[4.13.4] Update build.gradle, signing and changelog.

.idea/codeStyles/Project.xml

@@ -1,6 +1,7 @@
 <component name="ProjectCodeStyleConfiguration">
   <code_scheme name="Project" version="173">
     <JetCodeStyleSettings>
+      <option name="NAME_COUNT_TO_USE_STAR_IMPORT" value="2147483647" />
       <option name="ALLOW_TRAILING_COMMA" value="true" />
       <option name="CODE_STYLE_DEFAULTS" value="KOTLIN_OFFICIAL" />
     </JetCodeStyleSettings>

app/build.gradle

@@ -156,6 +156,7 @@ dependencies {
     implementation "androidx.navigation:navigation-fragment-ktx:2.5.2"
     implementation "androidx.recyclerview:recyclerview:1.2.1"
     implementation "androidx.room:room-runtime:2.4.3"
+    implementation "androidx.room:room-ktx:2.4.3"
     implementation "androidx.work:work-runtime-ktx:2.7.1"
     kapt "androidx.room:room-compiler:2.4.3"
 
@@ -208,7 +209,7 @@ dependencies {
     implementation "com.daimajia.swipelayout:library:1.2.0@aar"
     implementation "com.github.Applandeo:Material-Calendar-View:15de569cbc" // https://github.com/Applandeo/Material-Calendar-View
     implementation "com.github.CanHub:Android-Image-Cropper:2.2.2" // https://github.com/CanHub/Android-Image-Cropper
-    implementation "com.github.ChuckerTeam.Chucker:library:3.0.1" // https://github.com/ChuckerTeam/chucker
+    implementation "com.github.ChuckerTeam.Chucker:library:3.5.2" // https://github.com/ChuckerTeam/chucker
     implementation "com.github.antonKozyriatskyi:CircularProgressIndicator:1.2.2" // https://github.com/antonKozyriatskyi/CircularProgressIndicator
     implementation "com.github.bassaer:chatmessageview:2.0.1" // https://github.com/bassaer/ChatMessageView
     implementation "com.github.hypertrack:hyperlog-android:0.0.10" // https://github.com/hypertrack/hyperlog-android

app/proguard-rules.pro

@@ -22,6 +22,7 @@
 -keep class android.support.v7.widget.** { *; }
 
 -keep class pl.szczodrzynski.edziennik.utils.models.** { *; }
+-keep class pl.szczodrzynski.edziennik.data.db.enums.* { *; }
 -keep class pl.szczodrzynski.edziennik.data.db.entity.Event { *; }
 -keep class pl.szczodrzynski.edziennik.data.db.full.EventFull { *; }
 -keep class pl.szczodrzynski.edziennik.data.db.entity.FeedbackMessage { *; }
@@ -31,6 +32,9 @@
 -keepnames class pl.szczodrzynski.edziennik.ui.widgets.timetable.WidgetTimetableProvider
 -keepnames class pl.szczodrzynski.edziennik.ui.widgets.notifications.WidgetNotificationsProvider
 -keepnames class pl.szczodrzynski.edziennik.ui.widgets.luckynumber.WidgetLuckyNumberProvider
+-keep class pl.szczodrzynski.edziennik.config.AppData { *; }
+-keep class pl.szczodrzynski.edziennik.config.AppData$** { *; }
+-keep class pl.szczodrzynski.edziennik.utils.managers.TextStylingManager$HtmlMode { *; }
 
 -keepnames class androidx.appcompat.view.menu.MenuBuilder { setHeaderTitleInt(java.lang.CharSequence); }
 -keepnames class androidx.appcompat.view.menu.MenuPopupHelper { showPopup(int, int, boolean, boolean); }

app/src/main/assets/pl-changelog.html

@@ -1,12 +1,13 @@
-<h3>Wersja 4.13-rc.1, 2022-10-22</h3>
+<h3>Wersja 4.13.4, 2022-12-26</h3>
 <ul>
-    <li>Poprawione powiadomienia na Androidzie 13. @santoni0</li>
+    <li>USOS: zaktualizowano rodzaje wydarzeń. Wybór przedmiotu jest teraz zawsze widoczny.</li>
-    <li>Możliwość dostosowania wyświetlania planu lekcji.</li>
+    <li>Opcja wyświetlania nazwy przedmiotu w miejscu rodzaju wydarzenia.</li>
-    <li>Opcja kolorowania bloków w planie lekcji.</li>
+    <li>Notatki zastępujące treść lekcji są teraz wyświetlane wszędzie.</li>
-    <li><b>USOS</b> - pierwsza wersja obsługi systemu. Osobne rodzaje wydarzeń (oraz wygląd niektórych części aplikacji) lepiej dostosowany do nauki na studiach.</li>
+    <li>Na ekranie odliczania czasu lekcji również pada śnieg.</li>
-    <li>Poprawione opcje filtrowania powiadomień i wyboru przycisków menu bocznego.</li>
+    <li>Poprawiono synchronizację w Mobidzienniku bez ustawionego adresu e-mail.</li>
+    <li>Poprawiono błąd synchronizacji w Vulcanie.</li>
 </ul>
 <br>
 <br>
 Dzięki za korzystanie ze Szkolnego!<br>
-<i>&copy; [Kuba Szczodrzyński](@kuba2k2), [Kacper Ziubryniewicz](@kapi2289) 2022</i>
+<i>&copy; [Kuba Szczodrzyński](@kuba2k2) 2022</i>

app/src/main/cpp/szkolny-signing.cpp

@@ -9,7 +9,7 @@
 
 /*secret password - removed for source code publication*/
 static toys AES_IV[16] = {
-	0xb7, 0x04, 0xed, 0xb5, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff  };
+	0x4b, 0x43, 0x7e, 0xa2, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff  };
 
 unsigned char *agony(unsigned int laugh, unsigned char *box, unsigned char *heat);
 

app/src/main/java/pl/szczodrzynski/edziennik/App.kt

@@ -28,7 +28,11 @@ import com.google.gson.Gson
 import com.hypertrack.hyperlog.HyperLog
 import com.mikepenz.iconics.Iconics
 import im.wangchao.mhttp.MHttp
-import kotlinx.coroutines.*
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.Job
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 import me.leolin.shortcutbadger.ShortcutBadger
 import okhttp3.OkHttpClient
 import org.greenrobot.eventbus.EventBus
@@ -55,7 +59,19 @@ import pl.szczodrzynski.edziennik.utils.PermissionChecker
 import pl.szczodrzynski.edziennik.utils.Themes
 import pl.szczodrzynski.edziennik.utils.Utils
 import pl.szczodrzynski.edziennik.utils.Utils.d
-import pl.szczodrzynski.edziennik.utils.managers.*
+import pl.szczodrzynski.edziennik.utils.managers.AttendanceManager
+import pl.szczodrzynski.edziennik.utils.managers.AvailabilityManager
+import pl.szczodrzynski.edziennik.utils.managers.BuildManager
+import pl.szczodrzynski.edziennik.utils.managers.EventManager
+import pl.szczodrzynski.edziennik.utils.managers.GradesManager
+import pl.szczodrzynski.edziennik.utils.managers.MessageManager
+import pl.szczodrzynski.edziennik.utils.managers.NoteManager
+import pl.szczodrzynski.edziennik.utils.managers.NotificationChannelsManager
+import pl.szczodrzynski.edziennik.utils.managers.PermissionManager
+import pl.szczodrzynski.edziennik.utils.managers.TextStylingManager
+import pl.szczodrzynski.edziennik.utils.managers.TimetableManager
+import pl.szczodrzynski.edziennik.utils.managers.UpdateManager
+import pl.szczodrzynski.edziennik.utils.managers.UserActionManager
 import java.util.concurrent.TimeUnit
 import kotlin.coroutines.CoroutineContext
 import kotlin.system.exitProcess
@@ -80,18 +96,19 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
     }
 
     val api by lazy { SzkolnyApi(this) }
-    val notificationChannelsManager by lazy { NotificationChannelsManager(this) }
-    val userActionManager by lazy { UserActionManager(this) }
-    val gradesManager by lazy { GradesManager(this) }
-    val timetableManager by lazy { TimetableManager(this) }
-    val eventManager by lazy { EventManager(this) }
-    val permissionManager by lazy { PermissionManager(this) }
     val attendanceManager by lazy { AttendanceManager(this) }
-    val buildManager by lazy { BuildManager(this) }
     val availabilityManager by lazy { AvailabilityManager(this) }
-    val textStylingManager by lazy { TextStylingManager(this) }
+    val buildManager by lazy { BuildManager(this) }
+    val eventManager by lazy { EventManager(this) }
+    val gradesManager by lazy { GradesManager(this) }
     val messageManager by lazy { MessageManager(this) }
     val noteManager by lazy { NoteManager(this) }
+    val notificationChannelsManager by lazy { NotificationChannelsManager(this) }
+    val permissionManager by lazy { PermissionManager(this) }
+    val textStylingManager by lazy { TextStylingManager(this) }
+    val timetableManager by lazy { TimetableManager(this) }
+    val updateManager by lazy { UpdateManager(this) }
+    val userActionManager by lazy { UserActionManager(this) }
 
     val db
         get() = App.db
@@ -190,12 +207,6 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         Iconics.init(applicationContext)
         Iconics.respectFontBoundsDefault = true
 
-        if (devMode) {
-            HyperLog.initialize(this)
-            HyperLog.setLogLevel(Log.VERBOSE)
-            HyperLog.setLogFormat(DebugLogFormat(this))
-        }
-
         // initialize companion object values
         AppData.read(this)
         App.db = AppDb(this)
@@ -204,6 +215,12 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         devMode = config.devMode ?: debugMode
         enableChucker = config.enableChucker ?: devMode
 
+        if (devMode) {
+            HyperLog.initialize(this)
+            HyperLog.setLogLevel(Log.VERBOSE)
+            HyperLog.setLogFormat(DebugLogFormat(this))
+        }
+
         if (!profileLoadById(config.lastProfileId)) {
             val success = db.profileDao().firstId?.let { profileLoadById(it) }
             if (success != true)
@@ -405,6 +422,12 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         try {
             App.data = AppData.get(profile.loginStoreType)
             d("App", "Loaded AppData: ${App.data}")
+            // apply newly-added config overrides, if not changed by the user yet
+            for ((key, value) in App.data.configOverrides) {
+                val config = App.profile.config
+                if (!config.has(key))
+                    config.set(key, value)
+            }
         } catch (e: Exception) {
             Log.e("App", "Cannot load AppData", e)
             Toast.makeText(this, R.string.app_cannot_load_data, Toast.LENGTH_LONG).show()
@@ -445,6 +468,8 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
     }
     fun profileSave() = profileSave(profile)
     fun profileSave(profile: Profile) {
+        if (profile.id == profileId)
+            App.profile = profile
         launch(Dispatchers.Default) {
             App.db.profileDao().add(profile)
         }

app/src/main/java/pl/szczodrzynski/edziennik/MainActivity.kt

@@ -46,6 +46,7 @@ import pl.szczodrzynski.edziennik.databinding.ActivitySzkolnyBinding
 import pl.szczodrzynski.edziennik.ext.*
 import pl.szczodrzynski.edziennik.sync.AppManagerDetectedEvent
 import pl.szczodrzynski.edziennik.sync.SyncWorker
+import pl.szczodrzynski.edziennik.sync.UpdateStateEvent
 import pl.szczodrzynski.edziennik.sync.UpdateWorker
 import pl.szczodrzynski.edziennik.ui.base.MainSnackbar
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
@@ -56,6 +57,7 @@ import pl.szczodrzynski.edziennik.ui.dialogs.sync.RegisterUnavailableDialog
 import pl.szczodrzynski.edziennik.ui.dialogs.sync.ServerMessageDialog
 import pl.szczodrzynski.edziennik.ui.dialogs.sync.SyncViewListDialog
 import pl.szczodrzynski.edziennik.ui.dialogs.sync.UpdateAvailableDialog
+import pl.szczodrzynski.edziennik.ui.dialogs.sync.UpdateProgressDialog
 import pl.szczodrzynski.edziennik.ui.error.ErrorDetailsDialog
 import pl.szczodrzynski.edziennik.ui.error.ErrorSnackbar
 import pl.szczodrzynski.edziennik.ui.event.EventManualDialog
@@ -320,7 +322,7 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
 
         // IT'S WINTER MY DUDES
         val today = Date.getToday()
-        if ((today.month % 11 == 1) && app.config.ui.snowfall) {
+        if ((today.month / 3 % 4 == 0) && app.config.ui.snowfall) {
             b.rootFrame.addView(layoutInflater.inflate(R.layout.snowfall, b.rootFrame, false))
         } else if (app.config.ui.eggfall && BigNightUtil().isDataWielkanocyNearDzisiaj()) {
             val eggfall = layoutInflater.inflate(
@@ -536,6 +538,14 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
         UpdateAvailableDialog(this, event).show()
     }
 
+    @Subscribe(threadMode = ThreadMode.MAIN, sticky = true)
+    fun onUpdateStateEvent(event: UpdateStateEvent) {
+        if (!event.running)
+            return
+        EventBus.getDefault().removeStickyEvent(event)
+        UpdateProgressDialog(this, event.update ?: return, event.downloadId).show()
+    }
+
     @Subscribe(threadMode = ThreadMode.MAIN, sticky = true)
     fun onRegisterAvailabilityEvent(event: RegisterAvailabilityEvent) {
         EventBus.getDefault().removeStickyEvent(event)
@@ -699,6 +709,10 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
 
         if (extras?.containsKey("action") == true) {
             val handled = when (extras.getString("action")) {
+                "updateRequest" -> {
+                    UpdateAvailableDialog(this, app.config.update).show()
+                    true
+                }
                 "serverMessage" -> {
                     ServerMessageDialog(
                         this,

app/src/main/java/pl/szczodrzynski/edziennik/config/AppData.kt

@@ -59,10 +59,11 @@ data class AppData(
         val lessonHeight: Int,
         val enableMarkAsReadAnnouncements: Boolean,
         val enableNoticePoints: Boolean,
+        val eventManualShowSubjectDropdown: Boolean,
     )
 
     data class EventType(
-        val id: Int,
+        val id: Long,
         val color: String,
         val name: String,
     )

app/src/main/java/pl/szczodrzynski/edziennik/config/BaseConfig.kt

@@ -14,6 +14,7 @@ import pl.szczodrzynski.edziennik.ext.takePositive
 import kotlin.coroutines.CoroutineContext
 
 abstract class BaseConfig(
+    @Transient
     val db: AppDb,
     val profileId: Int? = null,
     protected var entries: List<ConfigEntry>? = null,
@@ -42,4 +43,6 @@ abstract class BaseConfig(
             db.configDao().add(ConfigEntry(profileId ?: -1, key, value))
         }
     }
+
+    fun has(key: String) = values.containsKey(key)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/Config.kt

@@ -24,7 +24,7 @@ class Config(db: AppDb) : BaseConfig(db) {
     val timetable by lazy { ConfigTimetable(this) }
     val grades by lazy { ConfigGrades(this) }
 
-    var dataVersion by config<Int>(0)
+    var dataVersion by config<Int>(DATA_VERSION)
     var hash by config<String>("")
 
     var lastProfileId by config<Int>(0)
@@ -33,12 +33,13 @@ class Config(db: AppDb) : BaseConfig(db) {
     var update by config<Update?>(null)
     var updatesChannel by config<String>("release")
 
-    var devMode by config<Boolean?>(null)
+    var devMode by config<Boolean?>("debugMode", null)
     var devModePassword by config<String?>(null)
     var enableChucker by config<Boolean?>(null)
 
     var apiAvailabilityCheck by config<Boolean>(true)
     var apiInvalidCert by config<String?>(null)
+    var apiKeyCustom by config<String?>(null)
     var appInstalledTime by config<Long>(0L)
     var appRateSnackbarTime by config<Long>(0L)
     var appVersion by config<Int>(BuildConfig.VERSION_CODE)
@@ -49,15 +50,14 @@ class Config(db: AppDb) : BaseConfig(db) {
     var widgetConfigs by config<JsonObject> { JsonObject() }
 
     fun migrate(app: App) {
-        if (dataVersion < DATA_VERSION)
+        if (dataVersion < DATA_VERSION || hash == "")
+            // migrate old data version OR freshly installed app (or updated from 3.x)
             ConfigMigration(app, this)
     }
 
-    fun getFor(profileId: Int): ProfileConfig {
+    operator fun get(profileId: Int): ProfileConfig {
         return profileConfigs[profileId] ?: ProfileConfig(db, profileId, entries).also {
             profileConfigs[profileId] = it
         }
     }
-
-    fun forProfile() = getFor(App.profileId)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/DelegateConfig.kt

@@ -115,9 +115,9 @@ class ConfigDelegate<T>(
             is Boolean -> value
             // enums, maps & collections
             is Enum<*> -> value.toInt()
-            is Collection<*> -> JsonArray(value.map {
+            is Collection<*> -> value.map {
                 if (it is Number || it is Boolean) it else serialize(it, serializeObjects = false)
-            })
+            }.toJsonElement()
             is Map<*, *> -> gson.toJson(value.mapValues { (_, it) ->
                 if (it is Number || it is Boolean) it else serialize(it, serializeObjects = false)
             })

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfig.kt

@@ -15,7 +15,7 @@ class ProfileConfig(
     entries: List<ConfigEntry>?,
 ) : BaseConfig(db, profileId, entries) {
     companion object {
-        const val DATA_VERSION = 4
+        const val DATA_VERSION = 5
     }
 
     val grades by lazy { ProfileConfigGrades(this) }
@@ -26,9 +26,11 @@ class ProfileConfig(
     val timetable by lazy { ConfigTimetable(this) }
     val grades by lazy { ConfigGrades(this) }*/
 
-    var dataVersion by config<Int>(0)
+    var dataVersion by config<Int>(DATA_VERSION)
     var hash by config<String>("")
 
+    var shareByDefault by config<Boolean>(false)
+
     init {
         if (dataVersion < DATA_VERSION)
             ProfileConfigMigration(this)

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfigUI.kt

@@ -15,6 +15,7 @@ class ProfileConfigUI(base: ProfileConfig) {
     var agendaGroupByType by base.config<Boolean>(false)
     var agendaLessonChanges by base.config<Boolean>(true)
     var agendaTeacherAbsence by base.config<Boolean>(true)
+    var agendaSubjectImportant by base.config<Boolean>(false)
     var agendaElearningMark by base.config<Boolean>(false)
     var agendaElearningGroup by base.config<Boolean>(true)
 

app/src/main/java/pl/szczodrzynski/edziennik/config/utils/AppConfigMigrationV3.kt

@@ -16,9 +16,9 @@ import pl.szczodrzynski.edziennik.utils.models.Time
 import kotlin.math.abs
 
 class AppConfigMigrationV3(p: SharedPreferences, config: Config) {
-    init { config.apply {
+    init {
         val s = "app.appConfig"
-        if (dataVersion < 1) {
+        config.apply {
             ui.theme = p.getString("$s.appTheme", null)?.toIntOrNull() ?: 1
             sync.enabled = p.getString("$s.registerSyncEnabled", null)?.toBoolean() ?: true
             sync.interval = p.getString("$s.registerSyncInterval", null)?.toIntOrNull() ?: 3600
@@ -37,9 +37,6 @@ class AppConfigMigrationV3(p: SharedPreferences, config: Config) {
                     NavTarget.HOMEWORK,
                     NavTarget.SETTINGS
             )
-            dataVersion = 1
-        }
-        if (dataVersion < 2) {
             devModePassword = p.getString("$s.devModePassword", null).fix()
             sync.tokenApp = p.getString("$s.fcmToken", null).fix()
             timetable.bellSyncMultiplier = p.getString("$s.bellSyncMultiplier", null)?.toIntOrNull() ?: 0
@@ -86,9 +83,8 @@ class AppConfigMigrationV3(p: SharedPreferences, config: Config) {
                     LoginType.LIBRUS.id -> sync.tokenLibrus = token
                 }
             }
-            dataVersion = 2
         }
-    }}
+    }
 
     private fun String?.fix(): String? {
         return this?.replace("\"", "")?.let { if (it == "null") null else it }

app/src/main/java/pl/szczodrzynski/edziennik/config/utils/ConfigMigration.kt

@@ -5,12 +5,9 @@
 package pl.szczodrzynski.edziennik.config.utils
 
 import android.content.Context
+import androidx.core.content.edit
 import pl.szczodrzynski.edziennik.App
-import pl.szczodrzynski.edziennik.BuildConfig
 import pl.szczodrzynski.edziennik.config.Config
-import pl.szczodrzynski.edziennik.ext.HOUR
-import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
-import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.ORDER_BY_DATE_DESC
 import pl.szczodrzynski.edziennik.utils.models.Time
 import kotlin.math.abs
 
@@ -22,6 +19,9 @@ class ConfigMigration(app: App, config: Config) {
             // migrate appConfig from app version 3.x and lower.
             // Updates dataVersion to level 2.
             AppConfigMigrationV3(p, config)
+            p.edit {
+                remove("app.appConfig.appTheme")
+            }
         }
 
         if (dataVersion < 11) {
@@ -43,5 +43,7 @@ class ConfigMigration(app: App, config: Config) {
 
             dataVersion = 11
         }
+
+        hash = "invalid"
     }}
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/utils/ProfileConfigMigration.kt

@@ -16,6 +16,8 @@ import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.YEAR_AL
 class ProfileConfigMigration(config: ProfileConfig) {
     init { config.apply {
 
+        val profile = db.profileDao().getByIdNow(profileId ?: -1)
+
         if (dataVersion < 2) {
             sync.notificationFilter = sync.notificationFilter + NotificationType.TEACHER_ABSENCE
 
@@ -37,11 +39,23 @@ class ProfileConfigMigration(config: ProfileConfig) {
             // switch to new event types (USOS)
             dataVersion = 4
 
-            val profile = db.profileDao().getByIdNow(profileId ?: -1)
             if (profile?.loginStoreType?.schoolType == SchoolType.UNIVERSITY) {
                 db.eventTypeDao().clear(profileId ?: -1)
                 db.eventTypeDao().addDefaultTypes(profile)
             }
         }
+
+        if (dataVersion < 5) {
+            // update USOS event types and the appropriate events (2022-12-25)
+            dataVersion = 5
+
+            if (profile?.loginStoreType?.schoolType == SchoolType.UNIVERSITY) {
+                db.eventTypeDao().getAllWithDefaults(profile)
+                // wejściówka (4) -> kartkówka (3)
+                db.eventDao().getRawNow("UPDATE events SET eventType = 3 WHERE profileId = $profileId AND eventType = 4;")
+                // zadanie (6) -> zadanie domowe (-1)
+                db.eventDao().getRawNow("UPDATE events SET eventType = -1 WHERE profileId = $profileId AND eventType = 6;")
+            }
+        }
     }}
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/EdziennikTask.kt

@@ -28,6 +28,8 @@ import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.data.db.full.AnnouncementFull
 import pl.szczodrzynski.edziennik.data.db.full.EventFull
 import pl.szczodrzynski.edziennik.data.db.full.MessageFull
+import pl.szczodrzynski.edziennik.ext.isBeforeYear
+import pl.szczodrzynski.edziennik.ext.shouldArchive
 import pl.szczodrzynski.edziennik.utils.Utils.d
 import pl.szczodrzynski.edziennik.utils.managers.AvailabilityManager.Error.Type
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/ProfileArchiver.kt

@@ -52,28 +52,29 @@ class ProfileArchiver(val app: App, val profile: Profile) {
 
         when (profile.loginStoreType) {
             LoginType.LIBRUS -> {
-                profile.removeStudentData("isPremium")
+                profile.studentData.remove("isPremium")
-                profile.removeStudentData("pushDeviceId")
+                profile.studentData.remove("pushDeviceId")
-                profile.removeStudentData("startPointsSemester1")
+                profile.studentData.remove("startPointsSemester1")
-                profile.removeStudentData("startPointsSemester2")
+                profile.studentData.remove("startPointsSemester2")
-                profile.removeStudentData("enablePointGrades")
+                profile.studentData.remove("enablePointGrades")
-                profile.removeStudentData("enableDescriptiveGrades")
+                profile.studentData.remove("enableDescriptiveGrades")
             }
             LoginType.MOBIDZIENNIK -> {}
             LoginType.VULCAN -> {
                 // DataVulcan.isApiLoginValid() returns false so it will update the semester
-                profile.removeStudentData("currentSemesterEndDate")
+                profile.studentData.remove("currentSemesterEndDate")
-                profile.removeStudentData("studentSemesterId")
+                profile.studentData.remove("studentSemesterId")
-                profile.removeStudentData("studentSemesterNumber")
+                profile.studentData.remove("studentSemesterNumber")
-                profile.removeStudentData("semester1Id")
+                profile.studentData.remove("semester1Id")
-                profile.removeStudentData("semester2Id")
+                profile.studentData.remove("semester2Id")
-                profile.removeStudentData("studentClassId")
+                profile.studentData.remove("studentClassId")
             }
             LoginType.IDZIENNIK -> {
-                profile.removeStudentData("schoolYearId")
+                profile.studentData.remove("schoolYearId")
             }
             LoginType.EDUDZIENNIK -> {}
             LoginType.PODLASIE -> {}
+            LoginType.USOS -> {}
             LoginType.DEMO -> {}
             LoginType.TEMPLATE -> {}
         }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/DataLibrus.kt

@@ -10,7 +10,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 
 class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app, profile, loginStore) {
 
@@ -117,7 +119,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiLogin: String? = null
     var apiLogin: String?
         get() { mApiLogin = mApiLogin ?: profile?.getStudentData("accountLogin", null); return mApiLogin }
-        set(value) { profile?.putStudentData("accountLogin", value); mApiLogin = value }
+        set(value) { profile["accountLogin"] = value; mApiLogin = value }
     /**
      * A Synergia password.
      * Used: for login (API Login Method) in Synergia mode.
@@ -126,7 +128,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiPassword: String? = null
     var apiPassword: String?
         get() { mApiPassword = mApiPassword ?: profile?.getStudentData("accountPassword", null); return mApiPassword }
-        set(value) { profile?.putStudentData("accountPassword", value); mApiPassword = value }
+        set(value) { profile["accountPassword"] = value; mApiPassword = value }
 
     /**
      * A JST login Code.
@@ -135,7 +137,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiCode: String? = null
     var apiCode: String?
         get() { mApiCode = mApiCode ?: loginStore.getLoginData("accountCode", null); return mApiCode }
-        set(value) { profile?.putStudentData("accountCode", value); mApiCode = value }
+        set(value) { profile["accountCode"] = value; mApiCode = value }
     /**
      * A JST login PIN.
      * Used only during first login in JST mode.
@@ -143,7 +145,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiPin: String? = null
     var apiPin: String?
         get() { mApiPin = mApiPin ?: loginStore.getLoginData("accountPin", null); return mApiPin }
-        set(value) { profile?.putStudentData("accountPin", value); mApiPin = value }
+        set(value) { profile["accountPin"] = value; mApiPin = value }
 
     /**
      * A Synergia API access token.
@@ -154,7 +156,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiAccessToken: String? = null
     var apiAccessToken: String?
         get() { mApiAccessToken = mApiAccessToken ?: profile?.getStudentData("accountToken", null); return mApiAccessToken }
-        set(value) { mApiAccessToken = value; profile?.putStudentData("accountToken", value) ?: return; }
+        set(value) { mApiAccessToken = value; profile["accountToken"] = value ?: return; }
     /**
      * A Synergia API refresh token.
      * Used when refreshing the [apiAccessToken] in JST, Synergia modes.
@@ -162,7 +164,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiRefreshToken: String? = null
     var apiRefreshToken: String?
         get() { mApiRefreshToken = mApiRefreshToken ?: profile?.getStudentData("accountRefreshToken", null); return mApiRefreshToken }
-        set(value) { mApiRefreshToken = value; profile?.putStudentData("accountRefreshToken", value) ?: return; }
+        set(value) { mApiRefreshToken = value; profile["accountRefreshToken"] = value ?: return; }
     /**
      * The expiry time for [apiAccessToken], as a UNIX timestamp.
      * Used when refreshing the [apiAccessToken] in JST, Synergia modes.
@@ -171,7 +173,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiTokenExpiryTime: Long? = null
     var apiTokenExpiryTime: Long
         get() { mApiTokenExpiryTime = mApiTokenExpiryTime ?: profile?.getStudentData("accountTokenTime", 0L); return mApiTokenExpiryTime ?: 0L }
-        set(value) { mApiTokenExpiryTime = value; profile?.putStudentData("accountTokenTime", value) ?: return; }
+        set(value) { mApiTokenExpiryTime = value; profile["accountTokenTime"] = value; }
 
     /**
      * A push device ID, generated by Librus when registering
@@ -181,7 +183,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mPushDeviceId: Int? = null
     var pushDeviceId: Int
         get() { mPushDeviceId = mPushDeviceId ?: profile?.getStudentData("pushDeviceId", 0); return mPushDeviceId ?: 0 }
-        set(value) { mPushDeviceId = value; profile?.putStudentData("pushDeviceId", value) ?: return; }
+        set(value) { mPushDeviceId = value; profile["pushDeviceId"] = value; }
 
     /*     _____                            _
           / ____|                          (_)
@@ -198,7 +200,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSynergiaSessionId: String? = null
     var synergiaSessionId: String?
         get() { mSynergiaSessionId = mSynergiaSessionId ?: profile?.getStudentData("accountSID", null); return mSynergiaSessionId }
-        set(value) { profile?.putStudentData("accountSID", value) ?: return; mSynergiaSessionId = value }
+        set(value) { profile["accountSID"] = value; mSynergiaSessionId = value }
     /**
      * The expiry time for [synergiaSessionId], as a UNIX timestamp.
      * Used in endpoints with Synergia login method.
@@ -207,7 +209,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSynergiaSessionIdExpiryTime: Long? = null
     var synergiaSessionIdExpiryTime: Long
         get() { mSynergiaSessionIdExpiryTime = mSynergiaSessionIdExpiryTime ?: profile?.getStudentData("accountSIDTime", 0L); return mSynergiaSessionIdExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("accountSIDTime", value) ?: return; mSynergiaSessionIdExpiryTime = value }
+        set(value) { profile["accountSIDTime"] = value; mSynergiaSessionIdExpiryTime = value }
 
 
     /**
@@ -217,7 +219,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mMessagesSessionId: String? = null
     var messagesSessionId: String?
         get() { mMessagesSessionId = mMessagesSessionId ?: profile?.getStudentData("messagesSID", null); return mMessagesSessionId }
-        set(value) { profile?.putStudentData("messagesSID", value) ?: return; mMessagesSessionId = value }
+        set(value) { profile["messagesSID"] = value; mMessagesSessionId = value }
     /**
      * The expiry time for [messagesSessionId], as a UNIX timestamp.
      * Used in endpoints with Messages login method.
@@ -226,7 +228,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mMessagesSessionIdExpiryTime: Long? = null
     var messagesSessionIdExpiryTime: Long
         get() { mMessagesSessionIdExpiryTime = mMessagesSessionIdExpiryTime ?: profile?.getStudentData("messagesSIDTime", 0L); return mMessagesSessionIdExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("messagesSIDTime", value) ?: return; mMessagesSessionIdExpiryTime = value }
+        set(value) { profile["messagesSIDTime"] = value; mMessagesSessionIdExpiryTime = value }
 
     /*     ____  _   _
           / __ \| | | |
@@ -236,42 +238,42 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
           \____/ \__|_| |_|\___|*/
     var isPremium
         get() = profile?.getStudentData("isPremium", false) ?: false
-        set(value) { profile?.putStudentData("isPremium", value) }
+        set(value) { profile["isPremium"] = value }
 
     private var mSchoolName: String? = null
     var schoolName: String?
         get() { mSchoolName = mSchoolName ?: profile?.getStudentData("schoolName", null); return mSchoolName }
-        set(value) { profile?.putStudentData("schoolName", value) ?: return; mSchoolName = value }
+        set(value) { profile["schoolName"] = value; mSchoolName = value }
 
     private var mUnitId: Long? = null
     var unitId: Long
         get() { mUnitId = mUnitId ?: profile?.getStudentData("unitId", 0L); return mUnitId ?: 0L }
-        set(value) { profile?.putStudentData("unitId", value) ?: return; mUnitId = value }
+        set(value) { profile["unitId"] = value; mUnitId = value }
 
     private var mStartPointsSemester1: Int? = null
     var startPointsSemester1: Int
         get() { mStartPointsSemester1 = mStartPointsSemester1 ?: profile?.getStudentData("startPointsSemester1", 0); return mStartPointsSemester1 ?: 0 }
-        set(value) { profile?.putStudentData("startPointsSemester1", value) ?: return; mStartPointsSemester1 = value }
+        set(value) { profile["startPointsSemester1"] = value; mStartPointsSemester1 = value }
 
     private var mStartPointsSemester2: Int? = null
     var startPointsSemester2: Int
         get() { mStartPointsSemester2 = mStartPointsSemester2 ?: profile?.getStudentData("startPointsSemester2", 0); return mStartPointsSemester2 ?: 0 }
-        set(value) { profile?.putStudentData("startPointsSemester2", value) ?: return; mStartPointsSemester2 = value }
+        set(value) { profile["startPointsSemester2"] = value; mStartPointsSemester2 = value }
 
     private var mEnablePointGrades: Boolean? = null
     var enablePointGrades: Boolean
         get() { mEnablePointGrades = mEnablePointGrades ?: profile?.getStudentData("enablePointGrades", true); return mEnablePointGrades ?: true }
-        set(value) { profile?.putStudentData("enablePointGrades", value) ?: return; mEnablePointGrades = value }
+        set(value) { profile["enablePointGrades"] = value; mEnablePointGrades = value }
 
     private var mEnableDescriptiveGrades: Boolean? = null
     var enableDescriptiveGrades: Boolean
         get() { mEnableDescriptiveGrades = mEnableDescriptiveGrades ?: profile?.getStudentData("enableDescriptiveGrades", true); return mEnableDescriptiveGrades ?: true }
-        set(value) { profile?.putStudentData("enableDescriptiveGrades", value) ?: return; mEnableDescriptiveGrades = value }
+        set(value) { profile["enableDescriptiveGrades"] = value; mEnableDescriptiveGrades = value }
 
     private var mTimetableNotPublic: Boolean? = null
     var timetableNotPublic: Boolean
         get() { mTimetableNotPublic = mTimetableNotPublic ?: profile?.getStudentData("timetableNotPublic", false); return mTimetableNotPublic ?: false }
-        set(value) { profile?.putStudentData("timetableNotPublic", value) ?: return; mTimetableNotPublic = value }
+        set(value) { profile["timetableNotPublic"] = value; mTimetableNotPublic = value }
 
     /**
      * Set to false when Recaptcha helper doesn't provide a working token.

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/api/LibrusApiNotices.kt

@@ -36,7 +36,7 @@ class LibrusApiNotices(override val data: DataLibrus,
                 val id = note.getLong("Id") ?: return@forEach
                 val text = note.getString("Text") ?: ""
                 val categoryId = note.getJsonObject("Category")?.getLong("Id") ?: -1
-                val teacherId = note.getJsonObject("AddedBy")?.getLong("Id") ?: -1
+                val teacherId = note.getJsonObject("Teacher")?.getLong("Id") ?: -1
                 val addedDate = note.getString("Date")?.let { Date.fromY_m_d(it) } ?: return@forEach
 
                 val type = when (note.getInt("Positive")) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/api/LibrusApiTimetables.kt

@@ -190,6 +190,7 @@ class LibrusApiTimetables(override val data: DataLibrus,
         }
 
         lessonObject.id = lessonObject.buildId()
+        lessonObject.ownerId = lessonObject.buildOwnerId()
 
         val seen = profile.empty || lessonDate < Date.getToday()
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/messages/LibrusMessagesGetMessage.kt

@@ -125,7 +125,7 @@ class LibrusMessagesGetMessage(override val data: DataLibrus,
                         val receiverId = teacher?.id ?: -1
                         teacher?.loginId = receiverLoginId
 
-                        val readDateText = message.select("readed").text()
+                        val readDateText = receiver.select("readed").text()
                         val readDate = when (readDateText.isNotNullNorEmpty()) {
                             true -> Date.fromIso(readDateText)
                             else -> 0

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/synergia/LibrusSynergiaHomework.kt

@@ -16,6 +16,7 @@ import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.ext.HOUR
 import pl.szczodrzynski.edziennik.ext.get
+import pl.szczodrzynski.edziennik.ext.getSemesterStart
 import pl.szczodrzynski.edziennik.ext.singleOrNull
 import pl.szczodrzynski.edziennik.utils.models.Date
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/DataMobidziennik.kt

@@ -11,7 +11,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
 
@@ -85,7 +87,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
     private var mStudentId: Int? = null
     var studentId: Int
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", 0); return mStudentId ?: 0 }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
 
     /*   __          __  _
          \ \        / / | |
@@ -125,7 +127,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var globalId: String?
         get() { mGlobalId = mGlobalId ?: profile?.getStudentData("globalId", null); return mGlobalId }
-        set(value) { profile?.putStudentData("globalId", value) ?: return; mGlobalId = value }
+        set(value) { profile["globalId"] = value; mGlobalId = value }
     private var mGlobalId: String? = null
 
     /**
@@ -135,7 +137,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var loginEmail: String?
         get() { mLoginEmail = mLoginEmail ?: profile?.getStudentData("email", null); return mLoginEmail }
-        set(value) { profile?.putStudentData("email", value); mLoginEmail = value }
+        set(value) { profile["email"] = value; mLoginEmail = value }
     private var mLoginEmail: String? = null
 
     /**
@@ -144,7 +146,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var loginId: String?
         get() { mLoginId = mLoginId ?: profile?.getStudentData("loginId", null); return mLoginId }
-        set(value) { profile?.putStudentData("loginId", value) ?: return; mLoginId = value }
+        set(value) { profile["loginId"] = value; mLoginId = value }
     private var mLoginId: String? = null
 
     /**
@@ -152,7 +154,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var ciasteczkoAutoryzacji: String?
         get() { mCiasteczkoAutoryzacji = mCiasteczkoAutoryzacji ?: profile?.getStudentData("ciasteczkoAutoryzacji", null); return mCiasteczkoAutoryzacji }
-        set(value) { profile?.putStudentData("ciasteczkoAutoryzacji", value) ?: return; mCiasteczkoAutoryzacji = value }
+        set(value) { profile["ciasteczkoAutoryzacji"] = value; mCiasteczkoAutoryzacji = value }
     private var mCiasteczkoAutoryzacji: String? = null
 
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/api/MobidziennikApiAttendance.kt

@@ -12,6 +12,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Attendance.Companion.TYPE_PRESE
 import pl.szczodrzynski.edziennik.data.db.entity.Attendance.Companion.TYPE_RELEASED
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.ext.dateToSemester
 
 class MobidziennikApiAttendance(val data: DataMobidziennik, rows: List<String>) {
     init { run {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/api/MobidziennikApiTimetable.kt

@@ -88,6 +88,7 @@ class MobidziennikApiTimetable(val data: DataMobidziennik, rows: List<String>) {
                 }
 
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
 
                 val seen = profile.empty || date < Date.getToday()
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebAccountEmail.kt

@@ -10,6 +10,7 @@ import pl.szczodrzynski.edziennik.data.api.edziennik.mobidziennik.ENDPOINT_MOBID
 import pl.szczodrzynski.edziennik.data.api.edziennik.mobidziennik.data.MobidziennikWeb
 import pl.szczodrzynski.edziennik.ext.DAY
 import pl.szczodrzynski.edziennik.ext.get
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 
 class MobidziennikWebAccountEmail(override val data: DataMobidziennik,
                                   override val lastSync: Long?,
@@ -24,7 +25,8 @@ class MobidziennikWebAccountEmail(override val data: DataMobidziennik,
             MobidziennikLuckyNumberExtractor(data, text)
 
             val email = Regexes.MOBIDZIENNIK_ACCOUNT_EMAIL.find(text)?.let { it[1] }
-            data.loginEmail = email
+            if (email.isNotNullNorBlank())
+                data.loginEmail = email
 
             data.setSyncNext(ENDPOINT_MOBIDZIENNIK_WEB_ACCOUNT_EMAIL, if (email == null) 3* DAY else 7* DAY)
             onSuccess(ENDPOINT_MOBIDZIENNIK_WEB_ACCOUNT_EMAIL)

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebAttendance.kt

@@ -21,6 +21,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Attendance.Companion.TYPE_UNKNO
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.entity.SYNC_ALWAYS
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.ext.dateToSemester
 import pl.szczodrzynski.edziennik.ext.fixName
 import pl.szczodrzynski.edziennik.ext.get
 import pl.szczodrzynski.edziennik.ext.singleOrNull

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebGrades.kt

@@ -15,6 +15,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Grade.Companion.TYPE_NORMAL
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.entity.SYNC_ALWAYS
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.ext.dateToSemester
 import pl.szczodrzynski.edziennik.ext.fixWhiteSpaces
 import pl.szczodrzynski.edziennik.ext.get
 import pl.szczodrzynski.edziennik.ext.singleOrNull

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebTimetable.kt

@@ -336,6 +336,7 @@ class MobidziennikWebTimetable(
                 }
 
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
                 it.isExtra = isExtra
 
                 val seen = profile?.empty == false || lessonDate < Date.getToday()

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/login/MobidziennikLoginApi2.kt

@@ -16,6 +16,7 @@ import pl.szczodrzynski.edziennik.data.api.models.ApiError
 import pl.szczodrzynski.edziennik.ext.JsonObject
 import pl.szczodrzynski.edziennik.ext.getJsonObject
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
 import pl.szczodrzynski.edziennik.utils.Utils
 
@@ -77,7 +78,9 @@ class MobidziennikLoginApi2(val data: DataMobidziennik, val onSuccess: () -> Uni
                     }
                 }
 
-                data.loginEmail = json.getString("email")
+                val email = json.getString("email")
+                if (email.isNotNullNorBlank())
+                    data.loginEmail = email
                 data.globalId = json.getString("id_global")
                 data.loginId = json.getString("login")
                 onSuccess()

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/podlasie/DataPodlasie.kt

@@ -10,7 +10,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.crc32
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 
 class DataPodlasie(app: App, profile: Profile?, loginStore: LoginStore) : Data(app, profile, loginStore) {
 
@@ -40,7 +42,7 @@ class DataPodlasie(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mApiUrl: String? = null
     var apiUrl: String?
         get() { mApiUrl = mApiUrl ?: profile?.getStudentData("apiUrl", null); return mApiUrl }
-        set(value) { profile?.putStudentData("apiUrl", value) ?: return; mApiUrl = value }
+        set(value) { profile["apiUrl"] = value; mApiUrl = value }
 
     /*     ____  _   _
           / __ \| | | |
@@ -51,32 +53,32 @@ class DataPodlasie(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mStudentId: String? = null
     var studentId: String?
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", null); return mStudentId }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
 
     private var mStudentLogin: String? = null
     var studentLogin: String?
         get() { mStudentLogin = mStudentLogin ?: profile?.getStudentData("studentLogin", null); return mStudentLogin }
-        set(value) { profile?.putStudentData("studentLogin", value) ?: return; mStudentLogin = value }
+        set(value) { profile["studentLogin"] = value; mStudentLogin = value }
 
     private var mSchoolName: String? = null
     var schoolName: String?
         get() { mSchoolName = mSchoolName ?: profile?.getStudentData("schoolName", null); return mSchoolName }
-        set(value) { profile?.putStudentData("schoolName", value) ?: return; mSchoolName = value }
+        set(value) { profile["schoolName"] = value; mSchoolName = value }
 
     private var mClassName: String? = null
     var className: String?
         get() { mClassName = mClassName ?: profile?.getStudentData("className", null); return mClassName }
-        set(value) { profile?.putStudentData("className", value) ?: return; mClassName = value }
+        set(value) { profile["className"] = value; mClassName = value }
 
     private var mSchoolYear: String? = null
     var schoolYear: String?
         get() { mSchoolYear = mSchoolYear ?: profile?.getStudentData("schoolYear", null); return mSchoolYear }
-        set(value) { profile?.putStudentData("schoolYear", value) ?: return; mSchoolYear = value }
+        set(value) { profile["schoolYear"] = value; mSchoolYear = value }
 
     private var mCurrentSemester: Int? = null
     var currentSemester: Int
         get() { mCurrentSemester = mCurrentSemester ?: profile?.getStudentData("currentSemester", 0); return mCurrentSemester ?: 0 }
-        set(value) { profile?.putStudentData("currentSemester", value) ?: return; mCurrentSemester = value }
+        set(value) { profile["currentSemester"] = value; mCurrentSemester = value }
 
     val schoolShortName: String?
         get() = studentLogin?.split('@')?.get(1)?.replace(".podlaskie.pl", "")

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/podlasie/data/api/PodlasieApiFinalGrades.kt

@@ -17,6 +17,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Grade.Companion.TYPE_YEAR_PROPO
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.ext.getLong
+import pl.szczodrzynski.edziennik.ext.getSemesterStart
 import pl.szczodrzynski.edziennik.ext.getString
 
 class PodlasieApiFinalGrades(val data: DataPodlasie, val rows: List<JsonObject>) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/podlasie/data/api/PodlasieApiTimetable.kt

@@ -72,6 +72,7 @@ class PodlasieApiTimetable(val data: DataPodlasie, rows: List<JsonObject>) {
                 it.classroom = classroom
 
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
                 data.lessonList += it
             }
         }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/template/DataTemplate.kt

@@ -10,7 +10,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 
 /**
  * Use http://patorjk.com/software/taag/#p=display&f=Big for the ascii art
@@ -43,12 +45,12 @@ class DataTemplate(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mWebCookie: String? = null
     var webCookie: String?
         get() { mWebCookie = mWebCookie ?: profile?.getStudentData("webCookie", null); return mWebCookie }
-        set(value) { profile?.putStudentData("webCookie", value) ?: return; mWebCookie = value }
+        set(value) { profile["webCookie"] = value; mWebCookie = value }
 
     private var mWebExpiryTime: Long? = null
     var webExpiryTime: Long
         get() { mWebExpiryTime = mWebExpiryTime ?: profile?.getStudentData("webExpiryTime", 0L); return mWebExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("webExpiryTime", value) ?: return; mWebExpiryTime = value }
+        set(value) { profile["webExpiryTime"] = value; mWebExpiryTime = value }
 
     /*                   _
              /\         (_)
@@ -61,10 +63,10 @@ class DataTemplate(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mApiToken: String? = null
     var apiToken: String?
         get() { mApiToken = mApiToken ?: profile?.getStudentData("apiToken", null); return mApiToken }
-        set(value) { profile?.putStudentData("apiToken", value) ?: return; mApiToken = value }
+        set(value) { profile["apiToken"] = value; mApiToken = value }
 
     private var mApiExpiryTime: Long? = null
     var apiExpiryTime: Long
         get() { mApiExpiryTime = mApiExpiryTime ?: profile?.getStudentData("apiExpiryTime", 0L); return mApiExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("apiExpiryTime", value) ?: return; mApiExpiryTime = value }
+        set(value) { profile["apiExpiryTime"] = value; mApiExpiryTime = value }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/DataUsos.kt

@@ -9,6 +9,8 @@ import pl.szczodrzynski.edziennik.data.api.models.Data
 import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
+import pl.szczodrzynski.edziennik.ext.getStudentData
+import pl.szczodrzynski.edziennik.ext.set
 
 class DataUsos(
     app: App,
@@ -69,6 +71,6 @@ class DataUsos(
 
     var studentId: Int
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", 0); return mStudentId ?: 0 }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
     private var mStudentId: Int? = null
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/api/UsosApiTerms.kt

@@ -41,24 +41,18 @@ class UsosApiTerms(
     }
 
     private fun processResponse(json: JsonArray): Boolean {
-        val dates = mutableSetOf<Date>()
+        val today = Date.getToday()
         for (term in json.asJsonObjectList()) {
             if (!term.getBoolean("is_active", false))
                 continue
-            val startDate = term.getString("start_date")?.let { Date.fromY_m_d(it) }
+            val startDate = term.getString("start_date")?.let { Date.fromY_m_d(it) } ?: continue
-            val finishDate = term.getString("finish_date")?.let { Date.fromY_m_d(it) }
+            val finishDate = term.getString("finish_date")?.let { Date.fromY_m_d(it) } ?: continue
-            if (startDate != null)
+            if (today in startDate..finishDate) {
-                dates += startDate
+                profile?.studentSchoolYearStart = startDate.year
-            if (finishDate != null)
+                profile?.dateSemester1Start = startDate
-                dates += finishDate
+                profile?.dateSemester2Start = finishDate
+            }
         }
-        val datesSorted = dates.sorted()
-        if (datesSorted.size != 3)
-            return false
-        profile?.studentSchoolYearStart = datesSorted[0].year
-        profile?.dateSemester1Start = datesSorted[0]
-        profile?.dateSemester2Start = datesSorted[1]
-        profile?.dateYearEnd = datesSorted[2]
         return true
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/api/UsosApiTimetable.kt

@@ -104,8 +104,9 @@ class UsosApiTimetable(
                 it.teacherId = lecturerIds?.firstOrNull() ?: -1L
                 it.teamId = unitId
                 val groupName = classTypeId?.plus(groupNumber)?.let { s -> "($s)" }
-                it.classroom = "$buildingId / $roomNumber ${groupName ?: ""}"
+                it.classroom = "Sala $roomNumber / bud. $buildingId ${groupName ?: ""}"
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
 
                 it.color = when (classTypeId) {
                     "WYK" -> 0xff0d6091

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/DataVulcan.kt

@@ -12,7 +12,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.crc16
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 import pl.szczodrzynski.fslogin.realm.RealmData
 
 class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app, profile, loginStore) {
@@ -57,7 +59,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSymbol: String? = null
     var symbol: String?
         get() { mSymbol = mSymbol ?: profile?.getStudentData("symbol", null); return mSymbol }
-        set(value) { profile?.putStudentData("symbol", value); mSymbol = value }
+        set(value) { profile["symbol"] = value; mSymbol = value }
 
     /**
      * Group symbol/number of the student's school.
@@ -69,7 +71,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSchoolSymbol: String? = null
     var schoolSymbol: String?
         get() { mSchoolSymbol = mSchoolSymbol ?: profile?.getStudentData("schoolSymbol", null); return mSchoolSymbol }
-        set(value) { profile?.putStudentData("schoolSymbol", value) ?: return; mSchoolSymbol = value }
+        set(value) { profile["schoolSymbol"] = value; mSchoolSymbol = value }
 
     /**
      * Short name of the school, used in some places.
@@ -79,7 +81,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSchoolShort: String? = null
     var schoolShort: String?
         get() { mSchoolShort = mSchoolShort ?: profile?.getStudentData("schoolShort", null); return mSchoolShort }
-        set(value) { profile?.putStudentData("schoolShort", value) ?: return; mSchoolShort = value }
+        set(value) { profile["schoolShort"] = value; mSchoolShort = value }
 
     /**
      * A school code consisting of the [symbol] and [schoolSymbol].
@@ -91,7 +93,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSchoolCode: String? = null
     var schoolCode: String?
         get() { mSchoolCode = mSchoolCode ?: profile?.getStudentData("schoolName", null); return mSchoolCode }
-        set(value) { profile?.putStudentData("schoolName", value) ?: return; mSchoolCode = value }
+        set(value) { profile["schoolName"] = value; mSchoolCode = value }
 
     /**
      * ID of the student.
@@ -101,7 +103,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentId: Int? = null
     var studentId: Int
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", 0); return mStudentId ?: 0 }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
 
     /**
      * ID of the student's account.
@@ -111,7 +113,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentLoginId: Int? = null
     var studentLoginId: Int
         get() { mStudentLoginId = mStudentLoginId ?: profile?.getStudentData("studentLoginId", 0); return mStudentLoginId ?: 0 }
-        set(value) { profile?.putStudentData("studentLoginId", value) ?: return; mStudentLoginId = value }
+        set(value) { profile["studentLoginId"] = value; mStudentLoginId = value }
 
     /**
      * ID of the student's class.
@@ -121,7 +123,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentClassId: Int? = null
     var studentClassId: Int
         get() { mStudentClassId = mStudentClassId ?: profile?.getStudentData("studentClassId", 0); return mStudentClassId ?: 0 }
-        set(value) { profile?.putStudentData("studentClassId", value) ?: return; mStudentClassId = value }
+        set(value) { profile["studentClassId"] = value; mStudentClassId = value }
 
     /**
      * ListaUczniow/IdOkresKlasyfikacyjny, e.g. 321
@@ -129,26 +131,26 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentSemesterId: Int? = null
     var studentSemesterId: Int
         get() { mStudentSemesterId = mStudentSemesterId ?: profile?.getStudentData("studentSemesterId", 0); return mStudentSemesterId ?: 0 }
-        set(value) { profile?.putStudentData("studentSemesterId", value) ?: return; mStudentSemesterId = value }
+        set(value) { profile["studentSemesterId"] = value; mStudentSemesterId = value }
 
     private var mStudentUnitId: Int? = null
     var studentUnitId: Int
         get() { mStudentUnitId = mStudentUnitId ?: profile?.getStudentData("studentUnitId", 0); return mStudentUnitId ?: 0 }
-        set(value) { profile?.putStudentData("studentUnitId", value) ?: return; mStudentUnitId = value }
+        set(value) { profile["studentUnitId"] = value; mStudentUnitId = value }
 
     private var mStudentConstituentId: Int? = null
     var studentConstituentId: Int
         get() { mStudentConstituentId = mStudentConstituentId ?: profile?.getStudentData("studentConstituentId", 0); return mStudentConstituentId ?: 0 }
-        set(value) { profile?.putStudentData("studentConstituentId", value) ?: return; mStudentConstituentId = value }
+        set(value) { profile["studentConstituentId"] = value; mStudentConstituentId = value }
 
     private var mSemester1Id: Int? = null
     var semester1Id: Int
         get() { mSemester1Id = mSemester1Id ?: profile?.getStudentData("semester1Id", 0); return mSemester1Id ?: 0 }
-        set(value) { profile?.putStudentData("semester1Id", value) ?: return; mSemester1Id = value }
+        set(value) { profile["semester1Id"] = value; mSemester1Id = value }
     private var mSemester2Id: Int? = null
     var semester2Id: Int
         get() { mSemester2Id = mSemester2Id ?: profile?.getStudentData("semester2Id", 0); return mSemester2Id ?: 0 }
-        set(value) { profile?.putStudentData("semester2Id", value) ?: return; mSemester2Id = value }
+        set(value) { profile["semester2Id"] = value; mSemester2Id = value }
 
     /**
      * ListaUczniow/OkresNumer, e.g. 1 or 2
@@ -156,7 +158,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentSemesterNumber: Int? = null
     var studentSemesterNumber: Int
         get() { mStudentSemesterNumber = mStudentSemesterNumber ?: profile?.getStudentData("studentSemesterNumber", 0); return mStudentSemesterNumber ?: 0 }
-        set(value) { profile?.putStudentData("studentSemesterNumber", value) ?: return; mStudentSemesterNumber = value }
+        set(value) { profile["studentSemesterNumber"] = value; mStudentSemesterNumber = value }
 
     /**
      * Date of the end of the current semester ([studentSemesterNumber]).
@@ -166,7 +168,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mCurrentSemesterEndDate: Long? = null
     var currentSemesterEndDate: Long
         get() { mCurrentSemesterEndDate = mCurrentSemesterEndDate ?: profile?.getStudentData("currentSemesterEndDate", 0L); return mCurrentSemesterEndDate ?: 0L }
-        set(value) { profile?.putStudentData("currentSemesterEndDate", value) ?: return; mCurrentSemesterEndDate = value }
+        set(value) { profile["currentSemesterEndDate"] = value; mCurrentSemesterEndDate = value }
 
     /*             _____ _____        ____
              /\   |  __ \_   _|      |___ \
@@ -219,17 +221,17 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mHebeContext: String? = null
     var hebeContext: String?
         get() { mHebeContext = mHebeContext ?: profile?.getStudentData("hebeContext", null); return mHebeContext }
-        set(value) { profile?.putStudentData("hebeContext", value) ?: return; mHebeContext = value }
+        set(value) { profile["hebeContext"] = value; mHebeContext = value }
 
     private var mMessageBoxKey: String? = null
     var messageBoxKey: String?
         get() { mMessageBoxKey = mMessageBoxKey ?: profile?.getStudentData("messageBoxKey", null); return mMessageBoxKey }
-        set(value) { profile?.putStudentData("messageBoxKey", value) ?: return; mMessageBoxKey = value }
+        set(value) { profile["messageBoxKey"] = value; mMessageBoxKey = value }
 
     private var mMessageBoxName: String? = null
     var messageBoxName: String?
         get() { mMessageBoxName = mMessageBoxName ?: profile?.getStudentData("messageBoxName", null); return mMessageBoxName }
-        set(value) { profile?.putStudentData("messageBoxName", value) ?: return; mMessageBoxName = value }
+        set(value) { profile["messageBoxName"] = value; mMessageBoxName = value }
 
     val apiUrl: String?
         get() {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/VulcanHebe.kt

@@ -26,6 +26,7 @@ import pl.szczodrzynski.edziennik.utils.Utils.d
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
 import java.net.HttpURLConnection
+import java.net.HttpURLConnection.HTTP_NOT_FOUND
 import java.net.URLEncoder
 import java.time.Instant
 import java.time.LocalDateTime
@@ -183,6 +184,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         payload: JsonElement? = null,
         baseUrl: Boolean = false,
         firebaseToken: String? = null,
+        allow404: Boolean = false,
         crossinline onSuccess: (json: T, response: Response?) -> Unit
     ) {
         val url = "${if (baseUrl) data.apiUrl else data.fullApiUrl}$endpoint"
@@ -295,6 +297,19 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             }
 
             override fun onFailure(response: Response?, throwable: Throwable?) {
+                if (allow404 && response?.code() == HTTP_NOT_FOUND) {
+                    try {
+                        onSuccess(null as T, response)
+                    } catch (e: Exception) {
+                        data.error(
+                            ApiError(tag, EXCEPTION_VULCAN_HEBE_REQUEST)
+                                .withResponse(response)
+                                .withThrowable(e)
+                        )
+                    }
+                    return
+                }
+
                 data.error(
                     ApiError(tag, ERROR_REQUEST_FAILURE)
                         .withResponse(response)
@@ -338,6 +353,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         query: Map<String, String> = mapOf(),
         baseUrl: Boolean = false,
         firebaseToken: String? = null,
+        allow404: Boolean = false,
         crossinline onSuccess: (json: T, response: Response?) -> Unit
     ) {
         val queryPath = query.map {
@@ -348,6 +364,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             if (query.isNotEmpty()) "$endpoint?$queryPath" else endpoint,
             baseUrl = baseUrl,
             firebaseToken = firebaseToken,
+            allow404 = allow404,
             onSuccess = onSuccess
         )
     }
@@ -382,6 +399,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         messageBox: String? = null,
         params: Map<String, String> = mapOf(),
         includeFilterType: Boolean = true,
+        allow404: Boolean = false,
         onSuccess: (data: List<JsonObject>, response: Response?) -> Unit
     ) {
         val url = if (includeFilterType && filterType != null)
@@ -427,8 +445,8 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             )
             .format(DateTimeFormatter.ofPattern("yyyy-MM-dd HH:mm:ss"))
 
-        apiGet(tag, url, query) { json: JsonArray, response ->
+        apiGet(tag, url, query, allow404 = allow404) { json: JsonArray?, response ->
-            onSuccess(json.map { it.asJsonObject }, response)
+            onSuccess(json?.map { it.asJsonObject } ?: listOf(), response)
         }
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/hebe/VulcanHebeAddressbook.kt

@@ -19,6 +19,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_PARENTS_
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_STUDENT
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_TEACHER
 import pl.szczodrzynski.edziennik.ext.*
+import java.net.HttpURLConnection.HTTP_NOT_FOUND
 
 class VulcanHebeAddressbook(
     override val data: DataVulcan,
@@ -41,8 +42,15 @@ class VulcanHebeAddressbook(
             VULCAN_HEBE_ENDPOINT_ADDRESSBOOK,
             HebeFilterType.BY_PERSON,
             lastSync = lastSync,
-            includeFilterType = false
+            includeFilterType = false,
-        ) { list, _ ->
+            allow404 = true,
+        ) { list, response ->
+            if (response?.code() == HTTP_NOT_FOUND) {
+                data.setSyncNext(ENDPOINT_VULCAN_HEBE_ADDRESSBOOK, 2 * DAY)
+                onSuccess(ENDPOINT_VULCAN_HEBE_ADDRESSBOOK)
+                return@apiGetList
+            }
+
             list.forEach { person ->
                 val id = person.getString("Id") ?: return@forEach
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/hebe/VulcanHebeTimetable.kt

@@ -247,7 +247,9 @@ class VulcanHebeTimetable(
             }
 
             lessonObject.id = lessonObject.buildId()
+            lessonObject.ownerId = lessonObject.buildOwnerId()
             lessonShift?.id = lessonShift?.buildId() ?: -1
+            lessonShift?.ownerId = lessonShift?.buildOwnerId() ?: -1
 
             lessonList.add(lessonObject)
             lessonShift?.let { lessonList.add(it) }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/SzkolnyApi.kt

@@ -13,7 +13,6 @@ import kotlinx.coroutines.Dispatchers
 import kotlinx.coroutines.Job
 import kotlinx.coroutines.withContext
 import okhttp3.OkHttpClient
-import org.greenrobot.eventbus.EventBus
 import pl.szczodrzynski.edziennik.*
 import pl.szczodrzynski.edziennik.data.api.ERROR_API_INVALID_SIGNATURE
 import pl.szczodrzynski.edziennik.data.api.szkolny.adapter.DateAdapter
@@ -128,16 +127,10 @@ class SzkolnyApi(val app: App) : CoroutineScope {
         response: Response<ApiResponse<T>>,
         updateDeviceHash: Boolean = false,
     ): T {
-        app.config.update = response.body()?.update?.let { update ->
+        response.body()?.update?.let { update ->
-            if (update.versionCode > BuildConfig.VERSION_CODE) {
+            // do not process "null" update, as it might not mean there's no update
-                if (update.updateMandatory
+            // do not notify; silently check and show the home update card
-                        && EventBus.getDefault().hasSubscriberForEvent(update::class.java)) {
+            app.updateManager.process(update, notify = false)
-                    EventBus.getDefault().postSticky(update)
-                }
-                update
-            }
-            else
-                null
         }
 
         response.body()?.registerAvailability?.let { registerAvailability ->
@@ -205,7 +198,6 @@ class SzkolnyApi(val app: App) : CoroutineScope {
         val teams = app.db.teamDao().allNow
 
         val users = profiles.mapNotNull { profile ->
-            val config = app.config.getFor(profile.id)
             val user = ServerSyncRequest.User(
                 profile.userCode,
                 profile.studentNameLong,
@@ -214,9 +206,9 @@ class SzkolnyApi(val app: App) : CoroutineScope {
                 teams.filter { it.profileId == profile.id }.map { it.code }
             )
             val hash = user.toString().md5()
-            if (hash == config.hash)
+            if (hash == profile.config.hash)
                 return@mapNotNull null
-            return@mapNotNull user to config
+            return@mapNotNull user to profile.config
         }
 
         val response = api.serverSync(ServerSyncRequest(
@@ -265,12 +257,10 @@ class SzkolnyApi(val app: App) : CoroutineScope {
                     seen = profile.empty
                     notified = profile.empty
 
-                    if (profile.userCode == event.sharedBy) {
+                    sharedBy = if (profile.userCode == event.sharedBy)
-                        sharedBy = "self"
+                        "self"
-                        addedManually = true
+                    else
-                    } else {
+                        eventSharedBy
-                        sharedBy = eventSharedBy
-                    }
                 }
             }
         }
@@ -334,11 +324,14 @@ class SzkolnyApi(val app: App) : CoroutineScope {
     }
 
     @Throws(Exception::class)
-    fun shareNote(note: Note) {
+    fun shareNote(note: Note, teamId: Long? = null) {
         val profile = app.db.profileDao().getByIdNow(note.profileId)
             ?: throw NullPointerException("Profile is not found")
-        val team = app.db.teamDao().getClassNow(note.profileId)
+        val team = if (teamId == null)
-            ?: throw NullPointerException("TeamClass is not found")
+            app.db.teamDao().getClassNow(note.profileId)
+        else
+            app.db.teamDao().getByIdNow(note.profileId, teamId)
+        team ?: throw NullPointerException("TeamClass is not found")
 
         val response = api.shareNote(NoteShareRequest(
             deviceId = app.deviceId,
@@ -431,8 +424,8 @@ class SzkolnyApi(val app: App) : CoroutineScope {
     }
 
     @Throws(Exception::class)
-    fun getUpdate(channel: String): List<Update> {
+    fun getUpdate(channel: Update.Type): List<Update> {
-        val response = api.updates(channel).execute()
+        val response = api.updates(channel.name.lowercase()).execute()
         return parseResponse(response)
     }
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/interceptor/SignatureInterceptor.kt

@@ -12,10 +12,11 @@ import pl.szczodrzynski.edziennik.ext.bodyToString
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
 import pl.szczodrzynski.edziennik.ext.hmacSHA1
 import pl.szczodrzynski.edziennik.ext.md5
+import pl.szczodrzynski.edziennik.ext.takeValue
 
 class SignatureInterceptor(val app: App) : Interceptor {
     companion object {
-        private const val API_KEY = "szkolny_android_42a66f0842fc7da4e37c66732acf705a"
+        const val API_KEY = "szkolny_android_42a66f0842fc7da4e37c66732acf705a"
     }
 
     override fun intercept(chain: Interceptor.Chain): Response {
@@ -27,7 +28,7 @@ class SignatureInterceptor(val app: App) : Interceptor {
 
         return chain.proceed(
                 request.newBuilder()
-                        .header("X-ApiKey", API_KEY)
+                        .header("X-ApiKey", app.config.apiKeyCustom?.takeValue() ?: API_KEY)
                         .header("X-AppVersion", BuildConfig.VERSION_CODE.toString())
                         .header("X-Timestamp", timestamp.toString())
                         .header("X-Signature", sign(timestamp, body, url))

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/interceptor/Signing.kt

@@ -46,6 +46,6 @@ object Signing {
 
     /*fun provideKey(param1: String, param2: Long): ByteArray {*/
     fun pleaseStopRightNow(param1: String, param2: Long): ByteArray {
-        return "$param1.MTIzNDU2Nzg5MDyDtdBKln===.$param2".sha256()
+        return "$param1.MTIzNDU2Nzg5MD4BikzMWC===.$param2".sha256()
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/response/UpdateResponse.kt

@@ -5,12 +5,21 @@
 package pl.szczodrzynski.edziennik.data.api.szkolny.response
 
 data class Update(
-        val versionCode: Int,
+    val versionCode: Int,
-        val versionName: String,
+    val versionName: String,
-        val releaseDate: String,
+    val releaseDate: String,
-        val releaseNotes: String?,
+    val releaseNotes: String?,
-        val releaseType: String,
+    val releaseType: String,
-        val isOnGooglePlay: Boolean,
+    val isOnGooglePlay: Boolean,
-        val downloadUrl: String?,
+    val downloadUrl: String?,
-        val updateMandatory: Boolean
+    val updateMandatory: Boolean,
-)
+) {
+
+    enum class Type {
+        NIGHTLY,
+        DEV,
+        BETA,
+        RC,
+        RELEASE,
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/data/api/task/SzkolnyTask.kt

@@ -55,7 +55,7 @@ class SzkolnyTask(val app: App, val syncingProfiles: List<Profile>) : IApiTask(-
         notificationList
                 .mapNotNull { it.profileId }
                 .distinct()
-                .map { app.config.getFor(it).sync.notificationFilter }
+                .map { app.config[it].sync.notificationFilter }
                 .forEach { filter ->
                     filter.forEach { type ->
                         notificationList.removeAll { it.type == type }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/AppDb.kt

@@ -44,7 +44,7 @@ import pl.szczodrzynski.edziennik.data.db.migration.*
     TimetableManual::class,
     Note::class,
     Metadata::class
-], version = 99)
+], version = 100)
 @TypeConverters(
         ConverterTime::class,
         ConverterDate::class,
@@ -188,6 +188,7 @@ abstract class AppDb : RoomDatabase() {
                 Migration97(),
                 Migration98(),
                 Migration99(),
+                Migration100(),
         ).allowMainThreadQueries().build()
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/converter/ConverterEnums.kt

@@ -5,13 +5,37 @@
 package pl.szczodrzynski.edziennik.data.db.converter
 
 import androidx.room.TypeConverter
+import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
+import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
+import pl.szczodrzynski.edziennik.data.db.enums.LoginMode
+import pl.szczodrzynski.edziennik.data.db.enums.LoginType
+import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.data.db.enums.NotificationType
 import pl.szczodrzynski.edziennik.ext.*
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
 
 class ConverterEnums {
 
     @TypeConverter
-    fun fromEnum(value: Enum<*>?) = value?.toInt()
+    fun fromFeatureType(value: FeatureType?) = value?.id
+
+    @TypeConverter
+    fun fromLoginMethod(value: LoginMethod?) = value?.id
+
+    @TypeConverter
+    fun fromLoginMode(value: LoginMode?) = value?.id
+
+    @TypeConverter
+    fun fromLoginType(value: LoginType?) = value?.id
+
+    @TypeConverter
+    fun fromMetadataType(value: MetadataType?) = value?.id
+
+    @TypeConverter
+    fun fromNotificationType(value: NotificationType?) = value?.id
+
+    @TypeConverter
+    fun fromNavTarget(value: NavTarget?) = value?.id
 
     @TypeConverter
     fun toFeatureType(value: Int?) = value.asFeatureTypeOrNull()

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/EventTypeDao.kt

@@ -25,6 +25,9 @@ abstract class EventTypeDao {
     @Query("DELETE FROM eventTypes WHERE profileId = :profileId")
     abstract fun clear(profileId: Int)
 
+    @Query("DELETE FROM eventTypes WHERE profileId = :profileId AND eventTypeSource = :source")
+    abstract fun clearBySource(profileId: Int, source: Int)
+
     @Query("SELECT * FROM eventTypes WHERE profileId = :profileId AND eventType = :typeId")
     abstract fun getByIdNow(profileId: Int, typeId: Long): EventType?
 
@@ -43,7 +46,7 @@ abstract class EventTypeDao {
         val typeList = data.eventTypes.map {
             EventType(
                 profileId = profile.id,
-                id = it.id.toLong(),
+                id = it.id,
                 name = it.name,
                 color = Color.parseColor(it.color),
                 order = order++,
@@ -53,4 +56,21 @@ abstract class EventTypeDao {
         addAll(typeList)
         return typeList
     }
+
+    fun getAllWithDefaults(profile: Profile): List<EventType> {
+        val eventTypes = getAllNow(profile.id)
+
+        val defaultIdsExpected = AppData.get(profile.loginStoreType).eventTypes
+            .map { it.id }
+        val defaultIdsFound = eventTypes.filter { it.source == SOURCE_DEFAULT }
+            .sortedBy { it.order }
+            .map { it.id }
+
+        if (defaultIdsExpected == defaultIdsFound)
+            return eventTypes
+
+        clearBySource(profile.id, SOURCE_DEFAULT)
+        addDefaultTypes(profile)
+        return eventTypes
+    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/ProfileDao.kt

@@ -28,6 +28,9 @@ interface ProfileDao {
     @Query("SELECT * FROM profiles WHERE profileId = :profileId")
     fun getByIdNow(profileId: Int): Profile?
 
+    @Query("SELECT * FROM profiles WHERE profileId = :profileId")
+    suspend fun getByIdSuspend(profileId: Int): Profile?
+
     @get:Query("SELECT * FROM profiles WHERE profileId >= 0 ORDER BY profileId")
     val all: LiveData<List<Profile>>
 
@@ -49,7 +52,7 @@ interface ProfileDao {
     @get:Query("SELECT profileId FROM profiles WHERE profileId >= 0 ORDER BY profileId")
     val idsNow: List<Int>
 
-    @Query("SELECT profiles.* FROM teams JOIN profiles USING(profileId) WHERE teamCode = :teamCode AND registration = " + Profile.REGISTRATION_ENABLED + " AND enableSharedEvents = 1")
+    @Query("SELECT profiles.* FROM teams JOIN profiles USING(profileId) WHERE teamCode = :teamCode AND registration = " + Profile.REGISTRATION_ENABLED)
     fun getByTeamCodeNowWithRegistration(teamCode: String?): List<Profile>
 
     @get:Query("SELECT profileId FROM profiles WHERE profileId > 0 ORDER BY profileId ASC LIMIT 1")

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/TimetableDao.kt

@@ -107,6 +107,9 @@ abstract class TimetableDao : BaseDao<Lesson, LessonFull> {
     fun getByIdNow(profileId: Int, id: Long) =
             getOneNow("$QUERY WHERE timetable.profileId = $profileId AND timetable.id = $id")
 
+    fun getByOwnerIdNow(profileId: Int, ownerId: Long) =
+            getOneNow("$QUERY WHERE timetable.profileId = $profileId AND timetable.ownerId = $ownerId")
+
     @Query("UPDATE timetable SET keep = 0 WHERE profileId = :profileId AND isExtra = :isExtra AND type != -1 AND ((type != 3 AND date >= :dateFrom) OR ((type = 3 OR type = 1) AND oldDate >= :dateFrom))")
     abstract fun dontKeepFromDate(profileId: Int, dateFrom: Date, isExtra: Boolean)
 

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Event.kt

@@ -73,13 +73,22 @@ open class Event(
         const val COLOR_INFORMATION = 0xff039be5.toInt()
     }
 
+    /**
+     * Added manually - added by self, shared by self, or shared by someone else.
+     */
     @ColumnInfo(name = "eventAddedManually")
     var addedManually: Boolean = false
-        get() = field || sharedBy == "self"
+        get() = field || isShared
+
+    /**
+     * Shared by - user code who shared the event. Null if not shared.
+     * "Self" if shared by this app user.
+     */
     @ColumnInfo(name = "eventSharedBy")
     var sharedBy: String? = null
     @ColumnInfo(name = "eventSharedByName")
     var sharedByName: String? = null
+
     @ColumnInfo(name = "eventBlacklisted")
     var blacklisted: Boolean = false
     @ColumnInfo(name = "eventIsDone")
@@ -104,6 +113,27 @@ open class Event(
     var attachmentIds: MutableList<Long>? = null
     var attachmentNames: MutableList<String>? = null
 
+    val isHomework
+        get() = type == TYPE_HOMEWORK
+
+    /**
+     * Whether the event is shared by anyone. Note that this implies [addedManually].
+     */
+    val isShared
+        get() = sharedBy != null
+
+    /**
+     * Whether the event is shared by "self" (this app user).
+     */
+    val isSharedSent
+        get() = sharedBy == "self"
+
+    /**
+     * Whether the event is shared by someone else from the class group.
+     */
+    val isSharedReceived
+        get() = sharedBy != null && sharedBy != "self"
+
     /**
      * Add an attachment
      * @param id attachment ID
@@ -134,9 +164,6 @@ open class Event(
             it.timeInMillis += 45 * MINUTE * 1000
         }
 
-    val isHomework
-        get() = type == TYPE_HOMEWORK
-
     @Ignore
     fun withMetadata(metadata: Metadata) = EventFull(this, metadata)
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/EventType.kt

@@ -5,31 +5,6 @@ package pl.szczodrzynski.edziennik.data.db.entity
 
 import androidx.room.ColumnInfo
 import androidx.room.Entity
-import pl.szczodrzynski.edziennik.R
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_CLASS_EVENT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_DEFAULT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_ELEARNING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_ESSAY
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_EXAM
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_EXCURSION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_HOMEWORK
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_INFORMATION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_PROJECT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_PT_MEETING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_READING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_SHORT_QUIZ
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_CLASS_EVENT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_DEFAULT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_ELEARNING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_ESSAY
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_EXAM
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_EXCURSION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_HOMEWORK
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_INFORMATION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_PROJECT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_PT_MEETING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_READING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_SHORT_QUIZ
 
 @Entity(
     tableName = "eventTypes",
@@ -55,35 +30,5 @@ class EventType(
         const val SOURCE_REGISTER = 1
         const val SOURCE_CUSTOM = 2
         const val SOURCE_SHARED = 3
-
-        fun getTypeColorMap() = mapOf(
-            TYPE_ELEARNING to COLOR_ELEARNING,
-            TYPE_HOMEWORK to COLOR_HOMEWORK,
-            TYPE_DEFAULT to COLOR_DEFAULT,
-            TYPE_EXAM to COLOR_EXAM,
-            TYPE_SHORT_QUIZ to COLOR_SHORT_QUIZ,
-            TYPE_ESSAY to COLOR_ESSAY,
-            TYPE_PROJECT to COLOR_PROJECT,
-            TYPE_PT_MEETING to COLOR_PT_MEETING,
-            TYPE_EXCURSION to COLOR_EXCURSION,
-            TYPE_READING to COLOR_READING,
-            TYPE_CLASS_EVENT to COLOR_CLASS_EVENT,
-            TYPE_INFORMATION to COLOR_INFORMATION
-        )
-
-        fun getTypeNameMap() = mapOf(
-            TYPE_ELEARNING to R.string.event_type_elearning,
-            TYPE_HOMEWORK to R.string.event_type_homework,
-            TYPE_DEFAULT to R.string.event_other,
-            TYPE_EXAM to R.string.event_exam,
-            TYPE_SHORT_QUIZ to R.string.event_short_quiz,
-            TYPE_ESSAY to R.string.event_essay,
-            TYPE_PROJECT to R.string.event_project,
-            TYPE_PT_MEETING to R.string.event_pt_meeting,
-            TYPE_EXCURSION to R.string.event_excursion,
-            TYPE_READING to R.string.event_reading,
-            TYPE_CLASS_EVENT to R.string.event_class_event,
-            TYPE_INFORMATION to R.string.event_information
-        )
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Lesson.kt

@@ -50,6 +50,13 @@ open class Lesson(
 
     var isExtra: Boolean = false
 
+    /**
+     * Stable ID denoting this lesson, used for note sharing (i.e. [profileId]-independent).
+     *
+     * This is simply the Unix timestamp of the lesson (in seconds).
+     */
+    var ownerId: Long = id
+
     val displayDate: Date?
         get() {
             if (type == TYPE_SHIFTED_SOURCE)
@@ -69,7 +76,12 @@ open class Lesson(
     val isChange
         get() = type == TYPE_CHANGE || type == TYPE_SHIFTED_TARGET
 
-    fun buildId(): Long = (displayDate?.combineWith(displayStartTime) ?: 0L) / 6L * 10L + (hashCode() and 0xFFFF)
+    fun buildId(): Long =
+        (displayDate?.combineWith(displayStartTime) ?: 0L) / 6L * 10L +
+                (hashCode() and 0xFFFF)
+
+    fun buildOwnerId(): Long =
+        (displayDate?.combineWith(displayStartTime) ?: 0L)
 
     @Ignore
     var showAsUnseen = false

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Noteable.kt

@@ -9,6 +9,7 @@ interface Noteable {
     fun getNoteType(): Note.OwnerType
     fun getNoteOwnerProfileId(): Int
     fun getNoteOwnerId(): Long
+    fun getNoteShareTeamId(): Long? = null
 
     var notes: MutableList<Note>
 

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Profile.kt

@@ -5,25 +5,18 @@
 package pl.szczodrzynski.edziennik.data.db.entity
 
 import android.content.Context
-import android.graphics.PorterDuff
-import android.graphics.PorterDuffColorFilter
-import android.graphics.drawable.Drawable
 import android.widget.ImageView
-import androidx.core.graphics.drawable.RoundedBitmapDrawableFactory
 import androidx.room.ColumnInfo
 import androidx.room.Entity
 import androidx.room.Ignore
 import com.google.gson.JsonObject
-import pl.droidsonroids.gif.GifDrawable
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
-import pl.szczodrzynski.edziennik.ext.*
+import pl.szczodrzynski.edziennik.ext.dateToSemester
-import pl.szczodrzynski.edziennik.utils.ProfileImageHolder
+import pl.szczodrzynski.edziennik.ext.getDrawable
+import pl.szczodrzynski.edziennik.ext.getHolder
 import pl.szczodrzynski.edziennik.utils.models.Date
-import pl.szczodrzynski.navlib.ImageHolder
-import pl.szczodrzynski.navlib.R
 import pl.szczodrzynski.navlib.drawer.IDrawerProfile
-import pl.szczodrzynski.navlib.getDrawableFromRes
 
 @Entity(tableName = "profiles", primaryKeys = ["profileId"])
 open class Profile(
@@ -60,9 +53,13 @@ open class Profile(
     }
 
     override var image: String? = null
-
     var empty = true
     var archived = false
+    var syncEnabled = true
+    @ColumnInfo(name = "enableSharedEvents")
+    var unused1 = true
+    var registration = REGISTRATION_UNSPECIFIED
+    var userCode = ""
 
     /**
      * A unique ID matching [archived] profiles with current ones
@@ -70,117 +67,35 @@ open class Profile(
      */
     var archiveId: Int? = null
 
-    var syncEnabled = true
-    var enableSharedEvents = true
-    var registration = REGISTRATION_UNSPECIFIED
-    var userCode = ""
-
     /**
      * The student's number in the class register.
      */
     var studentNumber = -1
     var studentClassName: String? = null
     var studentSchoolYearStart = Date.getToday().let { if (it.month < 9) it.year - 1 else it.year }
-
     var dateSemester1Start = Date(studentSchoolYearStart, 9, 1)
     var dateSemester2Start = Date(studentSchoolYearStart + 1, 2, 1)
     var dateYearEnd = Date(studentSchoolYearStart + 1, 6, 30)
-    fun getSemesterStart(semester: Int) = if (semester == 1) dateSemester1Start else dateSemester2Start
-    fun getSemesterEnd(semester: Int) = if (semester == 1) dateSemester2Start.clone().stepForward(0, 0, -1) else dateYearEnd
-    fun dateToSemester(date: Date) = if (date >= dateSemester2Start) 2 else 1
-    @delegate:Ignore
-    val currentSemester by lazy { dateToSemester(Date.getToday()) }
-
-    fun shouldArchive(): Boolean {
-        // vulcan hotfix
-        if (dateYearEnd.month > 6) {
-            dateYearEnd.month = 6
-            dateYearEnd.day = 30
-        }
-        // fix for when versions <4.3 synced 2020/2021 year dates to older profiles during 2020 Jun-Aug
-        if (dateSemester1Start.year > studentSchoolYearStart) {
-            val diff = dateSemester1Start.year - studentSchoolYearStart
-            dateSemester1Start.year -= diff
-            dateSemester2Start.year -= diff
-            dateYearEnd.year -= diff
-        }
-        return App.config.archiverEnabled
-                && Date.getToday() >= dateYearEnd
-                && Date.getToday().year > studentSchoolYearStart
-    }
-    fun isBeforeYear() = false && Date.getToday() < dateSemester1Start
-
     var disabledNotifications: List<Long>? = null
-
     var lastReceiversSync: Long = 0
 
-    fun hasStudentData(key: String) = studentData.has(key)
+    val currentSemester
-    fun getStudentData(key: String, defaultValue: Boolean) = studentData.getBoolean(key) ?: defaultValue
+        get() = dateToSemester(Date.getToday())
-    fun getStudentData(key: String, defaultValue: String?) = studentData.getString(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Int) = studentData.getInt(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Long) = studentData.getLong(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Float) = studentData.getFloat(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Char) = studentData.getChar(key) ?: defaultValue
-    fun putStudentData(key: String, value: Boolean) { studentData[key] = value }
-    fun putStudentData(key: String, value: String?) { studentData[key] = value }
-    fun putStudentData(key: String, value: Number) { studentData[key] = value }
-    fun putStudentData(key: String, value: Char) { studentData[key] = value }
-    fun removeStudentData(key: String) { studentData.remove(key) }
-
     val isParent
         get() = accountName != null
-
     val accountOwnerName
         get() = accountName ?: studentNameLong
-
+    val registerName
-    @Ignore
+        get() = loginStoreType.name.lowercase()
-    val registerName = loginStoreType.name.lowercase()
-
     val canShare
         get() = registration == REGISTRATION_ENABLED && !archived
 
-    override fun getImageDrawable(context: Context): Drawable {
+    @delegate:Ignore
-        if (archived) {
+    @delegate:Transient
-            return context.getDrawableFromRes(pl.szczodrzynski.edziennik.R.drawable.profile_archived).also {
+    val config by lazy { App.config[this.id] }
-                it.colorFilter = PorterDuffColorFilter(colorFromName(name), PorterDuff.Mode.DST_OVER)
-            }
-        }
 
-        if (!image.isNullOrEmpty()) {
+    override fun getImageDrawable(context: Context) = this.getDrawable(context)
-            try {
+    override fun getImageHolder(context: Context) = this.getHolder()
-                return if (image?.endsWith(".gif", true) == true) {
-                    GifDrawable(image ?: "")
-                } else {
-                    RoundedBitmapDrawableFactory.create(context.resources, image ?: "")
-                    //return Drawable.createFromPath(image ?: "") ?: throw Exception()
-                }
-            }
-            catch (e: Exception) {
-                e.printStackTrace()
-            }
-        }
-
-        return context.getDrawableFromRes(R.drawable.profile).also {
-            it.colorFilter = PorterDuffColorFilter(colorFromName(name), PorterDuff.Mode.DST_OVER)
-        }
-    }
-
-    override fun getImageHolder(context: Context): ImageHolder {
-        if (archived) {
-            return ImageHolder(pl.szczodrzynski.edziennik.R.drawable.profile_archived, colorFromName(name))
-        }
-
-        return if (!image.isNullOrEmpty()) {
-            try {
-                ProfileImageHolder(image ?: "")
-            } catch (_: Exception) {
-                ImageHolder(R.drawable.profile, colorFromName(name))
-            }
-        }
-        else {
-            ImageHolder(R.drawable.profile, colorFromName(name))
-        }
-    }
     override fun applyImageTo(imageView: ImageView) {
         getImageHolder(imageView.context).applyTo(imageView)
     }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/enums/LoginMethod.kt

@@ -6,6 +6,8 @@ package pl.szczodrzynski.edziennik.data.db.enums
 
 import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
+import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 
 enum class LoginMethod(
     val loginType: LoginType,
@@ -26,7 +28,7 @@ enum class LoginMethod(
     MOBIDZIENNIK_API2(
         loginType = LoginType.MOBIDZIENNIK,
         id = 1300,
-        isPossible = { profile, _ -> profile?.studentData?.has("email") ?: false },
+        isPossible = { profile, _ -> profile?.studentData?.getString("email").isNotNullNorBlank() },
     ),
     LIBRUS_PORTAL(
         loginType = LoginType.LIBRUS,
@@ -57,7 +59,7 @@ enum class LoginMethod(
     VULCAN_WEB_MAIN(
         loginType = LoginType.VULCAN,
         id = 4100,
-        isPossible = { _, loginStore -> loginStore.hasLoginData("webHost") },
+        isPossible = { _, loginStore -> loginStore.getLoginData("webHost", null).isNotNullNorBlank() },
     ),
     VULCAN_HEBE(
         loginType = LoginType.VULCAN,

app/src/main/java/pl/szczodrzynski/edziennik/data/db/full/EventFull.kt

@@ -9,6 +9,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Event
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.entity.Note
 import pl.szczodrzynski.edziennik.data.db.entity.Noteable
+import pl.szczodrzynski.edziennik.ext.takePositive
 import pl.szczodrzynski.edziennik.ui.search.Searchable
 import pl.szczodrzynski.edziennik.utils.html.BetterHtml
 import pl.szczodrzynski.edziennik.utils.models.Date
@@ -118,4 +119,5 @@ class EventFull(
     override fun getNoteType() = Note.OwnerType.EVENT
     override fun getNoteOwnerProfileId() = profileId
     override fun getNoteOwnerId() = id
+    override fun getNoteShareTeamId() = teamId.takePositive()
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/full/LessonFull.kt

@@ -9,6 +9,7 @@ import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.data.db.entity.Lesson
 import pl.szczodrzynski.edziennik.data.db.entity.Note
 import pl.szczodrzynski.edziennik.data.db.entity.Noteable
+import pl.szczodrzynski.edziennik.ext.takePositive
 import pl.szczodrzynski.edziennik.utils.models.Time
 
 class LessonFull(
@@ -137,9 +138,10 @@ class LessonFull(
     var seen: Boolean = false
     var notified: Boolean = false
 
-    @Relation(parentColumn = "id", entityColumn = "noteOwnerId", entity = Note::class)
+    @Relation(parentColumn = "ownerId", entityColumn = "noteOwnerId", entity = Note::class)
     override lateinit var notes: MutableList<Note>
     override fun getNoteType() = Note.OwnerType.LESSON
     override fun getNoteOwnerProfileId() = profileId
-    override fun getNoteOwnerId() = id
+    override fun getNoteOwnerId() = ownerId
+    override fun getNoteShareTeamId() = teamId.takePositive()
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/migration/Migration100.kt

@@ -0,0 +1,25 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-25.
+ */
+
+package pl.szczodrzynski.edziennik.data.db.migration
+
+import androidx.room.migration.Migration
+import androidx.sqlite.db.SupportSQLiteDatabase
+
+class Migration100 : Migration(99, 100) {
+    override fun migrate(database: SupportSQLiteDatabase) {
+        // add Note Owner ID to Lesson, to make it profileId-independent
+        // calculate the new owner ID based on the old ID
+        database.execSQL("ALTER TABLE timetable ADD COLUMN ownerId INT NOT NULL DEFAULT 0;")
+        // set new ID for actual lessons
+        database.execSQL("UPDATE timetable SET ownerId = ROUND((id & ~65535) / 500000.0) * 300000;")
+        // copy the old ID (date value) for NO_LESSONS
+        database.execSQL("UPDATE timetable SET ownerId = id WHERE type = -1;")
+        // update ID for notes as well
+        database.execSQL("UPDATE notes SET noteOwnerId = ROUND((noteOwnerId & ~65535) / 500000.0) * 300000 WHERE noteOwnerType = 'LESSON' AND noteOwnerId > 2000000000000;")
+        // force full app sync to download notes with new IDs
+        database.execSQL("DELETE FROM config WHERE `key` = 'hash';")
+        database.execSQL("DELETE FROM config WHERE `key` = 'lastAppSync';")
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyAppFirebase.kt

@@ -6,7 +6,11 @@ package pl.szczodrzynski.edziennik.data.firebase
 
 import com.google.gson.JsonParser
 import com.google.gson.reflect.TypeToken
-import kotlinx.coroutines.*
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.Job
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 import org.greenrobot.eventbus.EventBus
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.api.events.FeedbackMessageEvent
@@ -14,14 +18,18 @@ import pl.szczodrzynski.edziennik.data.api.events.RegisterAvailabilityEvent
 import pl.szczodrzynski.edziennik.data.api.szkolny.response.RegisterAvailabilityStatus
 import pl.szczodrzynski.edziennik.data.api.szkolny.response.Update
 import pl.szczodrzynski.edziennik.data.api.task.PostNotifications
-import pl.szczodrzynski.edziennik.data.db.entity.*
+import pl.szczodrzynski.edziennik.data.db.entity.Event
+import pl.szczodrzynski.edziennik.data.db.entity.FeedbackMessage
+import pl.szczodrzynski.edziennik.data.db.entity.Metadata
+import pl.szczodrzynski.edziennik.data.db.entity.Note
+import pl.szczodrzynski.edziennik.data.db.entity.Notification
+import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.data.db.enums.NotificationType
 import pl.szczodrzynski.edziennik.ext.getInt
 import pl.szczodrzynski.edziennik.ext.getLong
 import pl.szczodrzynski.edziennik.ext.getString
 import pl.szczodrzynski.edziennik.ext.resolveString
-import pl.szczodrzynski.edziennik.sync.UpdateWorker
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
@@ -64,7 +72,10 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
                         message.data.getString("title") ?: "",
                         message.data.getString("message") ?: ""
                 )
-                "appUpdate" -> launch { UpdateWorker.runNow(app, app.gson.fromJson(message.data.getString("update"), Update::class.java)) }
+                "appUpdate" -> {
+                    val update = app.gson.fromJson(message.data.getString("update"), Update::class.java)
+                    app.updateManager.process(update, notify = true)
+                }
                 "feedbackMessage" -> launch {
                     val message = app.gson.fromJson(message.data.getString("message"), FeedbackMessage::class.java) ?: return@launch
                     feedbackMessage(message)
@@ -149,11 +160,11 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
             if (event.color == -1)
                 event.color = null
 
+            event.addedManually = true
             event.sharedBy = json.getString("sharedBy")
             event.sharedByName = json.getString("sharedByName")
             if (profile.userCode == event.sharedBy) {
                 event.sharedBy = "self"
-                event.addedManually = true
             }
 
             val metadata = Metadata(
@@ -165,7 +176,7 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
             )
 
             val type = if (event.isHomework) NotificationType.SHARED_HOMEWORK else NotificationType.SHARED_EVENT
-            val notificationFilter = app.config.getFor(event.profileId).sync.notificationFilter
+            val notificationFilter = app.config[event.profileId].sync.notificationFilter
 
             if (!notificationFilter.contains(type) && event.sharedBy != "self" && event.date >= Date.getToday()) {
                 val notification = Notification(
@@ -200,7 +211,7 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
             val profile = profiles.firstOrNull { it.id == team.profileId } ?: return@forEach
             if (!profile.canShare)
                 return@forEach
-            val notificationFilter = app.config.getFor(team.profileId).sync.notificationFilter
+            val notificationFilter = app.config[team.profileId].sync.notificationFilter
 
             if (!notificationFilter.contains(NotificationType.REMOVED_SHARED_EVENT)) {
                 val notification = Notification(
@@ -254,7 +265,7 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
                 return@forEach
 
             val type = NotificationType.SHARED_NOTE
-            val notificationFilter = app.config.getFor(note.profileId).sync.notificationFilter
+            val notificationFilter = app.config[note.profileId].sync.notificationFilter
 
             if (!notificationFilter.contains(type) && note.sharedBy != "self") {
                 val notification = Notification(

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyLibrusFirebase.kt

@@ -6,12 +6,37 @@ package pl.szczodrzynski.edziennik.data.firebase
 
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.api.edziennik.EdziennikTask
-import pl.szczodrzynski.edziennik.data.api.edziennik.librus.*
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_ANNOUNCEMENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_ATTENDANCES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_BEHAVIOUR_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_BEHAVIOUR_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_BEHAVIOUR_GRADE_COMMENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_CLASS_FREE_DAYS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_DESCRIPTIVE_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_DESCRIPTIVE_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_DESCRIPTIVE_TEXT_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_EVENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_HOMEWORK
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_LUCKY_NUMBER
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NORMAL_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NORMAL_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NORMAL_GRADE_COMMENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NOTICES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_POINT_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_POINT_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_PT_MEETINGS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_SCHOOL_FREE_DAYS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_TEACHER_FREE_DAYS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_TEXT_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_TIMETABLES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_MESSAGES_RECEIVED
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_SYNERGIA_HOMEWORK
 import pl.szczodrzynski.edziennik.data.api.task.IApiTask
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.getStudentData
 
 class SzkolnyLibrusFirebase(val app: App, val profiles: List<Profile>, val message: FirebaseService.Message) {
     /*{

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyMobidziennikFirebase.kt

@@ -12,6 +12,7 @@ import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.ext.getLong
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.getStudentData
 
 class SzkolnyMobidziennikFirebase(val app: App, val profiles: List<Profile>, val message: FirebaseService.Message) {
     /*{

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyVulcanFirebase.kt

@@ -4,15 +4,15 @@
 
 package pl.szczodrzynski.edziennik.data.firebase
 
-import pl.szczodrzynski.edziennik.*
+import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.api.edziennik.EdziennikTask
 import pl.szczodrzynski.edziennik.data.api.task.IApiTask
-import pl.szczodrzynski.edziennik.data.db.entity.Message
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.ext.getInt
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.toJsonObject
 
 class SzkolnyVulcanFirebase(val app: App, val profiles: List<Profile>, val message: FirebaseService.Message) {

app/src/main/java/pl/szczodrzynski/edziennik/ext/DataExtensions.kt

@@ -6,14 +6,9 @@ package pl.szczodrzynski.edziennik.ext
 
 import android.util.LongSparseArray
 import androidx.core.util.forEach
-import com.google.android.material.datepicker.CalendarConstraints
-import com.google.gson.JsonElement
-import pl.szczodrzynski.edziennik.App
-import pl.szczodrzynski.edziennik.config.AppData
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher
 import pl.szczodrzynski.edziennik.data.db.entity.Team
-import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 
 fun List<Teacher>.byId(id: Long) = firstOrNull { it.id == id }
 fun List<Teacher>.byNameFirstLast(nameFirstLast: String) = firstOrNull { it.name + " " + it.surname == nameFirstLast }
@@ -34,22 +29,3 @@ fun LongSparseArray<Team>.getById(id: Long): Team? {
     }
     return null
 }
-
-operator fun Profile.set(key: String, value: JsonElement) = this.studentData.add(key, value)
-operator fun Profile.set(key: String, value: Boolean) = this.studentData.addProperty(key, value)
-operator fun Profile.set(key: String, value: String?) = this.studentData.addProperty(key, value)
-operator fun Profile.set(key: String, value: Number) = this.studentData.addProperty(key, value)
-operator fun Profile.set(key: String, value: Char) = this.studentData.addProperty(key, value)
-
-fun Profile.getSchoolYearConstrains(): CalendarConstraints {
-    return CalendarConstraints.Builder()
-        .setStart(dateSemester1Start.inMillisUtc)
-        .setEnd(dateYearEnd.inMillisUtc)
-        .build()
-}
-
-fun Profile.hasFeature(featureType: FeatureType) = featureType in this.loginStoreType.features
-fun Profile.hasUIFeature(featureType: FeatureType) = featureType.isUIAlwaysAvailable || hasFeature(featureType)
-
-fun Profile.getAppData() =
-    if (App.profileId == this.id) App.data else AppData.get(this.loginStoreType)

app/src/main/java/pl/szczodrzynski/edziennik/ext/EnumExtensions.kt

@@ -50,13 +50,13 @@ inline fun <reified E : Enum<E>> Int.toEnum() = when (E::class.java) {
 } as E
 
 fun <E : Enum<E>> Int.toEnum(type: Class<*>) = when (type) {
-    // enums commented out are not really used in Bundles
+    // this is used for Config so all enums are here
     FeatureType::class.java -> this.asFeatureType()
-    // LoginMethod::class.java -> this.asLoginMethod()
+    LoginMethod::class.java -> this.asLoginMethod()
     LoginMode::class.java -> this.asLoginMode()
     LoginType::class.java -> this.asLoginType()
-    // MetadataType::class.java -> this.asMetadataType()
+    MetadataType::class.java -> this.asMetadataType()
-    // NotificationType::class.java -> this.asNotificationType()
+    NotificationType::class.java -> this.asNotificationType()
     NavTarget::class.java -> this.asNavTarget()
     else -> throw IllegalArgumentException("Unknown type $type")
 } as E

app/src/main/java/pl/szczodrzynski/edziennik/ext/JsonExtensions.kt

@@ -5,6 +5,7 @@
 package pl.szczodrzynski.edziennik.ext
 
 import android.os.Bundle
+import com.google.gson.Gson
 import com.google.gson.JsonArray
 import com.google.gson.JsonElement
 import com.google.gson.JsonObject
@@ -48,6 +49,11 @@ fun JsonObject.putEnum(key: String, value: Enum<*>) = addProperty(key, value.toI
 fun String.toJsonObject(): JsonObject? = try { JsonParser.parseString(this).asJsonObject } catch (ignore: Exception) { null }
 fun String.toJsonArray(): JsonArray? = try { JsonParser.parseString(this).asJsonArray } catch (ignore: Exception) { null }
 
+fun Any?.toJsonElement(): JsonElement = when (this) {
+    is Collection<*> -> JsonArray(this)
+    else -> Gson().toJsonTree(this)
+}
+
 operator fun JsonObject.set(key: String, value: JsonElement) = this.add(key, value)
 operator fun JsonObject.set(key: String, value: Boolean) = this.addProperty(key, value)
 operator fun JsonObject.set(key: String, value: String?) = this.addProperty(key, value)
@@ -67,6 +73,8 @@ fun JsonObject(vararg properties: Pair<String, Any?>): JsonObject {
                 is Number -> addProperty(key, value)
                 is Boolean -> addProperty(key, value)
                 is Enum<*> -> addProperty(key, value.toInt())
+                null -> add(key, null)
+                else -> add(key, value.toJsonElement())
             }
         }
     }
@@ -98,6 +106,8 @@ fun JsonArray(properties: Collection<Any?>): JsonArray {
                 is Char -> add(property as Char?)
                 is Number -> add(property as Number?)
                 is Boolean -> add(property as Boolean?)
+                is Enum<*> -> add(property.toInt())
+                else -> add(property.toJsonElement())
             }
         }
     }

app/src/main/java/pl/szczodrzynski/edziennik/ext/MiscExtensions.kt

@@ -76,4 +76,9 @@ fun pendingIntentFlag(): Int {
 fun Int?.takeValue() = if (this == -1) null else this
 fun Int?.takePositive() = if (this == -1 || this == 0) null else this
 
+fun Long?.takeValue() = if (this == -1L) null else this
+fun Long?.takePositive() = if (this == -1L || this == 0L) null else this
+
+fun String?.takeValue() = if (this.isNullOrBlank()) null else this
+
 fun Any?.ignore() = Unit

app/src/main/java/pl/szczodrzynski/edziennik/ext/ProfileExtensions.kt

@@ -0,0 +1,127 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-25.
+ */
+
+package pl.szczodrzynski.edziennik.ext
+
+import android.content.Context
+import android.graphics.PorterDuff
+import android.graphics.PorterDuffColorFilter
+import android.graphics.drawable.Drawable
+import androidx.core.graphics.drawable.RoundedBitmapDrawableFactory
+import com.google.android.material.datepicker.CalendarConstraints
+import com.google.gson.JsonElement
+import pl.droidsonroids.gif.GifDrawable
+import pl.szczodrzynski.edziennik.App
+import pl.szczodrzynski.edziennik.R
+import pl.szczodrzynski.edziennik.config.AppData
+import pl.szczodrzynski.edziennik.data.db.entity.Profile
+import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
+import pl.szczodrzynski.edziennik.utils.ProfileImageHolder
+import pl.szczodrzynski.edziennik.utils.models.Date
+import pl.szczodrzynski.navlib.ImageHolder
+import pl.szczodrzynski.navlib.getDrawableFromRes
+
+// TODO refactor Data* fields and make the receiver non-nullable
+operator fun Profile?.set(key: String, value: JsonElement) = this?.studentData?.add(key, value)
+operator fun Profile?.set(key: String, value: Boolean) = this?.studentData?.addProperty(key, value)
+operator fun Profile?.set(key: String, value: String?) = this?.studentData?.addProperty(key, value)
+operator fun Profile?.set(key: String, value: Number) = this?.studentData?.addProperty(key, value)
+operator fun Profile?.set(key: String, value: Char) = this?.studentData?.addProperty(key, value)
+
+fun Profile.getStudentData(key: String, defaultValue: Boolean) =
+    studentData.getBoolean(key) ?: defaultValue
+
+fun Profile.getStudentData(key: String, defaultValue: String?) =
+    studentData.getString(key) ?: defaultValue
+
+fun Profile.getStudentData(key: String, defaultValue: Int) =
+    studentData.getInt(key) ?: defaultValue
+
+fun Profile.getStudentData(key: String, defaultValue: Long) =
+    studentData.getLong(key) ?: defaultValue
+
+fun Profile.getStudentData(key: String, defaultValue: Float) =
+    studentData.getFloat(key) ?: defaultValue
+
+fun Profile.getStudentData(key: String, defaultValue: Char) =
+    studentData.getChar(key) ?: defaultValue
+
+fun Profile.getSemesterStart(semester: Int) =
+    if (semester == 1) dateSemester1Start else dateSemester2Start
+
+fun Profile.getSemesterEnd(semester: Int) =
+    if (semester == 1) dateSemester2Start.clone().stepForward(0, 0, -1) else dateYearEnd
+
+fun Profile.dateToSemester(date: Date) = if (date >= dateSemester2Start) 2 else 1
+fun Profile.isBeforeYear() = false && Date.getToday() < dateSemester1Start
+
+fun Profile.getSchoolYearConstrains(): CalendarConstraints {
+    return CalendarConstraints.Builder()
+        .setStart(dateSemester1Start.inMillisUtc)
+        .setEnd(dateYearEnd.inMillisUtc)
+        .build()
+}
+
+fun Profile.hasFeature(featureType: FeatureType) = featureType in this.loginStoreType.features
+fun Profile.hasUIFeature(featureType: FeatureType) =
+    featureType.isUIAlwaysAvailable || hasFeature(featureType)
+
+fun Profile.getAppData() =
+    if (App.profileId == this.id) App.data else AppData.get(this.loginStoreType)
+
+fun Profile.shouldArchive(): Boolean {
+    // vulcan hotfix
+    if (dateYearEnd.month > 6) {
+        dateYearEnd.month = 6
+        dateYearEnd.day = 30
+    }
+    // fix for when versions <4.3 synced 2020/2021 year dates to older profiles during 2020 Jun-Aug
+    if (dateSemester1Start.year > studentSchoolYearStart) {
+        val diff = dateSemester1Start.year - studentSchoolYearStart
+        dateSemester1Start.year -= diff
+        dateSemester2Start.year -= diff
+        dateYearEnd.year -= diff
+    }
+    return App.config.archiverEnabled && Date.getToday() >= dateYearEnd && Date.getToday().year > studentSchoolYearStart
+}
+
+fun Profile.getDrawable(context: Context): Drawable {
+    if (archived) {
+        return context.getDrawableFromRes(R.drawable.profile_archived).also {
+            it.colorFilter = PorterDuffColorFilter(colorFromName(name), PorterDuff.Mode.DST_OVER)
+        }
+    }
+
+    if (!image.isNullOrEmpty()) {
+        try {
+            return if (image?.endsWith(".gif", true) == true) {
+                GifDrawable(image ?: "")
+            } else {
+                RoundedBitmapDrawableFactory.create(context.resources, image ?: "")
+            }
+        } catch (e: Exception) {
+            e.printStackTrace()
+        }
+    }
+
+    return context.getDrawableFromRes(R.drawable.profile).also {
+        it.colorFilter = PorterDuffColorFilter(colorFromName(name), PorterDuff.Mode.DST_OVER)
+    }
+}
+
+fun Profile.getHolder(): ImageHolder {
+    if (archived) {
+        return ImageHolder(R.drawable.profile_archived, colorFromName(name))
+    }
+
+    return if (!image.isNullOrEmpty()) {
+        try {
+            ProfileImageHolder(image ?: "")
+        } catch (_: Exception) {
+            ImageHolder(R.drawable.profile, colorFromName(name))
+        }
+    } else {
+        ImageHolder(R.drawable.profile, colorFromName(name))
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/ext/ViewExtensions.kt

@@ -8,6 +8,7 @@ import android.content.Context
 import android.content.res.Resources
 import android.graphics.Rect
 import android.view.View
+import android.view.ViewGroup
 import android.view.WindowManager
 import android.widget.*
 import androidx.annotation.StringRes
@@ -161,3 +162,12 @@ val SwipeRefreshLayout.onScrollListener: RecyclerView.OnScrollListener
         }
     }
 
+fun View.removeFromParent() {
+    (parent as? ViewGroup)?.removeView(this)
+}
+
+fun View.appendView(child: View) {
+    val parent = parent as? ViewGroup ?: return
+    val index = parent.indexOfChild(this)
+    parent.addView(child, index + 1)
+}

app/src/main/java/pl/szczodrzynski/edziennik/sync/UpdateStateEvent.kt

@@ -0,0 +1,9 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-22.
+ */
+
+package pl.szczodrzynski.edziennik.sync
+
+import pl.szczodrzynski.edziennik.data.api.szkolny.response.Update
+
+class UpdateStateEvent(val running: Boolean, val update: Update?, val downloadId: Long)

app/src/main/java/pl/szczodrzynski/edziennik/sync/UpdateWorker.kt

@@ -5,25 +5,14 @@
 package pl.szczodrzynski.edziennik.sync
 
 import android.annotation.SuppressLint
-import android.app.NotificationManager
-import android.app.PendingIntent
 import android.content.Context
-import android.content.Intent
-import android.widget.Toast
-import androidx.core.app.NotificationCompat
 import androidx.work.*
 import kotlinx.coroutines.*
-import org.greenrobot.eventbus.EventBus
 import pl.szczodrzynski.edziennik.*
-import pl.szczodrzynski.edziennik.R
-import pl.szczodrzynski.edziennik.data.api.szkolny.SzkolnyApi
 import pl.szczodrzynski.edziennik.data.api.szkolny.response.Update
 import pl.szczodrzynski.edziennik.ext.DAY
-import pl.szczodrzynski.edziennik.ext.concat
 import pl.szczodrzynski.edziennik.ext.formatDate
-import pl.szczodrzynski.edziennik.ext.pendingIntentFlag
 import pl.szczodrzynski.edziennik.utils.Utils
-import pl.szczodrzynski.edziennik.utils.html.BetterHtml
 import java.util.concurrent.TimeUnit
 import kotlin.coroutines.CoroutineContext
 
@@ -76,63 +65,6 @@ class UpdateWorker(val context: Context, val params: WorkerParameters) : Worker(
             Utils.d(TAG, "Cancelling work by tag $TAG")
             WorkManager.getInstance(app).cancelAllWorkByTag(TAG)
         }
-
-        suspend fun runNow(app: App, overrideUpdate: Update? = null) {
-            try {
-                val update = overrideUpdate
-                        ?: run {
-                            withContext(Dispatchers.Default) {
-                                SzkolnyApi(app).runCatching({
-                                    getUpdate("beta")
-                                }, {
-                                    Toast.makeText(app, app.getString(R.string.notification_cant_check_update), Toast.LENGTH_SHORT).show()
-                                })
-                            } ?: return@run null
-
-                            if (app.config.update == null
-                                    || app.config.update?.versionCode ?: BuildConfig.VERSION_CODE <= BuildConfig.VERSION_CODE) {
-                                app.config.update = null
-                                Toast.makeText(app, app.getString(R.string.notification_no_update), Toast.LENGTH_SHORT).show()
-                                return@run null
-                            }
-                            app.config.update
-                        } ?: return
-
-                if (update.versionCode <= BuildConfig.VERSION_CODE) {
-                    app.config.update = null
-                    return
-                }
-
-                if (EventBus.getDefault().hasSubscriberForEvent(update::class.java)) {
-                    if (!update.updateMandatory) // mandatory updates are posted by the SzkolnyApi
-                        EventBus.getDefault().postSticky(update)
-                    return
-                }
-
-                val notificationIntent = Intent(app, UpdateDownloaderService::class.java)
-                val pendingIntent = PendingIntent.getService(app, 0, notificationIntent, PendingIntent.FLAG_UPDATE_CURRENT or pendingIntentFlag())
-                val notification = NotificationCompat.Builder(app, app.notificationChannelsManager.updates.key)
-                        .setContentTitle(app.getString(R.string.notification_updates_title))
-                        .setContentText(app.getString(R.string.notification_updates_text, update.versionName))
-                        .setTicker(app.getString(R.string.notification_updates_summary))
-                        .setSmallIcon(R.drawable.ic_notification)
-                        .setStyle(NotificationCompat.BigTextStyle()
-                                .bigText(listOf(
-                                        app.getString(R.string.notification_updates_text, update.versionName),
-                                        update.releaseNotes?.let { BetterHtml.fromHtml(context = null, it) }
-                                ).concat("\n")))
-                        .setColor(0xff2196f3.toInt())
-                        .setLights(0xFF00FFFF.toInt(), 2000, 2000)
-                        .setPriority(NotificationCompat.PRIORITY_HIGH)
-                        .setDefaults(NotificationCompat.DEFAULT_ALL)
-                        .setGroup(app.notificationChannelsManager.updates.key)
-                        .setContentIntent(pendingIntent)
-                        .setAutoCancel(false)
-                        .build()
-                (app.getSystemService(Context.NOTIFICATION_SERVICE) as NotificationManager).notify(app.notificationChannelsManager.updates.id, notification)
-
-            } catch (ignore: Exception) { }
-        }
     }
 
     private val job = Job()
@@ -146,22 +78,13 @@ class UpdateWorker(val context: Context, val params: WorkerParameters) : Worker(
             return Result.success()
         }
 
-        launch {
+        val channel = if (App.devMode)
-            runNow(app)
+            Update.Type.BETA
-        }
+        else
+            Update.Type.RELEASE
+        app.updateManager.checkNowSync(channel, notify = true)
 
         rescheduleNext(this.context)
         return Result.success()
     }
-
-    class JavaWrapper(app: App) : CoroutineScope {
-        private val job = Job()
-        override val coroutineContext: CoroutineContext
-            get() = job + Dispatchers.Main
-        init {
-            launch {
-                runNow(app)
-            }
-        }
-    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/ui/agenda/AgendaFragment.kt

@@ -17,7 +17,12 @@ import com.mikepenz.iconics.typeface.library.community.material.CommunityMateria
 import com.mikepenz.iconics.utils.colorInt
 import com.mikepenz.iconics.utils.sizeDp
 import eu.szkolny.font.SzkolnyFont
-import kotlinx.coroutines.*
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.Job
+import kotlinx.coroutines.delay
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.MainActivity
 import pl.szczodrzynski.edziennik.R
@@ -53,7 +58,7 @@ class AgendaFragment : Fragment(), CoroutineScope {
         if (getActivity() == null || context == null) return null
         activity = getActivity() as MainActivity
         context?.theme?.applyStyle(Themes.appTheme, true)
-        type = app.config.forProfile().ui.agendaViewType
+        type = app.profile.config.ui.agendaViewType
         b = when (type) {
             Profile.AGENDA_DEFAULT -> FragmentAgendaDefaultBinding.inflate(inflater, container, false)
             Profile.AGENDA_CALENDAR -> FragmentAgendaCalendarBinding.inflate(inflater, container, false)
@@ -92,7 +97,7 @@ class AgendaFragment : Fragment(), CoroutineScope {
                             activity.bottomSheet.close()
                             type =
                                 if (type == Profile.AGENDA_DEFAULT) Profile.AGENDA_CALENDAR else Profile.AGENDA_DEFAULT
-                            app.config.forProfile().ui.agendaViewType = type
+                            app.profile.config.ui.agendaViewType = type
                             activity.reloadTarget()
                         },
                 BottomSheetSeparatorItem(true),
@@ -137,13 +142,7 @@ class AgendaFragment : Fragment(), CoroutineScope {
 
     private suspend fun checkEventTypes() {
         withContext(Dispatchers.Default) {
-            val eventTypes = app.db.eventTypeDao().getAllNow(app.profileId).map {
+            app.db.eventTypeDao().getAllWithDefaults(app.profile)
-                it.id
-            }
-            val defaultEventTypes = EventType.getTypeColorMap().keys
-            if (!eventTypes.containsAll(defaultEventTypes)) {
-                app.db.eventTypeDao().addDefaultTypes(app.profile)
-            }
         }
     }
 

app/src/main/java/pl/szczodrzynski/edziennik/ui/agenda/AgendaFragmentDefault.kt

@@ -16,7 +16,12 @@ import com.github.tibolte.agendacalendarview.agenda.AgendaAdapter
 import com.github.tibolte.agendacalendarview.models.BaseCalendarEvent
 import com.github.tibolte.agendacalendarview.models.CalendarEvent
 import com.github.tibolte.agendacalendarview.models.IDayItem
-import kotlinx.coroutines.*
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.Job
+import kotlinx.coroutines.delay
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.MainActivity
 import pl.szczodrzynski.edziennik.data.db.full.EventFull
@@ -49,7 +54,6 @@ class AgendaFragmentDefault(
     private val unreadDates = mutableSetOf<Int>()
     private val events = mutableListOf<CalendarEvent>()
     private var isInitialized = false
-    private val profileConfig by lazy { app.config.forProfile().ui }
 
     private val listView
         get() = b.agendaDefaultView.agendaView.agendaListView
@@ -107,10 +111,10 @@ class AgendaFragmentDefault(
         isInitialized = false
 
         withContext(Dispatchers.Default) {
-            if (profileConfig.agendaLessonChanges)
+            if (app.profile.config.ui.agendaLessonChanges)
                 addLessonChanges(events)
 
-            if (profileConfig.agendaTeacherAbsence)
+            if (app.profile.config.ui.agendaTeacherAbsence)
                 addTeacherAbsence(events)
         }
 
@@ -127,7 +131,7 @@ class AgendaFragmentDefault(
         val dateStart = app.profile.dateSemester1Start.asCalendar
         val dateEnd = app.profile.dateYearEnd.asCalendar
 
-        val isCompactMode = profileConfig.agendaCompactMode
+        val isCompactMode = app.profile.config.ui.agendaCompactMode
 
         b.agendaDefaultView.init(
             events,
@@ -247,7 +251,7 @@ class AgendaFragmentDefault(
     ) {
         events.removeAll { it is AgendaEvent || it is AgendaEventGroup }
 
-        if (!profileConfig.agendaGroupByType) {
+        if (!app.profile.config.ui.agendaGroupByType) {
             events += eventList.map {
                 if (!it.seen)
                     unreadDates.add(it.date.value)

app/src/main/java/pl/szczodrzynski/edziennik/ui/agenda/event/AgendaEventRenderer.kt

@@ -11,6 +11,7 @@ import android.widget.TextView
 import androidx.core.view.isVisible
 import com.github.tibolte.agendacalendarview.render.EventRenderer
 import com.mikepenz.iconics.view.IconicsTextView
+import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.databinding.AgendaWrappedEventBinding
 import pl.szczodrzynski.edziennik.databinding.AgendaWrappedEventCompactBinding
@@ -53,16 +54,24 @@ class AgendaEventRenderer(
         else
             event.time!!.stringHM
 
+        val agendaSubjectImportant = App.profile.config.ui.agendaSubjectImportant
         val eventSubtitle = listOfNotNull(
             timeText,
-            event.subjectLongName,
+            event.subjectLongName.takeIf { !agendaSubjectImportant },
+            event.typeName.takeIf { agendaSubjectImportant },
             event.teacherName,
             event.teamName
         ).join(", ")
 
         card.foreground.setTintColor(event.eventColor)
         card.background.setTintColor(event.eventColor)
-        manager.setEventTopic(title, event, doneIconColor = textColor)
+        manager.setEventTopic(
+            title = title,
+            event = event,
+            doneIconColor = textColor,
+            showType = !agendaSubjectImportant,
+            showSubject = agendaSubjectImportant,
+        )
         title.setTextColor(textColor)
         subtitle?.text = eventSubtitle
         subtitle?.setTextColor(textColor)

app/src/main/java/pl/szczodrzynski/edziennik/ui/attendance/AttendanceFragment.kt

@@ -18,7 +18,6 @@ import kotlinx.coroutines.Job
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.MainActivity
 import pl.szczodrzynski.edziennik.R
-import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.databinding.AttendanceFragmentBinding
 import pl.szczodrzynski.edziennik.ext.Bundle
@@ -83,7 +82,7 @@ class AttendanceFragment : Fragment(), CoroutineScope {
         activity.gainAttention()
 
         if (pageSelection == 1)
-            pageSelection = app.config.forProfile().attendance.attendancePageSelection
+            pageSelection = app.profile.config.attendance.attendancePageSelection
 
         val pagerAdapter = FragmentLazyPagerAdapter(
             parentFragmentManager,
@@ -114,7 +113,7 @@ class AttendanceFragment : Fragment(), CoroutineScope {
             currentItem = pageSelection
             addOnPageSelectedListener {
                 pageSelection = it
-                app.config.forProfile().attendance.attendancePageSelection = it
+                app.profile.config.attendance.attendancePageSelection = it
             }
             b.tabLayout.setupWithViewPager(this)
         }

app/src/main/java/pl/szczodrzynski/edziennik/ui/attendance/AttendanceListFragment.kt

@@ -129,8 +129,8 @@ class AttendanceListFragment : LazyFragment(), CoroutineScope {
         if (attendance.isEmpty())
             return mutableListOf()
 
-        val groupConsecutiveDays = app.config.forProfile().attendance.groupConsecutiveDays
+        val groupConsecutiveDays = app.profile.config.attendance.groupConsecutiveDays
-        val showPresenceInMonth = app.config.forProfile().attendance.showPresenceInMonth
+        val showPresenceInMonth = app.profile.config.attendance.showPresenceInMonth
 
         if (viewType == AttendanceFragment.VIEW_DAYS) {
             val items = attendance

app/src/main/java/pl/szczodrzynski/edziennik/ui/debug/LabPageFragment.kt

@@ -11,6 +11,7 @@ import android.view.View
 import android.view.ViewGroup
 import androidx.appcompat.app.AppCompatActivity
 import androidx.core.view.isVisible
+import androidx.core.widget.doAfterTextChanged
 import androidx.sqlite.db.SimpleSQLiteQuery
 import com.chuckerteam.chucker.api.Chucker
 import com.chuckerteam.chucker.api.Chucker.SCREEN_HTTP
@@ -21,6 +22,8 @@ import kotlinx.coroutines.Job
 import kotlinx.coroutines.launch
 import pl.szczodrzynski.edziennik.*
 import pl.szczodrzynski.edziennik.config.Config
+import pl.szczodrzynski.edziennik.data.api.szkolny.interceptor.SignatureInterceptor
+import pl.szczodrzynski.edziennik.data.db.entity.EventType.Companion.SOURCE_DEFAULT
 import pl.szczodrzynski.edziennik.databinding.LabFragmentBinding
 import pl.szczodrzynski.edziennik.ext.*
 import pl.szczodrzynski.edziennik.ui.base.lazypager.LazyFragment
@@ -60,8 +63,10 @@ class LabPageFragment : LazyFragment(), CoroutineScope {
             b.last10unseen.isVisible = false
             b.fullSync.isVisible = false
             b.clearProfile.isVisible = false
+            b.clearEndpointTimers.isVisible = false
             b.rodo.isVisible = false
             b.removeHomework.isVisible = false
+            b.resetEventTypes.isVisible = false
             b.unarchive.isVisible = false
             b.profile.isVisible = false
         }
@@ -80,19 +85,28 @@ class LabPageFragment : LazyFragment(), CoroutineScope {
             app.db.teacherDao().query(SimpleSQLiteQuery("UPDATE teachers SET teacherSurname = \"\" WHERE profileId = ${App.profileId}"))
         }
         
-        b.fullSync.onClick { 
+        b.fullSync.onClick {
-            app.db.query(SimpleSQLiteQuery("UPDATE profiles SET empty = 1 WHERE profileId = ${App.profileId}"))
+            app.profile.empty = true
-            app.db.query(SimpleSQLiteQuery("DELETE FROM endpointTimers WHERE profileId = ${App.profileId}"))
+            app.profileSave()
         }
 
         b.clearProfile.onClick {
             ProfileRemoveDialog(activity, App.profileId, "FAKE", noProfileRemoval = true).show()
         }
 
+        b.clearEndpointTimers.onClick {
+            app.db.endpointTimerDao().clear(app.profileId)
+        }
+
         b.removeHomework.onClick {
             app.db.eventDao().getRawNow("UPDATE events SET homeworkBody = NULL WHERE profileId = ${App.profileId}")
         }
 
+        b.resetEventTypes.onClick {
+            app.db.eventTypeDao().clearBySource(App.profileId, SOURCE_DEFAULT)
+            app.db.eventTypeDao().getAllWithDefaults(App.profile)
+        }
+
         b.chucker.isChecked = App.enableChucker
         b.chucker.onChange { _, isChecked ->
             app.config.enableChucker = isChecked
@@ -141,6 +155,16 @@ class LabPageFragment : LazyFragment(), CoroutineScope {
             app.config.apiInvalidCert = null
         }
 
+        b.apiKey.setText(app.config.apiKeyCustom ?: SignatureInterceptor.API_KEY)
+        b.apiKey.doAfterTextChanged {
+            it?.toString()?.let { key ->
+                if (key == SignatureInterceptor.API_KEY)
+                    app.config.apiKeyCustom = null
+                else
+                    app.config.apiKeyCustom = key.takeValue()?.trim()
+            }
+        }
+
         b.rebuildConfig.onClick {
             App.config = Config(App.db)
         }

app/src/main/java/pl/szczodrzynski/edziennik/ui/debug/LabProfileFragment.kt

@@ -12,11 +12,16 @@ import androidx.appcompat.app.AppCompatActivity
 import androidx.core.view.isVisible
 import androidx.recyclerview.widget.LinearLayoutManager
 import com.google.android.material.dialog.MaterialAlertDialogBuilder
-import com.google.gson.*
+import com.google.gson.JsonArray
+import com.google.gson.JsonObject
+import com.google.gson.JsonParser
+import com.google.gson.JsonPrimitive
 import kotlinx.coroutines.CoroutineScope
 import kotlinx.coroutines.Dispatchers
 import kotlinx.coroutines.Job
-import pl.szczodrzynski.edziennik.*
+import pl.szczodrzynski.edziennik.App
+import pl.szczodrzynski.edziennik.MainActivity
+import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.data.api.models.ApiError
 import pl.szczodrzynski.edziennik.databinding.TemplateListPageFragmentBinding
 import pl.szczodrzynski.edziennik.ext.*
@@ -66,7 +71,7 @@ class LabProfileFragment : LazyFragment(), CoroutineScope {
                         "LoginStore" -> loginStore
                         "LoginStore / data" -> loginStore?.data ?: JsonObject()
                         "Config" -> app.config.values
-                        "Config (profile)" -> app.config.forProfile().values
+                        "Config (profile)" -> app.profile.config.values
                         else -> when (obj) {
                             is JsonObject -> (obj as JsonObject).get(el)
                             is JsonArray -> (obj as JsonArray).get(el.toInt())
@@ -176,7 +181,7 @@ class LabProfileFragment : LazyFragment(), CoroutineScope {
             json.add("LoginStore", app.gson.toJsonTree(loginStore))
             json.add("LoginStore / data", loginStore?.data ?: JsonObject())
             json.add("Config", JsonParser.parseString(app.gson.toJson(app.config.values.toSortedMap())))
-            json.add("Config (profile)", JsonParser.parseString(app.gson.toJson(app.config.forProfile().values.toSortedMap())))
+            json.add("Config (profile)", JsonParser.parseString(app.gson.toJson(app.profile.config.values.toSortedMap())))
         }
         adapter.items = LabJsonAdapter.expand(json, 0)
         adapter.notifyDataSetChanged()

app/src/main/java/pl/szczodrzynski/edziennik/ui/dialogs/settings/AgendaConfigDialog.kt

@@ -6,13 +6,11 @@ package pl.szczodrzynski.edziennik.ui.dialogs.settings
 
 import android.view.LayoutInflater
 import androidx.appcompat.app.AppCompatActivity
-import com.google.android.material.dialog.MaterialAlertDialogBuilder
+import pl.szczodrzynski.edziennik.R
-import pl.szczodrzynski.edziennik.*
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.databinding.DialogConfigAgendaBinding
 import pl.szczodrzynski.edziennik.ext.onChange
 import pl.szczodrzynski.edziennik.ui.dialogs.base.ConfigDialog
-import java.util.*
 
 class AgendaConfigDialog(
     activity: AppCompatActivity,
@@ -32,48 +30,35 @@ class AgendaConfigDialog(
     override fun inflate(layoutInflater: LayoutInflater) =
         DialogConfigAgendaBinding.inflate(layoutInflater)
 
-    private val profileConfig by lazy { app.config.forProfile().ui }
-
     override suspend fun loadConfig() {
-        b.config = profileConfig
+        b.config = app.profile.config
-        b.isAgendaMode = profileConfig.agendaViewType == Profile.AGENDA_DEFAULT
+        b.isAgendaMode = app.profile.config.ui.agendaViewType == Profile.AGENDA_DEFAULT
 
-        b.eventSharingEnabled.isChecked =
+        var calledFromListener = false
-            app.profile.enableSharedEvents && app.profile.canShare
+        b.eventSharingEnabled.isChecked = app.profile.canShare
+        b.shareByDefault.isEnabled = app.profile.canShare
         b.eventSharingEnabled.onChange { _, isChecked ->
-            if (isChecked && !app.profile.canShare) {
+            if (calledFromListener) {
-                b.eventSharingEnabled.isChecked = false
+                calledFromListener = false
-                val dialog = RegistrationConfigDialog(
-                    activity,
-                    app.profile,
-                    onChangeListener = { enabled ->
-                        b.eventSharingEnabled.isChecked = enabled
-                        setEventSharingEnabled(enabled)
-                    },
-                    onShowListener,
-                    onDismissListener,
-                )
-                dialog.showEnableDialog()
                 return@onChange
             }
-            setEventSharingEnabled(isChecked)
+            b.eventSharingEnabled.isChecked = !isChecked
+            val dialog = RegistrationConfigDialog(
+                activity,
+                app.profile,
+                onChangeListener = { enabled ->
+                    calledFromListener = true
+                    b.eventSharingEnabled.isChecked = enabled
+                    b.shareByDefault.isEnabled = enabled
+                },
+                onShowListener,
+                onDismissListener,
+            )
+            if (isChecked)
+                dialog.showEnableDialog()
+            else
+                dialog.showDisableDialog()
+            return@onChange
         }
     }
-
-    private fun setEventSharingEnabled(enabled: Boolean) {
-        if (enabled == app.profile.enableSharedEvents)
-            return
-        app.profile.enableSharedEvents = enabled
-        app.profileSave()
-        MaterialAlertDialogBuilder(activity)
-            .setTitle(R.string.event_sharing)
-            .setMessage(
-                if (enabled)
-                    R.string.settings_register_shared_events_dialog_enabled_text
-                else
-                    R.string.settings_register_shared_events_dialog_disabled_text
-            )
-            .setPositiveButton(R.string.ok, null)
-            .show()
-    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/ui/dialogs/settings/AttendanceConfigDialog.kt

@@ -29,23 +29,21 @@ class AttendanceConfigDialog(
     override fun inflate(layoutInflater: LayoutInflater) =
         AttendanceConfigDialogBinding.inflate(layoutInflater)
 
-    private val profileConfig by lazy { app.config.getFor(app.profileId).attendance }
-
     override suspend fun loadConfig() {
-        b.useSymbols.isChecked = profileConfig.useSymbols
+        b.useSymbols.isChecked = app.profile.config.attendance.useSymbols
-        b.groupConsecutiveDays.isChecked = profileConfig.groupConsecutiveDays
+        b.groupConsecutiveDays.isChecked = app.profile.config.attendance.groupConsecutiveDays
-        b.showPresenceInMonth.isChecked = profileConfig.showPresenceInMonth
+        b.showPresenceInMonth.isChecked = app.profile.config.attendance.showPresenceInMonth
     }
 
     override fun initView() {
         b.useSymbols.onChange { _, isChecked ->
-            profileConfig.useSymbols = isChecked
+            app.profile.config.attendance.useSymbols = isChecked
         }
         b.groupConsecutiveDays.onChange { _, isChecked ->
-            profileConfig.groupConsecutiveDays = isChecked
+            app.profile.config.attendance.groupConsecutiveDays = isChecked
         }
         b.showPresenceInMonth.onChange { _, isChecked ->
-            profileConfig.showPresenceInMonth = isChecked
+            app.profile.config.attendance.showPresenceInMonth = isChecked
         }
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/ui/dialogs/settings/GradesConfigDialog.kt

@@ -45,17 +45,15 @@ class GradesConfigDialog(
     override fun inflate(layoutInflater: LayoutInflater) =
         DialogConfigGradesBinding.inflate(layoutInflater)
 
-    private val profileConfig by lazy { app.config.getFor(app.profileId).grades }
-
     @SuppressLint("SetTextI18n")
     override suspend fun loadConfig() {
-        b.customPlusCheckBox.isChecked = profileConfig.plusValue != null
+        b.customPlusCheckBox.isChecked = app.profile.config.grades.plusValue != null
         b.customPlusValue.isVisible = b.customPlusCheckBox.isChecked
-        b.customMinusCheckBox.isChecked = profileConfig.minusValue != null
+        b.customMinusCheckBox.isChecked = app.profile.config.grades.minusValue != null
         b.customMinusValue.isVisible = b.customMinusCheckBox.isChecked
 
-        b.customPlusValue.progress = profileConfig.plusValue ?: 0.5f
+        b.customPlusValue.progress = app.profile.config.grades.plusValue ?: 0.5f
-        b.customMinusValue.progress = profileConfig.minusValue ?: 0.25f
+        b.customMinusValue.progress = app.profile.config.grades.minusValue ?: 0.25f
 
         when (config.orderBy) {
             ORDER_BY_DATE_DESC -> b.sortGradesByDateRadio
@@ -63,13 +61,13 @@ class GradesConfigDialog(
             else -> null
         }?.isChecked = true
 
-        when (profileConfig.colorMode) {
+        when (app.profile.config.grades.colorMode) {
             COLOR_MODE_DEFAULT -> b.gradeColorFromERegister
             COLOR_MODE_WEIGHTED -> b.gradeColorByValue
             else -> null
         }?.isChecked = true
 
-        when (profileConfig.yearAverageMode) {
+        when (app.profile.config.grades.yearAverageMode) {
             YEAR_ALL_GRADES -> b.gradeAverageMode4
             YEAR_1_AVG_2_AVG -> b.gradeAverageMode0
             YEAR_1_SEM_2_AVG -> b.gradeAverageMode1
@@ -79,21 +77,21 @@ class GradesConfigDialog(
         }?.isChecked = true
 
         b.dontCountGrades.isChecked =
-            profileConfig.dontCountEnabled && profileConfig.dontCountGrades.isNotEmpty()
+            app.profile.config.grades.dontCountEnabled && app.profile.config.grades.dontCountGrades.isNotEmpty()
-        b.hideImproved.isChecked = profileConfig.hideImproved
+        b.hideImproved.isChecked = app.profile.config.grades.hideImproved
-        b.averageWithoutWeight.isChecked = profileConfig.averageWithoutWeight
+        b.averageWithoutWeight.isChecked = app.profile.config.grades.averageWithoutWeight
 
-        if (profileConfig.dontCountGrades.isEmpty()) {
+        if (app.profile.config.grades.dontCountGrades.isEmpty()) {
             b.dontCountGradesText.setText("nb, 0, bz, bd")
         } else {
-            b.dontCountGradesText.setText(profileConfig.dontCountGrades.join(", "))
+            b.dontCountGradesText.setText(app.profile.config.grades.dontCountGrades.join(", "))
         }
     }
 
     override suspend fun saveConfig() {
-        profileConfig.plusValue =
+        app.profile.config.grades.plusValue =
             if (b.customPlusCheckBox.isChecked) b.customPlusValue.progress else null
-        profileConfig.minusValue =
+        app.profile.config.grades.minusValue =
             if (b.customMinusCheckBox.isChecked) b.customMinusValue.progress else null
 
         b.dontCountGradesText.setText(
@@ -103,8 +101,8 @@ class GradesConfigDialog(
                 ?.lowercase()
                 ?.replace(", ", ",")
         )
-        profileConfig.dontCountEnabled = b.dontCountGrades.isChecked
+        app.profile.config.grades.dontCountEnabled = b.dontCountGrades.isChecked
-        profileConfig.dontCountGrades = b.dontCountGradesText.text
+        app.profile.config.grades.dontCountGrades = b.dontCountGradesText.text
             ?.split(",")
             ?.map { it.trim() }
             ?: listOf()
@@ -121,39 +119,39 @@ class GradesConfigDialog(
         // who the hell named those methods
         // THIS SHIT DOES NOT EVEN WORK
         b.customPlusValue.doOnStopTrackingTouch {
-            profileConfig.plusValue = it.progress
+            app.profile.config.grades.plusValue = it.progress
         }
         b.customMinusValue.doOnStopTrackingTouch {
-            profileConfig.minusValue = it.progress
+            app.profile.config.grades.minusValue = it.progress
         }
 
         b.sortGradesByDateRadio.setOnSelectedListener { config.orderBy = ORDER_BY_DATE_DESC }
         b.sortGradesBySubjectRadio.setOnSelectedListener { config.orderBy = ORDER_BY_SUBJECT_ASC }
 
         b.gradeColorFromERegister.setOnSelectedListener {
-            profileConfig.colorMode = COLOR_MODE_DEFAULT
+            app.profile.config.grades.colorMode = COLOR_MODE_DEFAULT
         }
-        b.gradeColorByValue.setOnSelectedListener { profileConfig.colorMode = COLOR_MODE_WEIGHTED }
+        b.gradeColorByValue.setOnSelectedListener { app.profile.config.grades.colorMode = COLOR_MODE_WEIGHTED }
 
         b.gradeAverageMode4.setOnSelectedListener {
-            profileConfig.yearAverageMode = YEAR_ALL_GRADES
+            app.profile.config.grades.yearAverageMode = YEAR_ALL_GRADES
         }
         b.gradeAverageMode0.setOnSelectedListener {
-            profileConfig.yearAverageMode = YEAR_1_AVG_2_AVG
+            app.profile.config.grades.yearAverageMode = YEAR_1_AVG_2_AVG
         }
         b.gradeAverageMode1.setOnSelectedListener {
-            profileConfig.yearAverageMode = YEAR_1_SEM_2_AVG
+            app.profile.config.grades.yearAverageMode = YEAR_1_SEM_2_AVG
         }
         b.gradeAverageMode2.setOnSelectedListener {
-            profileConfig.yearAverageMode = YEAR_1_AVG_2_SEM
+            app.profile.config.grades.yearAverageMode = YEAR_1_AVG_2_SEM
         }
         b.gradeAverageMode3.setOnSelectedListener {
-            profileConfig.yearAverageMode = YEAR_1_SEM_2_SEM
+            app.profile.config.grades.yearAverageMode = YEAR_1_SEM_2_SEM
         }
 
-        b.hideImproved.onChange { _, isChecked -> profileConfig.hideImproved = isChecked }
+        b.hideImproved.onChange { _, isChecked -> app.profile.config.grades.hideImproved = isChecked }
         b.averageWithoutWeight.onChange { _, isChecked ->
-            profileConfig.averageWithoutWeight = isChecked
+            app.profile.config.grades.averageWithoutWeight = isChecked
         }
 
         b.averageWithoutWeightHelp.onClick {

app/src/main/java/pl/szczodrzynski/edziennik/ui/dialogs/settings/MessagesConfigDialog.kt

@@ -28,13 +28,11 @@ class MessagesConfigDialog(
     override fun inflate(layoutInflater: LayoutInflater) =
         MessagesConfigDialogBinding.inflate(layoutInflater)
 
-    private val profileConfig by lazy { app.config.getFor(app.profileId).ui }
-
     override suspend fun loadConfig() {
-        b.config = profileConfig
+        b.config = app.profile.config.ui
 
         b.greetingText.setText(
-            profileConfig.messagesGreetingText
+            app.profile.config.ui.messagesGreetingText
                 ?: "\n\nZ poważaniem\n${app.profile.accountOwnerName}"
         )
     }
@@ -42,8 +40,8 @@ class MessagesConfigDialog(
     override suspend fun saveConfig() {
         val greetingText = b.greetingText.text?.toString()?.trim()
         if (greetingText.isNullOrEmpty())
-            profileConfig.messagesGreetingText = null
+            app.profile.config.ui.messagesGreetingText = null
         else
-            profileConfig.messagesGreetingText = "\n\n$greetingText"
+            app.profile.config.ui.messagesGreetingText = "\n\n$greetingText"
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/ui/dialogs/settings/NotificationFilterDialog.kt

@@ -30,7 +30,7 @@ class NotificationFilterDialog(
         .associateBy { it.titleRes.resolveString(activity) as CharSequence }
 
     override fun getDefaultSelectedItems() = NotificationType.values()
-        .filter { it.enabledByDefault != null && it !in app.config.forProfile().sync.notificationFilter }
+        .filter { it.enabledByDefault != null && it !in app.profile.config.sync.notificationFilter }
         .toSet()
 
     override suspend fun onShow() = Unit
@@ -47,7 +47,7 @@ class NotificationFilterDialog(
                 .setTitle(R.string.are_you_sure)
                 .setMessage(R.string.notification_filter_warning)
                 .setPositiveButton(R.string.ok) { _, _ ->
-                    app.config.forProfile().sync.notificationFilter = disabledTypes
+                    app.profile.config.sync.notificationFilter = disabledTypes
                     dismiss()
                 }
                 .setNegativeButton(R.string.cancel, null)
@@ -55,7 +55,7 @@ class NotificationFilterDialog(
             return NO_DISMISS
         }
 
-        app.config.forProfile().sync.notificationFilter = disabledTypes
+        app.profile.config.sync.notificationFilter = disabledTypes
 
         return DISMISS
     }

app/src/main/java/pl/szczodrzynski/edziennik/ui/dialogs/settings/RegistrationConfigDialog.kt

@@ -7,7 +7,11 @@ package pl.szczodrzynski.edziennik.ui.dialogs.settings
 import androidx.appcompat.app.AlertDialog
 import androidx.appcompat.app.AppCompatActivity
 import com.google.android.material.dialog.MaterialAlertDialogBuilder
-import kotlinx.coroutines.*
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.Job
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.data.api.szkolny.SzkolnyApi
@@ -117,7 +121,7 @@ class RegistrationConfigDialog(
             profile.registration = Profile.REGISTRATION_ENABLED
 
             // force full registration of the user
-            App.config.getFor(profile.id).hash = ""
+            profile.config.hash = ""
 
             SzkolnyApi(app).runCatching(activity) {
                 AppSync(app, mutableListOf(), listOf(profile), this).run(

app/src/main/java/pl/szczodrzynski/edziennik/ui/dialogs/settings/TimetableConfigDialog.kt

@@ -30,14 +30,12 @@ class TimetableConfigDialog(
     override fun inflate(layoutInflater: LayoutInflater) =
         TimetableConfigDialogBinding.inflate(layoutInflater)
 
-    private val profileConfig by lazy { app.config.getFor(app.profileId).ui }
-
     override fun initView() {
         b.features = app.profile.loginStoreType.features
     }
 
     override suspend fun loadConfig() {
-        b.config = profileConfig
+        b.config = app.profile.config.ui
     }
 
     override suspend fun saveConfig() {

app/src/main/java/pl/szczodrzynski/edziennik/ui/dialogs/sync/UpdateAvailableDialog.kt

@@ -43,11 +43,11 @@ class UpdateAvailableDialog(
     override suspend fun onShow() = Unit
 
     override suspend fun onPositiveClick(): Boolean {
-        if (update == null)
+        if (update == null || update.isOnGooglePlay)
             Utils.openGooglePlay(activity)
         else
             activity.startService(Intent(app, UpdateDownloaderService::class.java))
-        return NO_DISMISS
+        return DISMISS
     }
 
     override suspend fun onBeforeShow(): Boolean {

app/src/main/java/pl/szczodrzynski/edziennik/ui/dialogs/sync/UpdateProgressDialog.kt

@@ -0,0 +1,87 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-22.
+ */
+
+package pl.szczodrzynski.edziennik.ui.dialogs.sync
+
+import android.app.DownloadManager
+import android.database.CursorIndexOutOfBoundsException
+import android.view.LayoutInflater
+import androidx.appcompat.app.AppCompatActivity
+import androidx.core.content.getSystemService
+import kotlinx.coroutines.Job
+import org.greenrobot.eventbus.EventBus
+import org.greenrobot.eventbus.Subscribe
+import org.greenrobot.eventbus.ThreadMode
+import pl.szczodrzynski.edziennik.R
+import pl.szczodrzynski.edziennik.data.api.szkolny.response.Update
+import pl.szczodrzynski.edziennik.databinding.UpdateProgressDialogBinding
+import pl.szczodrzynski.edziennik.ext.getInt
+import pl.szczodrzynski.edziennik.ext.startCoroutineTimer
+import pl.szczodrzynski.edziennik.sync.UpdateStateEvent
+import pl.szczodrzynski.edziennik.ui.dialogs.base.BindingDialog
+import pl.szczodrzynski.edziennik.utils.Utils
+
+class UpdateProgressDialog(
+    activity: AppCompatActivity,
+    private val update: Update,
+    private val downloadId: Long,
+    onShowListener: ((tag: String) -> Unit)? = null,
+    onDismissListener: ((tag: String) -> Unit)? = null,
+) : BindingDialog<UpdateProgressDialogBinding>(activity, onShowListener, onDismissListener) {
+
+    override val TAG = "UpdateProgressDialog"
+
+    override fun getTitleRes() = R.string.notification_downloading_update
+    override fun inflate(layoutInflater: LayoutInflater) =
+        UpdateProgressDialogBinding.inflate(layoutInflater)
+
+    override fun isCancelable() = false
+    override fun getNegativeButtonText() = R.string.cancel
+
+    private var timerJob: Job? = null
+
+    override suspend fun onShow() {
+        EventBus.getDefault().register(this)
+        b.update = update
+        b.progress.progress = 0
+
+        val downloadManager = app.getSystemService<DownloadManager>() ?: return
+        val query = DownloadManager.Query().setFilterById(downloadId)
+
+        timerJob?.cancel()
+        timerJob = startCoroutineTimer(repeatMillis = 100L) {
+            try {
+                val cursor = downloadManager.query(query)
+                cursor.moveToFirst()
+                val progress = cursor.getInt(DownloadManager.COLUMN_BYTES_DOWNLOADED_SO_FAR)
+                    ?.toFloat() ?: return@startCoroutineTimer
+                b.downloadedSize.text = Utils.readableFileSize(progress.toLong())
+                val total = cursor.getInt(DownloadManager.COLUMN_TOTAL_SIZE_BYTES)
+                    ?.toFloat() ?: return@startCoroutineTimer
+                b.totalSize.text = Utils.readableFileSize(total.toLong())
+                b.progress.progress = (progress / total * 100.0f).toInt()
+            } catch (_: CursorIndexOutOfBoundsException) {}
+        }
+    }
+
+    override fun onDismiss() {
+        EventBus.getDefault().unregister(this)
+        timerJob?.cancel()
+    }
+
+    override suspend fun onNegativeClick(): Boolean {
+        val downloadManager = app.getSystemService<DownloadManager>() ?: return NO_DISMISS
+        downloadManager.remove(downloadId)
+        return DISMISS
+    }
+
+    @Subscribe(threadMode = ThreadMode.MAIN, sticky = true)
+    fun onUpdateStateEvent(event: UpdateStateEvent) {
+        if (event.downloadId != downloadId)
+            return
+        EventBus.getDefault().removeStickyEvent(event)
+        if (!event.running)
+            dismiss()
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/ui/event/EventDetailsDialog.kt

@@ -113,9 +113,20 @@ class EventDetailsDialog(
 
         b.typeColor.background?.setTintColor(event.eventColor)
 
-        b.details = mutableListOf(
+        val agendaSubjectImportant = event.subjectLongName != null
+                && App.config[event.profileId].ui.agendaSubjectImportant
+
+        b.name = if (agendaSubjectImportant)
+            event.subjectLongName
+        else
+            event.typeName
+
+        b.details = listOfNotNull(
+            if (agendaSubjectImportant)
+                event.typeName
+            else
                 event.subjectLongName,
-                event.teamName?.asColoredSpannable(colorSecondary)
+            event.teamName?.asColoredSpannable(colorSecondary)
         ).concat(bullet)
 
         b.addedBy.setText(

app/src/main/java/pl/szczodrzynski/edziennik/ui/event/EventListAdapter.kt

@@ -24,6 +24,7 @@ class EventListAdapter(
     val showDate: Boolean = false,
     val showColor: Boolean = true,
     val showType: Boolean = true,
+    val showTypeColor: Boolean = showType,
     val showTime: Boolean = true,
     val showSubject: Boolean = true,
     val markAsSeen: Boolean = true,

app/src/main/java/pl/szczodrzynski/edziennik/ui/event/EventManualDialog.kt

@@ -13,23 +13,37 @@ import androidx.appcompat.app.AppCompatActivity
 import com.google.android.material.dialog.MaterialAlertDialogBuilder
 import com.jaredrummler.android.colorpicker.ColorPickerDialog
 import com.jaredrummler.android.colorpicker.ColorPickerDialogListener
-import kotlinx.coroutines.*
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 import org.greenrobot.eventbus.EventBus
 import org.greenrobot.eventbus.Subscribe
 import org.greenrobot.eventbus.ThreadMode
-import pl.szczodrzynski.edziennik.*
+import pl.szczodrzynski.edziennik.App
+import pl.szczodrzynski.edziennik.R
+import pl.szczodrzynski.edziennik.config.AppData
 import pl.szczodrzynski.edziennik.data.api.edziennik.EdziennikTask
 import pl.szczodrzynski.edziennik.data.api.events.ApiTaskAllFinishedEvent
 import pl.szczodrzynski.edziennik.data.api.events.ApiTaskErrorEvent
 import pl.szczodrzynski.edziennik.data.api.events.ApiTaskFinishedEvent
 import pl.szczodrzynski.edziennik.data.api.szkolny.SzkolnyApi
-import pl.szczodrzynski.edziennik.data.db.entity.*
+import pl.szczodrzynski.edziennik.data.db.entity.Event
+import pl.szczodrzynski.edziennik.data.db.entity.Metadata
+import pl.szczodrzynski.edziennik.data.db.entity.Profile
+import pl.szczodrzynski.edziennik.data.db.entity.Subject
 import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.data.db.full.EventFull
 import pl.szczodrzynski.edziennik.data.db.full.LessonFull
 import pl.szczodrzynski.edziennik.databinding.DialogEventManualV2Binding
-import pl.szczodrzynski.edziennik.ext.*
+import pl.szczodrzynski.edziennik.ext.JsonObject
+import pl.szczodrzynski.edziennik.ext.appendView
+import pl.szczodrzynski.edziennik.ext.getStudentData
+import pl.szczodrzynski.edziennik.ext.onChange
+import pl.szczodrzynski.edziennik.ext.onClick
+import pl.szczodrzynski.edziennik.ext.removeFromParent
+import pl.szczodrzynski.edziennik.ext.setText
+import pl.szczodrzynski.edziennik.ext.setTintColor
 import pl.szczodrzynski.edziennik.ui.dialogs.base.BindingDialog
 import pl.szczodrzynski.edziennik.ui.dialogs.settings.RegistrationConfigDialog
 import pl.szczodrzynski.edziennik.ui.views.TimeDropdown.Companion.DISPLAY_LESSONS
@@ -107,8 +121,14 @@ class EventManualDialog(
     }
 
     override suspend fun onShow() {
-        b.shareSwitch.isChecked = editingShared
+        val data = withContext(Dispatchers.IO) {
-        b.shareSwitch.isEnabled = !editingShared || (editingShared && editingOwn)
+            val profile = app.db.profileDao().getByIdSuspend(profileId) ?: return@withContext null
+            AppData.get(profile.loginStoreType)
+        }
+        if (data?.uiConfig?.eventManualShowSubjectDropdown == true) {
+            b.subjectDropdownLayout.removeFromParent()
+            b.timeDropdownLayout.appendView(b.subjectDropdownLayout)
+        }
 
         b.showMore.onClick { // TODO iconics is broken
             it.apply {
@@ -137,6 +157,11 @@ class EventManualDialog(
         }
 
         loadLists()
+
+        val shareByDefault = app.profile.config.shareByDefault && profile.canShare
+
+        b.shareSwitch.isChecked = editingShared || editingEvent == null && shareByDefault
+        b.shareSwitch.isEnabled = !editingShared || editingOwn
     }
 
     private fun updateShareText(checked: Boolean = b.shareSwitch.isChecked) {

app/src/main/java/pl/szczodrzynski/edziennik/ui/event/EventViewHolder.kt

@@ -113,7 +113,7 @@ class EventViewHolder(
         b.attachmentIcon.isVisible = item.hasAttachments
 
         b.typeColor.background?.setTintColor(item.eventColor)
-        b.typeColor.isVisible = adapter.showType && adapter.showColor
+        b.typeColor.isVisible = adapter.showTypeColor
 
         b.editButton.isVisible = !adapter.simpleMode
                 && item.addedManually

app/src/main/java/pl/szczodrzynski/edziennik/ui/grades/GradesListFragment.kt

@@ -81,7 +81,7 @@ class GradesListFragment : Fragment(), CoroutineScope {
             }
 
             val items = when {
-                app.config.forProfile().grades.hideSticksFromOld && App.devMode -> grades.filter { it.value != 1.0f }
+                app.profile.config.grades.hideSticksFromOld && App.devMode -> grades.filter { it.value != 1.0f }
                 else -> grades
             }
 

app/src/main/java/pl/szczodrzynski/edziennik/ui/grades/editor/GradesEditorFragment.kt

@@ -12,7 +12,9 @@ import androidx.fragment.app.Fragment
 import androidx.lifecycle.Observer
 import androidx.recyclerview.widget.LinearLayoutManager
 import com.google.android.material.dialog.MaterialAlertDialogBuilder
-import pl.szczodrzynski.edziennik.*
+import pl.szczodrzynski.edziennik.App
+import pl.szczodrzynski.edziennik.MainActivity
+import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.data.db.entity.Grade
 import pl.szczodrzynski.edziennik.databinding.FragmentGradesEditorBinding
 import pl.szczodrzynski.edziennik.ext.getFloat
@@ -37,7 +39,7 @@ class GradesEditorFragment : Fragment() {
     private val navController: NavController by lazy { Navigation.findNavController(b.root) }
 */
 
-    private val config by lazy { app.config.getFor(App.profileId).grades }
+    private val config by lazy { app.profile.config.grades }
 
     private var subjectId: Long = -1
     private var semester: Int = 1

app/src/main/java/pl/szczodrzynski/edziennik/ui/home/CounterActivity.kt

@@ -4,8 +4,10 @@
 
 package pl.szczodrzynski.edziennik.ui.home
 
+import android.graphics.BitmapFactory
 import android.os.Bundle
 import androidx.appcompat.app.AppCompatActivity
+import com.jetradarmobile.snowfall.SnowfallView
 import com.mikepenz.iconics.IconicsDrawable
 import com.mikepenz.iconics.utils.colorInt
 import com.mikepenz.iconics.utils.sizeDp
@@ -20,6 +22,7 @@ import pl.szczodrzynski.edziennik.ext.startCoroutineTimer
 import pl.szczodrzynski.edziennik.ext.timeLeft
 import pl.szczodrzynski.edziennik.ext.timeTill
 import pl.szczodrzynski.edziennik.ui.dialogs.BellSyncTimeChooseDialog
+import pl.szczodrzynski.edziennik.utils.BigNightUtil
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
 import kotlin.coroutines.CoroutineContext
@@ -61,6 +64,7 @@ class CounterActivity : AppCompatActivity(), CoroutineScope {
                                     it.type != Lesson.TYPE_SHIFTED_SOURCE
                         })
             }
+            lessonList.onEach { it.filterNotes() }
         }
 
         b.bellSync.setImageDrawable(
@@ -81,6 +85,27 @@ class CounterActivity : AppCompatActivity(), CoroutineScope {
         counterJob = startCoroutineTimer(repeatMillis = 500) {
             update()
         }
+
+        // IT'S WINTER MY DUDES
+        val today = Date.getToday()
+        if ((today.month / 3 % 4 == 0) && app.config.ui.snowfall) {
+            b.rootFrame.addView(layoutInflater.inflate(R.layout.snowfall, b.rootFrame, false))
+        } else if (app.config.ui.eggfall && BigNightUtil().isDataWielkanocyNearDzisiaj()) {
+            val eggfall = layoutInflater.inflate(
+                R.layout.eggfall,
+                b.rootFrame,
+                false
+            ) as SnowfallView
+            eggfall.setSnowflakeBitmaps(listOf(
+                BitmapFactory.decodeResource(resources, R.drawable.egg1),
+                BitmapFactory.decodeResource(resources, R.drawable.egg2),
+                BitmapFactory.decodeResource(resources, R.drawable.egg3),
+                BitmapFactory.decodeResource(resources, R.drawable.egg4),
+                BitmapFactory.decodeResource(resources, R.drawable.egg5),
+                BitmapFactory.decodeResource(resources, R.drawable.egg6)
+            ))
+            b.rootFrame.addView(eggfall)
+        }
     }}
 
     private fun update() {
@@ -101,13 +126,15 @@ class CounterActivity : AppCompatActivity(), CoroutineScope {
 
             when {
                 actual != null -> {
-                    b.lessonName.text = actual.displaySubjectName
+                    b.lessonName.text = actual.getNoteSubstituteText(showNotes = true)
+                        ?: actual.displaySubjectName
 
                     val left = actual.displayEndTime!! - now
                     b.timeLeft.text = timeLeft(left.toInt(), "\n", countInSeconds)
                 }
                 next != null -> {
-                    b.lessonName.text = next.displaySubjectName
+                    b.lessonName.text = next.getNoteSubstituteText(showNotes = true)
+                        ?: next.displaySubjectName
 
                     val till = next.displayStartTime!! - now
                     b.timeLeft.text = timeTill(till.toInt(), "\n", countInSeconds)

app/src/main/java/pl/szczodrzynski/edziennik/ui/home/HomeConfigDialog.kt

@@ -37,18 +37,17 @@ class HomeConfigDialog(
     ).mapKeys { (resId, _) -> activity.getString(resId) }
 
     override fun getDefaultSelectedItems() =
-        profileConfig.homeCards
+        app.profile.config.ui.homeCards
             .filter { it.profileId == App.profileId }
             .map { it.cardId }
             .toSet()
 
     override suspend fun onShow() = Unit
 
-    private val profileConfig by lazy { app.config.getFor(app.profileId).ui }
     private var configChanged = false
 
     override suspend fun onPositiveClick(): Boolean {
-        val homeCards = profileConfig.homeCards.toMutableList()
+        val homeCards = app.profile.config.ui.homeCards.toMutableList()
         homeCards.removeAll { it.profileId == App.profileId }
         homeCards += getMultiSelection().mapNotNull {
             HomeCardModel(
@@ -56,7 +55,7 @@ class HomeConfigDialog(
                 cardId = it as? Int ?: return@mapNotNull null
             )
         }
-        profileConfig.homeCards = homeCards
+        app.profile.config.ui.homeCards = homeCards
         return DISMISS
     }
 

app/src/main/java/pl/szczodrzynski/edziennik/ui/home/HomeFragment.kt

@@ -50,18 +50,18 @@ class HomeFragment : Fragment(), CoroutineScope {
             cardAdapter.items[toPosition] = fromCard
             cardAdapter.notifyItemMoved(fromPosition, toPosition)
 
-            val homeCards = App.config.forProfile().ui.homeCards.toMutableList()
+            val homeCards = App.profile.config.ui.homeCards.toMutableList()
             val fromIndex = homeCards.indexOfFirst { it.cardId == fromCard.id }
             val toIndex = homeCards.indexOfFirst { it.cardId == toCard.id }
             val fromPair = homeCards[fromIndex]
             homeCards[fromIndex] = homeCards[toIndex]
             homeCards[toIndex] = fromPair
-            App.config.forProfile().ui.homeCards = homeCards
+            App.profile.config.ui.homeCards = homeCards
             return true
         }
 
         fun removeCard(position: Int, cardAdapter: HomeCardAdapter) {
-            val homeCards = App.config.forProfile().ui.homeCards.toMutableList()
+            val homeCards = App.profile.config.ui.homeCards.toMutableList()
             if (position >= homeCards.size)
                 return
             val card = cardAdapter.items[position]
@@ -71,7 +71,7 @@ class HomeFragment : Fragment(), CoroutineScope {
                 return
             }
             homeCards.removeAll { it.cardId == card.id }
-            App.config.forProfile().ui.homeCards = homeCards
+            App.profile.config.ui.homeCards = homeCards
         }
     }
 
@@ -144,7 +144,7 @@ class HomeFragment : Fragment(), CoroutineScope {
             b.refreshLayout.isEnabled = scrollY == 0
         }
 
-        val cards = app.config.forProfile().ui.homeCards.filter { it.profileId == app.profile.id }.toMutableList()
+        val cards = app.profile.config.ui.homeCards.filter { it.profileId == app.profile.id }.toMutableList()
         if (cards.isEmpty()) {
             cards += listOfNotNull(
                     HomeCardModel(app.profile.id, HomeCard.CARD_LUCKY_NUMBER).takeIf { app.profile.hasUIFeature(FeatureType.LUCKY_NUMBER) },
@@ -153,7 +153,7 @@ class HomeFragment : Fragment(), CoroutineScope {
                     HomeCardModel(app.profile.id, HomeCard.CARD_GRADES).takeIf { app.profile.hasUIFeature(FeatureType.GRADES) },
                     HomeCardModel(app.profile.id, HomeCard.CARD_NOTES),
             )
-            app.config.forProfile().ui.homeCards = app.config.forProfile().ui.homeCards.toMutableList().also { it.addAll(cards) }
+            app.profile.config.ui.homeCards = app.profile.config.ui.homeCards.toMutableList().also { it.addAll(cards) }
         }
 
         val items = mutableListOf<HomeCard>()

app/src/main/java/pl/szczodrzynski/edziennik/ui/home/cards/HomeAvailabilityCard.kt

@@ -15,7 +15,10 @@ import coil.load
 import kotlinx.coroutines.CoroutineScope
 import kotlinx.coroutines.Dispatchers
 import kotlinx.coroutines.Job
-import pl.szczodrzynski.edziennik.*
+import pl.szczodrzynski.edziennik.App
+import pl.szczodrzynski.edziennik.BuildConfig
+import pl.szczodrzynski.edziennik.MainActivity
+import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.databinding.CardHomeAvailabilityBinding
 import pl.szczodrzynski.edziennik.ext.Intent
@@ -28,6 +31,7 @@ import pl.szczodrzynski.edziennik.ui.dialogs.sync.UpdateAvailableDialog
 import pl.szczodrzynski.edziennik.ui.home.HomeCard
 import pl.szczodrzynski.edziennik.ui.home.HomeCardAdapter
 import pl.szczodrzynski.edziennik.ui.home.HomeFragment
+import pl.szczodrzynski.edziennik.utils.Utils
 import pl.szczodrzynski.edziennik.utils.html.BetterHtml
 import kotlin.coroutines.CoroutineContext
 
@@ -79,7 +83,7 @@ class HomeAvailabilityCard(
         else if (update != null && update.versionCode > BuildConfig.VERSION_CODE) {
             b.homeAvailabilityTitle.setText(R.string.home_availability_title)
             b.homeAvailabilityText.setText(R.string.home_availability_text, update.versionName)
-            b.homeAvailabilityUpdate.isVisible = true
+            b.homeAvailabilityUpdate.isVisible = !app.buildManager.isPlayRelease
             b.homeAvailabilityIcon.setImageResource(R.drawable.ic_update)
             onInfoClick = {
                 UpdateAvailableDialog(activity, update).show()
@@ -92,7 +96,10 @@ class HomeAvailabilityCard(
         b.homeAvailabilityUpdate.onClick {
             if (update == null)
                 return@onClick
-            activity.startService(Intent(app, UpdateDownloaderService::class.java))
+            if (update.isOnGooglePlay)
+                Utils.openGooglePlay(activity)
+            else
+                activity.startService(Intent(app, UpdateDownloaderService::class.java))
         }
 
         b.homeAvailabilityInfo.onClick(onInfoClick)