static final String TTF_FILE = "materialdrawerfont-font-v5.0.0.ttf";
+
+    private static Typeface typeface = null;
+
+    private static HashMap<String, Character> mChars;
+
+    @Override
+    public IIcon getIcon(String key) {
+        return Icon.valueOf(key);
+    }
+
+    @Override
+    public HashMap<String, Character> getCharacters() {
+        if (mChars == null) {
+            HashMap<String, Character> aChars = new HashMap<String, Character>();
+            for (Icon v : Icon.values()) {
+                aChars.put(v.name(), v.character);
+            }
+            mChars = aChars;
+        }
+
+        return mChars;
+    }
+
+    @Override
+    public String getMappingPrefix() {
+        return "mdf";
+    }
+
+    @Override
+    public String getFontName() {
+        return "MaterialDrawerFont";
+    }
+
+    @Override
+    public String getVersion() {
+        return "5.0.0";
+    }
+
+    @Override
+    public int getIconCount() {
+        return mChars.size();
+    }
+
+    @Override
+    public Collection<String> getIcons() {
+        Collection<String> icons = new LinkedList<String>();
+
+        for (Icon value : Icon.values()) {
+            icons.add(value.name());
+        }
+
+        return icons;
+    }
+
+
+    @Override
+    public String getAuthor() {
+        return "";
+    }
+
+    @Override
+    public String getUrl() {
+        return "";
+    }
+
+    @Override
+    public String getDescription() {
+        return "";
+    }
+
+    @Override
+    public String getLicense() {
+        return "";
+    }
+
+    @Override
+    public String getLicenseUrl() {
+        return "";
+    }
+
+    @Override
+    public Typeface getTypeface(Context context) {
+        if (typeface == null) {
+            try {
+                typeface = Typeface.createFromAsset(context.getAssets(), "fonts/" + TTF_FILE);
+            } catch (Exception e) {
+                return null;
+            }
+        }
+        return typeface;
+    }
+
+    public enum Icon implements IIcon {
+        mdf_arrow_drop_down('\ue5c5'),
+        mdf_arrow_drop_up('\ue5c7'),
+        mdf_expand_less('\ue5ce'),
+        mdf_expand_more('\ue5cf'),
+        mdf_person('\ue7fd');
+
+        char character;
+
+        Icon(char character) {
+            this.character = character;
+        }
+
+        public String getFormattedName() {
+            return "{" + name() + "}";
+        }
+
+        public char getCharacter() {
+            return character;
+        }
+
+        public String getName() {
+            return name();
+        }
+
+        // remember the typeface so we can use it later
+        private static ITypeface typeface;
+
+        public ITypeface getTypeface() {
+            if (typeface == null) {
+                typeface = new MaterialDrawerFont();
+            }
+            return typeface;
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/interfaces/ICrossfader.java

@@ -0,0 +1,10 @@
+package com.mikepenz.materialdrawer.interfaces;
+
+/**
+ * Created by mikepenz on 18.07.15.
+ */
+public interface ICrossfader {
+    void crossfade();
+
+    boolean isCrossfaded();
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/interfaces/OnCheckedChangeListener.java

@@ -0,0 +1,19 @@
+package com.mikepenz.materialdrawer.interfaces;
+
+import android.widget.CompoundButton;
+
+import com.mikepenz.materialdrawer.model.interfaces.IDrawerItem;
+
+/**
+ * Interface definition for a callback to be invoked when the checked state
+ * of a compound button changed.
+ */
+public interface OnCheckedChangeListener {
+    /**
+     * Called when the checked state of a compound button has changed.
+     *
+     * @param buttonView The compound button view whose state has changed.
+     * @param isChecked  The new checked state of buttonView.
+     */
+    void onCheckedChanged(IDrawerItem drawerItem, CompoundButton buttonView, boolean isChecked);
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/AbstractBadgeableDrawerItem.java

@@ -0,0 +1,107 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import androidx.annotation.LayoutRes;
+import androidx.annotation.StringRes;
+import android.view.View;
+import android.widget.TextView;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.BadgeStyle;
+import com.mikepenz.materialdrawer.holder.StringHolder;
+import com.mikepenz.materialdrawer.model.interfaces.ColorfulBadgeable;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public abstract class AbstractBadgeableDrawerItem<Item extends AbstractBadgeableDrawerItem> extends BaseDescribeableDrawerItem<Item, AbstractBadgeableDrawerItem.ViewHolder> implements ColorfulBadgeable<Item> {
+    protected StringHolder mBadge;
+    protected BadgeStyle mBadgeStyle = new BadgeStyle();
+
+    @Override
+    public Item withBadge(StringHolder badge) {
+        this.mBadge = badge;
+        return (Item) this;
+    }
+
+    @Override
+    public Item withBadge(String badge) {
+        this.mBadge = new StringHolder(badge);
+        return (Item) this;
+    }
+
+    @Override
+    public Item withBadge(@StringRes int badgeRes) {
+        this.mBadge = new StringHolder(badgeRes);
+        return (Item) this;
+    }
+
+    @Override
+    public Item withBadgeStyle(BadgeStyle badgeStyle) {
+        this.mBadgeStyle = badgeStyle;
+        return (Item) this;
+    }
+
+    public StringHolder getBadge() {
+        return mBadge;
+    }
+
+    public BadgeStyle getBadgeStyle() {
+        return mBadgeStyle;
+    }
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_primary;/*"PRIMARY_ITEM"*/
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_primary;
+    }
+
+    @Override
+    public void bindView(ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        Context ctx = viewHolder.itemView.getContext();
+        //bind the basic view parts
+        bindViewHelper(viewHolder);
+
+        //set the text for the badge or hide
+        boolean badgeVisible = StringHolder.applyToOrHide(mBadge, viewHolder.badge);
+        //style the badge if it is visible
+        if (badgeVisible) {
+            mBadgeStyle.style(viewHolder.badge, getTextColorStateList(getColor(ctx), getSelectedTextColor(ctx)));
+            viewHolder.badgeContainer.setVisibility(View.VISIBLE);
+        } else {
+            viewHolder.badgeContainer.setVisibility(View.GONE);
+        }
+
+        //define the typeface for our textViews
+        if (getTypeface() != null) {
+            viewHolder.badge.setTypeface(getTypeface());
+        }
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends BaseViewHolder {
+        private View badgeContainer;
+        private TextView badge;
+
+        public ViewHolder(View view) {
+            super(view);
+            this.badgeContainer = view.findViewById(R.id.material_drawer_badge_container);
+            this.badge = (TextView) view.findViewById(R.id.material_drawer_badge);
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/AbstractDrawerItem.java

@@ -0,0 +1,449 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import android.view.LayoutInflater;
+import android.view.View;
+import android.view.ViewGroup;
+
+import com.mikepenz.materialdrawer.Drawer;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.model.interfaces.IDrawerItem;
+import com.mikepenz.materialdrawer.model.interfaces.OnPostBindViewListener;
+import com.mikepenz.materialdrawer.model.interfaces.Selectable;
+import com.mikepenz.materialdrawer.model.interfaces.Tagable;
+
+import java.util.ArrayList;
+import java.util.Collections;
+import java.util.List;
+
+import androidx.annotation.CallSuper;
+import androidx.recyclerview.widget.RecyclerView;
+
+/**
+ * Created by mikepenz on 14.07.15.
+ */
+public abstract class AbstractDrawerItem<T, VH extends RecyclerView.ViewHolder> implements IDrawerItem<T, VH>, Selectable<T>, Tagable<T> {
+
+    protected boolean mExcludeFromMiniDrawer = false;
+
+    @Override
+    public boolean isExcludeFromMiniDrawer() {
+        return mExcludeFromMiniDrawer;
+    }
+
+    // the identifier for this item
+    protected long mIdentifier = -1;
+
+    /**
+     * set the identifier of this item
+     *
+     * @param identifier
+     * @return
+     */
+    public T withIdentifier(long identifier) {
+        this.mIdentifier = identifier;
+        return (T) this;
+    }
+
+    /**
+     * returns the identifier of this item
+     * -1 is the default not set state
+     *
+     * @return
+     */
+    @Override
+    public long getIdentifier() {
+        return mIdentifier;
+    }
+
+    // the tag for this item
+    protected Object mTag;
+
+    /**
+     * set the tag of this item
+     *
+     * @param object
+     * @return
+     */
+    public T withTag(Object object) {
+        this.mTag = object;
+        return (T) this;
+    }
+
+    /**
+     * @return the tag of this item
+     */
+    @Override
+    public Object getTag() {
+        return mTag;
+    }
+
+    // defines if this item is enabled
+    protected boolean mEnabled = true;
+
+    /**
+     * set if this item is enabled
+     *
+     * @param enabled true if this item is enabled
+     * @return
+     */
+    public T withEnabled(boolean enabled) {
+        this.mEnabled = enabled;
+        return (T) this;
+    }
+
+    /**
+     * @return if this item is enabled
+     */
+    @Override
+    public boolean isEnabled() {
+        return mEnabled;
+    }
+
+    // defines if the item is selected
+    protected boolean mSelected = false;
+
+    /**
+     * set if this item is selected
+     *
+     * @param selected true if this item is selected
+     * @return
+     */
+    @Override
+    public T withSetSelected(boolean selected) {
+        this.mSelected = selected;
+        return (T) this;
+    }
+
+    /**
+     * @return if this item is selected
+     */
+    @Override
+    public boolean isSelected() {
+        return mSelected;
+    }
+
+    // defines if this item is selectable
+    protected boolean mSelectable = true;
+
+    /**
+     * set if this item is selectable
+     *
+     * @param selectable true if this item is selectable
+     * @return
+     */
+    @Override
+    public T withSelectable(boolean selectable) {
+        this.mSelectable = selectable;
+        return (T) this;
+    }
+
+    /**
+     * @return if this item is selectable
+     */
+    @Override
+    public boolean isSelectable() {
+        return mSelectable;
+    }
+
+    // defines if the item's background' change should be animated when it is (de)selected
+    protected boolean mSelectedBackgroundAnimated = true;
+
+    /**
+     * set if this item is selectable
+     *
+     * @param selectedBackgroundAnimated true if this item's background should fade when it is (de) selected
+     * @return
+     */
+    public T withSelectedBackgroundAnimated(boolean selectedBackgroundAnimated) {
+        this.mSelectedBackgroundAnimated = selectedBackgroundAnimated;
+        return (T) this;
+    }
+
+    /**
+     * @return if this item is selectable
+     */
+    public boolean isSelectedBackgroundAnimated() {
+        return mSelectedBackgroundAnimated;
+    }
+
+    public Drawer.OnDrawerItemClickListener mOnDrawerItemClickListener = null;
+
+    public Drawer.OnDrawerItemClickListener getOnDrawerItemClickListener() {
+        return mOnDrawerItemClickListener;
+    }
+
+    /**
+     * this listener is called when an item is clicked in the drawer.
+     * WARNING: don't overwrite this in the Switch / Toggle drawerItems if you want the toggle / switch to be selected
+     * if the item is clicked and the item is not selectable.
+     *
+     * @param onDrawerItemClickListener
+     * @return
+     */
+    public T withOnDrawerItemClickListener(Drawer.OnDrawerItemClickListener onDrawerItemClickListener) {
+        this.mOnDrawerItemClickListener = onDrawerItemClickListener;
+        return (T) this;
+    }
+
+    protected OnPostBindViewListener mOnPostBindViewListener = null;
+
+    public OnPostBindViewListener getOnPostBindViewListener() {
+        return mOnPostBindViewListener;
+    }
+
+    /**
+     * add this listener and hook in if you want to modify a drawerItems view without creating a custom drawer item
+     *
+     * @param onPostBindViewListener
+     * @return
+     */
+    public T withPostOnBindViewListener(OnPostBindViewListener onPostBindViewListener) {
+        this.mOnPostBindViewListener = onPostBindViewListener;
+        return (T) this;
+    }
+
+    /**
+     * is called after bindView to allow some post creation setps
+     *
+     * @param drawerItem the drawerItem which is bound to the view
+     * @param view       the currently view which will be bound
+     */
+    public void onPostBindView(IDrawerItem drawerItem, View view) {
+        if (mOnPostBindViewListener != null) {
+            mOnPostBindViewListener.onBindView(drawerItem, view);
+        }
+    }
+
+    // the parent of this item
+    private IDrawerItem mParent;
+
+    /**
+     * @return the parent of this item
+     */
+    @Override
+    public IDrawerItem getParent() {
+        return mParent;
+    }
+
+    /**
+     * the parent for this item
+     *
+     * @param parent it's parent
+     * @return this
+     */
+    @Override
+    public IDrawerItem withParent(IDrawerItem parent) {
+        this.mParent = parent;
+        return this;
+    }
+
+    // the subItems to expand for this item
+    protected List<IDrawerItem> mSubItems;
+
+    /**
+     * a list of subItems
+     * **WARNING** Make sure the subItems provided already have identifiers
+     *
+     * @param subItems
+     * @return
+     */
+    public T withSubItems(List<IDrawerItem> subItems) {
+        this.mSubItems = subItems;
+        for (IDrawerItem subItem : subItems) {
+            subItem.withParent(this);
+        }
+        return (T) this;
+    }
+
+    /**
+     * an array of subItems
+     * **WARNING** Make sure the subItems provided already have identifiers
+     *
+     * @param subItems
+     * @return
+     */
+    public T withSubItems(IDrawerItem... subItems) {
+        if (mSubItems == null) {
+            mSubItems = new ArrayList<>();
+        }
+        for (IDrawerItem subItem : subItems) {
+            subItem.withParent(this);
+        }
+        Collections.addAll(mSubItems, subItems);
+        return (T) this;
+    }
+
+    /**
+     * @return the subItems for this item
+     */
+    @Override
+    public List<IDrawerItem> getSubItems() {
+        return mSubItems;
+    }
+
+    //if the this item is currently expanded
+    private boolean mExpanded = false;
+
+    /**
+     * @param expanded defines if this item is now expanded or not
+     * @return this
+     */
+    @Override
+    public T withIsExpanded(boolean expanded) {
+        mExpanded = expanded;
+        return (T) this;
+    }
+
+    /**
+     * @return if this item is currently expaneded
+     */
+    @Override
+    public boolean isExpanded() {
+        return mExpanded;
+    }
+
+
+    /**
+     * overwrite this method and return true if the item should auto expand on click, false if you want to disable this
+     *
+     * @return true if this item should auto expand in the adapter
+     */
+    @Override
+    public boolean isAutoExpanding() {
+        return true;
+    }
+
+    /**
+     * generates a view by the defined LayoutRes
+     *
+     * @param ctx
+     * @return
+     */
+    @Override
+    public View generateView(Context ctx) {
+        VH viewHolder = getViewHolder(LayoutInflater.from(ctx).inflate(getLayoutRes(), null, false));
+        bindView(viewHolder, Collections.emptyList());
+        return viewHolder.itemView;
+    }
+
+    /**
+     * generates a view by the defined LayoutRes and pass the LayoutParams from the parent
+     *
+     * @param ctx
+     * @param parent
+     * @return
+     */
+    @Override
+    public View generateView(Context ctx, ViewGroup parent) {
+        VH viewHolder = getViewHolder(LayoutInflater.from(ctx).inflate(getLayoutRes(), parent, false));
+        bindView(viewHolder, Collections.emptyList());
+        return viewHolder.itemView;
+    }
+
+    @CallSuper
+    @Override
+    public void bindView(VH holder, List<Object> payloads) {
+        holder.itemView.setTag(R.id.material_drawer_item, this);
+    }
+
+    /**
+     * called when the view is unbound
+     *
+     * @param holder
+     */
+    @Override
+    public void unbindView(VH holder) {
+        holder.itemView.clearAnimation();
+    }
+
+    /**
+     * View got attached to the window
+     *
+     * @param holder
+     */
+    @Override
+    public void attachToWindow(VH holder) {
+
+    }
+
+    /**
+     * View got detached from the window
+     *
+     * @param holder
+     */
+    @Override
+    public void detachFromWindow(VH holder) {
+
+    }
+
+    /**
+     * is called when the ViewHolder is in a transient state. return true if you want to reuse
+     * that view anyways
+     *
+     * @param holder the viewHolder for the view which failed to recycle
+     * @return true if we want to recycle anyways (false - it get's destroyed)
+     */
+    @Override
+    public boolean failedToRecycle(VH holder) {
+        return false;
+    }
+
+    /**
+     * This method returns the ViewHolder for our item, using the provided View.
+     *
+     * @param parent
+     * @return the ViewHolder for this Item
+     */
+    @Override
+    public VH getViewHolder(ViewGroup parent) {
+        return getViewHolder(LayoutInflater.from(parent.getContext()).inflate(getLayoutRes(), parent, false));
+    }
+
+    /**
+     * This method returns the ViewHolder for our item, using the provided View.
+     *
+     * @param v
+     * @return the ViewHolder for this Item
+     */
+    public abstract VH getViewHolder(View v);
+
+    /**
+     * If this item equals to the given identifier
+     *
+     * @param id
+     * @return
+     */
+    @Override
+    public boolean equals(long id) {
+        return id == mIdentifier;
+    }
+
+    public boolean equals(int id) {
+        return id == mIdentifier;
+    }
+
+    /**
+     * If this item equals to the given object
+     *
+     * @param o
+     * @return
+     */
+    @Override
+    public boolean equals(Object o) {
+        if (this == o) return true;
+        if (o == null || getClass() != o.getClass()) return false;
+        AbstractDrawerItem<?, ?> that = (AbstractDrawerItem<?, ?>) o;
+        return mIdentifier == that.mIdentifier;
+    }
+
+    /**
+     * the hashCode implementation
+     *
+     * @return
+     */
+    @Override
+    public int hashCode() {
+        return Long.valueOf(mIdentifier).hashCode();
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/AbstractSwitchableDrawerItem.java

@@ -0,0 +1,126 @@
+package com.mikepenz.materialdrawer.model;
+
+import androidx.annotation.LayoutRes;
+import androidx.appcompat.widget.SwitchCompat;
+import android.view.View;
+import android.widget.CompoundButton;
+
+import com.mikepenz.materialdrawer.Drawer;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.interfaces.OnCheckedChangeListener;
+import com.mikepenz.materialdrawer.model.interfaces.IDrawerItem;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public abstract class AbstractSwitchableDrawerItem<Item extends AbstractSwitchableDrawerItem> extends BaseDescribeableDrawerItem<Item, AbstractSwitchableDrawerItem.ViewHolder> {
+
+    private boolean switchEnabled = true;
+
+    private boolean checked = false;
+    private OnCheckedChangeListener onCheckedChangeListener = null;
+
+    public Item withChecked(boolean checked) {
+        this.checked = checked;
+        return (Item) this;
+    }
+
+    public Item withSwitchEnabled(boolean switchEnabled) {
+        this.switchEnabled = switchEnabled;
+        return (Item) this;
+    }
+
+    public Item withOnCheckedChangeListener(OnCheckedChangeListener onCheckedChangeListener) {
+        this.onCheckedChangeListener = onCheckedChangeListener;
+        return (Item) this;
+    }
+
+    public Item withCheckable(boolean checkable) {
+        return withSelectable(checkable);
+    }
+
+    public boolean isChecked() {
+        return checked;
+    }
+
+    public boolean isSwitchEnabled() {
+        return switchEnabled;
+    }
+
+    public OnCheckedChangeListener getOnCheckedChangeListener() {
+        return onCheckedChangeListener;
+    }
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_primary_switch;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_switch;
+    }
+
+    @Override
+    public void bindView(final ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        //bind the basic view parts
+        bindViewHelper(viewHolder);
+
+        //handle the switch
+        viewHolder.switchView.setOnCheckedChangeListener(null);
+        viewHolder.switchView.setChecked(checked);
+        viewHolder.switchView.setOnCheckedChangeListener(checkedChangeListener);
+        viewHolder.switchView.setEnabled(switchEnabled);
+
+        //add a onDrawerItemClickListener here to be able to check / uncheck if the drawerItem can't be selected
+        withOnDrawerItemClickListener(new Drawer.OnDrawerItemClickListener() {
+            @Override
+            public boolean onItemClick(View view, int position, IDrawerItem drawerItem) {
+                if (!isSelectable()) {
+                    checked = !checked;
+                    viewHolder.switchView.setChecked(checked);
+                }
+
+                return false;
+            }
+        });
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends BaseViewHolder {
+        private SwitchCompat switchView;
+
+        private ViewHolder(View view) {
+            super(view);
+            this.switchView = (SwitchCompat) view.findViewById(R.id.material_drawer_switch);
+        }
+    }
+
+    private CompoundButton.OnCheckedChangeListener checkedChangeListener = new CompoundButton.OnCheckedChangeListener() {
+        @Override
+        public void onCheckedChanged(CompoundButton buttonView, boolean isChecked) {
+            if (isEnabled()) {
+                checked = isChecked;
+                if (getOnCheckedChangeListener() != null) {
+                    getOnCheckedChangeListener().onCheckedChanged(AbstractSwitchableDrawerItem.this, buttonView, isChecked);
+                }
+            } else {
+                buttonView.setOnCheckedChangeListener(null);
+                buttonView.setChecked(!isChecked);
+                buttonView.setOnCheckedChangeListener(checkedChangeListener);
+            }
+        }
+    };
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/AbstractToggleableDrawerItem.java

@@ -0,0 +1,133 @@
+package com.mikepenz.materialdrawer.model;
+
+import androidx.annotation.LayoutRes;
+import android.view.View;
+import android.widget.CompoundButton;
+import android.widget.ToggleButton;
+
+import com.mikepenz.materialdrawer.Drawer;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.interfaces.OnCheckedChangeListener;
+import com.mikepenz.materialdrawer.model.interfaces.IDrawerItem;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class AbstractToggleableDrawerItem<Item extends AbstractToggleableDrawerItem> extends BaseDescribeableDrawerItem<Item, AbstractToggleableDrawerItem.ViewHolder> {
+    private boolean toggleEnabled = true;
+
+    private boolean checked = false;
+    private OnCheckedChangeListener onCheckedChangeListener = null;
+
+    public Item withChecked(boolean checked) {
+        this.checked = checked;
+        return (Item) this;
+    }
+
+    public Item withToggleEnabled(boolean toggleEnabled) {
+        this.toggleEnabled = toggleEnabled;
+        return (Item) this;
+    }
+
+    public Item withOnCheckedChangeListener(OnCheckedChangeListener onCheckedChangeListener) {
+        this.onCheckedChangeListener = onCheckedChangeListener;
+        return (Item) this;
+    }
+
+    public boolean isChecked() {
+        return checked;
+    }
+
+    public void setChecked(boolean checked) {
+        this.checked = checked;
+    }
+
+    public boolean isToggleEnabled() {
+        return toggleEnabled;
+    }
+
+    public void setToggleEnabled(boolean toggleEnabled) {
+        this.toggleEnabled = toggleEnabled;
+    }
+
+    public OnCheckedChangeListener getOnCheckedChangeListener() {
+        return onCheckedChangeListener;
+    }
+
+    public void setOnCheckedChangeListener(OnCheckedChangeListener onCheckedChangeListener) {
+        this.onCheckedChangeListener = onCheckedChangeListener;
+    }
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_primary_toggle;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_toggle;
+    }
+
+    @Override
+    public void bindView(final ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        //bind the basic view parts
+        bindViewHelper(viewHolder);
+
+        //handle the toggle
+        viewHolder.toggle.setOnCheckedChangeListener(null);
+        viewHolder.toggle.setChecked(checked);
+        viewHolder.toggle.setOnCheckedChangeListener(checkedChangeListener);
+        viewHolder.toggle.setEnabled(toggleEnabled);
+
+        //add a onDrawerItemClickListener here to be able to check / uncheck if the drawerItem can't be selected
+        withOnDrawerItemClickListener(new Drawer.OnDrawerItemClickListener() {
+            @Override
+            public boolean onItemClick(View view, int position, IDrawerItem drawerItem) {
+                if (!isSelectable()) {
+                    checked = !checked;
+                    viewHolder.toggle.setChecked(checked);
+                }
+
+                return false;
+            }
+        });
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends BaseViewHolder {
+        private ToggleButton toggle;
+
+        private ViewHolder(View view) {
+            super(view);
+            this.toggle = (ToggleButton) view.findViewById(R.id.material_drawer_toggle);
+        }
+    }
+
+    private CompoundButton.OnCheckedChangeListener checkedChangeListener = new CompoundButton.OnCheckedChangeListener() {
+        @Override
+        public void onCheckedChanged(CompoundButton buttonView, boolean isChecked) {
+            if (isEnabled()) {
+                checked = isChecked;
+                if (getOnCheckedChangeListener() != null) {
+                    getOnCheckedChangeListener().onCheckedChanged(AbstractToggleableDrawerItem.this, buttonView, isChecked);
+                }
+            } else {
+                buttonView.setOnCheckedChangeListener(null);
+                buttonView.setChecked(!isChecked);
+                buttonView.setOnCheckedChangeListener(checkedChangeListener);
+            }
+        }
+    };
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/BaseDescribeableDrawerItem.java

@@ -0,0 +1,114 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import android.content.res.ColorStateList;
+import android.graphics.drawable.Drawable;
+
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+import com.mikepenz.materialdrawer.holder.ImageHolder;
+import com.mikepenz.materialdrawer.holder.StringHolder;
+import com.mikepenz.materialdrawer.util.DrawerUIUtils;
+
+import androidx.annotation.ColorInt;
+import androidx.annotation.ColorRes;
+import androidx.annotation.StringRes;
+
+import static com.mikepenz.materialdrawer.util.DrawerUIUtils.themeDrawerItem;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public abstract class BaseDescribeableDrawerItem<T, VH extends BaseViewHolder> extends BaseDrawerItem<T, VH> {
+    private StringHolder description;
+    private ColorHolder descriptionTextColor;
+
+    @Override
+    public boolean isExcludeFromMiniDrawer() {
+        return this.excludeFromMiniDrawer;
+    }
+
+    public T withDescription(String description) {
+        this.description = new StringHolder(description);
+        return (T) this;
+    }
+
+    public T withDescription(@StringRes int descriptionRes) {
+        this.description = new StringHolder(descriptionRes);
+        return (T) this;
+    }
+
+    public T withDescriptionTextColor(@ColorInt int color) {
+        this.descriptionTextColor = ColorHolder.fromColor(color);
+        return (T) this;
+    }
+
+    public T withDescriptionTextColorRes(@ColorRes int colorRes) {
+        this.descriptionTextColor = ColorHolder.fromColorRes(colorRes);
+        return (T) this;
+    }
+
+    public StringHolder getDescription() {
+        return description;
+    }
+
+    public ColorHolder getDescriptionTextColor() {
+        return descriptionTextColor;
+    }
+
+    /**
+     * a helper method to have the logic for all secondaryDrawerItems only once
+     *
+     * @param viewHolder
+     */
+    protected void bindViewHelper(BaseViewHolder viewHolder) {
+        Context ctx = viewHolder.itemView.getContext();
+
+        //set the identifier from the drawerItem here. It can be used to run tests
+        viewHolder.itemView.setId(hashCode());
+
+        //set the item selected if it is
+        viewHolder.itemView.setSelected(isSelected());
+
+        //set the item enabled if it is
+        viewHolder.itemView.setEnabled(isEnabled());
+
+        //get the correct color for the background
+        int selectedColor = getSelectedColor(ctx);
+        //get the correct color for the text
+        int color = getColor(ctx);
+        ColorStateList selectedTextColor = getTextColorStateList(color, getSelectedTextColor(ctx));
+        //get the correct color for the icon
+        int iconColor = getIconColor(ctx);
+        int selectedIconColor = getSelectedIconColor(ctx);
+
+        //set the background for the item
+        themeDrawerItem(ctx, viewHolder.view, selectedColor, isSelectedBackgroundAnimated());
+        //set the text for the name
+        StringHolder.applyTo(this.getName(), viewHolder.name);
+        //set the text for the description or hide
+        StringHolder.applyToOrHide(this.getDescription(), viewHolder.description);
+
+        //set the colors for textViews
+        viewHolder.name.setTextColor(selectedTextColor);
+        //set the description text color
+        ColorHolder.applyToOr(getDescriptionTextColor(), viewHolder.description, selectedTextColor);
+
+        //define the typeface for our textViews
+        if (getTypeface() != null) {
+            viewHolder.name.setTypeface(getTypeface());
+            viewHolder.description.setTypeface(getTypeface());
+        }
+
+        //get the drawables for our icon and set it
+        Drawable icon = ImageHolder.decideIcon(getIcon(), ctx, iconColor, isIconTinted(), 1);
+        if (icon != null) {
+            Drawable selectedIcon = ImageHolder.decideIcon(getSelectedIcon(), ctx, selectedIconColor, isIconTinted(), 1);
+            ImageHolder.applyMultiIconTo(icon, iconColor, selectedIcon, selectedIconColor, isIconTinted(), viewHolder.icon);
+        } else {
+            ImageHolder.applyDecidedIconOrSetGone(getIcon(), viewHolder.icon, iconColor, isIconTinted(), 1);
+        }
+
+        //for android API 17 --> Padding not applied via xml
+        DrawerUIUtils.setDrawerVerticalPadding(viewHolder.view, level);
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/BaseDrawerItem.java

@@ -0,0 +1,356 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import android.content.res.ColorStateList;
+import android.graphics.Typeface;
+import android.graphics.drawable.Drawable;
+import android.os.Build;
+import android.util.Pair;
+
+import com.mikepenz.iconics.typeface.IIcon;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+import com.mikepenz.materialdrawer.holder.ImageHolder;
+import com.mikepenz.materialdrawer.holder.StringHolder;
+import com.mikepenz.materialdrawer.model.interfaces.Iconable;
+import com.mikepenz.materialdrawer.model.interfaces.Nameable;
+import com.mikepenz.materialdrawer.model.interfaces.Tagable;
+import com.mikepenz.materialdrawer.model.interfaces.Typefaceable;
+import com.mikepenz.materialdrawer.util.DrawerUIUtils;
+
+import androidx.annotation.ColorInt;
+import androidx.annotation.ColorRes;
+import androidx.annotation.DrawableRes;
+import androidx.annotation.StringRes;
+import androidx.recyclerview.widget.RecyclerView;
+
+import static com.mikepenz.materialdrawer.util.DrawerUIUtils.getBooleanStyleable;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public abstract class BaseDrawerItem<T, VH extends RecyclerView.ViewHolder> extends AbstractDrawerItem<T, VH> implements Nameable<T>, Iconable<T>, Tagable<T>, Typefaceable<T> {
+    protected ImageHolder icon;
+    protected ImageHolder selectedIcon;
+    protected StringHolder name;
+
+    protected boolean iconTinted = false;
+
+    protected ColorHolder selectedColor;
+    protected ColorHolder textColor;
+    protected ColorHolder selectedTextColor;
+    protected ColorHolder disabledTextColor;
+
+    protected ColorHolder iconColor;
+    protected ColorHolder selectedIconColor;
+    protected ColorHolder disabledIconColor;
+
+    protected Typeface typeface = null;
+
+    protected Pair<Integer, ColorStateList> colorStateList;
+
+    protected int level = 1;
+
+    protected boolean excludeFromMiniDrawer = false;
+
+    public T withIcon(ImageHolder icon) {
+        this.icon = icon;
+        return (T) this;
+    }
+
+    public T withIcon(Drawable icon) {
+        this.icon = new ImageHolder(icon);
+        return (T) this;
+    }
+
+    public T withIcon(@DrawableRes int iconRes) {
+        this.icon = new ImageHolder(iconRes);
+        return (T) this;
+    }
+
+    public T withSelectedIcon(Drawable selectedIcon) {
+        this.selectedIcon = new ImageHolder(selectedIcon);
+        return (T) this;
+    }
+
+    public T withSelectedIcon(@DrawableRes int selectedIconRes) {
+        this.selectedIcon = new ImageHolder(selectedIconRes);
+        return (T) this;
+    }
+
+    public T withIcon(IIcon iicon) {
+        this.icon = new ImageHolder(iicon);
+        //if we are on api 21 or higher we use the IconicsDrawable for selection too and color it with the correct color
+        //else we use just the one drawable and enable tinting on press
+        if (Build.VERSION.SDK_INT >= 21) {
+            this.selectedIcon = new ImageHolder(iicon);
+        } else {
+            this.withIconTintingEnabled(true);
+        }
+
+        return (T) this;
+    }
+
+    public T withName(StringHolder name) {
+        this.name = name;
+        return (T) this;
+    }
+
+    public T withName(String name) {
+        this.name = new StringHolder(name);
+        return (T) this;
+    }
+
+    public T withName(@StringRes int nameRes) {
+        this.name = new StringHolder(nameRes);
+        return (T) this;
+    }
+
+    public T withSelectedColor(@ColorInt int selectedColor) {
+        this.selectedColor = ColorHolder.fromColor(selectedColor);
+        return (T) this;
+    }
+
+    public T withSelectedColorRes(@ColorRes int selectedColorRes) {
+        this.selectedColor = ColorHolder.fromColorRes(selectedColorRes);
+        return (T) this;
+    }
+
+    public T withTextColor(@ColorInt int textColor) {
+        this.textColor = ColorHolder.fromColor(textColor);
+        return (T) this;
+    }
+
+    public T withTextColorRes(@ColorRes int textColorRes) {
+        this.textColor = ColorHolder.fromColorRes(textColorRes);
+        return (T) this;
+    }
+
+    public T withSelectedTextColor(@ColorInt int selectedTextColor) {
+        this.selectedTextColor = ColorHolder.fromColor(selectedTextColor);
+        return (T) this;
+    }
+
+    public T withSelectedTextColorRes(@ColorRes int selectedColorRes) {
+        this.selectedTextColor = ColorHolder.fromColorRes(selectedColorRes);
+        return (T) this;
+    }
+
+    public T withDisabledTextColor(@ColorInt int disabledTextColor) {
+        this.disabledTextColor = ColorHolder.fromColor(disabledTextColor);
+        return (T) this;
+    }
+
+    public T withDisabledTextColorRes(@ColorRes int disabledTextColorRes) {
+        this.disabledTextColor = ColorHolder.fromColorRes(disabledTextColorRes);
+        return (T) this;
+    }
+
+    public T withIconColor(@ColorInt int iconColor) {
+        this.iconColor = ColorHolder.fromColor(iconColor);
+        return (T) this;
+    }
+
+    public T withIconColorRes(@ColorRes int iconColorRes) {
+        this.iconColor = ColorHolder.fromColorRes(iconColorRes);
+        return (T) this;
+    }
+
+    public T withSelectedIconColor(@ColorInt int selectedIconColor) {
+        this.selectedIconColor = ColorHolder.fromColor(selectedIconColor);
+        return (T) this;
+    }
+
+    public T withSelectedIconColorRes(@ColorRes int selectedColorRes) {
+        this.selectedIconColor = ColorHolder.fromColorRes(selectedColorRes);
+        return (T) this;
+    }
+
+    public T withDisabledIconColor(@ColorInt int disabledIconColor) {
+        this.disabledIconColor = ColorHolder.fromColor(disabledIconColor);
+        return (T) this;
+    }
+
+    public T withDisabledIconColorRes(@ColorRes int disabledIconColorRes) {
+        this.disabledIconColor = ColorHolder.fromColorRes(disabledIconColorRes);
+        return (T) this;
+    }
+
+    /**
+     * will tint the icon with the default (or set) colors
+     * (default and selected state)
+     *
+     * @param iconTintingEnabled
+     * @return
+     */
+    public T withIconTintingEnabled(boolean iconTintingEnabled) {
+        this.iconTinted = iconTintingEnabled;
+        return (T) this;
+    }
+
+    @Deprecated
+    public T withIconTinted(boolean iconTinted) {
+        this.iconTinted = iconTinted;
+        return (T) this;
+    }
+
+    /**
+     * for backwards compatibility - withIconTinted..
+     *
+     * @param iconTinted
+     * @return
+     */
+    @Deprecated
+    public T withTintSelectedIcon(boolean iconTinted) {
+        return withIconTintingEnabled(iconTinted);
+    }
+
+    public T withTypeface(Typeface typeface) {
+        this.typeface = typeface;
+        return (T) this;
+    }
+
+    public T withLevel(int level) {
+        this.level = level;
+        return (T) this;
+    }
+
+    public T withExcludeFromMiniDrawer(boolean excludeFromMiniDrawer) {
+        this.excludeFromMiniDrawer = excludeFromMiniDrawer;
+        return (T) this;
+    }
+
+
+    public ColorHolder getSelectedColor() {
+        return selectedColor;
+    }
+
+    public ColorHolder getTextColor() {
+        return textColor;
+    }
+
+    public ColorHolder getSelectedTextColor() {
+        return selectedTextColor;
+    }
+
+    public ColorHolder getDisabledTextColor() {
+        return disabledTextColor;
+    }
+
+    public boolean isIconTinted() {
+        return iconTinted;
+    }
+
+    public ImageHolder getIcon() {
+        return icon;
+    }
+
+    public ImageHolder getSelectedIcon() {
+        return selectedIcon;
+    }
+
+    public StringHolder getName() {
+        return name;
+    }
+
+    public ColorHolder getDisabledIconColor() {
+        return disabledIconColor;
+    }
+
+    public ColorHolder getSelectedIconColor() {
+        return selectedIconColor;
+    }
+
+    public ColorHolder getIconColor() {
+        return iconColor;
+    }
+
+    public Typeface getTypeface() {
+        return typeface;
+    }
+
+    public int getLevel() {
+        return level;
+    }
+
+    /**
+     * helper method to decide for the correct color
+     *
+     * @param ctx
+     * @return
+     */
+    protected int getSelectedColor(Context ctx) {
+        if (getBooleanStyleable(ctx, R.styleable.MaterialDrawer_material_drawer_legacy_style, false)) {
+            return ColorHolder.color(getSelectedColor(), ctx, R.attr.material_drawer_selected_legacy, R.color.material_drawer_selected_legacy);
+        } else {
+            return ColorHolder.color(getSelectedColor(), ctx, R.attr.material_drawer_selected, R.color.material_drawer_selected);
+        }
+    }
+
+    /**
+     * helper method to decide for the correct color
+     *
+     * @param ctx
+     * @return
+     */
+    protected int getColor(Context ctx) {
+        int color;
+        if (this.isEnabled()) {
+            color = ColorHolder.color(getTextColor(), ctx, R.attr.material_drawer_primary_text, R.color.material_drawer_primary_text);
+        } else {
+            color = ColorHolder.color(getDisabledTextColor(), ctx, R.attr.material_drawer_hint_text, R.color.material_drawer_hint_text);
+        }
+        return color;
+    }
+
+    /**
+     * helper method to decide for the correct color
+     *
+     * @param ctx
+     * @return
+     */
+    protected int getSelectedTextColor(Context ctx) {
+        return ColorHolder.color(getSelectedTextColor(), ctx, R.attr.material_drawer_selected_text, R.color.material_drawer_selected_text);
+    }
+
+    /**
+     * helper method to decide for the correct color
+     *
+     * @param ctx
+     * @return
+     */
+    public int getIconColor(Context ctx) {
+        int iconColor;
+        if (this.isEnabled()) {
+            iconColor = ColorHolder.color(getIconColor(), ctx, R.attr.material_drawer_primary_icon, R.color.material_drawer_primary_icon);
+        } else {
+            iconColor = ColorHolder.color(getDisabledIconColor(), ctx, R.attr.material_drawer_hint_icon, R.color.material_drawer_hint_icon);
+        }
+        return iconColor;
+    }
+
+    /**
+     * helper method to decide for the correct color
+     *
+     * @param ctx
+     * @return
+     */
+    protected int getSelectedIconColor(Context ctx) {
+        return ColorHolder.color(getSelectedIconColor(), ctx, R.attr.material_drawer_selected_text, R.color.material_drawer_selected_text);
+    }
+
+    /**
+     * helper to get the ColorStateList for the text and remembering it so we do not have to recreate it all the time
+     *
+     * @param color
+     * @param selectedTextColor
+     * @return
+     */
+    protected ColorStateList getTextColorStateList(@ColorInt int color, @ColorInt int selectedTextColor) {
+        if (colorStateList == null || color + selectedTextColor != colorStateList.first) {
+            colorStateList = new Pair<>(color + selectedTextColor, DrawerUIUtils.getTextColorStateList(color, selectedTextColor));
+        }
+
+        return colorStateList.second;
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/BaseViewHolder.java

@@ -0,0 +1,25 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.view.View;
+import android.widget.ImageView;
+import android.widget.TextView;
+
+import com.mikepenz.materialdrawer.R;
+
+import androidx.recyclerview.widget.RecyclerView;
+
+public class BaseViewHolder extends RecyclerView.ViewHolder {
+    protected View view;
+    protected ImageView icon;
+    protected TextView name;
+    protected TextView description;
+
+    public BaseViewHolder(View view) {
+        super(view);
+
+        this.view = view;
+        this.icon = view.findViewById(R.id.material_drawer_icon);
+        this.name = view.findViewById(R.id.material_drawer_name);
+        this.description = view.findViewById(R.id.material_drawer_description);
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/ContainerDrawerItem.java

@@ -0,0 +1,149 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import androidx.annotation.LayoutRes;
+import androidx.recyclerview.widget.RecyclerView;
+import android.view.View;
+import android.view.ViewGroup;
+import android.widget.LinearLayout;
+
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.DimenHolder;
+import com.mikepenz.materialize.util.UIUtils;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class ContainerDrawerItem extends AbstractDrawerItem<ContainerDrawerItem, ContainerDrawerItem.ViewHolder> {
+
+    private DimenHolder mHeight;
+
+    public ContainerDrawerItem withHeight(DimenHolder height) {
+        mHeight = height;
+        return this;
+    }
+
+    public DimenHolder getHeight() {
+        return mHeight;
+    }
+
+    private View mView;
+
+    public ContainerDrawerItem withView(View view) {
+        this.mView = view;
+        return this;
+    }
+
+    public View getView() {
+        return mView;
+    }
+
+    public enum Position {
+        TOP,
+        BOTTOM,
+        NONE;
+    }
+
+    private Position mViewPosition = Position.TOP;
+
+    public ContainerDrawerItem withViewPosition(Position position) {
+        this.mViewPosition = position;
+        return this;
+    }
+
+    private boolean mDivider = true;
+
+    public ContainerDrawerItem withDivider(boolean divider) {
+        this.mDivider = divider;
+        return this;
+    }
+
+    public Position getViewPosition() {
+        return mViewPosition;
+    }
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_container;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_container;
+    }
+
+    @Override
+    public void bindView(ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        Context ctx = viewHolder.itemView.getContext();
+
+        //set the identifier from the drawerItem here. It can be used to run tests
+        viewHolder.itemView.setId(hashCode());
+
+        //define how the divider should look like
+        viewHolder.view.setEnabled(false);
+
+        //make sure our view is not used in another parent
+        if (mView.getParent() != null) {
+            ((ViewGroup) mView.getParent()).removeView(mView);
+        }
+
+        //set the height
+        int height = ViewGroup.LayoutParams.WRAP_CONTENT;
+        if (mHeight != null) {
+            RecyclerView.LayoutParams lp = (RecyclerView.LayoutParams) viewHolder.view.getLayoutParams();
+            height = mHeight.asPixel(ctx);
+            lp.height = height;
+            viewHolder.view.setLayoutParams(lp);
+        }
+
+        //make sure the header view is empty
+        ((ViewGroup) viewHolder.view).removeAllViews();
+
+        int dividerHeight = 0;
+        if (mDivider) {
+            dividerHeight = 1;
+        }
+
+        View divider = new View(ctx);
+        divider.setMinimumHeight(dividerHeight);
+        divider.setBackgroundColor(UIUtils.getThemeColorFromAttrOrRes(ctx, R.attr.material_drawer_divider, R.color.material_drawer_divider));
+
+        LinearLayout.LayoutParams dividerParams = new LinearLayout.LayoutParams(ViewGroup.LayoutParams.MATCH_PARENT, (int) UIUtils.convertDpToPixel(dividerHeight, ctx));
+        LinearLayout.LayoutParams viewParams = new LinearLayout.LayoutParams(ViewGroup.LayoutParams.MATCH_PARENT, mHeight != null ? height - (int) UIUtils.convertDpToPixel(dividerHeight, ctx) : height);
+
+        //depending on the position we add the view
+        if (mViewPosition == Position.TOP) {
+            ((ViewGroup) viewHolder.view).addView(mView, viewParams);
+            dividerParams.bottomMargin = ctx.getResources().getDimensionPixelSize(R.dimen.material_drawer_padding);
+            ((ViewGroup) viewHolder.view).addView(divider, dividerParams);
+        } else if (mViewPosition == Position.BOTTOM) {
+            dividerParams.topMargin = ctx.getResources().getDimensionPixelSize(R.dimen.material_drawer_padding);
+            ((ViewGroup) viewHolder.view).addView(divider, dividerParams);
+            ((ViewGroup) viewHolder.view).addView(mView, viewParams);
+        } else {
+            ((ViewGroup) viewHolder.view).addView(mView, viewParams);
+        }
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends RecyclerView.ViewHolder {
+        private View view;
+
+        private ViewHolder(View view) {
+            super(view);
+            this.view = view;
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/DividerDrawerItem.java

@@ -0,0 +1,67 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import androidx.annotation.LayoutRes;
+import androidx.core.view.ViewCompat;
+import androidx.recyclerview.widget.RecyclerView;
+import android.view.View;
+
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialize.util.UIUtils;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class DividerDrawerItem extends AbstractDrawerItem<DividerDrawerItem, DividerDrawerItem.ViewHolder> {
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_divider;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_divider;
+    }
+
+    @Override
+    public void bindView(ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        Context ctx = viewHolder.itemView.getContext();
+
+        //set the identifier from the drawerItem here. It can be used to run tests
+        viewHolder.itemView.setId(hashCode());
+
+        //define how the divider should look like
+        viewHolder.view.setClickable(false);
+        viewHolder.view.setEnabled(false);
+        viewHolder.view.setMinimumHeight(1);
+        ViewCompat.setImportantForAccessibility(viewHolder.view,
+                ViewCompat.IMPORTANT_FOR_ACCESSIBILITY_NO);
+
+        //set the color for the divider
+        viewHolder.divider.setBackgroundColor(UIUtils.getThemeColorFromAttrOrRes(ctx, R.attr.material_drawer_divider, R.color.material_drawer_divider));
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends RecyclerView.ViewHolder {
+        private View view;
+        private View divider;
+
+        private ViewHolder(View view) {
+            super(view);
+            this.view = view;
+            this.divider = view.findViewById(R.id.material_drawer_divider);
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/ExpandableBadgeDrawerItem.java

@@ -0,0 +1,174 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import android.graphics.Color;
+import androidx.annotation.LayoutRes;
+import androidx.annotation.StringRes;
+import androidx.core.view.ViewCompat;
+import android.view.View;
+import android.widget.ImageView;
+import android.widget.TextView;
+
+import com.mikepenz.iconics.IconicsDrawable;
+import com.mikepenz.materialdrawer.Drawer;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.BadgeStyle;
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+import com.mikepenz.materialdrawer.holder.StringHolder;
+import com.mikepenz.materialdrawer.icons.MaterialDrawerFont;
+import com.mikepenz.materialdrawer.model.interfaces.ColorfulBadgeable;
+import com.mikepenz.materialdrawer.model.interfaces.IDrawerItem;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ * NOTE: The arrow will just animate (and rotate) on APIs higher than 11 as the ViewCompat will skip this on API 10
+ */
+public class ExpandableBadgeDrawerItem extends BaseDescribeableDrawerItem<ExpandableBadgeDrawerItem, ExpandableBadgeDrawerItem.ViewHolder>
+        implements ColorfulBadgeable<ExpandableBadgeDrawerItem> {
+
+    private Drawer.OnDrawerItemClickListener mOnDrawerItemClickListener;
+
+    protected ColorHolder arrowColor;
+
+    protected int arrowRotationAngleStart = 0;
+
+    protected int arrowRotationAngleEnd = 180;
+
+    protected StringHolder mBadge;
+    protected BadgeStyle mBadgeStyle = new BadgeStyle();
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_expandable_badge;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_expandable_badge;
+    }
+
+    @Override
+    public void bindView(ExpandableBadgeDrawerItem.ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        Context ctx = viewHolder.itemView.getContext();
+        //bind the basic view parts
+        bindViewHelper(viewHolder);
+
+        //set the text for the badge or hide
+        boolean badgeVisible = StringHolder.applyToOrHide(mBadge, viewHolder.badge);
+        //style the badge if it is visible
+        if (true) {
+            mBadgeStyle.style(viewHolder.badge, getTextColorStateList(getColor(ctx), getSelectedTextColor(ctx)));
+            viewHolder.badgeContainer.setVisibility(View.VISIBLE);
+        } else {
+            viewHolder.badgeContainer.setVisibility(View.GONE);
+        }
+
+        //define the typeface for our textViews
+        if (getTypeface() != null) {
+            viewHolder.badge.setTypeface(getTypeface());
+        }
+
+        //make sure all animations are stopped
+        if (viewHolder.arrow.getDrawable() instanceof IconicsDrawable) {
+            ((IconicsDrawable) viewHolder.arrow.getDrawable()).color(this.arrowColor != null ? this.arrowColor.color(ctx) : getIconColor(ctx));
+        }
+        viewHolder.arrow.clearAnimation();
+        if (!isExpanded()) {
+            viewHolder.arrow.setRotation(this.arrowRotationAngleStart);
+        } else {
+            viewHolder.arrow.setRotation(this.arrowRotationAngleEnd);
+        }
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ExpandableBadgeDrawerItem withOnDrawerItemClickListener(Drawer.OnDrawerItemClickListener onDrawerItemClickListener) {
+        mOnDrawerItemClickListener = onDrawerItemClickListener;
+        return this;
+    }
+
+    @Override
+    public Drawer.OnDrawerItemClickListener getOnDrawerItemClickListener() {
+        return mOnArrowDrawerItemClickListener;
+    }
+
+    /**
+     * our internal onDrawerItemClickListener which will handle the arrow animation
+     */
+    private Drawer.OnDrawerItemClickListener mOnArrowDrawerItemClickListener = new Drawer.OnDrawerItemClickListener() {
+        @Override
+        public boolean onItemClick(View view, int position, IDrawerItem drawerItem) {
+            if (drawerItem instanceof AbstractDrawerItem && drawerItem.isEnabled()) {
+                if (((AbstractDrawerItem) drawerItem).getSubItems() != null) {
+                    if (((AbstractDrawerItem) drawerItem).isExpanded()) {
+                        ViewCompat.animate(view.findViewById(R.id.material_drawer_arrow)).rotation(ExpandableBadgeDrawerItem.this.arrowRotationAngleEnd).start();
+                    } else {
+                        ViewCompat.animate(view.findViewById(R.id.material_drawer_arrow))
+                                .rotation(ExpandableBadgeDrawerItem.this.arrowRotationAngleStart)
+                                .start();
+                    }
+                }
+            }
+
+            return mOnDrawerItemClickListener != null && mOnDrawerItemClickListener.onItemClick(view, position, drawerItem);
+        }
+    };
+
+    @Override
+    public ExpandableBadgeDrawerItem withBadge(StringHolder badge) {
+        this.mBadge = badge;
+        return (ExpandableBadgeDrawerItem) this;
+    }
+
+    @Override
+    public ExpandableBadgeDrawerItem withBadge(String badge) {
+        this.mBadge = new StringHolder(badge);
+        return (ExpandableBadgeDrawerItem) this;
+    }
+
+    @Override
+    public ExpandableBadgeDrawerItem withBadge(@StringRes int badgeRes) {
+        this.mBadge = new StringHolder(badgeRes);
+        return (ExpandableBadgeDrawerItem) this;
+    }
+
+    @Override
+    public ExpandableBadgeDrawerItem withBadgeStyle(BadgeStyle badgeStyle) {
+        this.mBadgeStyle = badgeStyle;
+        return (ExpandableBadgeDrawerItem) this;
+    }
+
+    public StringHolder getBadge() {
+        return mBadge;
+    }
+
+    public BadgeStyle getBadgeStyle() {
+        return mBadgeStyle;
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends BaseViewHolder {
+        public ImageView arrow;
+        public View badgeContainer;
+        public TextView badge;
+
+        public ViewHolder(View view) {
+            super(view);
+            badgeContainer = view.findViewById(R.id.material_drawer_badge_container);
+            badge = view.findViewById(R.id.material_drawer_badge);
+            arrow = view.findViewById(R.id.material_drawer_arrow);
+            arrow.setImageDrawable(new IconicsDrawable(view.getContext(), MaterialDrawerFont.Icon.mdf_expand_more).sizeDp(16).paddingDp(2).color(Color.BLACK));
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/ExpandableDrawerItem.java

@@ -0,0 +1,134 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import android.graphics.Color;
+import androidx.annotation.ColorInt;
+import androidx.annotation.ColorRes;
+import androidx.annotation.LayoutRes;
+import androidx.core.view.ViewCompat;
+import android.view.View;
+import android.widget.ImageView;
+
+import com.mikepenz.iconics.IconicsDrawable;
+import com.mikepenz.materialdrawer.Drawer;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+import com.mikepenz.materialdrawer.icons.MaterialDrawerFont;
+import com.mikepenz.materialdrawer.model.interfaces.IDrawerItem;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ * NOTE: The arrow will just animate (and rotate) on APIs higher than 11 as the ViewCompat will skip this on API 10
+ */
+public class ExpandableDrawerItem extends BaseDescribeableDrawerItem<ExpandableDrawerItem, ExpandableDrawerItem.ViewHolder> {
+
+    private Drawer.OnDrawerItemClickListener mOnDrawerItemClickListener;
+
+    protected ColorHolder arrowColor;
+
+    protected int arrowRotationAngleStart = 0;
+
+    protected int arrowRotationAngleEnd = 180;
+
+    public ExpandableDrawerItem withArrowColor(@ColorInt int arrowColor) {
+        this.arrowColor = ColorHolder.fromColor(arrowColor);
+        return this;
+    }
+
+    public ExpandableDrawerItem withArrowColorRes(@ColorRes int arrowColorRes) {
+        this.arrowColor = ColorHolder.fromColorRes(arrowColorRes);
+        return this;
+    }
+
+    public ExpandableDrawerItem withArrowRotationAngleStart(int angle) {
+        this.arrowRotationAngleStart = angle;
+        return this;
+    }
+
+    public ExpandableDrawerItem withArrowRotationAngleEnd(int angle) {
+        this.arrowRotationAngleEnd = angle;
+        return this;
+    }
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_expandable;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_expandable;
+    }
+
+    @Override
+    public ExpandableDrawerItem withOnDrawerItemClickListener(Drawer.OnDrawerItemClickListener onDrawerItemClickListener) {
+        mOnDrawerItemClickListener = onDrawerItemClickListener;
+        return this;
+    }
+
+    @Override
+    public Drawer.OnDrawerItemClickListener getOnDrawerItemClickListener() {
+        return mOnArrowDrawerItemClickListener;
+    }
+
+    /**
+     * our internal onDrawerItemClickListener which will handle the arrow animation
+     */
+    private Drawer.OnDrawerItemClickListener mOnArrowDrawerItemClickListener = new Drawer.OnDrawerItemClickListener() {
+        @Override
+        public boolean onItemClick(View view, int position, IDrawerItem drawerItem) {
+            if (drawerItem instanceof AbstractDrawerItem && drawerItem.isEnabled()) {
+                if (((AbstractDrawerItem) drawerItem).getSubItems() != null) {
+                    if (((AbstractDrawerItem) drawerItem).isExpanded()) {
+                        ViewCompat.animate(view.findViewById(R.id.material_drawer_arrow)).rotation(ExpandableDrawerItem.this.arrowRotationAngleEnd).start();
+                    } else {
+                        ViewCompat.animate(view.findViewById(R.id.material_drawer_arrow)).rotation(ExpandableDrawerItem.this.arrowRotationAngleStart).start();
+                    }
+                }
+            }
+
+            return mOnDrawerItemClickListener != null && mOnDrawerItemClickListener.onItemClick(view, position, drawerItem);
+        }
+    };
+
+    @Override
+    public void bindView(ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        Context ctx = viewHolder.itemView.getContext();
+        //bind the basic view parts
+        bindViewHelper(viewHolder);
+
+        //make sure all animations are stopped
+        if (viewHolder.arrow.getDrawable() instanceof IconicsDrawable) {
+            ((IconicsDrawable) viewHolder.arrow.getDrawable()).color(this.arrowColor != null ? this.arrowColor.color(ctx) : getIconColor(ctx));
+        }
+        viewHolder.arrow.clearAnimation();
+        if (!isExpanded()) {
+            viewHolder.arrow.setRotation(this.arrowRotationAngleStart);
+        } else {
+            viewHolder.arrow.setRotation(this.arrowRotationAngleEnd);
+        }
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends BaseViewHolder {
+        public ImageView arrow;
+
+        public ViewHolder(View view) {
+            super(view);
+            arrow = view.findViewById(R.id.material_drawer_arrow);
+            arrow.setImageDrawable(new IconicsDrawable(view.getContext(), MaterialDrawerFont.Icon.mdf_expand_more).sizeDp(16).paddingDp(2).color(Color.BLACK));
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/MiniDrawerItem.java

@@ -0,0 +1,193 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import android.graphics.drawable.Drawable;
+import android.view.View;
+import android.widget.ImageView;
+import android.widget.TextView;
+
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.BadgeStyle;
+import com.mikepenz.materialdrawer.holder.DimenHolder;
+import com.mikepenz.materialdrawer.holder.ImageHolder;
+import com.mikepenz.materialdrawer.holder.StringHolder;
+
+import java.util.List;
+
+import androidx.annotation.DimenRes;
+import androidx.annotation.LayoutRes;
+import androidx.recyclerview.widget.RecyclerView;
+
+import static com.mikepenz.materialdrawer.util.DrawerUIUtils.themeDrawerItem;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class MiniDrawerItem extends BaseDrawerItem<MiniDrawerItem, MiniDrawerItem.ViewHolder> {
+    private StringHolder mBadge;
+    private BadgeStyle mBadgeStyle = new BadgeStyle();
+
+    private boolean mEnableSelectedBackground = false;
+    protected DimenHolder mCustomHeight;
+
+    public MiniDrawerItem() {
+
+    }
+
+    public MiniDrawerItem(PrimaryDrawerItem primaryDrawerItem) {
+        this.mIdentifier = primaryDrawerItem.mIdentifier;
+        this.mTag = primaryDrawerItem.mTag;
+
+        this.mBadge = primaryDrawerItem.mBadge;
+        this.mBadgeStyle = primaryDrawerItem.mBadgeStyle;
+
+        this.mEnabled = primaryDrawerItem.mEnabled;
+        this.mSelectable = primaryDrawerItem.mSelectable;
+        this.mSelected = primaryDrawerItem.mSelected;
+
+        this.icon = primaryDrawerItem.icon;
+        this.selectedIcon = primaryDrawerItem.selectedIcon;
+
+        this.iconTinted = primaryDrawerItem.iconTinted;
+        this.selectedColor = primaryDrawerItem.selectedColor;
+
+        this.iconColor = primaryDrawerItem.iconColor;
+        this.selectedIconColor = primaryDrawerItem.selectedIconColor;
+        this.disabledIconColor = primaryDrawerItem.disabledIconColor;
+    }
+
+    public MiniDrawerItem(SecondaryDrawerItem secondaryDrawerItem) {
+        this.mIdentifier = secondaryDrawerItem.mIdentifier;
+        this.mTag = secondaryDrawerItem.mTag;
+
+        this.mBadge = secondaryDrawerItem.mBadge;
+        this.mBadgeStyle = secondaryDrawerItem.mBadgeStyle;
+
+        this.mEnabled = secondaryDrawerItem.mEnabled;
+        this.mSelectable = secondaryDrawerItem.mSelectable;
+        this.mSelected = secondaryDrawerItem.mSelected;
+
+        this.icon = secondaryDrawerItem.icon;
+        this.selectedIcon = secondaryDrawerItem.selectedIcon;
+
+        this.iconTinted = secondaryDrawerItem.iconTinted;
+        this.selectedColor = secondaryDrawerItem.selectedColor;
+
+        this.iconColor = secondaryDrawerItem.iconColor;
+        this.selectedIconColor = secondaryDrawerItem.selectedIconColor;
+        this.disabledIconColor = secondaryDrawerItem.disabledIconColor;
+    }
+
+
+    public MiniDrawerItem withCustomHeightRes(@DimenRes int customHeightRes) {
+        this.mCustomHeight = DimenHolder.fromResource(customHeightRes);
+        return this;
+    }
+
+    public MiniDrawerItem withCustomHeightDp(int customHeightDp) {
+        this.mCustomHeight = DimenHolder.fromDp(customHeightDp);
+        return this;
+    }
+
+    public MiniDrawerItem withCustomHeightPx(int customHeightPx) {
+        this.mCustomHeight = DimenHolder.fromPixel(customHeightPx);
+        return this;
+    }
+
+    public MiniDrawerItem withCustomHeight(DimenHolder customHeight) {
+        this.mCustomHeight = customHeight;
+        return this;
+    }
+
+    public MiniDrawerItem withEnableSelectedBackground(boolean enableSelectedBackground) {
+        this.mEnableSelectedBackground = enableSelectedBackground;
+        return this;
+    }
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_mini;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_mini;
+    }
+
+    @Override
+    public void bindView(ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        Context ctx = viewHolder.itemView.getContext();
+
+        //set a different height for this item
+        if (mCustomHeight != null) {
+            RecyclerView.LayoutParams lp = (RecyclerView.LayoutParams) viewHolder.itemView.getLayoutParams();
+            lp.height = mCustomHeight.asPixel(ctx);
+            viewHolder.itemView.setLayoutParams(lp);
+        }
+
+        //set the identifier from the drawerItem here. It can be used to run tests
+        viewHolder.itemView.setId(hashCode());
+
+        //set the item enabled if it is
+        viewHolder.itemView.setEnabled(isEnabled());
+
+        //set the item selected if it is
+        viewHolder.itemView.setSelected(isSelected());
+
+        //
+        viewHolder.itemView.setTag(this);
+
+        //get the correct color for the icon
+        int iconColor = getIconColor(ctx);
+        int selectedIconColor = getSelectedIconColor(ctx);
+
+        if (mEnableSelectedBackground) {
+            //get the correct color for the background
+            int selectedColor = getSelectedColor(ctx);
+            //set the background for the item
+            themeDrawerItem(ctx, viewHolder.view, selectedColor, isSelectedBackgroundAnimated());
+        }
+
+        //set the text for the badge or hide
+        boolean badgeVisible = StringHolder.applyToOrHide(mBadge, viewHolder.badge);
+        //style the badge if it is visible
+        if (badgeVisible) {
+            mBadgeStyle.style(viewHolder.badge);
+        }
+
+        //get the drawables for our icon and set it
+        Drawable icon = ImageHolder.decideIcon(getIcon(), ctx, iconColor, isIconTinted(), 1);
+        Drawable selectedIcon = ImageHolder.decideIcon(getSelectedIcon(), ctx, selectedIconColor, isIconTinted(), 1);
+        ImageHolder.applyMultiIconTo(icon, iconColor, selectedIcon, selectedIconColor, isIconTinted(), viewHolder.icon);
+
+        //for android API 17 --> Padding not applied via xml
+        int verticalPadding = ctx.getResources().getDimensionPixelSize(R.dimen.material_drawer_padding);
+        int topBottomPadding = ctx.getResources().getDimensionPixelSize(R.dimen.material_mini_drawer_item_padding);
+        viewHolder.itemView.setPadding(verticalPadding, topBottomPadding, verticalPadding, topBottomPadding);
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends RecyclerView.ViewHolder {
+        private View view;
+        private ImageView icon;
+        private TextView badge;
+
+        public ViewHolder(View view) {
+            super(view);
+
+            this.view = view;
+            this.icon = (ImageView) view.findViewById(R.id.material_drawer_icon);
+            this.badge = (TextView) view.findViewById(R.id.material_drawer_badge);
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/MiniProfileDrawerItem.java

@@ -0,0 +1,168 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.graphics.Bitmap;
+import android.graphics.drawable.Drawable;
+import android.net.Uri;
+import androidx.annotation.DimenRes;
+import androidx.annotation.DrawableRes;
+import androidx.annotation.LayoutRes;
+import androidx.recyclerview.widget.RecyclerView;
+import android.view.View;
+import android.widget.ImageView;
+
+import com.mikepenz.iconics.typeface.IIcon;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.DimenHolder;
+import com.mikepenz.materialdrawer.holder.ImageHolder;
+import com.mikepenz.materialdrawer.holder.StringHolder;
+import com.mikepenz.materialdrawer.model.interfaces.IProfile;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class MiniProfileDrawerItem extends AbstractDrawerItem<MiniProfileDrawerItem, MiniProfileDrawerItem.ViewHolder> implements IProfile<MiniProfileDrawerItem> {
+    protected ImageHolder icon;
+
+    protected DimenHolder customHeight;
+
+    public MiniProfileDrawerItem() {
+        withSelectable(false);
+    }
+
+    public MiniProfileDrawerItem(ProfileDrawerItem profile) {
+        this.icon = profile.icon;
+        this.mEnabled = profile.mEnabled;
+        withSelectable(false);
+    }
+
+    @Override
+    public MiniProfileDrawerItem withName(CharSequence name) {
+        return null;
+    }
+
+    @Override
+    public StringHolder getName() {
+        return null;
+    }
+
+    @Override
+    public MiniProfileDrawerItem withEmail(String email) {
+        return null;
+    }
+
+    @Override
+    public StringHolder getEmail() {
+        return null;
+    }
+
+    @Override
+    public MiniProfileDrawerItem withIcon(Drawable icon) {
+        this.icon = new ImageHolder(icon);
+        return this;
+    }
+
+    @Override
+    public MiniProfileDrawerItem withIcon(@DrawableRes int iconRes) {
+        this.icon = new ImageHolder(iconRes);
+        return this;
+    }
+
+    @Override
+    public MiniProfileDrawerItem withIcon(Bitmap iconBitmap) {
+        this.icon = new ImageHolder(iconBitmap);
+        return this;
+    }
+
+    @Override
+    public MiniProfileDrawerItem withIcon(String url) {
+        this.icon = new ImageHolder(url);
+        return this;
+    }
+
+    @Override
+    public MiniProfileDrawerItem withIcon(Uri uri) {
+        this.icon = new ImageHolder(uri);
+        return this;
+    }
+
+    @Override
+    public MiniProfileDrawerItem withIcon(IIcon icon) {
+        this.icon = new ImageHolder(icon);
+        return this;
+    }
+
+    public MiniProfileDrawerItem withCustomHeightRes(@DimenRes int customHeightRes) {
+        this.customHeight = DimenHolder.fromResource(customHeightRes);
+        return this;
+    }
+
+    public MiniProfileDrawerItem withCustomHeightDp(int customHeightDp) {
+        this.customHeight = DimenHolder.fromDp(customHeightDp);
+        return this;
+    }
+
+    public MiniProfileDrawerItem withCustomHeightPx(int customHeightPx) {
+        this.customHeight = DimenHolder.fromPixel(customHeightPx);
+        return this;
+    }
+
+    public MiniProfileDrawerItem withCustomHeight(DimenHolder customHeight) {
+        this.customHeight = customHeight;
+        return this;
+    }
+
+    @Override
+    public ImageHolder getIcon() {
+        return icon;
+    }
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_mini_profile;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_mini_profile;
+    }
+
+    @Override
+    public void bindView(ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        if (customHeight != null) {
+            RecyclerView.LayoutParams lp = (RecyclerView.LayoutParams) viewHolder.itemView.getLayoutParams();
+            lp.height = customHeight.asPixel(viewHolder.itemView.getContext());
+            viewHolder.itemView.setLayoutParams(lp);
+        }
+
+        //set the identifier from the drawerItem here. It can be used to run tests
+        viewHolder.itemView.setId(hashCode());
+
+        //set the item enabled if it is
+        viewHolder.itemView.setEnabled(isEnabled());
+
+        //set the icon
+        ImageHolder.applyToOrSetInvisible(getIcon(), viewHolder.icon);
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends RecyclerView.ViewHolder {
+        private ImageView icon;
+
+        public ViewHolder(View view) {
+            super(view);
+            this.icon = (ImageView) view.findViewById(R.id.material_drawer_icon);
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/PrimaryDrawerItem.java

@@ -0,0 +1,8 @@
+package com.mikepenz.materialdrawer.model;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class PrimaryDrawerItem extends AbstractBadgeableDrawerItem<PrimaryDrawerItem> {
+
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/ProfileDrawerItem.java

@@ -0,0 +1,365 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import android.content.res.ColorStateList;
+import android.graphics.Bitmap;
+import android.graphics.Typeface;
+import android.graphics.drawable.Drawable;
+import android.net.Uri;
+import android.util.Pair;
+import android.view.View;
+import android.widget.ImageView;
+import android.widget.TextView;
+
+import com.mikepenz.iconics.typeface.IIcon;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+import com.mikepenz.materialdrawer.holder.ImageHolder;
+import com.mikepenz.materialdrawer.holder.StringHolder;
+import com.mikepenz.materialdrawer.model.interfaces.IProfile;
+import com.mikepenz.materialdrawer.model.interfaces.Tagable;
+import com.mikepenz.materialdrawer.model.interfaces.Typefaceable;
+import com.mikepenz.materialdrawer.util.DrawerImageLoader;
+import com.mikepenz.materialdrawer.util.DrawerUIUtils;
+
+import java.util.List;
+
+import androidx.annotation.ColorInt;
+import androidx.annotation.ColorRes;
+import androidx.annotation.DrawableRes;
+import androidx.annotation.LayoutRes;
+import androidx.annotation.StringRes;
+import androidx.recyclerview.widget.RecyclerView;
+
+import static com.mikepenz.materialdrawer.util.DrawerUIUtils.getBooleanStyleable;
+import static com.mikepenz.materialdrawer.util.DrawerUIUtils.themeDrawerItem;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class ProfileDrawerItem extends AbstractDrawerItem<ProfileDrawerItem, ProfileDrawerItem.ViewHolder> implements IProfile<ProfileDrawerItem>, Tagable<ProfileDrawerItem>, Typefaceable<ProfileDrawerItem> {
+    protected boolean nameShown = false;
+
+    protected ImageHolder icon;
+
+    protected StringHolder name;
+    protected StringHolder email;
+
+    protected ColorHolder selectedColor;
+    protected ColorHolder textColor;
+    protected ColorHolder selectedTextColor;
+    protected ColorHolder disabledTextColor;
+
+    protected Typeface typeface = null;
+
+    @Override
+    public ProfileDrawerItem withIcon(Drawable icon) {
+        this.icon = new ImageHolder(icon);
+        return this;
+    }
+
+    @Override
+    public ProfileDrawerItem withIcon(@DrawableRes int iconRes) {
+        this.icon = new ImageHolder(iconRes);
+        return this;
+    }
+
+    @Override
+    public ProfileDrawerItem withIcon(Bitmap iconBitmap) {
+        this.icon = new ImageHolder(iconBitmap);
+        return this;
+    }
+
+    @Override
+    public ProfileDrawerItem withIcon(IIcon icon) {
+        this.icon = new ImageHolder(icon);
+        return this;
+    }
+
+    @Override
+    public ProfileDrawerItem withIcon(String url) {
+        this.icon = new ImageHolder(url);
+        return this;
+    }
+
+    @Override
+    public ProfileDrawerItem withIcon(Uri uri) {
+        this.icon = new ImageHolder(uri);
+        return this;
+    }
+
+    public ProfileDrawerItem withName(CharSequence name) {
+        this.name = new StringHolder(name);
+        return this;
+    }
+
+    public ProfileDrawerItem withName(@StringRes int nameRes) {
+        this.name = new StringHolder(nameRes);
+        return this;
+    }
+
+    public ProfileDrawerItem withEmail(String email) {
+        this.email = new StringHolder(email);
+        return this;
+    }
+
+    public ProfileDrawerItem withEmail(@StringRes int emailRes) {
+        this.email = new StringHolder(emailRes);
+        return this;
+    }
+
+  /**
+   * Whether to show the profile name in the account switcher.
+   *
+   * @param nameShown show name in switcher
+   * @return the {@link ProfileDrawerItem}
+   */
+    public ProfileDrawerItem withNameShown(boolean nameShown) {
+        this.nameShown = nameShown;
+        return this;
+    }
+
+    public ProfileDrawerItem withSelectedColor(@ColorInt int selectedColor) {
+        this.selectedColor = ColorHolder.fromColor(selectedColor);
+        return this;
+    }
+
+    public ProfileDrawerItem withSelectedColorRes(@ColorRes int selectedColorRes) {
+        this.selectedColor = ColorHolder.fromColorRes(selectedColorRes);
+        return this;
+    }
+
+    public ProfileDrawerItem withTextColor(@ColorInt int textColor) {
+        this.textColor = ColorHolder.fromColor(textColor);
+        return this;
+    }
+
+    public ProfileDrawerItem withTextColorRes(@ColorRes int textColorRes) {
+        this.textColor = ColorHolder.fromColorRes(textColorRes);
+        return this;
+    }
+
+    public ProfileDrawerItem withSelectedTextColor(@ColorInt int selectedTextColor) {
+        this.selectedTextColor = ColorHolder.fromColor(selectedTextColor);
+        return this;
+    }
+
+    public ProfileDrawerItem withSelectedTextColorRes(@ColorRes int selectedColorRes) {
+        this.selectedTextColor = ColorHolder.fromColorRes(selectedColorRes);
+        return this;
+    }
+
+    public ProfileDrawerItem withDisabledTextColor(@ColorInt int disabledTextColor) {
+        this.disabledTextColor = ColorHolder.fromColor(disabledTextColor);
+        return this;
+    }
+
+    public ProfileDrawerItem withDisabledTextColorRes(@ColorRes int disabledTextColorRes) {
+        this.disabledTextColor = ColorHolder.fromColorRes(disabledTextColorRes);
+        return this;
+    }
+
+    public ProfileDrawerItem withTypeface(Typeface typeface) {
+        this.typeface = typeface;
+        return this;
+    }
+
+    public boolean isNameShown() {
+        return nameShown;
+    }
+
+    public ColorHolder getSelectedColor() {
+        return selectedColor;
+    }
+
+    public ColorHolder getTextColor() {
+        return textColor;
+    }
+
+    public ColorHolder getSelectedTextColor() {
+        return selectedTextColor;
+    }
+
+    public ColorHolder getDisabledTextColor() {
+        return disabledTextColor;
+    }
+
+    @Override
+    public Typeface getTypeface() {
+        return typeface;
+    }
+
+    public ImageHolder getIcon() {
+        return icon;
+    }
+
+    @Override
+    public StringHolder getName() {
+        return name;
+    }
+
+    public StringHolder getEmail() {
+        return email;
+    }
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_profile;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_profile;
+    }
+
+    @Override
+    public void bindView(ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        Context ctx = viewHolder.itemView.getContext();
+
+        //set the identifier from the drawerItem here. It can be used to run tests
+        viewHolder.itemView.setId(hashCode());
+
+        //set the item enabled if it is
+        viewHolder.itemView.setEnabled(isEnabled());
+
+        //set the item selected if it is
+        viewHolder.itemView.setSelected(isSelected());
+
+        //get the correct color for the background
+        int selectedColor = getSelectedColor(ctx);
+        //get the correct color for the text
+        int color = getColor(ctx);
+        int secondaryColor = getSecondaryColor(ctx);
+        int selectedTextColor = getSelectedTextColor(ctx);
+
+        //set the background for the item
+        themeDrawerItem(ctx, viewHolder.view, selectedColor, isSelectedBackgroundAnimated());
+
+        if (nameShown) {
+            viewHolder.name.setVisibility(View.VISIBLE);
+            StringHolder.applyTo(this.getName(), viewHolder.name);
+        } else {
+            viewHolder.name.setVisibility(View.GONE);
+        }
+        //the MaterialDrawer follows the Google Apps. those only show the e-mail
+        //within the profile switcher. The problem this causes some confusion for
+        //some developers. And if you only set the name, the item would be empty
+        //so here's a small fallback which will prevent this issue of empty items ;)
+        if (!nameShown && this.getEmail() == null && this.getName() != null) {
+            StringHolder.applyTo(this.getName(), viewHolder.email);
+        } else {
+            StringHolder.applyTo(this.getEmail(), viewHolder.email);
+        }
+
+        if (getTypeface() != null) {
+            viewHolder.name.setTypeface(getTypeface());
+            viewHolder.email.setTypeface(getTypeface());
+        }
+
+        if (nameShown) {
+            viewHolder.name.setTextColor(getTextColorStateList(color, selectedTextColor));
+        }
+        viewHolder.email.setTextColor(getTextColorStateList(secondaryColor, selectedTextColor));
+
+        //cancel previous started image loading processes
+        DrawerImageLoader.getInstance().cancelImage(viewHolder.profileIcon);
+        //set the icon
+        ImageHolder.applyToOrSetInvisible(getIcon(), viewHolder.profileIcon, DrawerImageLoader.Tags.PROFILE_DRAWER_ITEM.name());
+
+        //for android API 17 --> Padding not applied via xml
+        DrawerUIUtils.setDrawerVerticalPadding(viewHolder.view);
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends RecyclerView.ViewHolder {
+        private View view;
+        private ImageView profileIcon;
+        private TextView name;
+        private TextView email;
+
+        private ViewHolder(View view) {
+            super(view);
+            this.view = view;
+            this.profileIcon = view.findViewById(R.id.material_drawer_profileIcon);
+            this.name = view.findViewById(R.id.material_drawer_name);
+            this.email = view.findViewById(R.id.material_drawer_email);
+        }
+    }
+
+    /**
+     * helper method to decide for the correct color
+     *
+     * @param ctx
+     * @return
+    */
+    protected int getSelectedColor(Context ctx) {
+        if (getBooleanStyleable(ctx, R.styleable.MaterialDrawer_material_drawer_legacy_style, false)) {
+            return ColorHolder.color(getSelectedColor(), ctx, R.attr.material_drawer_selected_legacy, R.color.material_drawer_selected_legacy);
+        } else {
+            return ColorHolder.color(getSelectedColor(), ctx, R.attr.material_drawer_selected, R.color.material_drawer_selected);
+        }
+    }
+
+    /**
+     * helper method to decide for the correct color
+     *
+     * @param ctx
+     * @return
+     */
+    protected int getColor(Context ctx) {
+        int color;
+        if (this.isEnabled()) {
+            color = ColorHolder.color(getTextColor(), ctx, R.attr.material_drawer_primary_text, R.color.material_drawer_primary_text);
+        } else {
+            color = ColorHolder.color(getDisabledTextColor(), ctx, R.attr.material_drawer_hint_text, R.color.material_drawer_hint_text);
+        }
+        return color;
+    }
+
+    protected int getSecondaryColor(Context ctx) {
+        int color;
+        if (this.isEnabled()) {
+            color = ColorHolder.color(getTextColor(), ctx, R.attr.material_drawer_secondary_text, R.color.material_drawer_secondary_text);
+        } else {
+            color = ColorHolder.color(getDisabledTextColor(), ctx, R.attr.material_drawer_hint_text, R.color.material_drawer_hint_text);
+        }
+        return color;
+    }
+
+    /**
+     * helper method to decide for the correct color
+     *
+     * @param ctx
+     * @return
+     */
+    protected int getSelectedTextColor(Context ctx) {
+        return ColorHolder.color(getSelectedTextColor(), ctx, R.attr.material_drawer_selected_text, R.color.material_drawer_selected_text);
+    }
+
+    protected Pair<Integer, ColorStateList> colorStateList;
+
+    /**
+     * helper to get the ColorStateList for the text and remembering it so we do not have to recreate it all the time
+     *
+     * @param color
+     * @param selectedTextColor
+     * @return
+     */
+    protected ColorStateList getTextColorStateList(@ColorInt int color, @ColorInt int selectedTextColor) {
+        if (colorStateList == null || color + selectedTextColor != colorStateList.first) {
+            colorStateList = new Pair<>(color + selectedTextColor, DrawerUIUtils.getTextColorStateList(color, selectedTextColor));
+        }
+
+        return colorStateList.second;
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/ProfileSettingDrawerItem.java

@@ -0,0 +1,318 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import android.graphics.Bitmap;
+import android.graphics.Typeface;
+import android.graphics.drawable.Drawable;
+import android.net.Uri;
+import android.view.View;
+import android.widget.ImageView;
+import android.widget.TextView;
+
+import com.mikepenz.iconics.typeface.IIcon;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+import com.mikepenz.materialdrawer.holder.ImageHolder;
+import com.mikepenz.materialdrawer.holder.StringHolder;
+import com.mikepenz.materialdrawer.model.interfaces.IProfile;
+import com.mikepenz.materialdrawer.model.interfaces.Tagable;
+import com.mikepenz.materialdrawer.model.interfaces.Typefaceable;
+import com.mikepenz.materialdrawer.util.DrawerUIUtils;
+import com.mikepenz.materialize.util.UIUtils;
+
+import java.util.List;
+
+import androidx.annotation.ColorInt;
+import androidx.annotation.ColorRes;
+import androidx.annotation.DrawableRes;
+import androidx.annotation.LayoutRes;
+import androidx.annotation.StringRes;
+import androidx.core.view.ViewCompat;
+import androidx.recyclerview.widget.RecyclerView;
+
+import static com.mikepenz.materialdrawer.util.DrawerUIUtils.getBooleanStyleable;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class ProfileSettingDrawerItem extends AbstractDrawerItem<ProfileSettingDrawerItem, ProfileSettingDrawerItem.ViewHolder> implements IProfile<ProfileSettingDrawerItem>, Tagable<ProfileSettingDrawerItem>, Typefaceable<ProfileSettingDrawerItem> {
+    private ImageHolder icon;
+
+    private StringHolder name;
+    private StringHolder description;
+
+    private boolean iconTinted = false;
+
+    private ColorHolder selectedColor;
+    private ColorHolder textColor;
+    private ColorHolder iconColor;
+    private ColorHolder descriptionTextColor;
+
+    private Typeface typeface = null;
+
+    private boolean selectable = false;
+
+    @Override
+    public ProfileSettingDrawerItem withIcon(Drawable icon) {
+        this.icon = new ImageHolder(icon);
+        return this;
+    }
+
+    @Override
+    public ProfileSettingDrawerItem withIcon(@DrawableRes int iconRes) {
+        this.icon = new ImageHolder(iconRes);
+        return this;
+    }
+
+    @Override
+    public ProfileSettingDrawerItem withIcon(Bitmap icon) {
+        this.icon = new ImageHolder(icon);
+        return this;
+    }
+
+    @Override
+    public ProfileSettingDrawerItem withIcon(IIcon iicon) {
+        this.icon = new ImageHolder(iicon);
+        return this;
+    }
+
+    @Override
+    public ProfileSettingDrawerItem withIcon(String url) {
+        this.icon = new ImageHolder(url);
+        return this;
+    }
+
+    @Override
+    public ProfileSettingDrawerItem withIcon(Uri uri) {
+        this.icon = new ImageHolder(uri);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withName(CharSequence name) {
+        this.name = new StringHolder(name);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withName(@StringRes int nameRes) {
+        this.name = new StringHolder(nameRes);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withDescription(String description) {
+        this.description = new StringHolder(description);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withDescription(@StringRes int descriptionRes) {
+        this.description = new StringHolder(descriptionRes);
+        return this;
+    }
+
+    //NOTE we reuse the IProfile here to allow custom items within the AccountSwitcher. There is an alias method withDescription for this
+    public ProfileSettingDrawerItem withEmail(String email) {
+        this.description = new StringHolder(email);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withSelectedColor(@ColorInt int selectedColor) {
+        this.selectedColor = ColorHolder.fromColor(selectedColor);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withSelectedColorRes(@ColorRes int selectedColorRes) {
+        this.selectedColor = ColorHolder.fromColorRes(selectedColorRes);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withTextColor(@ColorInt int textColor) {
+        this.textColor = ColorHolder.fromColor(textColor);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withTextColorRes(@ColorRes int textColorRes) {
+        this.textColor = ColorHolder.fromColorRes(textColorRes);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withDescriptionTextColor(@ColorInt int descriptionColor) {
+        this.descriptionTextColor = ColorHolder.fromColor(descriptionColor);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withDescriptionTextColorRes(@ColorRes int descriptionColorRes) {
+        this.descriptionTextColor = ColorHolder.fromColorRes(descriptionColorRes);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withIconColor(@ColorInt int iconColor) {
+        this.iconColor = ColorHolder.fromColor(iconColor);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withIconColorRes(@ColorRes int iconColorRes) {
+        this.iconColor = ColorHolder.fromColorRes(iconColorRes);
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withTypeface(Typeface typeface) {
+        this.typeface = typeface;
+        return this;
+    }
+
+    public ProfileSettingDrawerItem withIconTinted(boolean iconTinted) {
+        this.iconTinted = iconTinted;
+        return this;
+    }
+
+    public ColorHolder getSelectedColor() {
+        return selectedColor;
+    }
+
+    public ColorHolder getTextColor() {
+        return textColor;
+    }
+
+    public ColorHolder getDescriptionTextColor() {
+        return descriptionTextColor;
+    }
+
+    public ColorHolder getIconColor() {
+        return iconColor;
+    }
+
+
+    public ImageHolder getIcon() {
+        return icon;
+    }
+
+    public boolean isIconTinted() {
+        return iconTinted;
+    }
+
+    public void setIconTinted(boolean iconTinted) {
+        this.iconTinted = iconTinted;
+    }
+
+    @Override
+    public Typeface getTypeface() {
+        return typeface;
+    }
+
+    @Override
+    public StringHolder getName() {
+        return name;
+    }
+
+    public StringHolder getEmail() {
+        return description;
+    }
+
+    public StringHolder getDescription() {
+        return description;
+    }
+
+    public void setDescription(String description) {
+        this.description = new StringHolder(description);
+    }
+
+    @Override
+    public boolean isSelectable() {
+        return selectable;
+    }
+
+    public ProfileSettingDrawerItem withSelectable(boolean selectable) {
+        this.selectable = selectable;
+        return this;
+    }
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_profile_setting;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_profile_setting;
+    }
+
+    @Override
+    public void bindView(ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        //get the context
+        Context ctx = viewHolder.itemView.getContext();
+
+        //set the identifier from the drawerItem here. It can be used to run tests
+        viewHolder.itemView.setId(hashCode());
+
+        //set the item enabled if it is
+        viewHolder.itemView.setEnabled(isEnabled());
+
+        //set the item selected if it is
+        viewHolder.itemView.setSelected(isSelected());
+
+        //get the correct color for the background
+        int selectedColor = getSelectedColor(ctx);
+        //get the correct color for the text
+        int color = ColorHolder.color(getTextColor(), ctx, R.attr.material_drawer_primary_text, R.color.material_drawer_primary_text);
+        int iconColor = ColorHolder.color(getIconColor(), ctx, R.attr.material_drawer_primary_icon, R.color.material_drawer_primary_icon);
+        int descriptionColor = ColorHolder.color(getDescriptionTextColor(), ctx, R.attr.material_drawer_primary_text, R.color.material_drawer_primary_text);
+
+        ViewCompat.setBackground(viewHolder.view, UIUtils.getSelectableBackground(ctx, selectedColor, isSelectedBackgroundAnimated()));
+
+        StringHolder.applyTo(this.getName(), viewHolder.name);
+        viewHolder.name.setTextColor(color);
+
+        StringHolder.applyToOrHide(this.getDescription(), viewHolder.description);
+        viewHolder.description.setTextColor(descriptionColor);
+
+        if (getTypeface() != null) {
+            viewHolder.name.setTypeface(getTypeface());
+            viewHolder.description.setTypeface(getTypeface());
+        }
+
+        //set the correct icon
+        ImageHolder.applyDecidedIconOrSetGone(icon, viewHolder.icon, iconColor, isIconTinted(), 2);
+
+        //for android API 17 --> Padding not applied via xml
+        DrawerUIUtils.setDrawerVerticalPadding(viewHolder.view);
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    /**
+     * helper method to decide for the correct color
+     *
+     * @param ctx
+     * @return
+     */
+    protected int getSelectedColor(Context ctx) {
+        if (getBooleanStyleable(ctx, R.styleable.MaterialDrawer_material_drawer_legacy_style, false)) {
+            return ColorHolder.color(getSelectedColor(), ctx, R.attr.material_drawer_selected_legacy, R.color.material_drawer_selected_legacy);
+        } else {
+            return ColorHolder.color(getSelectedColor(), ctx, R.attr.material_drawer_selected, R.color.material_drawer_selected);
+        }
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends RecyclerView.ViewHolder {
+        private View view;
+        private ImageView icon;
+        private TextView name;
+        private TextView description;
+
+        private ViewHolder(View view) {
+            super(view);
+            this.view = view;
+            this.icon = (ImageView) view.findViewById(R.id.material_drawer_icon);
+            this.name = (TextView) view.findViewById(R.id.material_drawer_name);
+            this.description = (TextView) view.findViewById(R.id.material_drawer_description);
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/SecondaryDrawerItem.java

@@ -0,0 +1,42 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import androidx.annotation.LayoutRes;
+
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class SecondaryDrawerItem extends AbstractBadgeableDrawerItem<SecondaryDrawerItem> {
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_secondary;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_secondary;
+    }
+
+    /**
+     * helper method to decide for the correct color
+     * OVERWRITE to get the correct secondary color
+     *
+     * @param ctx
+     * @return
+     */
+    @Override
+    protected int getColor(Context ctx) {
+        int color;
+        if (this.isEnabled()) {
+            color = ColorHolder.color(getTextColor(), ctx, R.attr.material_drawer_secondary_text, R.color.material_drawer_secondary_text);
+        } else {
+            color = ColorHolder.color(getDisabledTextColor(), ctx, R.attr.material_drawer_hint_text, R.color.material_drawer_hint_text);
+        }
+        return color;
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/SecondarySwitchDrawerItem.java

@@ -0,0 +1,42 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import androidx.annotation.LayoutRes;
+
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class SecondarySwitchDrawerItem extends AbstractSwitchableDrawerItem<SecondarySwitchDrawerItem> {
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_secondary_switch;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_secondary_switch;
+    }
+
+    /**
+     * helper method to decide for the correct color
+     * OVERWRITE to get the correct secondary color
+     *
+     * @param ctx
+     * @return
+     */
+    @Override
+    protected int getColor(Context ctx) {
+        int color;
+        if (this.isEnabled()) {
+            color = ColorHolder.color(getTextColor(), ctx, R.attr.material_drawer_secondary_text, R.color.material_drawer_secondary_text);
+        } else {
+            color = ColorHolder.color(getDisabledTextColor(), ctx, R.attr.material_drawer_hint_text, R.color.material_drawer_hint_text);
+        }
+        return color;
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/SecondaryToggleDrawerItem.java

@@ -0,0 +1,42 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import androidx.annotation.LayoutRes;
+
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class SecondaryToggleDrawerItem extends AbstractToggleableDrawerItem<SecondaryToggleDrawerItem> {
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_secondary_toggle;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_secondary_toggle;
+    }
+
+    /**
+     * helper method to decide for the correct color
+     * OVERWRITE to get the correct secondary color
+     *
+     * @param ctx
+     * @return
+     */
+    @Override
+    protected int getColor(Context ctx) {
+        int color;
+        if (this.isEnabled()) {
+            color = ColorHolder.color(getTextColor(), ctx, R.attr.material_drawer_secondary_text, R.color.material_drawer_secondary_text);
+        } else {
+            color = ColorHolder.color(getDisabledTextColor(), ctx, R.attr.material_drawer_hint_text, R.color.material_drawer_hint_text);
+        }
+        return color;
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/SectionDrawerItem.java

@@ -0,0 +1,160 @@
+package com.mikepenz.materialdrawer.model;
+
+import android.content.Context;
+import android.graphics.Typeface;
+import androidx.annotation.LayoutRes;
+import androidx.annotation.StringRes;
+import androidx.recyclerview.widget.RecyclerView;
+import android.view.View;
+import android.widget.TextView;
+
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+import com.mikepenz.materialdrawer.holder.StringHolder;
+import com.mikepenz.materialdrawer.model.interfaces.Nameable;
+import com.mikepenz.materialdrawer.model.interfaces.Typefaceable;
+import com.mikepenz.materialize.util.UIUtils;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class SectionDrawerItem extends AbstractDrawerItem<SectionDrawerItem, SectionDrawerItem.ViewHolder> implements Nameable<SectionDrawerItem>, Typefaceable<SectionDrawerItem> {
+
+    private StringHolder name;
+    private boolean divider = true;
+
+    private ColorHolder textColor;
+
+    private Typeface typeface = null;
+
+    public SectionDrawerItem withName(StringHolder name) {
+        this.name = name;
+        return this;
+    }
+
+    public SectionDrawerItem withName(String name) {
+        this.name = new StringHolder(name);
+        return this;
+    }
+
+    public SectionDrawerItem withName(@StringRes int nameRes) {
+        this.name = new StringHolder(nameRes);
+        return this;
+    }
+
+    public SectionDrawerItem withDivider(boolean divider) {
+        this.divider = divider;
+        return this;
+    }
+
+    public SectionDrawerItem withTextColor(int textColor) {
+        this.textColor = ColorHolder.fromColor(textColor);
+        return this;
+    }
+
+    public SectionDrawerItem withTextColorRes(int textColorRes) {
+        this.textColor = ColorHolder.fromColorRes(textColorRes);
+        return this;
+    }
+
+    public SectionDrawerItem withTypeface(Typeface typeface) {
+        this.typeface = typeface;
+        return this;
+    }
+
+    public boolean hasDivider() {
+        return divider;
+    }
+
+    public ColorHolder getTextColor() {
+        return textColor;
+    }
+
+    public StringHolder getName() {
+        return name;
+    }
+
+    @Override
+    public boolean isEnabled() {
+        return false;
+    }
+
+    @Override
+    public boolean isSelected() {
+        return false;
+    }
+
+    @Override
+    public int getType() {
+        return R.id.material_drawer_item_section;
+    }
+
+    @Override
+    @LayoutRes
+    public int getLayoutRes() {
+        return R.layout.material_drawer_item_section;
+    }
+
+    @Override
+    public Typeface getTypeface() {
+        return typeface;
+    }
+
+    @Override
+    public void bindView(ViewHolder viewHolder, List payloads) {
+        super.bindView(viewHolder, payloads);
+
+        Context ctx = viewHolder.itemView.getContext();
+
+        //set the identifier from the drawerItem here. It can be used to run tests
+        viewHolder.itemView.setId(hashCode());
+
+        //define this item to be not clickable nor enabled
+        viewHolder.view.setClickable(false);
+        viewHolder.view.setEnabled(false);
+
+        //define the text color
+        viewHolder.name.setTextColor(ColorHolder.color(getTextColor(), ctx, R.attr.material_drawer_secondary_text, R.color.material_drawer_secondary_text));
+
+        //set the text for the name
+        StringHolder.applyTo(this.getName(), viewHolder.name);
+
+        //define the typeface for our textViews
+        if (getTypeface() != null) {
+            viewHolder.name.setTypeface(getTypeface());
+        }
+
+        //hide the divider if we do not need one
+        if (this.hasDivider()) {
+            viewHolder.divider.setVisibility(View.VISIBLE);
+        } else {
+            viewHolder.divider.setVisibility(View.GONE);
+        }
+
+        //set the color for the divider
+        viewHolder.divider.setBackgroundColor(UIUtils.getThemeColorFromAttrOrRes(ctx, R.attr.material_drawer_divider, R.color.material_drawer_divider));
+
+        //call the onPostBindView method to trigger post bind view actions (like the listener to modify the item if required)
+        onPostBindView(this, viewHolder.itemView);
+    }
+
+    @Override
+    public ViewHolder getViewHolder(View v) {
+        return new ViewHolder(v);
+    }
+
+    public static class ViewHolder extends RecyclerView.ViewHolder {
+        private View view;
+        private View divider;
+        private TextView name;
+
+        private ViewHolder(View view) {
+            super(view);
+            this.view = view;
+            this.divider = view.findViewById(R.id.material_drawer_divider);
+            this.name = (TextView) view.findViewById(R.id.material_drawer_name);
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/SwitchDrawerItem.java

@@ -0,0 +1,8 @@
+package com.mikepenz.materialdrawer.model;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class SwitchDrawerItem extends AbstractSwitchableDrawerItem<SwitchDrawerItem> {
+
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/ToggleDrawerItem.java

@@ -0,0 +1,8 @@
+package com.mikepenz.materialdrawer.model;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public class ToggleDrawerItem extends AbstractToggleableDrawerItem<ToggleDrawerItem> {
+
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/interfaces/Badgeable.java

@@ -0,0 +1,16 @@
+package com.mikepenz.materialdrawer.model.interfaces;
+
+import com.mikepenz.materialdrawer.holder.StringHolder;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public interface Badgeable<T> {
+    T withBadge(String badge);
+
+    T withBadge(int badgeRes);
+
+    T withBadge(StringHolder badgeRes);
+
+    StringHolder getBadge();
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/interfaces/ColorfulBadgeable.java

@@ -0,0 +1,13 @@
+package com.mikepenz.materialdrawer.model.interfaces;
+
+import com.mikepenz.materialdrawer.holder.BadgeStyle;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public interface ColorfulBadgeable<T> extends Badgeable<T> {
+    T withBadgeStyle(BadgeStyle badgeStyle);
+
+    BadgeStyle getBadgeStyle();
+
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/interfaces/IDrawerItem.java

@@ -0,0 +1,48 @@
+package com.mikepenz.materialdrawer.model.interfaces;
+
+import android.content.Context;
+import androidx.recyclerview.widget.RecyclerView;
+import android.view.View;
+import android.view.ViewGroup;
+
+import com.mikepenz.fastadapter.IExpandable;
+import com.mikepenz.fastadapter.IItem;
+import com.mikepenz.fastadapter.ISubItem;
+
+import java.util.List;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public interface IDrawerItem<T, VH extends RecyclerView.ViewHolder> extends IItem<T, VH>, IExpandable<T, IDrawerItem>, ISubItem<IDrawerItem, IDrawerItem> {
+
+    Object getTag();
+
+    boolean isEnabled();
+
+    boolean isSelected();
+
+    T withSetSelected(boolean selected);
+
+    boolean isSelectable();
+
+    boolean isExcludeFromMiniDrawer();
+
+    T withSelectable(boolean selectable);
+
+    int getType();
+
+    int getLayoutRes();
+
+    View generateView(Context ctx);
+
+    View generateView(Context ctx, ViewGroup parent);
+
+    VH getViewHolder(ViewGroup parent);
+
+    void unbindView(VH holder);
+
+    void bindView(VH holder, List<Object> payloads);
+
+    boolean equals(long id);
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/interfaces/IProfile.java

@@ -0,0 +1,42 @@
+package com.mikepenz.materialdrawer.model.interfaces;
+
+import android.graphics.Bitmap;
+import android.graphics.drawable.Drawable;
+import android.net.Uri;
+import androidx.annotation.DrawableRes;
+
+import com.mikepenz.fastadapter.IIdentifyable;
+import com.mikepenz.iconics.typeface.IIcon;
+import com.mikepenz.materialdrawer.holder.ImageHolder;
+import com.mikepenz.materialdrawer.holder.StringHolder;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public interface IProfile<T> extends IIdentifyable<T> {
+    T withName(CharSequence name);
+
+    StringHolder getName();
+
+    T withEmail(String email);
+
+    StringHolder getEmail();
+
+    T withIcon(Drawable icon);
+
+    T withIcon(Bitmap bitmap);
+
+    T withIcon(@DrawableRes int iconRes);
+
+    T withIcon(String url);
+
+    T withIcon(Uri uri);
+
+    T withIcon(IIcon icon);
+
+    ImageHolder getIcon();
+
+    T withSelectable(boolean selectable);
+
+    boolean isSelectable();
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/interfaces/Iconable.java

@@ -0,0 +1,19 @@
+package com.mikepenz.materialdrawer.model.interfaces;
+
+import android.graphics.drawable.Drawable;
+
+import com.mikepenz.iconics.typeface.IIcon;
+import com.mikepenz.materialdrawer.holder.ImageHolder;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public interface Iconable<T> {
+    T withIcon(Drawable icon);
+
+    T withIcon(IIcon iicon);
+
+    T withIcon(ImageHolder icon);
+
+    ImageHolder getIcon();
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/interfaces/Nameable.java

@@ -0,0 +1,16 @@
+package com.mikepenz.materialdrawer.model.interfaces;
+
+import com.mikepenz.materialdrawer.holder.StringHolder;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public interface Nameable<T> {
+    T withName(String name);
+
+    T withName(int nameRes);
+
+    T withName(StringHolder name);
+
+    StringHolder getName();
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/interfaces/OnPostBindViewListener.java

@@ -0,0 +1,16 @@
+package com.mikepenz.materialdrawer.model.interfaces;
+
+import android.view.View;
+
+/**
+ * Created by mikepenz on 21.08.15.
+ */
+public interface OnPostBindViewListener {
+    /**
+     * allows you to hook in the BindView method and modify the view after binding
+     *
+     * @param drawerItem the drawerItem used for this view
+     * @param view       the view which will be set
+     */
+    void onBindView(IDrawerItem drawerItem, View view);
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/interfaces/Selectable.java

@@ -0,0 +1,10 @@
+package com.mikepenz.materialdrawer.model.interfaces;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public interface Selectable<T> {
+    T withSelectable(boolean selectable);
+
+    boolean isSelectable();
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/interfaces/Tagable.java

@@ -0,0 +1,10 @@
+package com.mikepenz.materialdrawer.model.interfaces;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public interface Tagable<T> {
+    T withTag(Object tag);
+
+    Object getTag();
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/interfaces/Typefaceable.java

@@ -0,0 +1,12 @@
+package com.mikepenz.materialdrawer.model.interfaces;
+
+import android.graphics.Typeface;
+
+/**
+ * Created by mikepenz on 03.02.15.
+ */
+public interface Typefaceable<T> {
+    T withTypeface(Typeface typeface);
+
+    Typeface getTypeface();
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/model/utils/BadgeDrawableBuilder.java

@@ -0,0 +1,44 @@
+package com.mikepenz.materialdrawer.model.utils;
+
+import android.content.Context;
+import android.graphics.drawable.GradientDrawable;
+import android.graphics.drawable.StateListDrawable;
+import androidx.appcompat.content.res.AppCompatResources;
+import android.util.StateSet;
+
+import com.mikepenz.materialdrawer.holder.BadgeStyle;
+import com.mikepenz.materialdrawer.holder.ColorHolder;
+
+/**
+ * Created by mikepenz on 02.07.15.
+ */
+public class BadgeDrawableBuilder {
+    private BadgeStyle mStyle;
+
+    public BadgeDrawableBuilder(BadgeStyle style) {
+        this.mStyle = style;
+    }
+
+    public StateListDrawable build(Context ctx) {
+        StateListDrawable stateListDrawable = new StateListDrawable();
+        GradientDrawable normal = (GradientDrawable) AppCompatResources.getDrawable(ctx, mStyle.getGradientDrawable());
+        GradientDrawable selected = (GradientDrawable) normal.getConstantState().newDrawable().mutate();
+
+        ColorHolder.applyToOrTransparent(mStyle.getColor(), ctx, normal);
+        if (mStyle.getColorPressed() == null) {
+            ColorHolder.applyToOrTransparent(mStyle.getColor(), ctx, selected);
+        } else {
+            ColorHolder.applyToOrTransparent(mStyle.getColorPressed(), ctx, selected);
+        }
+
+        if (mStyle.getCorners() != null) {
+            normal.setCornerRadius(mStyle.getCorners().asPixel(ctx));
+            selected.setCornerRadius(mStyle.getCorners().asPixel(ctx));
+        }
+
+        stateListDrawable.addState(new int[]{android.R.attr.state_pressed}, selected);
+        stateListDrawable.addState(StateSet.WILD_CARD, normal);
+
+        return stateListDrawable;
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/util/AbstractDrawerImageLoader.java

@@ -0,0 +1,34 @@
+package com.mikepenz.materialdrawer.util;
+
+import android.content.Context;
+import android.graphics.drawable.Drawable;
+import android.net.Uri;
+import android.util.Log;
+import android.widget.ImageView;
+
+public abstract class AbstractDrawerImageLoader implements DrawerImageLoader.IDrawerImageLoader {
+    @Override
+    public void set(ImageView imageView, Uri uri, Drawable placeholder) {
+    }
+
+    @Override
+    public void set(ImageView imageView, Uri uri, Drawable placeholder, String tag) {
+        //for backwards compatibility call the method without tag too
+        set(imageView, uri, placeholder);
+        //this won't do anything
+        Log.i("MaterialDrawer", "You have not specified a ImageLoader implementation through the DrawerImageLoader.init() method, or you are still overriding the deprecated method set(ImageView iv, Uri u, Drawable d) instead of set(ImageView iv, Uri u, Drawable d, String tag)");
+    }
+    @Override
+    public void cancel(ImageView imageView) {
+    }
+
+    @Override
+    public Drawable placeholder(Context ctx) {
+        return DrawerUIUtils.getPlaceHolder(ctx);
+    }
+
+    @Override
+    public Drawable placeholder(Context ctx, String tag) {
+        return placeholder(ctx);
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/util/DrawerImageLoader.java

@@ -0,0 +1,94 @@
+package com.mikepenz.materialdrawer.util;
+
+import android.content.Context;
+import android.graphics.drawable.Drawable;
+import android.net.Uri;
+import android.widget.ImageView;
+
+/**
+ * Created by mikepenz on 24.03.15.
+ */
+public class DrawerImageLoader {
+    public enum Tags {
+        PROFILE,
+        PROFILE_DRAWER_ITEM,
+        ACCOUNT_HEADER
+    }
+
+    private static DrawerImageLoader SINGLETON = null;
+
+    private IDrawerImageLoader imageLoader;
+    private boolean mHandleAllUris = false;
+
+    private DrawerImageLoader(IDrawerImageLoader loaderImpl) {
+        imageLoader = loaderImpl;
+    }
+
+    public static DrawerImageLoader init(IDrawerImageLoader loaderImpl) {
+        SINGLETON = new DrawerImageLoader(loaderImpl);
+        return SINGLETON;
+    }
+
+    public static DrawerImageLoader getInstance() {
+        if (SINGLETON == null) {
+            SINGLETON = new DrawerImageLoader(new AbstractDrawerImageLoader() {
+            });
+        }
+        return SINGLETON;
+    }
+
+    public DrawerImageLoader withHandleAllUris(boolean handleAllUris) {
+        this.mHandleAllUris = handleAllUris;
+        return this;
+    }
+
+    /**
+     * @param imageView
+     * @param uri
+     * @param tag
+     * @return false if not consumed
+     */
+    public boolean setImage(ImageView imageView, Uri uri, String tag) {
+        //if we do not handle all uris and are not http or https we keep the original behavior
+        if (mHandleAllUris || "http".equals(uri.getScheme()) || "https".equals(uri.getScheme())) {
+            if (imageLoader != null) {
+                Drawable placeHolder = imageLoader.placeholder(imageView.getContext(), tag);
+                imageLoader.set(imageView, uri, placeHolder, tag);
+            }
+            return true;
+        }
+        return false;
+    }
+
+    public void cancelImage(ImageView imageView) {
+        if (imageLoader != null) {
+            imageLoader.cancel(imageView);
+        }
+    }
+
+    public IDrawerImageLoader getImageLoader() {
+        return imageLoader;
+    }
+
+    public void setImageLoader(IDrawerImageLoader imageLoader) {
+        this.imageLoader = imageLoader;
+    }
+
+    public interface IDrawerImageLoader {
+        @Deprecated
+        void set(ImageView imageView, Uri uri, Drawable placeholder);
+
+        void set(ImageView imageView, Uri uri, Drawable placeholder, String tag);
+
+        void cancel(ImageView imageView);
+
+        Drawable placeholder(Context ctx);
+
+        /**
+         * @param ctx
+         * @param tag current possible tags: "profile", "profileDrawerItem", "accountHeader"
+         * @return
+         */
+        Drawable placeholder(Context ctx, String tag);
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/util/DrawerItemViewHelper.java

@@ -0,0 +1,95 @@
+package com.mikepenz.materialdrawer.util;
+
+import android.content.Context;
+import android.view.View;
+import android.view.ViewGroup;
+import android.widget.LinearLayout;
+
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.model.interfaces.IDrawerItem;
+import com.mikepenz.materialize.util.UIUtils;
+
+import java.util.ArrayList;
+import java.util.Collections;
+
+/**
+ * Created by mikepenz on 27.03.15.
+ */
+public class DrawerItemViewHelper {
+
+    private Context mContext;
+
+    public DrawerItemViewHelper(Context context) {
+        this.mContext = context;
+    }
+
+    private ArrayList<IDrawerItem> mDrawerItems = new ArrayList<>();
+
+    public DrawerItemViewHelper withDrawerItems(ArrayList<IDrawerItem> drawerItems) {
+        this.mDrawerItems = drawerItems;
+        return this;
+    }
+
+    public DrawerItemViewHelper withDrawerItems(IDrawerItem... drawerItems) {
+        Collections.addAll(this.mDrawerItems, drawerItems);
+        return this;
+    }
+
+    private boolean mDivider = true;
+
+    public DrawerItemViewHelper withDivider(boolean divider) {
+        this.mDivider = divider;
+        return this;
+    }
+
+    private OnDrawerItemClickListener mOnDrawerItemClickListener = null;
+
+    public DrawerItemViewHelper withOnDrawerItemClickListener(OnDrawerItemClickListener onDrawerItemClickListener) {
+        mOnDrawerItemClickListener = onDrawerItemClickListener;
+        return this;
+    }
+
+    public View build() {
+        //create the container view
+        LinearLayout linearLayout = new LinearLayout(mContext);
+        linearLayout.setLayoutParams(new LinearLayout.LayoutParams(ViewGroup.LayoutParams.MATCH_PARENT, ViewGroup.LayoutParams.WRAP_CONTENT));
+        linearLayout.setOrientation(LinearLayout.VERTICAL);
+
+        //create the divider
+        if (mDivider) {
+            LinearLayout divider = new LinearLayout(mContext);
+            divider.setLayoutParams(new LinearLayout.LayoutParams(ViewGroup.LayoutParams.MATCH_PARENT, ViewGroup.LayoutParams.WRAP_CONTENT));
+            divider.setMinimumHeight((int) UIUtils.convertDpToPixel(1, mContext));
+            divider.setOrientation(LinearLayout.VERTICAL);
+            divider.setBackgroundColor(UIUtils.getThemeColorFromAttrOrRes(mContext, R.attr.material_drawer_divider, R.color.material_drawer_divider));
+            linearLayout.addView(divider);
+        }
+
+        //add all drawer items
+        for (IDrawerItem drawerItem : mDrawerItems) {
+            View view = drawerItem.generateView(mContext);
+            view.setTag(drawerItem);
+
+            if (drawerItem.isEnabled()) {
+                view.setBackgroundResource(UIUtils.getSelectableBackgroundRes(mContext));
+                view.setOnClickListener(new View.OnClickListener() {
+                    @Override
+                    public void onClick(View v) {
+                        if (mOnDrawerItemClickListener != null) {
+                            mOnDrawerItemClickListener.onItemClick(v, (IDrawerItem) v.getTag(R.id.material_drawer_item));
+                        }
+                    }
+                });
+            }
+
+            linearLayout.addView(view);
+        }
+
+        return linearLayout;
+    }
+
+
+    public interface OnDrawerItemClickListener {
+        public void onItemClick(View view, IDrawerItem drawerItem);
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/util/DrawerUIUtils.java

@@ -0,0 +1,242 @@
+package com.mikepenz.materialdrawer.util;
+
+import android.annotation.SuppressLint;
+import android.content.Context;
+import android.content.res.ColorStateList;
+import android.content.res.Configuration;
+import android.content.res.TypedArray;
+import android.graphics.Color;
+import android.graphics.drawable.ColorDrawable;
+import android.graphics.drawable.Drawable;
+import android.graphics.drawable.GradientDrawable;
+import android.graphics.drawable.InsetDrawable;
+import android.graphics.drawable.RippleDrawable;
+import android.graphics.drawable.StateListDrawable;
+import android.os.Build;
+import android.util.DisplayMetrics;
+import android.view.View;
+import android.view.WindowManager;
+
+import androidx.annotation.StyleableRes;
+import androidx.core.view.ViewCompat;
+
+import com.mikepenz.iconics.IconicsDrawable;
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.icons.MaterialDrawerFont;
+import com.mikepenz.materialize.util.UIUtils;
+
+/**
+ * Created by mikepenz on 15.03.14.
+ */
+@SuppressLint("InlinedApi")
+public class DrawerUIUtils {
+
+    /**
+     * Get the boolean value of a given styleable.
+     *
+     * @param ctx
+     * @param styleable
+     * @param def
+     * @return
+     */
+    public static boolean getBooleanStyleable(Context ctx, @StyleableRes int styleable, boolean def) {
+        TypedArray ta = ctx.getTheme().obtainStyledAttributes(R.styleable.MaterialDrawer);
+        return ta.getBoolean(styleable, def);
+    }
+
+    /**
+     * Util method to theme the drawer item view's background (and foreground if possible)
+     *
+     * @param ctx            the context to use
+     * @param view           the view to theme
+     * @param selected_color the selected color to use
+     * @param animate        true if we want to animate the StateListDrawable
+     */
+    public static void themeDrawerItem(Context ctx, View view, int selected_color, boolean animate) {
+        boolean legacyStyle = getBooleanStyleable(ctx, R.styleable.MaterialDrawer_material_drawer_legacy_style, false);
+
+        Drawable selected;
+        Drawable unselected;
+
+        if (legacyStyle) {
+            // Material 1.0 styling
+            selected = new ColorDrawable(selected_color);
+            unselected = UIUtils.getSelectableBackground(ctx);
+        } else {
+            // Material 2.0 styling
+            int cornerRadius = ctx.getResources().getDimensionPixelSize(R.dimen.material_drawer_item_corner_radius);
+            int paddingTopBottom = ctx.getResources().getDimensionPixelSize(R.dimen.material_drawer_item_background_padding_top_bottom);
+            int paddingStartEnd = ctx.getResources().getDimensionPixelSize(R.dimen.material_drawer_item_background_padding_start_end);
+
+            // define normal selected background
+            GradientDrawable gradientDrawable = new GradientDrawable();
+            gradientDrawable.setColor(selected_color);
+            gradientDrawable.setCornerRadius(cornerRadius);
+            selected = new InsetDrawable(gradientDrawable, paddingStartEnd, paddingTopBottom, paddingStartEnd, paddingTopBottom);
+
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.LOLLIPOP) {
+                // define mask for ripple
+                GradientDrawable gradientMask = new GradientDrawable();
+                gradientMask.setColor(Color.BLACK);
+                gradientMask.setCornerRadius(cornerRadius);
+                Drawable mask = new InsetDrawable(gradientMask, paddingStartEnd, paddingTopBottom, paddingStartEnd, paddingTopBottom);
+
+                unselected = new RippleDrawable(new ColorStateList(new int[][]{new int[]{}}, new int[]{UIUtils.getThemeColor(ctx, R.attr.colorControlHighlight)}), null, mask);
+            } else {
+                // define touch drawable
+                GradientDrawable touchDrawable = new GradientDrawable();
+                touchDrawable.setColor(UIUtils.getThemeColor(ctx, R.attr.colorControlHighlight));
+                touchDrawable.setCornerRadius(cornerRadius);
+                Drawable touchInsetDrawable = new InsetDrawable(touchDrawable, paddingStartEnd, paddingTopBottom, paddingStartEnd, paddingTopBottom);
+
+                StateListDrawable unselectedStates = new StateListDrawable();
+                //if possible and wanted we enable animating across states
+                if (animate) {
+                    int duration = ctx.getResources().getInteger(android.R.integer.config_shortAnimTime);
+                    unselectedStates.setEnterFadeDuration(duration);
+                    unselectedStates.setExitFadeDuration(duration);
+                }
+                unselectedStates.addState(new int[]{android.R.attr.state_pressed}, touchInsetDrawable);
+                unselectedStates.addState(new int[]{}, new ColorDrawable(Color.TRANSPARENT));
+                unselected = unselectedStates;
+            }
+        }
+
+        StateListDrawable states = new StateListDrawable();
+
+        //if possible and wanted we enable animating across states
+        if (animate) {
+            int duration = ctx.getResources().getInteger(android.R.integer.config_shortAnimTime);
+            states.setEnterFadeDuration(duration);
+            states.setExitFadeDuration(duration);
+        }
+
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+            states.addState(new int[]{android.R.attr.state_selected}, selected);
+            states.addState(new int[]{}, new ColorDrawable(Color.TRANSPARENT));
+
+            ViewCompat.setBackground(view, states);
+            view.setForeground(unselected);
+        } else {
+            states.addState(new int[]{android.R.attr.state_selected}, selected);
+            states.addState(new int[]{}, unselected);
+
+            ViewCompat.setBackground(view, states);
+        }
+    }
+
+    /**
+     * helper to create a colorStateList for the text
+     *
+     * @param text_color
+     * @param selected_text_color
+     * @return
+     */
+    public static ColorStateList getTextColorStateList(int text_color, int selected_text_color) {
+        return new ColorStateList(
+                new int[][]{
+                        new int[]{android.R.attr.state_selected},
+                        new int[]{}
+                },
+                new int[]{
+                        selected_text_color,
+                        text_color
+                }
+        );
+    }
+
+    /**
+     * helper to create a stateListDrawable for the icon
+     *
+     * @param icon
+     * @param selectedIcon
+     * @return
+     */
+    public static StateListDrawable getIconStateList(Drawable icon, Drawable selectedIcon) {
+        StateListDrawable iconStateListDrawable = new StateListDrawable();
+        iconStateListDrawable.addState(new int[]{android.R.attr.state_selected}, selectedIcon);
+        iconStateListDrawable.addState(new int[]{}, icon);
+        return iconStateListDrawable;
+    }
+
+    /**
+     * helper to create a StateListDrawable for the drawer item background
+     *
+     * @param selected_color
+     * @return
+     */
+    public static StateListDrawable getDrawerItemBackground(int selected_color) {
+        ColorDrawable clrActive = new ColorDrawable(selected_color);
+        StateListDrawable states = new StateListDrawable();
+        states.addState(new int[]{android.R.attr.state_selected}, clrActive);
+        return states;
+    }
+
+    /**
+     * helper to calculate the optimal drawer width
+     *
+     * @param context
+     * @return
+     */
+    public static int getOptimalDrawerWidth(Context context) {
+        int possibleMinDrawerWidth = UIUtils.getScreenWidth(context) - UIUtils.getActionBarHeight(context);
+        int maxDrawerWidth = context.getResources().getDimensionPixelSize(R.dimen.material_drawer_width);
+        return Math.min(possibleMinDrawerWidth, maxDrawerWidth);
+    }
+
+
+    /**
+     * helper method to get a person placeHolder drawable
+     *
+     * @param ctx
+     * @return
+     */
+    public static Drawable getPlaceHolder(Context ctx) {
+        return new IconicsDrawable(ctx, MaterialDrawerFont.Icon.mdf_person).colorRes(R.color.accent).backgroundColorRes(R.color.primary).sizeDp(56).paddingDp(16);
+    }
+
+    /**
+     * helper to set the vertical padding to the DrawerItems
+     * this is required because on API Level 17 the padding is ignored which is set via the XML
+     *
+     * @param v
+     */
+    public static void setDrawerVerticalPadding(View v) {
+        int verticalPadding = v.getContext().getResources().getDimensionPixelSize(R.dimen.material_drawer_vertical_padding);
+        v.setPadding(verticalPadding, 0, verticalPadding, 0);
+    }
+
+    /**
+     * helper to set the vertical padding including the extra padding for deeper item hirachy level to the DrawerItems
+     * this is required because on API Level 17 the padding is ignored which is set via the XML
+     *
+     * @param v
+     * @param level
+     */
+    public static void setDrawerVerticalPadding(View v, int level) {
+        int verticalPadding = v.getContext().getResources().getDimensionPixelSize(R.dimen.material_drawer_vertical_padding);
+
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.JELLY_BEAN_MR1) {
+            v.setPaddingRelative(verticalPadding * level, 0, verticalPadding, 0);
+        } else {
+            v.setPadding(verticalPadding * level, 0, verticalPadding, 0);
+        }
+    }
+
+    /**
+     * helper to check if the system bar is on the bottom of the screen
+     *
+     * @param ctx
+     * @return
+     */
+    public static boolean isSystemBarOnBottom(Context ctx) {
+        WindowManager wm = (WindowManager) ctx.getSystemService(Context.WINDOW_SERVICE);
+        DisplayMetrics metrics = new DisplayMetrics();
+        wm.getDefaultDisplay().getMetrics(metrics);
+        Configuration cfg = ctx.getResources().getConfiguration();
+        boolean canMove = (metrics.widthPixels != metrics.heightPixels &&
+                cfg.smallestScreenWidthDp < 600);
+
+        return (!canMove || metrics.widthPixels < metrics.heightPixels);
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/util/KeyboardUtil.java

@@ -0,0 +1,103 @@
+/*
+ * Copyright 2015 Mike Penz All rights reserved.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.mikepenz.materialdrawer.util;
+
+import android.app.Activity;
+import android.graphics.Rect;
+import android.os.Build;
+import android.view.View;
+import android.view.ViewTreeObserver;
+import android.view.inputmethod.InputMethodManager;
+
+/**
+ * Created by mikepenz on 14.03.15.
+ * This class implements a hack to change the layout padding on bottom if the keyboard is shown
+ * to allow long lists with editTextViews
+ * Basic idea for this solution found here: http://stackoverflow.com/a/9108219/325479
+ * @deprecated Do not use this anymore, the MaterialDrawer uses the `fitsSystemWindows` now correctly so it should not be required. (it would only be required for cases with the fullscreen flag)
+ */
+@Deprecated
+public class KeyboardUtil {
+    private View decorView;
+    private View contentView;
+
+    public KeyboardUtil(Activity act, View contentView) {
+        this.decorView = act.getWindow().getDecorView();
+        this.contentView = contentView;
+
+        //only required on newer android versions. it was working on API level 19
+        if (Build.VERSION.SDK_INT >= 19) {
+            decorView.getViewTreeObserver().addOnGlobalLayoutListener(onGlobalLayoutListener);
+        }
+    }
+
+    public void enable() {
+        if (Build.VERSION.SDK_INT >= 19) {
+            decorView.getViewTreeObserver().addOnGlobalLayoutListener(onGlobalLayoutListener);
+        }
+    }
+
+    public void disable() {
+        if (Build.VERSION.SDK_INT >= 19) {
+            decorView.getViewTreeObserver().removeOnGlobalLayoutListener(onGlobalLayoutListener);
+        }
+    }
+
+
+    //a small helper to allow showing the editText focus
+    ViewTreeObserver.OnGlobalLayoutListener onGlobalLayoutListener = new ViewTreeObserver.OnGlobalLayoutListener() {
+        @Override
+        public void onGlobalLayout() {
+            Rect r = new Rect();
+            //r will be populated with the coordinates of your view that area still visible.
+            decorView.getWindowVisibleDisplayFrame(r);
+
+            //get screen height and calculate the difference with the useable area from the r
+            int height = decorView.getContext().getResources().getDisplayMetrics().heightPixels;
+            int diff = height - r.bottom;
+
+            //if it could be a keyboard add the padding to the view
+            if (diff != 0) {
+                // if the use-able screen height differs from the total screen height we assume that it shows a keyboard now
+                //check if the padding is 0 (if yes set the padding for the keyboard)
+                if (contentView.getPaddingBottom() != diff) {
+                    //set the padding of the contentView for the keyboard
+                    contentView.setPadding(0, 0, 0, diff);
+                }
+            } else {
+                //check if the padding is != 0 (if yes reset the padding)
+                if (contentView.getPaddingBottom() != 0) {
+                    //reset the padding of the contentView
+                    contentView.setPadding(0, 0, 0, 0);
+                }
+            }
+        }
+    };
+
+
+    /**
+     * Helper to hide the keyboard
+     *
+     * @param act
+     */
+    public static void hideKeyboard(Activity act) {
+        if (act != null && act.getCurrentFocus() != null) {
+            InputMethodManager inputMethodManager = (InputMethodManager) act.getSystemService(Activity.INPUT_METHOD_SERVICE);
+            inputMethodManager.hideSoftInputFromWindow(act.getCurrentFocus().getWindowToken(), 0);
+        }
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/util/PressedEffectStateListDrawable.java

@@ -0,0 +1,51 @@
+package com.mikepenz.materialdrawer.util;
+
+import android.annotation.SuppressLint;
+import android.graphics.PorterDuff;
+import android.graphics.drawable.Drawable;
+import android.graphics.drawable.StateListDrawable;
+
+/**
+ * http://stackoverflow.com/questions/7979440/android-cloning-a-drawable-in-order-to-make-a-statelistdrawable-with-filters
+ * http://stackoverflow.com/users/2075875/malachiasz
+ */
+
+@SuppressLint("InlinedApi")
+public class PressedEffectStateListDrawable extends StateListDrawable {
+
+    private int color;
+    private int selectionColor;
+
+    public PressedEffectStateListDrawable(Drawable drawable, int color, int selectionColor) {
+        super();
+
+        drawable = drawable.mutate();
+
+        addState(new int[]{android.R.attr.state_selected}, drawable);
+        addState(new int[]{}, drawable);
+
+        this.color = color;
+        this.selectionColor = selectionColor;
+    }
+
+    @Override
+    protected boolean onStateChange(int[] states) {
+        boolean isStatePressedInArray = false;
+        for (int state : states) {
+            if (state == android.R.attr.state_selected) {
+                isStatePressedInArray = true;
+            }
+        }
+        if (isStatePressedInArray) {
+            super.setColorFilter(selectionColor, PorterDuff.Mode.SRC_IN);
+        } else {
+            super.setColorFilter(color, PorterDuff.Mode.SRC_IN);
+        }
+        return super.onStateChange(states);
+    }
+
+    @Override
+    public boolean isStateful() {
+        return true;
+    }
+}

MaterialDrawer/src/main/java/com/mikepenz/materialdrawer/view/BezelImageView.java

@@ -0,0 +1,349 @@
+/*
+ * Copyright 2014 Google Inc. All rights reserved.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *
+ * The original is from Google you can find here:
+ * https://github.com/google/iosched/blob/master/android/src/main/java/com/google/samples/apps/iosched/ui/widget/BezelImageView.java
+ *
+ * Modified and improved with additional functionality by Mike Penz
+ */
+
+package com.mikepenz.materialdrawer.view;
+
+import android.annotation.TargetApi;
+import android.content.Context;
+import android.content.res.TypedArray;
+import android.graphics.Bitmap;
+import android.graphics.Canvas;
+import android.graphics.Color;
+import android.graphics.ColorFilter;
+import android.graphics.ColorMatrix;
+import android.graphics.ColorMatrixColorFilter;
+import android.graphics.Outline;
+import android.graphics.Paint;
+import android.graphics.PorterDuff;
+import android.graphics.PorterDuffColorFilter;
+import android.graphics.PorterDuffXfermode;
+import android.graphics.Rect;
+import android.graphics.RectF;
+import android.graphics.drawable.Drawable;
+import android.net.Uri;
+import android.os.Build;
+
+import androidx.appcompat.widget.AppCompatImageView;
+import androidx.core.view.ViewCompat;
+import android.util.AttributeSet;
+import android.view.MotionEvent;
+import android.view.View;
+import android.view.ViewOutlineProvider;
+import android.widget.ImageView;
+
+import com.mikepenz.materialdrawer.R;
+import com.mikepenz.materialdrawer.util.DrawerImageLoader;
+
+
+/**
+ * An {@link android.widget.ImageView} that draws its contents inside a mask and draws a border
+ * drawable on top. This is useful for applying a beveled look to image contents, but is also
+ * flexible enough for use with other desired aesthetics.
+ */
+public class BezelImageView extends AppCompatImageView {
+    private Paint mBlackPaint;
+    private Paint mMaskedPaint;
+
+    private Rect mBounds;
+    private RectF mBoundsF;
+
+    private Drawable mMaskDrawable;
+    private boolean mDrawCircularShadow = true;
+
+    private ColorMatrixColorFilter mDesaturateColorFilter;
+
+    private int mSelectorAlpha = 150;
+    private int mSelectorColor;
+    private ColorFilter mSelectorFilter;
+
+    private boolean mCacheValid = false;
+    private Bitmap mCacheBitmap;
+    private int mCachedWidth;
+    private int mCachedHeight;
+
+    private boolean isPressed = false;
+    private boolean isSelected;
+
+    public BezelImageView(Context context) {
+        this(context, null);
+    }
+
+    public BezelImageView(Context context, AttributeSet attrs) {
+        this(context, attrs, 0);
+    }
+
+    public BezelImageView(Context context, AttributeSet attrs, int defStyle) {
+        super(context, attrs, defStyle);
+
+        // Attribute initialization
+        final TypedArray a = context.obtainStyledAttributes(attrs, R.styleable.BezelImageView, defStyle, R.style.BezelImageView);
+
+        mMaskDrawable = a.getDrawable(R.styleable.BezelImageView_biv_maskDrawable);
+        if (mMaskDrawable != null) {
+            mMaskDrawable.setCallback(this);
+        }
+
+        mDrawCircularShadow = a.getBoolean(R.styleable.BezelImageView_biv_drawCircularShadow, true);
+
+        mSelectorColor = a.getColor(R.styleable.BezelImageView_biv_selectorOnPress, 0);
+
+        a.recycle();
+
+        // Other initialization
+        mBlackPaint = new Paint();
+        mBlackPaint.setColor(0xff000000);
+
+        mMaskedPaint = new Paint();
+        mMaskedPaint.setXfermode(new PorterDuffXfermode(PorterDuff.Mode.SRC_IN));
+
+        // Always want a cache allocated.
+        mCacheBitmap = Bitmap.createBitmap(1, 1, Bitmap.Config.ARGB_8888);
+
+        // Create a desaturate color filter for pressed state.
+        ColorMatrix cm = new ColorMatrix();
+        cm.setSaturation(0);
+        mDesaturateColorFilter = new ColorMatrixColorFilter(cm);
+
+        //create a selectorFilter if we already have a color
+        if (mSelectorColor != 0) {
+            this.mSelectorFilter = new PorterDuffColorFilter(Color.argb(mSelectorAlpha, Color.red(mSelectorColor), Color.green(mSelectorColor), Color.blue(mSelectorColor)), PorterDuff.Mode.SRC_ATOP);
+        }
+    }
+
+    @Override
+    protected void onSizeChanged(int w, int h, int old_w, int old_h) {
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.LOLLIPOP) {
+            if (mDrawCircularShadow) {
+                setOutlineProvider(new CustomOutline(w, h));
+            }
+        }
+    }
+
+    @TargetApi(21)
+    private class CustomOutline extends ViewOutlineProvider {
+
+        int width;
+        int height;
+
+        CustomOutline(int width, int height) {
+            this.width = width;
+            this.height = height;
+        }
+
+        @Override
+        public void getOutline(View view, Outline outline) {
+            outline.setOval(0, 0, width, height);
+        }
+    }
+
+    @Override
+    protected boolean setFrame(int l, int t, int r, int b) {
+        final boolean changed = super.setFrame(l, t, r, b);
+        mBounds = new Rect(0, 0, r - l, b - t);
+        mBoundsF = new RectF(mBounds);
+
+        if (mMaskDrawable != null) {
+            mMaskDrawable.setBounds(mBounds);
+        }
+
+        if (changed) {
+            mCacheValid = false;
+        }
+
+        return changed;
+    }
+
+    @Override
+    protected void onDraw(Canvas canvas) {
+        if (mBounds == null) {
+            return;
+        }
+
+        int width = mBounds.width();
+        int height = mBounds.height();
+
+        if (width == 0 || height == 0) {
+            return;
+        }
+
+        if (!mCacheValid || width != mCachedWidth || height != mCachedHeight || isSelected != isPressed) {
+            // Need to redraw the cache
+            if (width == mCachedWidth && height == mCachedHeight) {
+                // Have a correct-sized bitmap cache already allocated. Just erase it.
+                mCacheBitmap.eraseColor(0);
+            } else {
+                // Allocate a new bitmap with the correct dimensions.
+                mCacheBitmap.recycle();
+                //noinspection AndroidLintDrawAllocation
+                mCacheBitmap = Bitmap.createBitmap(width, height, Bitmap.Config.ARGB_8888);
+                mCachedWidth = width;
+                mCachedHeight = height;
+            }
+
+            Canvas cacheCanvas = new Canvas(mCacheBitmap);
+            if (mMaskDrawable != null) {
+                int sc = cacheCanvas.save();
+                mMaskDrawable.draw(cacheCanvas);
+                if (isSelected) {
+                    if (mSelectorFilter != null) {
+                        mMaskedPaint.setColorFilter(mSelectorFilter);
+                    } else {
+                        mMaskedPaint.setColorFilter(mDesaturateColorFilter);
+
+                    }
+                } else {
+                    mMaskedPaint.setColorFilter(null);
+                }
+                cacheCanvas.saveLayer(mBoundsF, mMaskedPaint, Canvas.ALL_SAVE_FLAG);
+                super.onDraw(cacheCanvas);
+                cacheCanvas.restoreToCount(sc);
+            } else if (isSelected) {
+                int sc = cacheCanvas.save();
+                cacheCanvas.drawRect(0, 0, mCachedWidth, mCachedHeight, mBlackPaint);
+                if (mSelectorFilter != null) {
+                    mMaskedPaint.setColorFilter(mSelectorFilter);
+                } else {
+                    mMaskedPaint.setColorFilter(mDesaturateColorFilter);
+                }
+                cacheCanvas.saveLayer(mBoundsF, mMaskedPaint, Canvas.ALL_SAVE_FLAG);
+                super.onDraw(cacheCanvas);
+                cacheCanvas.restoreToCount(sc);
+            } else {
+                super.onDraw(cacheCanvas);
+            }
+        }
+
+        // Draw from cache
+        canvas.drawBitmap(mCacheBitmap, mBounds.left, mBounds.top, null);
+
+        //remember the previous press state
+        isPressed = isPressed();
+    }
+
+
+    @Override
+    public boolean dispatchTouchEvent(MotionEvent event) {
+        // Check for clickable state and do nothing if disabled
+        if (!this.isClickable()) {
+            this.isSelected = false;
+            return super.onTouchEvent(event);
+        }
+
+        // Set selected state based on Motion Event
+        switch (event.getAction()) {
+            case MotionEvent.ACTION_DOWN:
+                this.isSelected = true;
+                break;
+            case MotionEvent.ACTION_UP:
+            case MotionEvent.ACTION_SCROLL:
+            case MotionEvent.ACTION_OUTSIDE:
+            case MotionEvent.ACTION_CANCEL:
+                this.isSelected = false;
+                break;
+        }
+
+        // Redraw image and return super type
+        this.invalidate();
+        return super.dispatchTouchEvent(event);
+    }
+
+    @Override
+    protected void drawableStateChanged() {
+        super.drawableStateChanged();
+        if (mMaskDrawable != null && mMaskDrawable.isStateful()) {
+            mMaskDrawable.setState(getDrawableState());
+        }
+        if (isDuplicateParentStateEnabled()) {
+            ViewCompat.postInvalidateOnAnimation(this);
+        }
+    }
+
+    @Override
+    public void invalidateDrawable(Drawable who) {
+        if (who == mMaskDrawable) {
+            invalidate();
+        } else {
+            super.invalidateDrawable(who);
+        }
+    }
+
+    @Override
+    protected boolean verifyDrawable(Drawable who) {
+        return who == mMaskDrawable || super.verifyDrawable(who);
+    }
+
+
+    /**
+     * Sets the color of the selector to be draw over the
+     * CircularImageView. Be sure to provide some opacity.
+     *
+     * @param selectorColor The color (including alpha) to set for the selector overlay.
+     */
+    public void setSelectorColor(int selectorColor) {
+        this.mSelectorColor = selectorColor;
+        this.mSelectorFilter = new PorterDuffColorFilter(Color.argb(mSelectorAlpha, Color.red(mSelectorColor), Color.green(mSelectorColor), Color.blue(mSelectorColor)), PorterDuff.Mode.SRC_ATOP);
+        this.invalidate();
+    }
+
+
+    @Override
+    public void setImageDrawable(Drawable drawable) {
+        super.setImageDrawable(drawable);
+    }
+
+    @Override
+    public void setImageResource(int resId) {
+        super.setImageResource(resId);
+    }
+
+    @Override
+    public void setImageBitmap(Bitmap bm) {
+        super.setImageBitmap(bm);
+    }
+
+    @Override
+    public void setImageURI(Uri uri) {
+        if ("http".equals(uri.getScheme()) || "https".equals(uri.getScheme())) {
+            DrawerImageLoader.getInstance().setImage(this, uri, null);
+        } else {
+            super.setImageURI(uri);
+        }
+    }
+
+    private ColorMatrixColorFilter mTempDesaturateColorFilter;
+    private ColorFilter mTempSelectorFilter;
+
+    public void disableTouchFeedback(boolean disable) {
+        if (disable) {
+            mTempDesaturateColorFilter = this.mDesaturateColorFilter;
+            mTempSelectorFilter = this.mSelectorFilter;
+            this.mSelectorFilter = null;
+            this.mDesaturateColorFilter = null;
+        } else {
+            if (mTempDesaturateColorFilter != null) {
+                this.mDesaturateColorFilter = mTempDesaturateColorFilter;
+            }
+            if (mTempSelectorFilter != null) {
+                this.mSelectorFilter = mTempSelectorFilter;
+            }
+        }
+    }
+}

MaterialDrawer/src/main/res/drawable/material_drawer_badge.xml

@@ -1,8 +1,5 @@
 <?xml version="1.0" encoding="utf-8"?>
-<!--
-  ~ Copyright (c) Kuba Szczodrzyński 2020-1-7.
-  -->
-
 <shape xmlns:android="http://schemas.android.com/apk/res/android">
-    <solid android:color="#30000000"/>
+    <corners android:radius="5dp" />
+    <solid android:color="@android:color/black" />
 </shape>

MaterialDrawer/src/main/res/drawable/material_drawer_circle_mask.xml

@@ -0,0 +1,20 @@
+<!--
+  Copyright 2014 Google Inc. All rights reserved.
+  
+  Licensed under the Apache License, Version 2.0 (the "License");
+  you may not use this file except in compliance with the License.
+  You may obtain a copy of the License at
+  
+       http://www.apache.org/licenses/LICENSE-2.0
+  
+  Unless required by applicable law or agreed to in writing, software
+  distributed under the License is distributed on an "AS IS" BASIS,
+  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+  See the License for the specific language governing permissions and
+  limitations under the License.
+  -->
+
+<shape xmlns:android="http://schemas.android.com/apk/res/android"
+    android:shape="oval">
+    <solid android:color="#000" />
+</shape>

MaterialDrawer/src/main/res/drawable/material_drawer_shadow_bottom.xml

@@ -0,0 +1,7 @@
+<shape xmlns:android="http://schemas.android.com/apk/res/android"
+    android:shape="rectangle">
+    <gradient
+        android:angle="90"
+        android:endColor="#40000000"
+        android:startColor="@android:color/transparent" />
+</shape>

MaterialDrawer/src/main/res/drawable/material_drawer_shadow_top.xml

@@ -0,0 +1,7 @@
+<shape xmlns:android="http://schemas.android.com/apk/res/android"
+    android:shape="rectangle">
+    <gradient
+        android:angle="270"
+        android:endColor="#40000000"
+        android:startColor="@android:color/transparent" />
+</shape>

MaterialDrawer/src/main/res/layout/material_drawer.xml

@@ -0,0 +1,5 @@
+<?xml version="1.0" encoding="utf-8"?>
+<androidx.drawerlayout.widget.DrawerLayout xmlns:android="http://schemas.android.com/apk/res/android"
+    android:layout_width="match_parent"
+    android:layout_height="match_parent"
+    android:fitsSystemWindows="true" />

MaterialDrawer/src/main/res/layout/material_drawer_compact_header.xml

@@ -0,0 +1,114 @@
+<androidx.constraintlayout.widget.ConstraintLayout xmlns:android="http://schemas.android.com/apk/res/android"
+    xmlns:app="http://schemas.android.com/apk/res-auto"
+    xmlns:tools="http://schemas.android.com/tools"
+    android:id="@+id/material_drawer_account_header"
+    android:layout_width="match_parent"
+    android:layout_height="@dimen/material_drawer_account_header_height_compact"
+    android:clickable="true"
+    android:fitsSystemWindows="false"
+    android:focusable="true"
+    app:layout_dodgeInsetEdges="top">
+
+    <androidx.appcompat.widget.AppCompatImageView
+        android:id="@+id/material_drawer_account_header_background"
+        android:layout_width="match_parent"
+        android:layout_height="@dimen/material_drawer_account_header_height_compact"
+        android:scaleType="fitXY"
+        app:layout_constraintBottom_toBottomOf="parent"
+        app:layout_constraintEnd_toEndOf="parent"
+        app:layout_constraintStart_toStartOf="parent"
+        app:layout_constraintTop_toTopOf="parent" />
+
+    <androidx.constraintlayout.widget.Guideline
+        android:id="@+id/material_drawer_statusbar_guideline"
+        android:layout_width="wrap_content"
+        android:layout_height="wrap_content"
+        android:orientation="horizontal"
+        app:layout_constraintGuide_begin="0dp" />
+
+    <com.mikepenz.materialdrawer.view.BezelImageView
+        android:id="@+id/material_drawer_account_header_small_first"
+        android:layout_width="1dp"
+        android:layout_height="1dp"
+        android:visibility="gone"
+        tools:ignore="MissingConstraints" />
+
+    <com.mikepenz.materialdrawer.view.BezelImageView
+        android:id="@+id/material_drawer_account_header_small_second"
+        android:layout_width="1dp"
+        android:layout_height="1dp"
+        android:visibility="gone"
+        tools:ignore="MissingConstraints" />
+
+    <com.mikepenz.materialdrawer.view.BezelImageView
+        android:id="@+id/material_drawer_account_header_small_third"
+        android:layout_width="1dp"
+        android:layout_height="1dp"
+        android:visibility="gone"
+        tools:ignore="MissingConstraints" />
+
+    <com.mikepenz.materialdrawer.view.BezelImageView
+        android:id="@+id/material_drawer_account_header_current"
+        android:layout_width="@dimen/material_drawer_account_header_compact"
+        android:layout_height="@dimen/material_drawer_account_header_compact"
+        android:layout_gravity="bottom"
+        android:layout_marginStart="@dimen/material_drawer_vertical_padding"
+        android:layout_marginLeft="@dimen/material_drawer_vertical_padding"
+        android:clickable="true"
+        android:elevation="2dp"
+        android:focusable="true"
+        app:layout_constraintBottom_toBottomOf="parent"
+        app:layout_constraintStart_toStartOf="parent"
+        app:layout_constraintTop_toBottomOf="@+id/material_drawer_statusbar_guideline" />
+
+    <androidx.appcompat.widget.AppCompatTextView
+        android:id="@+id/material_drawer_account_header_name"
+        android:layout_width="0dp"
+        android:layout_height="wrap_content"
+        android:ellipsize="end"
+        android:fontFamily="sans-serif-medium"
+        android:lines="1"
+        android:maxLines="1"
+        android:paddingStart="@dimen/material_drawer_vertical_padding"
+        android:paddingLeft="@dimen/material_drawer_vertical_padding"
+        android:paddingEnd="@dimen/material_drawer_vertical_padding"
+        android:paddingRight="@dimen/material_drawer_vertical_padding"
+        android:textSize="@dimen/material_drawer_account_header_title"
+        app:layout_constraintBottom_toTopOf="@id/material_drawer_account_header_email"
+        app:layout_constraintEnd_toStartOf="@+id/material_drawer_account_header_text_switcher"
+        app:layout_constraintStart_toEndOf="@id/material_drawer_account_header_current"
+        app:layout_constraintTop_toBottomOf="@+id/material_drawer_statusbar_guideline"
+        app:layout_constraintVertical_chainStyle="packed"
+        app:layout_goneMarginStart="0dp" />
+
+    <androidx.appcompat.widget.AppCompatTextView
+        android:id="@+id/material_drawer_account_header_email"
+        android:layout_width="0dp"
+        android:layout_height="wrap_content"
+        android:ellipsize="end"
+        android:fontFamily="sans-serif"
+        android:lines="1"
+        android:maxLines="1"
+        android:paddingStart="@dimen/material_drawer_vertical_padding"
+        android:paddingLeft="@dimen/material_drawer_vertical_padding"
+        android:paddingEnd="@dimen/material_drawer_vertical_padding"
+        android:paddingRight="@dimen/material_drawer_vertical_padding"
+        android:textSize="@dimen/material_drawer_account_header_subtext"
+        app:layout_constraintBottom_toBottomOf="parent"
+        app:layout_constraintEnd_toStartOf="@+id/material_drawer_account_header_text_switcher"
+        app:layout_constraintStart_toEndOf="@id/material_drawer_account_header_current"
+        app:layout_constraintTop_toBottomOf="@id/material_drawer_account_header_name"
+        app:layout_goneMarginStart="0dp" />
+
+    <androidx.appcompat.widget.AppCompatImageView
+        android:id="@+id/material_drawer_account_header_text_switcher"
+        android:layout_width="@dimen/material_drawer_account_header_dropdown"
+        android:layout_height="@dimen/material_drawer_account_header_dropdown"
+        android:layout_gravity="bottom"
+        android:layout_marginEnd="@dimen/material_drawer_vertical_padding"
+        android:layout_marginRight="@dimen/material_drawer_vertical_padding"
+        android:layout_marginBottom="@dimen/material_drawer_padding"
+        app:layout_constraintBottom_toBottomOf="parent"
+        app:layout_constraintEnd_toEndOf="parent" />
+
+</androidx.constraintlayout.widget.ConstraintLayout>

MaterialDrawer/src/main/res/layout/material_drawer_fits_not.xml

@@ -0,0 +1,6 @@
+<?xml version="1.0" encoding="utf-8"?>
+<androidx.drawerlayout.widget.DrawerLayout xmlns:android="http://schemas.android.com/apk/res/android"
+    android:layout_width="match_parent"
+    android:layout_height="match_parent"
+    android:clickable="true"
+    android:focusable="true" />

MaterialDrawer/src/main/res/layout/material_drawer_header.xml

@@ -0,0 +1,128 @@
+<androidx.constraintlayout.widget.ConstraintLayout xmlns:android="http://schemas.android.com/apk/res/android"
+    xmlns:app="http://schemas.android.com/apk/res-auto"
+    android:id="@+id/material_drawer_account_header"
+    android:layout_width="match_parent"
+    android:layout_height="@dimen/material_drawer_account_header_height"
+    android:clickable="true">
+
+    <pl.droidsonroids.gif.GifImageView
+        android:id="@+id/material_drawer_account_header_background"
+        android:layout_width="match_parent"
+        android:layout_height="@dimen/material_drawer_account_header_height"
+        android:scaleType="centerCrop"
+        app:layout_constraintBottom_toBottomOf="parent"
+        app:layout_constraintEnd_toEndOf="parent"
+        app:layout_constraintStart_toStartOf="parent"
+        app:layout_constraintTop_toTopOf="parent" />
+
+    <androidx.constraintlayout.widget.Guideline
+        android:id="@+id/material_drawer_statusbar_guideline"
+        android:layout_width="wrap_content"
+        android:layout_height="wrap_content"
+        android:orientation="horizontal"
+        app:layout_constraintGuide_begin="0dp" />
+
+    <com.mikepenz.materialdrawer.view.BezelImageView
+        android:id="@+id/material_drawer_account_header_current"
+        android:layout_width="@dimen/material_drawer_account_header_selected"
+        android:layout_height="@dimen/material_drawer_account_header_selected"
+        android:layout_marginStart="@dimen/material_drawer_vertical_padding"
+        android:layout_marginLeft="@dimen/material_drawer_vertical_padding"
+        android:layout_marginTop="@dimen/material_drawer_account_header_horizontal_top"
+        android:clickable="true"
+        android:elevation="2dp"
+        android:focusable="true"
+        app:layout_constraintStart_toStartOf="parent"
+        app:layout_constraintTop_toBottomOf="@+id/material_drawer_statusbar_guideline" />
+
+    <com.mikepenz.materialdrawer.view.BezelImageView
+        android:id="@+id/material_drawer_account_header_small_first"
+        android:layout_width="@dimen/material_drawer_account_header_secondary"
+        android:layout_height="@dimen/material_drawer_account_header_secondary"
+        android:layout_marginTop="@dimen/material_drawer_account_header_horizontal_top"
+        android:layout_marginEnd="@dimen/material_drawer_vertical_padding"
+        android:layout_marginRight="@dimen/material_drawer_vertical_padding"
+        android:clickable="true"
+        android:elevation="2dp"
+        android:focusable="true"
+        android:visibility="visible"
+        app:layout_constraintEnd_toStartOf="@id/material_drawer_account_header_small_second"
+        app:layout_constraintTop_toBottomOf="@+id/material_drawer_statusbar_guideline" />
+
+    <com.mikepenz.materialdrawer.view.BezelImageView
+        android:id="@+id/material_drawer_account_header_small_second"
+        android:layout_width="@dimen/material_drawer_account_header_secondary"
+        android:layout_height="@dimen/material_drawer_account_header_secondary"
+        android:layout_marginTop="@dimen/material_drawer_account_header_horizontal_top"
+        android:layout_marginEnd="@dimen/material_drawer_vertical_padding"
+        android:layout_marginRight="@dimen/material_drawer_vertical_padding"
+        android:clickable="true"
+        android:elevation="2dp"
+        android:focusable="true"
+        android:visibility="visible"
+        app:layout_constraintEnd_toStartOf="@id/material_drawer_account_header_small_third"
+        app:layout_constraintTop_toBottomOf="@+id/material_drawer_statusbar_guideline" />
+
+    <com.mikepenz.materialdrawer.view.BezelImageView
+        android:id="@+id/material_drawer_account_header_small_third"
+        android:layout_width="@dimen/material_drawer_account_header_secondary"
+        android:layout_height="@dimen/material_drawer_account_header_secondary"
+        android:layout_marginTop="@dimen/material_drawer_account_header_horizontal_top"
+        android:layout_marginEnd="@dimen/material_drawer_vertical_padding"
+        android:layout_marginRight="@dimen/material_drawer_vertical_padding"
+        android:clickable="true"
+        android:elevation="2dp"
+        android:focusable="true"
+        android:visibility="visible"
+        app:layout_constraintEnd_toEndOf="parent"
+        app:layout_constraintTop_toBottomOf="@+id/material_drawer_statusbar_guideline" />
+
+    <androidx.constraintlayout.widget.Guideline
+        android:id="@+id/material_drawer_text_guideline"
+        android:layout_width="wrap_content"
+        android:layout_height="wrap_content"
+        android:orientation="horizontal"
+        app:layout_constraintGuide_end="@dimen/material_drawer_account_header_dropdown_guideline" />
+
+    <androidx.appcompat.widget.AppCompatTextView
+        android:id="@+id/material_drawer_account_header_name"
+        android:layout_width="0dp"
+        android:layout_height="wrap_content"
+        android:layout_marginStart="@dimen/material_drawer_vertical_padding"
+        android:layout_marginLeft="@dimen/material_drawer_vertical_padding"
+        android:fontFamily="sans-serif-medium"
+        android:lines="1"
+        android:maxLines="1"
+        android:textSize="@dimen/material_drawer_account_header_title"
+        app:layout_constraintBottom_toTopOf="@id/material_drawer_account_header_email"
+        app:layout_constraintEnd_toStartOf="@id/material_drawer_account_header_text_switcher"
+        app:layout_constraintStart_toStartOf="parent"
+        app:layout_constraintTop_toBottomOf="@id/material_drawer_text_guideline"
+        app:layout_constraintVertical_chainStyle="packed" />
+
+    <androidx.appcompat.widget.AppCompatTextView
+        android:id="@+id/material_drawer_account_header_email"
+        android:layout_width="0dp"
+        android:layout_height="wrap_content"
+        android:layout_marginStart="@dimen/material_drawer_vertical_padding"
+        android:layout_marginLeft="@dimen/material_drawer_vertical_padding"
+        android:layout_marginBottom="@dimen/material_drawer_padding"
+        android:fontFamily="sans-serif"
+        android:lines="1"
+        android:maxLines="1"
+        android:textSize="@dimen/material_drawer_account_header_subtext"
+        app:layout_constraintBottom_toBottomOf="parent"
+        app:layout_constraintEnd_toStartOf="@id/material_drawer_account_header_text_switcher"
+        app:layout_constraintStart_toStartOf="parent"
+        app:layout_constraintTop_toBottomOf="@id/material_drawer_account_header_name" />
+
+    <androidx.appcompat.widget.AppCompatImageView
+        android:id="@+id/material_drawer_account_header_text_switcher"
+        android:layout_width="@dimen/material_drawer_account_header_dropdown"
+        android:layout_height="@dimen/material_drawer_account_header_dropdown"
+        android:layout_marginEnd="@dimen/material_drawer_vertical_padding"
+        android:layout_marginRight="@dimen/material_drawer_vertical_padding"
+        android:layout_marginBottom="@dimen/material_drawer_account_header_dropdown_margin_bottom"
+        app:layout_constraintBottom_toBottomOf="parent"
+        app:layout_constraintEnd_toEndOf="parent" />
+</androidx.constraintlayout.widget.ConstraintLayout>

MaterialDrawer/src/main/res/layout/material_drawer_item_container.xml

@@ -0,0 +1,7 @@
+<?xml version="1.0" encoding="utf-8"?>
+<LinearLayout xmlns:android="http://schemas.android.com/apk/res/android"
+    android:layout_width="match_parent"
+    android:layout_height="wrap_content"
+    android:orientation="vertical">
+
+</LinearLayout>

MaterialDrawer/src/main/res/layout/material_drawer_item_divider.xml

@@ -0,0 +1,12 @@
+<?xml version="1.0" encoding="utf-8"?>
+<RelativeLayout xmlns:android="http://schemas.android.com/apk/res/android"
+    android:layout_width="match_parent"
+    android:layout_height="wrap_content"
+    android:paddingTop="@dimen/material_drawer_padding"
+    android:paddingBottom="@dimen/material_drawer_padding">
+
+    <View
+        android:id="@+id/material_drawer_divider"
+        android:layout_width="match_parent"
+        android:layout_height="1dp" />
+</RelativeLayout>

MaterialDrawer/src/main/res/layout/material_drawer_item_expandable.xml

@@ -0,0 +1,79 @@
+<?xml version="1.0" encoding="utf-8"?>
+<androidx.constraintlayout.widget.ConstraintLayout xmlns:android="http://schemas.android.com/apk/res/android"
+    xmlns:app="http://schemas.android.com/apk/res-auto"
+    xmlns:tools="http://schemas.android.com/tools"
+    android:layout_width="match_parent"
+    android:layout_height="@dimen/material_drawer_item_primary"
+    android:orientation="horizontal"
+    android:paddingStart="@dimen/material_drawer_vertical_padding"
+    android:paddingLeft="@dimen/material_drawer_vertical_padding"
+    android:paddingEnd="@dimen/material_drawer_vertical_padding"
+    android:paddingRight="@dimen/material_drawer_vertical_padding">
+
+    <androidx.appcompat.widget.AppCompatImageView
+        android:id="@+id/material_drawer_icon"
+        android:layout_width="@dimen/material_drawer_item_primary_icon"
+        android:layout_height="@dimen/material_drawer_item_primary"
+        android:layout_gravity="center_vertical"
+        android:paddingStart="0dp"
+        android:paddingLeft="0dp"
+        android:paddingTop="@dimen/material_drawer_item_primary_icon_padding"
+        android:paddingEnd="@dimen/material_drawer_item_primary_icon_padding_right"
+        android:paddingRight="@dimen/material_drawer_item_primary_icon_padding_right"
+        android:paddingBottom="@dimen/material_drawer_item_primary_icon_padding"
+        app:layout_constraintBottom_toBottomOf="parent"
+        app:layout_constraintStart_toStartOf="parent"
+        app:layout_constraintTop_toTopOf="parent" />
+
+    <androidx.appcompat.widget.AppCompatTextView
+        android:id="@+id/material_drawer_name"
+        android:layout_width="0dp"
+        android:layout_height="wrap_content"
+        android:fontFamily="sans-serif-medium"
+        android:gravity="center_vertical|start"
+        android:lines="1"
+        android:singleLine="true"
+        android:textDirection="anyRtl"
+        android:textSize="@dimen/material_drawer_item_primary_text"
+        app:layout_constraintBottom_toTopOf="@id/material_drawer_description"
+        app:layout_constraintEnd_toStartOf="@+id/material_drawer_arrow_container"
+        app:layout_constraintStart_toEndOf="@id/material_drawer_icon"
+        app:layout_constraintTop_toTopOf="parent"
+        app:layout_constraintVertical_chainStyle="packed"
+        tools:text="Some drawer text" />
+
+    <androidx.appcompat.widget.AppCompatTextView
+        android:id="@+id/material_drawer_description"
+        android:layout_width="0dp"
+        android:layout_height="wrap_content"
+        android:fontFamily="sans-serif"
+        android:gravity="center_vertical|start"
+        android:lines="1"
+        android:singleLine="true"
+        android:textDirection="anyRtl"
+        android:textSize="@dimen/material_drawer_item_primary_description"
+        app:layout_constraintBottom_toBottomOf="parent"
+        app:layout_constraintEnd_toStartOf="@+id/material_drawer_arrow_container"
+        app:layout_constraintStart_toEndOf="@id/material_drawer_icon"
+        app:layout_constraintTop_toBottomOf="@id/material_drawer_name"
+        tools:text="Some drawer text" />
+
+    <LinearLayout
+        android:id="@+id/material_drawer_arrow_container"
+        android:layout_width="wrap_content"
+        android:layout_height="match_parent"
+        android:gravity="center"
+        android:paddingStart="@dimen/material_drawer_padding"
+        android:paddingLeft="@dimen/material_drawer_padding"
+        android:paddingEnd="0dp"
+        android:paddingRight="0dp"
+        app:layout_constraintBottom_toBottomOf="parent"
+        app:layout_constraintEnd_toEndOf="parent"
+        app:layout_constraintTop_toTopOf="parent">
+
+        <androidx.appcompat.widget.AppCompatImageView
+            android:id="@+id/material_drawer_arrow"
+            android:layout_width="16dp"
+            android:layout_height="16dp" />
+    </LinearLayout>
+</androidx.constraintlayout.widget.ConstraintLayout>