diff --git a/.bettercodehub.yml b/.bettercodehub.yml index cce850d7..d7be5169 100644 --- a/.bettercodehub.yml +++ b/.bettercodehub.yml @@ -1,5 +1,3 @@ -exclude: -- /app/src/main/java/io/github/wulkanowy/data/db/dao/entities/.* -component_depth: 1 +component_depth: 10 languages: -- java +- kotlin diff --git a/.circleci/config.yml b/.circleci/config.yml index 841ff9e0..ce2922ba 100644 --- a/.circleci/config.yml +++ b/.circleci/config.yml @@ -7,11 +7,11 @@ references: container_config: &container_config docker: - - image: circleci/android:api-27-alpha + - image: circleci/android@sha256:5cdc8626cc6f13efe5ed982cdcdb432b0472f8740fed8743a6461e025ad6cdfc working_directory: *workspace_root environment: environment: - JVM_OPTS: -Xmx3200m + _JAVA_OPTS: -Xmx3072m attach_workspace: &attach_workspace attach_workspace: @@ -25,6 +25,8 @@ jobs: build: <<: *container_config steps: + - run: | + curl -H 'Cache-Control: no-cache' https://raw.githubusercontent.com/fossas/fossa-cli/master/install.sh | bash - checkout - restore_cache: <<: *general_cache_key @@ -33,10 +35,10 @@ jobs: command: ./gradlew dependencies --no-daemon --stacktrace --console=plain -PdisablePreDex || true - run: name: Initial build - command: ./gradlew build assembleDebug -x test -x lint -x fabricGenerateResourcesRelease --no-daemon --stacktrace --console=plain -PdisablePreDex - - store_artifacts: - path: ./app/build/outputs/apk/ - destination: apks/ + command: ./gradlew build -x test -x lint -x fabricGenerateResourcesFdroidRelease -x fabricGenerateResourcesPlayRelease -x packageRelease --no-daemon --stacktrace --console=plain -PdisablePreDex + - run: + name: Run FOSSA + command: fossa --no-ansi || true - persist_to_workspace: root: *workspace_root paths: @@ -54,7 +56,7 @@ jobs: <<: *general_cache_key - run: name: Run lint - command: ./gradlew lint -x fabricGenerateResourcesRelease --no-daemon --stacktrace --console=plain -PdisablePreDex + command: ./gradlew lint -x fabricGenerateResourcesFdroidRelease -x fabricGenerateResourcesPlayRelease --no-daemon --stacktrace --console=plain -PdisablePreDex - store_artifacts: path: ./app/build/reports/ destination: lint_reports/app/ @@ -73,16 +75,13 @@ jobs: <<: *general_cache_key - run: name: Run app tests - command: ./gradlew :app:test :app:jacocoTestReport -x fabricGenerateResourcesRelease --no-daemon --stacktrace --console=plain -PdisablePreDex + command: ./gradlew :app:test :app:jacocoTestReport -x fabricGenerateResourcesFdroidRelease -x fabricGenerateResourcesPlayRelease --no-daemon --stacktrace --console=plain -PdisablePreDex - run: name: Upload unit code coverage to codecov command: bash <(curl -s https://codecov.io/bash) -F app - store_artifacts: - path: ./app/build/reports/tests/ - destination: tests_reports/ - - store_artifacts: - path: ./app/build/reports/jacoco/jacocoTestDebugUnitTestReport/ - destination: coverage_reports/ + path: ./app/build/reports/ + destination: reports/ - store_test_results: path: ./app/build/test-results - persist_to_workspace: @@ -90,42 +89,23 @@ jobs: paths: - "./app/build/jacoco" - api-test: - <<: *container_config - steps: - - *attach_workspace - - restore_cache: - <<: *general_cache_key - - run: - name: Run api tests - command: ./gradlew :api:test :api:jacocoTestReport --no-daemon --stacktrace --console=plain -PdisablePreDex - - run: - name: Upload code coverage to codecov - command: bash <(curl -s https://codecov.io/bash) -F api - - store_artifacts: - path: ./api/build/reports/tests/ - destination: tests_reports/ - - store_artifacts: - path: ./api/build/reports/jacoco/test/ - destination: coverage_reports/ - - store_test_results: - path: ./api/build/test-results - - persist_to_workspace: - root: *workspace_root - paths: - - "./api/build/jacoco" - instrumented: <<: *container_config steps: - *attach_workspace + - run: + name: Accept licenses + command: yes | sdkmanager --licenses && yes | sdkmanager --update - run: name: Setup emulator - command: sdkmanager "system-images;android-19;google_apis;armeabi-v7a" && echo "no" | avdmanager create avd -n test -k "system-images;android-19;google_apis;armeabi-v7a" + command: sdkmanager "system-images;android-22;default;armeabi-v7a" && echo "no" | avdmanager create avd -n test -k "system-images;android-22;default;armeabi-v7a" - run: name: Launch emulator command: export LD_LIBRARY_PATH=${ANDROID_HOME}/emulator/lib64:${ANDROID_HOME}/emulator/lib64/qt/lib && emulator64-arm -avd test -noaudio -no-boot-anim -no-window -accel on background: true + - run: + name: Change circle-android script file permissions + command: sudo chmod +rx /bin/circle-android - run: name: Wait emulator command: | @@ -134,15 +114,13 @@ jobs: # unlock the emulator screen sleep 30 adb shell input keyevent 82 - - run: - name: Clean project - command: ./gradlew clean --no-daemon --stacktrace --console=plain -PdisablePreDex - run: name: Run instrumented tests - command: ./gradlew createDebugCoverageReport --no-daemon --stacktrace --console=plain -PdisablePreDex + command: ./gradlew clean createFdroidDebugCoverageReport jacocoTestReport --no-daemon --stacktrace --console=plain -PdisablePreDex - run: name: Collect logs from emulator command: adb logcat -d > ./app/build/reports/logcat_emulator.txt + when: always - run: name: Upload code covarage to codecov command: bash <(curl -s https://codecov.io/bash) -F instrumented @@ -167,32 +145,66 @@ jobs: command: ./gradlew jacocoTestReport --no-daemon --stacktrace --console=plain -PdisablePreDex - run: name: Run sonarqube runner - command: ./gradlew -x test -x lint sonarqube -Dsonar.host.url=$SONAR_HOST -Dsonar.organization=$SONAR_ORG -Dsonar.login=$SONAR_KEY -Dsonar.branch.name=$CIRCLE_BRANCH --no-daemon --stacktrace --console=plain -PdisablePreDex + command: if [ -z ${SONAR_HOST+x} ]; then echo "sonar scan skipped"; else ./gradlew -x test -x lint sonarqube -Dsonar.host.url=$SONAR_HOST -Dsonar.organization=$SONAR_ORG -Dsonar.login=$SONAR_KEY -Dsonar.branch.name=$CIRCLE_BRANCH --no-daemon --stacktrace --console=plain -PdisablePreDex; fi + command: "[[ -v CIRCLE_PR_NUMBER ]] && ./gradlew -x test -x lint sonarqube -Dsonar.host.url=$SONAR_HOST -Dsonar.organization=$SONAR_ORG -Dsonar.login=$SONAR_KEY -Dsonar.branch.name=$CIRCLE_BRANCH --no-daemon --stacktrace --console=plain -PdisablePreDex || true" + + deploy: + <<: *container_config + steps: + - *attach_workspace + - restore_cache: + <<: *general_cache_key + - run: + name: Decrypt keys + command: | + gpg --yes --batch --passphrase=$SERVICES_ENCRYPT_KEY ./app/src/release/google-services.json.gpg + openssl aes-256-cbc -d -in ./app/key-encrypted.p12 -k $ENCRYPT_KEY >> ./app/key.p12 + openssl aes-256-cbc -d -in ./app/upload-key-encrypted.jks -k $ENCRYPT_KEY >> ./app/upload-key.jks + - run: + name: Publish release + command: ./gradlew publishPlayRelease --no-daemon --stacktrace --console=plain -PenableCrashlytics -PdisablePreDex workflows: version: 2 - build_check_tests: + build-test-deploy: jobs: - - build + - build: + filters: + tags: + only: /.*/ - lint: + filters: + tags: + only: /.*/ requires: - build - app-test: - requires: - - build - - api-test: + filters: + tags: + only: /.*/ requires: - build - instrumented: - requires: - - build + filters: + tags: + only: /.*/ requires: - build - sonarcube: + filters: + tags: + only: /.*/ requires: - build - lint - app-test - - api-test - instrumented + - deploy: + requires: + - instrumented + filters: + tags: + only: /\d+\.\d+\.\d+/ + branches: + ignore: /.*/ diff --git a/.github/ISSUE_TEMPLATE.md b/.github/ISSUE_TEMPLATE.md new file mode 100644 index 00000000..27d57f59 --- /dev/null +++ b/.github/ISSUE_TEMPLATE.md @@ -0,0 +1,17 @@ +## Co powinno się dziać + + +## Co się dzieje + + +## Jak to zrobić kolejny raz: + + 1. + 2. + 3. + +## Informacje o urządzeniu i dzienniku + + - Wersja aplikacji: + - Wersja Androida: + - Adres URL dziennika: diff --git a/.gitignore b/.gitignore index 3b524b65..d3fb6e4e 100644 --- a/.gitignore +++ b/.gitignore @@ -1,38 +1,91 @@ -/captures -.externalNativeBuild - -## https://gist.github.com/iainconnor/8605514 +# Created by https://www.gitignore.io # Built application files -/build -/*/build/ +*.apk +*.ap_ +*.aab -# Crashlytics configuations -com_crashlytics_export_strings.xml +# Files for the ART/Dalvik VM +*.dex + +# Java class files +*.class + +# Generated files +bin/ +gen/ +out/ + +# Gradle files +.gradle/ +build/ # Local configuration file (sdk path, etc) local.properties -# Gradle generated files -.gradle/ +# Proguard folder generated by Eclipse +proguard/ -# Signing files -.signing/ +# Log Files +*.log -# User-specific configurations -.idea/copyright/profiles_settings.xml +# Android Studio Navigation editor temp files +.navigation/ + +# Android Studio captures folder +captures/ + +# IntelliJ configurations +*.iml +.idea/workspace.xml +.idea/tasks.xml +.idea/gradle.xml +.idea/assetWizardSettings.xml +.idea/dictionaries +.idea/libraries +.idea/caches +.idea/modules.xml +.idea/navEditor.xml +.idea/caches/ .idea/libraries/ -.idea/inspectionProfiles/ +.idea/shelf/ .idea/.name .idea/compiler.xml +.idea/copyright/profiles_settings.xml .idea/encodings.xml .idea/misc.xml -.idea/modules.xml .idea/scopes/scope_settings.xml -.idea/tasks.xml .idea/vcs.xml -.idea/workspace.xml -*.iml +.idea/jsLibraryMappings.xml +.idea/datasources.xml +.idea/dataSources.ids +.idea/sqlDataSources.xml +.idea/dynamic.xml +.idea/uiDesigner.xml +.idea/runConfigurations.xml +.idea/discord.xml + +# Keystore files +*.jks +*.keystore +*.p12 + +# External native build folder generated in Android Studio 2.2 and later +.externalNativeBuild + +# Version control +vcs.xml + +# lint +lint/intermediates/ +lint/generated/ +lint/outputs/ +lint/tmp/ +lint/reports/ + +### Android Patch ### +gen-external-apklibs +output.json # OS-specific files .DS_Store @@ -42,3 +95,21 @@ local.properties .Trashes ehthumbs.db Thumbs.db + +# Legacy Eclipse project files +.classpath +.project +.cproject +.settings/ + +# Mobile Tools for Java (J2ME) +.mtj.tmp/ + +# Package Files # +*.war +*.ear + +### AndroidStudio Patch ### + +!/gradle/wrapper/gradle-wrapper.jar +.idea/jarRepositories.xml diff --git a/.gitlab-ci.yml b/.gitlab-ci.yml index d8fdd058..a84ac839 100644 --- a/.gitlab-ci.yml +++ b/.gitlab-ci.yml @@ -1,4 +1,4 @@ -image: circleci/android:api-27-alpha +image: circleci/android:api-28-alpha before_script: - export GRADLE_USER_HOME=`pwd`/.gradle @@ -12,7 +12,7 @@ build: script: - ./gradlew --no-daemon --stacktrace dependencies || true - ./gradlew --no-daemon --stacktrace assembleDebug - - mv app/build/outputs/apk/app-debug.apk . + - mv app/build/outputs/apk/fdroid/debug/app-fdroid-debug.apk . artifacts: name: "${CI_PROJECT_NAME}_${CI_BUILD_REF_NAME}-${CI_BUILD_ID}" paths: @@ -26,7 +26,7 @@ tests: - .gradle policy: pull script: - - ./gradlew --no-daemon --stacktrace test + - ./gradlew --no-daemon --stacktrace -x fabricGenerateResourcesFdroidRelease -x fabricGenerateResourcesPlayRelease test artifacts: paths: - app/build/reports/tests @@ -39,7 +39,7 @@ lint: - .gradle policy: pull script: - - ./gradlew --no-daemon --stacktrace lint + - ./gradlew --no-daemon --stacktrace -x fabricGenerateResourcesFdroidRelease -x fabricGenerateResourcesPlayRelease lint artifacts: paths: - app/build/reports diff --git a/.idea/codeStyleSettings.xml b/.idea/codeStyleSettings.xml deleted file mode 100644 index f5bd97e6..00000000 --- a/.idea/codeStyleSettings.xml +++ /dev/null @@ -1,226 +0,0 @@ - - - - - - \ No newline at end of file diff --git a/.idea/codeStyles/Project.xml b/.idea/codeStyles/Project.xml new file mode 100644 index 00000000..cb2f4119 --- /dev/null +++ b/.idea/codeStyles/Project.xml @@ -0,0 +1,158 @@ + + + + \ No newline at end of file diff --git a/.idea/codeStyles/codeStyleConfig.xml b/.idea/codeStyles/codeStyleConfig.xml new file mode 100644 index 00000000..0f7bc519 --- /dev/null +++ b/.idea/codeStyles/codeStyleConfig.xml @@ -0,0 +1,5 @@ + + + + diff --git a/.idea/gradle.xml b/.idea/gradle.xml deleted file mode 100644 index 48777522..00000000 --- a/.idea/gradle.xml +++ /dev/null @@ -1,19 +0,0 @@ - - - - - - \ No newline at end of file diff --git a/.idea/runConfigurations.xml b/.idea/runConfigurations.xml deleted file mode 100644 index 7f68460d..00000000 --- a/.idea/runConfigurations.xml +++ /dev/null @@ -1,12 +0,0 @@ - - - - - - \ No newline at end of file diff --git a/.travis.yml b/.travis.yml new file mode 100644 index 00000000..688dd000 --- /dev/null +++ b/.travis.yml @@ -0,0 +1,63 @@ +language: android +jdk: oraclejdk8 + +env: + global: + - ANDROID_API_LEVEL=29 + - ANDROID_BUILD_TOOLS_VERSION=29.0.3 + +cache: + directories: + - $HOME/.gradle/caches/ + - $HOME/.gradle/wrapper/ + +branches: + only: + - develop + - 0.20.2 + +android: + licenses: + - android-sdk-preview-license-.+ + - android-sdk-license-.+ + - google-gdk-license-.+ + components: + - tools + - platform-tools + # The BuildTools version used by your project + - build-tools-$ANDROID_BUILD_TOOLS_VERSION + # The SDK version used to compile your project + - android-$ANDROID_API_LEVEL + # Additional components + - extra-google-google_play_services + - extra-google-m2repository + - extra-android-m2repository + - addon-google_apis-google-$ANDROID_API_LEVEL + # Android emulator + - android-22 + - sys-img-armeabi-v7a-android-22 + +before_script: + # Launch emulator before the execution + - echo no | android create avd --force -n test -t android-22 --abi armeabi-v7a + - emulator -avd test -no-audio -no-window & + - android-wait-for-emulator + - adb shell input keyevent 82 & + - "curl -H 'Cache-Control: no-cache' https://raw.githubusercontent.com/fossas/fossa-cli/master/install.sh | sudo bash" + +script: + - ./gradlew dependencies --stacktrace --daemon + - fossa --no-ansi || true + - ./gradlew -Pcoverage testPlayDebugUnitTest --stacktrace --daemon + - ./gradlew -Pcoverage createFdroidDebugCoverageReport --stacktrace --daemon + - ./gradlew -Pcoverage jacocoTestReport --stacktrace --daemon + - | + if [ $TRAVIS_TAG ]; then + gpg --yes --batch --passphrase=$SERVICES_ENCRYPT_KEY ./app/src/release/google-services.json.gpg; + gpg --yes --batch --passphrase=$ENCRYPT_KEY ./app/key.p12.gpg; + gpg --yes --batch --passphrase=$ENCRYPT_KEY ./app/upload-key.jks.gpg; + ./gradlew publishPlayRelease -PenableFirebase --stacktrace; + fi + +after_success: + - bash <(curl -s https://codecov.io/bash) diff --git a/LICENSE b/LICENSE index f48b2114..5dd9cacf 100644 --- a/LICENSE +++ b/LICENSE @@ -186,7 +186,7 @@ same "printed page" as the copyright notice for easier identification within third-party archives. - Copyright 2017 wulkanowy + Copyright 2019 Wulkanowy Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/README.en.md b/README.en.md new file mode 100644 index 00000000..28cce1c3 --- /dev/null +++ b/README.en.md @@ -0,0 +1,60 @@ +[Polska wersja README](README.md) + +# Wulkanowy +[![Travis](https://img.shields.io/travis/com/wulkanowy/wulkanowy/master.svg?style=flat-square)](https://travis-ci.com/wulkanowy/wulkanowy) +[![Codecov](https://img.shields.io/codecov/c/github/wulkanowy/wulkanowy/master.svg?style=flat-square)](https://codecov.io/gh/wulkanowy/wulkanowy) +[![Discord](https://img.shields.io/discord/390889354199040011.svg?style=flat-square)](https://discord.gg/vccAQBr) +[![F-Droid](https://img.shields.io/f-droid/v/io.github.wulkanowy.svg?style=flat-square)](https://f-droid.org/packages/io.github.wulkanowy/) +[![Last release](https://img.shields.io/github/release/wulkanowy/wulkanowy.svg?logo=github&style=flat-square)](https://github.com/wulkanowy/wulkanowy/releases) + +Unofficial android VULCAN UONET+ register client for both students and their parents + +## Features + +* logging in using the email and password OR using token and pin +* functions from the register website: + * grades + * grade statistics + * attendance + * percentage of attendance + * exams + * timetable + * completed lessons + * messages + * homework + * notes + * lucky number +* calculation of the average independently of school's preferences +* notifications, e.g. about a new grade +* dark and black (AMOLED) theme +* offline mode +* no ads + +## Download + +You can download the current beta version from the Google Play or the F-Droid store + +[Get it on Google Play](https://play.google.com/store/apps/details?id=io.github.wulkanowy) +[Get it on F-Droid](https://f-droid.org/packages/io.github.wulkanowy/) + +You can also download a [development version](https://wulkanowy.github.io/#download) that includes new features being prepared for the next release + +## Built With + + +* [Wulkanowy SDK](https://github.com/wulkanowy/sdk) +* [Dagger 2](https://github.com/google/dagger) +* [Room](https://developer.android.com/topic/libraries/architecture/room) +* [WorkManager](https://developer.android.com/topic/libraries/architecture/workmanager) + +## Contributing + +Please contribute to the project either by creating a PR or submitting an issue on GitHub. + +## License + +This project is licensed under the Apache License 2.0 - see the [LICENSE](LICENSE) file for details diff --git a/README.md b/README.md index 76a8d6e6..02e1900c 100644 --- a/README.md +++ b/README.md @@ -1,12 +1,61 @@ +[English version of README](README.en.md) + # Wulkanowy +[![Travis](https://img.shields.io/travis/com/wulkanowy/wulkanowy/master.svg?style=flat-square)](https://travis-ci.com/wulkanowy/wulkanowy) +[![Codecov](https://img.shields.io/codecov/c/github/wulkanowy/wulkanowy/master.svg?style=flat-square)](https://codecov.io/gh/wulkanowy/wulkanowy) +[![Discord](https://img.shields.io/discord/390889354199040011.svg?style=flat-square)](https://discord.gg/vccAQBr) +[![F-Droid](https://img.shields.io/f-droid/v/io.github.wulkanowy.svg?style=flat-square)](https://f-droid.org/packages/io.github.wulkanowy/) +[![Last release](https://img.shields.io/github/release/wulkanowy/wulkanowy.svg?logo=github&style=flat-square)](https://github.com/wulkanowy/wulkanowy/releases) -[![Codecov](https://img.shields.io/codecov/c/github/wulkanowy/wulkanowy.svg?style=flat-square)](https://codecov.io/gh/wulkanowy/wulkanowy) -[![Dependency Status](https://www.versioneye.com/user/projects/5969ff0b0fb24f004f8c711b/badge.svg?style=flat-square)](https://www.versioneye.com/user/projects/5969ff0b0fb24f004f8c711b) -[![CircleCI](https://img.shields.io/circleci/project/github/wulkanowy/wulkanowy.svg?style=flat-square)](https://circleci.com/gh/wulkanowy/wulkanowy) -[![Bitrise](https://img.shields.io/bitrise/daeff1893f3c8128/master.svg?token=Hjm1ACamk86JDeVVJHOeqQ&style=flat-square)](https://www.bitrise.io/app/daeff1893f3c8128) -[![BCH compliance](https://bettercodehub.com/edge/badge/wulkanowy/wulkanowy?branch=master)](https://bettercodehub.com/) -[![Bintray](https://img.shields.io/bintray/v/wulkanowy/wulkanowy/api.svg?style=flat-square)](https://bintray.com/wulkanowy/wulkanowy/api) +Nieoficjalny klient dziennika VULCAN UONET+ dla ucznia i rodzica -[Pobierz wersję rozwojową](https://bitrise-redirector.herokuapp.com/v0.1/apps/daeff1893f3c8128/builds/master/artifacts/app-release-bitrise-signed.apk) +## Funkcje -Wulkanowy to projekt aplikacji na androida ułatwiającej używanie dziennika VULCANa. +* logowanie za pomocą e-maila i hasła LUB tokena i pinu +* funkcje ze strony internetowej dziennika: + * oceny + * statystyki ocen + * frekwencja + * procent frekwencji + * sprawdziany + * plan lekcji + * lekcje zrealizowane + * wiadomości + * zadania domowe + * uwagi + * szczęśliwy numerek +* obliczanie średniej niezależnie od preferencji szkoły +* powiadomienia np. o nowej ocenie +* ciemny i czarny (AMOLED) motyw +* tryb offilne +* brak reklam + +## Pobierz + +Aktualną wersję beta możesz pobrać ze sklepu Google Play lub F-Droid + +[Pobierz z Google Play](https://play.google.com/store/apps/details?id=io.github.wulkanowy) +[Pobierz z F-Droid](https://f-droid.org/packages/io.github.wulkanowy/) + + +Możesz także pobrać [wersję rozwojową](https://wulkanowy.github.io/#download), która zawiera nowe funkcje przygotowywane do następnego wydania + + +## Zbudowana za pomocą + +* [Wulkanowy SDK](https://github.com/wulkanowy/SDK) +* [Dagger 2](https://github.com/google/dagger) +* [Room](https://developer.android.com/topic/libraries/architecture/room) +* [WorkManager](https://developer.android.com/topic/libraries/architecture/workmanager) + +## Współpraca + +Wnieś swój wkład w projekt, tworząc PR lub wysyłając issue na GitHub. + +## Licencja + +Ten projekt udostępniany jest na licencji Apache License 2.0 - szczegóły w pliku [LICENSE](LICENSE) diff --git a/api/build.gradle b/api/build.gradle deleted file mode 100644 index ebaca4c8..00000000 --- a/api/build.gradle +++ /dev/null @@ -1,117 +0,0 @@ -apply plugin: 'java-library' -apply plugin: 'org.sonarqube' -apply plugin: 'jacoco' -apply plugin: 'com.jfrog.bintray' -apply plugin: 'com.github.dcendents.android-maven' - -compileJava.options.encoding = "UTF-8" -compileTestJava.options.encoding = "UTF-8" - -ext { - PUBLISH_GROUP_ID = GROUP_ID - PUBLISH_ARTIFACT_ID = 'api' - PUBLISH_VERSION = System.getenv('GIT_TAG') -} - -test { - testLogging { - events "passed", "skipped", "failed", "standardOut", "standardError" - outputs.upToDateWhen {false} - showStandardStreams = true - } -} - -jacocoTestReport { - reports { - xml.enabled true - } -} - -dependencies { - implementation 'org.jsoup:jsoup:1.10.3' - implementation 'org.apache.commons:commons-lang3:3.7' - implementation 'com.google.code.gson:gson:2.8.2' - - testImplementation 'junit:junit:4.12' - testImplementation 'org.mockito:mockito-core:2.13.0' -} - -version = PUBLISH_VERSION -group = GROUP_ID - -sonarqube { - properties { - property "sonar.projectName", GROUP_ID + ":api" - property "sonar.projectKey", GROUP_ID + ":wulkanowy-api" - } -} - -def siteUrl = 'https://github.com/wulkanowy/wulkanowy' -def gitUrl = 'https://github.com/wulkanowy/wulkanowy.git' - -bintray { - user = System.getenv('BINTRAY_USER') - key = System.getenv('BINTRAY_KEY') - configurations = ['archives'] - pkg { - repo = 'wulkanowy' - name = 'api' - userOrg = 'wulkanowy' - licenses = ['Apache-2.0'] - vcsUrl = gitUrl - labels = ['aar', 'android', 'wulkanowy', 'api'] - publicDownloadNumbers = true - publish = true - - version { - name = PUBLISH_VERSION - vcsTag = PUBLISH_VERSION - released = new Date() - } - } -} - -install { - repositories.mavenInstaller { - pom { - project { - packaging 'aar' - name 'Bintray publish Gradle aar' - url siteUrl - licenses { - license { - name 'The Apache Software License, Version 2.0' - url 'http://www.apache.org/licenses/LICENSE-2.0.txt' - } - } - developers { - developer { - id 'mklkj' - name 'Mikołaj Pich' - email 'm.pich@outlook.com' - } - } - scm { - connection gitUrl - developerConnection gitUrl - url siteUrl - } - } - } - } -} - -task sourcesJar(type: Jar, dependsOn: classes) { - classifier = 'sources' - from sourceSets.main.allSource -} - -task javadocJar(type: Jar, dependsOn: javadoc) { - classifier = 'javadoc' - from javadoc.destinationDir -} - -artifacts { - archives sourcesJar - archives javadocJar -} diff --git a/api/src/main/java/io/github/wulkanowy/api/Client.java b/api/src/main/java/io/github/wulkanowy/api/Client.java deleted file mode 100644 index f7a663ec..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/Client.java +++ /dev/null @@ -1,104 +0,0 @@ -package io.github.wulkanowy.api; - -import org.jsoup.Connection; -import org.jsoup.Jsoup; -import org.jsoup.nodes.Document; - -import java.io.IOException; -import java.util.Map; - -public class Client { - - private String protocol; - - private String host; - - private String symbol; - - private Cookies cookies = new Cookies(); - - Client(String protocol, String host, String symbol) { - this.protocol = protocol; - this.host = host; - this.symbol = symbol; - } - - String getHost() { - return host; - } - - public void setSymbol(String symbol) { - this.symbol = symbol; - } - - Map getCookies() { - return cookies.getItems(); - } - - private String getFilledUrl(String url) { - return url - .replace("{schema}", protocol) - .replace("{host}", host.replace(":", "%253A")) - .replace("{symbol}", symbol == null ? "Default" : symbol); - } - - Document getPageByUrl(String url) throws IOException { - Connection.Response response = Jsoup.connect(getFilledUrl(url)) - .followRedirects(true) - .cookies(getCookies()) - .execute(); - - this.cookies.addItems(response.cookies()); - - return response.parse(); - } - - public Document postPageByUrl(String url, String[][] params) throws IOException { - Connection connection = Jsoup.connect(getFilledUrl(url)); - - for (String[] data : params) { - connection.data(data[0], data[1]); - } - - Connection.Response response = connection - .followRedirects(true) - .method(Connection.Method.POST) - .cookies(getCookies()) - .execute(); - - this.cookies.addItems(response.cookies()); - - return response.parse(); - } - - public String getJsonStringByUrl(String url) throws IOException { - Connection.Response response = Jsoup.connect(getFilledUrl(url)) - .followRedirects(true) - .ignoreContentType(true) - .cookies(getCookies()) - .execute(); - - this.cookies.addItems(response.cookies()); - - return response.body(); - } - - public String postJsonStringByUrl(String url, String[][] params) throws IOException { - Connection connection = Jsoup.connect(getFilledUrl(url)); - - for (String[] data : params) { - connection.data(data[0], data[1]); - } - - Connection.Response response = connection - .followRedirects(true) - .ignoreContentType(true) - .method(Connection.Method.POST) - .cookies(getCookies()) - .execute(); - - this.cookies.addItems(response.cookies()); - - return response.body(); - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/Cookies.java b/api/src/main/java/io/github/wulkanowy/api/Cookies.java deleted file mode 100644 index c97d9658..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/Cookies.java +++ /dev/null @@ -1,23 +0,0 @@ -package io.github.wulkanowy.api; - -import java.util.HashMap; -import java.util.Map; - -public class Cookies { - - private Map jar = new HashMap<>(); - - public Map getItems() { - return jar; - } - - public Cookies setItems(Map items) { - this.jar = items; - return this; - } - - public Cookies addItems(Map items) { - this.jar.putAll(items); - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/Semester.java b/api/src/main/java/io/github/wulkanowy/api/Semester.java deleted file mode 100644 index 64a07c97..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/Semester.java +++ /dev/null @@ -1,37 +0,0 @@ -package io.github.wulkanowy.api; - -public class Semester { - - private String number = ""; - - private String id = ""; - - private boolean isCurrent = false; - - public String getNumber() { - return number; - } - - public Semester setNumber(String number) { - this.number = number; - return this; - } - - public String getId() { - return id; - } - - public Semester setId(String id) { - this.id = id; - return this; - } - - public boolean isCurrent() { - return isCurrent; - } - - public Semester setCurrent(boolean current) { - isCurrent = current; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/SnP.java b/api/src/main/java/io/github/wulkanowy/api/SnP.java deleted file mode 100644 index 614b77b6..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/SnP.java +++ /dev/null @@ -1,26 +0,0 @@ -package io.github.wulkanowy.api; - -import org.jsoup.nodes.Document; -import org.jsoup.nodes.Element; - -import java.io.IOException; -import java.util.List; - -import io.github.wulkanowy.api.login.NotLoggedInErrorException; - -public interface SnP { - - String getId(); - - void storeContextCookies() throws IOException, NotLoggedInErrorException; - - String getRowDataChildValue(Element e, int index); - - Document getSnPPageDocument(String url) throws IOException; - - List getSemesters() throws IOException; - - List getSemesters(Document gradesPage); - - Semester getCurrentSemester(List semesterList); -} diff --git a/api/src/main/java/io/github/wulkanowy/api/StudentAndParent.java b/api/src/main/java/io/github/wulkanowy/api/StudentAndParent.java deleted file mode 100644 index a8d61913..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/StudentAndParent.java +++ /dev/null @@ -1,119 +0,0 @@ -package io.github.wulkanowy.api; - -import org.jsoup.nodes.Document; -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.login.NotLoggedInErrorException; - -public class StudentAndParent implements SnP { - - private static final String START_PAGE_URL = "{schema}://uonetplus.{host}/{symbol}/Start.mvc/Index"; - - private static final String BASE_URL = "{schema}://uonetplus-opiekun.{host}/{symbol}/{ID}/"; - - private static final String GRADES_PAGE_URL = "Oceny/Wszystkie"; - - private Client client; - - private String id; - - StudentAndParent(Client client) { - this.client = client; - } - - StudentAndParent(Client client, String id) { - this(client); - this.id = id; - } - - private String getBaseUrl() { - return BASE_URL.replace("{ID}", getId()); - } - - public String getId() { - return id; - } - - public void storeContextCookies() throws IOException, NotLoggedInErrorException { - client.getPageByUrl(getSnpHomePageUrl()); - } - - String getSnpHomePageUrl() throws IOException, NotLoggedInErrorException { - if (null != getId()) { - return getBaseUrl(); - } - - // get url to uonetplus-opiekun.vulcan.net.pl - Document startPage = client.getPageByUrl(START_PAGE_URL); - Element studentTileLink = startPage.select(".panel.linkownia.pracownik.klient > a").first(); - - if (null == studentTileLink) { - throw new NotLoggedInErrorException(); - } - - String snpPageUrl = studentTileLink.attr("href"); - - this.id = getExtractedIdFromUrl(snpPageUrl); - - return snpPageUrl; - } - - String getExtractedIdFromUrl(String snpPageUrl) throws NotLoggedInErrorException { - String[] path = snpPageUrl.split(client.getHost())[1].split("/"); - - if (5 != path.length) { - throw new NotLoggedInErrorException(); - } - - return path[2]; - } - - public String getRowDataChildValue(Element e, int index) { - return e.select(".daneWiersz .wartosc").get(index - 1).text(); - } - - public Document getSnPPageDocument(String url) throws IOException { - return client.getPageByUrl(getBaseUrl() + url); - } - - public List getSemesters() throws IOException { - return getSemesters(getSnPPageDocument(GRADES_PAGE_URL)); - } - - public List getSemesters(Document gradesPage) { - Elements semesterOptions = gradesPage.select("#okresyKlasyfikacyjneDropDownList option"); - - List semesters = new ArrayList<>(); - - for (Element e : semesterOptions) { - Semester semester = new Semester() - .setId(e.text()) - .setNumber(e.attr("value")); - - if ("selected".equals(e.attr("selected"))) { - semester.setCurrent(true); - } - - semesters.add(semester); - } - - return semesters; - } - - public Semester getCurrentSemester(List semesterList) { - Semester current = null; - for (Semester s : semesterList) { - if (s.isCurrent()) { - current = s; - break; - } - } - - return current; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/Vulcan.java b/api/src/main/java/io/github/wulkanowy/api/Vulcan.java deleted file mode 100644 index a44e868f..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/Vulcan.java +++ /dev/null @@ -1,196 +0,0 @@ -package io.github.wulkanowy.api; - -import java.io.IOException; - -import io.github.wulkanowy.api.attendance.AttendanceStatistics; -import io.github.wulkanowy.api.attendance.AttendanceTable; -import io.github.wulkanowy.api.exams.ExamsWeek; -import io.github.wulkanowy.api.grades.GradesList; -import io.github.wulkanowy.api.grades.SubjectsList; -import io.github.wulkanowy.api.login.AccountPermissionException; -import io.github.wulkanowy.api.login.BadCredentialsException; -import io.github.wulkanowy.api.login.Login; -import io.github.wulkanowy.api.login.LoginErrorException; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; -import io.github.wulkanowy.api.login.VulcanOfflineException; -import io.github.wulkanowy.api.messages.Messages; -import io.github.wulkanowy.api.notes.AchievementsList; -import io.github.wulkanowy.api.notes.NotesList; -import io.github.wulkanowy.api.school.SchoolInfo; -import io.github.wulkanowy.api.school.TeachersInfo; -import io.github.wulkanowy.api.timetable.Timetable; -import io.github.wulkanowy.api.user.BasicInformation; -import io.github.wulkanowy.api.user.FamilyInformation; - -public class Vulcan { - - private String id; - - private String symbol; - - private SnP snp; - - private String protocolSchema = "https"; - - private String logHost = "vulcan.net.pl"; - - private String email; - - private Client client; - - private Login login; - - public void setClient(Client client) { - this.client = client; - } - - public void setLogin(Login login) { - this.login = login; - } - - public void login(String email, String password, String symbol) - throws BadCredentialsException, AccountPermissionException, - LoginErrorException, IOException, VulcanOfflineException { - - setFullEndpointInfo(email); - login = getLogin(); - - this.symbol = login.login(this.email, password, symbol); - } - - public Vulcan login(String email, String password, String symbol, String id) - throws BadCredentialsException, AccountPermissionException, - LoginErrorException, IOException, VulcanOfflineException { - login(email, password, symbol); - - this.id = id; - - return this; - } - - String getProtocolSchema() { - return protocolSchema; - } - - String getLogHost() { - return logHost; - } - - public String getEmail() { - return email; - } - - public String getSymbol() { - return symbol; - } - - private void setFullEndpointInfo(String email) { - String[] creds = email.split("\\\\"); - - this.email = email; - - if (creds.length >= 2) { - String[] url = creds[0].split("://"); - - this.protocolSchema = url[0]; - this.logHost = url[1]; - this.email = creds[2]; - } - } - - protected Client getClient() { - if (null != client) { - return client; - } - - client = new Client(getProtocolSchema(), getLogHost(), symbol); - - return client; - } - - protected Login getLogin() { - if (null != login) { - return login; - } - - login = new Login(getClient()); - - return login; - } - - public SnP getStudentAndParent() throws IOException, NotLoggedInErrorException { - if (0 == getClient().getCookies().size()) { - throw new NotLoggedInErrorException(); - } - - if (null != snp) { - return snp; - } - - snp = createSnp(getClient(), id); - - snp.storeContextCookies(); - - return snp; - } - - SnP createSnp(Client client, String id) { - if (null == id) { - return new StudentAndParent(client); - } - - return new StudentAndParent(client, id); - } - - public AttendanceStatistics getAttendanceStatistics() throws IOException, NotLoggedInErrorException { - return new AttendanceStatistics(getStudentAndParent()); - } - - public AttendanceTable getAttendanceTable() throws IOException, NotLoggedInErrorException { - return new AttendanceTable(getStudentAndParent()); - } - - public ExamsWeek getExamsList() throws IOException, NotLoggedInErrorException { - return new ExamsWeek(getStudentAndParent()); - } - - public GradesList getGradesList() throws IOException, NotLoggedInErrorException { - return new GradesList(getStudentAndParent()); - } - - public SubjectsList getSubjectsList() throws IOException, NotLoggedInErrorException { - return new SubjectsList(getStudentAndParent()); - } - - public AchievementsList getAchievementsList() throws IOException, NotLoggedInErrorException { - return new AchievementsList(getStudentAndParent()); - } - - public NotesList getNotesList() throws IOException, NotLoggedInErrorException { - return new NotesList(getStudentAndParent()); - } - - public SchoolInfo getSchoolInfo() throws IOException, NotLoggedInErrorException { - return new SchoolInfo(getStudentAndParent()); - } - - public TeachersInfo getTeachersInfo() throws IOException, NotLoggedInErrorException { - return new TeachersInfo(getStudentAndParent()); - } - - public Timetable getTimetable() throws IOException, NotLoggedInErrorException { - return new Timetable(getStudentAndParent()); - } - - public BasicInformation getBasicInformation() throws IOException, NotLoggedInErrorException { - return new BasicInformation(getStudentAndParent()); - } - - public FamilyInformation getFamilyInformation() throws IOException, NotLoggedInErrorException { - return new FamilyInformation(getStudentAndParent()); - } - - public Messages getMessages() { - return new Messages(getClient()); - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/attendance/AttendanceStatistics.java b/api/src/main/java/io/github/wulkanowy/api/attendance/AttendanceStatistics.java deleted file mode 100644 index 023a436e..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/attendance/AttendanceStatistics.java +++ /dev/null @@ -1,88 +0,0 @@ -package io.github.wulkanowy.api.attendance; - -import org.apache.commons.lang3.math.NumberUtils; -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.SnP; -import io.github.wulkanowy.api.generic.Month; -import io.github.wulkanowy.api.generic.Subject; - -public class AttendanceStatistics { - - private SnP snp; - - private String attendancePageUrl = "Frekwencja.mvc"; - - public AttendanceStatistics(SnP snp) { - this.snp = snp; - } - - public Types getTypesTable() throws IOException { - return getTypesTable(""); - } - - public Types getTypesTable(String tick) throws IOException { - return getTypesTable(tick, -1); - } - - public List getSubjectList() throws IOException { - Element mainContainer = snp.getSnPPageDocument(attendancePageUrl) - .select(".mainContainer #idPrzedmiot").first(); - - List subjectList = new ArrayList<>(); - - for (Element subject : mainContainer.select("option")) { - subjectList.add(new Subject() - .setId(Integer.parseInt(subject.attr("value"))) - .setName(subject.text()) - ); - } - - return subjectList; - } - - public Types getTypesTable(String tick, Integer subjectId) throws IOException { - Element mainContainer = snp.getSnPPageDocument((attendancePageUrl - + "?data={tick}&idPrzedmiot={subject}") - .replace("{tick}", tick) - .replace("{subject}", subjectId.toString()) - ).select(".mainContainer").first(); - - Element table = mainContainer.select("table:nth-of-type(2)").first(); - - Elements headerCells = table.select("thead th"); - List typeList = new ArrayList<>(); - - Elements typesRows = table.select("tbody tr"); - - // fill types with months - for (Element row : typesRows) { - Elements monthsCells = row.select("td"); - - List monthList = new ArrayList<>(); - - // iterate over month in type, first column is empty, last is `total`; (0, n-1) - for (int i = 1; i < monthsCells.size() - 1; i++) { - monthList.add(new Month() - .setValue(NumberUtils.toInt(monthsCells.get(i).text(), 0)) - .setName(headerCells.get(i).text())); - } - - typeList.add(new Type() - .setTotal(NumberUtils.toInt(monthsCells.last().text(), 0)) - .setName(monthsCells.get(0).text()) - .setMonthList(monthList)); - } - - String total = mainContainer.select("h2").text().split(": ")[1]; - - return new Types() - .setTotal(NumberUtils.toDouble(total.replace("%", "").replace(",", "."))) - .setTypeList(typeList); - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/attendance/AttendanceTable.java b/api/src/main/java/io/github/wulkanowy/api/attendance/AttendanceTable.java deleted file mode 100644 index 7c9fc27f..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/attendance/AttendanceTable.java +++ /dev/null @@ -1,101 +0,0 @@ -package io.github.wulkanowy.api.attendance; - -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.SnP; -import io.github.wulkanowy.api.generic.Day; -import io.github.wulkanowy.api.generic.Lesson; -import io.github.wulkanowy.api.generic.Week; - -public class AttendanceTable { - - private SnP snp; - - private String attendancePageUrl = "Frekwencja.mvc?data="; - - public AttendanceTable(SnP snp) { - this.snp = snp; - } - - public Week getWeekTable() throws IOException { - return getWeekTable(""); - } - - public Week getWeekTable(String tick) throws IOException { - Element table = snp.getSnPPageDocument(attendancePageUrl + tick) - .select(".mainContainer .presentData").first(); - - Elements headerCells = table.select("thead th"); - List days = new ArrayList<>(); - - for (int i = 1; i < headerCells.size(); i++) { - days.add(new Day().setDate(headerCells.get(i).html().split("
")[1])); - } - - Elements hoursInDays = table.select("tbody tr"); - - // fill days in week with lessons - for (Element row : hoursInDays) { - Elements hours = row.select("td"); - - // fill hours in day - int size = hours.size(); - for (int i = 1; i < size; i++) { - days.get(i - 1).setLesson(getNewLesson(hours.get(i))); - } - } - - String[] dayDescription = headerCells.get(1).html().split("
"); - - return new Week() - .setStartDayDate(dayDescription[1]) - .setDays(days); - } - - private Lesson getNewLesson(Element cell) { - Lesson lesson = new Lesson(); - lesson.setSubject(cell.select("span").text()); - - if (LessonTypes.CLASS_NOT_EXIST.equals(cell.attr("class"))) { - lesson.setNotExist(true); - lesson.setEmpty(true); - - return lesson; - } - - switch (cell.select("div").attr("class")) { - case LessonTypes.CLASS_PRESENCE: - lesson.setPresence(true); - break; - case LessonTypes.CLASS_ABSENCE_UNEXCUSED: - lesson.setAbsenceUnexcused(true); - break; - case LessonTypes.CLASS_ABSENCE_EXCUSED: - lesson.setAbsenceExcused(true); - break; - case LessonTypes.CLASS_ABSENCE_FOR_SCHOOL_REASONS: - lesson.setAbsenceForSchoolReasons(true); - break; - case LessonTypes.CLASS_UNEXCUSED_LATENESS: - lesson.setUnexcusedLateness(true); - break; - case LessonTypes.CLASS_EXCUSED_LATENESS: - lesson.setExcusedLateness(true); - break; - case LessonTypes.CLASS_EXEMPTION: - lesson.setExemption(true); - break; - - default: - lesson.setEmpty(true); - break; - } - - return lesson; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/attendance/LessonTypes.java b/api/src/main/java/io/github/wulkanowy/api/attendance/LessonTypes.java deleted file mode 100644 index a9a1fac4..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/attendance/LessonTypes.java +++ /dev/null @@ -1,24 +0,0 @@ -package io.github.wulkanowy.api.attendance; - -class LessonTypes { - - static final String CLASS_NOT_EXIST = "x-sp-nieobecny-w-oddziale"; - - static final String CLASS_PRESENCE = "x-obecnosc"; - - static final String CLASS_ABSENCE_UNEXCUSED = "x-nieobecnosc-nieuspr"; - - static final String CLASS_ABSENCE_EXCUSED = "x-nieobecnosc-uspr"; - - static final String CLASS_ABSENCE_FOR_SCHOOL_REASONS = "x-nieobecnosc-przycz-szkol"; - - static final String CLASS_UNEXCUSED_LATENESS = "x-sp-nieusprawiedliwione"; - - static final String CLASS_EXCUSED_LATENESS = "x-sp-spr"; - - static final String CLASS_EXEMPTION = "x-sp-zwolnienie"; - - private LessonTypes() { - throw new IllegalStateException("Utility class"); - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/attendance/Type.java b/api/src/main/java/io/github/wulkanowy/api/attendance/Type.java deleted file mode 100644 index 6deb003e..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/attendance/Type.java +++ /dev/null @@ -1,42 +0,0 @@ -package io.github.wulkanowy.api.attendance; - -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.generic.Month; - -public class Type { - - private String name = ""; - - private int total = 0; - - private List monthList = new ArrayList<>(); - - public String getName() { - return name; - } - - public Type setName(String name) { - this.name = name; - return this; - } - - public int getTotal() { - return total; - } - - public Type setTotal(int total) { - this.total = total; - return this; - } - - public List getMonthList() { - return monthList; - } - - public Type setMonthList(List monthList) { - this.monthList = monthList; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/attendance/Types.java b/api/src/main/java/io/github/wulkanowy/api/attendance/Types.java deleted file mode 100644 index d1b1777d..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/attendance/Types.java +++ /dev/null @@ -1,29 +0,0 @@ -package io.github.wulkanowy.api.attendance; - -import java.util.ArrayList; -import java.util.List; - -public class Types { - - private double total = 0; - - private List typeList = new ArrayList<>(); - - public double getTotal() { - return total; - } - - public Types setTotal(double total) { - this.total = total; - return this; - } - - public List getTypeList() { - return typeList; - } - - public Types setTypeList(List typeList) { - this.typeList = typeList; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/exams/Exam.java b/api/src/main/java/io/github/wulkanowy/api/exams/Exam.java deleted file mode 100644 index 466bfe4f..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/exams/Exam.java +++ /dev/null @@ -1,59 +0,0 @@ -package io.github.wulkanowy.api.exams; - -public class Exam { - - private String subjectAndGroup = ""; - - private String type = ""; - - private String description = ""; - - private String teacher = ""; - - private String entryDate = ""; - - public String getSubjectAndGroup() { - return subjectAndGroup; - } - - public Exam setSubjectAndGroup(String subjectAndGroup) { - this.subjectAndGroup = subjectAndGroup; - return this; - } - - public String getType() { - return type; - } - - public Exam setType(String type) { - this.type = type; - return this; - } - - public String getDescription() { - return description; - } - - public Exam setDescription(String description) { - this.description = description; - return this; - } - - public String getTeacher() { - return teacher; - } - - public Exam setTeacher(String teacher) { - this.teacher = teacher; - return this; - } - - public String getEntryDate() { - return entryDate; - } - - public Exam setEntryDate(String entryDate) { - this.entryDate = entryDate; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/exams/ExamDay.java b/api/src/main/java/io/github/wulkanowy/api/exams/ExamDay.java deleted file mode 100644 index 8127e631..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/exams/ExamDay.java +++ /dev/null @@ -1,19 +0,0 @@ -package io.github.wulkanowy.api.exams; - -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.generic.Day; - -public class ExamDay extends Day { - - private List examList = new ArrayList<>(); - - public List getExamList() { - return examList; - } - - public void addExam(Exam exam) { - this.examList.add(exam); - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/exams/ExamsWeek.java b/api/src/main/java/io/github/wulkanowy/api/exams/ExamsWeek.java deleted file mode 100644 index b4921b8b..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/exams/ExamsWeek.java +++ /dev/null @@ -1,64 +0,0 @@ -package io.github.wulkanowy.api.exams; - -import org.jsoup.nodes.Document; -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.SnP; -import io.github.wulkanowy.api.generic.Week; - -public class ExamsWeek { - - private static final String EXAMS_PAGE_URL = "Sprawdziany.mvc/Terminarz?rodzajWidoku=2&data="; - - private final SnP snp; - - public ExamsWeek(SnP snp) { - this.snp = snp; - } - - public Week getCurrent() throws IOException { - return getWeek("", true); - } - - public Week getWeek(String tick, final boolean onlyNotEmpty) throws IOException { - Document examsPage = snp.getSnPPageDocument(EXAMS_PAGE_URL + tick); - Elements examsDays = examsPage.select(".mainContainer > div:not(.navigation)"); - - List days = new ArrayList<>(); - - for (Element item : examsDays) { - ExamDay day = new ExamDay(); - Element dayHeading = item.select("h2").first(); - - if (null == dayHeading && onlyNotEmpty) { - continue; - } - - if (null != dayHeading) { - day.setDate(dayHeading.text().split(", ")[1]); - } - - Elements exams = item.select("article"); - for (Element e : exams) { - day.addExam(new Exam() - .setSubjectAndGroup(snp.getRowDataChildValue(e, 1)) - .setType(snp.getRowDataChildValue(e, 2)) - .setDescription(snp.getRowDataChildValue(e, 3)) - .setTeacher(snp.getRowDataChildValue(e, 4).split(", ")[0]) - .setEntryDate(snp.getRowDataChildValue(e, 4).split(", ")[1]) - ); - } - - days.add(day); - } - - return new Week() - .setStartDayDate(examsDays.select("h2").first().text().split(" ")[1]) - .setDays(days); - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/generic/Day.java b/api/src/main/java/io/github/wulkanowy/api/generic/Day.java deleted file mode 100644 index 6bf26c04..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/generic/Day.java +++ /dev/null @@ -1,63 +0,0 @@ -package io.github.wulkanowy.api.generic; - -import java.util.ArrayList; -import java.util.List; - -public class Day { - - private List lessons = new ArrayList<>(); - - protected String date = ""; - - private String dayName = ""; - - private boolean isFreeDay = false; - - private String freeDayName = ""; - - public Lesson getLesson(int index) { - return lessons.get(index); - } - - public List getLessons() { - return lessons; - } - - public Day setLesson(Lesson lesson) { - this.lessons.add(lesson); - return this; - } - - public String getDate() { - return date; - } - - public Day setDate(String date) { - this.date = date; - return this; - } - - public String getDayName() { - return dayName; - } - - public void setDayName(String dayName) { - this.dayName = dayName; - } - - public boolean isFreeDay() { - return isFreeDay; - } - - public void setFreeDay(boolean freeDay) { - isFreeDay = freeDay; - } - - public String getFreeDayName() { - return freeDayName; - } - - public void setFreeDayName(String freeDayName) { - this.freeDayName = freeDayName; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/generic/Lesson.java b/api/src/main/java/io/github/wulkanowy/api/generic/Lesson.java deleted file mode 100644 index 8dd65327..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/generic/Lesson.java +++ /dev/null @@ -1,240 +0,0 @@ -package io.github.wulkanowy.api.generic; - -public class Lesson { - - private String number = ""; - - private String subject = ""; - - private String teacher = ""; - - private String room = ""; - - private String description = ""; - - private String groupName = ""; - - private String startTime = ""; - - private String endTime = ""; - - private String date = ""; - - private boolean isEmpty = false; - - private boolean isDivisionIntoGroups = false; - - private boolean isPlanning = false; - - private boolean isRealized = false; - - private boolean isMovedOrCanceled = false; - - private boolean isNewMovedInOrChanged = false; - - private boolean isNotExist = false; - - private boolean isPresence = false; - - private boolean isAbsenceUnexcused = false; - - private boolean isAbsenceExcused = false; - - private boolean isUnexcusedLateness = false; - - private boolean isAbsenceForSchoolReasons = false; - - private boolean isExcusedLateness = false; - - private boolean isExemption = false; - - public String getNumber() { - return number; - } - - public void setNumber(String number) { - this.number = number; - } - - public String getSubject() { - return subject; - } - - public Lesson setSubject(String subject) { - this.subject = subject; - return this; - } - - public String getTeacher() { - return teacher; - } - - public Lesson setTeacher(String teacher) { - this.teacher = teacher; - return this; - } - - public String getRoom() { - return room; - } - - public Lesson setRoom(String room) { - this.room = room; - return this; - } - - public String getDescription() { - return description; - } - - public Lesson setDescription(String description) { - this.description = description; - return this; - } - - public String getGroupName() { - return groupName; - } - - public void setGroupName(String groupName) { - this.groupName = groupName; - } - - public String getStartTime() { - return startTime; - } - - public void setStartTime(String startTime) { - this.startTime = startTime; - } - - public String getEndTime() { - return endTime; - } - - public void setEndTime(String endTime) { - this.endTime = endTime; - } - - public String getDate() { - return date; - } - - public Lesson setDate(String date) { - this.date = date; - return this; - } - - public boolean isEmpty() { - return isEmpty; - } - - public Lesson setEmpty(boolean empty) { - isEmpty = empty; - return this; - } - - public boolean isDivisionIntoGroups() { - return isDivisionIntoGroups; - } - - public void setDivisionIntoGroups(boolean divisionIntoGroups) { - isDivisionIntoGroups = divisionIntoGroups; - } - - public boolean isPlanning() { - return isPlanning; - } - - public void setPlanning(boolean planning) { - isPlanning = planning; - } - - public boolean isRealized() { - return isRealized; - } - - public void setRealized(boolean realized) { - isRealized = realized; - } - - public boolean isMovedOrCanceled() { - return isMovedOrCanceled; - } - - public void setMovedOrCanceled(boolean movedOrCanceled) { - isMovedOrCanceled = movedOrCanceled; - } - - public boolean isNewMovedInOrChanged() { - return isNewMovedInOrChanged; - } - - public void setNewMovedInOrChanged(boolean newMovedInOrChanged) { - isNewMovedInOrChanged = newMovedInOrChanged; - } - - public boolean isNotExist() { - return isNotExist; - } - - public void setNotExist(boolean notExist) { - isNotExist = notExist; - } - - public boolean isPresence() { - return isPresence; - } - - public void setPresence(boolean presence) { - isPresence = presence; - } - - public boolean isAbsenceUnexcused() { - return isAbsenceUnexcused; - } - - public void setAbsenceUnexcused(boolean absenceUnexcused) { - isAbsenceUnexcused = absenceUnexcused; - } - - public boolean isAbsenceExcused() { - return isAbsenceExcused; - } - - public void setAbsenceExcused(boolean absenceExcused) { - isAbsenceExcused = absenceExcused; - } - - public boolean isUnexcusedLateness() { - return isUnexcusedLateness; - } - - public void setUnexcusedLateness(boolean unexcusedLateness) { - isUnexcusedLateness = unexcusedLateness; - } - - public boolean isAbsenceForSchoolReasons() { - return isAbsenceForSchoolReasons; - } - - public void setAbsenceForSchoolReasons(boolean absenceForSchoolReasons) { - isAbsenceForSchoolReasons = absenceForSchoolReasons; - } - - public boolean isExcusedLateness() { - return isExcusedLateness; - } - - public void setExcusedLateness(boolean excusedLateness) { - isExcusedLateness = excusedLateness; - } - - public boolean isExemption() { - return isExemption; - } - - public void setExemption(boolean exemption) { - isExemption = exemption; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/generic/Month.java b/api/src/main/java/io/github/wulkanowy/api/generic/Month.java deleted file mode 100644 index e38ef3a3..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/generic/Month.java +++ /dev/null @@ -1,26 +0,0 @@ -package io.github.wulkanowy.api.generic; - -public class Month { - - private String name = ""; - - private int value = 0; - - public String getName() { - return name; - } - - public Month setName(String name) { - this.name = name; - return this; - } - - public int getValue() { - return value; - } - - public Month setValue(int value) { - this.value = value; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/generic/Subject.java b/api/src/main/java/io/github/wulkanowy/api/generic/Subject.java deleted file mode 100644 index fcf27bef..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/generic/Subject.java +++ /dev/null @@ -1,26 +0,0 @@ -package io.github.wulkanowy.api.generic; - -public class Subject { - - private int id = -1; - - private String name = ""; - - public int getId() { - return id; - } - - public Subject setId(int id) { - this.id = id; - return this; - } - - public String getName() { - return name; - } - - public Subject setName(String name) { - this.name = name; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/generic/Week.java b/api/src/main/java/io/github/wulkanowy/api/generic/Week.java deleted file mode 100644 index 1e46f394..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/generic/Week.java +++ /dev/null @@ -1,33 +0,0 @@ -package io.github.wulkanowy.api.generic; - -import java.util.ArrayList; -import java.util.List; - -public class Week { - - private List days = new ArrayList<>(); - - private String startDayDate = ""; - - public T getDay(int index) { - return days.get(index); - } - - public List getDays() { - return days; - } - - public Week setDays(List days) { - this.days = days; - return this; - } - - public String getStartDayDate() { - return startDayDate; - } - - public Week setStartDayDate(String startDayDate) { - this.startDayDate = startDayDate; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/grades/Grade.java b/api/src/main/java/io/github/wulkanowy/api/grades/Grade.java deleted file mode 100644 index 564b3e47..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/grades/Grade.java +++ /dev/null @@ -1,112 +0,0 @@ -package io.github.wulkanowy.api.grades; - -public class Grade { - - protected String value = ""; - - private String subject = ""; - - private String color = ""; - - private String symbol = ""; - - private String description = ""; - - private String weight = ""; - - private String date = ""; - - private String teacher = ""; - - private String semester = ""; - - public String getSubject() { - return subject; - } - - public Grade setSubject(String subject) { - this.subject = subject; - - return this; - } - - public String getValue() { - return value; - } - - public Grade setValue(String value) { - this.value = value; - - return this; - } - - public String getColor() { - return color; - } - - public Grade setColor(String color) { - this.color = color; - - return this; - } - - public String getSymbol() { - return symbol; - } - - public Grade setSymbol(String symbol) { - this.symbol = symbol; - - return this; - } - - public String getDescription() { - return description; - } - - public Grade setDescription(String description) { - this.description = description; - - return this; - } - - public String getWeight() { - return weight; - } - - public Grade setWeight(String weight) { - this.weight = weight; - - return this; - } - - public String getDate() { - return date; - } - - public Grade setDate(String date) { - this.date = date; - - return this; - } - - public String getTeacher() { - return teacher; - } - - public Grade setTeacher(String teacher) { - this.teacher = teacher; - - return this; - } - - public String getSemester() { - return semester; - } - - public Grade setSemester(String semester) { - this.semester = semester; - - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/grades/GradesList.java b/api/src/main/java/io/github/wulkanowy/api/grades/GradesList.java deleted file mode 100644 index 44c45c9a..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/grades/GradesList.java +++ /dev/null @@ -1,82 +0,0 @@ -package io.github.wulkanowy.api.grades; - -import org.jsoup.nodes.Document; -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.text.ParseException; -import java.text.SimpleDateFormat; -import java.util.ArrayList; -import java.util.Date; -import java.util.List; -import java.util.Locale; -import java.util.regex.Matcher; -import java.util.regex.Pattern; - -import io.github.wulkanowy.api.Semester; -import io.github.wulkanowy.api.SnP; - -public class GradesList { - - private static final String GRADES_PAGE_URL = "Oceny/Wszystkie?details=2&okres="; - - private SnP snp = null; - - private List grades = new ArrayList<>(); - - public GradesList(SnP snp) { - this.snp = snp; - } - - private String getGradesPageUrl() { - return GRADES_PAGE_URL; - } - - public List getAll() throws IOException, ParseException { - return getAll(""); - } - - public List getAll(String semester) throws IOException, ParseException { - Document gradesPage = snp.getSnPPageDocument(getGradesPageUrl() + semester); - Elements gradesRows = gradesPage.select(".ocenySzczegoly-table > tbody > tr"); - Semester currentSemester = snp.getCurrentSemester(snp.getSemesters(gradesPage)); - - for (Element row : gradesRows) { - if ("Brak ocen".equals(row.select("td:nth-child(2)").text())) { - continue; - } - - String descriptions = row.select("td:nth-child(3)").text(); - String symbol = descriptions.split(", ")[0]; - String description = descriptions.replaceFirst(symbol, "").replaceFirst(", ", ""); - - Pattern pattern = Pattern.compile("#([A-Fa-f0-9]{6}|[A-Fa-f0-9]{3})"); - Matcher matcher = pattern.matcher(row.select("td:nth-child(2) span.ocenaCzastkowa") - .attr("style")); - - String color = ""; - while (matcher.find()) { - color = matcher.group(1); - } - - SimpleDateFormat sdf = new SimpleDateFormat("dd.MM.yyyy", Locale.ROOT); - Date d = sdf.parse(row.select("td:nth-child(5)").text()); - sdf.applyPattern("yyyy-MM-dd"); - - grades.add(new Grade() - .setSubject(row.select("td:nth-child(1)").text()) - .setValue(row.select("td:nth-child(2)").text()) - .setColor(color) - .setSymbol(symbol) - .setDescription(description) - .setWeight(row.select("td:nth-child(4)").text()) - .setDate(sdf.format(d)) - .setTeacher(row.select("td:nth-child(6)").text()) - .setSemester(currentSemester.getNumber()) - ); - } - - return grades; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/grades/Subject.java b/api/src/main/java/io/github/wulkanowy/api/grades/Subject.java deleted file mode 100644 index c7917810..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/grades/Subject.java +++ /dev/null @@ -1,40 +0,0 @@ -package io.github.wulkanowy.api.grades; - -public class Subject { - - private String name; - - private String predictedRating; - - private String finalRating; - - public String getName() { - return name; - } - - public Subject setName(String name) { - this.name = name; - - return this; - } - - public String getPredictedRating() { - return predictedRating; - } - - public Subject setPredictedRating(String predictedRating) { - this.predictedRating = predictedRating; - - return this; - } - - public String getFinalRating() { - return finalRating; - } - - public Subject setFinalRating(String finalRating) { - this.finalRating = finalRating; - - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/grades/SubjectsList.java b/api/src/main/java/io/github/wulkanowy/api/grades/SubjectsList.java deleted file mode 100644 index decf4468..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/grades/SubjectsList.java +++ /dev/null @@ -1,40 +0,0 @@ -package io.github.wulkanowy.api.grades; - -import org.jsoup.nodes.Document; -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.SnP; - -public class SubjectsList { - - private static final String SUBJECTS_PAGE_URL = "Oceny/Wszystkie?details=1"; - - private SnP snp = null; - - public SubjectsList(SnP snp) { - this.snp = snp; - } - - public List getAll() throws IOException { - Document subjectPage = snp.getSnPPageDocument(SUBJECTS_PAGE_URL); - - Elements rows = subjectPage.select(".ocenyZwykle-table > tbody > tr"); - - List subjects = new ArrayList<>(); - - for (Element subjectRow : rows) { - subjects.add(new Subject() - .setName(subjectRow.select("td:nth-child(1)").text()) - .setPredictedRating(subjectRow.select("td:nth-last-child(2)").text()) - .setFinalRating(subjectRow.select("td:nth-last-child(1)").text()) - ); - } - - return subjects; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/login/AccountPermissionException.java b/api/src/main/java/io/github/wulkanowy/api/login/AccountPermissionException.java deleted file mode 100644 index 15be359c..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/login/AccountPermissionException.java +++ /dev/null @@ -1,4 +0,0 @@ -package io.github.wulkanowy.api.login; - -public class AccountPermissionException extends Exception { -} diff --git a/api/src/main/java/io/github/wulkanowy/api/login/BadCredentialsException.java b/api/src/main/java/io/github/wulkanowy/api/login/BadCredentialsException.java deleted file mode 100644 index 4502bb15..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/login/BadCredentialsException.java +++ /dev/null @@ -1,4 +0,0 @@ -package io.github.wulkanowy.api.login; - -public class BadCredentialsException extends Exception { -} diff --git a/api/src/main/java/io/github/wulkanowy/api/login/Login.java b/api/src/main/java/io/github/wulkanowy/api/login/Login.java deleted file mode 100644 index e680804a..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/login/Login.java +++ /dev/null @@ -1,97 +0,0 @@ -package io.github.wulkanowy.api.login; - -import org.jsoup.Jsoup; -import org.jsoup.nodes.Document; -import org.jsoup.parser.Parser; -import org.jsoup.select.Elements; - -import java.io.IOException; - -import io.github.wulkanowy.api.Client; - -public class Login { - - private static final String LOGIN_PAGE_URL = "{schema}://cufs.{host}/{symbol}/Account/LogOn" + - "?ReturnUrl=%2F{symbol}%2FFS%2FLS%3Fwa%3Dwsignin1.0%26wtrealm%3D" + - "{schema}%253a%252f%252fuonetplus.{host}%252f{symbol}%252fLoginEndpoint.aspx%26wctx%3D" + - "{schema}%253a%252f%252fuonetplus.{host}%252f{symbol}%252fLoginEndpoint.aspx"; - - private static final String LOGIN_ENDPOINT_PAGE_URL = - "{schema}://uonetplus.{host}/{symbol}/LoginEndpoint.aspx"; - - private Client client; - - private String symbol; - - public Login(Client client) { - this.client = client; - } - - public String login(String email, String password, String symbol) - throws BadCredentialsException, LoginErrorException, - AccountPermissionException, IOException, VulcanOfflineException { - String certificate = sendCredentials(email, password, symbol); - - return sendCertificate(certificate, symbol); - } - - String sendCredentials(String email, String password, String symbol) - throws IOException, BadCredentialsException { - this.symbol = symbol; - - Document html = client.postPageByUrl(LOGIN_PAGE_URL, new String[][]{ - {"LoginName", email}, - {"Password", password} - }); - - if (null != html.select(".ErrorMessage").first()) { - throw new BadCredentialsException(); - } - - return html.select("input[name=wresult]").attr("value"); - } - - String sendCertificate(String certificate, String defaultSymbol) - throws IOException, LoginErrorException, AccountPermissionException, VulcanOfflineException { - this.symbol = findSymbol(defaultSymbol, certificate); - client.setSymbol(this.symbol); - - Document html = client.postPageByUrl(LOGIN_ENDPOINT_PAGE_URL, new String[][]{ - {"wa", "wsignin1.0"}, - {"wresult", certificate} - }); - - if (html.getElementsByTag("title").text().equals("Logowanie")) { - throw new AccountPermissionException(); - } - - if (html.getElementsByTag("title").text().equals("Przerwa techniczna")) { - throw new VulcanOfflineException(); - } - - if (!html.select("title").text().equals("Uonet+")) { - throw new LoginErrorException(); - } - - return this.symbol; - } - - private String findSymbol(String symbol, String certificate) { - if ("Default".equals(symbol)) { - return findSymbolInCertificate(certificate); - } - - return symbol; - } - - String findSymbolInCertificate(String certificate) { - Elements els = Jsoup.parse(certificate.replaceAll(":", ""), "", Parser.xmlParser()) - .select("[AttributeName=\"UserInstance\"] samlAttributeValue"); - - if (els.isEmpty()) { - return ""; - } - - return els.get(1).text(); - } -} \ No newline at end of file diff --git a/api/src/main/java/io/github/wulkanowy/api/login/LoginErrorException.java b/api/src/main/java/io/github/wulkanowy/api/login/LoginErrorException.java deleted file mode 100644 index eec2b4e4..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/login/LoginErrorException.java +++ /dev/null @@ -1,4 +0,0 @@ -package io.github.wulkanowy.api.login; - -public class LoginErrorException extends NotLoggedInErrorException { -} diff --git a/api/src/main/java/io/github/wulkanowy/api/login/NotLoggedInErrorException.java b/api/src/main/java/io/github/wulkanowy/api/login/NotLoggedInErrorException.java deleted file mode 100644 index d33b892d..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/login/NotLoggedInErrorException.java +++ /dev/null @@ -1,4 +0,0 @@ -package io.github.wulkanowy.api.login; - -public class NotLoggedInErrorException extends Exception { -} diff --git a/api/src/main/java/io/github/wulkanowy/api/login/VulcanOfflineException.java b/api/src/main/java/io/github/wulkanowy/api/login/VulcanOfflineException.java deleted file mode 100644 index 45cf6458..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/login/VulcanOfflineException.java +++ /dev/null @@ -1,4 +0,0 @@ -package io.github.wulkanowy.api.login; - -public class VulcanOfflineException extends Exception { -} diff --git a/api/src/main/java/io/github/wulkanowy/api/messages/BadRequestException.java b/api/src/main/java/io/github/wulkanowy/api/messages/BadRequestException.java deleted file mode 100644 index 90af17ce..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/messages/BadRequestException.java +++ /dev/null @@ -1,4 +0,0 @@ -package io.github.wulkanowy.api.messages; - -class BadRequestException extends Exception { -} diff --git a/api/src/main/java/io/github/wulkanowy/api/messages/Message.java b/api/src/main/java/io/github/wulkanowy/api/messages/Message.java deleted file mode 100644 index 331ec819..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/messages/Message.java +++ /dev/null @@ -1,30 +0,0 @@ -package io.github.wulkanowy.api.messages; - -import com.google.gson.annotations.SerializedName; - -public class Message { - - @SerializedName("Nieprzeczytana") - public boolean unread; - - @SerializedName("Data") - public String date; - - @SerializedName("Tresc") - public String content; - - @SerializedName("Temat") - public String subject; - - @SerializedName("NadawcaNazwa") - public String sender; - - @SerializedName("IdWiadomosci") - public int messageID; - - @SerializedName("IdNadawca") - public int senderID; - - @SerializedName("Id") - public int id; -} diff --git a/api/src/main/java/io/github/wulkanowy/api/messages/Messages.java b/api/src/main/java/io/github/wulkanowy/api/messages/Messages.java deleted file mode 100644 index 4eb969cd..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/messages/Messages.java +++ /dev/null @@ -1,98 +0,0 @@ -package io.github.wulkanowy.api.messages; - -import com.google.gson.Gson; -import com.google.gson.JsonParseException; - -import java.io.IOException; -import java.util.List; - -import io.github.wulkanowy.api.Client; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; - -public class Messages { - - private static final String BASE_URL = "{schema}://uonetplus-uzytkownik.{host}/{symbol}/"; - - private static final String LIST_BASE_URL = BASE_URL + "Wiadomosc.mvc/"; - - private static final String RECEIVED_URL = LIST_BASE_URL + "GetWiadomosciOdebrane"; - - private static final String SENT_URL = LIST_BASE_URL + "GetWiadomosciWyslane"; - - private static final String DELETED_URL = LIST_BASE_URL + "GetWiadomosciUsuniete"; - - private static final String MESSAGE_URL = LIST_BASE_URL + "GetTrescWiadomosci"; - - public static final int RECEIVED_FOLDER = 1; - - public static final int SENT_FOLDER = 2; - - public static final int DELETED_FOLDER = 3; - - private static final String ERROR_TITLE = "Błąd strony"; - - private Client client; - - public Messages(Client client) { - this.client = client; - } - - public List getReceived() throws IOException, NotLoggedInErrorException, BadRequestException { - return getMessages(RECEIVED_URL); - } - - public List getSent() throws IOException, NotLoggedInErrorException, BadRequestException { - return getMessages(SENT_URL); - } - - public List getDeleted() throws IOException, NotLoggedInErrorException, BadRequestException { - return getMessages(DELETED_URL); - } - - private List getMessages(String url) throws IOException, NotLoggedInErrorException, BadRequestException { - String res = client.getJsonStringByUrl(url); - - List messages; - - try { - messages = new Gson().fromJson(res, MessagesContainer.class).data; - } catch (JsonParseException e) { - if (res.contains(ERROR_TITLE)) { - throw new BadRequestException(); - } - - throw new NotLoggedInErrorException(); - } - - return messages; - } - - public Message getMessage(int id, int folder) throws IOException, BadRequestException, NotLoggedInErrorException { - String res = client.postJsonStringByUrl(MESSAGE_URL, new String[][]{ - {"idWiadomosc", String.valueOf(id)}, - {"Folder", String.valueOf(folder)} - }); - - Message message; - - try { - message = new Gson().fromJson(res, MessageContainer.class).data; - } catch (JsonParseException e) { - if (res.contains(ERROR_TITLE)) { - throw new BadRequestException(); - } - - throw new NotLoggedInErrorException(); - } - - return message; - } - - private static class MessagesContainer { - private List data; - } - - private static class MessageContainer { - private Message data; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/notes/AchievementsList.java b/api/src/main/java/io/github/wulkanowy/api/notes/AchievementsList.java deleted file mode 100644 index c821e8be..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/notes/AchievementsList.java +++ /dev/null @@ -1,35 +0,0 @@ -package io.github.wulkanowy.api.notes; - -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.SnP; - -public class AchievementsList { - - private static final String NOTES_PAGE_URL = "UwagiOsiagniecia.mvc/Wszystkie"; - - private SnP snp = null; - - private List achievements = new ArrayList<>(); - - public AchievementsList(SnP snp) { - this.snp = snp; - } - - public List getAllAchievements() throws IOException { - Element pageFragment = snp.getSnPPageDocument(NOTES_PAGE_URL) - .select(".mainContainer > div").get(1); - Elements items = pageFragment.select("article"); - - for (Element item : items) { - achievements.add(item.text()); - } - - return achievements; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/notes/Note.java b/api/src/main/java/io/github/wulkanowy/api/notes/Note.java deleted file mode 100644 index b1fa68b9..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/notes/Note.java +++ /dev/null @@ -1,48 +0,0 @@ -package io.github.wulkanowy.api.notes; - -public class Note { - - private String date; - - private String teacher; - - private String category; - - private String content; - - public String getDate() { - return date; - } - - public Note setDate(String date) { - this.date = date; - return this; - } - - public String getTeacher() { - return teacher; - } - - public Note setTeacher(String teacher) { - this.teacher = teacher; - return this; - } - - public String getCategory() { - return category; - } - - public Note setCategory(String category) { - this.category = category; - return this; - } - - public String getContent() { - return content; - } - - public Note setContent(String content) { - this.content = content; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/notes/NotesList.java b/api/src/main/java/io/github/wulkanowy/api/notes/NotesList.java deleted file mode 100644 index 34b8540d..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/notes/NotesList.java +++ /dev/null @@ -1,42 +0,0 @@ -package io.github.wulkanowy.api.notes; - -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.SnP; - -public class NotesList { - - private static final String NOTES_PAGE_URL = "UwagiOsiagniecia.mvc/Wszystkie"; - - private SnP snp = null; - - private List notes = new ArrayList<>(); - - public NotesList(SnP snp) { - this.snp = snp; - } - - public List getAllNotes() throws IOException { - Element pageFragment = snp.getSnPPageDocument(NOTES_PAGE_URL) - .select(".mainContainer > div").get(0); - Elements items = pageFragment.select("article"); - Elements dates = pageFragment.select("h2"); - - int index = 0; - for (Element item : items) { - notes.add(new Note() - .setDate(dates.get(index++).text()) - .setTeacher(snp.getRowDataChildValue(item, 1)) - .setCategory(snp.getRowDataChildValue(item, 2)) - .setContent(snp.getRowDataChildValue(item, 3)) - ); - } - - return notes; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/school/SchoolData.java b/api/src/main/java/io/github/wulkanowy/api/school/SchoolData.java deleted file mode 100644 index f135163a..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/school/SchoolData.java +++ /dev/null @@ -1,59 +0,0 @@ -package io.github.wulkanowy.api.school; - -public class SchoolData { - - private String name = ""; - - private String address = ""; - - private String phoneNumber = ""; - - private String headmaster = ""; - - private String[] pedagogue; - - public String getName() { - return name; - } - - public SchoolData setName(String name) { - this.name = name; - return this; - } - - public String getAddress() { - return address; - } - - public SchoolData setAddress(String address) { - this.address = address; - return this; - } - - public String getPhoneNumber() { - return phoneNumber; - } - - public SchoolData setPhoneNumber(String phoneNumber) { - this.phoneNumber = phoneNumber; - return this; - } - - public String getHeadmaster() { - return headmaster; - } - - public SchoolData setHeadmaster(String headmaster) { - this.headmaster = headmaster; - return this; - } - - public String[] getPedagogues() { - return pedagogue; - } - - public SchoolData setPedagogue(String[] pedagogue) { - this.pedagogue = pedagogue; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/school/SchoolInfo.java b/api/src/main/java/io/github/wulkanowy/api/school/SchoolInfo.java deleted file mode 100644 index 4eeb641c..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/school/SchoolInfo.java +++ /dev/null @@ -1,30 +0,0 @@ -package io.github.wulkanowy.api.school; - -import org.jsoup.nodes.Element; - -import java.io.IOException; - -import io.github.wulkanowy.api.SnP; - -public class SchoolInfo { - - private static final String SCHOOL_PAGE_URL = "Szkola.mvc/Nauczyciele"; - - private SnP snp = null; - - public SchoolInfo(SnP snp) { - this.snp = snp; - } - - public SchoolData getSchoolData() throws IOException { - Element e = snp.getSnPPageDocument(SCHOOL_PAGE_URL) - .select(".mainContainer > article").get(0); - - return new SchoolData() - .setName(snp.getRowDataChildValue(e, 1)) - .setAddress(snp.getRowDataChildValue(e, 2)) - .setPhoneNumber(snp.getRowDataChildValue(e, 3)) - .setHeadmaster(snp.getRowDataChildValue(e, 4)) - .setPedagogue(snp.getRowDataChildValue(e, 5).split(", ")); - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/school/Subject.java b/api/src/main/java/io/github/wulkanowy/api/school/Subject.java deleted file mode 100644 index 0a3c0957..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/school/Subject.java +++ /dev/null @@ -1,26 +0,0 @@ -package io.github.wulkanowy.api.school; - -public class Subject { - - private String name = ""; - - private String[] teachers; - - public String getName() { - return name; - } - - public Subject setName(String name) { - this.name = name; - return this; - } - - public String[] getTeachers() { - return teachers; - } - - public Subject setTeachers(String[] teachers) { - this.teachers = teachers; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/school/TeachersData.java b/api/src/main/java/io/github/wulkanowy/api/school/TeachersData.java deleted file mode 100644 index 7d41162e..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/school/TeachersData.java +++ /dev/null @@ -1,39 +0,0 @@ -package io.github.wulkanowy.api.school; - -import java.util.List; - -public class TeachersData { - - private String className = ""; - - private String[] classTeacher; - - private List subjects; - - public String getClassName() { - return className; - } - - public TeachersData setClassName(String className) { - this.className = className; - return this; - } - - public String[] getClassTeacher() { - return classTeacher; - } - - public TeachersData setClassTeacher(String[] classTeacher) { - this.classTeacher = classTeacher; - return this; - } - - public List getSubjects() { - return subjects; - } - - public TeachersData setSubjects(List subjects) { - this.subjects = subjects; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/school/TeachersInfo.java b/api/src/main/java/io/github/wulkanowy/api/school/TeachersInfo.java deleted file mode 100644 index e8af6744..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/school/TeachersInfo.java +++ /dev/null @@ -1,42 +0,0 @@ -package io.github.wulkanowy.api.school; - -import org.jsoup.nodes.Document; -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.SnP; - -public class TeachersInfo { - - private static final String SCHOOL_PAGE_URL = "Szkola.mvc/Nauczyciele"; - - private SnP snp = null; - - public TeachersInfo(SnP snp) { - this.snp = snp; - } - - public TeachersData getTeachersData() throws IOException { - Document doc = snp.getSnPPageDocument(SCHOOL_PAGE_URL); - Elements rows = doc.select(".mainContainer > table tbody tr"); - String description = doc.select(".mainContainer > p").first().text(); - - List subjects = new ArrayList<>(); - - for (Element subject : rows) { - subjects.add(new Subject() - .setName(subject.select("td").get(1).text()) - .setTeachers(subject.select("td").get(2).text().split(", ")) - ); - } - - return new TeachersData() - .setClassName(description.split(", ")[0].split(": ")[1].trim()) - .setClassTeacher(description.split("Wychowawcy:")[1].trim().split(", ")) - .setSubjects(subjects); - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/timetable/LessonTypes.java b/api/src/main/java/io/github/wulkanowy/api/timetable/LessonTypes.java deleted file mode 100644 index be1f44e9..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/timetable/LessonTypes.java +++ /dev/null @@ -1,16 +0,0 @@ -package io.github.wulkanowy.api.timetable; - -class LessonTypes { - - static final String CLASS_PLANNING = "x-treelabel-ppl"; - - static final String CLASS_REALIZED = "x-treelabel-rlz"; - - static final String CLASS_MOVED_OR_CANCELED = "x-treelabel-inv"; - - static final String CLASS_NEW_MOVED_IN_OR_CHANGED = "x-treelabel-zas"; - - private LessonTypes() { - throw new IllegalStateException("Utility class"); - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/timetable/Timetable.java b/api/src/main/java/io/github/wulkanowy/api/timetable/Timetable.java deleted file mode 100644 index 1d526494..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/timetable/Timetable.java +++ /dev/null @@ -1,215 +0,0 @@ -package io.github.wulkanowy.api.timetable; - -import org.apache.commons.lang3.StringUtils; -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.text.ParseException; -import java.text.SimpleDateFormat; -import java.util.ArrayList; -import java.util.Date; -import java.util.List; -import java.util.Locale; - -import io.github.wulkanowy.api.SnP; -import io.github.wulkanowy.api.generic.Day; -import io.github.wulkanowy.api.generic.Lesson; -import io.github.wulkanowy.api.generic.Week; - -public class Timetable { - - private static final String TIMETABLE_PAGE_URL = "Lekcja.mvc/PlanLekcji?data="; - - private SnP snp; - - public Timetable(SnP snp) { - this.snp = snp; - } - - public Week getWeekTable() throws IOException, ParseException { - return getWeekTable(""); - } - - public Week getWeekTable(final String tick) throws IOException, ParseException { - Element table = snp.getSnPPageDocument(TIMETABLE_PAGE_URL + tick) - .select(".mainContainer .presentData").first(); - - List days = getDays(table.select("thead th")); - - setLessonToDays(table, days); - - return new Week() - .setStartDayDate(days.get(0).getDate()) - .setDays(days); - } - - private List getDays(Elements tableHeaderCells) throws ParseException { - List days = new ArrayList<>(); - - for (int i = 2; i < 7; i++) { - String[] dayHeaderCell = tableHeaderCells.get(i).html().split("
"); - - SimpleDateFormat sdf = new SimpleDateFormat("dd.MM.yyyy", Locale.ROOT); - Date d = sdf.parse(dayHeaderCell[1].trim()); - sdf.applyPattern("yyyy-MM-dd"); - - Day day = new Day(); - day.setDayName(dayHeaderCell[0]); - day.setDate(sdf.format(d)); - - if (tableHeaderCells.get(i).hasClass("free-day")) { - day.setFreeDay(true); - day.setFreeDayName(dayHeaderCell[2]); - } - - days.add(day); - } - - return days; - } - - private void setLessonToDays(Element table, List days) { - for (Element row : table.select("tbody tr")) { - Elements hours = row.select("td"); - - // fill hours in day - for (int i = 2; i < hours.size(); i++) { - Lesson lesson = new Lesson(); - - String[] startEndEnd = hours.get(1).text().split(" "); - lesson.setStartTime(startEndEnd[0]); - lesson.setEndTime(startEndEnd[1]); - lesson.setDate(days.get(i - 2).getDate()); - lesson.setNumber(hours.get(0).text()); - - addLessonDetails(lesson, hours.get(i).select("div")); - - days.get(i - 2).setLesson(lesson); - } - } - } - - private void addLessonDetails(Lesson lesson, Elements e) { - moveWarningToLessonNode(e); - - switch (e.size()) { - case 1: - addLessonInfoFromElement(lesson, e.first()); - break; - case 2: - addLessonInfoFromElement(lesson, e.last()); - break; - case 3: - addLessonInfoFromElement(lesson, e.get(1)); - break; - default: - lesson.setEmpty(true); - break; - } - } - - private void moveWarningToLessonNode(Elements e) { - Elements warn = e.select(".uwaga-panel"); - - if (!warn.isEmpty()) { - e.select(".x-treelabel-rlz").last().text("(" + warn.text() + ")"); - e.remove(1); - } - } - - private void addLessonInfoFromElement(Lesson lesson, Element e) { - Elements spans = e.select("span"); - - addTypeInfo(lesson, spans); - addNormalLessonInfo(lesson, spans); - addChangesInfo(lesson, spans); - addGroupLessonInfo(lesson, spans); - } - - private void addTypeInfo(Lesson lesson, Elements spans) { - if (spans.first().hasClass(LessonTypes.CLASS_PLANNING)) { - lesson.setPlanning(true); - } - - if (spans.first().hasClass(LessonTypes.CLASS_MOVED_OR_CANCELED)) { - lesson.setMovedOrCanceled(true); - } - - if (spans.first().hasClass(LessonTypes.CLASS_NEW_MOVED_IN_OR_CHANGED)) { - lesson.setNewMovedInOrChanged(true); - } - - if (spans.last().hasClass(LessonTypes.CLASS_REALIZED) || "".equals(spans.first().attr("class"))) { - lesson.setRealized(true); - } - } - - private void addNormalLessonInfo(Lesson lesson, Elements spans) { - if (3 == spans.size()) { - lesson.setSubject(spans.get(0).text()); - lesson.setTeacher(spans.get(1).text()); - lesson.setRoom(spans.get(2).text()); - } - } - - private void addChangesInfo(Lesson lesson, Elements spans) { - if (!spans.last().hasClass(LessonTypes.CLASS_REALIZED)) { - return; - } - - if (7 == spans.size()) { - lesson.setSubject(spans.get(3).text()); - lesson.setTeacher(spans.get(4).text()); - lesson.setRoom(spans.get(5).text()); - lesson.setMovedOrCanceled(false); - lesson.setNewMovedInOrChanged(true); - lesson.setDescription(StringUtils.substringBetween(spans.last().text(), "(", ")") - + " (poprzednio: " + spans.get(0).text() + ")"); - } else if (9 == spans.size()) { - String[] subjectAndGroupInfo = getLessonAndGroupInfoFromSpan(spans.get(4)); - lesson.setSubject(subjectAndGroupInfo[0]); - lesson.setGroupName(subjectAndGroupInfo[1]); - lesson.setTeacher(spans.get(6).text()); - lesson.setRoom(spans.get(7).text()); - lesson.setMovedOrCanceled(false); - lesson.setNewMovedInOrChanged(true); - lesson.setDivisionIntoGroups(true); - lesson.setDescription(StringUtils.substringBetween(spans.last().text(), "(", ")") - + " (poprzednio: " + getLessonAndGroupInfoFromSpan(spans.get(0))[0] + ")"); - } else if (4 <= spans.size()) { - lesson.setSubject(spans.get(0).text()); - lesson.setTeacher(spans.get(1).text()); - lesson.setRoom(spans.get(2).text()); - lesson.setDescription(StringUtils.substringBetween(spans.last().text(), "(", ")")); - } - } - - private void addGroupLessonInfo(Lesson lesson, Elements spans) { - if (4 == spans.size() && !spans.last().hasClass(LessonTypes.CLASS_REALIZED)) { - lesson.setRoom(spans.last().text()); - } - - if ((4 == spans.size() && !spans.last().hasClass(LessonTypes.CLASS_REALIZED) || 5 == spans.size())) { - String[] subjectAndGroupInfo = getLessonAndGroupInfoFromSpan(spans.get(0)); - lesson.setSubject(subjectAndGroupInfo[0]); - lesson.setGroupName(subjectAndGroupInfo[1]); - lesson.setTeacher(spans.get(2).text()); - lesson.setDivisionIntoGroups(true); - } - - if (5 == spans.size()) { - lesson.setRoom(spans.get(3).text()); - } - } - - private String[] getLessonAndGroupInfoFromSpan(Element span) { - String[] subjectNameArray = span.text().split(" "); - String groupName = subjectNameArray[subjectNameArray.length - 1]; - - return new String[]{ - span.text().replace(" " + groupName, ""), - StringUtils.substringBetween(groupName, "[", "]") - }; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/user/AddressData.java b/api/src/main/java/io/github/wulkanowy/api/user/AddressData.java deleted file mode 100644 index 3d6fc6d5..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/user/AddressData.java +++ /dev/null @@ -1,40 +0,0 @@ -package io.github.wulkanowy.api.user; - -public class AddressData { - - private String address = ""; - - private String registeredAddress = ""; - - private String correspondenceAddress = ""; - - public String getAddress() { - return address; - } - - public AddressData setAddress(String address) { - this.address = address; - - return this; - } - - public String getRegisteredAddress() { - return registeredAddress; - } - - public AddressData setRegisteredAddress(String registeredAddress) { - this.registeredAddress = registeredAddress; - - return this; - } - - public String getCorrespondenceAddress() { - return correspondenceAddress; - } - - public AddressData setCorrespondenceAddress(String correspondenceAddress) { - this.correspondenceAddress = correspondenceAddress; - - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/user/BasicInformation.java b/api/src/main/java/io/github/wulkanowy/api/user/BasicInformation.java deleted file mode 100644 index 875cc8da..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/user/BasicInformation.java +++ /dev/null @@ -1,69 +0,0 @@ -package io.github.wulkanowy.api.user; - -import org.jsoup.nodes.Document; -import org.jsoup.nodes.Element; - -import java.io.IOException; - -import io.github.wulkanowy.api.SnP; - -public class BasicInformation { - - private static final String STUDENT_DATA_PAGE_URL = "Uczen.mvc/DanePodstawowe"; - - private static final String CONTENT_QUERY = ".mainContainer > article"; - - private Document studentDataPageDocument; - - private SnP snp; - - public BasicInformation(SnP snp) { - this.snp = snp; - } - - public Document getStudentDataPageDocument() throws IOException { - if (null == studentDataPageDocument) { - studentDataPageDocument = snp.getSnPPageDocument(STUDENT_DATA_PAGE_URL); - } - - return studentDataPageDocument; - } - - public PersonalData getPersonalData() throws IOException { - Element e = getStudentDataPageDocument().select(CONTENT_QUERY).get(0); - - String name = snp.getRowDataChildValue(e, 1); - String[] names = name.split(" "); - - return new PersonalData() - .setName(name) - .setFirstName(names[0]) - .setSurname(names[names.length - 1]) - .setFirstAndLastName(names[0] + " " + names[names.length - 1]) - .setDateAndBirthPlace(snp.getRowDataChildValue(e, 2)) - .setPesel(snp.getRowDataChildValue(e, 3)) - .setGender(snp.getRowDataChildValue(e, 4)) - .setPolishCitizenship("Tak".equals(snp.getRowDataChildValue(e, 5))) - .setFamilyName(snp.getRowDataChildValue(e, 6)) - .setParentsNames(snp.getRowDataChildValue(e, 7)); - } - - public AddressData getAddressData() throws IOException { - Element e = getStudentDataPageDocument().select(CONTENT_QUERY).get(1); - - return new AddressData() - .setAddress(snp.getRowDataChildValue(e, 1)) - .setRegisteredAddress(snp.getRowDataChildValue(e, 2)) - .setCorrespondenceAddress(snp.getRowDataChildValue(e, 3)); - - } - - public ContactDetails getContactDetails() throws IOException { - Element e = getStudentDataPageDocument().select(CONTENT_QUERY).get(2); - - return new ContactDetails() - .setPhoneNumber(snp.getRowDataChildValue(e, 1)) - .setCellPhoneNumber(snp.getRowDataChildValue(e, 2)) - .setEmail(snp.getRowDataChildValue(e, 3)); - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/user/ContactDetails.java b/api/src/main/java/io/github/wulkanowy/api/user/ContactDetails.java deleted file mode 100644 index c8556944..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/user/ContactDetails.java +++ /dev/null @@ -1,37 +0,0 @@ -package io.github.wulkanowy.api.user; - -public class ContactDetails { - - private String phoneNumber = ""; - - private String cellPhoneNumber = ""; - - private String email = ""; - - public String getPhoneNumber() { - return phoneNumber; - } - - public ContactDetails setPhoneNumber(String phoneNumber) { - this.phoneNumber = phoneNumber; - return this; - } - - public String getCellPhoneNumber() { - return cellPhoneNumber; - } - - public ContactDetails setCellPhoneNumber(String cellPhoneNumber) { - this.cellPhoneNumber = cellPhoneNumber; - return this; - } - - public String getEmail() { - return email; - } - - public ContactDetails setEmail(String email) { - this.email = email; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/user/FamilyInformation.java b/api/src/main/java/io/github/wulkanowy/api/user/FamilyInformation.java deleted file mode 100644 index 555de866..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/user/FamilyInformation.java +++ /dev/null @@ -1,40 +0,0 @@ -package io.github.wulkanowy.api.user; - -import org.jsoup.nodes.Element; -import org.jsoup.select.Elements; - -import java.io.IOException; -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.SnP; - -public class FamilyInformation { - - private static final String STUDENT_DATA_PAGE_URL = "Uczen.mvc/DanePodstawowe"; - - private SnP snp; - - public FamilyInformation(SnP snp) { - this.snp = snp; - } - - public List getFamilyMembers() throws IOException { - Elements membersElements = snp.getSnPPageDocument(STUDENT_DATA_PAGE_URL) - .select(".mainContainer > article:nth-of-type(n+4)"); - - List familyMembers = new ArrayList<>(); - - for (Element e : membersElements) { - familyMembers.add(new FamilyMember() - .setName(snp.getRowDataChildValue(e, 1)) - .setKinship(snp.getRowDataChildValue(e, 2)) - .setAddress(snp.getRowDataChildValue(e, 3)) - .setTelephones(snp.getRowDataChildValue(e, 4)) - .setEmail(snp.getRowDataChildValue(e, 5)) - ); - } - - return familyMembers; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/user/FamilyMember.java b/api/src/main/java/io/github/wulkanowy/api/user/FamilyMember.java deleted file mode 100644 index dfb96674..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/user/FamilyMember.java +++ /dev/null @@ -1,59 +0,0 @@ -package io.github.wulkanowy.api.user; - -public class FamilyMember { - - private String name = ""; - - private String kinship = ""; - - private String address = ""; - - private String telephones = ""; - - private String email = ""; - - public String getName() { - return name; - } - - public FamilyMember setName(String name) { - this.name = name; - return this; - } - - public String getKinship() { - return kinship; - } - - public FamilyMember setKinship(String kinship) { - this.kinship = kinship; - return this; - } - - public String getAddress() { - return address; - } - - public FamilyMember setAddress(String address) { - this.address = address; - return this; - } - - public String getTelephones() { - return telephones; - } - - public FamilyMember setTelephones(String telephones) { - this.telephones = telephones; - return this; - } - - public String getEmail() { - return email; - } - - public FamilyMember setEmail(String email) { - this.email = email; - return this; - } -} diff --git a/api/src/main/java/io/github/wulkanowy/api/user/PersonalData.java b/api/src/main/java/io/github/wulkanowy/api/user/PersonalData.java deleted file mode 100644 index d2991e61..00000000 --- a/api/src/main/java/io/github/wulkanowy/api/user/PersonalData.java +++ /dev/null @@ -1,114 +0,0 @@ -package io.github.wulkanowy.api.user; - -public class PersonalData { - - private String name = ""; - - private String firstName = ""; - - private String surname = ""; - - private String firstAndLastName = ""; - - private String dateAndBirthPlace = ""; - - private String pesel = ""; - - private String gender = ""; - - private boolean isPolishCitizenship; - - private String familyName = ""; - - private String parentsNames = ""; - - public String getName() { - return name; - } - - public PersonalData setName(String name) { - this.name = name; - return this; - } - - public String getFirstName() { - return firstName; - } - - public PersonalData setFirstName(String firstName) { - this.firstName = firstName; - return this; - } - - public String getSurname() { - return surname; - } - - public PersonalData setSurname(String surname) { - this.surname = surname; - return this; - } - - public String getFirstAndLastName() { - return firstAndLastName; - } - - public PersonalData setFirstAndLastName(String firstAndLastName) { - this.firstAndLastName = firstAndLastName; - return this; - } - - public String getDateAndBirthPlace() { - return dateAndBirthPlace; - } - - public PersonalData setDateAndBirthPlace(String dateAndBirthPlace) { - this.dateAndBirthPlace = dateAndBirthPlace; - return this; - } - - public String getPesel() { - return pesel; - } - - public PersonalData setPesel(String pesel) { - this.pesel = pesel; - return this; - } - - public String getGender() { - return gender; - } - - public PersonalData setGender(String gender) { - this.gender = gender; - return this; - } - - public boolean isPolishCitizenship() { - return isPolishCitizenship; - } - - public PersonalData setPolishCitizenship(boolean polishCitizenship) { - isPolishCitizenship = polishCitizenship; - return this; - } - - public String getFamilyName() { - return familyName; - } - - public PersonalData setFamilyName(String familyName) { - this.familyName = familyName; - return this; - } - - public String getParentsNames() { - return parentsNames; - } - - public PersonalData setParentsNames(String parentsNames) { - this.parentsNames = parentsNames; - return this; - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/FixtureHelper.java b/api/src/test/java/io/github/wulkanowy/api/FixtureHelper.java deleted file mode 100644 index 94dd47b8..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/FixtureHelper.java +++ /dev/null @@ -1,12 +0,0 @@ -package io.github.wulkanowy.api; - -import java.io.InputStream; -import java.util.Scanner; - -public class FixtureHelper { - - public static String getAsString(InputStream inputStream) { - Scanner s = new Scanner(inputStream).useDelimiter("\\A"); - return s.hasNext() ? s.next() : ""; - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/StudentAndParentTest.java b/api/src/test/java/io/github/wulkanowy/api/StudentAndParentTest.java deleted file mode 100644 index 89a5b190..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/StudentAndParentTest.java +++ /dev/null @@ -1,125 +0,0 @@ -package io.github.wulkanowy.api; - -import org.jsoup.Jsoup; -import org.jsoup.nodes.Document; -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; -import org.mockito.Mockito; - -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.api.login.NotLoggedInErrorException; - -public class StudentAndParentTest { - - private Client client; - - @Before - public void setUp() throws Exception { - String input = FixtureHelper.getAsString( - getClass().getResourceAsStream("OcenyWszystkie-semester.html")); - Document gradesPageDocument = Jsoup.parse(input); - - client = Mockito.mock(Client.class); - Mockito.when(client.getPageByUrl(Mockito.anyString())).thenReturn(gradesPageDocument); - } - - @Test - public void snpTest() throws Exception { - StudentAndParent snp = new StudentAndParent(client, "id123"); - Assert.assertEquals("id123", snp.getId()); - } - - @Test - public void getSnpPageUrlWithIdTest() throws Exception { - Assert.assertEquals("{schema}://uonetplus-opiekun.{host}/{symbol}/123456/", - (new StudentAndParent(client, "123456")).getSnpHomePageUrl()); - } - - @Test - public void getSnpPageUrlWithoutIdTest() throws Exception { - String input = FixtureHelper.getAsString(getClass().getResourceAsStream("Start.html")); - Document startPageDocument = Jsoup.parse(input); - - Mockito.when(client.getHost()).thenReturn("vulcan.net.pl"); - Mockito.when(client.getPageByUrl(Mockito.anyString())).thenReturn(startPageDocument); - StudentAndParent snp = new StudentAndParent(client); - - Assert.assertEquals("https://uonetplus-opiekun.vulcan.net.pl/symbol/534213/Start/Index/", - snp.getSnpHomePageUrl()); - } - - @Test(expected = NotLoggedInErrorException.class) - public void getSnpPageUrlWithWrongPage() throws Exception { - Document wrongPageDocument = Jsoup.parse( - FixtureHelper.getAsString(getClass().getResourceAsStream("OcenyWszystkie-semester.html")) - ); - - Mockito.when(client.getPageByUrl(Mockito.anyString())).thenReturn(wrongPageDocument); - StudentAndParent snp = new StudentAndParent(client); - - snp.getSnpHomePageUrl(); - } - - @Test - public void getExtractedIDStandardTest() throws Exception { - Mockito.when(client.getHost()).thenReturn("vulcan.net.pl"); - StudentAndParent snp = new StudentAndParent(client, "symbol"); - Assert.assertEquals("123456", snp.getExtractedIdFromUrl("https://uonetplus-opiekun" - + ".vulcan.net.pl/powiat/123456/Start/Index/")); - } - - @Test - public void getExtractedIDDemoTest() throws Exception { - Mockito.when(client.getHost()).thenReturn("vulcan.net.pl"); - StudentAndParent snp = new StudentAndParent(client, "symbol"); - Assert.assertEquals("demo12345", - snp.getExtractedIdFromUrl("https://uonetplus-opiekun.vulcan.net.pl/demoupowiat/demo12345/Start/Index/")); - } - - @Test(expected = NotLoggedInErrorException.class) - public void getExtractedIDNotLoggedTest() throws Exception { - Mockito.when(client.getHost()).thenReturn("vulcan.net.pl"); - StudentAndParent snp = new StudentAndParent(client, "symbol"); - Assert.assertEquals("123", - snp.getExtractedIdFromUrl("https://uonetplus.vulcan.net.pl/powiat/")); - } - - @Test - public void getSemestersTest() throws Exception { - SnP snp = new StudentAndParent(client, "123456"); - List semesters = snp.getSemesters(); - - Assert.assertEquals(2, semesters.size()); - - Assert.assertEquals("1", semesters.get(0).getId()); - Assert.assertEquals("1234", semesters.get(0).getNumber()); - Assert.assertFalse(semesters.get(0).isCurrent()); - - Assert.assertEquals("2", semesters.get(1).getId()); - Assert.assertEquals("1235", semesters.get(1).getNumber()); - Assert.assertTrue(semesters.get(1).isCurrent()); - } - - @Test - public void getCurrentSemesterTest() throws Exception { - List semesters = new ArrayList<>(); - semesters.add(new Semester().setNumber("1500100900").setId("1").setCurrent(false)); - semesters.add(new Semester().setNumber("1500100901").setId("2").setCurrent(true)); - - SnP snp = new StudentAndParent(client, ""); - Assert.assertTrue(snp.getCurrentSemester(semesters).isCurrent()); - Assert.assertEquals("2", snp.getCurrentSemester(semesters).getId()); - Assert.assertEquals("1500100901", snp.getCurrentSemester(semesters).getNumber()); - } - - @Test - public void getCurrentSemesterFromEmptyTest() throws Exception { - SnP snp = new StudentAndParent(client, ""); - List semesters = new ArrayList<>(); - - Assert.assertNull(snp.getCurrentSemester(semesters)); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/StudentAndParentTestCase.java b/api/src/test/java/io/github/wulkanowy/api/StudentAndParentTestCase.java deleted file mode 100644 index b18076cf..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/StudentAndParentTestCase.java +++ /dev/null @@ -1,26 +0,0 @@ -package io.github.wulkanowy.api; - -import org.jsoup.Jsoup; -import org.jsoup.nodes.Document; -import org.jsoup.nodes.Element; -import org.mockito.Mockito; - -public abstract class StudentAndParentTestCase { - - protected StudentAndParent getSnp(String fixtureFileName) throws Exception { - String input = FixtureHelper.getAsString(getClass().getResourceAsStream(fixtureFileName)); - - Document tablePageDocument = Jsoup.parse(input); - - StudentAndParent snp = Mockito.mock(StudentAndParent.class); - Mockito.when(snp.getSnPPageDocument(Mockito.anyString())) - .thenReturn(tablePageDocument); - Mockito.when(snp.getSemesters(Mockito.any(Document.class))).thenCallRealMethod(); - Mockito.when(snp.getCurrentSemester(Mockito.anyList())) - .thenCallRealMethod(); - Mockito.when(snp.getRowDataChildValue(Mockito.any(Element.class), - Mockito.anyInt())).thenCallRealMethod(); - - return snp; - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/VulcanTest.java b/api/src/test/java/io/github/wulkanowy/api/VulcanTest.java deleted file mode 100644 index a80c798a..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/VulcanTest.java +++ /dev/null @@ -1,86 +0,0 @@ -package io.github.wulkanowy.api; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; -import org.mockito.Mockito; - -import java.util.HashMap; -import java.util.Map; - -import io.github.wulkanowy.api.login.Login; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; - -public class VulcanTest { - - private Vulcan vulcan; - - @Before - public void setUp() throws Exception { - vulcan = new Vulcan(); - vulcan.setClient(Mockito.mock(Client.class)); - vulcan.setLogin(Mockito.mock(Login.class)); - } - - @Test - public void setFullEndpointInfoTest() throws Exception { - vulcan.login("http://fakelog.net\\\\admin", "pass", "Default", "123"); - - Assert.assertEquals("http", vulcan.getProtocolSchema()); - Assert.assertEquals("fakelog.net", vulcan.getLogHost()); - Assert.assertEquals("admin", vulcan.getEmail()); - } - - @Test - public void getClientTwiceTest() throws Exception { - Vulcan vulcan = new Vulcan(); - Assert.assertTrue(vulcan.getClient().equals(vulcan.getClient())); - } - - @Test - public void getLoginTwiceTest() throws Exception { - Vulcan vulcan = new Vulcan(); - Assert.assertTrue(vulcan.getLogin().equals(vulcan.getLogin())); - } - - @Test(expected = NotLoggedInErrorException.class) - public void getStudentAndParentNotLoggedInTest() throws Exception { - vulcan.getStudentAndParent(); - } - - @Test - public void getStudentAndParentTwiceTest() throws Exception { - Client client = Mockito.mock(Client.class); - Map cookies = new HashMap<>(); - cookies.put("test", "test"); - Mockito.when(client.getCookies()).thenReturn(cookies); - - SnP snp = Mockito.mock(StudentAndParent.class); - Mockito.doNothing().when(snp).storeContextCookies(); - - Vulcan vulcan = Mockito.mock(Vulcan.class); - Mockito.when(vulcan.getClient()).thenReturn(client); - Mockito.when(vulcan.getStudentAndParent()).thenCallRealMethod(); - Mockito.when(vulcan.createSnp(Mockito.any(Client.class), Mockito.any())).thenReturn(snp); - - vulcan.getStudentAndParent(); - vulcan.getStudentAndParent(); - } - - @Test - public void createSnPTest() throws Exception { - vulcan.login("wulkanowy@wulkanowy.io", "wulkanowy123", "wulkan"); - - SnP snp1 = vulcan.createSnp(Mockito.mock(Client.class), null); - Assert.assertEquals(null, snp1.getId()); - - SnP snp2 = vulcan.createSnp(Mockito.mock(Client.class), "wulkan"); - Assert.assertEquals("wulkan", snp2.getId()); - - } - - @Test(expected = NotLoggedInErrorException.class) - public void getAttendanceExceptionText() throws Exception { - vulcan.getAttendanceTable(); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/attendance/AttendanceStatisticsTest.java b/api/src/test/java/io/github/wulkanowy/api/attendance/AttendanceStatisticsTest.java deleted file mode 100644 index ca50f378..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/attendance/AttendanceStatisticsTest.java +++ /dev/null @@ -1,144 +0,0 @@ -package io.github.wulkanowy.api.attendance; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import java.util.List; - -import io.github.wulkanowy.api.StudentAndParentTestCase; -import io.github.wulkanowy.api.generic.Month; - -public class AttendanceStatisticsTest extends StudentAndParentTestCase { - - private AttendanceStatistics excellent; - - private AttendanceStatistics full; - - @Before - public void setUp() throws Exception { - this.excellent = new AttendanceStatistics(getSnp("Frekwencja-excellent.html")); - this.full = new AttendanceStatistics(getSnp("Frekwencja-full.html")); - } - - @Test - public void getSubjectList() throws Exception { - Assert.assertEquals(26, excellent.getSubjectList().size()); - Assert.assertEquals(23, full.getSubjectList().size()); - } - - @Test - public void getSubjectListId() throws Exception { - Assert.assertEquals(-1, excellent.getSubjectList().get(0).getId()); - Assert.assertEquals(63, excellent.getSubjectList().get(10).getId()); - Assert.assertEquals(0, excellent.getSubjectList().get(25).getId()); - - Assert.assertEquals(-1, full.getSubjectList().get(0).getId()); - Assert.assertEquals(108, full.getSubjectList().get(14).getId()); - Assert.assertEquals(492, full.getSubjectList().get(21).getId()); - } - - @Test - public void getSubjectListName() throws Exception { - Assert.assertEquals("Wszystkie", excellent.getSubjectList().get(0).getName()); - Assert.assertEquals("Fizyka", excellent.getSubjectList().get(8).getName()); - Assert.assertEquals("Sieci komputerowe i administrowanie sieciami", - excellent.getSubjectList().get(21).getName()); - - Assert.assertEquals("Praktyka zawodowa", full.getSubjectList().get(11).getName()); - Assert.assertEquals("Użytkowanie urządzeń peryferyjnych komputera", - full.getSubjectList().get(16).getName()); - Assert.assertEquals("Brak opisu lekcji", full.getSubjectList().get(22).getName()); - } - - @Test - public void getTypesTotal() throws Exception { - Assert.assertEquals(100.0, excellent.getTypesTable().getTotal(), 0); - Assert.assertEquals(80.94, full.getTypesTable().getTotal(), 0); - } - - @Test - public void getTypeName() throws Exception { - List typeList1 = excellent.getTypesTable().getTypeList(); - Assert.assertEquals("Obecność", typeList1.get(0).getName()); - Assert.assertEquals("Nieobecność nieusprawiedliwiona", typeList1.get(1).getName()); - Assert.assertEquals("Nieobecność usprawiedliwiona", typeList1.get(2).getName()); - Assert.assertEquals("Nieobecność z przyczyn szkolnych", typeList1.get(3).getName()); - - List typeList2 = full.getTypesTable().getTypeList(); - Assert.assertEquals("Spóźnienie nieusprawiedliwione", typeList2.get(4).getName()); - Assert.assertEquals("Spóźnienie usprawiedliwione", typeList2.get(5).getName()); - Assert.assertEquals("Zwolnienie", typeList2.get(6).getName()); - } - - @Test - public void getTypeTotal() throws Exception { - List typeList1 = excellent.getTypesTable().getTypeList(); - Assert.assertEquals(1211, typeList1.get(0).getTotal()); - Assert.assertEquals(0, typeList1.get(1).getTotal()); - Assert.assertEquals(0, typeList1.get(2).getTotal()); - Assert.assertEquals(0, typeList1.get(3).getTotal()); - Assert.assertEquals(0, typeList1.get(4).getTotal()); - Assert.assertEquals(0, typeList1.get(5).getTotal()); - Assert.assertEquals(0, typeList1.get(6).getTotal()); - - List typeList2 = full.getTypesTable().getTypeList(); - Assert.assertEquals(822, typeList2.get(0).getTotal()); - Assert.assertEquals(6, typeList2.get(1).getTotal()); - Assert.assertEquals(192, typeList2.get(2).getTotal()); - Assert.assertEquals(7, typeList2.get(3).getTotal()); - Assert.assertEquals(12, typeList2.get(4).getTotal()); - Assert.assertEquals(1, typeList2.get(5).getTotal()); - Assert.assertEquals(2, typeList2.get(6).getTotal()); - } - - @Test - public void getTypeList() throws Exception { - List typesList1 = excellent.getTypesTable().getTypeList(); - Assert.assertEquals(12, typesList1.get(0).getMonthList().size()); - Assert.assertEquals(12, typesList1.get(5).getMonthList().size()); - - List typesList2 = full.getTypesTable().getTypeList(); - Assert.assertEquals(12, typesList2.get(0).getMonthList().size()); - Assert.assertEquals(12, typesList2.get(5).getMonthList().size()); - } - - @Test - public void getMonthList() throws Exception { - List typeList1 = excellent.getTypesTable().getTypeList(); - Assert.assertEquals(12, typeList1.get(0).getMonthList().size()); - - List typeList2 = full.getTypesTable().getTypeList(); - Assert.assertEquals(12, typeList2.get(0).getMonthList().size()); - } - - @Test - public void getMonthName() throws Exception { - List monthsList1 = excellent.getTypesTable().getTypeList().get(0).getMonthList(); - Assert.assertEquals("IX", monthsList1.get(0).getName()); - Assert.assertEquals("III", monthsList1.get(6).getName()); - Assert.assertEquals("VIII", monthsList1.get(11).getName()); - - List monthsList2 = full.getTypesTable().getTypeList().get(0).getMonthList(); - Assert.assertEquals("XI", monthsList2.get(2).getName()); - Assert.assertEquals("II", monthsList2.get(5).getName()); - Assert.assertEquals("VI", monthsList2.get(9).getName()); - } - - @Test - public void getMonthValue() throws Exception { - List monthsList1 = excellent.getTypesTable().getTypeList().get(0).getMonthList(); - Assert.assertEquals(142, monthsList1.get(0).getValue()); - Assert.assertEquals(131, monthsList1.get(4).getValue()); - Assert.assertEquals(139, monthsList1.get(7).getValue()); - Assert.assertEquals(114, monthsList1.get(9).getValue()); - Assert.assertEquals(0, monthsList1.get(11).getValue()); - - List typeList1 = full.getTypesTable().getTypeList(); - Assert.assertEquals(135, typeList1.get(0).getMonthList().get(0).getValue()); - Assert.assertEquals(7, typeList1.get(3).getMonthList().get(5).getValue()); - Assert.assertEquals(1, typeList1.get(5).getMonthList().get(0).getValue()); - Assert.assertEquals(27, typeList1.get(2).getMonthList().get(9).getValue()); - Assert.assertEquals(0, typeList1.get(0).getMonthList().get(11).getValue()); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/attendance/AttendanceTableTest.java b/api/src/test/java/io/github/wulkanowy/api/attendance/AttendanceTableTest.java deleted file mode 100644 index 1420a475..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/attendance/AttendanceTableTest.java +++ /dev/null @@ -1,165 +0,0 @@ -package io.github.wulkanowy.api.attendance; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class AttendanceTableTest extends StudentAndParentTestCase { - - private AttendanceTable excellent; - - private AttendanceTable full; - - @Before - public void setUp() throws Exception { - excellent = new AttendanceTable(getSnp("Frekwencja-excellent.html")); - full = new AttendanceTable(getSnp("Frekwencja-full.html")); - } - - @Test - public void getWeekStartByDate() throws Exception { - Assert.assertEquals("31.08.2015", excellent.getWeekTable().getStartDayDate()); - Assert.assertEquals("05.09.2016", full.getWeekTable().getStartDayDate()); - } - - @Test - public void getWeekDaysNumber() throws Exception { - Assert.assertEquals(5, excellent.getWeekTable().getDays().size()); - Assert.assertEquals(5, full.getWeekTable().getDays().size()); - } - - @Test - public void getDayLessonsNumber() throws Exception { - Assert.assertEquals(14, excellent.getWeekTable().getDay(0).getLessons().size()); - Assert.assertEquals(14, full.getWeekTable().getDay(0).getLessons().size()); - } - - @Test - public void getDayDate() throws Exception { - Assert.assertEquals("31.08.2015", excellent.getWeekTable().getDay(0).getDate()); - Assert.assertEquals("02.09.2015", excellent.getWeekTable().getDay(2).getDate()); - Assert.assertEquals("04.09.2015", excellent.getWeekTable().getDay(4).getDate()); - - Assert.assertEquals("05.09.2016", full.getWeekTable().getDay(0).getDate()); - Assert.assertEquals("07.09.2016", full.getWeekTable().getDay(2).getDate()); - Assert.assertEquals("09.09.2016", full.getWeekTable().getDay(4).getDate()); - } - - @Test - public void getLessonSubject() throws Exception { - Assert.assertEquals("", - excellent.getWeekTable().getDay(0).getLesson(7).getSubject()); - Assert.assertEquals("Uroczyste rozpoczęcie roku szkolnego 2015/2016", - excellent.getWeekTable().getDay(1).getLesson(1).getSubject()); - Assert.assertEquals("Geografia", - excellent.getWeekTable().getDay(3).getLesson(4).getSubject()); - - Assert.assertEquals("Naprawa komputera", - full.getWeekTable().getDay(1).getLesson(8).getSubject()); - Assert.assertEquals("Religia", - full.getWeekTable().getDay(3).getLesson(1).getSubject()); - Assert.assertEquals("Metodologia programowania", - full.getWeekTable().getDay(4).getLesson(5).getSubject()); - } - - @Test - public void getLessonIsNotExist() throws Exception { - Assert.assertTrue(excellent.getWeekTable().getDay(0).getLesson(5).isNotExist()); - Assert.assertFalse(excellent.getWeekTable().getDay(2).getLesson(1).isNotExist()); - Assert.assertFalse(excellent.getWeekTable().getDay(4).getLesson(12).isNotExist()); - - Assert.assertFalse(full.getWeekTable().getDay(1).getLesson(12).isAbsenceUnexcused()); - Assert.assertFalse(full.getWeekTable().getDay(3).getLesson(1).isAbsenceUnexcused()); - Assert.assertFalse(full.getWeekTable().getDay(4).getLesson(5).isAbsenceUnexcused()); - } - - @Test - public void getLessonIsEmpty() throws Exception { - Assert.assertTrue(excellent.getWeekTable().getDay(0).getLesson(0).isEmpty()); - Assert.assertFalse(excellent.getWeekTable().getDay(2).getLesson(6).isEmpty()); - Assert.assertTrue(excellent.getWeekTable().getDay(4).getLesson(12).isEmpty()); - - Assert.assertTrue(full.getWeekTable().getDay(1).getLesson(9).isEmpty()); - Assert.assertFalse(full.getWeekTable().getDay(2).getLesson(5).isEmpty()); - Assert.assertFalse(full.getWeekTable().getDay(4).getLesson(2).isEmpty()); - } - - @Test - public void getLessonIsPresence() throws Exception { - Assert.assertFalse(excellent.getWeekTable().getDay(0).getLesson(7).isPresence()); - Assert.assertTrue(excellent.getWeekTable().getDay(1).getLesson(1).isPresence()); - Assert.assertTrue(excellent.getWeekTable().getDay(3).getLesson(7).isPresence()); - - Assert.assertTrue(full.getWeekTable().getDay(0).getLesson(1).isPresence()); - Assert.assertTrue(full.getWeekTable().getDay(2).getLesson(6).isPresence()); - Assert.assertFalse(full.getWeekTable().getDay(4).getLesson(7).isPresence()); - } - - @Test - public void getLessonIsAbsenceUnexcused() throws Exception { - Assert.assertFalse(excellent.getWeekTable().getDay(0).getLesson(7).isAbsenceUnexcused()); - Assert.assertFalse(excellent.getWeekTable().getDay(2).getLesson(0).isAbsenceUnexcused()); - Assert.assertFalse(excellent.getWeekTable().getDay(4).getLesson(4).isAbsenceUnexcused()); - - Assert.assertTrue(full.getWeekTable().getDay(1).getLesson(8).isAbsenceUnexcused()); - Assert.assertFalse(full.getWeekTable().getDay(3).getLesson(1).isAbsenceUnexcused()); - Assert.assertFalse(full.getWeekTable().getDay(4).getLesson(8).isAbsenceUnexcused()); - } - - @Test - public void getLessonIsAbsenceExcused() throws Exception { - Assert.assertFalse(excellent.getWeekTable().getDay(0).getLesson(7).isAbsenceExcused()); - Assert.assertFalse(excellent.getWeekTable().getDay(2).getLesson(0).isAbsenceExcused()); - Assert.assertFalse(excellent.getWeekTable().getDay(4).getLesson(4).isAbsenceExcused()); - - Assert.assertFalse(full.getWeekTable().getDay(2).getLesson(5).isAbsenceExcused()); - Assert.assertFalse(full.getWeekTable().getDay(3).getLesson(1).isAbsenceExcused()); - Assert.assertTrue(full.getWeekTable().getDay(4).getLesson(3).isAbsenceExcused()); - } - - @Test - public void getLessonIsAbsenceForSchoolReasons() throws Exception { - Assert.assertFalse(excellent.getWeekTable().getDay(0).getLesson(4).isAbsenceForSchoolReasons()); - Assert.assertFalse(excellent.getWeekTable().getDay(2).getLesson(8).isAbsenceForSchoolReasons()); - Assert.assertFalse(excellent.getWeekTable().getDay(4).getLesson(12).isAbsenceForSchoolReasons()); - - Assert.assertTrue(full.getWeekTable().getDay(2).getLesson(5).isAbsenceForSchoolReasons()); - Assert.assertFalse(full.getWeekTable().getDay(3).getLesson(1).isAbsenceForSchoolReasons()); - Assert.assertFalse(full.getWeekTable().getDay(4).getLesson(8).isAbsenceForSchoolReasons()); - } - - @Test - public void getLessonIsUnexcusedLateness() throws Exception { - Assert.assertFalse(excellent.getWeekTable().getDay(0).getLesson(4).isUnexcusedLateness()); - Assert.assertFalse(excellent.getWeekTable().getDay(2).getLesson(8).isUnexcusedLateness()); - Assert.assertFalse(excellent.getWeekTable().getDay(4).getLesson(12).isUnexcusedLateness()); - - Assert.assertTrue(full.getWeekTable().getDay(1).getLesson(6).isUnexcusedLateness()); - Assert.assertFalse(full.getWeekTable().getDay(3).getLesson(1).isUnexcusedLateness()); - Assert.assertFalse(full.getWeekTable().getDay(4).getLesson(8).isUnexcusedLateness()); - } - - @Test - public void getLessonIsExcusedLateness() throws Exception { - Assert.assertFalse(excellent.getWeekTable().getDay(0).getLesson(4).isExcusedLateness()); - Assert.assertFalse(excellent.getWeekTable().getDay(2).getLesson(8).isExcusedLateness()); - Assert.assertFalse(excellent.getWeekTable().getDay(4).getLesson(12).isExcusedLateness()); - - Assert.assertTrue(full.getWeekTable().getDay(1).getLesson(7).isExcusedLateness()); - Assert.assertFalse(full.getWeekTable().getDay(3).getLesson(1).isExcusedLateness()); - Assert.assertFalse(full.getWeekTable().getDay(4).getLesson(8).isExcusedLateness()); - } - - @Test - public void getLessonIsExemption() throws Exception { - Assert.assertFalse(excellent.getWeekTable().getDay(0).getLesson(4).isExemption()); - Assert.assertFalse(excellent.getWeekTable().getDay(2).getLesson(8).isExemption()); - Assert.assertFalse(excellent.getWeekTable().getDay(4).getLesson(12).isExemption()); - - Assert.assertFalse(full.getWeekTable().getDay(2).getLesson(5).isExemption()); - Assert.assertFalse(full.getWeekTable().getDay(3).getLesson(1).isExemption()); - Assert.assertTrue(full.getWeekTable().getDay(4).getLesson(8).isExemption()); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/exams/ExamsWeekTest.java b/api/src/test/java/io/github/wulkanowy/api/exams/ExamsWeekTest.java deleted file mode 100644 index 9b57ddd6..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/exams/ExamsWeekTest.java +++ /dev/null @@ -1,97 +0,0 @@ -package io.github.wulkanowy.api.exams; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import java.util.List; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class ExamsWeekTest extends StudentAndParentTestCase { - - private ExamsWeek onePerDay; - - @Before - public void getCurrent() throws Exception { - onePerDay = new ExamsWeek(getSnp("Sprawdziany-one-per-day.html")); - } - - @Test - public void getWeekTest() throws Exception { - Assert.assertEquals("23.10.2017", onePerDay.getCurrent().getStartDayDate()); - } - - @Test - public void getDaysListTest() throws Exception { - Assert.assertEquals(3, onePerDay.getCurrent().getDays().size()); - Assert.assertEquals(7, onePerDay.getWeek("", false).getDays().size()); - } - - @Test - public void getExamsListTest() throws Exception { - List notEmpty = onePerDay.getCurrent().getDays(); - Assert.assertEquals(1, notEmpty.get(0).getExamList().size()); - Assert.assertEquals(1, notEmpty.get(1).getExamList().size()); - Assert.assertEquals(1, notEmpty.get(2).getExamList().size()); - - List emptyToo = onePerDay.getWeek("", false).getDays(); - Assert.assertEquals(1, emptyToo.get(0).getExamList().size()); - Assert.assertEquals(1, emptyToo.get(1).getExamList().size()); - Assert.assertEquals(1, emptyToo.get(4).getExamList().size()); - } - - @Test - public void getDayDateTest() throws Exception { - List dayList = onePerDay.getCurrent().getDays(); - - Assert.assertEquals("23.10.2017", dayList.get(0).getDate()); - Assert.assertEquals("24.10.2017", dayList.get(1).getDate()); - Assert.assertEquals("27.10.2017", dayList.get(2).getDate()); - } - - @Test - public void getExamSubjectAndGroupTest() throws Exception { - List dayList = onePerDay.getCurrent().getDays(); - - Assert.assertEquals("Sieci komputerowe 3Ti|zaw2", dayList.get(0).getExamList().get(0).getSubjectAndGroup()); - Assert.assertEquals("Język angielski 3Ti|J1", dayList.get(1).getExamList().get(0).getSubjectAndGroup()); - Assert.assertEquals("Metodologia programowania 3Ti|zaw2", dayList.get(2).getExamList().get(0).getSubjectAndGroup()); - } - - @Test - public void getExamTypeTest() throws Exception { - List dayList = onePerDay.getCurrent().getDays(); - - Assert.assertEquals("Sprawdzian", dayList.get(0).getExamList().get(0).getType()); - Assert.assertEquals("Sprawdzian", dayList.get(1).getExamList().get(0).getType()); - Assert.assertEquals("Sprawdzian", dayList.get(2).getExamList().get(0).getType()); - } - - @Test - public void getExamDescriptionTest() throws Exception { - List dayList = onePerDay.getCurrent().getDays(); - - Assert.assertEquals("Łącza danych", dayList.get(0).getExamList().get(0).getDescription()); - Assert.assertEquals("Czasy teraźniejsze", dayList.get(1).getExamList().get(0).getDescription()); - Assert.assertEquals("", dayList.get(2).getExamList().get(0).getDescription()); - } - - @Test - public void getExamTeacherTest() throws Exception { - List dayList = onePerDay.getCurrent().getDays(); - - Assert.assertEquals("Adam Wiśniewski [AW]", dayList.get(0).getExamList().get(0).getTeacher()); - Assert.assertEquals("Natalia Nowak [NN]", dayList.get(1).getExamList().get(0).getTeacher()); - Assert.assertEquals("Małgorzata Nowacka [MN]", dayList.get(2).getExamList().get(0).getTeacher()); - } - - @Test - public void getExamEntryDateTest() throws Exception { - List dayList = onePerDay.getCurrent().getDays(); - - Assert.assertEquals("16.10.2017", dayList.get(0).getExamList().get(0).getEntryDate()); - Assert.assertEquals("17.10.2017", dayList.get(1).getExamList().get(0).getEntryDate()); - Assert.assertEquals("16.10.2017", dayList.get(2).getExamList().get(0).getEntryDate()); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/grades/GradesListTest.java b/api/src/test/java/io/github/wulkanowy/api/grades/GradesListTest.java deleted file mode 100644 index bee5b4fe..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/grades/GradesListTest.java +++ /dev/null @@ -1,114 +0,0 @@ -package io.github.wulkanowy.api.grades; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import java.util.List; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class GradesListTest extends StudentAndParentTestCase { - - private GradesList filled; - - @Before - public void setUp() throws Exception { - filled = new GradesList(getSnp("OcenyWszystkie-filled.html")); - } - - @Test - public void getAllTest() throws Exception { - Assert.assertEquals(6, filled.getAll().size()); // 2 items are skipped - } - - @Test - public void getSubjectTest() throws Exception { - List list = filled.getAll(); - - Assert.assertEquals("Zajęcia z wychowawcą", list.get(0).getSubject()); - Assert.assertEquals("Język angielski", list.get(3).getSubject()); - Assert.assertEquals("Wychowanie fizyczne", list.get(4).getSubject()); - Assert.assertEquals("Język polski", list.get(5).getSubject()); - } - - @Test - public void getValueTest() throws Exception { - List list = filled.getAll(); - - Assert.assertEquals("5", list.get(0).getValue()); - Assert.assertEquals("5", list.get(3).getValue()); - Assert.assertEquals("1", list.get(4).getValue()); - Assert.assertEquals("1", list.get(5).getValue()); - } - - @Test - public void getColorTest() throws Exception { - List list = filled.getAll(); - - Assert.assertEquals("000000", list.get(0).getColor()); - Assert.assertEquals("1289F7", list.get(3).getColor()); - Assert.assertEquals("6ECD07", list.get(4).getColor()); - Assert.assertEquals("6ECD07", list.get(5).getColor()); - } - - @Test - public void getSymbolTest() throws Exception { - List list = filled.getAll(); - - Assert.assertEquals("A1", list.get(0).getSymbol()); - Assert.assertEquals("BW3", list.get(3).getSymbol()); - Assert.assertEquals("STR", list.get(4).getSymbol()); - Assert.assertEquals("K", list.get(5).getSymbol()); - } - - @Test - public void getDescriptionTest() throws Exception { - List list = filled.getAll(); - - Assert.assertEquals("Dzień Kobiet w naszej klasie", list.get(0).getDescription()); - Assert.assertEquals("Writing", list.get(3).getDescription()); - Assert.assertEquals("", list.get(4).getDescription()); - Assert.assertEquals("Kordian", list.get(5).getDescription()); - } - - @Test - public void getWeightTest() throws Exception { - List list = filled.getAll(); - - Assert.assertEquals("1,00", list.get(0).getWeight()); - Assert.assertEquals("3,00", list.get(3).getWeight()); - Assert.assertEquals("8,00", list.get(4).getWeight()); - Assert.assertEquals("5,00", list.get(5).getWeight()); - } - - @Test - public void getDateTest() throws Exception { - List list = filled.getAll(); - - Assert.assertEquals("2017-03-21", list.get(0).getDate()); - Assert.assertEquals("2017-06-02", list.get(3).getDate()); - Assert.assertEquals("2017-04-02", list.get(4).getDate()); - Assert.assertEquals("2017-02-06", list.get(5).getDate()); - } - - @Test - public void getTeacherTest() throws Exception { - List list = filled.getAll(); - - Assert.assertEquals("Patryk Maciejewski", list.get(0).getTeacher()); - Assert.assertEquals("Oliwia Woźniak", list.get(3).getTeacher()); - Assert.assertEquals("Klaudia Dziedzic", list.get(4).getTeacher()); - Assert.assertEquals("Amelia Stępień", list.get(5).getTeacher()); - } - - @Test - public void getSemesterTest() throws Exception { - List list = filled.getAll(); - - Assert.assertEquals("7654321", list.get(0).getSemester()); - Assert.assertEquals("7654321", list.get(3).getSemester()); - Assert.assertEquals("7654321", list.get(4).getSemester()); - Assert.assertEquals("7654321", list.get(5).getSemester()); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/grades/SubjectsListTest.java b/api/src/test/java/io/github/wulkanowy/api/grades/SubjectsListTest.java deleted file mode 100644 index d3228378..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/grades/SubjectsListTest.java +++ /dev/null @@ -1,82 +0,0 @@ -package io.github.wulkanowy.api.grades; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import java.util.List; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class SubjectsListTest extends StudentAndParentTestCase { - - private SubjectsList std; - - private SubjectsList average; - - @Before - public void setUp() throws Exception { - std = new SubjectsList(getSnp("OcenyWszystkie-subjects.html")); - average = new SubjectsList(getSnp("OcenyWszystkie-subjects-average.html")); - } - - @Test - public void getAllTest() throws Exception { - Assert.assertEquals(5, std.getAll().size()); - Assert.assertEquals(5, average.getAll().size()); - } - - @Test - public void getNameTest() throws Exception { - List stdList = std.getAll(); - - Assert.assertEquals("Zachowanie", stdList.get(0).getName()); - Assert.assertEquals("Praktyka zawodowa", stdList.get(1).getName()); - Assert.assertEquals("Metodologia programowania", stdList.get(2).getName()); - Assert.assertEquals("Podstawy przedsiębiorczości", stdList.get(3).getName()); - Assert.assertEquals("Wychowanie do życia w rodzinie", stdList.get(4).getName()); - - List averageList = average.getAll(); - Assert.assertEquals("Zachowanie", averageList.get(0).getName()); - Assert.assertEquals("Język polski", averageList.get(1).getName()); - Assert.assertEquals("Wychowanie fizyczne", averageList.get(2).getName()); - Assert.assertEquals("Język angielski", averageList.get(3).getName()); - Assert.assertEquals("Wiedza o społeczeństwie", averageList.get(4).getName()); - } - - @Test - public void getPredictedRatingTest() throws Exception { - List stdList = std.getAll(); - - Assert.assertEquals("bardzo dobre", stdList.get(0).getPredictedRating()); - Assert.assertEquals("-", stdList.get(1).getPredictedRating()); - Assert.assertEquals("bardzo dobry", stdList.get(2).getPredictedRating()); - Assert.assertEquals("3/4", stdList.get(3).getPredictedRating()); - Assert.assertEquals("-", stdList.get(4).getPredictedRating()); - - List averageList = average.getAll(); - Assert.assertEquals("bardzo dobre", averageList.get(0).getPredictedRating()); - Assert.assertEquals("-", averageList.get(1).getPredictedRating()); - Assert.assertEquals("bardzo dobry", averageList.get(2).getPredictedRating()); - Assert.assertEquals("4/5", averageList.get(3).getPredictedRating()); - Assert.assertEquals("-", averageList.get(4).getPredictedRating()); - } - - @Test - public void getFinalRatingTest() throws Exception { - List stdList = std.getAll(); - - Assert.assertEquals("bardzo dobre", stdList.get(0).getFinalRating()); - Assert.assertEquals("celujący", stdList.get(1).getFinalRating()); - Assert.assertEquals("celujący", stdList.get(2).getFinalRating()); - Assert.assertEquals("dostateczny", stdList.get(3).getFinalRating()); - Assert.assertEquals("-", stdList.get(4).getFinalRating()); - - List averageList = average.getAll(); - Assert.assertEquals("bardzo dobre", averageList.get(0).getFinalRating()); - Assert.assertEquals("dobry", averageList.get(1).getFinalRating()); - Assert.assertEquals("celujący", averageList.get(2).getFinalRating()); - Assert.assertEquals("bardzo dobry", averageList.get(3).getFinalRating()); - Assert.assertEquals("-", averageList.get(4).getFinalRating()); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/login/LoginTest.java b/api/src/test/java/io/github/wulkanowy/api/login/LoginTest.java deleted file mode 100644 index 335ab84b..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/login/LoginTest.java +++ /dev/null @@ -1,104 +0,0 @@ -package io.github.wulkanowy.api.login; - - -import org.jsoup.Jsoup; -import org.jsoup.nodes.Document; -import org.junit.Assert; -import org.junit.Test; -import org.mockito.Mockito; - -import io.github.wulkanowy.api.Client; -import io.github.wulkanowy.api.FixtureHelper; - -public class LoginTest { - - private String getFixtureAsString(String fixtureFileName) { - return FixtureHelper.getAsString(getClass().getResourceAsStream(fixtureFileName)); - } - - private Client getClient(String fixtureFileName) throws Exception { - Document doc = Jsoup.parse(getFixtureAsString(fixtureFileName)); - - Client client = Mockito.mock(Client.class); - Mockito.when(client.postPageByUrl(Mockito.anyString(), Mockito.any(String[][].class))).thenReturn(doc); - - return client; - } - - @Test - public void loginTest() throws Exception { - Login login = new Login(getClient("Logowanie-success.html")); - - Assert.assertEquals("d123", login.login("a@a", "pswd", "d123")); - } - - @Test(expected = BadCredentialsException.class) - public void sendWrongCredentialsTest() throws Exception { - Login login = new Login(getClient("Logowanie-error.html")); - - login.sendCredentials("a@a", "pswd", "d123"); - } - - @Test - public void sendCredentialsCertificateTest() throws Exception { - Login login = new Login(getClient("Logowanie-certyfikat.html")); - - Assert.assertEquals( - getFixtureAsString("cert.xml").replaceAll("\\s+",""), - login.sendCredentials("a@a", "passwd", "d123").replaceAll("\\s+","") - ); - } - - @Test - public void sendCertificateNotDefaultSymbolSuccessTest() throws Exception { - Login login = new Login(getClient("Logowanie-success.html")); - - Assert.assertEquals("wulkanowyschool321", - login.sendCertificate("", "wulkanowyschool321")); - } - - @Test - public void sendCertificateDefaultSymbolSuccessTest() throws Exception { - Login login = new Login(getClient("Logowanie-success.html")); - - Assert.assertEquals("demo12345", - login.sendCertificate(getFixtureAsString("cert.xml"), "Default")); - } - - @Test(expected = AccountPermissionException.class) - public void sendCertificateAccountPermissionTest() throws Exception { - Login login = new Login(getClient("Logowanie-brak-dostepu.html")); - - login.sendCertificate(getFixtureAsString("cert.xml"), "demo123"); - } - - @Test(expected = LoginErrorException.class) - public void sendCertificateLoginErrorTest() throws Exception { - Login login = new Login(getClient("Logowanie-certyfikat.html")); // change to other document - - login.sendCertificate(getFixtureAsString("cert.xml"), "demo123"); - } - - @Test(expected = VulcanOfflineException.class) - public void sendCertificateVulcanOfflineTest() throws Exception { - Login login = new Login(getClient("PrzerwaTechniczna.html")); - - login.sendCertificate(getFixtureAsString("cert.xml"), "demo123"); - } - - @Test - public void findSymbolInCertificateTest() throws Exception { - Login login = new Login(getClient("Logowanie-certyfikat.html")); - - String certificate = getFixtureAsString("cert.xml"); - - Assert.assertEquals("demo12345", login.findSymbolInCertificate(certificate)); - } - - @Test - public void findSymbolInInvalidCertificateTest() throws Exception { - Login login = new Login(getClient("Logowanie-certyfikat.html")); - - Assert.assertEquals("", login.findSymbolInCertificate("")); // change to real cert with empty symbols - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/messages/MessagesTest.java b/api/src/test/java/io/github/wulkanowy/api/messages/MessagesTest.java deleted file mode 100644 index 44880a88..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/messages/MessagesTest.java +++ /dev/null @@ -1,89 +0,0 @@ -package io.github.wulkanowy.api.messages; - -import org.junit.Assert; -import org.junit.Test; -import org.mockito.Mockito; - -import java.util.List; - -import io.github.wulkanowy.api.Client; -import io.github.wulkanowy.api.FixtureHelper; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; - -public class MessagesTest { - - private Client getFixtureAsString(String fixtureFileName) throws Exception { - Client client = Mockito.mock(Client.class); - Mockito.when(client.getJsonStringByUrl(Mockito.anyString())) - .thenReturn(FixtureHelper.getAsString(getClass().getResourceAsStream(fixtureFileName))); - Mockito.when(client.postJsonStringByUrl(Mockito.anyString(), Mockito.any())) - .thenReturn(FixtureHelper.getAsString(getClass().getResourceAsStream(fixtureFileName))); - return client; - } - - @Test - public void getMessages() throws Exception { - Client client = getFixtureAsString("GetWiadomosciOdebrane.json"); - - Messages messages = new Messages(client); - List messageList = messages.getReceived(); - - Assert.assertEquals(true, messageList.get(1).unread); - Assert.assertEquals("2016-03-15 09:00:00", messageList.get(0).date); - Assert.assertEquals(null, messageList.get(0).content); - Assert.assertEquals("Kowalski Jan", messageList.get(0).sender); - Assert.assertEquals(12347, messageList.get(2).id); - } - - @Test - public void getMessagesEmpty() throws Exception { - Client client = getFixtureAsString("GetWiadomosciUsuniete-empty.json"); - - Messages messages = new Messages(client); - List messageList = messages.getSent(); - - Assert.assertTrue(messageList.isEmpty()); - } - - @Test(expected = NotLoggedInErrorException.class) - public void getMessagesError() throws Exception { - Client client = getFixtureAsString("UndefinedError.txt"); - - Messages messages = new Messages(client); - messages.getDeleted(); - } - - @Test(expected = BadRequestException.class) - public void getMessagesBadRequest() throws Exception { - Client client = getFixtureAsString("PageError.html"); - - Messages messages = new Messages(client); - messages.getDeleted(); - } - - @Test - public void getMessage() throws Exception { - Client client = getFixtureAsString("GetTrescWiadomosci.json"); - - Messages messages = new Messages(client); - Message message = messages.getMessage(123, Messages.RECEIVED_FOLDER); - Assert.assertEquals(12345, message.id); - Assert.assertEquals("Witam, …. \nPozdrawiam Krzysztof Czerkas", message.content); - } - - @Test(expected = NotLoggedInErrorException.class) - public void getMessageError() throws Exception { - Client client = getFixtureAsString("UndefinedError.txt"); - - Messages messages = new Messages(client); - messages.getMessage(321, Messages.SENT_FOLDER); - } - - @Test(expected = BadRequestException.class) - public void getMessageBadRequest() throws Exception { - Client client = getFixtureAsString("PageError.html"); - - Messages messages = new Messages(client); - messages.getMessage(1, Messages.DELETED_FOLDER); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/notes/AchievementsListTest.java b/api/src/test/java/io/github/wulkanowy/api/notes/AchievementsListTest.java deleted file mode 100644 index 0d7774bb..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/notes/AchievementsListTest.java +++ /dev/null @@ -1,36 +0,0 @@ -package io.github.wulkanowy.api.notes; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import java.util.List; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class AchievementsListTest extends StudentAndParentTestCase { - - private AchievementsList filledAchievementsList; - - private AchievementsList emptyAchievementsList; - - @Before - public void setUp() throws Exception { - filledAchievementsList = new AchievementsList(getSnp("UwagiOsiagniecia-filled.html")); - emptyAchievementsList = new AchievementsList(getSnp("UwagiOsiagniecia-empty.html")); - } - - @Test - public void getAllAchievementsTest() throws Exception { - Assert.assertEquals(2, filledAchievementsList.getAllAchievements().size()); - Assert.assertEquals(0, emptyAchievementsList.getAllAchievements().size()); - } - - @Test - public void getAchievements() throws Exception { - List filledList = filledAchievementsList.getAllAchievements(); - - Assert.assertEquals("I miejsce w ogólnopolskim konkursie ortograficznym", filledList.get(0)); - Assert.assertEquals("III miejsce w ogólnopolskim konkursie plastycznym", filledList.get(1)); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/notes/NotesListTest.java b/api/src/test/java/io/github/wulkanowy/api/notes/NotesListTest.java deleted file mode 100644 index d76c0648..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/notes/NotesListTest.java +++ /dev/null @@ -1,60 +0,0 @@ -package io.github.wulkanowy.api.notes; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import java.util.List; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class NotesListTest extends StudentAndParentTestCase { - - private NotesList filled; - - private NotesList empty; - - @Before - public void setUp() throws Exception { - filled = new NotesList(getSnp("UwagiOsiagniecia-filled.html")); - empty = new NotesList(getSnp("UwagiOsiagniecia-empty.html")); - } - - @Test - public void getAllNotesTest() throws Exception { - Assert.assertEquals(3, filled.getAllNotes().size()); - Assert.assertEquals(0, empty.getAllNotes().size()); - } - - @Test - public void getDateTest() throws Exception { - List filledList = filled.getAllNotes(); - - Assert.assertEquals("06.06.2017", filledList.get(0).getDate()); - Assert.assertEquals("01.10.2016", filledList.get(2).getDate()); - } - - @Test - public void getTeacherTest() throws Exception { - List filledList = filled.getAllNotes(); - - Assert.assertEquals("Jan Kowalski [JK]", filledList.get(0).getTeacher()); - Assert.assertEquals("Kochański Leszek [KL]", filledList.get(2).getTeacher()); - } - - @Test - public void getCategoryTest() throws Exception { - List filledList = filled.getAllNotes(); - - Assert.assertEquals("Zaangażowanie społeczne", filledList.get(0).getCategory()); - Assert.assertEquals("Zachowanie na lekcji", filledList.get(2).getCategory()); - } - - @Test - public void getContentTest() throws Exception { - List filledList = filled.getAllNotes(); - - Assert.assertEquals("Pomoc przy pikniku charytatywnym", filledList.get(0).getContent()); - Assert.assertEquals("Przeszkadzanie w prowadzeniu lekcji", filledList.get(2).getContent()); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/school/SchoolInfoTest.java b/api/src/test/java/io/github/wulkanowy/api/school/SchoolInfoTest.java deleted file mode 100644 index 947db9b8..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/school/SchoolInfoTest.java +++ /dev/null @@ -1,48 +0,0 @@ -package io.github.wulkanowy.api.school; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class SchoolInfoTest extends StudentAndParentTestCase { - - private SchoolInfo schoolInfo; - - @Before - public void setUp() throws Exception { - schoolInfo = new SchoolInfo(getSnp("Szkola.html")); - } - - @Test - public void getNameTest() throws Exception { - Assert.assertEquals("Zespół Szkół nr 64", schoolInfo.getSchoolData().getName()); - } - - @Test - public void getAddressTest() throws Exception { - Assert.assertEquals("ul. Wiśniowa 128, 01-234 Rogalowo, Nibylandia", - schoolInfo.getSchoolData().getAddress()); - } - - @Test - public void getPhoneNumberTest() throws Exception { - Assert.assertEquals("55 5555555", schoolInfo.getSchoolData().getPhoneNumber()); - } - - @Test - public void getHeadmasterTest() throws Exception { - Assert.assertEquals("Antoni Sobczyk", schoolInfo.getSchoolData().getHeadmaster()); - } - - @Test - public void getPedagoguesTest() throws Exception { - Assert.assertArrayEquals(new String[]{ - "Zofia Czerwińska [ZC]", - "Aleksander Krzemiński [AK]", - "Karolina Kowalska [KK]", - "Bartek Dąbrowski [BD]" - }, schoolInfo.getSchoolData().getPedagogues()); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/school/TeachersInfoTest.java b/api/src/test/java/io/github/wulkanowy/api/school/TeachersInfoTest.java deleted file mode 100644 index b0da356b..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/school/TeachersInfoTest.java +++ /dev/null @@ -1,56 +0,0 @@ -package io.github.wulkanowy.api.school; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import java.util.List; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class TeachersInfoTest extends StudentAndParentTestCase { - - private TeachersInfo teachersInfo; - - @Before - public void setUp() throws Exception { - teachersInfo = new TeachersInfo(getSnp("Szkola.html")); - } - - @Test - public void getClassNameTest() throws Exception { - Assert.assertEquals("1a", teachersInfo.getTeachersData().getClassName()); - } - - @Test - public void getClassTeacherTest() throws Exception { - Assert.assertArrayEquals(new String[]{ - "Karolina Kowalska [AN]", - "Antoni Sobczyk [AS]" - }, teachersInfo.getTeachersData().getClassTeacher()); - } - - @Test - public void getTeachersDataSubjectsNameTest() throws Exception { - List subjects = teachersInfo.getTeachersData().getSubjects(); - - Assert.assertEquals("Biologia", subjects.get(0).getName()); - Assert.assertEquals("Język angielski", subjects.get(6).getName()); - } - - @Test - public void getTeachersDataSubjectsTeachersTest() throws Exception { - List subjects = teachersInfo.getTeachersData().getSubjects(); - - Assert.assertArrayEquals(new String[]{"Karolina Kowalska [AN]"}, - subjects.get(0).getTeachers()); - Assert.assertEquals("Karolina Kowalska [AN]", - subjects.get(0).getTeachers()[0]); - - Assert.assertArrayEquals(new String[]{ - "Karolina Kowalska [AN]", - "Mateusz Kowal [MK]", - "Amelia Mazur [AM]" - }, subjects.get(6).getTeachers()); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/timetable/TimetableTest.java b/api/src/test/java/io/github/wulkanowy/api/timetable/TimetableTest.java deleted file mode 100644 index 65267634..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/timetable/TimetableTest.java +++ /dev/null @@ -1,242 +0,0 @@ -package io.github.wulkanowy.api.timetable; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class TimetableTest extends StudentAndParentTestCase { - - private Timetable std; - - private Timetable full; - - private Timetable holidays; - - @Before - public void setUp() throws Exception { - std = new Timetable(getSnp("PlanLekcji-std.html")); - full = new Timetable(getSnp("PlanLekcji-full.html")); - holidays = new Timetable(getSnp("PlanLekcji-holidays.html")); - } - - // Week - - @Test - public void getWeekTableTest() throws Exception { - Assert.assertEquals(5, std.getWeekTable().getDays().size()); - Assert.assertEquals(5, full.getWeekTable().getDays().size()); - Assert.assertEquals(5, holidays.getWeekTable().getDays().size()); - } - - @Test - public void getStartDayDateTest() throws Exception { - Assert.assertEquals("2017-06-19", std.getWeekTable().getStartDayDate()); - Assert.assertEquals("2017-06-19", full.getWeekTable().getStartDayDate()); - Assert.assertEquals("2017-07-31", holidays.getWeekTable().getStartDayDate()); - } - - // ExamDay - - @Test - public void getDayNameTest() throws Exception { - Assert.assertEquals("poniedziałek", std.getWeekTable().getDay(0).getDayName()); - Assert.assertEquals("piątek", std.getWeekTable().getDay(4).getDayName()); - Assert.assertEquals("wtorek", full.getWeekTable().getDay(1).getDayName()); - Assert.assertEquals("czwartek", full.getWeekTable().getDay(3).getDayName()); - Assert.assertEquals("środa", holidays.getWeekTable().getDay(2).getDayName()); - } - - @Test - public void getDayDateTest() throws Exception { - Assert.assertEquals("2017-06-19", std.getWeekTable().getDay(0).getDate()); - Assert.assertEquals("2017-06-23", std.getWeekTable().getDay(4).getDate()); - Assert.assertEquals("2017-06-20", full.getWeekTable().getDay(1).getDate()); - Assert.assertEquals("2017-06-22", full.getWeekTable().getDay(3).getDate()); - Assert.assertEquals("2017-08-02", holidays.getWeekTable().getDay(2).getDate()); - } - - @Test - public void getDayIsFreeTest() throws Exception { - Assert.assertFalse(std.getWeekTable().getDay(0).isFreeDay()); - Assert.assertFalse(full.getWeekTable().getDay(2).isFreeDay()); - Assert.assertTrue(holidays.getWeekTable().getDay(4).isFreeDay()); - } - - @Test - public void getDayFreeDayName() throws Exception { - Assert.assertNotEquals("Wakacje", std.getWeekTable().getDay(0).getFreeDayName()); - Assert.assertNotEquals("Ferie letnie", full.getWeekTable().getDay(1).getFreeDayName()); - Assert.assertNotEquals("Wakacje", holidays.getWeekTable().getDay(2).getFreeDayName()); - Assert.assertEquals("Ferie letnie", holidays.getWeekTable().getDay(4).getFreeDayName()); - } - - @Test - public void getDayLessonsTest() throws Exception { - Assert.assertEquals(8, std.getWeekTable().getDay(0).getLessons().size()); - Assert.assertEquals(14, full.getWeekTable().getDay(2).getLessons().size()); - Assert.assertEquals(14, holidays.getWeekTable().getDay(4).getLessons().size()); - } - - // Lesson - - @Test - public void getLessonNumberTest() throws Exception { - Assert.assertEquals("2", std.getWeekTable().getDay(0).getLesson(1).getNumber()); - Assert.assertEquals("5", std.getWeekTable().getDay(2).getLesson(4).getNumber()); - Assert.assertEquals("0", full.getWeekTable().getDay(0).getLesson(0).getNumber()); - Assert.assertEquals("13", full.getWeekTable().getDay(4).getLesson(13).getNumber()); - Assert.assertEquals("3", holidays.getWeekTable().getDay(3).getLesson(3).getNumber()); - } - - @Test - public void getLessonDayTest() throws Exception { - Assert.assertEquals("2017-06-19", std.getWeekTable().getDay(0).getLesson(1).getDate()); - Assert.assertEquals("2017-06-23", std.getWeekTable().getDay(4).getLesson(4).getDate()); - Assert.assertEquals("2017-06-20", full.getWeekTable().getDay(1).getLesson(6).getDate()); - Assert.assertEquals("2017-06-22", full.getWeekTable().getDay(3).getLesson(3).getDate()); - Assert.assertEquals("2017-08-02", holidays.getWeekTable().getDay(2).getLesson(8).getDate()); - } - - @Test - public void getLessonSubjectTest() throws Exception { - Assert.assertEquals("Historia", std.getWeekTable().getDay(0).getLesson(1).getSubject()); - Assert.assertEquals("Zajęcia techniczne", std.getWeekTable().getDay(2).getLesson(4).getSubject()); - Assert.assertEquals("Wychowanie fizyczne", std.getWeekTable().getDay(1).getLesson(1).getSubject()); - Assert.assertEquals("Język angielski", full.getWeekTable().getDay(0).getLesson(1).getSubject()); - Assert.assertEquals("Wychowanie do życia w rodzinie", full.getWeekTable().getDay(2).getLesson(0).getSubject()); - Assert.assertEquals("Wychowanie fizyczne", full.getWeekTable().getDay(3).getLesson(1).getSubject()); - Assert.assertEquals("Uroczyste zakończenie roku szkolnego", full.getWeekTable().getDay(4).getLesson(0).getSubject()); - Assert.assertEquals("Fizyka", full.getWeekTable().getDay(0).getLesson(0).getSubject()); - Assert.assertEquals("Metodologia programowania", full.getWeekTable().getDay(1).getLesson(0).getSubject()); - Assert.assertEquals("", holidays.getWeekTable().getDay(3).getLesson(3).getSubject()); - } - - @Test - public void getLessonTeacherTest() throws Exception { - Assert.assertEquals("Bogatka Katarzyna", std.getWeekTable().getDay(0).getLesson(1).getTeacher()); - Assert.assertEquals("Chlebowski Stanisław", std.getWeekTable().getDay(2).getLesson(4).getTeacher()); - Assert.assertEquals("Kobczyk Iwona", full.getWeekTable().getDay(0).getLesson(1).getTeacher()); - Assert.assertEquals("Bączek Grzegorz", full.getWeekTable().getDay(0).getLesson(7).getTeacher()); - Assert.assertEquals("Nowak Jadwiga", full.getWeekTable().getDay(2).getLesson(0).getTeacher()); - Assert.assertEquals("Nowicka Irena", full.getWeekTable().getDay(3).getLesson(1).getTeacher()); - Assert.assertEquals("Baran Małgorzata", full.getWeekTable().getDay(4).getLesson(0).getTeacher()); - Assert.assertEquals("", holidays.getWeekTable().getDay(3).getLesson(3).getTeacher()); - } - - @Test - public void getLessonRoomTest() throws Exception { - Assert.assertEquals("", std.getWeekTable().getDay(3).getLesson(3).getRoom()); - Assert.assertEquals("33", full.getWeekTable().getDay(0).getLesson(7).getRoom()); - Assert.assertEquals("19", full.getWeekTable().getDay(0).getLesson(0).getRoom()); - Assert.assertEquals("32", full.getWeekTable().getDay(1).getLesson(0).getRoom()); - Assert.assertEquals("32", full.getWeekTable().getDay(1).getLesson(8).getRoom()); - Assert.assertEquals("32", full.getWeekTable().getDay(2).getLesson(8).getRoom()); - Assert.assertEquals("G4", full.getWeekTable().getDay(3).getLesson(1).getRoom()); - Assert.assertEquals("37", full.getWeekTable().getDay(4).getLesson(0).getRoom()); - Assert.assertEquals("", holidays.getWeekTable().getDay(3).getLesson(3).getRoom()); - } - - @Test - public void getLessonDescriptionTest() throws Exception { - Assert.assertEquals("", std.getWeekTable().getDay(3).getLesson(3).getDescription()); - Assert.assertEquals("przeniesiona z lekcji 7, 01.12.2017", full.getWeekTable().getDay(1).getLesson(1).getDescription()); - Assert.assertEquals("okienko dla uczniów", full.getWeekTable().getDay(0).getLesson(7).getDescription()); - Assert.assertEquals("przeniesiona z lekcji 7, 20.06.2017", full.getWeekTable().getDay(1).getLesson(2).getDescription()); - Assert.assertEquals("przeniesiona z lekcji 4, 20.06.2017", full.getWeekTable().getDay(1).getLesson(3).getDescription()); - Assert.assertEquals("zastępstwo (poprzednio: Religia)", full.getWeekTable().getDay(2).getLesson(0).getDescription()); - Assert.assertEquals("zastępstwo (poprzednio: Wychowanie fizyczne)", full.getWeekTable().getDay(3).getLesson(1).getDescription()); - Assert.assertEquals("", full.getWeekTable().getDay(4).getLesson(0).getDescription()); - Assert.assertEquals("egzamin", full.getWeekTable().getDay(3).getLesson(0).getDescription()); - Assert.assertEquals("", holidays.getWeekTable().getDay(3).getLesson(3).getDescription()); - } - - @Test - public void getLessonGroupNameTest() throws Exception { - Assert.assertEquals("CH", std.getWeekTable().getDay(0).getLesson(2).getGroupName()); - Assert.assertEquals("JNPW", std.getWeekTable().getDay(4).getLesson(0).getGroupName()); - Assert.assertEquals("", full.getWeekTable().getDay(0).getLesson(7).getGroupName()); - Assert.assertEquals("zaw2", full.getWeekTable().getDay(1).getLesson(0).getGroupName()); - Assert.assertEquals("wf2", full.getWeekTable().getDay(1).getLesson(3).getGroupName()); - Assert.assertEquals("zaw1", full.getWeekTable().getDay(3).getLesson(1).getGroupName()); - Assert.assertEquals("", holidays.getWeekTable().getDay(3).getLesson(3).getGroupName()); - } - - @Test - public void getLessonStartTimeTest() throws Exception { - Assert.assertEquals("08:00", std.getWeekTable().getDay(0).getLesson(0).getStartTime()); - Assert.assertEquals("14:10", std.getWeekTable().getDay(3).getLesson(7).getStartTime()); - Assert.assertEquals("07:10", full.getWeekTable().getDay(0).getLesson(0).getStartTime()); - Assert.assertEquals("12:20", full.getWeekTable().getDay(2).getLesson(6).getStartTime()); - Assert.assertEquals("12:20", holidays.getWeekTable().getDay(2).getLesson(6).getStartTime()); - } - - @Test - public void getLessonEndTimeTest() throws Exception { - Assert.assertEquals("08:45", std.getWeekTable().getDay(1).getLesson(0).getEndTime()); - Assert.assertEquals("12:15", std.getWeekTable().getDay(2).getLesson(4).getEndTime()); - Assert.assertEquals("07:55", full.getWeekTable().getDay(1).getLesson(0).getEndTime()); - Assert.assertEquals("19:00", full.getWeekTable().getDay(3).getLesson(13).getEndTime()); - Assert.assertEquals("19:00", holidays.getWeekTable().getDay(3).getLesson(13).getEndTime()); - } - - @Test - public void getLessonIsEmptyTest() throws Exception { - Assert.assertFalse(std.getWeekTable().getDay(1).getLesson(4).isEmpty()); - Assert.assertTrue(std.getWeekTable().getDay(3).getLesson(7).isEmpty()); - Assert.assertFalse(full.getWeekTable().getDay(1).getLesson(1).isEmpty()); - Assert.assertFalse(full.getWeekTable().getDay(1).getLesson(2).isEmpty()); - Assert.assertFalse(full.getWeekTable().getDay(0).getLesson(7).isEmpty()); - Assert.assertTrue(full.getWeekTable().getDay(2).getLesson(9).isEmpty()); - Assert.assertTrue(holidays.getWeekTable().getDay(0).getLesson(5).isEmpty()); - Assert.assertTrue(holidays.getWeekTable().getDay(4).getLesson(13).isEmpty()); - } - - @Test - public void getLessonIsDivisionIntoGroupsTest() throws Exception { - Assert.assertTrue(std.getWeekTable().getDay(0).getLesson(2).isDivisionIntoGroups()); - Assert.assertTrue(std.getWeekTable().getDay(4).getLesson(0).isDivisionIntoGroups()); - Assert.assertFalse(full.getWeekTable().getDay(0).getLesson(7).isDivisionIntoGroups()); - Assert.assertTrue(full.getWeekTable().getDay(1).getLesson(3).isDivisionIntoGroups()); - Assert.assertTrue(full.getWeekTable().getDay(3).getLesson(1).isDivisionIntoGroups()); - Assert.assertFalse(holidays.getWeekTable().getDay(3).getLesson(3).isDivisionIntoGroups()); - } - - @Test - public void getLessonIsPlanningTest() throws Exception { - Assert.assertFalse(std.getWeekTable().getDay(4).getLesson(4).isPlanning()); - Assert.assertFalse(full.getWeekTable().getDay(0).getLesson(1).isPlanning()); - Assert.assertTrue(full.getWeekTable().getDay(1).getLesson(3).isPlanning()); - Assert.assertTrue(full.getWeekTable().getDay(4).getLesson(0).isPlanning()); - Assert.assertFalse(holidays.getWeekTable().getDay(3).getLesson(3).isPlanning()); - } - - @Test - public void getLessonIsRealizedTest() throws Exception { - Assert.assertTrue(std.getWeekTable().getDay(3).getLesson(3).isRealized()); - Assert.assertTrue(full.getWeekTable().getDay(0).getLesson(1).isRealized()); - Assert.assertTrue(full.getWeekTable().getDay(1).getLesson(3).isRealized()); - Assert.assertFalse(full.getWeekTable().getDay(4).getLesson(0).isRealized()); - Assert.assertFalse(holidays.getWeekTable().getDay(3).getLesson(3).isRealized()); - } - - @Test - public void getLessonIsMovedOrCanceledTest() throws Exception { - Assert.assertFalse(std.getWeekTable().getDay(3).getLesson(3).isMovedOrCanceled()); - Assert.assertTrue(full.getWeekTable().getDay(0).getLesson(7).isMovedOrCanceled()); - Assert.assertFalse(full.getWeekTable().getDay(1).getLesson(3).isMovedOrCanceled()); - Assert.assertFalse(full.getWeekTable().getDay(4).getLesson(0).isMovedOrCanceled()); - Assert.assertFalse(holidays.getWeekTable().getDay(3).getLesson(3).isMovedOrCanceled()); - } - - @Test - public void getLessonIsNewMovedInOrChangedTest() throws Exception { - Assert.assertFalse(std.getWeekTable().getDay(3).getLesson(3).isNewMovedInOrChanged()); - Assert.assertFalse(full.getWeekTable().getDay(0).getLesson(1).isNewMovedInOrChanged()); - Assert.assertTrue(full.getWeekTable().getDay(1).getLesson(2).isNewMovedInOrChanged()); - Assert.assertTrue(full.getWeekTable().getDay(1).getLesson(3).isNewMovedInOrChanged()); - Assert.assertTrue(full.getWeekTable().getDay(3).getLesson(1).isNewMovedInOrChanged()); - Assert.assertFalse(holidays.getWeekTable().getDay(3).getLesson(3).isNewMovedInOrChanged()); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/user/BasicInformationTest.java b/api/src/test/java/io/github/wulkanowy/api/user/BasicInformationTest.java deleted file mode 100644 index 6b729c95..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/user/BasicInformationTest.java +++ /dev/null @@ -1,106 +0,0 @@ -package io.github.wulkanowy.api.user; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class BasicInformationTest extends StudentAndParentTestCase { - - private BasicInformation basicInformation; - - @Before - public void setUp() throws Exception { - basicInformation = new BasicInformation(getSnp("UczenDanePodstawowe.html")); - } - - @Test - public void getPersonalFirstNameTest() throws Exception { - Assert.assertEquals("Maria", basicInformation.getPersonalData().getFirstName()); - } - - @Test - public void getPersonalSurnameTest() throws Exception { - Assert.assertEquals("Kamińska", basicInformation.getPersonalData().getSurname()); - } - - @Test - public void getPersonalFirstAndLastNameTest() throws Exception { - Assert.assertEquals("Maria Kamińska", - basicInformation.getPersonalData().getFirstAndLastName()); - } - - @Test - public void getPersonalNameTest() throws Exception { - Assert.assertEquals("Maria Aneta Kamińska", basicInformation.getPersonalData().getName()); - } - - @Test - public void getPersonalDateAndBirthPlaceTest() throws Exception { - Assert.assertEquals("01.01.1900, Warszawa", - basicInformation.getPersonalData().getDateAndBirthPlace()); - } - - @Test - public void getPersonalPeselTest() throws Exception { - Assert.assertEquals("12345678900", basicInformation.getPersonalData().getPesel()); - } - - @Test - public void getPersonalGenderTest() throws Exception { - Assert.assertEquals("Kobieta", basicInformation.getPersonalData().getGender()); - } - - @Test - public void isPersonalPolishCitizenshipTest() throws Exception { - Assert.assertTrue(basicInformation.getPersonalData().isPolishCitizenship()); - } - - @Test - public void getPersonalFamilyNameTest() throws Exception { - Assert.assertEquals("Nowak", basicInformation.getPersonalData().getFamilyName()); - } - - @Test - public void getPersonalParentsNames() throws Exception { - Assert.assertEquals("Gabriela, Kamil", - basicInformation.getPersonalData().getParentsNames()); - } - - @Test - public void getBasicAddressTest() throws Exception { - Assert.assertEquals("ul. Sportowa 16, 00-123 Warszawa", - basicInformation.getAddressData().getAddress()); - } - - @Test - public void getBasicRegisteredAddressTest() throws Exception { - Assert.assertEquals("ul. Sportowa 17, 00-123 Warszawa", - basicInformation.getAddressData().getRegisteredAddress()); - } - - @Test - public void getBasicCorrespondenceAddressTest() throws Exception { - Assert.assertEquals("ul. Sportowa 18, 00-123 Warszawa", - basicInformation.getAddressData().getCorrespondenceAddress()); - } - - @Test - public void getContactPhoneNumberTest() throws Exception { - Assert.assertEquals("005554433", - basicInformation.getContactDetails().getPhoneNumber()); - } - - @Test - public void getContactCellPhoneNumberTest() throws Exception { - Assert.assertEquals("555444333", - basicInformation.getContactDetails().getCellPhoneNumber()); - } - - @Test - public void getContactEmailTest() throws Exception { - Assert.assertEquals("wulkanowy@example.null", - basicInformation.getContactDetails().getEmail()); - } -} diff --git a/api/src/test/java/io/github/wulkanowy/api/user/FamilyInformationTest.java b/api/src/test/java/io/github/wulkanowy/api/user/FamilyInformationTest.java deleted file mode 100644 index b4f858ec..00000000 --- a/api/src/test/java/io/github/wulkanowy/api/user/FamilyInformationTest.java +++ /dev/null @@ -1,59 +0,0 @@ -package io.github.wulkanowy.api.user; - -import org.junit.Assert; -import org.junit.Before; -import org.junit.Test; - -import java.util.List; - -import io.github.wulkanowy.api.StudentAndParentTestCase; - -public class FamilyInformationTest extends StudentAndParentTestCase { - - private FamilyInformation familyInformation; - - @Before - public void setUp() throws Exception { - familyInformation = new FamilyInformation(getSnp("UczenDanePodstawowe.html")); - } - - @Test - public void getFamilyMembers() throws Exception { - Assert.assertEquals(2, familyInformation.getFamilyMembers().size()); - } - - @Test - public void getNameTest() throws Exception { - List list = familyInformation.getFamilyMembers(); - Assert.assertEquals("Marianna Pająk", list.get(0).getName()); - Assert.assertEquals("Dawid Świątek", list.get(1).getName()); - } - - @Test - public void getKinshipTest() throws Exception { - List list = familyInformation.getFamilyMembers(); - Assert.assertEquals("matka", list.get(0).getKinship()); - Assert.assertEquals("ojciec", list.get(1).getKinship()); - } - - @Test - public void getAddressTest() throws Exception { - List list = familyInformation.getFamilyMembers(); - Assert.assertEquals("ul. Sportowa 16, 00-123 Warszawa", list.get(0).getAddress()); - Assert.assertEquals("ul. Sportowa 18, 00-123 Warszawa", list.get(1).getAddress()); - } - - @Test - public void getTelephonesTest() throws Exception { - List list = familyInformation.getFamilyMembers(); - Assert.assertEquals("555111222", list.get(0).getTelephones()); - Assert.assertEquals("555222111", list.get(1).getTelephones()); - } - - @Test - public void getEmailTest() throws Exception { - List list = familyInformation.getFamilyMembers(); - Assert.assertEquals("wulkanowy@example.null", list.get(0).getEmail()); - Assert.assertEquals("wulkanowy@example.null", list.get(1).getEmail()); - } -} diff --git a/api/src/test/resources/io/github/wulkanowy/api/OcenyWszystkie-semester.html b/api/src/test/resources/io/github/wulkanowy/api/OcenyWszystkie-semester.html deleted file mode 100644 index f4b712c1..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/OcenyWszystkie-semester.html +++ /dev/null @@ -1,21 +0,0 @@ - - - - - Witryna ucznia i rodzica – Oceny - - -
-

Oceny

-
-
- - -
-
-
wersja: 17.05.0000.24042
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/Start.html b/api/src/test/resources/io/github/wulkanowy/api/Start.html deleted file mode 100644 index 40e69161..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/Start.html +++ /dev/null @@ -1,24 +0,0 @@ - - - - - Uonet+ - - -
-
-
-
- -
-
-
Uczeń
-
-
- -
-
-
-
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/attendance/Frekwencja-excellent.html b/api/src/test/resources/io/github/wulkanowy/api/attendance/Frekwencja-excellent.html deleted file mode 100644 index 5eaf50df..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/attendance/Frekwencja-excellent.html +++ /dev/null @@ -1,408 +0,0 @@ - - - - - Witryna ucznia i rodzica – Frekwencja - - - -
-

Frekwencja

- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
Lekcjaponiedziałek
31.08.2015		wtorek
01.09.2015		środa
02.09.2015		czwartek
03.09.2015		piątek
04.09.2015
0
1 -
- Uroczyste rozpoczęcie roku szkolnego 2015/2016 -
- 		-
- Wychowanie do życia w rodzinie -
- 		-
- Urządzenia techniki komputerowej -
-
2 -
- Język angielski -
- 		-
- Język niemiecki -
- 		-
- Urządzenia techniki komputerowej -
-
3 -
- Systemy operacyjne -
- 		-
- Chemia -
- 		-
- Urządzenia techniki komputerowej -
-
4 -
- Systemy operacyjne -
- 		-
- Geografia -
- 		-
- Urządzenia techniki komputerowej -
-
5 -
- Tworzenie stron internetowych -
- 		-
- Matematyka -
- 		-
- Język polski -
-
6 -
- Tworzenie stron internetowych -
- 		-
- Fizyka -
- 		-
- Matematyka -
-
7 -
- Wychowanie fizyczne -
- 		-
- Język polski -
- 		-
- Historia -
-
8 -
- Wychowanie fizyczne -
-
9
10
11
12
13
-

Statystyki

-
- - -
-

Frekwencja od początku roku szkolnego: 100,00%

- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
IXXXIXIIIIIIIIIVVVIVIIVIIIRazem
Obecność14214313911013175126139921141211
Nieobecność nieusprawiedliwiona
Nieobecność usprawiedliwiona
Nieobecność z przyczyn szkolnych
Spóźnienie nieusprawiedliwione
Spóźnienie usprawiedliwione
Zwolnienie
-
-
wersja: 17.07.0002.24480
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/attendance/Frekwencja-full.html b/api/src/test/resources/io/github/wulkanowy/api/attendance/Frekwencja-full.html deleted file mode 100644 index aa995305..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/attendance/Frekwencja-full.html +++ /dev/null @@ -1,498 +0,0 @@ - - - - - Witryna ucznia i rodzica – Frekwencja - - - -
-

Frekwencja

- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
Lekcjaponiedziałek
05.09.2016		wtorek
06.09.2016		środa
07.09.2016		czwartek
08.09.2016		piątek
09.09.2016
0
1 -
- Urządzenia techniki komputerowej -
- 		-
- Multimedia i grafika komputerowa -
- 		-
- Użytkowanie urządzeń peryferyjnych komputera -
- 		-
- Religia -
-
2 -
- Urządzenia techniki komputerowej -
- 		-
- Język niemiecki -
- 		-
- Użytkowanie urządzeń peryferyjnych komputera -
- 		-
- Język niemiecki -
- 		-
- Sieci komputerowe i administrowanie sieciami -
-
3 -
- Urządzenia techniki komputerowej -
- 		-
- Fizyka -
- 		-
- Historia -
- 		-
- Wychowanie fizyczne -
- 		-
- Wiedza o kulturze -
-
4 -
- Naprawa komputera -
- 		-
- Wychowanie fizyczne -
- 		-
- Język angielski -
- 		-
- Wychowanie fizyczne -
- 		-
- Język polski -
-
5 -
- Sieci komputerowe i administrowanie sieciami -
- 		-
- Metodologia programowania -
- 		-
- Urządzenia techniki komputerowej -
- 		-
- Matematyka -
- 		-
- Metodologia programowania -
-
6 -
- Język niemiecki -
- 		-
- Sieci komputerowe i administrowanie sieciami -
- 		-
- Język polski -
- 		-
- Podstawy przedsiębiorczości -
- 		-
- Matematyka -
-
7 -
- Fizyka -
- 		-
- Język polski -
- 		-
- Systemy operacyjne -
- 		-
- Zajęcia z wychowawcą -
- 		-
- Religia -
-
8 -
- Naprawa komputera -
- 		-
- Systemy operacyjne -
- 		-
- Urządzenia techniki komputerowej -
- 		-
- Zajęcia z wychowawcą -
-
9
10
11
12
13
-

Statystyki

-
- - -
-

Frekwencja od początku roku szkolnego: 80,94%

- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
IXXXIXIIIIIIIIIVVVIVIIVIIIRazem
Obecność1351031085437100339010359822
Nieobecność nieusprawiedliwiona246
Nieobecność usprawiedliwiona627293044161327192
Nieobecność z przyczyn szkolnych77
Spóźnienie nieusprawiedliwione41222112
Spóźnienie usprawiedliwione11
Zwolnienie112
-
-
wersja: 17.07.0002.24480
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/exams/Sprawdziany-one-per-day.html b/api/src/test/resources/io/github/wulkanowy/api/exams/Sprawdziany-one-per-day.html deleted file mode 100644 index ecc48cf1..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/exams/Sprawdziany-one-per-day.html +++ /dev/null @@ -1,85 +0,0 @@ - - - - - Witryna ucznia i rodzica – Terminarz sprawdzianów - - -
-

Sprawdziany

-

Tydzień 23.10.2017 - 29.10.2017

-
-

poniedziałek, 23.10.2017

-
-
-
Przedmiot i grupa:
-
Sieci komputerowe 3Ti|zaw2
-
-
-
Rodzaj sprawdzianu:
-
Sprawdzian
-
-
-
Opis:
-
Łącza danych
-
-
-
Nauczyciel i data wpisu:
-
Adam Wiśniewski [AW], 16.10.2017
-
-
-
-
-

wtorek, 24.10.2017

-
-
-
Przedmiot i grupa:
-
Język angielski 3Ti|J1
-
-
-
Rodzaj sprawdzianu:
-
Sprawdzian
-
-
-
Opis:
-
Czasy teraźniejsze
-
-
-
Nauczyciel i data wpisu:
-
Natalia Nowak [NN], 17.10.2017
-
-
-
-
-
-
-

piątek, 27.10.2017

-
-
-
Przedmiot i grupa:
-
Metodologia programowania 3Ti|zaw2
-
-
-
Rodzaj sprawdzianu:
-
Sprawdzian
-
-
-
Opis:
-
-
-
-
Nauczyciel i data wpisu:
-
Małgorzata Nowacka [MN], 16.10.2017
-
-
-
-
-
-
- Poprzedni tydzień - Następny tydzień -
-
-
wersja: 17.08.0001.24874
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/grades/OcenyWszystkie-filled.html b/api/src/test/resources/io/github/wulkanowy/api/grades/OcenyWszystkie-filled.html deleted file mode 100644 index a229d1d5..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/grades/OcenyWszystkie-filled.html +++ /dev/null @@ -1,108 +0,0 @@ - - - - - Witryna ucznia i rodzica – Oceny - - -
-

Oceny

-
-
- - -
-
- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
PrzedmiotOcena cząstkowaOpisWagaDataNauczyciel
ZachowanieBrak ocen
Zajęcia z wychowawcą - 5 - A1, Dzień Kobiet w naszej klasie1,0021.03.2017Patryk Maciejewski
Edukacja dla bezpieczeństwa - 4- - S1, PIERWSZA POMOC I RESUSCYTACJA5,0031.03.2017Weronika Ratajczak
Fizyka - 2 - O, Odpowiedź3,0025.06.2017Jakub Michalak
Język angielski - 5 - BW3, Writing3,0002.06.2017Oliwia Woźniak
Wiedza o społeczeństwieBrak ocen
Wychowanie fizyczne1STR8,0002.04.2017Klaudia Dziedzic
Język polski1K, Kordian5,0006.02.2017Amelia Stępień
-
-
wersja: 17.02.0000.23328
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/grades/OcenyWszystkie-subjects-average.html b/api/src/test/resources/io/github/wulkanowy/api/grades/OcenyWszystkie-subjects-average.html deleted file mode 100644 index 023b5405..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/grades/OcenyWszystkie-subjects-average.html +++ /dev/null @@ -1,70 +0,0 @@ - - - - - Witryna ucznia i rodzica – Oceny - - -
-

Oceny

-
-
- - -
-
- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
PrzedmiotOceny cząstkoweŚredniaPrzewidywana ocena rocznaOcena roczna
ZachowanieBrak ocen-bardzo dobrebardzo dobre
Język polski03,53-dobry
Wychowanie fizyczne05,05bardzo dobrycelujący
Język angielski04,44/5bardzo dobry
Wiedza o społeczeństwieBrak ocen---
-
-
wersja: 17.02.0000.23328
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/grades/OcenyWszystkie-subjects.html b/api/src/test/resources/io/github/wulkanowy/api/grades/OcenyWszystkie-subjects.html deleted file mode 100644 index 0f6da414..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/grades/OcenyWszystkie-subjects.html +++ /dev/null @@ -1,64 +0,0 @@ - - - - - Witryna ucznia i rodzica – Oceny - - -
-

Oceny

-
-
- - -
-
- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
PrzedmiotOceny cząstkowePrzewidywana ocena rocznaOcena roczna
Zachowanie-bardzo dobrebardzo dobre
Praktyka zawodowa--celujący
Metodologia programowania-bardzo dobrycelujący
Podstawy przedsiębiorczości-3/4dostateczny
Wychowanie do życia w rodzinie---
-
-
wersja: 17.05.0000.24042
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-brak-dostepu.html b/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-brak-dostepu.html deleted file mode 100644 index 2911f1d2..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-brak-dostepu.html +++ /dev/null @@ -1,15 +0,0 @@ - - - - Logowanie - - -
-
- Adres example@wulkanowy.io nie został zarejestrowany w dzienniku uczniowskim jako adres rodzica, bądź ucznia. - Jeśli jesteś rodzicem (prawnym opiekunem) ucznia (lub uczniem) szkoły korzystającej z dziennika „UONET +” udaj się do - wychowawcy i poproś o wprowadzenie Twojego adresu e-mail do Twoich danych. -
-
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-certyfikat.html b/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-certyfikat.html deleted file mode 100644 index a8496cd1..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-certyfikat.html +++ /dev/null @@ -1,17 +0,0 @@ - - - Working... - - -
- - - - -
- - - diff --git a/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-error.html b/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-error.html deleted file mode 100644 index 08713188..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-error.html +++ /dev/null @@ -1,18 +0,0 @@ - - - - Logowanie (demo123) - - -
-
-
- Zła nazwa użytkownika lub hasło -
-
-
- - - diff --git a/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-success.html b/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-success.html deleted file mode 100644 index 23c27a3f..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/login/Logowanie-success.html +++ /dev/null @@ -1,16 +0,0 @@ - - - - - Uonet+ - - -
-
-
- example@wulkanowy.io (wyloguj) -
-
-
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/login/PrzerwaTechniczna.html b/api/src/test/resources/io/github/wulkanowy/api/login/PrzerwaTechniczna.html deleted file mode 100644 index 062f9b60..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/login/PrzerwaTechniczna.html +++ /dev/null @@ -1,23 +0,0 @@ - - - - - Przerwa techniczna - - -
-
-
-

Przerwa techniczna

-

Aktualnie trwają prace konserwacyjne. Witryna będzie dostępna za kilka minut.

> -
-
- Przejdź do strony głównej -
-
-

3

-
-
-
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/login/cert.xml b/api/src/test/resources/io/github/wulkanowy/api/login/cert.xml deleted file mode 100644 index 549b2d42..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/login/cert.xml +++ /dev/null @@ -1,18 +0,0 @@ - - - - - - - Default - demo12345 - incorrect value - warszawa - asdf - asdfsdf - - - - - - diff --git a/api/src/test/resources/io/github/wulkanowy/api/messages/GetTrescWiadomosci.json b/api/src/test/resources/io/github/wulkanowy/api/messages/GetTrescWiadomosci.json deleted file mode 100644 index 1ba54a32..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/messages/GetTrescWiadomosci.json +++ /dev/null @@ -1,7 +0,0 @@ -{ - "success": true, - "data": { - "Id": 12345, - "Tresc": "Witam, …. \nPozdrawiam Krzysztof Czerkas" - } -} diff --git a/api/src/test/resources/io/github/wulkanowy/api/messages/GetWiadomosciOdebrane.json b/api/src/test/resources/io/github/wulkanowy/api/messages/GetWiadomosciOdebrane.json deleted file mode 100644 index 326390ed..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/messages/GetWiadomosciOdebrane.json +++ /dev/null @@ -1,35 +0,0 @@ -{ - "success": true, - "data": [ - { - "Nieprzeczytana": false, - "Data": "2016-03-15 09:00:00", - "Tresc": null, - "Temat": "Wycieczka", - "NadawcaNazwa": "Kowalski Jan", - "IdWiadomosci": 1234, - "IdNadawca": 4321, - "Id": 12345 - }, - { - "Nieprzeczytana": true, - "Data": "2016-04-20 22:00:00", - "Tresc": null, - "Temat": "\"Dzień dobrego słowa\"", - "NadawcaNazwa": "Pazura Agnieszka", - "IdWiadomosci": 1235, - "IdNadawca": 12, - "Id": 12346 - }, - { - "Nieprzeczytana": false, - "Data": "2016-04-29 10:00:00", - "Tresc": null, - "Temat": "Rozdajemy oceny celujące", - "NadawcaNazwa": "Kowalski Jan", - "IdWiadomosci": 1236, - "IdNadawca": 4321, - "Id": 12347 - } - ] -} diff --git a/api/src/test/resources/io/github/wulkanowy/api/messages/GetWiadomosciUsuniete-empty.json b/api/src/test/resources/io/github/wulkanowy/api/messages/GetWiadomosciUsuniete-empty.json deleted file mode 100644 index 36f89aa1..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/messages/GetWiadomosciUsuniete-empty.json +++ /dev/null @@ -1,4 +0,0 @@ -{ - "success": true, - "data": [] -} diff --git a/api/src/test/resources/io/github/wulkanowy/api/messages/PageError.html b/api/src/test/resources/io/github/wulkanowy/api/messages/PageError.html deleted file mode 100644 index ae976af1..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/messages/PageError.html +++ /dev/null @@ -1,88 +0,0 @@ - - - - - - - - - - Błąd strony - - - -
-
 
-
-
- Wystąpił nieoczekiwany błąd -
- 
Wystąpił błąd aplikacji. Prosimy zalogować się ponownie. Jeśli problem będzie się powtarzał, prosimy o kontakt z serwisem.
-
-
-
-
- Copyright © VULCAN 2018 Wszelkie prawa zastrzeżone -
-
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/messages/UndefinedError.txt b/api/src/test/resources/io/github/wulkanowy/api/messages/UndefinedError.txt deleted file mode 100644 index c8d55a96..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/messages/UndefinedError.txt +++ /dev/null @@ -1 +0,0 @@ -The custom error module does not recognize this error. \ No newline at end of file diff --git a/api/src/test/resources/io/github/wulkanowy/api/notes/UwagiOsiagniecia-empty.html b/api/src/test/resources/io/github/wulkanowy/api/notes/UwagiOsiagniecia-empty.html deleted file mode 100644 index b15bb6e7..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/notes/UwagiOsiagniecia-empty.html +++ /dev/null @@ -1,20 +0,0 @@ - - - - - Witryna ucznia i rodzica – Uwagi i osiągnięcia - - -
-
-

Uwagi

-

Brak informacji do wyświetlenia

-
-
-

Osiągnięcia

-

Brak informacji do wyświetlenia

-
-
-
wersja: 17.05.0000.24042
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/notes/UwagiOsiagniecia-filled.html b/api/src/test/resources/io/github/wulkanowy/api/notes/UwagiOsiagniecia-filled.html deleted file mode 100644 index 50e74058..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/notes/UwagiOsiagniecia-filled.html +++ /dev/null @@ -1,65 +0,0 @@ - - - - - Witryna ucznia i rodzica – Uwagi i osiągnięcia - - -
-
-

Uwagi

-

06.06.2017

-
-
-
Nauczyciel:
-
Jan Kowalski [JK]
-
-
-
Kategoria:
-
Zaangażowanie społeczne
-
-
-
Treść:
-
Pomoc przy pikniku charytatywnym
-
-
-

01.12.2016

-
-
-
Nauczyciel:
-
Ochocka Zofia [PZ]
-
-
-
Kategoria:
-
Reprezentowanie szkoły
-
-
-
Treść:
-
Udział w przygotowaniu spektaklu
-
-
-

01.10.2016

-
-
-
Nauczyciel:
-
Kochański Leszek [KL]
-
-
-
Kategoria:
-
Zachowanie na lekcji
-
-
-
Treść:
-
Przeszkadzanie w prowadzeniu lekcji
-
-
-
-
-

Osiągnięcia

-
I miejsce w ogólnopolskim konkursie ortograficznym
-
III miejsce w ogólnopolskim konkursie plastycznym
-
-
-
wersja: 17.05.0000.24042
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/school/Szkola.html b/api/src/test/resources/io/github/wulkanowy/api/school/Szkola.html deleted file mode 100644 index 05a698a0..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/school/Szkola.html +++ /dev/null @@ -1,136 +0,0 @@ - - - - - Witryna ucznia i rodzica – Szkoła i nauczyciele - - -
-

Szkoła

-
-
- Nazwa szkoły: - Zespół Szkół nr 64 -
-
- Adres szkoły: - ul. Wiśniowa 128, 01-234 Rogalowo, Nibylandia -
-
- Telefon: - 55 5555555 -
-
- Imię i nazwisko dyrektora: - Antoni Sobczyk -
-
- Imię i nazwisko pedagoga: - Zofia Czerwińska [ZC], Aleksander Krzemiński [AK], Karolina Kowalska [KK], Bartek Dąbrowski [BD] -
-
-

Nauczyciele

-

- Klasa: 1a, Wychowawcy: - Karolina Kowalska [AN], Antoni Sobczyk [AS]

-
- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
Lp.PrzedmiotNauczyciel
1BiologiaKarolina Kowalska [AN]
2ChemiaZofia Czerwińska [NA]
3Edukacja dla bezpieczeństwaAleksandra Krajewska [AK]
4FizykaStanisław Krupa [BS]
5GeografiaAleksandra Wójtowicz [AW]
6HistoriaSara Wierzbicka [KB]
7Język angielskiKarolina Kowalska [AN], Mateusz Kowal [MK], Amelia Mazur [AM]
8Język niemieckiMateusz Kowal [MK], Barbara Markowska [BM]
9Język polskiMichał Mazur [MM]
10MatematykaSzymon Wojciechowski [SW]
11PlastykaMichał Mazur [MM]
12ReligiaMaja Wiśniewska [M]
13Wiedza o społeczeństwieKarolina Kowalska [AN]
14Wychowanie do życia w rodzinieZofia Czerwińska [NA]
15Wychowanie fizyczneKarolina Kowalska [AN], Liliana Kowal [LK]
16Zajęcia techniczneBartek Dąbrowski [BD]
17Zajęcia z wychowawcąKarolina Kowalska [AN]
-
-
wersja: 17.02.0000.23328
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/timetable/PlanLekcji-full.html b/api/src/test/resources/io/github/wulkanowy/api/timetable/PlanLekcji-full.html deleted file mode 100644 index 53eb0485..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/timetable/PlanLekcji-full.html +++ /dev/null @@ -1,466 +0,0 @@ - - - - - Witryna ucznia i rodzica – Plan lekcji - - -
-

Plan lekcji

-
- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
LekcjaPora lekcjiponiedziałek
19.06.2017		wtorek
20.06.2017		środa
21.06.2017		czwartek
22.06.2017		piątek
23.06.2017
007:10 07:55 -
- Fizyka [zaw2] - - Bączek Grzegorz - 19 - (uczniowie zwolnieni do domu) -
- 		-
- Metodologia programowania [zaw2] - - - 32 -
- 		-
- Religia - Cyranka Krystian - 3 - Wychowanie do życia w rodzinie - Nowak Jadwiga - 3 - (zastępstwo) -
- 		-
- Język polski - - 16 - (oddział nieobecny) -
- -
egzamin
- 		-
- Uroczyste zakończenie roku szkolnego - Baran Małgorzata - 37 -
-
108:00 08:45 -
- Język angielski [J1] - - Kobczyk Iwona - -
- 		-
- Metodologia programowania [zaw2] - - Baran Małgorzata - 36 - (zmiana organizacji zajęć) -
-
- Wychowanie fizyczne [zaw2] - - - G3 - (przeniesiona z lekcji 7, 01.12.2017) -
- 		-
- Użytkowanie urządzeń peryferyjnych komputera [zaw2] - - Bączek Robert - -
- 		-
- Wychowanie fizyczne [zaw1] - - Jarocki Krzysztof - G4 - Wychowanie fizyczne [zaw1] - - Nowicka Irena - G4 - (zastępstwo) -
-
208:50 09:35 -
- Język polski - Bocian Natalia - -
- 		-
- Język niemiecki [J1] - - Rożeniec Honorata - 25 - (okienko dla uczniów) -
-
- Język polski - Bocian Natalia - - (przeniesiona z lekcji 7, 20.06.2017) -
-
- Język polski - Bocian Natalia - -
- 		-
- Urządzenia techniki komputerowej [zaw2] - - Bocian Grzegorz - -
- 		-
- Matematyka - Baran Małgorzata - -
-
309:40 10:25 -
- Język polski - Bocian Natalia - -
- 		-
- Fizyka - Bączek Grzegorz - 19 - (okienko dla uczniów) -
-
- Wychowanie fizyczne [wf2] - - Nowicka Irena - - (przeniesiona z lekcji 4, 20.06.2017) -
-
- Wychowanie fizyczne [wf2] - - Nowicka Irena - -
- 		-
- Metodologia programowania [zaw2] - - Baran Małgorzata - -
- 		-
- Wychowanie fizyczne [wf2] - - Nowicka Irena - -
-
410:40 11:25 -
- Urządzenia techniki komputerowej [zaw2] - - Bocian Grzegorz - -
- 		-
- Wychowanie fizyczne [wf2] - - Nowicka Irena - - (przeniesiona na lekcję 3, 20.06.2017) -
- 		-
- Matematyka - Baran Małgorzata - -
- 		-
- Wychowanie fizyczne [wf2] - - Nowicka Irena - -
-
511:30 12:15 -
- Urządzenia techniki komputerowej [zaw2] - - Bocian Grzegorz - -
- 		-
- Podstawy przedsiębiorczości - Bogatka Anna - W12 - (okienko dla uczniów) -
- 		-
- Religia - Cyranka Krystian - -
- 		-
- Sieci komputerowe i administrowanie sieciami [zaw2] - - Rożeniec Piotr - -
-
612:20 13:05 -
- Matematyka - Baran Małgorzata - -
- 		-
- Podstawy przedsiębiorczości - Bogatka Anna - W12 - (okienko dla uczniów) -
- 		-
- Język angielski [J1] - - Brodziec Sylwia - -
- 		-
- Religia - Cyranka Krystian - -
-
713:10 13:55 -
- Fizyka - Bączek Grzegorz - 33 - (okienko dla uczniów) -
- 		-
- Język polski - Bocian Natalia - - (przeniesiona na lekcję 2, 20.06.2017) -
- 		-
- Multimedia i grafika komputerowa [zaw2] - - Bocian Konrad - -
- 		-
- Wiedza o kulturze - Bocian Natalia - -
-
814:00 14:45 -
- Zajęcia z wychowawcą - Baran Małgorzata - -
- 		-
- Naprawa komputera [zaw2] - - Kraska Maciej - 32 - (okienko dla uczniów) -
- 		-
- Systemy operacyjne [zaw2] - - Kraska Maciej - 32 -
-
914:50 15:35 -
- Język niemiecki [J1] - - Rożeniec Honorata - 25 - (uczniowie zwolnieni do domu) -
-
1015:40 16:25
1116:35 17:20
1217:25 18:10
1318:15 19:00
-
-
-
- Kursywa- planowane -
-
- Zwykła czcionka- zrealizowane -
-
- Przekreślone- odwołane lub przeniesione -
-
- Pogrubione- nowe lekcje, przeniesione z innego terminu, zastępstwa -
-
-
-
wersja: 17.05.0000.24042
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/timetable/PlanLekcji-holidays.html b/api/src/test/resources/io/github/wulkanowy/api/timetable/PlanLekcji-holidays.html deleted file mode 100644 index 09555cf3..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/timetable/PlanLekcji-holidays.html +++ /dev/null @@ -1,156 +0,0 @@ - - - - - Witryna ucznia i rodzica – Plan lekcji - - -
-

Plan lekcji

-
- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
LekcjaPora lekcjiponiedziałek
31.07.2017
Ferie letnie		wtorek
01.08.2017
Ferie letnie		środa
02.08.2017
Ferie letnie		czwartek
03.08.2017
Ferie letnie		piątek
04.08.2017
Ferie letnie
007:10 07:55
108:00 08:45
208:50 09:35
309:40 10:25
410:40 11:25
511:30 12:15
612:20 13:05
713:10 13:55
814:00 14:45
914:50 15:35
1015:40 16:25
1116:35 17:20
1217:25 18:10
1318:15 19:00
-
-
-
wersja: 17.05.0000.24042
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/timetable/PlanLekcji-std.html b/api/src/test/resources/io/github/wulkanowy/api/timetable/PlanLekcji-std.html deleted file mode 100644 index 8bcc9794..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/timetable/PlanLekcji-std.html +++ /dev/null @@ -1,303 +0,0 @@ - - - - - Witryna ucznia i rodzica – Plan lekcji - - -
-

Plan lekcji

-
- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
LekcjaPora lekcjiponiedziałek
19.06.2017		wtorek
20.06.2017		środa
21.06.2017		czwartek
22.06.2017		piątek
23.06.2017
108:00 08:45 -
- Edukacja dla bezpieczeństwa - Kobczyk Iwona - -
- 		-
- Język niemiecki [JNPW] - - Dzwoniec Ewa - -
- 		-
- Wychowanie do życia w rodzinie - Baran Dominika - -
- 		-
- Język niemiecki [JNPW] - - Dzwoniec Ewa - -
-
208:50 09:35 -
- Historia - Bogatka Katarzyna - -
- 		-
- Wychowanie fizyczne [CH] - - Brodziec Dominika - -
- 		-
- Fizyka - Bocian Łukasz - -
- 		-
- Biologia - Kowalska Anna - -
- 		-
- Religia - Kraska Maciej - -
-
309:40 10:25 -
- Wychowanie fizyczne [CH] - - Brodziec Dominika - -
- 		-
- Język polski - Rożeniec Paulina - -
- 		-
- Matematyka - Bączek Dominika - -
- 		-
- Plastyka - Rożeniec Paulina - -
- 		-
- Zajęcia z wychowawcą - Kowalska Anna - -
-
410:30 11:15 -
- Geografia - Orłowski Konrad - -
- 		-
- Matematyka - Bączek Dominika - -
- 		-
- Język angielski [JAPN] - - Biegus Kazimiera - -
- 		-
- Matematyka - Bączek Dominika - -
- 		-
- Historia - Bogatka Katarzyna - -
-
511:30 12:15 -
- Matematyka - Bączek Dominika - -
- 		-
- Biologia - Kowalska Anna - -
- 		-
- Zajęcia techniczne - Chlebowski Stanisław - -
- 		-
- Język angielski [JAPN] - - Biegus Kazimiera - -
- 		-
- Język polski - Rożeniec Paulina - -
-
612:30 13:15 -
- Matematyka - Bączek Dominika - -
- 		-
- Fizyka - Bocian Łukasz - -
- 		-
- Język polski - Rożeniec Paulina - -
- 		-
- Wychowanie fizyczne [CH] - - Brodziec Dominika - -
- 		-
- Język polski - Rożeniec Paulina - -
-
713:20 14:05 -
- Język angielski [JAPN] - - Biegus Kazimiera - -
- 		-
- Religia - Kraska Maciej - -
- 		-
- Wychowanie fizyczne [CH] - - Brodziec Dominika - -
-
814:10 14:55
-
-
-
wersja: 17.02.0000.23328
- - diff --git a/api/src/test/resources/io/github/wulkanowy/api/user/UczenDanePodstawowe.html b/api/src/test/resources/io/github/wulkanowy/api/user/UczenDanePodstawowe.html deleted file mode 100644 index c54dd861..00000000 --- a/api/src/test/resources/io/github/wulkanowy/api/user/UczenDanePodstawowe.html +++ /dev/null @@ -1,119 +0,0 @@ - - - - - Witryna ucznia i rodzica – Dane ucznia - - -
-

Dane podstawowe

-

Dane osobowe

-
-
- Imię (imiona) nazwisko: - Maria Aneta Kamińska -
-
- Data i miejsce urodzenia: - 01.01.1900, Warszawa -
-
- PESEL: - 12345678900 -
-
- Płeć: - Kobieta -
-
- Obywatelstwo polskie: - Tak -
-
- Nazwisko rodowe: - Nowak -
-
- Imię matki i ojca: - Gabriela, Kamil -
-
-

Dane adresowe

-
-
- Adres zamieszkania: - ul. Sportowa 16, 00-123 Warszawa -
-
- Adres zameldowania: - ul. Sportowa 17, 00-123 Warszawa -
-
- Adres korespondencji: - ul. Sportowa 18, 00-123 Warszawa -
-
-

Kontakt

-
-
- Telefon: - 005554433 -
-
- Telefon komórkowy: - 555444333 -
-
- E-mail: - wulkanowy@example.null -
-
-

Rodzina

-
-
- Nazwisko i imię: - Marianna Pająk -
-
- Stopień pokrewieństwa: - matka -
-
- Adres: - ul. Sportowa 16, 00-123 Warszawa -
-
- Telefony: - 555111222 -
-
- E-mail: - wulkanowy@example.null -
-
-
-
- Nazwisko i imię: - Dawid Świątek -
-
- Stopień pokrewieństwa: - ojciec -
-
- Adres: - ul. Sportowa 18, 00-123 Warszawa -
-
- Telefony: - 555222111 -
-
- E-mail: - wulkanowy@example.null -
-
-
-
wersja: 17.02.0000.23328
- - diff --git a/app/.gitignore b/app/.gitignore deleted file mode 100644 index 796b96d1..00000000 --- a/app/.gitignore +++ /dev/null @@ -1 +0,0 @@ -/build diff --git a/app/build.gradle b/app/build.gradle index 444a166b..b046834a 100644 --- a/app/build.gradle +++ b/app/build.gradle @@ -1,106 +1,207 @@ -buildscript { - repositories { - maven { url "https://plugins.gradle.org/m2/" } - maven { url 'https://maven.fabric.io/public' } - } - - dependencies { - classpath 'org.greenrobot:greendao-gradle-plugin:3.2.2' - classpath 'io.fabric.tools:gradle:1.25.1' - } -} - -repositories { - maven { url 'https://maven.fabric.io/public' } -} - apply plugin: 'com.android.application' -apply plugin: 'org.greenrobot.greendao' -apply plugin: 'io.fabric' -apply from: '../jacoco.gradle' -apply from: '../android-sonarqube.gradle' +apply plugin: 'kotlin-android' +apply plugin: 'kotlin-kapt' +apply plugin: 'dagger.hilt.android.plugin' +apply plugin: 'com.google.firebase.crashlytics' +apply plugin: 'com.github.triplet.play' +apply plugin: 'com.mikepenz.aboutlibraries.plugin' +apply from: 'jacoco.gradle' +apply from: 'sonarqube.gradle' +apply from: 'hooks.gradle' android { - compileSdkVersion 27 - buildToolsVersion "27.0.3" + compileSdkVersion 29 + buildToolsVersion '29.0.3' + defaultConfig { applicationId "io.github.wulkanowy" testApplicationId "io.github.tests.wulkanowy" - minSdkVersion 15 - targetSdkVersion 27 - versionCode 1 - versionName "0.1.0" - testInstrumentationRunner "android.support.test.runner.AndroidJUnitRunner" + minSdkVersion 17 + targetSdkVersion 29 + versionCode 66 + versionName "0.20.2" + multiDexEnabled true + resValue "string", "app_name", "Wulkanowy" + testInstrumentationRunner "androidx.test.runner.AndroidJUnitRunner" vectorDrawables.useSupportLibrary = true manifestPlaceholders = [ - fabricApiKey: System.getenv("FABRIC_API_KEY") ?: "null" + firebase_enabled: project.hasProperty("enableFirebase") ] + javaCompileOptions { + annotationProcessorOptions { + arguments += [ + "room.schemaLocation": "$projectDir/schemas".toString(), + "room.incremental" : "true" + ] + } + } + } + + sourceSets { + androidTest.assets.srcDirs += files("$projectDir/schemas".toString()) + } + + signingConfigs { + release { + storeFile file("upload-key.jks") + storePassword System.getenv("PLAY_STORE_PASSWORD") + keyAlias System.getenv("PLAY_KEY_ALIAS") + keyPassword System.getenv("PLAY_KEY_PASSWORD") + } } buildTypes { release { - minifyEnabled false + minifyEnabled true + shrinkResources true proguardFiles getDefaultProguardFile('proguard-android.txt'), 'proguard-rules.pro' + signingConfig signingConfigs.release } debug { - testCoverageEnabled = true - ext.enableCrashlytics = false + resValue "string", "app_name", "Wulkanowy DEV " + defaultConfig.versionCode + applicationIdSuffix ".dev" + versionNameSuffix "-dev" + testCoverageEnabled = project.hasProperty('coverage') + ext.enableCrashlytics = project.hasProperty("enableFirebase") } } - testOptions { - unitTests.all { - testLogging { - events "passed", "skipped", "failed", "standardOut", "standardError" - outputs.upToDateWhen { false } - showStandardStreams = true - } + flavorDimensions "platform" + + productFlavors { + play { + dimension "platform" } + + fdroid { + dimension "platform" + } + } + + buildFeatures { + viewBinding = true + } + + lintOptions { + disable 'HardwareIds' + } + + compileOptions { + coreLibraryDesugaringEnabled true + sourceCompatibility JavaVersion.VERSION_1_8 + targetCompatibility JavaVersion.VERSION_1_8 + } + + kotlinOptions { + jvmTarget = "1.8" + freeCompilerArgs += ["-Xopt-in=kotlin.RequiresOptIn", "-Xjvm-default=all"] + } + + packagingOptions { + exclude 'META-INF/library_release.kotlin_module' + exclude 'META-INF/library-core_release.kotlin_module' + } + + aboutLibraries { + configPath = "app/src/main/res/raw" } } -greendao { - schemaVersion 20 - generateTests = true +play { + serviceAccountEmail = System.getenv("PLAY_SERVICE_ACCOUNT_EMAIL") ?: "jan@fakelog.cf" + serviceAccountCredentials = file('key.p12') + defaultToAppBundles = false + track = 'alpha' +} + +ext { + work_manager = "2.4.0" + room = "2.2.5" + chucker = "3.2.0" + mockk = "1.10.0" +} + +configurations.all { + resolutionStrategy.force "androidx.constraintlayout:constraintlayout:1.1.3" } dependencies { - implementation project(':api') - implementation 'com.android.support:appcompat-v7:27.1.0' - implementation 'com.android.support:design:27.1.0' - implementation 'com.android.support:support-v4:27.1.0' - implementation 'com.android.support:recyclerview-v7:27.1.0' - implementation 'com.android.support:cardview-v7:27.1.0' - implementation 'com.android.support:customtabs:27.1.0' - implementation 'com.firebase:firebase-jobdispatcher:0.8.5' - implementation 'org.apache.commons:commons-lang3:3.7' - implementation 'eu.davidea:flexible-adapter:5.0.0-rc4' - implementation 'eu.davidea:flexible-adapter-ui:1.0.0-b1' - implementation 'org.apache.commons:commons-collections4:4.1' - implementation 'org.greenrobot:greendao:3.2.2' - implementation 'com.jakewharton:butterknife:8.8.1' - implementation 'joda-time:joda-time:2.9.9' - implementation 'com.google.dagger:dagger-android:2.14.1' - implementation 'com.google.dagger:dagger-android-support:2.14.1' - implementation 'com.aurelhubert:ahbottomnavigation:2.1.0' + implementation "io.github.wulkanowy:sdk:0.20.2" - implementation('com.crashlytics.sdk.android:crashlytics:2.8.0@aar') { - transitive = true - } - implementation('com.crashlytics.sdk.android:answers:1.4.1@aar') { - transitive = true - } + coreLibraryDesugaring 'com.android.tools:desugar_jdk_libs:1.0.10' - annotationProcessor 'com.google.dagger:dagger-android-processor:2.14.1' - annotationProcessor 'com.google.dagger:dagger-compiler:2.14.1' - annotationProcessor 'com.jakewharton:butterknife-compiler:8.8.1' + implementation "org.jetbrains.kotlin:kotlin-stdlib-jdk8:$kotlin_version" + implementation 'org.jetbrains.kotlinx:kotlinx-coroutines-android:1.3.9' - debugImplementation 'com.amitshekhar.android:debug-db:1.0.1' - debugImplementation 'net.zetetic:android-database-sqlcipher:3.5.9' + implementation "androidx.core:core-ktx:1.3.1" + implementation "androidx.activity:activity-ktx:1.1.0" + implementation "androidx.appcompat:appcompat:1.2.0" + implementation "androidx.appcompat:appcompat-resources:1.2.0" + implementation "androidx.fragment:fragment-ktx:1.2.5" + implementation "androidx.annotation:annotation:1.1.0" + implementation "androidx.multidex:multidex:2.0.1" - testImplementation 'junit:junit:4.12' - testImplementation 'org.mockito:mockito-core:2.13.0' + implementation "androidx.preference:preference-ktx:1.1.1" + implementation "androidx.recyclerview:recyclerview:1.1.0" + implementation "androidx.viewpager:viewpager:1.0.0" + implementation "androidx.swiperefreshlayout:swiperefreshlayout:1.1.0" + implementation "androidx.constraintlayout:constraintlayout:2.0.1" + implementation "androidx.coordinatorlayout:coordinatorlayout:1.1.0" + implementation "com.google.android.material:material:1.2.0" + implementation "com.github.wulkanowy:material-chips-input:2.1.1" + implementation "com.github.PhilJay:MPAndroidChart:v3.1.0" + implementation "me.zhanghai.android.materialprogressbar:library:1.6.1" - androidTestImplementation 'com.android.support.test:runner:1.0.1' - androidTestImplementation 'org.mockito:mockito-android:2.13.0' + implementation "androidx.work:work-runtime-ktx:$work_manager" + implementation "androidx.work:work-gcm:$work_manager" + + implementation "androidx.lifecycle:lifecycle-livedata-ktx:2.2.0" + + implementation "androidx.room:room-runtime:$room" + implementation "androidx.room:room-ktx:$room" + kapt "androidx.room:room-compiler:$room" + + implementation "com.google.dagger:hilt-android:$hilt_version" + kapt "com.google.dagger:hilt-android-compiler:$hilt_version" + implementation 'androidx.hilt:hilt-work:1.0.0-alpha02' + kapt 'androidx.hilt:hilt-compiler:1.0.0-alpha02' + + implementation "com.aurelhubert:ahbottomnavigation:2.3.4" + implementation "com.ncapdevi:frag-nav:3.3.0" + implementation "com.github.YarikSOffice:lingver:1.2.2" + + implementation "com.google.code.gson:gson:2.8.6" + implementation "com.jakewharton.timber:timber:4.7.1" + implementation "at.favre.lib:slf4j-timber:1.0.1" + implementation "fr.bipi.treessence:treessence:0.3.2" + implementation "com.mikepenz:aboutlibraries-core:$about_libraries" + implementation 'com.wdullaer:materialdatetimepicker:4.2.3' + implementation "io.coil-kt:coil:1.0.0-rc1" + implementation "io.github.wulkanowy:AppKillerManager:3.0.0" + implementation 'me.xdrop:fuzzywuzzy:1.3.1' + + playImplementation 'com.google.firebase:firebase-analytics:17.5.0' + playImplementation 'com.google.firebase:firebase-inappmessaging-display-ktx:19.1.1' + playImplementation "com.google.firebase:firebase-inappmessaging-ktx:19.1.1" + playImplementation 'com.google.firebase:firebase-messaging:20.2.4' + playImplementation 'com.google.firebase:firebase-crashlytics:17.2.1' + playImplementation 'com.google.guava:listenablefuture:9999.0-empty-to-avoid-conflict-with-guava' + + releaseImplementation "com.github.ChuckerTeam.Chucker:library-no-op:$chucker" + + debugImplementation "com.github.ChuckerTeam.Chucker:library:$chucker" + debugImplementation "com.amitshekhar.android:debug-db:1.0.6" + + testImplementation "junit:junit:4.13" + testImplementation "io.mockk:mockk:$mockk" + testImplementation 'org.jetbrains.kotlinx:kotlinx-coroutines-test:1.3.9' + + androidTestImplementation "androidx.test:core:1.3.0" + androidTestImplementation "androidx.test:runner:1.3.0" + androidTestImplementation "androidx.test.ext:junit:1.1.2" + androidTestImplementation "io.mockk:mockk-android:$mockk" + androidTestImplementation "androidx.room:room-testing:$room" + androidTestImplementation "org.jetbrains.kotlin:kotlin-test:$kotlin_version" } + +apply plugin: 'com.google.gms.google-services' diff --git a/app/hooks.gradle b/app/hooks.gradle new file mode 100644 index 00000000..038fa9fb --- /dev/null +++ b/app/hooks.gradle @@ -0,0 +1,10 @@ +apply plugin: "com.star-zero.gradle.githook" + +githook { + failOnMissingHooksDir = false + hooks { + "pre-push" { + shell = "./app/play-publish-lint.sh" + } + } +} diff --git a/app/jacoco.gradle b/app/jacoco.gradle new file mode 100644 index 00000000..e9abfb61 --- /dev/null +++ b/app/jacoco.gradle @@ -0,0 +1,50 @@ +apply plugin: "jacoco" + +jacoco { + toolVersion "0.8.5" + reportsDir = file("$buildDir/reports") +} + +tasks.withType(Test) { + jacoco.includeNoLocationClasses = true +} + +task jacocoTestReport(type: JacocoReport) { + + group = "Reporting" + description = "Generate Jacoco coverage reports" + + reports { + xml.enabled = true + html.enabled = true + } + + def excludes = ['**/R.class', + '**/R$*.class', + '**/BuildConfig.*', + '**/Manifest*.*', + '**/*Test*.*', + 'android/**/*.*', + '**/*Module.*', + '**/*Dagger*.*', + '**/*MembersInjector*.*', + '**/*_Provide*Factory*.*', + '**/*_Factory.*'] + + classDirectories.setFrom(fileTree( + dir: "$buildDir/intermediates/classes/debug", + excludes: excludes + ) + fileTree( + dir: "$buildDir/tmp/kotlin-classes/playDebug", + excludes: excludes + )) + + sourceDirectories.setFrom(files([ + "src/main/java", + "src/play/java" + ])) + executionData.setFrom(fileTree( + dir: project.projectDir, + includes: ["**/*.exec", "**/*.ec"] + )) +} diff --git a/app/key.p12.gpg b/app/key.p12.gpg new file mode 100644 index 00000000..e9b6d06e Binary files /dev/null and b/app/key.p12.gpg differ diff --git a/app/play-publish-lint.sh b/app/play-publish-lint.sh new file mode 100755 index 00000000..d3354b1a --- /dev/null +++ b/app/play-publish-lint.sh @@ -0,0 +1,7 @@ +#!/bin/bash - + +content=$(cat < "app/src/main/play/release-notes/pl-PL/default.txt") || exit +if [[ "${#content}" -gt 500 ]]; then + echo >&2 "Release notes content has reached the limit of 500 characters" + exit 1 +fi diff --git a/app/proguard-rules.pro b/app/proguard-rules.pro index 34ed4c38..7c796257 100644 --- a/app/proguard-rules.pro +++ b/app/proguard-rules.pro @@ -1,25 +1,45 @@ -# Add project specific ProGuard rules here. -# By default, the flags in this file are appended to flags specified -# in C:\Users\RicomenPL\AppData\Local\Android\Sdk/tools/proguard/proguard-android.txt -# You can edit the include path and order by changing the proguardFiles -# directive in build.gradle. -# -# For more details, see -# http://developer.android.com/guide/developing/tools/proguard.html +# Optimizations +-optimizationpasses 5 +-optimizations !code/simplification/arithmetic,!field/*,!class/merging/* +-dontusemixedcaseclassnames +-dontskipnonpubliclibraryclasses +-dontskipnonpubliclibraryclassmembers +-dontpreverify +-dontobfuscate +-allowaccessmodification +-repackageclasses '' +-verbose -# Add any project specific keep options here: -# If your project uses WebView with JS, uncomment the following -# and specify the fully qualified class name to the JavaScript interface -# class: -#-keepclassmembers class fqcn.of.javascript.interface.for.webview { -# public *; -#} +#Keep all wulkanowy files +-keep class io.github.wulkanowy.** {*;} -# Uncomment this to preserve the line number information for -# debugging stack traces. -#-keepattributes SourceFile,LineNumberTable -# If you keep the line number information, uncomment this to -# hide the original source file name. -#-renamesourcefileattribute SourceFile +#Config for anallitycs +-keepattributes *Annotation* +-keepattributes SourceFile,LineNumberTable +-keep class com.crashlytics.** {*;} +-keep public class * extends java.lang.Exception +-dontwarn com.crashlytics.** + + +#Config for OkHttp +-keepnames class okhttp3.internal.publicsuffix.PublicSuffixDatabase +-dontwarn org.codehaus.mojo.animal_sniffer.* +-dontwarn okhttp3.internal.platform.ConscryptPlatform +-dontwarn javax.annotation.** + + +#Config for MPAndroidChart +-keep class com.github.mikephil.charting.** { *; } + + +#Config for Material Components +-keep class com.google.android.material.tabs.** { *; } + + +#Config for About Libraries +-keep class .R +-keep class **.R$* { + ; +} diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/11.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/11.json new file mode 100644 index 00000000..e42a4a71 --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/11.json @@ -0,0 +1,1325 @@ +{ + "formatVersion": 1, + "database": { + "version": 11, + "identityHash": "478af7daed6ac4563e71826fb70cc8c8", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `endpoint` TEXT NOT NULL, `loginType` TEXT NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "endpoint", + "columnName": "endpoint", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "loginType", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id" + ], + "createSql": "CREATE UNIQUE INDEX `index_Students_email_symbol_student_id_school_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` INTEGER NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predictedGrade` TEXT NOT NULL, `finalGrade` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predictedGrade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "finalGrade", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `content` TEXT, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": false + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, \"478af7daed6ac4563e71826fb70cc8c8\")" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/12.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/12.json new file mode 100644 index 00000000..32f94355 --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/12.json @@ -0,0 +1,1332 @@ +{ + "formatVersion": 1, + "database": { + "version": 12, + "identityHash": "972ad26e6488d9a8239f6bd8597af61d", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `endpoint` TEXT NOT NULL, `loginType` TEXT NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "endpoint", + "columnName": "endpoint", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "loginType", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` INTEGER NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predictedGrade` TEXT NOT NULL, `finalGrade` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predictedGrade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "finalGrade", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `content` TEXT, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": false + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, \"972ad26e6488d9a8239f6bd8597af61d\")" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/13.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/13.json new file mode 100644 index 00000000..ab554665 --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/13.json @@ -0,0 +1,1356 @@ +{ + "formatVersion": 1, + "database": { + "version": 13, + "identityHash": "18643bb64804b8268ec9395e3dd55ecb", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `endpoint` TEXT NOT NULL, `loginType` TEXT NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "endpoint", + "columnName": "endpoint", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "loginType", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` INTEGER NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predictedGrade` TEXT NOT NULL, `finalGrade` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predictedGrade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "finalGrade", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `content` TEXT, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": false + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, \"18643bb64804b8268ec9395e3dd55ecb\")" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/14.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/14.json new file mode 100644 index 00000000..82b76492 --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/14.json @@ -0,0 +1,1386 @@ +{ + "formatVersion": 1, + "database": { + "version": 14, + "identityHash": "b22945c41e7841ff2e6b16af346dde0c", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `endpoint` TEXT NOT NULL, `loginType` TEXT NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "endpoint", + "columnName": "endpoint", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "loginType", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` INTEGER NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `content` TEXT, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": false + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, 'b22945c41e7841ff2e6b16af346dde0c')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/15.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/15.json new file mode 100644 index 00000000..6f2d1d1d --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/15.json @@ -0,0 +1,1430 @@ +{ + "formatVersion": 1, + "database": { + "version": 15, + "identityHash": "84b300bf53c7dd70b60a29a842275bb2", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `endpoint` TEXT NOT NULL, `loginType` TEXT NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "endpoint", + "columnName": "endpoint", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "loginType", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` INTEGER NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `content` TEXT, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": false + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, '84b300bf53c7dd70b60a29a842275bb2')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/16.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/16.json new file mode 100644 index 00000000..34df45eb --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/16.json @@ -0,0 +1,1480 @@ +{ + "formatVersion": 1, + "database": { + "version": 16, + "identityHash": "1eccdcb09adc922713ef67f298ec77a7", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `endpoint` TEXT NOT NULL, `loginType` TEXT NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "endpoint", + "columnName": "endpoint", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "loginType", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` INTEGER NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `content` TEXT, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": false + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, '1eccdcb09adc922713ef67f298ec77a7')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/17.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/17.json new file mode 100644 index 00000000..8b777b7b --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/17.json @@ -0,0 +1,1530 @@ +{ + "formatVersion": 1, + "database": { + "version": 17, + "identityHash": "8bcb3c86f1ddbdf7e20cfa8050525b95", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `endpoint` TEXT NOT NULL, `loginType` TEXT NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "endpoint", + "columnName": "endpoint", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "loginType", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` INTEGER NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `content` TEXT, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": false + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, '8bcb3c86f1ddbdf7e20cfa8050525b95')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/18.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/18.json new file mode 100644 index 00000000..4f7497fe --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/18.json @@ -0,0 +1,1592 @@ +{ + "formatVersion": 1, + "database": { + "version": 18, + "identityHash": "73b1dcfe0cf84170ba102b2818dd0191", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `endpoint` TEXT NOT NULL, `loginType` TEXT NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "endpoint", + "columnName": "endpoint", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "loginType", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` INTEGER NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `content` TEXT, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": false + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "School", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `address` TEXT NOT NULL, `contact` TEXT NOT NULL, `headmaster` TEXT NOT NULL, `pedagogue` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "address", + "columnName": "address", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "contact", + "columnName": "contact", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "headmaster", + "columnName": "headmaster", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pedagogue", + "columnName": "pedagogue", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, '73b1dcfe0cf84170ba102b2818dd0191')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/19.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/19.json new file mode 100644 index 00000000..1e4593bb --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/19.json @@ -0,0 +1,1628 @@ +{ + "formatVersion": 1, + "database": { + "version": 19, + "identityHash": "294f40cebf8314f9776208827240e65f", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `scrapper_base_url` TEXT NOT NULL, `mobile_base_url` TEXT NOT NULL, `login_type` TEXT NOT NULL, `login_mode` TEXT NOT NULL, `certificate_key` TEXT NOT NULL, `private_key` TEXT NOT NULL, `is_parent` INTEGER NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `user_login_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "scrapperBaseUrl", + "columnName": "scrapper_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "mobileBaseUrl", + "columnName": "mobile_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "login_type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginMode", + "columnName": "login_mode", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "certificateKey", + "columnName": "certificate_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "privateKey", + "columnName": "private_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isParent", + "columnName": "is_parent", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "userLoginId", + "columnName": "user_login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` REAL NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "School", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `address` TEXT NOT NULL, `contact` TEXT NOT NULL, `headmaster` TEXT NOT NULL, `pedagogue` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "address", + "columnName": "address", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "contact", + "columnName": "contact", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "headmaster", + "columnName": "headmaster", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pedagogue", + "columnName": "pedagogue", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, '294f40cebf8314f9776208827240e65f')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/20.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/20.json new file mode 100644 index 00000000..925d787a --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/20.json @@ -0,0 +1,1634 @@ +{ + "formatVersion": 1, + "database": { + "version": 20, + "identityHash": "37a216a7afcea922b66001ca5ed6cf74", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `scrapper_base_url` TEXT NOT NULL, `mobile_base_url` TEXT NOT NULL, `login_type` TEXT NOT NULL, `login_mode` TEXT NOT NULL, `certificate_key` TEXT NOT NULL, `private_key` TEXT NOT NULL, `is_parent` INTEGER NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `user_login_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "scrapperBaseUrl", + "columnName": "scrapper_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "mobileBaseUrl", + "columnName": "mobile_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "login_type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginMode", + "columnName": "login_mode", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "certificateKey", + "columnName": "certificate_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "privateKey", + "columnName": "private_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isParent", + "columnName": "is_parent", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "userLoginId", + "columnName": "user_login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `student_plan` INTEGER NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentPlan", + "columnName": "student_plan", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` REAL NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "School", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `address` TEXT NOT NULL, `contact` TEXT NOT NULL, `headmaster` TEXT NOT NULL, `pedagogue` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "address", + "columnName": "address", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "contact", + "columnName": "contact", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "headmaster", + "columnName": "headmaster", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pedagogue", + "columnName": "pedagogue", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, '37a216a7afcea922b66001ca5ed6cf74')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/21.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/21.json new file mode 100644 index 00000000..dfad69f5 --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/21.json @@ -0,0 +1,1652 @@ +{ + "formatVersion": 1, + "database": { + "version": 21, + "identityHash": "f905d8a3ff4718d30ae7413a5a717b1f", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `scrapper_base_url` TEXT NOT NULL, `mobile_base_url` TEXT NOT NULL, `login_type` TEXT NOT NULL, `login_mode` TEXT NOT NULL, `certificate_key` TEXT NOT NULL, `private_key` TEXT NOT NULL, `is_parent` INTEGER NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `user_login_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "scrapperBaseUrl", + "columnName": "scrapper_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "mobileBaseUrl", + "columnName": "mobile_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "login_type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginMode", + "columnName": "login_mode", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "certificateKey", + "columnName": "certificate_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "privateKey", + "columnName": "private_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isParent", + "columnName": "is_parent", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "userLoginId", + "columnName": "user_login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `student_plan` INTEGER NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentPlan", + "columnName": "student_plan", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `time_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL, `excusable` INTEGER NOT NULL, `excuse_status` TEXT)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "timeId", + "columnName": "time_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excusable", + "columnName": "excusable", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excuseStatus", + "columnName": "excuse_status", + "affinity": "TEXT", + "notNull": false + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` REAL NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "School", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `address` TEXT NOT NULL, `contact` TEXT NOT NULL, `headmaster` TEXT NOT NULL, `pedagogue` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "address", + "columnName": "address", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "contact", + "columnName": "contact", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "headmaster", + "columnName": "headmaster", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pedagogue", + "columnName": "pedagogue", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, 'f905d8a3ff4718d30ae7413a5a717b1f')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/22.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/22.json new file mode 100644 index 00000000..1eb8bc19 --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/22.json @@ -0,0 +1,1658 @@ +{ + "formatVersion": 1, + "database": { + "version": 22, + "identityHash": "798956844fdb3f64073921184e3acbfd", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `scrapper_base_url` TEXT NOT NULL, `mobile_base_url` TEXT NOT NULL, `login_type` TEXT NOT NULL, `login_mode` TEXT NOT NULL, `certificate_key` TEXT NOT NULL, `private_key` TEXT NOT NULL, `is_parent` INTEGER NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `user_login_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_short` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "scrapperBaseUrl", + "columnName": "scrapper_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "mobileBaseUrl", + "columnName": "mobile_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "login_type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginMode", + "columnName": "login_mode", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "certificateKey", + "columnName": "certificate_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "privateKey", + "columnName": "private_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isParent", + "columnName": "is_parent", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "userLoginId", + "columnName": "user_login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolShortName", + "columnName": "school_short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_current` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "current", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `student_plan` INTEGER NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isStudentPlan", + "columnName": "student_plan", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `time_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL, `excusable` INTEGER NOT NULL, `excuse_status` TEXT)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "timeId", + "columnName": "time_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excusable", + "columnName": "excusable", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excuseStatus", + "columnName": "excuse_status", + "affinity": "TEXT", + "notNull": false + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` REAL NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `category` TEXT NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "School", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `address` TEXT NOT NULL, `contact` TEXT NOT NULL, `headmaster` TEXT NOT NULL, `pedagogue` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "address", + "columnName": "address", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "contact", + "columnName": "contact", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "headmaster", + "columnName": "headmaster", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pedagogue", + "columnName": "pedagogue", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, '798956844fdb3f64073921184e3acbfd')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/23.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/23.json new file mode 100644 index 00000000..f75a72ac --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/23.json @@ -0,0 +1,1682 @@ +{ + "formatVersion": 1, + "database": { + "version": 23, + "identityHash": "f2505bf0c76c3ae4567856536d790909", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `scrapper_base_url` TEXT NOT NULL, `mobile_base_url` TEXT NOT NULL, `login_type` TEXT NOT NULL, `login_mode` TEXT NOT NULL, `certificate_key` TEXT NOT NULL, `private_key` TEXT NOT NULL, `is_parent` INTEGER NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `user_login_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_short` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "scrapperBaseUrl", + "columnName": "scrapper_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "mobileBaseUrl", + "columnName": "mobile_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "login_type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginMode", + "columnName": "login_mode", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "certificateKey", + "columnName": "certificate_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "privateKey", + "columnName": "private_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isParent", + "columnName": "is_parent", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "userLoginId", + "columnName": "user_login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolShortName", + "columnName": "school_short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_current` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "current", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `student_plan` INTEGER NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isStudentPlan", + "columnName": "student_plan", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `time_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL, `excusable` INTEGER NOT NULL, `excuse_status` TEXT)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "timeId", + "columnName": "time_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excusable", + "columnName": "excusable", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excuseStatus", + "columnName": "excuse_status", + "affinity": "TEXT", + "notNull": false + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` REAL NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `category` TEXT NOT NULL, `category_type` INTEGER NOT NULL, `is_points_show` INTEGER NOT NULL, `points` INTEGER NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "categoryType", + "columnName": "category_type", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isPointsShow", + "columnName": "is_points_show", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "points", + "columnName": "points", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "School", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `address` TEXT NOT NULL, `contact` TEXT NOT NULL, `headmaster` TEXT NOT NULL, `pedagogue` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "address", + "columnName": "address", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "contact", + "columnName": "contact", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "headmaster", + "columnName": "headmaster", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pedagogue", + "columnName": "pedagogue", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, 'f2505bf0c76c3ae4567856536d790909')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/24.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/24.json new file mode 100644 index 00000000..17ae7d79 --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/24.json @@ -0,0 +1,1732 @@ +{ + "formatVersion": 1, + "database": { + "version": 24, + "identityHash": "9bbf60310b56a855839164e2aae031f9", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `scrapper_base_url` TEXT NOT NULL, `mobile_base_url` TEXT NOT NULL, `login_type` TEXT NOT NULL, `login_mode` TEXT NOT NULL, `certificate_key` TEXT NOT NULL, `private_key` TEXT NOT NULL, `is_parent` INTEGER NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `user_login_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_short` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "scrapperBaseUrl", + "columnName": "scrapper_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "mobileBaseUrl", + "columnName": "mobile_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "login_type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginMode", + "columnName": "login_mode", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "certificateKey", + "columnName": "certificate_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "privateKey", + "columnName": "private_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isParent", + "columnName": "is_parent", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "userLoginId", + "columnName": "user_login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolShortName", + "columnName": "school_short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_current` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "current", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `student_plan` INTEGER NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isStudentPlan", + "columnName": "student_plan", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `time_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL, `excusable` INTEGER NOT NULL, `excuse_status` TEXT)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "timeId", + "columnName": "time_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excusable", + "columnName": "excusable", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excuseStatus", + "columnName": "excuse_status", + "affinity": "TEXT", + "notNull": false + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` REAL NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL, `has_attachments` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hasAttachments", + "columnName": "has_attachments", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MessageAttachments", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `one_drive_id` TEXT NOT NULL, `url` TEXT NOT NULL, `filename` TEXT NOT NULL, PRIMARY KEY(`real_id`))", + "fields": [ + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "oneDriveId", + "columnName": "one_drive_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "url", + "columnName": "url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "filename", + "columnName": "filename", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "real_id" + ], + "autoGenerate": false + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `category` TEXT NOT NULL, `category_type` INTEGER NOT NULL, `is_points_show` INTEGER NOT NULL, `points` INTEGER NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "categoryType", + "columnName": "category_type", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isPointsShow", + "columnName": "is_points_show", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "points", + "columnName": "points", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "School", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `address` TEXT NOT NULL, `contact` TEXT NOT NULL, `headmaster` TEXT NOT NULL, `pedagogue` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "address", + "columnName": "address", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "contact", + "columnName": "contact", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "headmaster", + "columnName": "headmaster", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pedagogue", + "columnName": "pedagogue", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, '9bbf60310b56a855839164e2aae031f9')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/25.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/25.json new file mode 100644 index 00000000..474824df --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/25.json @@ -0,0 +1,1744 @@ +{ + "formatVersion": 1, + "database": { + "version": 25, + "identityHash": "d101f5a26a024f62e6fee161e421b882", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `scrapper_base_url` TEXT NOT NULL, `mobile_base_url` TEXT NOT NULL, `login_type` TEXT NOT NULL, `login_mode` TEXT NOT NULL, `certificate_key` TEXT NOT NULL, `private_key` TEXT NOT NULL, `is_parent` INTEGER NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `user_login_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_short` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "scrapperBaseUrl", + "columnName": "scrapper_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "mobileBaseUrl", + "columnName": "mobile_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "login_type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginMode", + "columnName": "login_mode", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "certificateKey", + "columnName": "certificate_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "privateKey", + "columnName": "private_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isParent", + "columnName": "is_parent", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "userLoginId", + "columnName": "user_login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolShortName", + "columnName": "school_short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_current` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "current", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `student_plan` INTEGER NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isStudentPlan", + "columnName": "student_plan", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `time_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL, `excusable` INTEGER NOT NULL, `excuse_status` TEXT)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "timeId", + "columnName": "time_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excusable", + "columnName": "excusable", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excuseStatus", + "columnName": "excuse_status", + "affinity": "TEXT", + "notNull": false + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` REAL NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL, `has_attachments` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hasAttachments", + "columnName": "has_attachments", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MessageAttachments", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `one_drive_id` TEXT NOT NULL, `url` TEXT NOT NULL, `filename` TEXT NOT NULL, PRIMARY KEY(`real_id`))", + "fields": [ + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "oneDriveId", + "columnName": "one_drive_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "url", + "columnName": "url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "filename", + "columnName": "filename", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "real_id" + ], + "autoGenerate": false + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `category` TEXT NOT NULL, `category_type` INTEGER NOT NULL, `is_points_show` INTEGER NOT NULL, `points` INTEGER NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "categoryType", + "columnName": "category_type", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isPointsShow", + "columnName": "is_points_show", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "points", + "columnName": "points", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_done` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `attachments` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isDone", + "columnName": "is_done", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "attachments", + "columnName": "attachments", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "School", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `address` TEXT NOT NULL, `contact` TEXT NOT NULL, `headmaster` TEXT NOT NULL, `pedagogue` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "address", + "columnName": "address", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "contact", + "columnName": "contact", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "headmaster", + "columnName": "headmaster", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pedagogue", + "columnName": "pedagogue", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, 'd101f5a26a024f62e6fee161e421b882')" + ] + } +} diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/26.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/26.json new file mode 100644 index 00000000..21005f9c --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/26.json @@ -0,0 +1,1768 @@ +{ + "formatVersion": 1, + "database": { + "version": 26, + "identityHash": "43f8777ffe95a5a2850ee981db3dbe2e", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `scrapper_base_url` TEXT NOT NULL, `mobile_base_url` TEXT NOT NULL, `login_type` TEXT NOT NULL, `login_mode` TEXT NOT NULL, `certificate_key` TEXT NOT NULL, `private_key` TEXT NOT NULL, `is_parent` INTEGER NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `user_login_id` INTEGER NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_short` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "scrapperBaseUrl", + "columnName": "scrapper_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "mobileBaseUrl", + "columnName": "mobile_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "login_type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginMode", + "columnName": "login_mode", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "certificateKey", + "columnName": "certificate_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "privateKey", + "columnName": "private_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isParent", + "columnName": "is_parent", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "userLoginId", + "columnName": "user_login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolShortName", + "columnName": "school_short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_current` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "current", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `student_plan` INTEGER NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isStudentPlan", + "columnName": "student_plan", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `time_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL, `excusable` INTEGER NOT NULL, `excuse_status` TEXT)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "timeId", + "columnName": "time_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excusable", + "columnName": "excusable", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excuseStatus", + "columnName": "excuse_status", + "affinity": "TEXT", + "notNull": false + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` REAL NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_predicted_grade_notified` INTEGER NOT NULL, `is_final_grade_notified` INTEGER NOT NULL, `predicted_grade_last_change` INTEGER NOT NULL, `final_grade_last_change` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isPredictedGradeNotified", + "columnName": "is_predicted_grade_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isFinalGradeNotified", + "columnName": "is_final_grade_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "predictedGradeLastChange", + "columnName": "predicted_grade_last_change", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "finalGradeLastChange", + "columnName": "final_grade_last_change", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL, `has_attachments` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hasAttachments", + "columnName": "has_attachments", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MessageAttachments", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `one_drive_id` TEXT NOT NULL, `url` TEXT NOT NULL, `filename` TEXT NOT NULL, PRIMARY KEY(`real_id`))", + "fields": [ + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "oneDriveId", + "columnName": "one_drive_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "url", + "columnName": "url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "filename", + "columnName": "filename", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "real_id" + ], + "autoGenerate": false + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `category` TEXT NOT NULL, `category_type` INTEGER NOT NULL, `is_points_show` INTEGER NOT NULL, `points` INTEGER NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "categoryType", + "columnName": "category_type", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isPointsShow", + "columnName": "is_points_show", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "points", + "columnName": "points", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_done` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `attachments` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isDone", + "columnName": "is_done", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "attachments", + "columnName": "attachments", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "School", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `address` TEXT NOT NULL, `contact` TEXT NOT NULL, `headmaster` TEXT NOT NULL, `pedagogue` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "address", + "columnName": "address", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "contact", + "columnName": "contact", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "headmaster", + "columnName": "headmaster", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pedagogue", + "columnName": "pedagogue", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, '43f8777ffe95a5a2850ee981db3dbe2e')" + ] + } +} \ No newline at end of file diff --git a/app/schemas/io.github.wulkanowy.data.db.AppDatabase/27.json b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/27.json new file mode 100644 index 00000000..46b77751 --- /dev/null +++ b/app/schemas/io.github.wulkanowy.data.db.AppDatabase/27.json @@ -0,0 +1,1774 @@ +{ + "formatVersion": 1, + "database": { + "version": 27, + "identityHash": "b24d2d9662e26dd31f2eea78a297558c", + "entities": [ + { + "tableName": "Students", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `scrapper_base_url` TEXT NOT NULL, `mobile_base_url` TEXT NOT NULL, `login_type` TEXT NOT NULL, `login_mode` TEXT NOT NULL, `certificate_key` TEXT NOT NULL, `private_key` TEXT NOT NULL, `is_parent` INTEGER NOT NULL, `email` TEXT NOT NULL, `password` TEXT NOT NULL, `symbol` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `user_login_id` INTEGER NOT NULL, `user_name` TEXT NOT NULL, `student_name` TEXT NOT NULL, `school_id` TEXT NOT NULL, `school_short` TEXT NOT NULL, `school_name` TEXT NOT NULL, `class_name` TEXT NOT NULL, `class_id` INTEGER NOT NULL, `is_current` INTEGER NOT NULL, `registration_date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "scrapperBaseUrl", + "columnName": "scrapper_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "mobileBaseUrl", + "columnName": "mobile_base_url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginType", + "columnName": "login_type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginMode", + "columnName": "login_mode", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "certificateKey", + "columnName": "certificate_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "privateKey", + "columnName": "private_key", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isParent", + "columnName": "is_parent", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "email", + "columnName": "email", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "password", + "columnName": "password", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "symbol", + "columnName": "symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "userLoginId", + "columnName": "user_login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "userName", + "columnName": "user_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentName", + "columnName": "student_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolSymbol", + "columnName": "school_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolShortName", + "columnName": "school_short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolName", + "columnName": "school_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "className", + "columnName": "class_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isCurrent", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "registrationDate", + "columnName": "registration_date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Students_email_symbol_student_id_school_id_class_id", + "unique": true, + "columnNames": [ + "email", + "symbol", + "student_id", + "school_id", + "class_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Students_email_symbol_student_id_school_id_class_id` ON `${TABLE_NAME}` (`email`, `symbol`, `student_id`, `school_id`, `class_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Semesters", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_current` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `diary_name` TEXT NOT NULL, `school_year` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `semester_name` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "current", + "columnName": "is_current", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryName", + "columnName": "diary_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "schoolYear", + "columnName": "school_year", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterName", + "columnName": "semester_name", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [ + { + "name": "index_Semesters_student_id_diary_id_semester_id", + "unique": true, + "columnNames": [ + "student_id", + "diary_id", + "semester_id" + ], + "createSql": "CREATE UNIQUE INDEX IF NOT EXISTS `index_Semesters_student_id_diary_id_semester_id` ON `${TABLE_NAME}` (`student_id`, `diary_id`, `semester_id`)" + } + ], + "foreignKeys": [] + }, + { + "tableName": "Exams", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `group` TEXT NOT NULL, `type` TEXT NOT NULL, `description` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "type", + "columnName": "type", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Timetable", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `number` INTEGER NOT NULL, `start` INTEGER NOT NULL, `end` INTEGER NOT NULL, `date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `subjectOld` TEXT NOT NULL, `group` TEXT NOT NULL, `room` TEXT NOT NULL, `roomOld` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacherOld` TEXT NOT NULL, `info` TEXT NOT NULL, `student_plan` INTEGER NOT NULL, `changes` INTEGER NOT NULL, `canceled` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "start", + "columnName": "start", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "end", + "columnName": "end", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subjectOld", + "columnName": "subjectOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "group", + "columnName": "group", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "room", + "columnName": "room", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roomOld", + "columnName": "roomOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherOld", + "columnName": "teacherOld", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "info", + "columnName": "info", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "isStudentPlan", + "columnName": "student_plan", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "changes", + "columnName": "changes", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "canceled", + "columnName": "canceled", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Attendance", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `time_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `exemption` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `excused` INTEGER NOT NULL, `deleted` INTEGER NOT NULL, `excusable` INTEGER NOT NULL, `excuse_status` TEXT)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "timeId", + "columnName": "time_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excused", + "columnName": "excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deleted", + "columnName": "deleted", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excusable", + "columnName": "excusable", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "excuseStatus", + "columnName": "excuse_status", + "affinity": "TEXT", + "notNull": false + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "AttendanceSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `subject_id` INTEGER NOT NULL, `month` INTEGER NOT NULL, `presence` INTEGER NOT NULL, `absence` INTEGER NOT NULL, `absence_excused` INTEGER NOT NULL, `absence_for_school_reasons` INTEGER NOT NULL, `lateness` INTEGER NOT NULL, `lateness_excused` INTEGER NOT NULL, `exemption` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subjectId", + "columnName": "subject_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "month", + "columnName": "month", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "presence", + "columnName": "presence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceExcused", + "columnName": "absence_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "absenceForSchoolReasons", + "columnName": "absence_for_school_reasons", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "lateness", + "columnName": "lateness", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "latenessExcused", + "columnName": "lateness_excused", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "exemption", + "columnName": "exemption", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Grades", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `entry` TEXT NOT NULL, `value` REAL NOT NULL, `modifier` REAL NOT NULL, `comment` TEXT NOT NULL, `color` TEXT NOT NULL, `grade_symbol` TEXT NOT NULL, `description` TEXT NOT NULL, `weight` TEXT NOT NULL, `weightValue` REAL NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "entry", + "columnName": "entry", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "value", + "columnName": "value", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "modifier", + "columnName": "modifier", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "comment", + "columnName": "comment", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "color", + "columnName": "color", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "gradeSymbol", + "columnName": "grade_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "description", + "columnName": "description", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weight", + "columnName": "weight", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "weightValue", + "columnName": "weightValue", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesSummary", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_predicted_grade_notified` INTEGER NOT NULL, `is_final_grade_notified` INTEGER NOT NULL, `predicted_grade_last_change` INTEGER NOT NULL, `final_grade_last_change` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `position` INTEGER NOT NULL, `subject` TEXT NOT NULL, `predicted_grade` TEXT NOT NULL, `final_grade` TEXT NOT NULL, `proposed_points` TEXT NOT NULL, `final_points` TEXT NOT NULL, `points_sum` TEXT NOT NULL, `average` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isPredictedGradeNotified", + "columnName": "is_predicted_grade_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isFinalGradeNotified", + "columnName": "is_final_grade_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "predictedGradeLastChange", + "columnName": "predicted_grade_last_change", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "finalGradeLastChange", + "columnName": "final_grade_last_change", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "position", + "columnName": "position", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "predictedGrade", + "columnName": "predicted_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalGrade", + "columnName": "final_grade", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "proposedPoints", + "columnName": "proposed_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "finalPoints", + "columnName": "final_points", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pointsSum", + "columnName": "points_sum", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "average", + "columnName": "average", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `grade` INTEGER NOT NULL, `amount` INTEGER NOT NULL, `is_semester` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "grade", + "columnName": "grade", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "amount", + "columnName": "amount", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semester", + "columnName": "is_semester", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "GradesPointsStatistics", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `others` REAL NOT NULL, `student` REAL NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "others", + "columnName": "others", + "affinity": "REAL", + "notNull": true + }, + { + "fieldPath": "student", + "columnName": "student", + "affinity": "REAL", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Messages", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `content` TEXT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `recipient_name` TEXT NOT NULL, `subject` TEXT NOT NULL, `date` INTEGER NOT NULL, `folder_id` INTEGER NOT NULL, `unread` INTEGER NOT NULL, `unread_by` INTEGER NOT NULL, `read_by` INTEGER NOT NULL, `removed` INTEGER NOT NULL, `has_attachments` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "sender", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "recipient", + "columnName": "recipient_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "folderId", + "columnName": "folder_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unread", + "columnName": "unread", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unreadBy", + "columnName": "unread_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "readBy", + "columnName": "read_by", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "removed", + "columnName": "removed", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hasAttachments", + "columnName": "has_attachments", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MessageAttachments", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`real_id` INTEGER NOT NULL, `message_id` INTEGER NOT NULL, `one_drive_id` TEXT NOT NULL, `url` TEXT NOT NULL, `filename` TEXT NOT NULL, PRIMARY KEY(`real_id`))", + "fields": [ + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "messageId", + "columnName": "message_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "oneDriveId", + "columnName": "one_drive_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "url", + "columnName": "url", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "filename", + "columnName": "filename", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "real_id" + ], + "autoGenerate": false + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Notes", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_read` INTEGER NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `category` TEXT NOT NULL, `category_type` INTEGER NOT NULL, `is_points_show` INTEGER NOT NULL, `points` INTEGER NOT NULL, `content` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isRead", + "columnName": "is_read", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "category", + "columnName": "category", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "categoryType", + "columnName": "category_type", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isPointsShow", + "columnName": "is_points_show", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "points", + "columnName": "points", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Homework", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_done` INTEGER NOT NULL, `semester_id` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `entry_date` INTEGER NOT NULL, `subject` TEXT NOT NULL, `content` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `attachments` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isDone", + "columnName": "is_done", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "semesterId", + "columnName": "semester_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "entryDate", + "columnName": "entry_date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "content", + "columnName": "content", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "attachments", + "columnName": "attachments", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Subjects", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "LuckyNumbers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `is_notified` INTEGER NOT NULL, `student_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `lucky_number` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "isNotified", + "columnName": "is_notified", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "luckyNumber", + "columnName": "lucky_number", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "CompletedLesson", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `diary_id` INTEGER NOT NULL, `date` INTEGER NOT NULL, `number` INTEGER NOT NULL, `subject` TEXT NOT NULL, `topic` TEXT NOT NULL, `teacher` TEXT NOT NULL, `teacher_symbol` TEXT NOT NULL, `substitution` TEXT NOT NULL, `absence` TEXT NOT NULL, `resources` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "diaryId", + "columnName": "diary_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "number", + "columnName": "number", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "topic", + "columnName": "topic", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacher", + "columnName": "teacher", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "teacherSymbol", + "columnName": "teacher_symbol", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "substitution", + "columnName": "substitution", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "absence", + "columnName": "absence", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "resources", + "columnName": "resources", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "ReportingUnits", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` INTEGER NOT NULL, `short` TEXT NOT NULL, `sender_id` INTEGER NOT NULL, `sender_name` TEXT NOT NULL, `roles` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "senderId", + "columnName": "sender_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "senderName", + "columnName": "sender_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "roles", + "columnName": "roles", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Recipients", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `real_id` TEXT NOT NULL, `name` TEXT NOT NULL, `real_name` TEXT NOT NULL, `login_id` INTEGER NOT NULL, `unit_id` INTEGER NOT NULL, `role` INTEGER NOT NULL, `hash` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "realId", + "columnName": "real_id", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "realName", + "columnName": "real_name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "loginId", + "columnName": "login_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "unitId", + "columnName": "unit_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "role", + "columnName": "role", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "hash", + "columnName": "hash", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "MobileDevices", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `device_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `date` INTEGER NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "deviceId", + "columnName": "device_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "date", + "columnName": "date", + "affinity": "INTEGER", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "Teachers", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `subject` TEXT NOT NULL, `name` TEXT NOT NULL, `short_name` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "subject", + "columnName": "subject", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "shortName", + "columnName": "short_name", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + }, + { + "tableName": "School", + "createSql": "CREATE TABLE IF NOT EXISTS `${TABLE_NAME}` (`id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, `student_id` INTEGER NOT NULL, `class_id` INTEGER NOT NULL, `name` TEXT NOT NULL, `address` TEXT NOT NULL, `contact` TEXT NOT NULL, `headmaster` TEXT NOT NULL, `pedagogue` TEXT NOT NULL)", + "fields": [ + { + "fieldPath": "id", + "columnName": "id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "studentId", + "columnName": "student_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "classId", + "columnName": "class_id", + "affinity": "INTEGER", + "notNull": true + }, + { + "fieldPath": "name", + "columnName": "name", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "address", + "columnName": "address", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "contact", + "columnName": "contact", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "headmaster", + "columnName": "headmaster", + "affinity": "TEXT", + "notNull": true + }, + { + "fieldPath": "pedagogue", + "columnName": "pedagogue", + "affinity": "TEXT", + "notNull": true + } + ], + "primaryKey": { + "columnNames": [ + "id" + ], + "autoGenerate": true + }, + "indices": [], + "foreignKeys": [] + } + ], + "views": [], + "setupQueries": [ + "CREATE TABLE IF NOT EXISTS room_master_table (id INTEGER PRIMARY KEY,identity_hash TEXT)", + "INSERT OR REPLACE INTO room_master_table (id,identity_hash) VALUES(42, 'b24d2d9662e26dd31f2eea78a297558c')" + ] + } +} \ No newline at end of file diff --git a/android-sonarqube.gradle b/app/sonarqube.gradle similarity index 73% rename from android-sonarqube.gradle rename to app/sonarqube.gradle index b9284eea..3dad1034 100644 --- a/android-sonarqube.gradle +++ b/app/sonarqube.gradle @@ -4,16 +4,13 @@ sonarqube { //noinspection GroovyAssignabilityCheck properties { - def files = fileTree("${rootProject.projectDir}/api/build/libs/").filter { it.isFile() }.files.name - def libraries = project.android.sdkDirectory.getPath() + "/platforms/android-27/android.jar," + - "${project.rootDir}/api/build/libs/" + files[0] + def libraries = project.android.sdkDirectory.getPath() + "/platforms/android-28/android.jar" - property "sonar.projectName", GROUP_ID + ":app" - property "sonar.projectKey", GROUP_ID + ":app" + property "sonar.projectName", "io.github.wulkanowy:app" + property "sonar.projectKey", "io.github.wulkanowy:app" property "sonar.sources", "src/main/java" - property "sonar.exclusions", "build/**,**/*.png,*.iml, **/*generated*," + - "src/**/entities/*.java, src/androidTest/**/entities/*.java" + property "sonar.exclusions", "build/**,**/*.png,*.iml, **/*generated*," property "sonar.import_unknown_files", true // Defines where the java files are @@ -32,5 +29,6 @@ sonarqube { property "sonar.java.coveragePlugin", "jacoco" property "sonar.android.lint.report", "build/reports/lint-results.xml" property "sonar.jacoco.reportPaths", fileTree(dir: project.projectDir, includes: ['**/*.exec', '**/*.ec']) + property "sonar.coverage.jacoco.xmlReportPaths", "build/reports/jacocoTestReport/jacocoTestReport.xml" } } diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/TestDispatchersProvider.kt b/app/src/androidTest/java/io/github/wulkanowy/data/TestDispatchersProvider.kt new file mode 100644 index 00000000..8c4354d9 --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/TestDispatchersProvider.kt @@ -0,0 +1,11 @@ +package io.github.wulkanowy.data + +import io.github.wulkanowy.utils.DispatchersProvider +import kotlinx.coroutines.CoroutineDispatcher +import kotlinx.coroutines.Dispatchers + +class TestDispatchersProvider : DispatchersProvider() { + + override val backgroundThread: CoroutineDispatcher + get() = Dispatchers.Unconfined +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/AccountTest.java b/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/AccountTest.java deleted file mode 100644 index e5330b62..00000000 --- a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/AccountTest.java +++ /dev/null @@ -1,18 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.test.AbstractDaoTestLongPk; - -public class AccountTest extends AbstractDaoTestLongPk { - - public AccountTest() { - super(AccountDao.class); - } - - @Override - protected Account createEntity(Long key) { - Account entity = new Account(); - entity.setId(key); - return entity; - } - -} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/DayTest.java b/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/DayTest.java deleted file mode 100644 index 34c4c4c5..00000000 --- a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/DayTest.java +++ /dev/null @@ -1,19 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.test.AbstractDaoTestLongPk; - -public class DayTest extends AbstractDaoTestLongPk { - - public DayTest() { - super(DayDao.class); - } - - @Override - protected Day createEntity(Long key) { - Day entity = new Day(); - entity.setId(key); - entity.setIsFreeDay(false); - return entity; - } - -} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/GradeTest.java b/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/GradeTest.java deleted file mode 100644 index ea026559..00000000 --- a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/GradeTest.java +++ /dev/null @@ -1,20 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.test.AbstractDaoTestLongPk; - -public class GradeTest extends AbstractDaoTestLongPk { - - public GradeTest() { - super(GradeDao.class); - } - - @Override - protected Grade createEntity(Long key) { - Grade entity = new Grade(); - entity.setId(key); - entity.setIsNew(false); - entity.setRead(false); - return entity; - } - -} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/LessonTest.java b/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/LessonTest.java deleted file mode 100644 index c8690ff9..00000000 --- a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/LessonTest.java +++ /dev/null @@ -1,24 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.test.AbstractDaoTestLongPk; - -public class LessonTest extends AbstractDaoTestLongPk { - - public LessonTest() { - super(LessonDao.class); - } - - @Override - protected Lesson createEntity(Long key) { - Lesson entity = new Lesson(); - entity.setId(key); - entity.setIsEmpty(false); - entity.setIsDivisionIntoGroups(false); - entity.setIsPlanning(false); - entity.setIsRealized(false); - entity.setIsMovedOrCanceled(false); - entity.setIsNewMovedInOrChanged(false); - return entity; - } - -} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/SubjectTest.java b/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/SubjectTest.java deleted file mode 100644 index 81a2e724..00000000 --- a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/SubjectTest.java +++ /dev/null @@ -1,18 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.test.AbstractDaoTestLongPk; - -public class SubjectTest extends AbstractDaoTestLongPk { - - public SubjectTest() { - super(SubjectDao.class); - } - - @Override - protected Subject createEntity(Long key) { - Subject entity = new Subject(); - entity.setId(key); - return entity; - } - -} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/WeekTest.java b/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/WeekTest.java deleted file mode 100644 index 86e7a8be..00000000 --- a/app/src/androidTest/java/io/github/wulkanowy/data/db/dao/entities/WeekTest.java +++ /dev/null @@ -1,18 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.test.AbstractDaoTestLongPk; - -public class WeekTest extends AbstractDaoTestLongPk { - - public WeekTest() { - super(WeekDao.class); - } - - @Override - protected Week createEntity(Long key) { - Week entity = new Week(); - entity.setId(key); - return entity; - } - -} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/AbstractMigrationTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/AbstractMigrationTest.kt new file mode 100644 index 00000000..611161e5 --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/AbstractMigrationTest.kt @@ -0,0 +1,35 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.preference.PreferenceManager +import androidx.room.Room +import androidx.room.testing.MigrationTestHelper +import androidx.sqlite.db.framework.FrameworkSQLiteOpenHelperFactory +import androidx.test.core.app.ApplicationProvider +import androidx.test.platform.app.InstrumentationRegistry +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.SharedPrefProvider +import org.junit.Rule + +abstract class AbstractMigrationTest { + + val dbName = "migration-test" + + @get:Rule + val helper: MigrationTestHelper = MigrationTestHelper( + InstrumentationRegistry.getInstrumentation(), + AppDatabase::class.java.canonicalName, + FrameworkSQLiteOpenHelperFactory() + ) + + fun getMigratedRoomDatabase(): AppDatabase { + val database = Room.databaseBuilder(ApplicationProvider.getApplicationContext(), + AppDatabase::class.java, dbName) + .addMigrations(*AppDatabase.getMigrations(SharedPrefProvider(PreferenceManager + .getDefaultSharedPreferences(ApplicationProvider.getApplicationContext()))) + ) + .build() + // close the database and release any stream resources when the test finishes + helper.closeWhenFinished(database) + return database + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/Migration12Test.kt b/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/Migration12Test.kt new file mode 100644 index 00000000..b312048d --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/Migration12Test.kt @@ -0,0 +1,134 @@ +package io.github.wulkanowy.data.db.migrations + +import android.content.ContentValues +import android.database.sqlite.SQLiteDatabase.CONFLICT_FAIL +import androidx.sqlite.db.SupportSQLiteDatabase +import androidx.test.ext.junit.runners.AndroidJUnit4 +import kotlinx.coroutines.runBlocking +import org.junit.Test +import org.junit.runner.RunWith +import kotlin.test.assertEquals + +@RunWith(AndroidJUnit4::class) +class Migration12Test : AbstractMigrationTest() { + + @Test + fun twoNotRelatedStudents() { + helper.createDatabase(dbName, 11).apply { + // user 1 + createStudent(this, 1, true) + createSemester(this, 1, false, 5, 1) + createSemester(this, 1, true, 5, 2) + + // user 2 + createStudent(this, 2, true) + createSemester(this, 2, false, 6, 1) + createSemester(this, 2, true, 6, 2) + close() + } + + helper.runMigrationsAndValidate(dbName, 12, true, Migration12()) + + val db = getMigratedRoomDatabase() + val students = runBlocking { db.studentDao.loadAll() } + + assertEquals(2, students.size) + + students[0].run { + assertEquals(1, studentId) + assertEquals(5, classId) + } + + students[1].run { + assertEquals(2, studentId) + assertEquals(6, classId) + } + } + + @Test + fun removeStudentsWithoutClassId() { + helper.createDatabase(dbName, 11).apply { + // user 1 + createStudent(this, 1, true) + createSemester(this, 1, false, 0, 2) + createStudent(this, 2, true) + createSemester(this, 2, true, 1, 2) + close() + } + + helper.runMigrationsAndValidate(dbName, 12, true, Migration12()) + + val db = getMigratedRoomDatabase() + val students = runBlocking { db.studentDao.loadAll() } + + assertEquals(1, students.size) + + students[0].run { + assertEquals(2, studentId) + assertEquals(1, classId) + } + } + + @Test + fun ensureThereIsOnlyOneCurrentStudent() { + helper.createDatabase(dbName, 11).apply { + // user 1 + createStudent(this, 1, true) + createSemester(this, 1, true, 5, 2) + createStudent(this, 2, true) + createSemester(this, 2, true, 6, 2) + createStudent(this, 3, true) + createSemester(this, 3, false, 7, 2) + close() + } + + helper.runMigrationsAndValidate(dbName, 12, true, Migration12()) + + val db = getMigratedRoomDatabase() + val students = runBlocking { db.studentDao.loadAll() } + + assertEquals(3, students.size) + + students[0].run { + assertEquals(studentId, 1) + assertEquals(false, isCurrent) + } + students[1].run { + assertEquals(studentId, 2) + assertEquals(false, isCurrent) + } + students[2].run { + assertEquals(studentId, 3) + assertEquals(true, isCurrent) + } + } + + private fun createStudent(db: SupportSQLiteDatabase, studentId: Int, isCurrent: Boolean) { + db.insert("Students", CONFLICT_FAIL, ContentValues().apply { + put("endpoint", "https://fakelog.cf") + put("loginType", "STANDARD") + put("email", "jan@fakelog.cf") + put("password", "******") + put("symbol", "Default") + put("student_id", studentId) + put("student_name", "Jan Kowalski") + put("school_id", "000123") + put("school_name", "") + put("is_current", isCurrent) + put("registration_date", "0") + }) + } + + private fun createSemester(db: SupportSQLiteDatabase, studentId: Int, isCurrent: Boolean, classId: Int, diaryId: Int) { + db.insert("Semesters", CONFLICT_FAIL, ContentValues().apply { + put("student_id", studentId) + put("diary_id", diaryId) + put("diary_name", "IA") + put("semester_id", diaryId * 5) + put("semester_name", "1") + put("is_current", isCurrent) + put("class_id", classId) + put("unit_id", "99") + }) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/Migration13Test.kt b/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/Migration13Test.kt new file mode 100644 index 00000000..15e99f5f --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/Migration13Test.kt @@ -0,0 +1,196 @@ +package io.github.wulkanowy.data.db.migrations + +import android.content.ContentValues +import android.database.sqlite.SQLiteDatabase +import androidx.sqlite.db.SupportSQLiteDatabase +import io.github.wulkanowy.data.db.Converters +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.runBlocking +import org.junit.Assert.assertEquals +import org.junit.Assert.assertTrue +import org.junit.Test +import java.time.LocalDate.of +import kotlin.test.assertFalse +import kotlin.test.assertTrue + +class Migration13Test : AbstractMigrationTest() { + + @Test + fun studentsWithSchoolNameWithClassName() { + helper.createDatabase(dbName, 12).apply { + createStudent(this, 1, "Klasa A - Publiczna szkoła Wulkanowego nr 1 w fakelog.cf", 1, 1) + createStudent(this, 2, "Klasa B - Publiczna szkoła Wulkanowego-fejka nr 1 w fakelog.cf", 2, 1) + createStudent(this, 2, "Klasa C - Publiczna szkoła Wulkanowego-fejka nr 2 w fakelog.cf", 1, 2) + close() + } + + helper.runMigrationsAndValidate(dbName, 13, true, Migration13()) + + val db = getMigratedRoomDatabase() + val students = runBlocking { db.studentDao.loadAll() } + + assertEquals(3, students.size) + + students[0].run { + assertEquals(1, studentId) + assertEquals("A", className) + assertEquals("Publiczna szkoła Wulkanowego nr 1 w fakelog.cf", schoolName) + } + + students[1].run { + assertEquals(2, studentId) + assertEquals("B", className) + assertEquals("Publiczna szkoła Wulkanowego-fejka nr 1 w fakelog.cf", schoolName) + } + + students[2].run { + assertEquals(2, studentId) + assertEquals("C", className) + assertEquals("Publiczna szkoła Wulkanowego-fejka nr 2 w fakelog.cf", schoolName) + } + } + + @Test + fun studentsWithSchoolNameWithoutClassName() { + helper.createDatabase(dbName, 12).apply { + createStudent(this, 1, "Publiczna szkoła Wulkanowego nr 1 w fakelog.cf", 1) + createStudent(this, 2, "Publiczna szkoła Wulkanowego-fejka nr 1 w fakelog.cf", 1) + close() + } + + helper.runMigrationsAndValidate(dbName, 13, true, Migration13()) + + val db = getMigratedRoomDatabase() + val students = runBlocking { db.studentDao.loadAll() } + + assertEquals(2, students.size) + + students[0].run { + assertEquals(1, studentId) + assertEquals("", className) + assertEquals("Publiczna szkoła Wulkanowego nr 1 w fakelog.cf", schoolName) + } + + students[1].run { + assertEquals(2, studentId) + assertEquals("", className) + assertEquals("Publiczna szkoła Wulkanowego-fejka nr 1 w fakelog.cf", schoolName) + } + } + + @Test + fun markAtLeastAndOnlyOneSemesterAtCurrent() { + helper.createDatabase(dbName, 12).apply { + createStudent(this, 1, "", 5) + createSemester(this, 1, 5, 1, 1, false) + createSemester(this, 1, 5, 2, 1, false) + createSemester(this, 1, 5, 3, 2, false) + createSemester(this, 1, 5, 4, 2, false) + + createStudent(this, 2, "", 5) + createSemester(this, 2, 5, 5, 5, true) + createSemester(this, 2, 5, 6, 5, true) + createSemester(this, 2, 5, 7, 55, true) + createSemester(this, 2, 5, 8, 55, true) + + createStudent(this, 3, "", 5) + createSemester(this, 3, 5, 11, 99, false) + createSemester(this, 3, 5, 12, 99, false) + createSemester(this, 3, 5, 13, 100, false) + createSemester(this, 3, 5, 14, 100, true) + close() + } + + val db = helper.runMigrationsAndValidate(dbName, 13, true, Migration13()) + + val semesters1 = getSemesters(db, "SELECT * FROM Semesters WHERE student_id = 1 AND class_id = 5") + assertTrue { semesters1.single { it.second }.second } + semesters1[0].run { + assertFalse(second) + assertEquals(1, first.semesterId) + assertEquals(1, first.diaryId) + } + semesters1[2].run { + assertFalse(second) + assertEquals(3, first.semesterId) + assertEquals(2, first.diaryId) + } + semesters1[3].run { + assertTrue(second) + assertEquals(4, first.semesterId) + assertEquals(2, first.diaryId) + } + + getSemesters(db, "SELECT * FROM Semesters WHERE student_id = 2 AND class_id = 5").let { semesters -> + assertTrue { semesters.single { it.second }.second } + assertEquals(1970, semesters[0].first.schoolYear) + assertEquals(of(1970, 1, 1), semesters[0].first.end) + assertEquals(of(1970, 1, 1), semesters[0].first.start) + assertFalse(semesters[0].second) + assertFalse(semesters[1].second) + assertFalse(semesters[2].second) + assertTrue(semesters[3].second) + } + + getSemesters(db, "SELECT * FROM Semesters WHERE student_id = 2 AND class_id = 5").let { semesters -> + assertTrue { semesters.single { it.second }.second } + assertFalse(semesters[0].second) + assertFalse(semesters[1].second) + assertFalse(semesters[2].second) + assertTrue(semesters[3].second) + } + } + + private fun getSemesters(db: SupportSQLiteDatabase, query: String): List> { + val semesters = mutableListOf>() + + val cursor = db.query(query) + if (cursor.moveToFirst()) { + do { + semesters.add(Semester( + studentId = cursor.getInt(1), + diaryId = cursor.getInt(2), + diaryName = cursor.getString(3), + semesterId = cursor.getInt(4), + semesterName = cursor.getInt(5), + classId = cursor.getInt(7), + unitId = cursor.getInt(8), + schoolYear = cursor.getInt(9), + start = Converters().timestampToDate(cursor.getLong(10))!!, + end = Converters().timestampToDate(cursor.getLong(11))!! + ) to (cursor.getInt(6) == 1)) + } while (cursor.moveToNext()) + } + return semesters.toList() + } + + private fun createStudent(db: SupportSQLiteDatabase, studentId: Int, schoolName: String = "", classId: Int = -1, schoolId: Int = 123) { + db.insert("Students", SQLiteDatabase.CONFLICT_FAIL, ContentValues().apply { + put("endpoint", "https://fakelog.cf") + put("loginType", "STANDARD") + put("email", "jan@fakelog.cf") + put("password", "******") + put("symbol", "Default") + put("student_id", studentId) + put("class_id", classId) + put("student_name", "Jan Kowalski") + put("school_id", schoolId) + put("school_name", schoolName) + put("is_current", false) + put("registration_date", "0") + }) + } + + private fun createSemester(db: SupportSQLiteDatabase, studentId: Int, classId: Int, semesterId: Int, diaryId: Int, isCurrent: Boolean = false) { + db.insert("Semesters", SQLiteDatabase.CONFLICT_FAIL, ContentValues().apply { + put("student_id", studentId) + put("diary_id", diaryId) + put("diary_name", "IA") + put("semester_id", semesterId) + put("semester_name", "1") + put("is_current", isCurrent) + put("class_id", classId) + put("unit_id", "99") + }) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/Migration27Test.kt b/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/Migration27Test.kt new file mode 100644 index 00000000..75955258 --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/db/migrations/Migration27Test.kt @@ -0,0 +1,124 @@ +package io.github.wulkanowy.data.db.migrations + +import android.content.ContentValues +import android.database.sqlite.SQLiteDatabase +import androidx.sqlite.db.SupportSQLiteDatabase +import kotlinx.coroutines.runBlocking +import org.junit.Assert.assertEquals +import org.junit.Test +import kotlin.random.Random + +class Migration27Test : AbstractMigrationTest() { + + @Test + fun userWithoutCorrespondingUnit() { + with(helper.createDatabase(dbName, 26)) { + createStudent(this, 321, 123, "Jan Student") + createUnit(this, 9999, "Unit Jan") + close() + } + + helper.runMigrationsAndValidate(dbName, 27, true, Migration27()) + + val db = getMigratedRoomDatabase() + val students = runBlocking { db.studentDao.loadAll() } + + assertEquals(1, students.size) + + with(students[0]) { + assertEquals(321, id) + assertEquals(123, userLoginId) + assertEquals("Student Jan", userName) + } + } + + @Test + fun userWithCorrespondingUnit() { + with(helper.createDatabase(dbName, 26)) { + createStudent(this, 1, 2, "Jan Kowalski Student") + createUnit(this, 2, "Unit Jan") + close() + } + + helper.runMigrationsAndValidate(dbName, 27, true, Migration27()) + + val db = getMigratedRoomDatabase() + val students = runBlocking { db.studentDao.loadAll() } + + assertEquals(1, students.size) + + with(students[0]) { + assertEquals(1, id) + assertEquals(2, userLoginId) + assertEquals("Unit Jan", userName) + } + } + + @Test + fun studentAccountAndParentAccountWithCorrespondingUnits() { + with(helper.createDatabase(dbName, 26)) { + createStudent(this, 1, 222, "Jan Student") + createStudent(this, 2, 333, "Jan Parent") + createUnit(this, 222, "Unit Jan") + createUnit(this, 333, "Unit Tomasz") + close() + } + + helper.runMigrationsAndValidate(dbName, 27, true, Migration27()) + + val db = getMigratedRoomDatabase() + val students = runBlocking { db.studentDao.loadAll() } + + assertEquals(2, students.size) + + with(students[0]) { + assertEquals(1, id) + assertEquals(222, userLoginId) + assertEquals("Unit Jan", userName) + } + with(students[1]) { + assertEquals(2, id) + assertEquals(333, userLoginId) + assertEquals("Unit Tomasz", userName) + } + } + + private fun createStudent(db: SupportSQLiteDatabase, id: Long, userLoginId: Int, studentName: String) { + db.insert("Students", SQLiteDatabase.CONFLICT_FAIL, ContentValues().apply { + put("id", id) + put("scrapper_base_url", "https://fakelog.cf") + put("mobile_base_url", "") + put("login_mode", "SCRAPPER") + put("login_type", "STANDARD") + put("certificate_key", "") + put("private_key", "") + put("is_parent", false) + put("email", "jan@fakelog.cf") + put("password", "******") + put("symbol", "Default") + put("school_short", "") + put("class_name", "") + put("student_id", Random.nextInt()) + put("class_id", Random.nextInt()) + put("school_id", "123") + put("school_name", "Wulkan first class school") + put("is_current", false) + put("registration_date", "0") + + put("user_login_id", userLoginId) + put("student_name", studentName) + }) + } + + private fun createUnit(db: SupportSQLiteDatabase, senderId: Int, senderName: String) { + db.insert("ReportingUnits", SQLiteDatabase.CONFLICT_FAIL, ContentValues().apply { + put("student_id", Random.nextInt()) + put("real_id", Random.nextInt()) + put("short", "SHORT") + put("roles", "[0]") + + put("sender_id", senderId) + put("sender_name", senderName) + }) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/TestEntityCreator.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/TestEntityCreator.kt new file mode 100644 index 00000000..04d13be4 --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/TestEntityCreator.kt @@ -0,0 +1,45 @@ +package io.github.wulkanowy.data.repositories + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import java.time.LocalDate.now +import java.time.LocalDateTime + +fun getStudent(): Student { + return Student( + email = "test", + password = "test123", + schoolSymbol = "23", + scrapperBaseUrl = "fakelog.cf", + loginType = "AUTO", + isCurrent = true, + userName = "", + studentName = "", + schoolShortName = "", + schoolName = "", + studentId = 0, + classId = 1, + symbol = "", + registrationDate = LocalDateTime.now(), + className = "", + loginMode = "API", + certificateKey = "", + privateKey = "", + mobileBaseUrl = "", + userLoginId = 0, + isParent = false + ) +} + +fun getSemester() = Semester( + semesterId = 1, + studentId = 1, + classId = 1, + diaryId = 2, + diaryName = "", + end = now(), + schoolYear = 2019, + semesterName = 1, + start = now(), + unitId = 1 +) diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/attendance/AttendanceLocalTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/attendance/AttendanceLocalTest.kt new file mode 100644 index 00000000..fa128986 --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/attendance/AttendanceLocalTest.kt @@ -0,0 +1,83 @@ +package io.github.wulkanowy.data.repositories.attendance + +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider +import androidx.test.ext.junit.runners.AndroidJUnit4 +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.entities.Attendance +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import java.time.LocalDate +import java.time.LocalDate.now +import java.time.LocalDate.of +import kotlin.test.assertEquals + +@RunWith(AndroidJUnit4::class) +class AttendanceLocalTest { + + private lateinit var attendanceLocal: AttendanceLocal + + private lateinit var testDb: AppDatabase + + @Before + fun createDb() { + testDb = Room.inMemoryDatabaseBuilder(ApplicationProvider.getApplicationContext(), AppDatabase::class.java).build() + attendanceLocal = AttendanceLocal(testDb.attendanceDao) + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun saveAndReadTest() { + val list = listOf( + getAttendanceEntity( + of(2018, 9, 10), + SentExcuseStatus.ACCEPTED + ), + getAttendanceEntity( + of(2018, 9, 14), + SentExcuseStatus.WAITING + ), + getAttendanceEntity( + of(2018, 9, 17), + SentExcuseStatus.ACCEPTED + ) + ) + runBlocking { attendanceLocal.saveAttendance(list) } + + val semester = Semester(1, 2, "", 1, 3, 2019, now(), now(), 1, 1) + val attendance = runBlocking { attendanceLocal.getAttendance(semester, of(2018, 9, 10), of(2018, 9, 14)).first() } + assertEquals(2, attendance.size) + assertEquals(attendance[0].date, of(2018, 9, 10)) + assertEquals(attendance[1].date, of(2018, 9, 14)) + } + + private fun getAttendanceEntity( + date: LocalDate, + excuseStatus: SentExcuseStatus + ) = Attendance( + studentId = 1, + diaryId = 2, + timeId = 3, + date = date, + number = 0, + subject = "", + name = "", + presence = false, + absence = false, + exemption = false, + lateness = false, + excused = false, + deleted = false, + excusable = false, + excuseStatus = excuseStatus.name + ) +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsLocalTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsLocalTest.kt new file mode 100644 index 00000000..ca7d0b1b --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsLocalTest.kt @@ -0,0 +1,59 @@ +package io.github.wulkanowy.data.repositories.completedlessons + +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider +import androidx.test.ext.junit.runners.AndroidJUnit4 +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.entities.CompletedLesson +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import java.time.LocalDate +import java.time.LocalDate.now +import java.time.LocalDate.of +import kotlin.test.assertEquals + +@RunWith(AndroidJUnit4::class) +class CompletedLessonsLocalTest { + + private lateinit var completedLessonsLocal: CompletedLessonsLocal + + private lateinit var testDb: AppDatabase + + @Before + fun createDb() { + testDb = Room + .inMemoryDatabaseBuilder(ApplicationProvider.getApplicationContext(), AppDatabase::class.java) + .build() + completedLessonsLocal = CompletedLessonsLocal(testDb.completedLessonsDao) + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun saveAndReadTest() { + val list = listOf( + getCompletedLesson(of(2018, 9, 10), 1), + getCompletedLesson(of(2018, 9, 14), 2), + getCompletedLesson(of(2018, 9, 17), 3) + ) + runBlocking { completedLessonsLocal.saveCompletedLessons(list) } + + val semester = Semester(1, 2, "", 1, 3, 2019, now(), now(), 1, 1) + val completed = runBlocking { completedLessonsLocal.getCompletedLessons(semester, of(2018, 9, 10), of(2018, 9, 14)).first() } + assertEquals(2, completed.size) + assertEquals(completed[0].date, of(2018, 9, 10)) + assertEquals(completed[1].date, of(2018, 9, 14)) + } + + private fun getCompletedLesson(date: LocalDate, number: Int): CompletedLesson { + return CompletedLesson(1, 2, date, number, "", "", "", "", "", "", "") + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/exam/ExamLocalTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/exam/ExamLocalTest.kt new file mode 100644 index 00000000..14b29c9f --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/exam/ExamLocalTest.kt @@ -0,0 +1,52 @@ +package io.github.wulkanowy.data.repositories.exam + +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider +import androidx.test.ext.junit.runners.AndroidJUnit4 +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.entities.Exam +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import java.time.LocalDate.now +import java.time.LocalDate.of +import kotlin.test.assertEquals + +@RunWith(AndroidJUnit4::class) +class ExamLocalTest { + + private lateinit var examLocal: ExamLocal + + private lateinit var testDb: AppDatabase + + @Before + fun createDb() { + testDb = Room.inMemoryDatabaseBuilder(ApplicationProvider.getApplicationContext(), AppDatabase::class.java).build() + examLocal = ExamLocal(testDb.examsDao) + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun saveAndReadTest() { + val list = listOf( + Exam(1, 2, of(2018, 9, 10), now(), "", "", "", "", "", ""), + Exam(1, 2, of(2018, 9, 14), now(), "", "", "", "", "", ""), + Exam(1, 2, of(2018, 9, 17), now(), "", "", "", "", "", "") + ) + runBlocking { examLocal.saveExams(list) } + + val semester = Semester(1, 2, "", 1, 3, 2019, now(), now(), 1, 1) + val exams = runBlocking { examLocal.getExams(semester, of(2018, 9, 10), of(2018, 9, 14)).first() } + assertEquals(2, exams.size) + assertEquals(exams[0].date, of(2018, 9, 10)) + assertEquals(exams[1].date, of(2018, 9, 14)) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/grade/GradeLocalTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/grade/GradeLocalTest.kt new file mode 100644 index 00000000..946ebf8e --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/grade/GradeLocalTest.kt @@ -0,0 +1,55 @@ +package io.github.wulkanowy.data.repositories.grade + +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider +import androidx.test.ext.junit.runners.AndroidJUnit4 +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import java.time.LocalDate +import java.time.LocalDate.now +import kotlin.test.assertEquals + +@RunWith(AndroidJUnit4::class) +class GradeLocalTest { + + private lateinit var gradeLocal: GradeLocal + + private lateinit var testDb: AppDatabase + + @Before + fun createDb() { + testDb = Room + .inMemoryDatabaseBuilder(ApplicationProvider.getApplicationContext(), AppDatabase::class.java) + .build() + gradeLocal = GradeLocal(testDb.gradeDao, testDb.gradeSummaryDao) + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun saveAndReadTest() { + val list = listOf( + createGradeLocal(5, 3.0, LocalDate.of(2018, 9, 10), "", 1), + createGradeLocal(4, 4.0, LocalDate.of(2019, 2, 27), "", 2), + createGradeLocal(3, 5.0, LocalDate.of(2019, 2, 28), "", 2) + ) + runBlocking { gradeLocal.saveGrades(list) } + + val semester = Semester(1, 2, "", 2019, 2, 1, now(), now(), 1, 1) + + val grades = runBlocking { gradeLocal.getGradesDetails(semester).first() } + + assertEquals(2, grades.size) + assertEquals(grades[0].date, LocalDate.of(2019, 2, 27)) + assertEquals(grades[1].date, LocalDate.of(2019, 2, 28)) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/grade/GradeRepositoryTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/grade/GradeRepositoryTest.kt new file mode 100644 index 00000000..5cf9c219 --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/grade/GradeRepositoryTest.kt @@ -0,0 +1,221 @@ +package io.github.wulkanowy.data.repositories.grade + +import android.os.Build.VERSION_CODES.P +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider.getApplicationContext +import androidx.test.ext.junit.runners.AndroidJUnit4 +import androidx.test.filters.SdkSuppress +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.mockk.MockKAnnotations +import io.mockk.coEvery +import io.mockk.every +import io.mockk.impl.annotations.MockK +import kotlinx.coroutines.flow.filter +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import java.time.LocalDate.of +import java.time.LocalDateTime +import kotlin.test.assertEquals +import kotlin.test.assertFalse +import kotlin.test.assertTrue + +@SdkSuppress(minSdkVersion = P) +@RunWith(AndroidJUnit4::class) +class GradeRepositoryTest { + + @MockK + private lateinit var semesterMock: Semester + + private lateinit var studentMock: Student + + @MockK + private lateinit var gradeRemote: GradeRemote + + private lateinit var gradeLocal: GradeLocal + + private lateinit var testDb: AppDatabase + + @Before + fun initApi() { + MockKAnnotations.init(this) + testDb = Room.inMemoryDatabaseBuilder(getApplicationContext(), AppDatabase::class.java).build() + gradeLocal = GradeLocal(testDb.gradeDao, testDb.gradeSummaryDao) + studentMock = getStudentMock() + + every { semesterMock.studentId } returns 1 + every { semesterMock.diaryId } returns 1 + every { semesterMock.schoolYear } returns 2019 + every { semesterMock.semesterId } returns 1 + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun markOlderThanRegisterDateAsRead() { + coEvery { gradeRemote.getGrades(studentMock, semesterMock) } returns (listOf( + createGradeLocal(5, 4.0, of(2019, 2, 25), "Ocena pojawiła się"), + createGradeLocal(5, 4.0, of(2019, 2, 26), "przed zalogowanie w aplikacji"), + createGradeLocal(5, 4.0, of(2019, 2, 27), "Ocena z dnia logowania"), + createGradeLocal(5, 4.0, of(2019, 2, 28), "Ocena jeszcze nowsza") + ) to emptyList()) + + val grades = runBlocking { + GradeRepository(gradeLocal, gradeRemote) + .getGrades(studentMock, semesterMock, true) + .filter { it.status == Status.SUCCESS }.first().data!!.first.sortedByDescending { it.date } + } + + assertFalse { grades[0].isRead } + assertFalse { grades[1].isRead } + assertTrue { grades[2].isRead } + assertTrue { grades[3].isRead } + } + + @Test + fun mitigateOldGradesNotifications() { + val list = listOf( + createGradeLocal(5, 3.0, of(2019, 2, 25), "Jedna ocena"), + createGradeLocal(4, 4.0, of(2019, 2, 26), "Druga"), + createGradeLocal(3, 5.0, of(2019, 2, 27), "Trzecia") + ) + runBlocking { gradeLocal.saveGrades(list) } + + coEvery { gradeRemote.getGrades(studentMock, semesterMock) } returns (listOf( + createGradeLocal(5, 2.0, of(2019, 2, 25), "Ocena ma datę, jest inna, ale nie zostanie powiadomiona"), + createGradeLocal(4, 3.0, of(2019, 2, 26), "starszą niż ostatnia lokalnie"), + createGradeLocal(3, 4.0, of(2019, 2, 27), "Ta jest z tego samego dnia co ostatnia lokalnie"), + createGradeLocal(2, 5.0, of(2019, 2, 28), "Ta jest już w ogóle nowa") + ) to emptyList()) + + val grades = runBlocking { + GradeRepository(gradeLocal, gradeRemote) + .getGrades(studentMock, semesterMock, true) + .filter { it.status == Status.SUCCESS }.first().data!!.first.sortedByDescending { it.date } + } + + assertFalse { grades[0].isRead } + assertFalse { grades[1].isRead } + assertTrue { grades[2].isRead } + assertTrue { grades[3].isRead } + } + + @Test + fun subtractLocaleDuplicateGrades() { + val list = listOf( + createGradeLocal(5, 3.0, of(2019, 2, 25), "Taka sama ocena"), + createGradeLocal(5, 3.0, of(2019, 2, 25), "Taka sama ocena"), + createGradeLocal(3, 5.0, of(2019, 2, 26), "Jakaś inna ocena") + ) + runBlocking { gradeLocal.saveGrades(list) } + + coEvery { gradeRemote.getGrades(studentMock, semesterMock) } returns (listOf( + createGradeLocal(5, 3.0, of(2019, 2, 25), "Taka sama ocena"), + createGradeLocal(3, 5.0, of(2019, 2, 26), "Jakaś inna ocena") + ) to emptyList()) + + val grades = runBlocking { + GradeRepository(gradeLocal, gradeRemote) + .getGrades(studentMock, semesterMock, true) + .filter { it.status == Status.SUCCESS }.first().data!! + } + + assertEquals(2, grades.first.size) + } + + @Test + fun subtractRemoteDuplicateGrades() { + val list = listOf( + createGradeLocal(5, 3.0, of(2019, 2, 25), "Taka sama ocena"), + createGradeLocal(3, 5.0, of(2019, 2, 26), "Jakaś inna ocena") + ) + runBlocking { gradeLocal.saveGrades(list) } + + coEvery { gradeRemote.getGrades(studentMock, semesterMock) } returns (listOf( + createGradeLocal(5, 3.0, of(2019, 2, 25), "Taka sama ocena"), + createGradeLocal(5, 3.0, of(2019, 2, 25), "Taka sama ocena"), + createGradeLocal(3, 5.0, of(2019, 2, 26), "Jakaś inna ocena") + ) to emptyList()) + + val grades = runBlocking { + GradeRepository(gradeLocal, gradeRemote) + .getGrades(studentMock, semesterMock, true) + .filter { it.status == Status.SUCCESS }.first().data!! + } + + assertEquals(3, grades.first.size) + } + + @Test + fun emptyLocal() { + runBlocking { gradeLocal.saveGrades(listOf()) } + + coEvery { gradeRemote.getGrades(studentMock, semesterMock) } returns (listOf( + createGradeLocal(5, 3.0, of(2019, 2, 25), "Taka sama ocena"), + createGradeLocal(5, 3.0, of(2019, 2, 25), "Taka sama ocena"), + createGradeLocal(3, 5.0, of(2019, 2, 26), "Jakaś inna ocena") + ) to emptyList()) + + val grades = runBlocking { + GradeRepository(gradeLocal, gradeRemote) + .getGrades(studentMock, semesterMock, true) + .filter { it.status == Status.SUCCESS }.first().data!! + } + + assertEquals(3, grades.first.size) + } + + @Test + fun emptyRemote() { + val list = listOf( + createGradeLocal(5, 3.0, of(2019, 2, 25), "Taka sama ocena"), + createGradeLocal(3, 5.0, of(2019, 2, 26), "Jakaś inna ocena") + ) + runBlocking { gradeLocal.saveGrades(list) } + + coEvery { gradeRemote.getGrades(studentMock, semesterMock) } returns (emptyList() to emptyList()) + + val grades = runBlocking { + GradeRepository(gradeLocal, gradeRemote) + .getGrades(studentMock, semesterMock, true) + .filter { it.status == Status.SUCCESS }.first().data!! + } + + assertEquals(0, grades.first.size) + } + + private fun getStudentMock() = Student( + scrapperBaseUrl = "http://fakelog.cf", + email = "jan@fakelog.cf", + certificateKey = "", + classId = 0, + className = "", + isCurrent = false, + isParent = false, + loginMode = Sdk.Mode.SCRAPPER.name, + loginType = "STANDARD", + mobileBaseUrl = "", + password = "", + privateKey = "", + registrationDate = LocalDateTime.of(2019, 2, 27, 12, 0), + schoolName = "", + schoolShortName = "test", + schoolSymbol = "", + studentId = 0, + studentName = "", + symbol = "", + userLoginId = 0, + userName = "" + ) +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/grade/TestGradeEntityCreator.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/grade/TestGradeEntityCreator.kt new file mode 100644 index 00000000..629c2432 --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/grade/TestGradeEntityCreator.kt @@ -0,0 +1,41 @@ +package io.github.wulkanowy.data.repositories.grade + +import java.time.LocalDate +import io.github.wulkanowy.sdk.pojo.Grade as GradeRemote +import io.github.wulkanowy.data.db.entities.Grade as GradeLocal + +fun createGradeLocal(value: Int, weight: Double, date: LocalDate, desc: String, semesterId: Int = 1): GradeLocal { + return GradeLocal( + semesterId = semesterId, + studentId = 1, + modifier = .0, + teacher = "", + subject = "", + date = date, + color = "", + comment = "", + description = desc, + entry = "", + gradeSymbol = "", + value = value.toDouble(), + weight = "", + weightValue = weight + ) +} + +fun createGradeApi(value: Int, weight: Double, date: LocalDate, desc: String): GradeRemote { + return GradeRemote( + subject = "", + color = "", + comment = "", + date = date, + description = desc, + entry = "", + modifier = .0, + symbol = "", + teacher = "", + value = value.toDouble(), + weight = weight.toString(), + weightValue = weight + ) +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsLocalTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsLocalTest.kt new file mode 100644 index 00000000..197d2d0e --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsLocalTest.kt @@ -0,0 +1,112 @@ +package io.github.wulkanowy.data.repositories.gradestatistics + +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider +import androidx.test.ext.junit.runners.AndroidJUnit4 +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.entities.GradePointsStatistics +import io.github.wulkanowy.data.db.entities.GradeStatistics +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import java.time.LocalDate.now +import kotlin.test.assertEquals + +@RunWith(AndroidJUnit4::class) +class GradeStatisticsLocalTest { + + private lateinit var gradeStatisticsLocal: GradeStatisticsLocal + + private lateinit var testDb: AppDatabase + + @Before + fun createDb() { + testDb = Room.inMemoryDatabaseBuilder(ApplicationProvider.getApplicationContext(), AppDatabase::class.java) + .build() + gradeStatisticsLocal = GradeStatisticsLocal(testDb.gradeStatistics, testDb.gradePointsStatistics) + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun saveAndRead_subject() { + val list = listOf( + getGradeStatistics("Matematyka", 2, 1), + getGradeStatistics("Fizyka", 1, 2) + ) + runBlocking { gradeStatisticsLocal.saveGradesStatistics(list) } + + val stats = runBlocking { gradeStatisticsLocal.getGradesStatistics(getSemester(), false).first() } + assertEquals(1, stats.size) + assertEquals(stats[0].subject, "Matematyka") + } + + @Test + fun saveAndRead_all() { + val list = listOf( + getGradeStatistics("Matematyka", 2, 1), + getGradeStatistics("Chemia", 2, 1), + getGradeStatistics("Fizyka", 1, 2) + ) + runBlocking { gradeStatisticsLocal.saveGradesStatistics(list) } + + val stats = runBlocking { gradeStatisticsLocal.getGradesStatistics(getSemester(), false).first() } + assertEquals(2, stats.size) +// assertEquals(3, stats.size) +// assertEquals(stats[0].subject, "Wszystkie") // now in main repo + assertEquals(stats[0].subject, "Matematyka") + assertEquals(stats[1].subject, "Chemia") + } + + @Test + fun saveAndRead_points() { + val list = listOf( + getGradePointsStatistics("Matematyka", 2, 1), + getGradePointsStatistics("Chemia", 2, 1), + getGradePointsStatistics("Fizyka", 1, 2) + ) + runBlocking { gradeStatisticsLocal.saveGradesPointsStatistics(list) } + + val stats = runBlocking { gradeStatisticsLocal.getGradesPointsStatistics(getSemester()).first() } + with(stats[0]) { + assertEquals(subject, "Matematyka") + assertEquals(others, 5.0) + assertEquals(student, 5.0) + } + } + + @Test + fun saveAndRead_subjectEmpty() { + runBlocking { gradeStatisticsLocal.saveGradesPointsStatistics(listOf()) } + + val stats = runBlocking { gradeStatisticsLocal.getGradesPointsStatistics(getSemester()).first() } + assertEquals(emptyList(), stats) + } + + @Test + fun saveAndRead_allEmpty() { + runBlocking { gradeStatisticsLocal.saveGradesPointsStatistics(listOf()) } + + val stats = runBlocking { gradeStatisticsLocal.getGradesPointsStatistics(getSemester()).first() } + assertEquals(emptyList(), stats) + } + + private fun getSemester(): Semester { + return Semester(2, 2, "", 2019, 1, 2, now(), now(), 1, 1) + } + + private fun getGradeStatistics(subject: String, studentId: Int, semesterId: Int): GradeStatistics { + return GradeStatistics(studentId, semesterId, subject, 5, 5, false) + } + + private fun getGradePointsStatistics(subject: String, studentId: Int, semesterId: Int): GradePointsStatistics { + return GradePointsStatistics(studentId, semesterId, subject, 5.0, 5.0) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberLocalTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberLocalTest.kt new file mode 100644 index 00000000..ca38b1fe --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberLocalTest.kt @@ -0,0 +1,51 @@ +package io.github.wulkanowy.data.repositories.luckynumber + +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider +import androidx.test.ext.junit.runners.AndroidJUnit4 +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.entities.LuckyNumber +import io.github.wulkanowy.data.db.entities.Student +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import java.time.LocalDate +import java.time.LocalDateTime.now +import kotlin.test.assertEquals + +@RunWith(AndroidJUnit4::class) +class LuckyNumberLocalTest { + + private lateinit var luckyNumberLocal: LuckyNumberLocal + + private lateinit var testDb: AppDatabase + + @Before + fun createDb() { + testDb = Room + .inMemoryDatabaseBuilder(ApplicationProvider.getApplicationContext(), AppDatabase::class.java) + .build() + luckyNumberLocal = LuckyNumberLocal(testDb.luckyNumberDao) + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun saveAndReadTest() { + val number = LuckyNumber(1, LocalDate.of(2019, 1, 20), 14) + runBlocking { luckyNumberLocal.saveLuckyNumber(number) } + + val student = Student("", "", "", "", "", "", false, "", "", "", 1, 1, "", "", "", "", "", "", 1, false, now()) + val luckyNumber = runBlocking { luckyNumberLocal.getLuckyNumber(student, LocalDate.of(2019, 1, 20)).first() } + + assertEquals(1, luckyNumber?.studentId) + assertEquals(LocalDate.of(2019, 1, 20), luckyNumber?.date) + assertEquals(14, luckyNumber?.luckyNumber) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/recipient/RecipientLocalTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/recipient/RecipientLocalTest.kt new file mode 100644 index 00000000..6bd1959b --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/recipient/RecipientLocalTest.kt @@ -0,0 +1,65 @@ +package io.github.wulkanowy.data.repositories.recipient + +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider +import androidx.test.ext.junit.runners.AndroidJUnit4 +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.entities.Recipient +import io.github.wulkanowy.data.db.entities.ReportingUnit +import io.github.wulkanowy.data.db.entities.Student +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import java.time.LocalDateTime +import kotlin.test.assertEquals + +@RunWith(AndroidJUnit4::class) +class RecipientLocalTest { + + private lateinit var recipientLocal: RecipientLocal + + private lateinit var testDb: AppDatabase + + @Before + fun createDb() { + testDb = Room.inMemoryDatabaseBuilder(ApplicationProvider.getApplicationContext(), AppDatabase::class.java) + .build() + recipientLocal = RecipientLocal(testDb.recipientDao) + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun saveAndReadTest() { + val list = listOf( + Recipient(1, "2rPracownik", "Kowalski Jan", "Kowalski Jan [KJ] - Pracownik (Fake123456)", 3, 4, 2, "hash"), + Recipient(1, "3rPracownik", "Kowalska Karolina", "Kowalska Karolina [KK] - Pracownik (Fake123456)", 4, 4, 2, "hash"), + Recipient(1, "4rPracownik", "Krupa Stanisław", "Krupa Stanisław [KS] - Uczeń (Fake123456)", 5, 4, 1, "hash") + ) + runBlocking { recipientLocal.saveRecipients(list) } + + val student = Student("fakelog.cf", "AUTO", "", "", "", "", false, "", "", "", 1, 0, "", "", "", "", "", "", 1, true, LocalDateTime.now()) + val recipients = runBlocking { + recipientLocal.getRecipients( + student = student, + role = 2, + unit = ReportingUnit(1, 4, "", 0, "", emptyList()) + ) + } + + assertEquals(2, recipients.size) + assertEquals(1, recipients[0].studentId) + assertEquals("3rPracownik", recipients[1].realId) + assertEquals("Kowalski Jan", recipients[0].name) + assertEquals("Kowalska Karolina [KK] - Pracownik (Fake123456)", recipients[1].realName) + assertEquals(3, recipients[0].loginId) + assertEquals(4, recipients[1].unitId) + assertEquals(2, recipients[0].role) + assertEquals("hash", recipients[1].hash) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/student/StudentLocalTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/student/StudentLocalTest.kt new file mode 100644 index 00000000..d68f15a8 --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/student/StudentLocalTest.kt @@ -0,0 +1,46 @@ +package io.github.wulkanowy.data.repositories.student + +import android.content.Context +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider +import androidx.test.ext.junit.runners.AndroidJUnit4 +import io.github.wulkanowy.data.TestDispatchersProvider +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.repositories.getStudent +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import kotlin.test.assertEquals + +@RunWith(AndroidJUnit4::class) +class StudentLocalTest { + + private lateinit var studentLocal: StudentLocal + + private lateinit var testDb: AppDatabase + + private val student = getStudent() + + @Before + fun createDb() { + val context = ApplicationProvider.getApplicationContext() + testDb = Room.inMemoryDatabaseBuilder(context, AppDatabase::class.java) + .build() + studentLocal = StudentLocal(testDb.studentDao, TestDispatchersProvider(), context) + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun saveAndReadTest() { + runBlocking { studentLocal.saveStudents(listOf(student)) } + + val student = runBlocking { studentLocal.getCurrentStudent(true) } + assertEquals("23", student?.schoolSymbol) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/timetable/TestTimetableEntityCreator.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/timetable/TestTimetableEntityCreator.kt new file mode 100644 index 00000000..dddf6464 --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/timetable/TestTimetableEntityCreator.kt @@ -0,0 +1,48 @@ +package io.github.wulkanowy.data.repositories.timetable + +import java.time.LocalDateTime +import java.time.LocalDateTime.now +import io.github.wulkanowy.data.db.entities.Timetable as TimetableLocal +import io.github.wulkanowy.sdk.pojo.Timetable as TimetableRemote + +fun createTimetableLocal(start: LocalDateTime, number: Int, room: String = "", subject: String = "", teacher: String = "", changes: Boolean = false): TimetableLocal { + return TimetableLocal( + studentId = 1, + diaryId = 2, + number = number, + start = start, + end = now(), + date = start.toLocalDate(), + subject = subject, + subjectOld = "", + group = "", + room = room, + roomOld = "", + teacher = teacher, + teacherOld = "", + info = "", + isStudentPlan = true, + changes = changes, + canceled = false + ) +} + +fun createTimetableRemote(start: LocalDateTime, number: Int = 1, room: String = "", subject: String = "", teacher: String = "", changes: Boolean = false): TimetableRemote { + return TimetableRemote( + number = number, + start = start, + end = start.plusMinutes(45), + date = start.toLocalDate(), + subject = subject, + group = "", + room = room, + teacher = teacher, + info = "", + changes = changes, + canceled = false, + roomOld = "", + subjectOld = "", + teacherOld = "", + studentPlan = true + ) +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/timetable/TimetableLocalTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/timetable/TimetableLocalTest.kt new file mode 100644 index 00000000..e793212e --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/timetable/TimetableLocalTest.kt @@ -0,0 +1,59 @@ +package io.github.wulkanowy.data.repositories.timetable + +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider +import androidx.test.ext.junit.runners.AndroidJUnit4 +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import java.time.LocalDate +import java.time.LocalDateTime.of +import kotlin.test.assertEquals + +@RunWith(AndroidJUnit4::class) +class TimetableLocalTest { + + private lateinit var timetableDb: TimetableLocal + + private lateinit var testDb: AppDatabase + + @Before + fun createDb() { + testDb = Room.inMemoryDatabaseBuilder(ApplicationProvider.getApplicationContext(), AppDatabase::class.java) + .build() + timetableDb = TimetableLocal(testDb.timetableDao) + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun saveAndReadTest() { + val list = listOf( + createTimetableLocal(of(2018, 9, 10, 0, 0, 0), 1), + createTimetableLocal(of(2018, 9, 14, 0, 0, 0), 1), + createTimetableLocal(of(2018, 9, 17, 0, 0, 0), 1) + ) + runBlocking { timetableDb.saveTimetable(list) } + + val semester = Semester(1, 2, "", 1, 1, 2019, LocalDate.now(), LocalDate.now(), 1, 1) + val exams = runBlocking { + timetableDb.getTimetable( + semester = semester, + startDate = LocalDate.of(2018, 9, 10), + endDate = LocalDate.of(2018, 9, 14) + ).first() + } + + assertEquals(2, exams.size) + assertEquals(exams[0].date, LocalDate.of(2018, 9, 10)) + assertEquals(exams[1].date, LocalDate.of(2018, 9, 14)) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/data/repositories/timetable/TimetableRepositoryTest.kt b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/timetable/TimetableRepositoryTest.kt new file mode 100644 index 00000000..1bd3c467 --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/data/repositories/timetable/TimetableRepositoryTest.kt @@ -0,0 +1,155 @@ +package io.github.wulkanowy.data.repositories.timetable + +import android.os.Build.VERSION_CODES.P +import androidx.room.Room +import androidx.test.core.app.ApplicationProvider.getApplicationContext +import androidx.test.ext.junit.runners.AndroidJUnit4 +import androidx.test.filters.SdkSuppress +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.repositories.getSemester +import io.github.wulkanowy.data.repositories.getStudent +import io.github.wulkanowy.services.alarm.TimetableNotificationSchedulerHelper +import io.mockk.MockKAnnotations +import io.mockk.coEvery +import io.mockk.impl.annotations.MockK +import kotlinx.coroutines.flow.filter +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.runBlocking +import org.junit.After +import org.junit.Before +import org.junit.Test +import org.junit.runner.RunWith +import java.time.LocalDate +import java.time.LocalDateTime.of +import kotlin.test.assertEquals + +@SdkSuppress(minSdkVersion = P) +@RunWith(AndroidJUnit4::class) +class TimetableRepositoryTest { + + @MockK(relaxed = true) + private lateinit var timetableNotificationSchedulerHelper: TimetableNotificationSchedulerHelper + + @MockK + private lateinit var timetableRemote: TimetableRemote + + private lateinit var timetableLocal: TimetableLocal + + private lateinit var testDb: AppDatabase + + private val student = getStudent() + + private val semester = getSemester() + + @Before + fun initApi() { + MockKAnnotations.init(this) + testDb = Room.inMemoryDatabaseBuilder(getApplicationContext(), AppDatabase::class.java).build() + timetableLocal = TimetableLocal(testDb.timetableDao) + } + + @After + fun closeDb() { + testDb.close() + } + + @Test + fun copyRoomToCompletedFromPrevious() { + runBlocking { + timetableLocal.saveTimetable(listOf( + createTimetableLocal(of(2019, 3, 5, 8, 0), 1, "123", "Przyroda"), + createTimetableLocal(of(2019, 3, 5, 8, 50), 2, "321", "Religia"), + createTimetableLocal(of(2019, 3, 5, 9, 40), 3, "213", "W-F"), + createTimetableLocal(of(2019, 3, 5, 10, 30), 3, "213", "W-F", "Jan Kowalski") + )) + } + + coEvery { timetableRemote.getTimetable(student, semester, any(), any()) } returns listOf( + createTimetableLocal(of(2019, 3, 5, 8, 0), 1, "", "Przyroda"), + createTimetableLocal(of(2019, 3, 5, 8, 50), 2, "", "Religia"), + createTimetableLocal(of(2019, 3, 5, 9, 40), 3, "", "W-F"), + createTimetableLocal(of(2019, 3, 5, 10, 30), 4, "", "W-F") + ) + + val lessons = runBlocking { + TimetableRepository(timetableLocal, timetableRemote, timetableNotificationSchedulerHelper).getTimetable( + student = student, + semester = semester, + start = LocalDate.of(2019, 3, 5), + end = LocalDate.of(2019, 3, 5), + forceRefresh = true + ).filter { it.status == Status.SUCCESS }.first().data.orEmpty() + } + + assertEquals(4, lessons.size) + assertEquals("123", lessons[0].room) + assertEquals("321", lessons[1].room) + assertEquals("213", lessons[2].room) + } + + @Test + fun copyTeacherToCompletedFromPrevious() { + val list = listOf( + createTimetableLocal(of(2019, 12, 23, 8, 0), 1, "123", "Matematyka", "Paweł Poniedziałkowski", false), + createTimetableLocal(of(2019, 12, 23, 8, 50), 2, "124", "Matematyka", "Paweł Poniedziałkowski", false), + createTimetableLocal(of(2019, 12, 23, 9, 40), 3, "125", "Język polski", "Joanna Wtorkowska", true), + createTimetableLocal(of(2019, 12, 23, 10, 40), 4, "126", "Język polski", "Joanna Wtorkowska", true), + + createTimetableLocal(of(2019, 12, 24, 8, 0), 1, "123", "Język polski", "Joanna Wtorkowska", false), + createTimetableLocal(of(2019, 12, 24, 8, 50), 2, "124", "Język polski", "Joanna Wtorkowska", false), + createTimetableLocal(of(2019, 12, 24, 9, 40), 3, "125", "Język polski", "Joanna Środowska", true), + createTimetableLocal(of(2019, 12, 24, 10, 40), 4, "126", "Język polski", "Joanna Środowska", true), + + createTimetableLocal(of(2019, 12, 25, 8, 0), 1, "123", "Matematyka", "", false), + createTimetableLocal(of(2019, 12, 25, 8, 50), 2, "124", "Matematyka", "", false), + createTimetableLocal(of(2019, 12, 25, 9, 40), 3, "125", "Matematyka", "", true), + createTimetableLocal(of(2019, 12, 25, 10, 40), 4, "126", "Matematyka", "", true) + ) + runBlocking { timetableLocal.saveTimetable(list) } + + coEvery { timetableRemote.getTimetable(student, semester, any(), any()) } returns listOf( + createTimetableLocal(of(2019, 12, 23, 8, 0), 1, "123", "Matematyka", "Paweł Poniedziałkowski", false), + createTimetableLocal(of(2019, 12, 23, 8, 50), 2, "124", "Matematyka", "Jakub Wtorkowski", true), + createTimetableLocal(of(2019, 12, 23, 9, 40), 3, "125", "Język polski", "Joanna Poniedziałkowska", false), + createTimetableLocal(of(2019, 12, 23, 10, 40), 4, "126", "Język polski", "Joanna Wtorkowska", true), + + createTimetableLocal(of(2019, 12, 24, 8, 0), 1, "123", "Język polski", "", false), + createTimetableLocal(of(2019, 12, 24, 8, 50), 2, "124", "Język polski", "", true), + createTimetableLocal(of(2019, 12, 24, 9, 40), 3, "125", "Język polski", "", false), + createTimetableLocal(of(2019, 12, 24, 10, 40), 4, "126", "Język polski", "", true), + + createTimetableLocal(of(2019, 12, 25, 8, 0), 1, "123", "Matematyka", "Paweł Środowski", false), + createTimetableLocal(of(2019, 12, 25, 8, 50), 2, "124", "Matematyka", "Paweł Czwartkowski", true), + createTimetableLocal(of(2019, 12, 25, 9, 40), 3, "125", "Matematyka", "Paweł Środowski", false), + createTimetableLocal(of(2019, 12, 25, 10, 40), 4, "126", "Matematyka", "Paweł Czwartkowski", true) + ) + + val lessons = runBlocking { + TimetableRepository(timetableLocal, timetableRemote, timetableNotificationSchedulerHelper).getTimetable( + student = student, + semester = semester, + start = LocalDate.of(2019, 12, 23), + end = LocalDate.of(2019, 12, 25), + forceRefresh = true + ).filter { it.status == Status.SUCCESS }.first().data.orEmpty() + } + + assertEquals(12, lessons.size) + + assertEquals("Paweł Poniedziałkowski", lessons[0].teacher) + assertEquals("Jakub Wtorkowski", lessons[1].teacher) + assertEquals("Joanna Poniedziałkowska", lessons[2].teacher) + assertEquals("Joanna Wtorkowska", lessons[3].teacher) + + assertEquals("Joanna Wtorkowska", lessons[4].teacher) + assertEquals("", lessons[5].teacher) + assertEquals("", lessons[6].teacher) + assertEquals("", lessons[7].teacher) + + assertEquals("Paweł Środowski", lessons[8].teacher) + assertEquals("Paweł Czwartkowski", lessons[9].teacher) + assertEquals("Paweł Środowski", lessons[10].teacher) + assertEquals("Paweł Czwartkowski", lessons[11].teacher) + } +} diff --git a/app/src/androidTest/java/io/github/wulkanowy/utils/security/ScramblerTest.java b/app/src/androidTest/java/io/github/wulkanowy/utils/security/ScramblerTest.java deleted file mode 100644 index 2fd1904b..00000000 --- a/app/src/androidTest/java/io/github/wulkanowy/utils/security/ScramblerTest.java +++ /dev/null @@ -1,25 +0,0 @@ -package io.github.wulkanowy.utils.security; - -import android.content.Context; -import android.support.test.InstrumentationRegistry; -import android.support.test.filters.SdkSuppress; -import android.support.test.filters.SmallTest; -import android.support.test.runner.AndroidJUnit4; - -import org.junit.Assert; -import org.junit.Test; -import org.junit.runner.RunWith; - -@SmallTest -@RunWith(AndroidJUnit4.class) -public class ScramblerTest { - - @Test - @SdkSuppress(minSdkVersion = 18) - public void encryptDecryptTest() throws Exception { - Context targetContext = InstrumentationRegistry.getTargetContext(); - - Assert.assertEquals("PASS", Scrambler.decrypt("TEST", - Scrambler.encrypt("TEST", "PASS", targetContext))); - } -} \ No newline at end of file diff --git a/app/src/androidTest/java/io/github/wulkanowy/utils/security/ScramblerTest.kt b/app/src/androidTest/java/io/github/wulkanowy/utils/security/ScramblerTest.kt new file mode 100644 index 00000000..0c47e6bb --- /dev/null +++ b/app/src/androidTest/java/io/github/wulkanowy/utils/security/ScramblerTest.kt @@ -0,0 +1,47 @@ +package io.github.wulkanowy.utils.security + +import androidx.test.core.app.ApplicationProvider +import androidx.test.ext.junit.runners.AndroidJUnit4 +import androidx.test.filters.SdkSuppress +import androidx.test.filters.SmallTest +import org.junit.Test +import org.junit.runner.RunWith +import java.security.KeyStore +import kotlin.test.assertEquals +import kotlin.test.assertFailsWith + +@SmallTest +@RunWith(AndroidJUnit4::class) +class ScramblerTest { + + @Test + fun encryptDecryptTest() { + assertEquals("TEST", decrypt(encrypt("TEST", + ApplicationProvider.getApplicationContext()))) + } + + @Test + fun emptyTextEncryptTest() { + assertFailsWith { + decrypt("") + } + + assertFailsWith { + encrypt("", ApplicationProvider.getApplicationContext()) + } + } + + @Test + @SdkSuppress(minSdkVersion = 18) + fun emptyKeyStoreTest() { + val text = encrypt("test", ApplicationProvider.getApplicationContext()) + + val keyStore = KeyStore.getInstance("AndroidKeyStore") + keyStore.load(null) + keyStore.deleteEntry("wulkanowy_password") + + assertFailsWith { + decrypt(text) + } + } +} diff --git a/app/src/debug/google-services.json b/app/src/debug/google-services.json new file mode 100644 index 00000000..e9303986 --- /dev/null +++ b/app/src/debug/google-services.json @@ -0,0 +1,42 @@ +{ + "project_info": { + "project_number": "", + "firebase_url": "", + "project_id": "", + "storage_bucket": "" + }, + "client": [ + { + "client_info": { + "mobilesdk_app_id": "1:1091101852179:android:b558a25f65d088b1", + "android_client_info": { + "package_name": "io.github.wulkanowy.dev" + } + }, + "oauth_client": [ + { + "client_id": "", + "client_type": 3 + } + ], + "api_key": [ + { + "current_key": "" + } + ], + "services": { + "analytics_service": { + "status": 1 + }, + "appinvite_service": { + "status": 1, + "other_platform_oauth_client": [] + }, + "ads_service": { + "status": 2 + } + } + } + ], + "configuration_version": "1" +} diff --git a/app/src/debug/google-services.json.gpg b/app/src/debug/google-services.json.gpg new file mode 100644 index 00000000..736f7906 Binary files /dev/null and b/app/src/debug/google-services.json.gpg differ diff --git a/app/src/debug/res/drawable-anydpi-v24/ic_stat_grade.xml b/app/src/debug/res/drawable-anydpi-v24/ic_stat_grade.xml new file mode 100644 index 00000000..832eba83 --- /dev/null +++ b/app/src/debug/res/drawable-anydpi-v24/ic_stat_grade.xml @@ -0,0 +1,12 @@ + + + + diff --git a/app/src/debug/res/drawable-anydpi-v24/ic_stat_luckynumber.xml b/app/src/debug/res/drawable-anydpi-v24/ic_stat_luckynumber.xml new file mode 100644 index 00000000..4f3eb98e --- /dev/null +++ b/app/src/debug/res/drawable-anydpi-v24/ic_stat_luckynumber.xml @@ -0,0 +1,12 @@ + + + + diff --git a/app/src/debug/res/drawable-anydpi-v24/ic_stat_message.xml b/app/src/debug/res/drawable-anydpi-v24/ic_stat_message.xml new file mode 100644 index 00000000..8fe12de4 --- /dev/null +++ b/app/src/debug/res/drawable-anydpi-v24/ic_stat_message.xml @@ -0,0 +1,12 @@ + + + + diff --git a/app/src/debug/res/drawable-anydpi-v24/ic_stat_note.xml b/app/src/debug/res/drawable-anydpi-v24/ic_stat_note.xml new file mode 100644 index 00000000..d30f2233 --- /dev/null +++ b/app/src/debug/res/drawable-anydpi-v24/ic_stat_note.xml @@ -0,0 +1,12 @@ + + + + diff --git a/app/src/debug/res/drawable-hdpi/ic_stat_grade.png b/app/src/debug/res/drawable-hdpi/ic_stat_grade.png new file mode 100644 index 00000000..013b7ac4 Binary files /dev/null and b/app/src/debug/res/drawable-hdpi/ic_stat_grade.png differ diff --git a/app/src/debug/res/drawable-hdpi/ic_stat_luckynumber.png b/app/src/debug/res/drawable-hdpi/ic_stat_luckynumber.png new file mode 100644 index 00000000..74a4d0c5 Binary files /dev/null and b/app/src/debug/res/drawable-hdpi/ic_stat_luckynumber.png differ diff --git a/app/src/debug/res/drawable-hdpi/ic_stat_message.png b/app/src/debug/res/drawable-hdpi/ic_stat_message.png new file mode 100644 index 00000000..be41e343 Binary files /dev/null and b/app/src/debug/res/drawable-hdpi/ic_stat_message.png differ diff --git a/app/src/debug/res/drawable-hdpi/ic_stat_note.png b/app/src/debug/res/drawable-hdpi/ic_stat_note.png new file mode 100644 index 00000000..1992edf2 Binary files /dev/null and b/app/src/debug/res/drawable-hdpi/ic_stat_note.png differ diff --git a/app/src/debug/res/drawable-mdpi/ic_stat_grade.png b/app/src/debug/res/drawable-mdpi/ic_stat_grade.png new file mode 100644 index 00000000..a5df2a35 Binary files /dev/null and b/app/src/debug/res/drawable-mdpi/ic_stat_grade.png differ diff --git a/app/src/debug/res/drawable-mdpi/ic_stat_luckynumber.png b/app/src/debug/res/drawable-mdpi/ic_stat_luckynumber.png new file mode 100644 index 00000000..278ed2c6 Binary files /dev/null and b/app/src/debug/res/drawable-mdpi/ic_stat_luckynumber.png differ diff --git a/app/src/debug/res/drawable-mdpi/ic_stat_message.png b/app/src/debug/res/drawable-mdpi/ic_stat_message.png new file mode 100644 index 00000000..7327a02f Binary files /dev/null and b/app/src/debug/res/drawable-mdpi/ic_stat_message.png differ diff --git a/app/src/debug/res/drawable-mdpi/ic_stat_note.png b/app/src/debug/res/drawable-mdpi/ic_stat_note.png new file mode 100644 index 00000000..2fb02098 Binary files /dev/null and b/app/src/debug/res/drawable-mdpi/ic_stat_note.png differ diff --git a/app/src/debug/res/drawable-xhdpi/ic_stat_grade.png b/app/src/debug/res/drawable-xhdpi/ic_stat_grade.png new file mode 100644 index 00000000..c63f810f Binary files /dev/null and b/app/src/debug/res/drawable-xhdpi/ic_stat_grade.png differ diff --git a/app/src/debug/res/drawable-xhdpi/ic_stat_luckynumber.png b/app/src/debug/res/drawable-xhdpi/ic_stat_luckynumber.png new file mode 100644 index 00000000..4035ceba Binary files /dev/null and b/app/src/debug/res/drawable-xhdpi/ic_stat_luckynumber.png differ diff --git a/app/src/debug/res/drawable-xhdpi/ic_stat_message.png b/app/src/debug/res/drawable-xhdpi/ic_stat_message.png new file mode 100644 index 00000000..c4140be8 Binary files /dev/null and b/app/src/debug/res/drawable-xhdpi/ic_stat_message.png differ diff --git a/app/src/debug/res/drawable-xhdpi/ic_stat_note.png b/app/src/debug/res/drawable-xhdpi/ic_stat_note.png new file mode 100644 index 00000000..6b533c8e Binary files /dev/null and b/app/src/debug/res/drawable-xhdpi/ic_stat_note.png differ diff --git a/app/src/debug/res/drawable-xxhdpi/ic_stat_grade.png b/app/src/debug/res/drawable-xxhdpi/ic_stat_grade.png new file mode 100644 index 00000000..13c26b77 Binary files /dev/null and b/app/src/debug/res/drawable-xxhdpi/ic_stat_grade.png differ diff --git a/app/src/debug/res/drawable-xxhdpi/ic_stat_luckynumber.png b/app/src/debug/res/drawable-xxhdpi/ic_stat_luckynumber.png new file mode 100644 index 00000000..da435745 Binary files /dev/null and b/app/src/debug/res/drawable-xxhdpi/ic_stat_luckynumber.png differ diff --git a/app/src/debug/res/drawable-xxhdpi/ic_stat_message.png b/app/src/debug/res/drawable-xxhdpi/ic_stat_message.png new file mode 100644 index 00000000..9d0fa781 Binary files /dev/null and b/app/src/debug/res/drawable-xxhdpi/ic_stat_message.png differ diff --git a/app/src/debug/res/drawable-xxhdpi/ic_stat_note.png b/app/src/debug/res/drawable-xxhdpi/ic_stat_note.png new file mode 100644 index 00000000..64da443f Binary files /dev/null and b/app/src/debug/res/drawable-xxhdpi/ic_stat_note.png differ diff --git a/app/src/debug/res/drawable/ic_launcher_foreground_dev.xml b/app/src/debug/res/drawable/ic_launcher_foreground_dev.xml new file mode 100644 index 00000000..799ea037 --- /dev/null +++ b/app/src/debug/res/drawable/ic_launcher_foreground_dev.xml @@ -0,0 +1,34 @@ + + + + + + + + diff --git a/app/src/debug/res/mipmap-anydpi-v26/ic_launcher.xml b/app/src/debug/res/mipmap-anydpi-v26/ic_launcher.xml new file mode 100644 index 00000000..7dbec2cb --- /dev/null +++ b/app/src/debug/res/mipmap-anydpi-v26/ic_launcher.xml @@ -0,0 +1,5 @@ + + + + + \ No newline at end of file diff --git a/app/src/debug/res/mipmap-anydpi-v26/ic_launcher_round.xml b/app/src/debug/res/mipmap-anydpi-v26/ic_launcher_round.xml new file mode 100644 index 00000000..7dbec2cb --- /dev/null +++ b/app/src/debug/res/mipmap-anydpi-v26/ic_launcher_round.xml @@ -0,0 +1,5 @@ + + + + + \ No newline at end of file diff --git a/app/src/debug/res/mipmap-hdpi/ic_launcher.png b/app/src/debug/res/mipmap-hdpi/ic_launcher.png new file mode 100644 index 00000000..5b688d7c Binary files /dev/null and b/app/src/debug/res/mipmap-hdpi/ic_launcher.png differ diff --git a/app/src/debug/res/mipmap-hdpi/ic_launcher_round.png b/app/src/debug/res/mipmap-hdpi/ic_launcher_round.png new file mode 100644 index 00000000..81e723ec Binary files /dev/null and b/app/src/debug/res/mipmap-hdpi/ic_launcher_round.png differ diff --git a/app/src/debug/res/mipmap-mdpi/ic_launcher.png b/app/src/debug/res/mipmap-mdpi/ic_launcher.png new file mode 100644 index 00000000..48b13240 Binary files /dev/null and b/app/src/debug/res/mipmap-mdpi/ic_launcher.png differ diff --git a/app/src/debug/res/mipmap-mdpi/ic_launcher_round.png b/app/src/debug/res/mipmap-mdpi/ic_launcher_round.png new file mode 100644 index 00000000..394b5707 Binary files /dev/null and b/app/src/debug/res/mipmap-mdpi/ic_launcher_round.png differ diff --git a/app/src/debug/res/mipmap-xhdpi/ic_launcher.png b/app/src/debug/res/mipmap-xhdpi/ic_launcher.png new file mode 100644 index 00000000..ff8bfa3e Binary files /dev/null and b/app/src/debug/res/mipmap-xhdpi/ic_launcher.png differ diff --git a/app/src/debug/res/mipmap-xhdpi/ic_launcher_round.png b/app/src/debug/res/mipmap-xhdpi/ic_launcher_round.png new file mode 100644 index 00000000..365b4d66 Binary files /dev/null and b/app/src/debug/res/mipmap-xhdpi/ic_launcher_round.png differ diff --git a/app/src/debug/res/mipmap-xxhdpi/ic_launcher.png b/app/src/debug/res/mipmap-xxhdpi/ic_launcher.png new file mode 100644 index 00000000..96be1ed4 Binary files /dev/null and b/app/src/debug/res/mipmap-xxhdpi/ic_launcher.png differ diff --git a/app/src/debug/res/mipmap-xxhdpi/ic_launcher_round.png b/app/src/debug/res/mipmap-xxhdpi/ic_launcher_round.png new file mode 100644 index 00000000..463c089b Binary files /dev/null and b/app/src/debug/res/mipmap-xxhdpi/ic_launcher_round.png differ diff --git a/app/src/debug/res/mipmap-xxxhdpi/ic_launcher.png b/app/src/debug/res/mipmap-xxxhdpi/ic_launcher.png new file mode 100644 index 00000000..57c7416f Binary files /dev/null and b/app/src/debug/res/mipmap-xxxhdpi/ic_launcher.png differ diff --git a/app/src/debug/res/mipmap-xxxhdpi/ic_launcher_round.png b/app/src/debug/res/mipmap-xxxhdpi/ic_launcher_round.png new file mode 100644 index 00000000..53d6f5bb Binary files /dev/null and b/app/src/debug/res/mipmap-xxxhdpi/ic_launcher_round.png differ diff --git a/app/src/debug/res/values/preferences_defaults.xml b/app/src/debug/res/values/preferences_defaults.xml new file mode 100644 index 00000000..f5a12464 --- /dev/null +++ b/app/src/debug/res/values/preferences_defaults.xml @@ -0,0 +1,4 @@ + + + true + diff --git a/app/src/fdroid/java/io/github/wulkanowy/utils/CrashlyticsUtils.kt b/app/src/fdroid/java/io/github/wulkanowy/utils/CrashlyticsUtils.kt new file mode 100644 index 00000000..d03a319a --- /dev/null +++ b/app/src/fdroid/java/io/github/wulkanowy/utils/CrashlyticsUtils.kt @@ -0,0 +1,13 @@ +@file:Suppress("UNUSED_PARAMETER") + +package io.github.wulkanowy.utils + +import timber.log.Timber + +open class TimberTreeNoOp : Timber.Tree() { + override fun log(priority: Int, tag: String?, message: String, t: Throwable?) {} +} + +class CrashlyticsTree : TimberTreeNoOp() + +class CrashlyticsExceptionTree : TimberTreeNoOp() diff --git a/app/src/fdroid/java/io/github/wulkanowy/utils/FirebaseAnalyticsHelper.kt b/app/src/fdroid/java/io/github/wulkanowy/utils/FirebaseAnalyticsHelper.kt new file mode 100644 index 00000000..f23645bc --- /dev/null +++ b/app/src/fdroid/java/io/github/wulkanowy/utils/FirebaseAnalyticsHelper.kt @@ -0,0 +1,18 @@ +package io.github.wulkanowy.utils + +import android.app.Activity +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +@Suppress("UNUSED_PARAMETER") +class FirebaseAnalyticsHelper @Inject constructor() { + + fun logEvent(name: String, vararg params: Pair) { + // do nothing + } + + fun setCurrentScreen(activity: Activity, name: String?) { + // do nothing + } +} diff --git a/app/src/main/AndroidManifest.xml b/app/src/main/AndroidManifest.xml index f1733681..4ec2f781 100644 --- a/app/src/main/AndroidManifest.xml +++ b/app/src/main/AndroidManifest.xml @@ -1,54 +1,149 @@ + + android:supportsRtl="false" + android:theme="@style/WulkanowyTheme" + android:usesCleartextTraffic="true" + tools:ignore="GoogleAppIndexingWarning,UnusedAttribute"> + android:name=".ui.modules.splash.SplashActivity" + android:screenOrientation="portrait" + android:theme="@style/WulkanowyTheme.SplashScreen" + tools:ignore="LockedOrientationActivity"> - + android:label="@string/main_title" + android:theme="@style/WulkanowyTheme.NoActionBar" + android:windowSoftInputMode="adjustPan" /> + + + + + + + + + + + + android:name=".services.widgets.TimetableWidgetService" + android:permission="android.permission.BIND_REMOTEVIEWS" /> + + - + - + + + + + + + + + + + + + + + + + + + + - + android:name="firebase_analytics_collection_enabled" + android:value="${firebase_enabled}" /> + + + + + + + + + + + + diff --git a/app/src/main/assets/contributors.json b/app/src/main/assets/contributors.json new file mode 100644 index 00000000..40aff4c4 --- /dev/null +++ b/app/src/main/assets/contributors.json @@ -0,0 +1,38 @@ +[ + { + "displayName": "Mikołaj Pich", + "githubUsername": "mklkj" + }, + { + "displayName": "Rafał Borcz", + "githubUsername": "Faierbel" + }, + { + "displayName": "Dominik Korsa", + "githubUsername": "dominik-korsa" + }, + { + "displayName": "Kacper Ziubryniewicz", + "githubUsername": "kapi2289" + }, + { + "displayName": "doteq", + "githubUsername": "doteq" + }, + { + "displayName": "Paweł Krzyś", + "githubUsername": "pavuloff" + }, + { + "displayName": "Piotr Romanowski", + "githubUsername": "v0idzz" + }, + { + "displayName": "Dinolek", + "githubUsername": "Dinolek" + }, + { + "displayName": "Mateusz Idziejczak", + "githubUsername": "PanTajemnic" + } +] diff --git a/app/src/main/assets/message-print-page.html b/app/src/main/assets/message-print-page.html new file mode 100644 index 00000000..8da7dec6 --- /dev/null +++ b/app/src/main/assets/message-print-page.html @@ -0,0 +1,94 @@ + + + + + %SUBJECT% | Wulkanowy + + + +

%SUBJECT%

+
+
+ %INFO% +
+
+ + Wulkanowy Dzienniczek +
+
+
+

Treść wiadomości

+ %CONTENT% +
+ + diff --git a/app/src/main/assets/wulkanowy-logo-black.svg b/app/src/main/assets/wulkanowy-logo-black.svg new file mode 100644 index 00000000..9bfbe2c0 --- /dev/null +++ b/app/src/main/assets/wulkanowy-logo-black.svg @@ -0,0 +1,74 @@ + +image/svg+xml \ No newline at end of file diff --git a/app/src/main/ic_launcher-web.png b/app/src/main/ic_launcher-web.png deleted file mode 100644 index 7cad5c2f..00000000 Binary files a/app/src/main/ic_launcher-web.png and /dev/null differ diff --git a/app/src/main/java/io/github/wulkanowy/WulkanowyApp.java b/app/src/main/java/io/github/wulkanowy/WulkanowyApp.java deleted file mode 100644 index 4b8866ce..00000000 --- a/app/src/main/java/io/github/wulkanowy/WulkanowyApp.java +++ /dev/null @@ -1,59 +0,0 @@ -package io.github.wulkanowy; - -import android.app.Application; - -import com.crashlytics.android.Crashlytics; -import com.crashlytics.android.core.CrashlyticsCore; - -import org.greenrobot.greendao.query.QueryBuilder; - -import javax.inject.Inject; - -import eu.davidea.flexibleadapter.FlexibleAdapter; -import eu.davidea.flexibleadapter.utils.Log; -import io.fabric.sdk.android.Fabric; -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.di.component.ApplicationComponent; -import io.github.wulkanowy.di.component.DaggerApplicationComponent; -import io.github.wulkanowy.di.modules.ApplicationModule; - -public class WulkanowyApp extends Application { - - protected ApplicationComponent applicationComponent; - - @Inject - RepositoryContract repository; - - @Override - public void onCreate() { - super.onCreate(); - applicationComponent = DaggerApplicationComponent - .builder() - .applicationModule(new ApplicationModule(this)) - .build(); - applicationComponent.inject(this); - - if (BuildConfig.DEBUG) { - enableDebugLog(); - } - initializeFabric(); - } - - private void enableDebugLog() { - QueryBuilder.LOG_VALUES = true; - FlexibleAdapter.enableLogs(Log.Level.DEBUG); - } - - private void initializeFabric() { - Fabric.with(new Fabric.Builder(this) - .kits(new Crashlytics.Builder() - .core(new CrashlyticsCore.Builder().disabled(BuildConfig.DEBUG).build()) - .build()) - .debuggable(BuildConfig.DEBUG) - .build()); - } - - public ApplicationComponent getApplicationComponent() { - return applicationComponent; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/WulkanowyApp.kt b/app/src/main/java/io/github/wulkanowy/WulkanowyApp.kt new file mode 100644 index 00000000..64995858 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/WulkanowyApp.kt @@ -0,0 +1,69 @@ +package io.github.wulkanowy + +import android.app.Application +import android.content.Context +import android.util.Log.DEBUG +import android.util.Log.INFO +import android.util.Log.VERBOSE +import androidx.hilt.work.HiltWorkerFactory +import androidx.multidex.MultiDex +import androidx.work.Configuration +import com.yariksoffice.lingver.Lingver +import dagger.hilt.android.HiltAndroidApp +import fr.bipi.tressence.file.FileLoggerTree +import io.github.wulkanowy.ui.base.ThemeManager +import io.github.wulkanowy.utils.ActivityLifecycleLogger +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.CrashlyticsExceptionTree +import io.github.wulkanowy.utils.CrashlyticsTree +import io.github.wulkanowy.utils.DebugLogTree +import timber.log.Timber +import javax.inject.Inject + +@HiltAndroidApp +class WulkanowyApp : Application(), Configuration.Provider { + + @Inject + lateinit var workerFactory: HiltWorkerFactory + + @Inject + lateinit var themeManager: ThemeManager + + @Inject + lateinit var appInfo: AppInfo + + override fun attachBaseContext(base: Context?) { + super.attachBaseContext(base) + MultiDex.install(this) + } + + override fun onCreate() { + super.onCreate() + Lingver.init(this) + themeManager.applyDefaultTheme() + + initLogging() + } + + private fun initLogging() { + if (appInfo.isDebug) { + Timber.plant(DebugLogTree()) + Timber.plant(FileLoggerTree.Builder() + .withFileName("wulkanowy.%g.log") + .withDirName(applicationContext.filesDir.absolutePath) + .withFileLimit(10) + .withMinPriority(DEBUG) + .build() + ) + } else { + Timber.plant(CrashlyticsExceptionTree()) + Timber.plant(CrashlyticsTree()) + } + registerActivityLifecycleCallbacks(ActivityLifecycleLogger()) + } + + override fun getWorkManagerConfiguration() = Configuration.Builder() + .setWorkerFactory(workerFactory) + .setMinimumLoggingLevel(if (appInfo.isDebug) VERBOSE else INFO) + .build() +} diff --git a/app/src/main/java/io/github/wulkanowy/data/Repository.java b/app/src/main/java/io/github/wulkanowy/data/Repository.java deleted file mode 100644 index 04460a07..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/Repository.java +++ /dev/null @@ -1,143 +0,0 @@ -package io.github.wulkanowy.data; - - -import java.io.IOException; -import java.text.ParseException; -import java.util.List; - -import javax.inject.Inject; -import javax.inject.Singleton; - -import io.github.wulkanowy.api.login.AccountPermissionException; -import io.github.wulkanowy.api.login.BadCredentialsException; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; -import io.github.wulkanowy.api.login.VulcanOfflineException; -import io.github.wulkanowy.data.db.dao.entities.Account; -import io.github.wulkanowy.data.db.dao.entities.DaoSession; -import io.github.wulkanowy.data.db.dao.entities.Grade; -import io.github.wulkanowy.data.db.dao.entities.GradeDao; -import io.github.wulkanowy.data.db.dao.entities.Week; -import io.github.wulkanowy.data.db.dao.entities.WeekDao; -import io.github.wulkanowy.data.db.resources.ResourcesContract; -import io.github.wulkanowy.data.db.shared.SharedPrefContract; -import io.github.wulkanowy.data.sync.SyncContract; -import io.github.wulkanowy.data.sync.login.LoginSyncContract; -import io.github.wulkanowy.data.sync.timetable.TimetableSyncContract; -import io.github.wulkanowy.di.annotations.SyncGrades; -import io.github.wulkanowy.di.annotations.SyncSubjects; -import io.github.wulkanowy.utils.security.CryptoException; - -@Singleton -public class Repository implements RepositoryContract { - - private final SharedPrefContract sharedPref; - - private final ResourcesContract resources; - - private final DaoSession daoSession; - - private final LoginSyncContract loginSync; - - private final TimetableSyncContract timetableSync; - - private final SyncContract gradeSync; - - private final SyncContract subjectSync; - - @Inject - Repository(SharedPrefContract sharedPref, - ResourcesContract resources, - DaoSession daoSession, - LoginSyncContract loginSync, - TimetableSyncContract timetableSync, - @SyncGrades SyncContract gradeSync, - @SyncSubjects SyncContract subjectSync) { - this.sharedPref = sharedPref; - this.resources = resources; - this.daoSession = daoSession; - this.loginSync = loginSync; - this.timetableSync = timetableSync; - this.gradeSync = gradeSync; - this.subjectSync = subjectSync; - } - - @Override - public long getCurrentUserId() { - return sharedPref.getCurrentUserId(); - } - - @Override - public String[] getSymbolsKeysArray() { - return resources.getSymbolsKeysArray(); - } - - @Override - public String[] getSymbolsValuesArray() { - return resources.getSymbolsValuesArray(); - } - - @Override - public String getErrorLoginMessage(Exception e) { - return resources.getErrorLoginMessage(e); - } - - @Override - public void loginUser(String email, String password, String symbol) - throws NotLoggedInErrorException, AccountPermissionException, IOException, - CryptoException, VulcanOfflineException, BadCredentialsException { - loginSync.loginUser(email, password, symbol); - } - - @Override - public void loginCurrentUser() throws NotLoggedInErrorException, AccountPermissionException, - IOException, CryptoException, VulcanOfflineException, BadCredentialsException { - loginSync.loginCurrentUser(); - } - - @Override - public void syncGrades() throws NotLoggedInErrorException, IOException, ParseException { - gradeSync.sync(); - } - - @Override - public void syncSubjects() throws NotLoggedInErrorException, IOException, ParseException { - subjectSync.sync(); - } - - @Override - public void syncTimetable() throws NotLoggedInErrorException, IOException, ParseException { - timetableSync.syncTimetable(); - } - - @Override - public void syncTimetable(String date) throws NotLoggedInErrorException, IOException, ParseException { - timetableSync.syncTimetable(date); - } - - @Override - public void syncAll() throws NotLoggedInErrorException, IOException, ParseException { - syncSubjects(); - syncGrades(); - syncTimetable(); - } - - @Override - public Account getCurrentUser() { - return daoSession.getAccountDao().load(sharedPref.getCurrentUserId()); - } - - @Override - public Week getWeek(String date) { - return daoSession.getWeekDao().queryBuilder() - .where(WeekDao.Properties.StartDayDate.eq(date), - WeekDao.Properties.UserId.eq(getCurrentUserId())) - .unique(); - } - - @Override - public List getNewGrades() { - return daoSession.getGradeDao().queryBuilder() - .where(GradeDao.Properties.IsNew.eq(1)) - .list(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/RepositoryContract.java b/app/src/main/java/io/github/wulkanowy/data/RepositoryContract.java deleted file mode 100644 index fcdf29ed..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/RepositoryContract.java +++ /dev/null @@ -1,34 +0,0 @@ -package io.github.wulkanowy.data; - -import java.io.IOException; -import java.text.ParseException; -import java.util.List; - -import javax.inject.Singleton; - -import io.github.wulkanowy.api.login.NotLoggedInErrorException; -import io.github.wulkanowy.data.db.dao.entities.Account; -import io.github.wulkanowy.data.db.dao.entities.Grade; -import io.github.wulkanowy.data.db.dao.entities.Week; -import io.github.wulkanowy.data.db.resources.ResourcesContract; -import io.github.wulkanowy.data.sync.login.LoginSyncContract; -import io.github.wulkanowy.data.sync.timetable.TimetableSyncContract; - -@Singleton -public interface RepositoryContract extends ResourcesContract, LoginSyncContract, - TimetableSyncContract { - - long getCurrentUserId(); - - void syncGrades() throws NotLoggedInErrorException, IOException, ParseException; - - void syncSubjects() throws NotLoggedInErrorException, IOException, ParseException; - - void syncAll() throws NotLoggedInErrorException, IOException, ParseException; - - Account getCurrentUser(); - - Week getWeek(String date); - - List getNewGrades(); -} diff --git a/app/src/main/java/io/github/wulkanowy/data/RepositoryModule.kt b/app/src/main/java/io/github/wulkanowy/data/RepositoryModule.kt new file mode 100644 index 00000000..3370d0ac --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/RepositoryModule.kt @@ -0,0 +1,153 @@ +package io.github.wulkanowy.data + +import android.content.Context +import android.content.SharedPreferences +import android.content.res.AssetManager +import android.content.res.Resources +import androidx.preference.PreferenceManager +import com.chuckerteam.chucker.api.ChuckerCollector +import com.chuckerteam.chucker.api.ChuckerInterceptor +import com.chuckerteam.chucker.api.RetentionManager +import dagger.Module +import dagger.Provides +import dagger.hilt.InstallIn +import dagger.hilt.android.components.ApplicationComponent +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.data.db.AppDatabase +import io.github.wulkanowy.data.db.SharedPrefProvider +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.sdk.Sdk +import timber.log.Timber +import javax.inject.Singleton + +@Module +@InstallIn(ApplicationComponent::class) +internal class RepositoryModule { + + @Singleton + @Provides + fun provideSdk(chuckerCollector: ChuckerCollector, @ApplicationContext context: Context): Sdk { + return Sdk().apply { + androidVersion = android.os.Build.VERSION.RELEASE + buildTag = android.os.Build.MODEL + setSimpleHttpLogger { Timber.d(it) } + + // for debug only + addInterceptor(ChuckerInterceptor(context, chuckerCollector), true) + } + } + + @Singleton + @Provides + fun provideChuckerCollector(@ApplicationContext context: Context, prefRepository: PreferencesRepository): ChuckerCollector { + return ChuckerCollector( + context = context, + showNotification = prefRepository.isDebugNotificationEnable, + retentionPeriod = RetentionManager.Period.ONE_HOUR + ) + } + + @Singleton + @Provides + fun provideDatabase(@ApplicationContext context: Context, sharedPrefProvider: SharedPrefProvider) = AppDatabase.newInstance(context, sharedPrefProvider) + + @Singleton + @Provides + fun provideResources(@ApplicationContext context: Context): Resources = context.resources + + @Singleton + @Provides + fun provideAssets(@ApplicationContext context: Context): AssetManager = context.assets + + @Singleton + @Provides + fun provideSharedPref(@ApplicationContext context: Context): SharedPreferences = PreferenceManager.getDefaultSharedPreferences(context) + + @Singleton + @Provides + fun provideStudentDao(database: AppDatabase) = database.studentDao + + @Singleton + @Provides + fun provideSemesterDao(database: AppDatabase) = database.semesterDao + + @Singleton + @Provides + fun provideGradeDao(database: AppDatabase) = database.gradeDao + + @Singleton + @Provides + fun provideGradeSummaryDao(database: AppDatabase) = database.gradeSummaryDao + + @Singleton + @Provides + fun provideGradeStatisticsDao(database: AppDatabase) = database.gradeStatistics + + @Singleton + @Provides + fun provideGradePointsStatisticsDao(database: AppDatabase) = database.gradePointsStatistics + + @Singleton + @Provides + fun provideMessagesDao(database: AppDatabase) = database.messagesDao + + @Singleton + @Provides + fun provideMessageAttachmentsDao(database: AppDatabase) = database.messageAttachmentDao + + @Singleton + @Provides + fun provideExamDao(database: AppDatabase) = database.examsDao + + @Singleton + @Provides + fun provideAttendanceDao(database: AppDatabase) = database.attendanceDao + + @Singleton + @Provides + fun provideAttendanceSummaryDao(database: AppDatabase) = database.attendanceSummaryDao + + @Singleton + @Provides + fun provideTimetableDao(database: AppDatabase) = database.timetableDao + + @Singleton + @Provides + fun provideNoteDao(database: AppDatabase) = database.noteDao + + @Singleton + @Provides + fun provideHomeworkDao(database: AppDatabase) = database.homeworkDao + + @Singleton + @Provides + fun provideSubjectDao(database: AppDatabase) = database.subjectDao + + @Singleton + @Provides + fun provideLuckyNumberDao(database: AppDatabase) = database.luckyNumberDao + + @Singleton + @Provides + fun provideCompletedLessonsDao(database: AppDatabase) = database.completedLessonsDao + + @Singleton + @Provides + fun provideReportingUnitDao(database: AppDatabase) = database.reportingUnitDao + + @Singleton + @Provides + fun provideRecipientDao(database: AppDatabase) = database.recipientDao + + @Singleton + @Provides + fun provideMobileDevicesDao(database: AppDatabase) = database.mobileDeviceDao + + @Singleton + @Provides + fun provideTeacherDao(database: AppDatabase) = database.teacherDao + + @Singleton + @Provides + fun provideSchoolInfoDao(database: AppDatabase) = database.schoolDao +} diff --git a/app/src/main/java/io/github/wulkanowy/data/Resource.kt b/app/src/main/java/io/github/wulkanowy/data/Resource.kt new file mode 100644 index 00000000..ae22832a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/Resource.kt @@ -0,0 +1,23 @@ +package io.github.wulkanowy.data + +data class Resource(val status: Status, val data: T?, val error: Throwable?) { + companion object { + fun success(data: T?): Resource { + return Resource(Status.SUCCESS, data, null) + } + + fun error(error: Throwable?, data: T? = null): Resource { + return Resource(Status.ERROR, data, error) + } + + fun loading(data: T? = null): Resource { + return Resource(Status.LOADING, data, null) + } + } +} + +enum class Status { + LOADING, + SUCCESS, + ERROR +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/AppDatabase.kt b/app/src/main/java/io/github/wulkanowy/data/db/AppDatabase.kt new file mode 100644 index 00000000..ebd5119f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/AppDatabase.kt @@ -0,0 +1,201 @@ +package io.github.wulkanowy.data.db + +import android.content.Context +import androidx.room.Database +import androidx.room.Room +import androidx.room.RoomDatabase +import androidx.room.RoomDatabase.JournalMode.TRUNCATE +import androidx.room.TypeConverters +import androidx.room.migration.Migration +import io.github.wulkanowy.data.db.dao.AttendanceDao +import io.github.wulkanowy.data.db.dao.AttendanceSummaryDao +import io.github.wulkanowy.data.db.dao.CompletedLessonsDao +import io.github.wulkanowy.data.db.dao.ExamDao +import io.github.wulkanowy.data.db.dao.GradeDao +import io.github.wulkanowy.data.db.dao.GradePointsStatisticsDao +import io.github.wulkanowy.data.db.dao.GradeStatisticsDao +import io.github.wulkanowy.data.db.dao.GradeSummaryDao +import io.github.wulkanowy.data.db.dao.HomeworkDao +import io.github.wulkanowy.data.db.dao.LuckyNumberDao +import io.github.wulkanowy.data.db.dao.MessageAttachmentDao +import io.github.wulkanowy.data.db.dao.MessagesDao +import io.github.wulkanowy.data.db.dao.MobileDeviceDao +import io.github.wulkanowy.data.db.dao.NoteDao +import io.github.wulkanowy.data.db.dao.RecipientDao +import io.github.wulkanowy.data.db.dao.ReportingUnitDao +import io.github.wulkanowy.data.db.dao.SchoolDao +import io.github.wulkanowy.data.db.dao.SemesterDao +import io.github.wulkanowy.data.db.dao.StudentDao +import io.github.wulkanowy.data.db.dao.SubjectDao +import io.github.wulkanowy.data.db.dao.TeacherDao +import io.github.wulkanowy.data.db.dao.TimetableDao +import io.github.wulkanowy.data.db.entities.Attendance +import io.github.wulkanowy.data.db.entities.AttendanceSummary +import io.github.wulkanowy.data.db.entities.CompletedLesson +import io.github.wulkanowy.data.db.entities.Exam +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.data.db.entities.GradePointsStatistics +import io.github.wulkanowy.data.db.entities.GradeStatistics +import io.github.wulkanowy.data.db.entities.GradeSummary +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.data.db.entities.LuckyNumber +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.MessageAttachment +import io.github.wulkanowy.data.db.entities.MobileDevice +import io.github.wulkanowy.data.db.entities.Note +import io.github.wulkanowy.data.db.entities.Recipient +import io.github.wulkanowy.data.db.entities.ReportingUnit +import io.github.wulkanowy.data.db.entities.School +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.db.entities.Subject +import io.github.wulkanowy.data.db.entities.Teacher +import io.github.wulkanowy.data.db.entities.Timetable +import io.github.wulkanowy.data.db.migrations.Migration10 +import io.github.wulkanowy.data.db.migrations.Migration11 +import io.github.wulkanowy.data.db.migrations.Migration12 +import io.github.wulkanowy.data.db.migrations.Migration13 +import io.github.wulkanowy.data.db.migrations.Migration14 +import io.github.wulkanowy.data.db.migrations.Migration15 +import io.github.wulkanowy.data.db.migrations.Migration16 +import io.github.wulkanowy.data.db.migrations.Migration17 +import io.github.wulkanowy.data.db.migrations.Migration18 +import io.github.wulkanowy.data.db.migrations.Migration19 +import io.github.wulkanowy.data.db.migrations.Migration2 +import io.github.wulkanowy.data.db.migrations.Migration20 +import io.github.wulkanowy.data.db.migrations.Migration21 +import io.github.wulkanowy.data.db.migrations.Migration22 +import io.github.wulkanowy.data.db.migrations.Migration23 +import io.github.wulkanowy.data.db.migrations.Migration24 +import io.github.wulkanowy.data.db.migrations.Migration25 +import io.github.wulkanowy.data.db.migrations.Migration26 +import io.github.wulkanowy.data.db.migrations.Migration27 +import io.github.wulkanowy.data.db.migrations.Migration3 +import io.github.wulkanowy.data.db.migrations.Migration4 +import io.github.wulkanowy.data.db.migrations.Migration5 +import io.github.wulkanowy.data.db.migrations.Migration6 +import io.github.wulkanowy.data.db.migrations.Migration7 +import io.github.wulkanowy.data.db.migrations.Migration8 +import io.github.wulkanowy.data.db.migrations.Migration9 +import javax.inject.Singleton + +@Singleton +@Database( + entities = [ + Student::class, + Semester::class, + Exam::class, + Timetable::class, + Attendance::class, + AttendanceSummary::class, + Grade::class, + GradeSummary::class, + GradeStatistics::class, + GradePointsStatistics::class, + Message::class, + MessageAttachment::class, + Note::class, + Homework::class, + Subject::class, + LuckyNumber::class, + CompletedLesson::class, + ReportingUnit::class, + Recipient::class, + MobileDevice::class, + Teacher::class, + School::class + ], + version = AppDatabase.VERSION_SCHEMA, + exportSchema = true +) +@TypeConverters(Converters::class) +abstract class AppDatabase : RoomDatabase() { + + companion object { + const val VERSION_SCHEMA = 27 + + fun getMigrations(sharedPrefProvider: SharedPrefProvider): Array { + return arrayOf( + Migration2(), + Migration3(), + Migration4(), + Migration5(), + Migration6(), + Migration7(), + Migration8(), + Migration9(), + Migration10(), + Migration11(), + Migration12(), + Migration13(), + Migration14(), + Migration15(), + Migration16(), + Migration17(), + Migration18(), + Migration19(sharedPrefProvider), + Migration20(), + Migration21(), + Migration22(), + Migration23(), + Migration24(), + Migration25(), + Migration26(), + Migration27(), + ) + } + + fun newInstance(context: Context, sharedPrefProvider: SharedPrefProvider): AppDatabase { + return Room.databaseBuilder(context, AppDatabase::class.java, "wulkanowy_database") + .setJournalMode(TRUNCATE) + .fallbackToDestructiveMigrationFrom(VERSION_SCHEMA + 1) + .fallbackToDestructiveMigrationOnDowngrade() + .addMigrations(*getMigrations(sharedPrefProvider)) + .build() + } + } + + abstract val studentDao: StudentDao + + abstract val semesterDao: SemesterDao + + abstract val examsDao: ExamDao + + abstract val timetableDao: TimetableDao + + abstract val attendanceDao: AttendanceDao + + abstract val attendanceSummaryDao: AttendanceSummaryDao + + abstract val gradeDao: GradeDao + + abstract val gradeSummaryDao: GradeSummaryDao + + abstract val gradeStatistics: GradeStatisticsDao + + abstract val gradePointsStatistics: GradePointsStatisticsDao + + abstract val messagesDao: MessagesDao + + abstract val messageAttachmentDao: MessageAttachmentDao + + abstract val noteDao: NoteDao + + abstract val homeworkDao: HomeworkDao + + abstract val subjectDao: SubjectDao + + abstract val luckyNumberDao: LuckyNumberDao + + abstract val completedLessonsDao: CompletedLessonsDao + + abstract val reportingUnitDao: ReportingUnitDao + + abstract val recipientDao: RecipientDao + + abstract val mobileDeviceDao: MobileDeviceDao + + abstract val teacherDao: TeacherDao + + abstract val schoolDao: SchoolDao +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/Converters.kt b/app/src/main/java/io/github/wulkanowy/data/db/Converters.kt new file mode 100644 index 00000000..b21c4834 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/Converters.kt @@ -0,0 +1,60 @@ +package io.github.wulkanowy.data.db + +import androidx.room.TypeConverter +import com.google.gson.Gson +import com.google.gson.reflect.TypeToken +import java.time.Instant +import java.time.LocalDate +import java.time.LocalDateTime +import java.time.Month +import java.time.ZoneOffset +import java.util.Date + +class Converters { + + @TypeConverter + fun timestampToDate(value: Long?): LocalDate? = value?.run { + Date(value).toInstant().atZone(ZoneOffset.UTC).toLocalDate() + } + + @TypeConverter + fun dateToTimestamp(date: LocalDate?): Long? { + return date?.atStartOfDay()?.toInstant(ZoneOffset.UTC)?.toEpochMilli() + } + + @TypeConverter + fun timestampToTime(value: Long?): LocalDateTime? = value?.let { + LocalDateTime.ofInstant(Instant.ofEpochMilli(value), ZoneOffset.UTC) + } + + @TypeConverter + fun timeToTimestamp(date: LocalDateTime?): Long? { + return date?.atZone(ZoneOffset.UTC)?.toInstant()?.toEpochMilli() + } + + @TypeConverter + fun monthToInt(month: Month?) = month?.value + + @TypeConverter + fun intToMonth(value: Int?) = value?.let { Month.of(it) } + + @TypeConverter + fun intListToGson(list: List): String { + return Gson().toJson(list) + } + + @TypeConverter + fun gsonToIntList(value: String): List { + return Gson().fromJson(value, object : TypeToken>() {}.type) + } + + @TypeConverter + fun stringPairListToGson(list: List>): String { + return Gson().toJson(list) + } + + @TypeConverter + fun gsonToStringPairList(value: String): List> { + return Gson().fromJson(value, object : TypeToken>>() {}.type) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/SharedPrefProvider.kt b/app/src/main/java/io/github/wulkanowy/data/db/SharedPrefProvider.kt new file mode 100644 index 00000000..4a4aaf74 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/SharedPrefProvider.kt @@ -0,0 +1,30 @@ +package io.github.wulkanowy.data.db + +import android.content.SharedPreferences +import androidx.core.content.edit +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class SharedPrefProvider @Inject constructor(private val sharedPref: SharedPreferences) { + + companion object { + const val APP_VERSION_CODE_KEY = "app_version_code" + } + + fun putLong(key: String, value: Long, sync: Boolean = false) { + sharedPref.edit(sync) { putLong(key, value) } + } + + fun getLong(key: String, defaultValue: Long) = sharedPref.getLong(key, defaultValue) + + fun getString(key: String, defaultValue: String): String = sharedPref.getString(key, defaultValue) ?: defaultValue + + fun putString(key: String, value: String, sync: Boolean = false) { + sharedPref.edit(sync) { putString(key, value) } + } + + fun delete(key: String) { + sharedPref.edit().remove(key).apply() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/AttendanceDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/AttendanceDao.kt new file mode 100644 index 00000000..8ef3fd44 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/AttendanceDao.kt @@ -0,0 +1,16 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.Attendance +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Singleton + +@Singleton +@Dao +interface AttendanceDao : BaseDao { + + @Query("SELECT * FROM Attendance WHERE diary_id = :diaryId AND student_id = :studentId AND date >= :from AND date <= :end") + fun loadAll(diaryId: Int, studentId: Int, from: LocalDate, end: LocalDate): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/AttendanceSummaryDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/AttendanceSummaryDao.kt new file mode 100644 index 00000000..4218855c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/AttendanceSummaryDao.kt @@ -0,0 +1,13 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.AttendanceSummary +import kotlinx.coroutines.flow.Flow + +@Dao +interface AttendanceSummaryDao : BaseDao { + + @Query("SELECT * FROM AttendanceSummary WHERE diary_id = :diaryId AND student_id = :studentId AND subject_id = :subjectId") + fun loadAll(diaryId: Int, studentId: Int, subjectId: Int): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/BaseDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/BaseDao.kt new file mode 100644 index 00000000..048e9e3c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/BaseDao.kt @@ -0,0 +1,17 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Delete +import androidx.room.Insert +import androidx.room.Update + +interface BaseDao { + + @Insert + suspend fun insertAll(items: List): List + + @Update + suspend fun updateAll(items: List) + + @Delete + suspend fun deleteAll(items: List) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/CompletedLessonsDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/CompletedLessonsDao.kt new file mode 100644 index 00000000..8c03609d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/CompletedLessonsDao.kt @@ -0,0 +1,16 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.CompletedLesson +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Singleton + +@Singleton +@Dao +interface CompletedLessonsDao : BaseDao { + + @Query("SELECT * FROM CompletedLesson WHERE diary_id = :diaryId AND student_id = :studentId AND date >= :from AND date <= :end") + fun loadAll(diaryId: Int, studentId: Int, from: LocalDate, end: LocalDate): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/DbHelper.java b/app/src/main/java/io/github/wulkanowy/data/db/dao/DbHelper.java deleted file mode 100644 index 199a6c8b..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/dao/DbHelper.java +++ /dev/null @@ -1,19 +0,0 @@ -package io.github.wulkanowy.data.db.dao; - -import android.content.Context; - -import javax.inject.Inject; -import javax.inject.Singleton; - -import io.github.wulkanowy.data.db.dao.entities.DaoMaster; -import io.github.wulkanowy.di.annotations.ApplicationContext; -import io.github.wulkanowy.di.annotations.DatabaseInfo; - -@Singleton -public class DbHelper extends DaoMaster.DevOpenHelper { - - @Inject - DbHelper(@ApplicationContext Context context, @DatabaseInfo String dbName) { - super(context, dbName); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/ExamDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/ExamDao.kt new file mode 100644 index 00000000..311eeb9c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/ExamDao.kt @@ -0,0 +1,16 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.Exam +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Singleton + +@Singleton +@Dao +interface ExamDao : BaseDao { + + @Query("SELECT * FROM Exams WHERE diary_id = :diaryId AND student_id = :studentId AND date >= :from AND date <= :end") + fun loadAll(diaryId: Int, studentId: Int, from: LocalDate, end: LocalDate): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/GradeDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/GradeDao.kt new file mode 100644 index 00000000..12e70bde --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/GradeDao.kt @@ -0,0 +1,15 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.Grade +import kotlinx.coroutines.flow.Flow +import javax.inject.Singleton + +@Singleton +@Dao +interface GradeDao : BaseDao { + + @Query("SELECT * FROM Grades WHERE semester_id = :semesterId AND student_id = :studentId") + fun loadAll(semesterId: Int, studentId: Int): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/GradePointsStatisticsDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/GradePointsStatisticsDao.kt new file mode 100644 index 00000000..e8074f00 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/GradePointsStatisticsDao.kt @@ -0,0 +1,18 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.GradePointsStatistics +import kotlinx.coroutines.flow.Flow +import javax.inject.Singleton + +@Singleton +@Dao +interface GradePointsStatisticsDao : BaseDao { + + @Query("SELECT * FROM GradesPointsStatistics WHERE student_id = :studentId AND semester_id = :semesterId AND subject = :subjectName") + fun loadSubject(semesterId: Int, studentId: Int, subjectName: String): Flow> + + @Query("SELECT * FROM GradesPointsStatistics WHERE student_id = :studentId AND semester_id = :semesterId") + fun loadAll(semesterId: Int, studentId: Int): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/GradeStatisticsDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/GradeStatisticsDao.kt new file mode 100644 index 00000000..b462ad5d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/GradeStatisticsDao.kt @@ -0,0 +1,18 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.GradeStatistics +import kotlinx.coroutines.flow.Flow +import javax.inject.Singleton + +@Singleton +@Dao +interface GradeStatisticsDao : BaseDao { + + @Query("SELECT * FROM GradesStatistics WHERE student_id = :studentId AND semester_id = :semesterId AND subject = :subjectName AND is_semester = :isSemester") + fun loadSubject(semesterId: Int, studentId: Int, subjectName: String, isSemester: Boolean): Flow> + + @Query("SELECT * FROM GradesStatistics WHERE student_id = :studentId AND semester_id = :semesterId AND is_semester = :isSemester") + fun loadAll(semesterId: Int, studentId: Int, isSemester: Boolean): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/GradeSummaryDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/GradeSummaryDao.kt new file mode 100644 index 00000000..fc9ad66e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/GradeSummaryDao.kt @@ -0,0 +1,15 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.GradeSummary +import kotlinx.coroutines.flow.Flow +import javax.inject.Singleton + +@Singleton +@Dao +interface GradeSummaryDao : BaseDao { + + @Query("SELECT * FROM GradesSummary WHERE student_id = :studentId AND semester_id = :semesterId") + fun loadAll(semesterId: Int, studentId: Int): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/HomeworkDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/HomeworkDao.kt new file mode 100644 index 00000000..2092de49 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/HomeworkDao.kt @@ -0,0 +1,16 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.Homework +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Singleton + +@Singleton +@Dao +interface HomeworkDao : BaseDao { + + @Query("SELECT * FROM Homework WHERE semester_id = :semesterId AND student_id = :studentId AND date >= :from AND date <= :end") + fun loadAll(semesterId: Int, studentId: Int, from: LocalDate, end: LocalDate): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/LuckyNumberDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/LuckyNumberDao.kt new file mode 100644 index 00000000..57f3005a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/LuckyNumberDao.kt @@ -0,0 +1,16 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.LuckyNumber +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Singleton + +@Singleton +@Dao +interface LuckyNumberDao : BaseDao { + + @Query("SELECT * FROM LuckyNumbers WHERE student_id = :studentId AND date = :date") + fun load(studentId: Int, date: LocalDate): Flow +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/MessageAttachmentDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/MessageAttachmentDao.kt new file mode 100644 index 00000000..b69083a1 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/MessageAttachmentDao.kt @@ -0,0 +1,13 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Insert +import androidx.room.OnConflictStrategy +import io.github.wulkanowy.data.db.entities.MessageAttachment + +@Dao +interface MessageAttachmentDao : BaseDao { + + @Insert(onConflict = OnConflictStrategy.REPLACE) + suspend fun insertAttachments(items: List): List +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/MessagesDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/MessagesDao.kt new file mode 100644 index 00000000..79050de0 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/MessagesDao.kt @@ -0,0 +1,19 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import androidx.room.Transaction +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.MessageWithAttachment +import kotlinx.coroutines.flow.Flow + +@Dao +interface MessagesDao : BaseDao { + + @Transaction + @Query("SELECT * FROM Messages WHERE student_id = :studentId AND message_id = :messageId") + fun loadMessageWithAttachment(studentId: Int, messageId: Int): Flow + + @Query("SELECT * FROM Messages WHERE student_id = :studentId AND folder_id = :folder ORDER BY date DESC") + fun loadAll(studentId: Int, folder: Int): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/MobileDeviceDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/MobileDeviceDao.kt new file mode 100644 index 00000000..8baba2c3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/MobileDeviceDao.kt @@ -0,0 +1,13 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.MobileDevice +import kotlinx.coroutines.flow.Flow + +@Dao +interface MobileDeviceDao : BaseDao { + + @Query("SELECT * FROM MobileDevices WHERE student_id = :studentId ORDER BY date DESC") + fun loadAll(studentId: Int): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/NoteDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/NoteDao.kt new file mode 100644 index 00000000..e89a4135 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/NoteDao.kt @@ -0,0 +1,15 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.Note +import kotlinx.coroutines.flow.Flow +import javax.inject.Singleton + +@Singleton +@Dao +interface NoteDao : BaseDao { + + @Query("SELECT * FROM Notes WHERE student_id = :studentId") + fun loadAll(studentId: Int): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/RecipientDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/RecipientDao.kt new file mode 100644 index 00000000..419efde0 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/RecipientDao.kt @@ -0,0 +1,14 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.Recipient +import javax.inject.Singleton + +@Singleton +@Dao +interface RecipientDao : BaseDao { + + @Query("SELECT * FROM Recipients WHERE student_id = :studentId AND role = :role AND unit_id = :unitId") + suspend fun load(studentId: Int, role: Int, unitId: Int): List +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/ReportingUnitDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/ReportingUnitDao.kt new file mode 100644 index 00000000..ca697eda --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/ReportingUnitDao.kt @@ -0,0 +1,17 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.ReportingUnit +import javax.inject.Singleton + +@Singleton +@Dao +interface ReportingUnitDao : BaseDao { + + @Query("SELECT * FROM ReportingUnits WHERE student_id = :studentId") + suspend fun load(studentId: Int): List + + @Query("SELECT * FROM ReportingUnits WHERE student_id = :studentId AND real_id = :unitId") + suspend fun loadOne(studentId: Int, unitId: Int): ReportingUnit? +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/SchoolDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/SchoolDao.kt new file mode 100644 index 00000000..f39791f6 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/SchoolDao.kt @@ -0,0 +1,15 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.School +import kotlinx.coroutines.flow.Flow +import javax.inject.Singleton + +@Singleton +@Dao +interface SchoolDao : BaseDao { + + @Query("SELECT * FROM School WHERE student_id = :studentId AND class_id = :classId") + fun load(studentId: Int, classId: Int): Flow +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/SemesterDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/SemesterDao.kt new file mode 100644 index 00000000..4d171907 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/SemesterDao.kt @@ -0,0 +1,19 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Insert +import androidx.room.OnConflictStrategy +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.Semester +import javax.inject.Singleton + +@Singleton +@Dao +interface SemesterDao : BaseDao { + + @Insert(onConflict = OnConflictStrategy.IGNORE) + suspend fun insertSemesters(items: List): List + + @Query("SELECT * FROM Semesters WHERE student_id = :studentId AND class_id = :classId") + suspend fun loadAll(studentId: Int, classId: Int): List +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/StudentDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/StudentDao.kt new file mode 100644 index 00000000..d7237ea8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/StudentDao.kt @@ -0,0 +1,41 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Delete +import androidx.room.Insert +import androidx.room.OnConflictStrategy.ABORT +import androidx.room.Query +import androidx.room.Transaction +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import javax.inject.Singleton + +@Singleton +@Dao +interface StudentDao { + + @Insert(onConflict = ABORT) + suspend fun insertAll(student: List): List + + @Delete + suspend fun delete(student: Student) + + @Query("SELECT * FROM Students WHERE is_current = 1") + suspend fun loadCurrent(): Student? + + @Query("SELECT * FROM Students WHERE id = :id") + suspend fun loadById(id: Int): Student? + + @Query("SELECT * FROM Students") + suspend fun loadAll(): List + + @Transaction + @Query("SELECT * FROM Students") + suspend fun loadStudentsWithSemesters(): List + + @Query("UPDATE Students SET is_current = 1 WHERE id = :id") + suspend fun updateCurrent(id: Long) + + @Query("UPDATE Students SET is_current = 0") + suspend fun resetCurrent() +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/SubjectDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/SubjectDao.kt new file mode 100644 index 00000000..4cd742b5 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/SubjectDao.kt @@ -0,0 +1,13 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.Subject +import kotlinx.coroutines.flow.Flow + +@Dao +interface SubjectDao : BaseDao { + + @Query("SELECT * FROM Subjects WHERE diary_id = :diaryId AND student_id = :studentId") + fun loadAll(diaryId: Int, studentId: Int): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/TeacherDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/TeacherDao.kt new file mode 100644 index 00000000..6adac220 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/TeacherDao.kt @@ -0,0 +1,15 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.Teacher +import kotlinx.coroutines.flow.Flow +import javax.inject.Singleton + +@Singleton +@Dao +interface TeacherDao : BaseDao { + + @Query("SELECT * FROM Teachers WHERE student_id = :studentId AND class_id = :classId") + fun loadAll(studentId: Int, classId: Int): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/TimetableDao.kt b/app/src/main/java/io/github/wulkanowy/data/db/dao/TimetableDao.kt new file mode 100644 index 00000000..5e6eec66 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/dao/TimetableDao.kt @@ -0,0 +1,16 @@ +package io.github.wulkanowy.data.db.dao + +import androidx.room.Dao +import androidx.room.Query +import io.github.wulkanowy.data.db.entities.Timetable +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Singleton + +@Singleton +@Dao +interface TimetableDao : BaseDao { + + @Query("SELECT * FROM Timetable WHERE diary_id = :diaryId AND student_id = :studentId AND date >= :from AND date <= :end") + fun loadAll(diaryId: Int, studentId: Int, from: LocalDate, end: LocalDate): Flow> +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Account.java b/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Account.java deleted file mode 100644 index 20a47ac2..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Account.java +++ /dev/null @@ -1,258 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.DaoException; -import org.greenrobot.greendao.annotation.Entity; -import org.greenrobot.greendao.annotation.Generated; -import org.greenrobot.greendao.annotation.Id; -import org.greenrobot.greendao.annotation.Property; -import org.greenrobot.greendao.annotation.ToMany; - -import java.util.List; - -@Entity( - nameInDb = "Accounts", - active = true -) -public class Account { - - @Id(autoincrement = true) - private Long id; - - @Property(nameInDb = "NAME") - private String name; - - @Property(nameInDb = "E-MAIL") - private String email; - - @Property(nameInDb = "PASSWORD") - private String password; - - @Property(nameInDb = "SYMBOL") - private String symbol; - - @Property(nameInDb = "SNPID") - private String snpId; - - @ToMany(referencedJoinProperty = "userId") - private List subjectList; - - @ToMany(referencedJoinProperty = "userId") - private List gradeList; - - @ToMany(referencedJoinProperty = "userId") - private List dayList; - - /** - * Used to resolve relations - */ - @Generated(hash = 2040040024) - private transient DaoSession daoSession; - - /** - * Used for active entity operations. - */ - @Generated(hash = 335469827) - private transient AccountDao myDao; - - @Generated(hash = 735765217) - public Account(Long id, String name, String email, String password, String symbol, - String snpId) { - this.id = id; - this.name = name; - this.email = email; - this.password = password; - this.symbol = symbol; - this.snpId = snpId; - } - - @Generated(hash = 882125521) - public Account() { - } - - public Long getId() { - return id; - } - - public Account setId(Long id) { - this.id = id; - return this; - } - - public String getName() { - return name; - } - - public Account setName(String name) { - this.name = name; - return this; - } - - public String getEmail() { - return email; - } - - public Account setEmail(String email) { - this.email = email; - return this; - } - - public String getPassword() { - return password; - } - - public Account setPassword(String password) { - this.password = password; - return this; - } - - public String getSymbol() { - return symbol; - } - - public Account setSymbol(String symbol) { - this.symbol = symbol; - return this; - } - - public String getSnpId() { - return this.snpId; - } - - public Account setSnpId(String snpId) { - this.snpId = snpId; - return this; - } - - /** - * To-many relationship, resolved on first access (and after reset). - * Changes to to-many relations are not persisted, make changes to the target entity. - */ - @Generated(hash = 1800750450) - public List getSubjectList() { - if (subjectList == null) { - final DaoSession daoSession = this.daoSession; - if (daoSession == null) { - throw new DaoException("Entity is detached from DAO context"); - } - SubjectDao targetDao = daoSession.getSubjectDao(); - List subjectListNew = targetDao._queryAccount_SubjectList(id); - synchronized (this) { - if (subjectList == null) { - subjectList = subjectListNew; - } - } - } - return subjectList; - } - - /** - * Resets a to-many relationship, making the next get call to query for a fresh result. - */ - @Generated(hash = 594294258) - public synchronized void resetSubjectList() { - subjectList = null; - } - - /** - * To-many relationship, resolved on first access (and after reset). - * Changes to to-many relations are not persisted, make changes to the target entity. - */ - @Generated(hash = 1040074549) - public List getGradeList() { - if (gradeList == null) { - final DaoSession daoSession = this.daoSession; - if (daoSession == null) { - throw new DaoException("Entity is detached from DAO context"); - } - GradeDao targetDao = daoSession.getGradeDao(); - List gradeListNew = targetDao._queryAccount_GradeList(id); - synchronized (this) { - if (gradeList == null) { - gradeList = gradeListNew; - } - } - } - return gradeList; - } - - /** - * Resets a to-many relationship, making the next get call to query for a fresh result. - */ - @Generated(hash = 1939990047) - public synchronized void resetGradeList() { - gradeList = null; - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#delete(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 128553479) - public void delete() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.delete(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#refresh(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 1942392019) - public void refresh() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.refresh(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#update(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 713229351) - public void update() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.update(this); - } - - /** - * To-many relationship, resolved on first access (and after reset). - * Changes to to-many relations are not persisted, make changes to the target entity. - */ - @Generated(hash = 300459794) - public List getDayList() { - if (dayList == null) { - final DaoSession daoSession = this.daoSession; - if (daoSession == null) { - throw new DaoException("Entity is detached from DAO context"); - } - DayDao targetDao = daoSession.getDayDao(); - List dayListNew = targetDao._queryAccount_DayList(id); - synchronized (this) { - if (dayList == null) { - dayList = dayListNew; - } - } - } - return dayList; - } - - /** - * Resets a to-many relationship, making the next get call to query for a fresh result. - */ - @Generated(hash = 1010399236) - public synchronized void resetDayList() { - dayList = null; - } - - /** called by internal mechanisms, do not call yourself. */ - @Generated(hash = 1812283172) - public void __setDaoSession(DaoSession daoSession) { - this.daoSession = daoSession; - myDao = daoSession != null ? daoSession.getAccountDao() : null; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Day.java b/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Day.java deleted file mode 100644 index 15a06309..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Day.java +++ /dev/null @@ -1,214 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.DaoException; -import org.greenrobot.greendao.annotation.Entity; -import org.greenrobot.greendao.annotation.Generated; -import org.greenrobot.greendao.annotation.Id; -import org.greenrobot.greendao.annotation.Index; -import org.greenrobot.greendao.annotation.Property; -import org.greenrobot.greendao.annotation.ToMany; - -import java.util.List; - -@Entity( - nameInDb = "Days", - active = true, - indexes ={@Index(value = "userId,weekId,date", unique = true)} -) -public class Day { - - @Id(autoincrement = true) - private Long id; - - @Property(nameInDb = "USER_ID") - private Long userId; - - @Property(nameInDb = "WEEK_ID") - private Long weekId; - - @Property(nameInDb = "DATE") - private String date = ""; - - @Property(nameInDb = "DAY_NAME") - private String dayName = ""; - - @Property(nameInDb = "IS_FREE_DAY") - private boolean isFreeDay = false; - - @Property(nameInDb = "FREE_DAY_NAME") - private String freeDayName = ""; - - @ToMany(referencedJoinProperty = "dayId") - private List lessons; - - /** - * Used to resolve relations - */ - @Generated(hash = 2040040024) - private transient DaoSession daoSession; - - /** - * Used for active entity operations. - */ - @Generated(hash = 312167767) - private transient DayDao myDao; - - @Generated(hash = 723729681) - public Day(Long id, Long userId, Long weekId, String date, String dayName, - boolean isFreeDay, String freeDayName) { - this.id = id; - this.userId = userId; - this.weekId = weekId; - this.date = date; - this.dayName = dayName; - this.isFreeDay = isFreeDay; - this.freeDayName = freeDayName; - } - - @Generated(hash = 866989762) - public Day() { - } - - public Long getId() { - return this.id; - } - - public void setId(Long id) { - this.id = id; - } - - public Long getUserId() { - return userId; - } - - public Long getWeekId() { - return weekId; - } - - public Day setWeekId(Long weekId) { - this.weekId = weekId; - return this; - } - - public Day setUserId(Long userId) { - this.userId = userId; - return this; - } - - public String getDate() { - return date; - } - - public Day setDate(String date) { - this.date = date; - return this; - } - - public String getDayName() { - return dayName; - } - - public Day setDayName(String dayName) { - this.dayName = dayName; - return this; - } - - public boolean isFreeDay() { - return isFreeDay; - } - - public Day setFreeDay(boolean freeDay) { - isFreeDay = freeDay; - return this; - } - - public String getFreeDayName() { - return freeDayName; - } - - public Day setFreeDayName(String freeDayName) { - this.freeDayName = freeDayName; - return this; - } - - public boolean getIsFreeDay() { - return this.isFreeDay; - } - - public void setIsFreeDay(boolean isFreeDay) { - this.isFreeDay = isFreeDay; - } - - /** - * To-many relationship, resolved on first access (and after reset). - * Changes to to-many relations are not persisted, make changes to the target entity. - */ - @Generated(hash = 1552857303) - public List getLessons() { - if (lessons == null) { - final DaoSession daoSession = this.daoSession; - if (daoSession == null) { - throw new DaoException("Entity is detached from DAO context"); - } - LessonDao targetDao = daoSession.getLessonDao(); - List lessonsNew = targetDao._queryDay_Lessons(id); - synchronized (this) { - if (lessons == null) { - lessons = lessonsNew; - } - } - } - return lessons; - } - - /** - * Resets a to-many relationship, making the next get call to query for a fresh result. - */ - @Generated(hash = 1769801440) - public synchronized void resetLessons() { - lessons = null; - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#delete(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 128553479) - public void delete() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.delete(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#refresh(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 1942392019) - public void refresh() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.refresh(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#update(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 713229351) - public void update() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.update(this); - } - - /** called by internal mechanisms, do not call yourself. */ - @Generated(hash = 1409317752) - public void __setDaoSession(DaoSession daoSession) { - this.daoSession = daoSession; - myDao = daoSession != null ? daoSession.getDayDao() : null; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Grade.java b/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Grade.java deleted file mode 100644 index 632f9bcc..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Grade.java +++ /dev/null @@ -1,331 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.apache.commons.lang3.builder.EqualsBuilder; -import org.apache.commons.lang3.builder.HashCodeBuilder; -import org.greenrobot.greendao.DaoException; -import org.greenrobot.greendao.annotation.Entity; -import org.greenrobot.greendao.annotation.Generated; -import org.greenrobot.greendao.annotation.Id; -import org.greenrobot.greendao.annotation.Property; - -import java.io.Serializable; - -import io.github.wulkanowy.R; - -@Entity( - nameInDb = "Grades", - active = true -) -public class Grade implements Serializable { - - @Id(autoincrement = true) - protected Long id; - - @Property(nameInDb = "SUBJECT_ID") - private Long subjectId; - - @Property(nameInDb = "USER_ID") - private Long userId; - - @Property(nameInDb = "SUBJECT") - private String subject = ""; - - @Property(nameInDb = "VALUE") - protected String value = ""; - - @Property(nameInDb = "COLOR") - private String color = ""; - - @Property(nameInDb = "SYMBOL") - private String symbol = ""; - - @Property(nameInDb = "DESCRIPTION") - private String description = ""; - - @Property(nameInDb = "WEIGHT") - private String weight = ""; - - @Property(nameInDb = "DATE") - private String date = ""; - - @Property(nameInDb = "TEACHER") - private String teacher = ""; - - @Property(nameInDb = "SEMESTER") - private String semester = ""; - - @Property(nameInDb = "IS_NEW") - private boolean isNew = false; - - @Property(nameInDb = "READ") - private boolean read = true; - - private static final long serialVersionUID = 42L; - - @Generated(hash = 568899968) - public Grade(Long id, Long subjectId, Long userId, String subject, String value, - String color, String symbol, String description, String weight, - String date, String teacher, String semester, boolean isNew, - boolean read) { - this.id = id; - this.subjectId = subjectId; - this.userId = userId; - this.subject = subject; - this.value = value; - this.color = color; - this.symbol = symbol; - this.description = description; - this.weight = weight; - this.date = date; - this.teacher = teacher; - this.semester = semester; - this.isNew = isNew; - this.read = read; - } - - @Generated(hash = 2042976393) - public Grade() { - } - - /** - * Used to resolve relations - */ - @Generated(hash = 2040040024) - private transient DaoSession daoSession; - - /** - * Used for active entity operations. - */ - @Generated(hash = 681281562) - private transient GradeDao myDao; - - public int getValueColor() { - - String replacedString = value.replaceAll("[^0-9]", ""); - - if (!"".equals(replacedString)) { - switch (Integer.parseInt(replacedString)) { - case 6: - return R.color.six_grade; - case 5: - return R.color.five_grade; - case 4: - return R.color.four_grade; - case 3: - return R.color.three_grade; - case 2: - return R.color.two_grade; - case 1: - return R.color.one_grade; - default: - return R.color.default_grade; - } - } - return R.color.default_grade; - } - - @Override - public boolean equals(Object o) { - if (this == o) return true; - - if (o == null || getClass() != o.getClass()) return false; - - Grade grade = (Grade) o; - - return new EqualsBuilder() - .append(subject, grade.subject) - .append(value, grade.value) - .append(color, grade.color) - .append(symbol, grade.symbol) - .append(description, grade.description) - .append(weight, grade.weight) - .append(date, grade.date) - .append(teacher, grade.teacher) - .append(semester, grade.semester) - .isEquals(); - } - - @Override - public int hashCode() { - return new HashCodeBuilder(17, 37) - .append(subject) - .append(value) - .append(color) - .append(symbol) - .append(description) - .append(weight) - .append(date) - .append(teacher) - .append(semester) - .toHashCode(); - } - - public Long getId() { - return id; - } - - public Grade setId(Long id) { - this.id = id; - return this; - } - - public Long getSubjectId() { - return subjectId; - } - - public Grade setSubjectId(Long subjectId) { - this.subjectId = subjectId; - return this; - } - - public Long getUserId() { - return userId; - } - - public Grade setUserId(Long userId) { - this.userId = userId; - return this; - } - - public String getSubject() { - return subject; - } - - public Grade setSubject(String subject) { - this.subject = subject; - return this; - } - - public String getValue() { - return value; - } - - public Grade setValue(String value) { - this.value = value; - return this; - } - - public String getColor() { - return color; - } - - public Grade setColor(String color) { - this.color = color; - return this; - } - - public String getSymbol() { - return symbol; - } - - public Grade setSymbol(String symbol) { - this.symbol = symbol; - return this; - } - - public String getDescription() { - return description; - } - - public Grade setDescription(String description) { - this.description = description; - return this; - } - - public String getWeight() { - return weight; - } - - public Grade setWeight(String weight) { - this.weight = weight; - return this; - } - - public String getDate() { - return date; - } - - public Grade setDate(String date) { - this.date = date; - return this; - } - - public String getTeacher() { - return teacher; - } - - public Grade setTeacher(String teacher) { - this.teacher = teacher; - return this; - } - - public String getSemester() { - return semester; - } - - public Grade setSemester(String semester) { - this.semester = semester; - return this; - } - - public boolean getIsNew() { - return this.isNew; - } - - public Grade setIsNew(boolean isNew) { - this.isNew = isNew; - return this; - } - - public boolean getRead() { - return this.read; - } - - public Grade setRead(boolean read) { - this.read = read; - return this; - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#delete(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 128553479) - public void delete() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.delete(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#refresh(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 1942392019) - public void refresh() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.refresh(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#update(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 713229351) - public void update() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.update(this); - } - - /** called by internal mechanisms, do not call yourself. */ - @Generated(hash = 1187286414) - public void __setDaoSession(DaoSession daoSession) { - this.daoSession = daoSession; - myDao = daoSession != null ? daoSession.getGradeDao() : null; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Lesson.java b/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Lesson.java deleted file mode 100644 index db9be944..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Lesson.java +++ /dev/null @@ -1,353 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.DaoException; -import org.greenrobot.greendao.annotation.Entity; -import org.greenrobot.greendao.annotation.Generated; -import org.greenrobot.greendao.annotation.Id; -import org.greenrobot.greendao.annotation.Index; -import org.greenrobot.greendao.annotation.Property; - -import java.io.Serializable; - -@Entity( - nameInDb = "Lessons", - active = true, - indexes = {@Index(value = "dayId,date,startTime,endTime", unique = true)} -) -public class Lesson implements Serializable { - - @Id(autoincrement = true) - private Long id; - - @Property(nameInDb = "DAY_ID") - private Long dayId; - - @Property(nameInDb = "NUMBER_OF_LESSON") - private String number; - - @Property(nameInDb = "SUBJECT_NAME") - private String subject = ""; - - @Property(nameInDb = "TEACHER") - private String teacher = ""; - - @Property(nameInDb = "ROOM") - private String room = ""; - - @Property(nameInDb = "DESCRIPTION") - private String description = ""; - - @Property(nameInDb = "GROUP_NAME") - private String groupName = ""; - - @Property(nameInDb = "START_TIME") - private String startTime = ""; - - @Property(nameInDb = "END_TIME") - private String endTime = ""; - - @Property(nameInDb = "DATE") - private String date = ""; - - @Property(nameInDb = "IS_EMPTY") - private boolean isEmpty = false; - - @Property(nameInDb = "IS_DIVISION_INTO_GROUP") - private boolean isDivisionIntoGroups = false; - - @Property(nameInDb = "IS_PLANNING") - private boolean isPlanning = false; - - @Property(nameInDb = "IS_REALIZED") - private boolean isRealized = false; - - @Property(nameInDb = "IS_MOVED_CANCELED") - private boolean isMovedOrCanceled = false; - - @Property(nameInDb = "IS_NEW_MOVED_IN_CANCELED") - private boolean isNewMovedInOrChanged = false; - - private static final long serialVersionUID = 42L; - - /** - * Used to resolve relations - */ - @Generated(hash = 2040040024) - private transient DaoSession daoSession; - - /** - * Used for active entity operations. - */ - @Generated(hash = 610143130) - private transient LessonDao myDao; - - @Generated(hash = 140778287) - public Lesson(Long id, Long dayId, String number, String subject, String teacher, String room, - String description, String groupName, String startTime, String endTime, String date, - boolean isEmpty, boolean isDivisionIntoGroups, boolean isPlanning, boolean isRealized, - boolean isMovedOrCanceled, boolean isNewMovedInOrChanged) { - this.id = id; - this.dayId = dayId; - this.number = number; - this.subject = subject; - this.teacher = teacher; - this.room = room; - this.description = description; - this.groupName = groupName; - this.startTime = startTime; - this.endTime = endTime; - this.date = date; - this.isEmpty = isEmpty; - this.isDivisionIntoGroups = isDivisionIntoGroups; - this.isPlanning = isPlanning; - this.isRealized = isRealized; - this.isMovedOrCanceled = isMovedOrCanceled; - this.isNewMovedInOrChanged = isNewMovedInOrChanged; - } - - @Generated(hash = 1669664117) - public Lesson() { - } - - public Long getId() { - return this.id; - } - - public void setId(Long id) { - this.id = id; - } - - public Long getDayId() { - return this.dayId; - } - - public void setDayId(Long dayId) { - this.dayId = dayId; - } - - public String getNumber() { - return number; - } - - public Lesson setNumber(String number) { - this.number = number; - return this; - } - - public String getSubject() { - return subject; - } - - public Lesson setSubject(String subject) { - this.subject = subject; - return this; - } - - public String getTeacher() { - return teacher; - } - - public Lesson setTeacher(String teacher) { - this.teacher = teacher; - return this; - } - - public String getRoom() { - return room; - } - - public Lesson setRoom(String room) { - this.room = room; - return this; - } - - public String getDescription() { - return description; - } - - public Lesson setDescription(String description) { - this.description = description; - return this; - } - - public String getGroupName() { - return groupName; - } - - public Lesson setGroupName(String groupName) { - this.groupName = groupName; - return this; - } - - public String getStartTime() { - return startTime; - } - - public Lesson setStartTime(String startTime) { - this.startTime = startTime; - return this; - } - - public String getEndTime() { - return endTime; - } - - public Lesson setEndTime(String endTime) { - this.endTime = endTime; - return this; - } - - public String getDate() { - return date; - } - - public Lesson setDate(String date) { - this.date = date; - return this; - } - - public boolean isEmpty() { - return isEmpty; - } - - public Lesson setEmpty(boolean empty) { - isEmpty = empty; - return this; - } - - public boolean isDivisionIntoGroups() { - return isDivisionIntoGroups; - } - - public Lesson setDivisionIntoGroups(boolean divisionIntoGroups) { - isDivisionIntoGroups = divisionIntoGroups; - return this; - } - - public boolean isPlanning() { - return isPlanning; - } - - public Lesson setPlanning(boolean planning) { - isPlanning = planning; - return this; - } - - public boolean isRealized() { - return isRealized; - } - - public Lesson setRealized(boolean realized) { - isRealized = realized; - return this; - } - - public boolean isMovedOrCanceled() { - return isMovedOrCanceled; - } - - public Lesson setMovedOrCanceled(boolean movedOrCanceled) { - isMovedOrCanceled = movedOrCanceled; - return this; - } - - public boolean isNewMovedInOrChanged() { - return isNewMovedInOrChanged; - } - - public Lesson setNewMovedInOrChanged(boolean newMovedInOrChanged) { - isNewMovedInOrChanged = newMovedInOrChanged; - return this; - } - - public boolean getIsEmpty() { - return this.isEmpty; - } - - public void setIsEmpty(boolean isEmpty) { - this.isEmpty = isEmpty; - } - - public boolean getIsDivisionIntoGroups() { - return this.isDivisionIntoGroups; - } - - public void setIsDivisionIntoGroups(boolean isDivisionIntoGroups) { - this.isDivisionIntoGroups = isDivisionIntoGroups; - } - - public boolean getIsPlanning() { - return this.isPlanning; - } - - public void setIsPlanning(boolean isPlanning) { - this.isPlanning = isPlanning; - } - - public boolean getIsRealized() { - return this.isRealized; - } - - public void setIsRealized(boolean isRealized) { - this.isRealized = isRealized; - } - - public boolean getIsMovedOrCanceled() { - return this.isMovedOrCanceled; - } - - public void setIsMovedOrCanceled(boolean isMovedOrCanceled) { - this.isMovedOrCanceled = isMovedOrCanceled; - } - - public boolean getIsNewMovedInOrChanged() { - return this.isNewMovedInOrChanged; - } - - public void setIsNewMovedInOrChanged(boolean isNewMovedInOrChanged) { - this.isNewMovedInOrChanged = isNewMovedInOrChanged; - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#delete(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 128553479) - public void delete() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.delete(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#refresh(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 1942392019) - public void refresh() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.refresh(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#update(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 713229351) - public void update() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.update(this); - } - - /** called by internal mechanisms, do not call yourself. */ - @Generated(hash = 2078826279) - public void __setDaoSession(DaoSession daoSession) { - this.daoSession = daoSession; - myDao = daoSession != null ? daoSession.getLessonDao() : null; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Subject.java b/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Subject.java deleted file mode 100644 index 6bcce622..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Subject.java +++ /dev/null @@ -1,192 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.DaoException; -import org.greenrobot.greendao.annotation.Entity; -import org.greenrobot.greendao.annotation.Generated; -import org.greenrobot.greendao.annotation.Id; -import org.greenrobot.greendao.annotation.Property; -import org.greenrobot.greendao.annotation.ToMany; - -import java.util.List; - -@Entity( - nameInDb = "Subjects", - active = true -) -public class Subject { - - @Id(autoincrement = true) - private Long id; - - @Property(nameInDb = "USER_ID") - private Long userId; - - @Property(nameInDb = "NAME") - private String name; - - @Property(nameInDb = "PREDICTED_RATING") - private String predictedRating; - - @Property(nameInDb = "FINAL_RATING") - private String finalRating; - - @Property(nameInDb = "SEMESTER") - private String semester; - - @ToMany(referencedJoinProperty = "subjectId") - private List gradeList; - - /** - * Used to resolve relations - */ - @Generated(hash = 2040040024) - private transient DaoSession daoSession; - - /** - * Used for active entity operations. - */ - @Generated(hash = 1644932788) - private transient SubjectDao myDao; - - @Generated(hash = 396325764) - public Subject(Long id, Long userId, String name, String predictedRating, - String finalRating, String semester) { - this.id = id; - this.userId = userId; - this.name = name; - this.predictedRating = predictedRating; - this.finalRating = finalRating; - this.semester = semester; - } - - @Generated(hash = 1617906264) - public Subject() { - } - - public Long getId() { - return id; - } - - public Subject setId(Long id) { - this.id = id; - return this; - } - - public Long getUserId() { - return userId; - } - - public Subject setUserId(Long userId) { - this.userId = userId; - return this; - } - - public String getName() { - return name; - } - - public Subject setName(String name) { - this.name = name; - return this; - } - - public String getPredictedRating() { - return predictedRating; - } - - public Subject setPredictedRating(String predictedRating) { - this.predictedRating = predictedRating; - return this; - } - - public String getFinalRating() { - return finalRating; - } - - public Subject setFinalRating(String finalRating) { - this.finalRating = finalRating; - return this; - } - - public String getSemester() { - return semester; - } - - public Subject setSemester(String semester) { - this.semester = semester; - return this; - } - - /** - * To-many relationship, resolved on first access (and after reset). - * Changes to to-many relations are not persisted, make changes to the target entity. - */ - @Generated(hash = 1358847893) - public List getGradeList() { - if (gradeList == null) { - final DaoSession daoSession = this.daoSession; - if (daoSession == null) { - throw new DaoException("Entity is detached from DAO context"); - } - GradeDao targetDao = daoSession.getGradeDao(); - List gradeListNew = targetDao._querySubject_GradeList(id); - synchronized (this) { - if (gradeList == null) { - gradeList = gradeListNew; - } - } - } - return gradeList; - } - - /** - * Resets a to-many relationship, making the next get call to query for a fresh result. - */ - @Generated(hash = 1939990047) - public synchronized void resetGradeList() { - gradeList = null; - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#delete(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 128553479) - public void delete() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.delete(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#refresh(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 1942392019) - public void refresh() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.refresh(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#update(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 713229351) - public void update() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.update(this); - } - - /** called by internal mechanisms, do not call yourself. */ - @Generated(hash = 937984622) - public void __setDaoSession(DaoSession daoSession) { - this.daoSession = daoSession; - myDao = daoSession != null ? daoSession.getSubjectDao() : null; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Week.java b/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Week.java deleted file mode 100644 index c82f3277..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/dao/entities/Week.java +++ /dev/null @@ -1,148 +0,0 @@ -package io.github.wulkanowy.data.db.dao.entities; - -import org.greenrobot.greendao.DaoException; -import org.greenrobot.greendao.annotation.Entity; -import org.greenrobot.greendao.annotation.Generated; -import org.greenrobot.greendao.annotation.Id; -import org.greenrobot.greendao.annotation.Index; -import org.greenrobot.greendao.annotation.Property; -import org.greenrobot.greendao.annotation.ToMany; - -import java.util.List; - -@Entity( - nameInDb = "Weeks", - active = true, - indexes ={@Index(value = "userId,startDayDate", unique = true)} -) -public class Week { - - @Id(autoincrement = true) - private Long id; - - @Property(nameInDb = "USER_ID") - private Long userId; - - @Property(nameInDb = "START_DATE") - private String startDayDate = ""; - - @ToMany(referencedJoinProperty = "weekId") - private List dayList; - - /** Used to resolve relations */ - @Generated(hash = 2040040024) - private transient DaoSession daoSession; - - /** Used for active entity operations. */ - @Generated(hash = 1019310398) - private transient WeekDao myDao; - - @Generated(hash = 36829814) - public Week(Long id, Long userId, String startDayDate) { - this.id = id; - this.userId = userId; - this.startDayDate = startDayDate; - } - - @Generated(hash = 2135529658) - public Week() { - } - - public Long getId() { - return id; - } - - public Week setId(Long id) { - this.id = id; - return this; - } - - public Long getUserId() { - return userId; - } - - public Week setUserId(Long userId) { - this.userId = userId; - return this; - } - - public String getStartDayDate() { - return startDayDate; - } - - public Week setStartDayDate(String startDayDate) { - this.startDayDate = startDayDate; - return this; - } - - /** - * To-many relationship, resolved on first access (and after reset). - * Changes to to-many relations are not persisted, make changes to the target entity. - */ - @Generated(hash = 1562119145) - public List getDayList() { - if (dayList == null) { - final DaoSession daoSession = this.daoSession; - if (daoSession == null) { - throw new DaoException("Entity is detached from DAO context"); - } - DayDao targetDao = daoSession.getDayDao(); - List dayListNew = targetDao._queryWeek_DayList(id); - synchronized (this) { - if (dayList == null) { - dayList = dayListNew; - } - } - } - return dayList; - } - - /** Resets a to-many relationship, making the next get call to query for a fresh result. */ - @Generated(hash = 1010399236) - public synchronized void resetDayList() { - dayList = null; - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#delete(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 128553479) - public void delete() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.delete(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#refresh(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 1942392019) - public void refresh() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.refresh(this); - } - - /** - * Convenient call for {@link org.greenrobot.greendao.AbstractDao#update(Object)}. - * Entity must attached to an entity context. - */ - @Generated(hash = 713229351) - public void update() { - if (myDao == null) { - throw new DaoException("Entity is detached from DAO context"); - } - myDao.update(this); - } - - /** called by internal mechanisms, do not call yourself. */ - @Generated(hash = 665278367) - public void __setDaoSession(DaoSession daoSession) { - this.daoSession = daoSession; - myDao = daoSession != null ? daoSession.getWeekDao() : null; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Attendance.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Attendance.kt new file mode 100644 index 00000000..f141d5d5 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Attendance.kt @@ -0,0 +1,50 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDate + +@Entity(tableName = "Attendance") +data class Attendance( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "diary_id") + val diaryId: Int, + + @ColumnInfo(name = "time_id") + val timeId: Int, + + val date: LocalDate, + + val number: Int, + + val subject: String, + + val name: String, + + val presence: Boolean, + + val absence: Boolean, + + val exemption: Boolean, + + val lateness: Boolean, + + val excused: Boolean, + + val deleted: Boolean, + + val excusable: Boolean, + + @ColumnInfo(name = "excuse_status") + val excuseStatus: String? + +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/AttendanceSummary.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/AttendanceSummary.kt new file mode 100644 index 00000000..7d628eba --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/AttendanceSummary.kt @@ -0,0 +1,43 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.Month + +@Entity(tableName = "AttendanceSummary") +data class AttendanceSummary( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "diary_id") + val diaryId: Int, + + @ColumnInfo(name = "subject_id") + val subjectId: Int, + + val month: Month, + + val presence: Int, + + val absence: Int, + + @ColumnInfo(name = "absence_excused") + val absenceExcused: Int, + + @ColumnInfo(name = "absence_for_school_reasons") + val absenceForSchoolReasons: Int, + + val lateness: Int, + + @ColumnInfo(name = "lateness_excused") + val latenessExcused: Int, + + val exemption: Int +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/CompletedLesson.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/CompletedLesson.kt new file mode 100644 index 00000000..e305d467 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/CompletedLesson.kt @@ -0,0 +1,40 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDate + +@Entity(tableName = "CompletedLesson") +data class CompletedLesson( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "diary_id") + val diaryId: Int, + + val date: LocalDate, + + val number: Int, + + val subject: String, + + val topic: String, + + val teacher: String, + + @ColumnInfo(name = "teacher_symbol") + val teacherSymbol: String, + + val substitution: String, + + val absence: String, + + val resources: String +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Exam.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Exam.kt new file mode 100644 index 00000000..50ed343a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Exam.kt @@ -0,0 +1,39 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDate + +@Entity(tableName = "Exams") +data class Exam( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "diary_id") + val diaryId: Int, + + val date: LocalDate, + + @ColumnInfo(name = "entry_date") + val entryDate: LocalDate, + + val subject: String, + + val group: String, + + val type: String, + + val description: String, + + val teacher: String, + + @ColumnInfo(name = "teacher_symbol") + val teacherSymbol: String +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Grade.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Grade.kt new file mode 100644 index 00000000..a0f1c3a6 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Grade.kt @@ -0,0 +1,52 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDate + +@Entity(tableName = "Grades") +data class Grade( + + @ColumnInfo(name = "semester_id") + val semesterId: Int, + + @ColumnInfo(name = "student_id") + val studentId: Int, + + val subject: String, + + val entry: String, + + val value: Double, + + val modifier: Double, + + val comment: String, + + val color: String, + + @ColumnInfo(name = "grade_symbol") + val gradeSymbol: String, + + val description: String, + + val weight: String, + + val weightValue: Double, + + val date: LocalDate, + + val teacher: String +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 + + @ColumnInfo(name = "is_read") + var isRead: Boolean = true + + @ColumnInfo(name = "is_notified") + var isNotified: Boolean = true +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/GradePointsStatistics.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/GradePointsStatistics.kt new file mode 100644 index 00000000..407f18bd --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/GradePointsStatistics.kt @@ -0,0 +1,24 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey + +@Entity(tableName = "GradesPointsStatistics") +data class GradePointsStatistics( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "semester_id") + val semesterId: Int, + + val subject: String, + + val others: Double, + + val student: Double +) { + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/GradeStatistics.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/GradeStatistics.kt new file mode 100644 index 00000000..8ad8b8b8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/GradeStatistics.kt @@ -0,0 +1,27 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey + +@Entity(tableName = "GradesStatistics") +data class GradeStatistics( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "semester_id") + val semesterId: Int, + + val subject: String, + + val grade: Int, + + val amount: Int, + + @ColumnInfo(name = "is_semester") + val semester: Boolean +) { + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/GradeSummary.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/GradeSummary.kt new file mode 100644 index 00000000..fb7b60bb --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/GradeSummary.kt @@ -0,0 +1,52 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.time.LocalDateTime + +@Entity(tableName = "GradesSummary") +data class GradeSummary( + + @ColumnInfo(name = "semester_id") + val semesterId: Int, + + @ColumnInfo(name = "student_id") + val studentId: Int, + + val position: Int, + + val subject: String, + + @ColumnInfo(name = "predicted_grade") + val predictedGrade: String, + + @ColumnInfo(name = "final_grade") + val finalGrade: String, + + @ColumnInfo(name = "proposed_points") + val proposedPoints: String, + + @ColumnInfo(name = "final_points") + val finalPoints: String, + + @ColumnInfo(name = "points_sum") + val pointsSum: String, + + val average: Double +) { + @PrimaryKey(autoGenerate = true) + var id: Long = 0 + + @ColumnInfo(name = "is_predicted_grade_notified") + var isPredictedGradeNotified: Boolean = true + + @ColumnInfo(name = "is_final_grade_notified") + var isFinalGradeNotified: Boolean = true + + @ColumnInfo(name = "predicted_grade_last_change") + var predictedGradeLastChange: LocalDateTime = LocalDateTime.now() + + @ColumnInfo(name = "final_grade_last_change") + var finalGradeLastChange: LocalDateTime = LocalDateTime.now() +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Homework.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Homework.kt new file mode 100644 index 00000000..5b21445b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Homework.kt @@ -0,0 +1,40 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDate + +@Entity(tableName = "Homework") +data class Homework( + + @ColumnInfo(name = "semester_id") + val semesterId: Int, + + @ColumnInfo(name = "student_id") + val studentId: Int, + + val date: LocalDate, + + @ColumnInfo(name = "entry_date") + val entryDate: LocalDate, + + val subject: String, + + val content: String, + + val teacher: String, + + @ColumnInfo(name = "teacher_symbol") + val teacherSymbol: String, + + val attachments: List> +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 + + @ColumnInfo(name = "is_done") + var isDone: Boolean = false +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/LuckyNumber.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/LuckyNumber.kt new file mode 100644 index 00000000..7c24c8f5 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/LuckyNumber.kt @@ -0,0 +1,27 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDate + +@Entity(tableName = "LuckyNumbers") +data class LuckyNumber ( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + val date: LocalDate, + + @ColumnInfo(name = "lucky_number") + val luckyNumber: Int + +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 + + @ColumnInfo(name = "is_notified") + var isNotified: Boolean = true +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Message.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Message.kt new file mode 100644 index 00000000..914dc381 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Message.kt @@ -0,0 +1,58 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDateTime + +@Entity(tableName = "Messages") +data class Message( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "real_id") + val realId: Int, + + @ColumnInfo(name = "message_id") + val messageId: Int, + + @ColumnInfo(name = "sender_name") + val sender: String, + + @ColumnInfo(name = "sender_id") + val senderId: Int, + + @ColumnInfo(name = "recipient_name") + val recipient: String, + + val subject: String, + + val date: LocalDateTime, + + @ColumnInfo(name = "folder_id") + val folderId: Int, + + var unread: Boolean, + + @ColumnInfo(name = "unread_by") + val unreadBy: Int, + + @ColumnInfo(name = "read_by") + val readBy: Int, + + val removed: Boolean, + + @ColumnInfo(name = "has_attachments") + val hasAttachments: Boolean +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 + + @ColumnInfo(name = "is_notified") + var isNotified: Boolean = true + + var content: String = "" +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/MessageAttachment.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/MessageAttachment.kt new file mode 100644 index 00000000..d1886e91 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/MessageAttachment.kt @@ -0,0 +1,26 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable + +@Entity(tableName = "MessageAttachments") +data class MessageAttachment( + + @PrimaryKey + @ColumnInfo(name = "real_id") + val realId: Int, + + @ColumnInfo(name = "message_id") + val messageId: Int, + + @ColumnInfo(name = "one_drive_id") + val oneDriveId: String, + + @ColumnInfo(name = "url") + val url: String, + + @ColumnInfo(name = "filename") + val filename: String +) : Serializable diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/MessageWithAttachment.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/MessageWithAttachment.kt new file mode 100644 index 00000000..2e7af0f4 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/MessageWithAttachment.kt @@ -0,0 +1,12 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.Embedded +import androidx.room.Relation + +data class MessageWithAttachment( + @Embedded + val message: Message, + + @Relation(parentColumn = "message_id", entityColumn = "message_id") + val attachments: List +) diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/MobileDevice.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/MobileDevice.kt new file mode 100644 index 00000000..9d8f1162 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/MobileDevice.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDateTime + +@Entity(tableName = "MobileDevices") +data class MobileDevice( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "device_id") + val deviceId: Int, + + val name: String, + + val date: LocalDateTime +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Note.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Note.kt new file mode 100644 index 00000000..cfd54962 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Note.kt @@ -0,0 +1,43 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDate + +@Entity(tableName = "Notes") +data class Note( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + val date: LocalDate, + + val teacher: String, + + @ColumnInfo(name = "teacher_symbol") + val teacherSymbol: String, + + val category: String, + + @ColumnInfo(name = "category_type") + val categoryType: Int, + + @ColumnInfo(name = "is_points_show") + val isPointsShow: Boolean, + + val points: Int, + + val content: String +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 + + @ColumnInfo(name = "is_read") + var isRead: Boolean = true + + @ColumnInfo(name = "is_notified") + var isNotified: Boolean = true +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Recipient.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Recipient.kt new file mode 100644 index 00000000..3021da72 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Recipient.kt @@ -0,0 +1,38 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable + +@Entity(tableName = "Recipients") +data class Recipient( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "real_id") + val realId: String, + + val name: String, + + @ColumnInfo(name = "real_name") + val realName: String, + + @ColumnInfo(name = "login_id") + val loginId: Int, + + @ColumnInfo(name = "unit_id") + val unitId: Int, + + val role: Int, + + val hash: String + +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 + + override fun toString() = name +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/ReportingUnit.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/ReportingUnit.kt new file mode 100644 index 00000000..601d8aac --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/ReportingUnit.kt @@ -0,0 +1,32 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable + +@Entity(tableName = "ReportingUnits") +data class ReportingUnit( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "real_id") + val realId: Int, + + @ColumnInfo(name = "short") + val shortName: String, + + @ColumnInfo(name = "sender_id") + val senderId: Int, + + @ColumnInfo(name = "sender_name") + val senderName: String, + + val roles: List + +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/School.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/School.kt new file mode 100644 index 00000000..20fae450 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/School.kt @@ -0,0 +1,30 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable + +@Entity(tableName = "School") +data class School( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "class_id") + val classId: Int, + + val name: String, + + val address: String, + + val contact: String, + + val headmaster: String, + + val pedagogue: String +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Semester.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Semester.kt new file mode 100644 index 00000000..3b1f0add --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Semester.kt @@ -0,0 +1,48 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.Index +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDate + +@Entity(tableName = "Semesters", indices = [Index(value = ["student_id", "diary_id", "semester_id"], unique = true)]) +data class Semester( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "diary_id") + val diaryId: Int, + + @ColumnInfo(name = "diary_name") + val diaryName: String, + + @ColumnInfo(name = "school_year") + val schoolYear: Int, + + @ColumnInfo(name = "semester_id") + val semesterId: Int, + + @ColumnInfo(name = "semester_name") + val semesterName: Int, + + val start: LocalDate, + + val end: LocalDate, + + @ColumnInfo(name = "class_id") + val classId: Int, + + @ColumnInfo(name = "unit_id") + val unitId: Int +): Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 + + + @ColumnInfo(name = "is_current") + var current: Boolean = false +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Student.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Student.kt new file mode 100644 index 00000000..b6c75ff8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Student.kt @@ -0,0 +1,76 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.Index +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDateTime + +@Entity(tableName = "Students", indices = [Index(value = ["email", "symbol", "student_id", "school_id", "class_id"], unique = true)]) +data class Student( + + @ColumnInfo(name = "scrapper_base_url") + val scrapperBaseUrl: String, + + @ColumnInfo(name = "mobile_base_url") + val mobileBaseUrl: String, + + @ColumnInfo(name = "login_type") + val loginType: String, + + @ColumnInfo(name = "login_mode") + val loginMode: String, + + @ColumnInfo(name = "certificate_key") + val certificateKey: String, + + @ColumnInfo(name = "private_key") + val privateKey: String, + + @ColumnInfo(name = "is_parent") + val isParent: Boolean, + + val email: String, + + var password: String, + + val symbol: String, + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "user_login_id") + val userLoginId: Int, + + @ColumnInfo(name = "user_name") + val userName: String, + + @ColumnInfo(name = "student_name") + val studentName: String, + + @ColumnInfo(name = "school_id") + val schoolSymbol: String, + + @ColumnInfo(name ="school_short") + val schoolShortName: String, + + @ColumnInfo(name = "school_name") + val schoolName: String, + + @ColumnInfo(name = "class_name") + val className: String, + + @ColumnInfo(name = "class_id") + val classId: Int, + + @ColumnInfo(name = "is_current") + val isCurrent: Boolean, + + @ColumnInfo(name = "registration_date") + val registrationDate: LocalDateTime +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/StudentWithSemesters.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/StudentWithSemesters.kt new file mode 100644 index 00000000..9362a954 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/StudentWithSemesters.kt @@ -0,0 +1,13 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.Embedded +import androidx.room.Relation +import java.io.Serializable + +data class StudentWithSemesters( + @Embedded + val student: Student, + + @Relation(parentColumn = "student_id", entityColumn = "student_id") + val semesters: List +) : Serializable diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Subject.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Subject.kt new file mode 100644 index 00000000..dbaa6f4e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Subject.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable + +@Entity(tableName = "Subjects") +data class Subject( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "diary_id") + val diaryId: Int, + + @ColumnInfo(name = "real_id") + val realId: Int, + + val name: String +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Teacher.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Teacher.kt new file mode 100644 index 00000000..52c96f8a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Teacher.kt @@ -0,0 +1,27 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable + +@Entity(tableName = "Teachers") +data class Teacher( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "class_id") + val classId: Int, + + val subject: String, + + val name: String, + + @ColumnInfo(name = "short_name") + val shortName: String +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/entities/Timetable.kt b/app/src/main/java/io/github/wulkanowy/data/db/entities/Timetable.kt new file mode 100644 index 00000000..1bf159ef --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/entities/Timetable.kt @@ -0,0 +1,53 @@ +package io.github.wulkanowy.data.db.entities + +import androidx.room.ColumnInfo +import androidx.room.Entity +import androidx.room.PrimaryKey +import java.io.Serializable +import java.time.LocalDate +import java.time.LocalDateTime + +@Entity(tableName = "Timetable") +data class Timetable( + + @ColumnInfo(name = "student_id") + val studentId: Int, + + @ColumnInfo(name = "diary_id") + val diaryId: Int, + + val number: Int, + + val start: LocalDateTime, + + val end: LocalDateTime, + + val date: LocalDate, + + val subject: String, + + val subjectOld: String, + + val group: String, + + val room: String, + + val roomOld: String, + + val teacher: String, + + val teacherOld: String, + + val info: String, + + @ColumnInfo(name = "student_plan") + val isStudentPlan: Boolean, + + val changes: Boolean, + + val canceled: Boolean +) : Serializable { + + @PrimaryKey(autoGenerate = true) + var id: Long = 0 +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration10.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration10.kt new file mode 100644 index 00000000..c26a02d1 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration10.kt @@ -0,0 +1,11 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration10 : Migration(9, 10) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Grades_Summary RENAME TO GradesSummary") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration11.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration11.kt new file mode 100644 index 00000000..6d129bca --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration11.kt @@ -0,0 +1,34 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration11 : Migration(10, 11) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS Grades_temp ( + id INTEGER PRIMARY KEY NOT NULL, + is_read INTEGER NOT NULL, + is_notified INTEGER NOT NULL, + semester_id INTEGER NOT NULL, + student_id INTEGER NOT NULL, + subject TEXT NOT NULL, + entry TEXT NOT NULL, + value INTEGER NOT NULL, + modifier REAL NOT NULL, + comment TEXT NOT NULL, + color TEXT NOT NULL, + grade_symbol TEXT NOT NULL, + description TEXT NOT NULL, + weight TEXT NOT NULL, + weightValue REAL NOT NULL, + date INTEGER NOT NULL, + teacher TEXT NOT NULL + ) + """) + database.execSQL("INSERT INTO Grades_temp SELECT * FROM Grades") + database.execSQL("DROP TABLE Grades") + database.execSQL("ALTER TABLE Grades_temp RENAME TO Grades") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration12.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration12.kt new file mode 100644 index 00000000..1dc38e14 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration12.kt @@ -0,0 +1,69 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration12 : Migration(11, 12) { + + override fun migrate(database: SupportSQLiteDatabase) { + createTempStudentsTable(database) + replaceStudentTable(database) + updateStudentsWithClassId(database, getStudentsIds(database)) + removeStudentsWithNoClassId(database) + ensureThereIsOnlyOneCurrentStudent(database) + } + + private fun createTempStudentsTable(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS Students_tmp ( + id INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, + endpoint TEXT NOT NULL, + loginType TEXT NOT NULL, + email TEXT NOT NULL, + password TEXT NOT NULL, + symbol TEXT NOT NULL, + student_id INTEGER NOT NULL, + student_name TEXT NOT NULL, + school_id TEXT NOT NULL, + school_name TEXT NOT NULL, + is_current INTEGER NOT NULL, + registration_date INTEGER NOT NULL, + class_id INTEGER NOT NULL + ) + """) + database.execSQL("CREATE UNIQUE INDEX index_Students_email_symbol_student_id_school_id_class_id ON Students_tmp (email, symbol, student_id, school_id, class_id)") + } + + private fun replaceStudentTable(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Students ADD COLUMN class_id INTEGER DEFAULT 0 NOT NULL") + database.execSQL("INSERT INTO Students_tmp SELECT * FROM Students") + database.execSQL("DROP TABLE Students") + database.execSQL("ALTER TABLE Students_tmp RENAME TO Students") + } + + private fun getStudentsIds(database: SupportSQLiteDatabase): List { + val students = mutableListOf() + val studentsCursor = database.query("SELECT student_id FROM Students") + if (studentsCursor.moveToFirst()) { + do { + students.add(studentsCursor.getInt(0)) + } while (studentsCursor.moveToNext()) + } + return students + } + + private fun updateStudentsWithClassId(database: SupportSQLiteDatabase, students: List) { + students.forEach { + database.execSQL("UPDATE Students SET class_id = IFNULL((SELECT class_id FROM Semesters WHERE student_id = $it), 0) WHERE student_id = $it") + } + } + + private fun removeStudentsWithNoClassId(database: SupportSQLiteDatabase) { + database.execSQL("DELETE FROM Students WHERE class_id = 0") + } + + private fun ensureThereIsOnlyOneCurrentStudent(database: SupportSQLiteDatabase) { + database.execSQL("UPDATE Students SET is_current = 0") + database.execSQL("UPDATE Students SET is_current = 1 WHERE id = (SELECT MAX(id) FROM Students)") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration13.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration13.kt new file mode 100644 index 00000000..0cf8cd9b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration13.kt @@ -0,0 +1,64 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration13 : Migration(12, 13) { + + override fun migrate(database: SupportSQLiteDatabase) { + addClassNameToStudents(database, getStudentsIds(database)) + updateSemestersTable(database) + markAtLeastAndOnlyOneSemesterAtCurrent(database, getStudentsAndClassIds(database)) + clearMessagesTable(database) + } + + private fun addClassNameToStudents(database: SupportSQLiteDatabase, students: List>) { + database.execSQL("ALTER TABLE Students ADD COLUMN class_name TEXT DEFAULT \"\" NOT NULL") + + students.forEach { (id, name) -> + val schoolName = name.substringAfter(" - ") + val className = name.substringBefore(" - ", "").replace("Klasa ", "") + database.execSQL("UPDATE Students SET class_name = '$className' WHERE id = '$id'") + database.execSQL("UPDATE Students SET school_name = '$schoolName' WHERE id = '$id'") + } + } + + private fun getStudentsIds(database: SupportSQLiteDatabase): MutableList> { + val students = mutableListOf>() + val studentsCursor = database.query("SELECT id, school_name FROM Students") + if (studentsCursor.moveToFirst()) { + do { + students.add(studentsCursor.getInt(0) to studentsCursor.getString(1)) + } while (studentsCursor.moveToNext()) + } + return students + } + + private fun updateSemestersTable(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Semesters ADD COLUMN school_year INTEGER DEFAULT 1970 NOT NULL") + database.execSQL("ALTER TABLE Semesters ADD COLUMN start INTEGER DEFAULT 0 NOT NULL") + database.execSQL("ALTER TABLE Semesters ADD COLUMN `end` INTEGER DEFAULT 0 NOT NULL") + } + + private fun getStudentsAndClassIds(database: SupportSQLiteDatabase): List> { + val students = mutableListOf>() + val studentsCursor = database.query("SELECT student_id, class_id FROM Students") + if (studentsCursor.moveToFirst()) { + do { + students.add(studentsCursor.getInt(0) to studentsCursor.getInt(1)) + } while (studentsCursor.moveToNext()) + } + return students + } + + private fun markAtLeastAndOnlyOneSemesterAtCurrent(database: SupportSQLiteDatabase, students: List>) { + students.forEach { (studentId, classId) -> + database.execSQL("UPDATE Semesters SET is_current = 0 WHERE student_id = '$studentId' AND class_id = '$classId'") + database.execSQL("UPDATE Semesters SET is_current = 1 WHERE id = (SELECT id FROM Semesters WHERE student_id = '$studentId' AND class_id = '$classId' ORDER BY semester_id DESC)") + } + } + + private fun clearMessagesTable(database: SupportSQLiteDatabase) { + database.execSQL("DELETE FROM Messages") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration14.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration14.kt new file mode 100644 index 00000000..4dac0d30 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration14.kt @@ -0,0 +1,26 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration14 : Migration(13, 14) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("DROP TABLE IF EXISTS GradesSummary") + database.execSQL(""" + CREATE TABLE IF NOT EXISTS GradesSummary ( + id INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, + semester_id INTEGER NOT NULL, + student_id INTEGER NOT NULL, + position INTEGER NOT NULL, + subject TEXT NOT NULL, + predicted_grade TEXT NOT NULL, + final_grade TEXT NOT NULL, + proposed_points TEXT NOT NULL, + final_points TEXT NOT NULL, + points_sum TEXT NOT NULL, + average REAL NOT NULL + ) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration15.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration15.kt new file mode 100644 index 00000000..5be49a95 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration15.kt @@ -0,0 +1,19 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration15 : Migration(14, 15) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS MobileDevices ( + id INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, + student_id INTEGER NOT NULL, + device_id INTEGER NOT NULL, + name TEXT NOT NULL, + date INTEGER NOT NULL + ) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration16.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration16.kt new file mode 100644 index 00000000..7f40c0f8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration16.kt @@ -0,0 +1,20 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration16 : Migration(15, 16) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS Teachers ( + id INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, + student_id INTEGER NOT NULL, + class_id INTEGER NOT NULL, + subject TEXT NOT NULL, + name TEXT NOT NULL, + short_name TEXT NOT NULL + ) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration17.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration17.kt new file mode 100644 index 00000000..e2a2574d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration17.kt @@ -0,0 +1,29 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration17 : Migration(16, 17) { + + override fun migrate(database: SupportSQLiteDatabase) { + createGradesPointsStatisticsTable(database) + truncateSemestersTable(database) + } + + private fun createGradesPointsStatisticsTable(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS GradesPointsStatistics( + id INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, + student_id INTEGER NOT NULL, + semester_id INTEGER NOT NULL, + subject TEXT NOT NULL, + others REAL NOT NULL, + student REAL NOT NULL + ) + """) + } + + private fun truncateSemestersTable(database: SupportSQLiteDatabase) { + database.execSQL("DELETE FROM Semesters") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration18.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration18.kt new file mode 100644 index 00000000..6c5e56c6 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration18.kt @@ -0,0 +1,22 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration18 : Migration(17, 18) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS School ( + id INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, + student_id INTEGER NOT NULL, + class_id INTEGER NOT NULL, + name TEXT NOT NULL, + address TEXT NOT NULL, + contact TEXT NOT NULL, + headmaster TEXT NOT NULL, + pedagogue TEXT NOT NULL + ) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration19.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration19.kt new file mode 100644 index 00000000..d38f1245 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration19.kt @@ -0,0 +1,119 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase +import io.github.wulkanowy.data.db.SharedPrefProvider + +class Migration19(private val sharedPrefProvider: SharedPrefProvider) : Migration(18, 19) { + + override fun migrate(database: SupportSQLiteDatabase) { + migrateMessages(database) + migrateGrades(database) + migrateStudents(database) + migrateSharedPreferences() + } + + private fun migrateMessages(database: SupportSQLiteDatabase) { + database.execSQL("DROP TABLE Messages") + database.execSQL(""" + CREATE TABLE IF NOT EXISTS Messages ( + id INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, + is_notified INTEGER NOT NULL, + student_id INTEGER NOT NULL, + real_id INTEGER NOT NULL, + message_id INTEGER NOT NULL, + sender_name TEXT NOT NULL, + sender_id INTEGER NOT NULL, + recipient_name TEXT NOT NULL, + subject TEXT NOT NULL, + content TEXT NOT NULL, + date INTEGER NOT NULL, + folder_id INTEGER NOT NULL, + unread INTEGER NOT NULL, + unread_by INTEGER NOT NULL, + read_by INTEGER NOT NULL, + removed INTEGER NOT NULL + ) + """) + } + + private fun migrateGrades(database: SupportSQLiteDatabase) { + database.execSQL("DROP TABLE Grades") + database.execSQL(""" + CREATE TABLE IF NOT EXISTS Grades ( + id INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, + is_read INTEGER NOT NULL, + is_notified INTEGER NOT NULL, + semester_id INTEGER NOT NULL, + student_id INTEGER NOT NULL, + subject TEXT NOT NULL, + entry TEXT NOT NULL, + value REAL NOT NULL, + modifier REAL NOT NULL, + comment TEXT NOT NULL, + color TEXT NOT NULL, + grade_symbol TEXT NOT NULL, + description TEXT NOT NULL, + weight TEXT NOT NULL, + weightValue REAL NOT NULL, + date INTEGER NOT NULL, + teacher TEXT NOT NULL + ) + """) + } + + private fun migrateStudents(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS Students_tmp ( + id INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, + scrapper_base_url TEXT NOT NULL, + mobile_base_url TEXT NOT NULL, + is_parent INTEGER NOT NULL, + login_type TEXT NOT NULL, + login_mode TEXT NOT NULL, + certificate_key TEXT NOT NULL, + private_key TEXT NOT NULL, + email TEXT NOT NULL, + password TEXT NOT NULL, + symbol TEXT NOT NULL, + student_id INTEGER NOT NULL, + user_login_id INTEGER NOT NULL, + student_name TEXT NOT NULL, + school_id TEXT NOT NULL, + school_name TEXT NOT NULL, + class_name TEXT NOT NULL, + class_id INTEGER NOT NULL, + is_current INTEGER NOT NULL, + registration_date INTEGER NOT NULL + ) + """) + + database.execSQL("ALTER TABLE Students ADD COLUMN scrapperBaseUrl TEXT NOT NULL DEFAULT \"\";") + database.execSQL("ALTER TABLE Students ADD COLUMN apiBaseUrl TEXT NOT NULL DEFAULT \"\";") + database.execSQL("ALTER TABLE Students ADD COLUMN is_parent INT NOT NULL DEFAULT 0;") + database.execSQL("ALTER TABLE Students ADD COLUMN loginMode TEXT NOT NULL DEFAULT \"\";") + database.execSQL("ALTER TABLE Students ADD COLUMN certificateKey TEXT NOT NULL DEFAULT \"\";") + database.execSQL("ALTER TABLE Students ADD COLUMN privateKey TEXT NOT NULL DEFAULT \"\";") + database.execSQL("ALTER TABLE Students ADD COLUMN user_login_id INTEGER NOT NULL DEFAULT 0;") + + database.execSQL(""" + INSERT INTO Students_tmp( + id, scrapper_base_url, mobile_base_url, is_parent, login_type, login_mode, certificate_key, private_key, email, password, symbol, student_id, user_login_id, student_name, school_id, school_name, school_id, school_name, class_name, class_id, is_current, registration_date) + SELECT + id, endpoint, apiBaseUrl, is_parent, loginType, "SCRAPPER", certificateKey, privateKey, email, password, symbol, student_id, user_login_id, student_name, school_id, school_name, school_id, school_name, class_name, class_id, is_current, registration_date + FROM Students + """) + database.execSQL("DROP TABLE Students") + database.execSQL("ALTER TABLE Students_tmp RENAME TO Students") + database.execSQL("CREATE UNIQUE INDEX index_Students_email_symbol_student_id_school_id_class_id ON Students (email, symbol, student_id, school_id, class_id)") + } + + private fun migrateSharedPreferences() { + if (sharedPrefProvider.getString("grade_modifier_plus", "0.0") == "0.0") { + sharedPrefProvider.putString("grade_modifier_plus", "0.33") + } + if (sharedPrefProvider.getString("grade_modifier_minus", "0.0") == "0.0") { + sharedPrefProvider.putString("grade_modifier_minus", "0.33") + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration2.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration2.kt new file mode 100644 index 00000000..c5a30991 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration2.kt @@ -0,0 +1,18 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration2 : Migration(1, 2) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS LuckyNumbers ( + id INTEGER PRIMARY KEY NOT NULL, + is_notified INTEGER NOT NULL, + student_id INTEGER NOT NULL, + date INTEGER NOT NULL, + lucky_number INTEGER NOT NULL) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration20.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration20.kt new file mode 100644 index 00000000..2fcfc183 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration20.kt @@ -0,0 +1,42 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration20 : Migration(19, 20) { + + override fun migrate(database: SupportSQLiteDatabase) { + migrateTimetable(database) + truncateSubjects(database) + } + + private fun migrateTimetable(database: SupportSQLiteDatabase) { + database.execSQL("DROP TABLE Timetable") + database.execSQL(""" + CREATE TABLE IF NOT EXISTS `Timetable` ( + `id` INTEGER PRIMARY KEY AUTOINCREMENT NOT NULL, + `student_id` INTEGER NOT NULL, + `diary_id` INTEGER NOT NULL, + `number` INTEGER NOT NULL, + `start` INTEGER NOT NULL, + `end` INTEGER NOT NULL, + `date` INTEGER NOT NULL, + `subject` TEXT NOT NULL, + `subjectOld` TEXT NOT NULL, + `group` TEXT NOT NULL, + `room` TEXT NOT NULL, + `roomOld` TEXT NOT NULL, + `teacher` TEXT NOT NULL, + `teacherOld` TEXT NOT NULL, + `info` TEXT NOT NULL, + `student_plan` INTEGER NOT NULL, + `changes` INTEGER NOT NULL, + `canceled` INTEGER NOT NULL + ) + """) + } + + private fun truncateSubjects(database: SupportSQLiteDatabase) { + database.execSQL("DELETE FROM Subjects") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration21.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration21.kt new file mode 100644 index 00000000..bc0ff900 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration21.kt @@ -0,0 +1,15 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration21 : Migration(20, 21) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Attendance ADD COLUMN excusable INTEGER NOT NULL DEFAULT 0") + database.execSQL("ALTER TABLE Attendance ADD COLUMN time_id INTEGER NOT NULL DEFAULT 0") + database.execSQL("ALTER TABLE Attendance ADD COLUMN excuse_status TEXT DEFAULT NULL") + + database.execSQL("DELETE FROM Semesters") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration22.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration22.kt new file mode 100644 index 00000000..cf50a6c3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration22.kt @@ -0,0 +1,11 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration22 : Migration(21, 22) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Students ADD COLUMN school_short TEXT NOT NULL DEFAULT ''") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration23.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration23.kt new file mode 100644 index 00000000..22de94c3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration23.kt @@ -0,0 +1,14 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration23 : Migration(22, 23) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Notes ADD COLUMN teacher_symbol TEXT NOT NULL DEFAULT ''") + database.execSQL("ALTER TABLE Notes ADD COLUMN category_type INTEGER NOT NULL DEFAULT 0") + database.execSQL("ALTER TABLE Notes ADD COLUMN is_points_show INTEGER NOT NULL DEFAULT 0") + database.execSQL("ALTER TABLE Notes ADD COLUMN points INTEGER NOT NULL DEFAULT 0") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration24.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration24.kt new file mode 100644 index 00000000..604ed487 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration24.kt @@ -0,0 +1,21 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration24 : Migration(23, 24) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Messages ADD COLUMN has_attachments INTEGER NOT NULL DEFAULT 0") + database.execSQL(""" + CREATE TABLE IF NOT EXISTS MessageAttachments ( + real_id INTEGER NOT NULL, + message_id INTEGER NOT NULL, + one_drive_id TEXT NOT NULL, + url TEXT NOT NULL, + filename TEXT NOT NULL, + PRIMARY KEY(real_id) + ) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration25.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration25.kt new file mode 100644 index 00000000..4749bac7 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration25.kt @@ -0,0 +1,12 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration25 : Migration(24, 25) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Homework ADD COLUMN is_done INTEGER NOT NULL DEFAULT 0") + database.execSQL("ALTER TABLE Homework ADD COLUMN attachments TEXT NOT NULL DEFAULT \"[]\"") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration26.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration26.kt new file mode 100644 index 00000000..7130d86d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration26.kt @@ -0,0 +1,14 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration26 : Migration(25, 26) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE GradesSummary ADD COLUMN is_predicted_grade_notified INTEGER NOT NULL DEFAULT 1") + database.execSQL("ALTER TABLE GradesSummary ADD COLUMN is_final_grade_notified INTEGER NOT NULL DEFAULT 1") + database.execSQL("ALTER TABLE GradesSummary ADD COLUMN predicted_grade_last_change INTEGER NOT NULL DEFAULT 0") + database.execSQL("ALTER TABLE GradesSummary ADD COLUMN final_grade_last_change INTEGER NOT NULL DEFAULT 0") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration27.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration27.kt new file mode 100644 index 00000000..6592228a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration27.kt @@ -0,0 +1,45 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration27 : Migration(26, 27) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Students ADD COLUMN user_name TEXT NOT NULL DEFAULT \"\"") + + val students = getStudentsIdsAndNames(database) + val units = getReportingUnits(database) + + students.forEach { (id, userLoginId, studentName) -> + val userNameFromUnits = units.singleOrNull { (senderId, _) -> senderId == userLoginId }?.second + val normalizedStudentName = studentName.split(" ").asReversed().joinToString(" ") + + val userName = userNameFromUnits ?: normalizedStudentName + database.execSQL("UPDATE Students SET user_name = '$userName' WHERE id = '$id'") + } + } + + private fun getStudentsIdsAndNames(database: SupportSQLiteDatabase): MutableList> { + val students = mutableListOf>() + val studentsCursor = database.query("SELECT id, user_login_id, student_name FROM Students") + if (studentsCursor.moveToFirst()) { + do { + students.add(Triple(studentsCursor.getLong(0), studentsCursor.getInt(1), studentsCursor.getString(2))) + } while (studentsCursor.moveToNext()) + } + return students + } + + private fun getReportingUnits(database: SupportSQLiteDatabase): MutableList> { + val units = mutableListOf>() + val unitsCursor = database.query("SELECT sender_id, sender_name FROM ReportingUnits") + if (unitsCursor.moveToFirst()) { + do { + units.add(unitsCursor.getInt(0) to unitsCursor.getString(1)) + } while (unitsCursor.moveToNext()) + } + + return units + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration3.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration3.kt new file mode 100644 index 00000000..d9699c0f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration3.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration3 : Migration(2, 3) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS CompletedLesson ( + id INTEGER PRIMARY KEY NOT NULL, + student_id INTEGER NOT NULL, + diary_id INTEGER NOT NULL, + date INTEGER NOT NULL, + number INTEGER NOT NULL, + subject TEXT NOT NULL, + topic TEXT NOT NULL, + teacher TEXT NOT NULL, + teacher_symbol TEXT NOT NULL, + substitution TEXT NOT NULL, + absence TEXT NOT NULL, + resources TEXT NOT NULL) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration4.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration4.kt new file mode 100644 index 00000000..0ae89bdd --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration4.kt @@ -0,0 +1,31 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration4 : Migration(3, 4) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("DROP TABLE IF EXISTS Messages") + database.execSQL(""" + CREATE TABLE IF NOT EXISTS Messages ( + id INTEGER PRIMARY KEY NOT NULL, + is_notified INTEGER NOT NULL, + content TEXT, + student_id INTEGER NOT NULL, + real_id INTEGER NOT NULL, + message_id INTEGER NOT NULL, + sender_name TEXT NOT NULL, + sender_id INTEGER NOT NULL, + recipient_id INTEGER NOT NULL, + recipient_name TEXT NOT NULL, + subject TEXT NOT NULL, + date INTEGER NOT NULL, + folder_id INTEGER NOT NULL, + unread INTEGER NOT NULL, + unreadBy INTEGER NOT NULL, + readBy INTEGER NOT NULL, + removed INTEGER NOT NULL) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration5.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration5.kt new file mode 100644 index 00000000..dbcd916b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration5.kt @@ -0,0 +1,26 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase +import java.time.LocalDateTime.now +import java.time.ZoneOffset + +class Migration5 : Migration(4, 5) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Students ADD COLUMN registration_date INTEGER DEFAULT 0 NOT NULL") + database.execSQL("UPDATE Students SET registration_date = '${now().atZone(ZoneOffset.UTC).toInstant().toEpochMilli()}'") + database.execSQL("DROP TABLE IF EXISTS Notes") + database.execSQL(""" + CREATE TABLE IF NOT EXISTS Notes ( + id INTEGER PRIMARY KEY NOT NULL, + is_read INTEGER NOT NULL, + is_notified INTEGER NOT NULL, + student_id INTEGER NOT NULL, + date INTEGER NOT NULL, + teacher TEXT NOT NULL, + category TEXT NOT NULL, + content TEXT NOT NULL) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration6.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration6.kt new file mode 100644 index 00000000..fa943618 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration6.kt @@ -0,0 +1,37 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration6 : Migration(5, 6) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS ReportingUnits ( + id INTEGER PRIMARY KEY NOT NULL, + student_id INTEGER NOT NULL, + real_id INTEGER NOT NULL, + short TEXT NOT NULL, + sender_id INTEGER NOT NULL, + sender_name TEXT NOT NULL, + roles TEXT NOT NULL) + """) + + database.execSQL(""" + CREATE TABLE IF NOT EXISTS Recipients ( + id INTEGER PRIMARY KEY NOT NULL, + student_id INTEGER NOT NULL, + real_id TEXT NOT NULL, + name TEXT NOT NULL, + real_name TEXT NOT NULL, + login_id INTEGER NOT NULL, + unit_id INTEGER NOT NULL, + role INTEGER NOT NULL, + hash TEXT NOT NULL) + """) + + database.execSQL("DELETE FROM Semesters WHERE 1") + database.execSQL("ALTER TABLE Semesters ADD COLUMN class_id INTEGER DEFAULT 0 NOT NULL") + database.execSQL("ALTER TABLE Semesters ADD COLUMN unit_id INTEGER DEFAULT 0 NOT NULL") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration7.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration7.kt new file mode 100644 index 00000000..120716c8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration7.kt @@ -0,0 +1,20 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration7 : Migration(6, 7) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL(""" + CREATE TABLE IF NOT EXISTS GradesStatistics ( + id INTEGER PRIMARY KEY NOT NULL, + student_id INTEGER NOT NULL, + semester_id INTEGER NOT NULL, + subject TEXT NOT NULL, + grade INTEGER NOT NULL, + amount INTEGER NOT NULL, + is_semester INTEGER NOT NULL) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration8.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration8.kt new file mode 100644 index 00000000..7009ee12 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration8.kt @@ -0,0 +1,13 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration8 : Migration(7, 8) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("ALTER TABLE Timetable ADD COLUMN subjectOld TEXT DEFAULT \"\" NOT NULL") + database.execSQL("ALTER TABLE Timetable ADD COLUMN roomOld TEXT DEFAULT \"\" NOT NULL") + database.execSQL("ALTER TABLE Timetable ADD COLUMN teacherOld TEXT DEFAULT \"\" NOT NULL") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration9.kt b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration9.kt new file mode 100644 index 00000000..d79a5706 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/db/migrations/Migration9.kt @@ -0,0 +1,30 @@ +package io.github.wulkanowy.data.db.migrations + +import androidx.room.migration.Migration +import androidx.sqlite.db.SupportSQLiteDatabase + +class Migration9 : Migration(8, 9) { + + override fun migrate(database: SupportSQLiteDatabase) { + database.execSQL("DROP TABLE IF EXISTS Messages") + database.execSQL(""" + CREATE TABLE IF NOT EXISTS Messages ( + id INTEGER PRIMARY KEY NOT NULL, + student_id INTEGER NOT NULL, + real_id INTEGER NOT NULL, + message_id INTEGER NOT NULL, + sender_name TEXT NOT NULL, + sender_id INTEGER NOT NULL, + recipient_name TEXT NOT NULL, + subject TEXT NOT NULL, + date INTEGER NOT NULL, + folder_id INTEGER NOT NULL, + unread INTEGER NOT NULL, + unread_by INTEGER NOT NULL, + read_by INTEGER NOT NULL, + removed INTEGER NOT NULL, + is_notified INTEGER NOT NULL, + content TEXT) + """) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/resources/AppResources.java b/app/src/main/java/io/github/wulkanowy/data/db/resources/AppResources.java deleted file mode 100644 index 8e7227d3..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/resources/AppResources.java +++ /dev/null @@ -1,59 +0,0 @@ -package io.github.wulkanowy.data.db.resources; - -import android.content.Context; -import android.content.res.Resources; - -import java.io.IOException; -import java.net.SocketTimeoutException; -import java.net.UnknownHostException; - -import javax.inject.Inject; -import javax.inject.Singleton; - -import io.github.wulkanowy.R; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; -import io.github.wulkanowy.api.login.VulcanOfflineException; -import io.github.wulkanowy.di.annotations.ApplicationContext; -import io.github.wulkanowy.utils.AppConstant; -import io.github.wulkanowy.utils.LogUtils; -import io.github.wulkanowy.utils.security.CryptoException; - -@Singleton -public class AppResources implements ResourcesContract { - - private Resources resources; - - @Inject - AppResources(@ApplicationContext Context context) { - resources = context.getResources(); - } - - @Override - public String[] getSymbolsKeysArray() { - return resources.getStringArray(R.array.symbols); - } - - @Override - public String[] getSymbolsValuesArray() { - return resources.getStringArray(R.array.symbols_values); - } - - @Override - public String getErrorLoginMessage(Exception exception) { - LogUtils.error(AppConstant.APP_NAME + " encountered a error", exception); - - if (exception instanceof CryptoException) { - return resources.getString(R.string.encrypt_failed_text); - } else if (exception instanceof UnknownHostException) { - return resources.getString(R.string.noInternet_text); - } else if (exception instanceof SocketTimeoutException) { - return resources.getString(R.string.generic_timeout_error); - } else if (exception instanceof NotLoggedInErrorException || exception instanceof IOException) { - return resources.getString(R.string.login_denied_text); - } else if (exception instanceof VulcanOfflineException) { - return resources.getString(R.string.error_host_offline); - } else { - return exception.getMessage(); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/resources/ResourcesContract.java b/app/src/main/java/io/github/wulkanowy/data/db/resources/ResourcesContract.java deleted file mode 100644 index 3768ad2c..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/resources/ResourcesContract.java +++ /dev/null @@ -1,10 +0,0 @@ -package io.github.wulkanowy.data.db.resources; - -public interface ResourcesContract { - - String[] getSymbolsKeysArray(); - - String[] getSymbolsValuesArray(); - - String getErrorLoginMessage(Exception e); -} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/shared/SharedPref.java b/app/src/main/java/io/github/wulkanowy/data/db/shared/SharedPref.java deleted file mode 100644 index ba437f88..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/shared/SharedPref.java +++ /dev/null @@ -1,33 +0,0 @@ -package io.github.wulkanowy.data.db.shared; - -import android.content.Context; -import android.content.SharedPreferences; - -import javax.inject.Inject; -import javax.inject.Singleton; - -import io.github.wulkanowy.di.annotations.ApplicationContext; -import io.github.wulkanowy.di.annotations.SharedPreferencesInfo; - -@Singleton -public class SharedPref implements SharedPrefContract { - - private static final String SHARED_KEY_USER_ID = "USER_ID"; - - private final SharedPreferences sharedPreferences; - - @Inject - SharedPref(@ApplicationContext Context context, @SharedPreferencesInfo String sharedName) { - sharedPreferences = context.getSharedPreferences(sharedName, Context.MODE_PRIVATE); - } - - @Override - public long getCurrentUserId() { - return sharedPreferences.getLong(SHARED_KEY_USER_ID, 0); - } - - @Override - public void setCurrentUserId(long userId) { - sharedPreferences.edit().putLong(SHARED_KEY_USER_ID, userId).apply(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/db/shared/SharedPrefContract.java b/app/src/main/java/io/github/wulkanowy/data/db/shared/SharedPrefContract.java deleted file mode 100644 index 7f540acf..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/db/shared/SharedPrefContract.java +++ /dev/null @@ -1,8 +0,0 @@ -package io.github.wulkanowy.data.db.shared; - -public interface SharedPrefContract { - - long getCurrentUserId(); - - void setCurrentUserId(long userId); -} diff --git a/app/src/main/java/io/github/wulkanowy/data/exceptions/NoCurrentStudent.kt b/app/src/main/java/io/github/wulkanowy/data/exceptions/NoCurrentStudent.kt new file mode 100644 index 00000000..58a2396e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/exceptions/NoCurrentStudent.kt @@ -0,0 +1,3 @@ +package io.github.wulkanowy.data.exceptions + +class NoCurrentStudentException : Exception("There no set current student in database") diff --git a/app/src/main/java/io/github/wulkanowy/data/mappers/SemesterMapper.kt b/app/src/main/java/io/github/wulkanowy/data/mappers/SemesterMapper.kt new file mode 100644 index 00000000..acd93a91 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/mappers/SemesterMapper.kt @@ -0,0 +1,19 @@ +package io.github.wulkanowy.data.mappers + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.sdk.pojo.Semester as SdkSemester + +fun List.mapToEntities(studentId: Int) = map { + Semester( + studentId = studentId, + diaryId = it.diaryId, + diaryName = it.diaryName, + schoolYear = it.schoolYear, + semesterId = it.semesterId, + semesterName = it.semesterNumber, + start = it.start, + end = it.end, + classId = it.classId, + unitId = it.unitId + ) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/mappers/StudentMapper.kt b/app/src/main/java/io/github/wulkanowy/data/mappers/StudentMapper.kt new file mode 100644 index 00000000..67f56c62 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/mappers/StudentMapper.kt @@ -0,0 +1,35 @@ +package io.github.wulkanowy.data.mappers + +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import java.time.LocalDateTime +import io.github.wulkanowy.sdk.pojo.Student as SdkStudent + +fun List.mapToEntities(password: String = "") = map { + StudentWithSemesters( + student = Student( + email = it.email, + password = password, + isParent = it.isParent, + symbol = it.symbol, + studentId = it.studentId, + userLoginId = it.userLoginId, + userName = it.userName, + studentName = it.studentName + " " + it.studentSurname, + schoolSymbol = it.schoolSymbol, + schoolShortName = it.schoolShortName, + schoolName = it.schoolName, + className = it.className, + classId = it.classId, + scrapperBaseUrl = it.scrapperBaseUrl, + loginType = it.loginType.name, + isCurrent = false, + registrationDate = LocalDateTime.now(), + mobileBaseUrl = it.mobileBaseUrl, + privateKey = it.privateKey, + certificateKey = it.certificateKey, + loginMode = it.loginMode.name + ), + semesters = it.semesters.mapToEntities(it.studentId) + ) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/pojos/Contributor.kt b/app/src/main/java/io/github/wulkanowy/data/pojos/Contributor.kt new file mode 100644 index 00000000..e792bde4 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/pojos/Contributor.kt @@ -0,0 +1,3 @@ +package io.github.wulkanowy.data.pojos + +class Contributor(val displayName: String, val githubUsername: String) diff --git a/app/src/main/java/io/github/wulkanowy/data/pojos/GradeStatisticsItem.kt b/app/src/main/java/io/github/wulkanowy/data/pojos/GradeStatisticsItem.kt new file mode 100644 index 00000000..34b62abd --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/pojos/GradeStatisticsItem.kt @@ -0,0 +1,14 @@ +package io.github.wulkanowy.data.pojos + +import io.github.wulkanowy.data.db.entities.GradePointsStatistics +import io.github.wulkanowy.data.db.entities.GradeStatistics +import io.github.wulkanowy.ui.modules.grade.statistics.ViewType + +data class GradeStatisticsItem( + + val type: ViewType, + + val partial: List, + + val points: GradePointsStatistics? +) diff --git a/app/src/main/java/io/github/wulkanowy/data/pojos/MobileDeviceToken.kt b/app/src/main/java/io/github/wulkanowy/data/pojos/MobileDeviceToken.kt new file mode 100644 index 00000000..40101821 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/pojos/MobileDeviceToken.kt @@ -0,0 +1,12 @@ +package io.github.wulkanowy.data.pojos + +data class MobileDeviceToken( + + val token: String, + + val symbol: String, + + val pin: String, + + val qr: String +) diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/appcreator/AppCreatorRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/appcreator/AppCreatorRepository.kt new file mode 100644 index 00000000..d1956557 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/appcreator/AppCreatorRepository.kt @@ -0,0 +1,23 @@ +package io.github.wulkanowy.data.repositories.appcreator + +import android.content.res.AssetManager +import com.google.gson.Gson +import io.github.wulkanowy.data.pojos.Contributor +import io.github.wulkanowy.utils.DispatchersProvider +import kotlinx.coroutines.withContext +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class AppCreatorRepository @Inject constructor( + private val assets: AssetManager, + private val dispatchers: DispatchersProvider +) { + + suspend fun getAppCreators() = withContext(dispatchers.backgroundThread) { + Gson().fromJson( + assets.open("contributors.json").bufferedReader().use { it.readText() }, + Array::class.java + ).toList() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/AttendanceLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/AttendanceLocal.kt new file mode 100644 index 00000000..9aaa5230 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/AttendanceLocal.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.repositories.attendance + +import io.github.wulkanowy.data.db.dao.AttendanceDao +import io.github.wulkanowy.data.db.entities.Attendance +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class AttendanceLocal @Inject constructor(private val attendanceDb: AttendanceDao) { + + suspend fun saveAttendance(attendance: List) { + attendanceDb.insertAll(attendance) + } + + suspend fun deleteAttendance(attendance: List) { + attendanceDb.deleteAll(attendance) + } + + fun getAttendance(semester: Semester, startDate: LocalDate, endDate: LocalDate): Flow> { + return attendanceDb.loadAll(semester.diaryId, semester.studentId, startDate, endDate) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/AttendanceRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/AttendanceRemote.kt new file mode 100644 index 00000000..870690ec --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/AttendanceRemote.kt @@ -0,0 +1,50 @@ +package io.github.wulkanowy.data.repositories.attendance + +import io.github.wulkanowy.data.db.entities.Attendance +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.sdk.pojo.Absent +import io.github.wulkanowy.utils.init +import java.time.LocalDate +import java.time.LocalDateTime +import java.time.LocalTime +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class AttendanceRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getAttendance(student: Student, semester: Semester, startDate: LocalDate, endDate: LocalDate): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getAttendance(startDate, endDate, semester.semesterId) + .map { + Attendance( + studentId = semester.studentId, + diaryId = semester.diaryId, + date = it.date, + timeId = it.timeId, + number = it.number, + subject = it.subject, + name = it.name, + presence = it.presence, + absence = it.absence, + exemption = it.exemption, + lateness = it.lateness, + excused = it.excused, + deleted = it.deleted, + excusable = it.excusable, + excuseStatus = it.excuseStatus?.name + ) + } + } + + suspend fun excuseAbsence(student: Student, semester: Semester, absenceList: List, reason: String?): Boolean { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear).excuseForAbsence(absenceList.map { attendance -> + Absent( + date = LocalDateTime.of(attendance.date, LocalTime.of(0, 0)), + timeId = attendance.timeId + ) + }, reason) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/AttendanceRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/AttendanceRepository.kt new file mode 100644 index 00000000..60f864f2 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/AttendanceRepository.kt @@ -0,0 +1,34 @@ +package io.github.wulkanowy.data.repositories.attendance + +import io.github.wulkanowy.data.db.entities.Attendance +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.uniqueSubtract +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class AttendanceRepository @Inject constructor( + private val local: AttendanceLocal, + private val remote: AttendanceRemote +) { + + fun getAttendance(student: Student, semester: Semester, start: LocalDate, end: LocalDate, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getAttendance(semester, start.monday, end.sunday) }, + fetch = { remote.getAttendance(student, semester, start.monday, end.sunday) }, + saveFetchResult = { old, new -> + local.deleteAttendance(old uniqueSubtract new) + local.saveAttendance(new uniqueSubtract old) + }, + filterResult = { it.filter { item -> item.date in start..end } } + ) + + suspend fun excuseForAbsence(student: Student, semester: Semester, attendanceList: List, reason: String? = null) { + remote.excuseAbsence(student, semester, attendanceList, reason) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/SentExcuseStatus.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/SentExcuseStatus.kt new file mode 100644 index 00000000..50d6b8ed --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/attendance/SentExcuseStatus.kt @@ -0,0 +1,7 @@ +package io.github.wulkanowy.data.repositories.attendance + +enum class SentExcuseStatus(val id: Int = 0) { + WAITING, + ACCEPTED, + DENIED +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/attendancesummary/AttendanceSummaryLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/attendancesummary/AttendanceSummaryLocal.kt new file mode 100644 index 00000000..703bc947 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/attendancesummary/AttendanceSummaryLocal.kt @@ -0,0 +1,24 @@ +package io.github.wulkanowy.data.repositories.attendancesummary + +import io.github.wulkanowy.data.db.dao.AttendanceSummaryDao +import io.github.wulkanowy.data.db.entities.AttendanceSummary +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.Flow +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class AttendanceSummaryLocal @Inject constructor(private val attendanceDb: AttendanceSummaryDao) { + + suspend fun saveAttendanceSummary(attendance: List) { + attendanceDb.insertAll(attendance) + } + + suspend fun deleteAttendanceSummary(attendance: List) { + attendanceDb.deleteAll(attendance) + } + + fun getAttendanceSummary(semester: Semester, subjectId: Int): Flow> { + return attendanceDb.loadAll(semester.diaryId, semester.studentId, subjectId) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/attendancesummary/AttendanceSummaryRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/attendancesummary/AttendanceSummaryRemote.kt new file mode 100644 index 00000000..29a0b9a7 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/attendancesummary/AttendanceSummaryRemote.kt @@ -0,0 +1,33 @@ +package io.github.wulkanowy.data.repositories.attendancesummary + +import io.github.wulkanowy.data.db.entities.AttendanceSummary +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class AttendanceSummaryRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getAttendanceSummary(student: Student, semester: Semester, subjectId: Int): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getAttendanceSummary(subjectId) + .map { + AttendanceSummary( + studentId = semester.studentId, + diaryId = semester.diaryId, + subjectId = subjectId, + month = it.month, + presence = it.presence, + absence = it.absence, + absenceExcused = it.absenceExcused, + absenceForSchoolReasons = it.absenceForSchoolReasons, + lateness = it.lateness, + latenessExcused = it.latenessExcused, + exemption = it.exemption + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/attendancesummary/AttendanceSummaryRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/attendancesummary/AttendanceSummaryRepository.kt new file mode 100644 index 00000000..5dbe1ab0 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/attendancesummary/AttendanceSummaryRepository.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.repositories.attendancesummary + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.uniqueSubtract +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class AttendanceSummaryRepository @Inject constructor( + private val local: AttendanceSummaryLocal, + private val remote: AttendanceSummaryRemote +) { + + fun getAttendanceSummary(student: Student, semester: Semester, subjectId: Int, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getAttendanceSummary(semester, subjectId) }, + fetch = { remote.getAttendanceSummary(student, semester, subjectId) }, + saveFetchResult = { old, new -> + local.deleteAttendanceSummary(old uniqueSubtract new) + local.saveAttendanceSummary(new uniqueSubtract old) + } + ) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsLocal.kt new file mode 100644 index 00000000..51a1bdbf --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsLocal.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.repositories.completedlessons + +import io.github.wulkanowy.data.db.dao.CompletedLessonsDao +import io.github.wulkanowy.data.db.entities.CompletedLesson +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class CompletedLessonsLocal @Inject constructor(private val completedLessonsDb: CompletedLessonsDao) { + + suspend fun saveCompletedLessons(completedLessons: List) { + completedLessonsDb.insertAll(completedLessons) + } + + suspend fun deleteCompleteLessons(completedLessons: List) { + completedLessonsDb.deleteAll(completedLessons) + } + + fun getCompletedLessons(semester: Semester, start: LocalDate, end: LocalDate): Flow> { + return completedLessonsDb.loadAll(semester.diaryId, semester.studentId, start, end) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsRemote.kt new file mode 100644 index 00000000..d15a2762 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsRemote.kt @@ -0,0 +1,35 @@ +package io.github.wulkanowy.data.repositories.completedlessons + +import io.github.wulkanowy.data.db.entities.CompletedLesson +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class CompletedLessonsRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getCompletedLessons(student: Student, semester: Semester, startDate: LocalDate, endDate: LocalDate): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getCompletedLessons(startDate, endDate) + .map { + it.absence + CompletedLesson( + studentId = semester.studentId, + diaryId = semester.diaryId, + date = it.date, + number = it.number, + subject = it.subject, + topic = it.topic, + teacher = it.teacher, + teacherSymbol = it.teacherSymbol, + substitution = it.substitution, + absence = it.absence, + resources = it.resources + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsRepository.kt new file mode 100644 index 00000000..61268a66 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/completedlessons/CompletedLessonsRepository.kt @@ -0,0 +1,29 @@ +package io.github.wulkanowy.data.repositories.completedlessons + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.uniqueSubtract +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class CompletedLessonsRepository @Inject constructor( + private val local: CompletedLessonsLocal, + private val remote: CompletedLessonsRemote +) { + + fun getCompletedLessons(student: Student, semester: Semester, start: LocalDate, end: LocalDate, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getCompletedLessons(semester, start.monday, end.sunday) }, + fetch = { remote.getCompletedLessons(student, semester, start.monday, end.sunday) }, + saveFetchResult = { old, new -> + local.deleteCompleteLessons(old uniqueSubtract new) + local.saveCompletedLessons(new uniqueSubtract old) + }, + filterResult = { it.filter { item -> item.date in start..end } } + ) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/exam/ExamLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/exam/ExamLocal.kt new file mode 100644 index 00000000..acc55b5e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/exam/ExamLocal.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.repositories.exam + +import io.github.wulkanowy.data.db.dao.ExamDao +import io.github.wulkanowy.data.db.entities.Exam +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class ExamLocal @Inject constructor(private val examDb: ExamDao) { + + fun getExams(semester: Semester, startDate: LocalDate, endDate: LocalDate): Flow> { + return examDb.loadAll(semester.diaryId, semester.studentId, startDate, endDate) + } + + suspend fun saveExams(exams: List) { + examDb.insertAll(exams) + } + + suspend fun deleteExams(exams: List) { + examDb.deleteAll(exams) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/exam/ExamRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/exam/ExamRemote.kt new file mode 100644 index 00000000..ac4aa93d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/exam/ExamRemote.kt @@ -0,0 +1,33 @@ +package io.github.wulkanowy.data.repositories.exam + +import io.github.wulkanowy.data.db.entities.Exam +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class ExamRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getExams(student: Student, semester: Semester, startDate: LocalDate, endDate: LocalDate): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getExams(startDate, endDate, semester.semesterId) + .map { + Exam( + studentId = semester.studentId, + diaryId = semester.diaryId, + date = it.date, + entryDate = it.entryDate, + subject = it.subject, + group = it.group, + type = it.type, + description = it.description, + teacher = it.teacher, + teacherSymbol = it.teacherSymbol + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/exam/ExamRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/exam/ExamRepository.kt new file mode 100644 index 00000000..e7f115ac --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/exam/ExamRepository.kt @@ -0,0 +1,29 @@ +package io.github.wulkanowy.data.repositories.exam + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.uniqueSubtract +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class ExamRepository @Inject constructor( + private val local: ExamLocal, + private val remote: ExamRemote +) { + + fun getExams(student: Student, semester: Semester, start: LocalDate, end: LocalDate, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getExams(semester, start.monday, end.sunday) }, + fetch = { remote.getExams(student, semester, start.monday, end.sunday) }, + saveFetchResult = { old, new -> + local.deleteExams(old uniqueSubtract new) + local.saveExams(new uniqueSubtract old) + }, + filterResult = { it.filter { item -> item.date in start..end } } + ) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/grade/GradeLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/grade/GradeLocal.kt new file mode 100644 index 00000000..ed363542 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/grade/GradeLocal.kt @@ -0,0 +1,49 @@ +package io.github.wulkanowy.data.repositories.grade + +import io.github.wulkanowy.data.db.dao.GradeDao +import io.github.wulkanowy.data.db.dao.GradeSummaryDao +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.data.db.entities.GradeSummary +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.Flow +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class GradeLocal @Inject constructor( + private val gradeDb: GradeDao, + private val gradeSummaryDb: GradeSummaryDao +) { + + suspend fun saveGrades(grades: List) { + gradeDb.insertAll(grades) + } + + suspend fun deleteGrades(grades: List) { + gradeDb.deleteAll(grades) + } + + suspend fun updateGrades(grades: List) { + gradeDb.updateAll(grades) + } + + suspend fun updateGradesSummary(gradesSummary: List) { + gradeSummaryDb.updateAll(gradesSummary) + } + + fun getGradesDetails(semester: Semester): Flow> { + return gradeDb.loadAll(semester.semesterId, semester.studentId) + } + + suspend fun saveGradesSummary(gradesSummary: List) { + gradeSummaryDb.insertAll(gradesSummary) + } + + suspend fun deleteGradesSummary(gradesSummary: List) { + gradeSummaryDb.deleteAll(gradesSummary) + } + + fun getGradesSummary(semester: Semester): Flow> { + return gradeSummaryDb.loadAll(semester.semesterId, semester.studentId) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/grade/GradeRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/grade/GradeRemote.kt new file mode 100644 index 00000000..9534a891 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/grade/GradeRemote.kt @@ -0,0 +1,53 @@ +package io.github.wulkanowy.data.repositories.grade + +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.data.db.entities.GradeSummary +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class GradeRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getGrades(student: Student, semester: Semester): Pair, List> { + val (details, summary) = sdk + .init(student) + .switchDiary(semester.diaryId, semester.schoolYear) + .getGrades(semester.semesterId) + + return details.map { + Grade( + studentId = semester.studentId, + semesterId = semester.semesterId, + subject = it.subject, + entry = it.entry, + value = it.value, + modifier = it.modifier, + comment = it.comment, + color = it.color, + gradeSymbol = it.symbol, + description = it.description, + weight = it.weight, + weightValue = it.weightValue, + date = it.date, + teacher = it.teacher + ) + } to summary.map { + GradeSummary( + semesterId = semester.semesterId, + studentId = semester.studentId, + position = 0, + subject = it.name, + predictedGrade = it.predicted, + finalGrade = it.final, + pointsSum = it.pointsSum, + proposedPoints = it.proposedPoints, + finalPoints = it.finalPoints, + average = it.average + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/grade/GradeRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/grade/GradeRepository.kt new file mode 100644 index 00000000..8cbbfdfb --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/grade/GradeRepository.kt @@ -0,0 +1,98 @@ +package io.github.wulkanowy.data.repositories.grade + +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.data.db.entities.GradeSummary +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.uniqueSubtract +import kotlinx.coroutines.flow.Flow +import kotlinx.coroutines.flow.combine +import kotlinx.coroutines.flow.map +import java.time.LocalDateTime +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class GradeRepository @Inject constructor( + private val local: GradeLocal, + private val remote: GradeRemote +) { + + fun getGrades(student: Student, semester: Semester, forceRefresh: Boolean, notify: Boolean = false) = networkBoundResource( + shouldFetch = { (details, summaries) -> details.isEmpty() || summaries.isEmpty() || forceRefresh }, + query = { local.getGradesDetails(semester).combine(local.getGradesSummary(semester)) { details, summaries -> details to summaries } }, + fetch = { remote.getGrades(student, semester) }, + saveFetchResult = { old, new -> + refreshGradeDetails(student, old.first, new.first, notify) + refreshGradeSummaries(old.second, new.second, notify) + } + ) + + private suspend fun refreshGradeDetails(student: Student, oldGrades: List, newDetails: List, notify: Boolean) { + val notifyBreakDate = oldGrades.maxByOrNull { it.date }?.date ?: student.registrationDate.toLocalDate() + local.deleteGrades(oldGrades uniqueSubtract newDetails) + local.saveGrades((newDetails uniqueSubtract oldGrades).onEach { + if (it.date >= notifyBreakDate) it.apply { + isRead = false + if (notify) isNotified = false + } + }) + } + + private suspend fun refreshGradeSummaries(oldSummaries: List, newSummary: List, notify: Boolean) { + local.deleteGradesSummary(oldSummaries uniqueSubtract newSummary) + local.saveGradesSummary((newSummary uniqueSubtract oldSummaries).onEach { summary -> + val oldSummary = oldSummaries.find { oldSummary -> oldSummary.subject == summary.subject } + summary.isPredictedGradeNotified = when { + summary.predictedGrade.isEmpty() -> true + notify && oldSummary?.predictedGrade != summary.predictedGrade -> false + else -> true + } + summary.isFinalGradeNotified = when { + summary.finalGrade.isEmpty() -> true + notify && oldSummary?.finalGrade != summary.finalGrade -> false + else -> true + } + + summary.predictedGradeLastChange = when { + oldSummary == null -> LocalDateTime.now() + summary.predictedGrade != oldSummary.predictedGrade -> LocalDateTime.now() + else -> oldSummary.predictedGradeLastChange + } + summary.finalGradeLastChange = when { + oldSummary == null -> LocalDateTime.now() + summary.finalGrade != oldSummary.finalGrade -> LocalDateTime.now() + else -> oldSummary.finalGradeLastChange + } + }) + } + + fun getUnreadGrades(semester: Semester): Flow> { + return local.getGradesDetails(semester).map { it.filter { grade -> !grade.isRead } } + } + + fun getNotNotifiedGrades(semester: Semester): Flow> { + return local.getGradesDetails(semester).map { it.filter { grade -> !grade.isNotified } } + } + + fun getNotNotifiedPredictedGrades(semester: Semester): Flow> { + return local.getGradesSummary(semester).map { it.filter { gradeSummary -> !gradeSummary.isPredictedGradeNotified } } + } + + fun getNotNotifiedFinalGrades(semester: Semester): Flow> { + return local.getGradesSummary(semester).map { it.filter { gradeSummary -> !gradeSummary.isFinalGradeNotified } } + } + + suspend fun updateGrade(grade: Grade) { + return local.updateGrades(listOf(grade)) + } + + suspend fun updateGrades(grades: List) { + return local.updateGrades(grades) + } + + suspend fun updateGradesSummary(gradesSummary: List) { + return local.updateGradesSummary(gradesSummary) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsLocal.kt new file mode 100644 index 00000000..e0e2cd4d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsLocal.kt @@ -0,0 +1,41 @@ +package io.github.wulkanowy.data.repositories.gradestatistics + +import io.github.wulkanowy.data.db.dao.GradePointsStatisticsDao +import io.github.wulkanowy.data.db.dao.GradeStatisticsDao +import io.github.wulkanowy.data.db.entities.GradePointsStatistics +import io.github.wulkanowy.data.db.entities.GradeStatistics +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.Flow +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class GradeStatisticsLocal @Inject constructor( + private val gradeStatisticsDb: GradeStatisticsDao, + private val gradePointsStatisticsDb: GradePointsStatisticsDao +) { + + fun getGradesStatistics(semester: Semester, isSemester: Boolean): Flow> { + return gradeStatisticsDb.loadAll(semester.semesterId, semester.studentId, isSemester) + } + + fun getGradesPointsStatistics(semester: Semester): Flow> { + return gradePointsStatisticsDb.loadAll(semester.semesterId, semester.studentId) + } + + suspend fun saveGradesStatistics(gradesStatistics: List) { + gradeStatisticsDb.insertAll(gradesStatistics) + } + + suspend fun saveGradesPointsStatistics(gradePointsStatistics: List) { + gradePointsStatisticsDb.insertAll(gradePointsStatistics) + } + + suspend fun deleteGradesStatistics(gradesStatistics: List) { + gradeStatisticsDb.deleteAll(gradesStatistics) + } + + suspend fun deleteGradesPointsStatistics(gradesPointsStatistics: List) { + gradePointsStatisticsDb.deleteAll(gradesPointsStatistics) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsRemote.kt new file mode 100644 index 00000000..1ff8132f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsRemote.kt @@ -0,0 +1,44 @@ +package io.github.wulkanowy.data.repositories.gradestatistics + +import io.github.wulkanowy.data.db.entities.GradePointsStatistics +import io.github.wulkanowy.data.db.entities.GradeStatistics +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class GradeStatisticsRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getGradeStatistics(student: Student, semester: Semester, isSemester: Boolean): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear).let { + if (isSemester) it.getGradesAnnualStatistics(semester.semesterId) + else it.getGradesPartialStatistics(semester.semesterId) + }.map { + GradeStatistics( + semesterId = semester.semesterId, + studentId = semester.studentId, + subject = it.subject, + grade = it.gradeValue, + amount = it.amount, + semester = isSemester + ) + } + } + + suspend fun getGradePointsStatistics(student: Student, semester: Semester): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getGradesPointsStatistics(semester.semesterId) + .map { + GradePointsStatistics( + semesterId = semester.semesterId, + studentId = semester.studentId, + subject = it.subject, + others = it.others, + student = it.student + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsRepository.kt new file mode 100644 index 00000000..52ca705f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/gradestatistics/GradeStatisticsRepository.kt @@ -0,0 +1,72 @@ +package io.github.wulkanowy.data.repositories.gradestatistics + +import io.github.wulkanowy.data.db.entities.GradePointsStatistics +import io.github.wulkanowy.data.db.entities.GradeStatistics +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.pojos.GradeStatisticsItem +import io.github.wulkanowy.ui.modules.grade.statistics.ViewType +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.uniqueSubtract +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class GradeStatisticsRepository @Inject constructor( + private val local: GradeStatisticsLocal, + private val remote: GradeStatisticsRemote +) { + + fun getGradesStatistics(student: Student, semester: Semester, subjectName: String, isSemester: Boolean, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getGradesStatistics(semester, isSemester) }, + fetch = { remote.getGradeStatistics(student, semester, isSemester) }, + saveFetchResult = { old, new -> + local.deleteGradesStatistics(old uniqueSubtract new) + local.saveGradesStatistics(new uniqueSubtract old) + }, + mapResult = { items -> + when (subjectName) { + "Wszystkie" -> items.groupBy { it.grade }.map { + GradeStatistics(semester.studentId, semester.semesterId, subjectName, it.key, + it.value.fold(0) { acc, e -> acc + e.amount }, false) + } + items + else -> items.filter { it.subject == subjectName } + }.mapToStatisticItems() + } + ) + + fun getGradesPointsStatistics(student: Student, semester: Semester, subjectName: String, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getGradesPointsStatistics(semester) }, + fetch = { remote.getGradePointsStatistics(student, semester) }, + saveFetchResult = { old, new -> + local.deleteGradesPointsStatistics(old uniqueSubtract new) + local.saveGradesPointsStatistics(new uniqueSubtract old) + }, + mapResult = { items -> + when (subjectName) { + "Wszystkie" -> items + else -> items.filter { it.subject == subjectName } + }.mapToStatisticsItem() + } + ) + + private fun List.mapToStatisticItems() = groupBy { it.subject }.map { + GradeStatisticsItem( + type = ViewType.PARTIAL, + partial = it.value + .sortedByDescending { item -> item.grade } + .filter { item -> item.amount != 0 }, + points = null + ) + } + + private fun List.mapToStatisticsItem() = map { + GradeStatisticsItem( + type = ViewType.POINTS, + partial = emptyList(), + points = it + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/homework/HomeworkLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/homework/HomeworkLocal.kt new file mode 100644 index 00000000..f2cbb803 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/homework/HomeworkLocal.kt @@ -0,0 +1,29 @@ +package io.github.wulkanowy.data.repositories.homework + +import io.github.wulkanowy.data.db.dao.HomeworkDao +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class HomeworkLocal @Inject constructor(private val homeworkDb: HomeworkDao) { + + suspend fun saveHomework(homework: List) { + homeworkDb.insertAll(homework) + } + + suspend fun deleteHomework(homework: List) { + homeworkDb.deleteAll(homework) + } + + suspend fun updateHomework(homework: List) { + homeworkDb.updateAll(homework) + } + + fun getHomework(semester: Semester, startDate: LocalDate, endDate: LocalDate): Flow> { + return homeworkDb.loadAll(semester.semesterId, semester.studentId, startDate, endDate) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/homework/HomeworkRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/homework/HomeworkRemote.kt new file mode 100644 index 00000000..32109877 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/homework/HomeworkRemote.kt @@ -0,0 +1,32 @@ +package io.github.wulkanowy.data.repositories.homework + +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class HomeworkRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getHomework(student: Student, semester: Semester, startDate: LocalDate, endDate: LocalDate): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getHomework(startDate, endDate) + .map { + Homework( + semesterId = semester.semesterId, + studentId = semester.studentId, + date = it.date, + entryDate = it.entryDate, + subject = it.subject, + content = it.content, + teacher = it.teacher, + teacherSymbol = it.teacherSymbol, + attachments = it.attachments.map { attachment -> attachment.url to attachment.name } + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/homework/HomeworkRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/homework/HomeworkRepository.kt new file mode 100644 index 00000000..54397ea0 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/homework/HomeworkRepository.kt @@ -0,0 +1,35 @@ +package io.github.wulkanowy.data.repositories.homework + +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.uniqueSubtract +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class HomeworkRepository @Inject constructor( + private val local: HomeworkLocal, + private val remote: HomeworkRemote +) { + + fun getHomework(student: Student, semester: Semester, start: LocalDate, end: LocalDate, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getHomework(semester, start.monday, end.sunday) }, + fetch = { remote.getHomework(student, semester, start.monday, end.sunday) }, + saveFetchResult = { old, new -> + local.deleteHomework(old uniqueSubtract new) + local.saveHomework(new uniqueSubtract old) + } + ) + + suspend fun toggleDone(homework: Homework) { + local.updateHomework(listOf(homework.apply { + isDone = !isDone + })) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/logger/LoggerRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/logger/LoggerRepository.kt new file mode 100644 index 00000000..85168fee --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/logger/LoggerRepository.kt @@ -0,0 +1,38 @@ +package io.github.wulkanowy.data.repositories.logger + +import android.content.Context +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.utils.DispatchersProvider +import kotlinx.coroutines.withContext +import java.io.File +import java.io.FileNotFoundException +import javax.inject.Inject + +class LoggerRepository @Inject constructor( + @ApplicationContext private val context: Context, + private val dispatchers: DispatchersProvider +) { + + suspend fun getLastLogLines() = getLastModified().readText().split("\n") + + suspend fun getLogFiles() = withContext(dispatchers.backgroundThread) { + File(context.filesDir.absolutePath).listFiles(File::isFile)?.filter { + it.name.endsWith(".log") + }!! + } + + private suspend fun getLastModified(): File { + return withContext(dispatchers.backgroundThread) { + var lastModifiedTime = Long.MIN_VALUE + var chosenFile: File? = null + File(context.filesDir.absolutePath).listFiles(File::isFile)?.forEach { file -> + if (file.lastModified() > lastModifiedTime) { + lastModifiedTime = file.lastModified() + chosenFile = file + } + } + if (chosenFile == null) throw FileNotFoundException("Log file not found") + chosenFile!! + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberLocal.kt new file mode 100644 index 00000000..0c3156d1 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberLocal.kt @@ -0,0 +1,29 @@ +package io.github.wulkanowy.data.repositories.luckynumber + +import io.github.wulkanowy.data.db.dao.LuckyNumberDao +import io.github.wulkanowy.data.db.entities.LuckyNumber +import io.github.wulkanowy.data.db.entities.Student +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class LuckyNumberLocal @Inject constructor(private val luckyNumberDb: LuckyNumberDao) { + + suspend fun saveLuckyNumber(luckyNumber: LuckyNumber?) { + luckyNumberDb.insertAll(listOfNotNull(luckyNumber)) + } + + suspend fun updateLuckyNumber(luckyNumber: LuckyNumber?) { + luckyNumberDb.updateAll(listOfNotNull(luckyNumber)) + } + + suspend fun deleteLuckyNumber(luckyNumber: LuckyNumber?) { + luckyNumberDb.deleteAll(listOfNotNull(luckyNumber)) + } + + fun getLuckyNumber(student: Student, date: LocalDate): Flow { + return luckyNumberDb.load(student.studentId, date) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberRemote.kt new file mode 100644 index 00000000..2872957d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberRemote.kt @@ -0,0 +1,23 @@ +package io.github.wulkanowy.data.repositories.luckynumber + +import io.github.wulkanowy.data.db.entities.LuckyNumber +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class LuckyNumberRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getLuckyNumber(student: Student): LuckyNumber? { + return sdk.init(student).getLuckyNumber(student.schoolShortName)?.let { + LuckyNumber( + studentId = student.studentId, + date = LocalDate.now(), + luckyNumber = it + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberRepository.kt new file mode 100644 index 00000000..173ce7e4 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/luckynumber/LuckyNumberRepository.kt @@ -0,0 +1,36 @@ +package io.github.wulkanowy.data.repositories.luckynumber + +import io.github.wulkanowy.data.db.entities.LuckyNumber +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.networkBoundResource +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.flow.map +import java.time.LocalDate.now +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class LuckyNumberRepository @Inject constructor( + private val local: LuckyNumberLocal, + private val remote: LuckyNumberRemote +) { + + fun getLuckyNumber(student: Student, forceRefresh: Boolean, notify: Boolean = false) = networkBoundResource( + shouldFetch = { it == null || forceRefresh }, + query = { local.getLuckyNumber(student, now()) }, + fetch = { remote.getLuckyNumber(student) }, + saveFetchResult = { old, new -> + if (new != old) { + old?.let { local.deleteLuckyNumber(it) } + local.saveLuckyNumber(new?.apply { + if (notify) isNotified = false + }) + } + } + ) + + suspend fun getNotNotifiedLuckyNumber(student: Student) = + local.getLuckyNumber(student, now()).map { if (it?.isNotified == false) it else null }.first() + + suspend fun updateLuckyNumber(luckyNumber: LuckyNumber?) = local.updateLuckyNumber(luckyNumber) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageFolder.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageFolder.kt new file mode 100644 index 00000000..06f5a1e0 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageFolder.kt @@ -0,0 +1,7 @@ +package io.github.wulkanowy.data.repositories.message + +enum class MessageFolder(val id: Int = 1) { + RECEIVED(1), + SENT(2), + TRASHED(3) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageLocal.kt new file mode 100644 index 00000000..730bd005 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageLocal.kt @@ -0,0 +1,43 @@ +package io.github.wulkanowy.data.repositories.message + +import io.github.wulkanowy.data.db.dao.MessageAttachmentDao +import io.github.wulkanowy.data.db.dao.MessagesDao +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.MessageAttachment +import io.github.wulkanowy.data.db.entities.MessageWithAttachment +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.message.MessageFolder.TRASHED +import kotlinx.coroutines.flow.Flow +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class MessageLocal @Inject constructor( + private val messagesDb: MessagesDao, + private val messageAttachmentDao: MessageAttachmentDao +) { + + suspend fun saveMessages(messages: List) { + messagesDb.insertAll(messages) + } + + suspend fun updateMessages(messages: List) { + messagesDb.updateAll(messages) + } + + suspend fun deleteMessages(messages: List) { + messagesDb.deleteAll(messages) + } + + fun getMessageWithAttachment(student: Student, message: Message): Flow { + return messagesDb.loadMessageWithAttachment(student.id.toInt(), message.messageId) + } + + suspend fun saveMessageAttachments(attachments: List) { + messageAttachmentDao.insertAttachments(attachments) + } + + fun getMessages(student: Student, folder: MessageFolder): Flow> { + return messagesDb.loadAll(student.id.toInt(), folder.id) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageRemote.kt new file mode 100644 index 00000000..fdf0c675 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageRemote.kt @@ -0,0 +1,78 @@ +package io.github.wulkanowy.data.repositories.message + +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.MessageAttachment +import io.github.wulkanowy.data.db.entities.Recipient +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.sdk.pojo.Folder +import io.github.wulkanowy.sdk.pojo.SentMessage +import io.github.wulkanowy.utils.init +import java.time.LocalDateTime.now +import javax.inject.Inject +import javax.inject.Singleton +import io.github.wulkanowy.sdk.pojo.Recipient as SdkRecipient + +@Singleton +class MessageRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getMessages(student: Student, semester: Semester, folder: MessageFolder): List { + return sdk.init(student).getMessages(Folder.valueOf(folder.name), now().minusMonths(3), now()).map { + Message( + studentId = student.id.toInt(), + realId = it.id ?: 0, + messageId = it.messageId ?: 0, + sender = it.sender?.name.orEmpty(), + senderId = it.sender?.loginId ?: 0, + recipient = it.recipients.singleOrNull()?.name ?: "Wielu adresatów", + subject = it.subject.trim(), + date = it.date ?: now(), + folderId = it.folderId, + unread = it.unread ?: false, + unreadBy = it.unreadBy ?: 0, + readBy = it.readBy ?: 0, + removed = it.removed, + hasAttachments = it.hasAttachments + ).apply { + content = it.content.orEmpty() + } + } + } + + suspend fun getMessagesContentDetails(student: Student, message: Message, markAsRead: Boolean = false): Pair> { + return sdk.init(student).getMessageDetails(message.messageId, message.folderId, markAsRead, message.realId).let { details -> + details.content to details.attachments.map { + MessageAttachment( + realId = it.id, + messageId = it.messageId, + oneDriveId = it.oneDriveId, + url = it.url, + filename = it.filename + ) + } + } + } + + suspend fun sendMessage(student: Student, subject: String, content: String, recipients: List): SentMessage { + return sdk.init(student).sendMessage( + subject = subject, + content = content, + recipients = recipients.map { + SdkRecipient( + id = it.realId, + name = it.realName, + loginId = it.loginId, + reportingUnitId = it.unitId, + role = it.role, + hash = it.hash, + shortName = it.name + ) + } + ) + } + + suspend fun deleteMessage(student: Student, message: Message): Boolean { + return sdk.init(student).deleteMessages(listOf(message.messageId), message.folderId) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageRepository.kt new file mode 100644 index 00000000..f653f268 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/message/MessageRepository.kt @@ -0,0 +1,74 @@ +package io.github.wulkanowy.data.repositories.message + +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.Recipient +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.message.MessageFolder.RECEIVED +import io.github.wulkanowy.sdk.pojo.SentMessage +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.uniqueSubtract +import kotlinx.coroutines.flow.Flow +import kotlinx.coroutines.flow.map +import timber.log.Timber +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class MessageRepository @Inject constructor( + private val local: MessageLocal, + private val remote: MessageRemote +) { + + fun getMessages(student: Student, semester: Semester, folder: MessageFolder, forceRefresh: Boolean, notify: Boolean = false) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getMessages(student, folder) }, + fetch = { remote.getMessages(student, semester, folder) }, + saveFetchResult = { old, new -> + local.deleteMessages(old uniqueSubtract new) + local.saveMessages((new uniqueSubtract old).onEach { + it.isNotified = !notify + }) + } + ) + + fun getMessage(student: Student, message: Message, markAsRead: Boolean = false) = networkBoundResource( + shouldFetch = { + Timber.d("Message content in db empty: ${it.message.content.isEmpty()}") + it.message.unread || it.message.content.isEmpty() + }, + query = { local.getMessageWithAttachment(student, message) }, + fetch = { remote.getMessagesContentDetails(student, it.message, markAsRead) }, + saveFetchResult = { old, (downloadedMessage, attachments) -> + local.updateMessages(listOf(old.message.copy(unread = !markAsRead).apply { + id = old.message.id + content = content.ifBlank { downloadedMessage } + })) + local.saveMessageAttachments(attachments) + Timber.d("Message ${message.messageId} with blank content: ${old.message.content.isBlank()}, marked as read") + } + ) + + fun getNotNotifiedMessages(student: Student): Flow> { + return local.getMessages(student, RECEIVED).map { it.filter { message -> !message.isNotified && message.unread } } + } + + suspend fun updateMessages(messages: List) { + return local.updateMessages(messages) + } + + suspend fun sendMessage(student: Student, subject: String, content: String, recipients: List): SentMessage { + return remote.sendMessage(student, subject, content, recipients) + } + + suspend fun deleteMessage(student: Student, message: Message) { + val isDeleted = remote.deleteMessage(student, message) + + if (message.folderId != MessageFolder.TRASHED.id) { + if (isDeleted) local.updateMessages(listOf(message.copy(folderId = MessageFolder.TRASHED.id).apply { + id = message.id + content = message.content + })) + } else local.deleteMessages(listOf(message)) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/mobiledevice/MobileDeviceLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/mobiledevice/MobileDeviceLocal.kt new file mode 100644 index 00000000..0ccb3d7e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/mobiledevice/MobileDeviceLocal.kt @@ -0,0 +1,24 @@ +package io.github.wulkanowy.data.repositories.mobiledevice + +import io.github.wulkanowy.data.db.dao.MobileDeviceDao +import io.github.wulkanowy.data.db.entities.MobileDevice +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.Flow +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class MobileDeviceLocal @Inject constructor(private val mobileDb: MobileDeviceDao) { + + suspend fun saveDevices(devices: List) { + mobileDb.insertAll(devices) + } + + suspend fun deleteDevices(devices: List) { + mobileDb.deleteAll(devices) + } + + fun getDevices(semester: Semester): Flow> { + return mobileDb.loadAll(semester.studentId) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/mobiledevice/MobileDeviceRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/mobiledevice/MobileDeviceRemote.kt new file mode 100644 index 00000000..907e965c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/mobiledevice/MobileDeviceRemote.kt @@ -0,0 +1,45 @@ +package io.github.wulkanowy.data.repositories.mobiledevice + +import io.github.wulkanowy.data.db.entities.MobileDevice +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.pojos.MobileDeviceToken +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class MobileDeviceRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getDevices(student: Student, semester: Semester): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getRegisteredDevices() + .map { + MobileDevice( + studentId = semester.studentId, + date = it.createDate, + deviceId = it.id, + name = it.name + ) + } + } + + suspend fun unregisterDevice(student: Student, semester: Semester, device: MobileDevice): Boolean { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .unregisterDevice(device.deviceId) + } + + suspend fun getToken(student: Student, semester: Semester): MobileDeviceToken { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getToken() + .let { + MobileDeviceToken( + token = it.token, + symbol = it.symbol, + pin = it.pin, + qr = it.qrCodeImage + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/mobiledevice/MobileDeviceRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/mobiledevice/MobileDeviceRepository.kt new file mode 100644 index 00000000..65526ef8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/mobiledevice/MobileDeviceRepository.kt @@ -0,0 +1,36 @@ +package io.github.wulkanowy.data.repositories.mobiledevice + +import io.github.wulkanowy.data.db.entities.MobileDevice +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.pojos.MobileDeviceToken +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.uniqueSubtract +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class MobileDeviceRepository @Inject constructor( + private val local: MobileDeviceLocal, + private val remote: MobileDeviceRemote +) { + + fun getDevices(student: Student, semester: Semester, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getDevices(semester) }, + fetch = { remote.getDevices(student, semester) }, + saveFetchResult = { old, new -> + local.deleteDevices(old uniqueSubtract new) + local.saveDevices(new uniqueSubtract old) + } + ) + + suspend fun unregisterDevice(student: Student, semester: Semester, device: MobileDevice) { + remote.unregisterDevice(student, semester, device) + local.deleteDevices(listOf(device)) + } + + suspend fun getToken(student: Student, semester: Semester): MobileDeviceToken { + return remote.getToken(student, semester) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/note/NoteLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/note/NoteLocal.kt new file mode 100644 index 00000000..85ba5e22 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/note/NoteLocal.kt @@ -0,0 +1,28 @@ +package io.github.wulkanowy.data.repositories.note + +import io.github.wulkanowy.data.db.dao.NoteDao +import io.github.wulkanowy.data.db.entities.Note +import io.github.wulkanowy.data.db.entities.Student +import kotlinx.coroutines.flow.Flow +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class NoteLocal @Inject constructor(private val noteDb: NoteDao) { + + suspend fun saveNotes(notes: List) { + noteDb.insertAll(notes) + } + + suspend fun updateNotes(notes: List) { + noteDb.updateAll(notes) + } + + suspend fun deleteNotes(notes: List) { + noteDb.deleteAll(notes) + } + + fun getNotes(student: Student): Flow> { + return noteDb.loadAll(student.studentId) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/note/NoteRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/note/NoteRemote.kt new file mode 100644 index 00000000..0e488b7d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/note/NoteRemote.kt @@ -0,0 +1,31 @@ +package io.github.wulkanowy.data.repositories.note + +import io.github.wulkanowy.data.db.entities.Note +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class NoteRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getNotes(student: Student, semester: Semester): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getNotes(semester.semesterId) + .map { + Note( + studentId = semester.studentId, + date = it.date, + teacher = it.teacher, + teacherSymbol = it.teacherSymbol, + category = it.category, + categoryType = it.categoryType.id, + isPointsShow = it.showPoints, + points = it.points, + content = it.content + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/note/NoteRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/note/NoteRepository.kt new file mode 100644 index 00000000..6cf62ba2 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/note/NoteRepository.kt @@ -0,0 +1,45 @@ +package io.github.wulkanowy.data.repositories.note + +import io.github.wulkanowy.data.db.entities.Note +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.uniqueSubtract +import kotlinx.coroutines.flow.Flow +import kotlinx.coroutines.flow.map +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class NoteRepository @Inject constructor( + private val local: NoteLocal, + private val remote: NoteRemote +) { + + fun getNotes(student: Student, semester: Semester, forceRefresh: Boolean, notify: Boolean = false) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getNotes(student) }, + fetch = { remote.getNotes(student, semester) }, + saveFetchResult = { old, new -> + local.deleteNotes(old uniqueSubtract new) + local.saveNotes((new uniqueSubtract old).onEach { + if (it.date >= student.registrationDate.toLocalDate()) it.apply { + isRead = false + if (notify) isNotified = false + } + }) + } + ) + + fun getNotNotifiedNotes(student: Student): Flow> { + return local.getNotes(student).map { it.filter { note -> !note.isNotified } } + } + + suspend fun updateNote(note: Note) { + local.updateNotes(listOf(note)) + } + + suspend fun updateNotes(notes: List) { + return local.updateNotes(notes) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/preferences/PreferencesRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/preferences/PreferencesRepository.kt new file mode 100644 index 00000000..1d5e57f8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/preferences/PreferencesRepository.kt @@ -0,0 +1,90 @@ +package io.github.wulkanowy.data.repositories.preferences + +import android.content.Context +import android.content.SharedPreferences +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import io.github.wulkanowy.ui.modules.grade.GradeAverageMode +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class PreferencesRepository @Inject constructor( + private val sharedPref: SharedPreferences, + @ApplicationContext val context: Context +) { + val startMenuIndex: Int + get() = getString(R.string.pref_key_start_menu, R.string.pref_default_startup).toInt() + + val isShowPresent: Boolean + get() = getBoolean(R.string.pref_key_attendance_present, R.bool.pref_default_attendance_present) + + val gradeAverageMode: GradeAverageMode + get() = GradeAverageMode.getByValue(getString(R.string.pref_key_grade_average_mode, R.string.pref_default_grade_average_mode)) + + val gradeAverageForceCalc: Boolean + get() = getBoolean(R.string.pref_key_grade_average_force_calc, R.bool.pref_default_grade_average_force_calc) + + val isGradeExpandable: Boolean + get() = !getBoolean(R.string.pref_key_expand_grade, R.bool.pref_default_expand_grade) + + val showAllSubjectsOnStatisticsList: Boolean + get() = getBoolean(R.string.pref_key_grade_statistics_list, R.bool.pref_default_grade_statistics_list) + + val appThemeKey = context.getString(R.string.pref_key_app_theme) + val appTheme: String + get() = getString(appThemeKey, R.string.pref_default_app_theme) + + val gradeColorTheme: String + get() = getString(R.string.pref_key_grade_color_scheme, R.string.pref_default_grade_color_scheme) + + val appLanguageKey = context.getString(R.string.pref_key_app_language) + val appLanguage + get() = getString(appLanguageKey, R.string.pref_default_app_language) + + val serviceEnableKey = context.getString(R.string.pref_key_services_enable) + val isServiceEnabled: Boolean + get() = getBoolean(serviceEnableKey, R.bool.pref_default_services_enable) + + val servicesIntervalKey = context.getString(R.string.pref_key_services_interval) + val servicesInterval: Long + get() = getString(servicesIntervalKey, R.string.pref_default_services_interval).toLong() + + val servicesOnlyWifiKey = context.getString(R.string.pref_key_services_wifi_only) + val isServicesOnlyWifi: Boolean + get() = getBoolean(servicesOnlyWifiKey, R.bool.pref_default_services_wifi_only) + + val isNotificationsEnable: Boolean + get() = getBoolean(R.string.pref_key_notifications_enable, R.bool.pref_default_notifications_enable) + + val isUpcomingLessonsNotificationsEnableKey = context.getString(R.string.pref_key_notifications_upcoming_lessons_enable) + val isUpcomingLessonsNotificationsEnable: Boolean + get() = getBoolean(isUpcomingLessonsNotificationsEnableKey, R.bool.pref_default_notification_upcoming_lessons_enable) + + val isDebugNotificationEnableKey = context.getString(R.string.pref_key_notification_debug) + val isDebugNotificationEnable: Boolean + get() = getBoolean(isDebugNotificationEnableKey, R.bool.pref_default_notification_debug) + + val gradePlusModifier: Double + get() = getString(R.string.pref_key_grade_modifier_plus, R.string.pref_default_grade_modifier_plus).toDouble() + + val gradeMinusModifier: Double + get() = getString(R.string.pref_key_grade_modifier_minus, R.string.pref_default_grade_modifier_minus).toDouble() + + val fillMessageContent: Boolean + get() = getBoolean(R.string.pref_key_fill_message_content, R.bool.pref_default_fill_message_content) + + val showWholeClassPlan: String + get() = getString(R.string.pref_key_timetable_show_whole_class, R.string.pref_default_timetable_show_whole_class) + + val showTimetableTimers: Boolean + get() = getBoolean(R.string.pref_key_timetable_show_timers, R.bool.pref_default_timetable_show_timers) + + private fun getString(id: Int, default: Int) = getString(context.getString(id), default) + + private fun getString(id: String, default: Int) = sharedPref.getString(id, context.getString(default)) ?: context.getString(default) + + private fun getBoolean(id: Int, default: Int) = getBoolean(context.getString(id), default) + + private fun getBoolean(id: String, default: Int) = sharedPref.getBoolean(id, context.resources.getBoolean(default)) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/recipient/RecipientLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/recipient/RecipientLocal.kt new file mode 100644 index 00000000..fac1645e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/recipient/RecipientLocal.kt @@ -0,0 +1,24 @@ +package io.github.wulkanowy.data.repositories.recipient + +import io.github.wulkanowy.data.db.dao.RecipientDao +import io.github.wulkanowy.data.db.entities.Recipient +import io.github.wulkanowy.data.db.entities.ReportingUnit +import io.github.wulkanowy.data.db.entities.Student +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class RecipientLocal @Inject constructor(private val recipientDb: RecipientDao) { + + suspend fun getRecipients(student: Student, role: Int, unit: ReportingUnit): List { + return recipientDb.load(student.studentId, role, unit.realId) + } + + suspend fun saveRecipients(recipients: List): List { + return recipientDb.insertAll(recipients) + } + + suspend fun deleteRecipients(recipients: List) { + recipientDb.deleteAll(recipients) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/recipient/RecipientRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/recipient/RecipientRemote.kt new file mode 100644 index 00000000..a5318e77 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/recipient/RecipientRemote.kt @@ -0,0 +1,38 @@ +package io.github.wulkanowy.data.repositories.recipient + +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.Recipient +import io.github.wulkanowy.data.db.entities.ReportingUnit +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject +import javax.inject.Singleton +import io.github.wulkanowy.sdk.pojo.Recipient as SdkRecipient + +@Singleton +class RecipientRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getRecipients(student: Student, role: Int, unit: ReportingUnit): List { + return sdk.init(student).getRecipients(unit.realId, role) + .map { it.toRecipient() } + } + + suspend fun getMessageRecipients(student: Student, message: Message): List { + return sdk.init(student).getMessageRecipients(message.messageId, message.senderId) + .map { it.toRecipient() } + } + + private fun SdkRecipient.toRecipient(): Recipient { + return Recipient( + studentId = sdk.studentId, + realId = id, + realName = name, + name = shortName, + hash = hash, + loginId = loginId, + role = role, + unitId = reportingUnitId ?: 0 + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/recipient/RecipientRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/recipient/RecipientRepository.kt new file mode 100644 index 00000000..f5e876b0 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/recipient/RecipientRepository.kt @@ -0,0 +1,36 @@ +package io.github.wulkanowy.data.repositories.recipient + +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.Recipient +import io.github.wulkanowy.data.db.entities.ReportingUnit +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.uniqueSubtract +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class RecipientRepository @Inject constructor( + private val local: RecipientLocal, + private val remote: RecipientRemote +) { + + suspend fun refreshRecipients(student: Student, role: Int, unit: ReportingUnit) { + val new = remote.getRecipients(student, role, unit) + val old = local.getRecipients(student, role, unit) + + local.deleteRecipients(old uniqueSubtract new) + local.saveRecipients(new uniqueSubtract old) + } + + suspend fun getRecipients(student: Student, role: Int, unit: ReportingUnit): List { + return local.getRecipients(student, role, unit).ifEmpty { + refreshRecipients(student, role, unit) + + local.getRecipients(student, role, unit) + } + } + + suspend fun getMessageRecipients(student: Student, message: Message): List { + return remote.getMessageRecipients(student, message) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/recover/RecoverRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/recover/RecoverRemote.kt new file mode 100644 index 00000000..11eac71e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/recover/RecoverRemote.kt @@ -0,0 +1,18 @@ +package io.github.wulkanowy.data.repositories.recover + +import io.github.wulkanowy.sdk.Sdk +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class RecoverRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getReCaptchaSiteKey(host: String, symbol: String): Pair { + return sdk.getPasswordResetCaptchaCode(host, symbol) + } + + suspend fun sendRecoverRequest(url: String, symbol: String, email: String, reCaptchaResponse: String): String { + return sdk.sendPasswordResetRequest(url, symbol, email, reCaptchaResponse) + } +} + diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/recover/RecoverRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/recover/RecoverRepository.kt new file mode 100644 index 00000000..3117a606 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/recover/RecoverRepository.kt @@ -0,0 +1,16 @@ +package io.github.wulkanowy.data.repositories.recover + +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class RecoverRepository @Inject constructor(private val remote: RecoverRemote) { + + suspend fun getReCaptchaSiteKey(host: String, symbol: String): Pair { + return remote.getReCaptchaSiteKey(host, symbol) + } + + suspend fun sendRecoverRequest(url: String, symbol: String, email: String, reCaptchaResponse: String): String { + return remote.sendRecoverRequest(url, symbol, email, reCaptchaResponse) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/reportingunit/ReportingUnitLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/reportingunit/ReportingUnitLocal.kt new file mode 100644 index 00000000..737f1a04 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/reportingunit/ReportingUnitLocal.kt @@ -0,0 +1,27 @@ +package io.github.wulkanowy.data.repositories.reportingunit + +import io.github.wulkanowy.data.db.dao.ReportingUnitDao +import io.github.wulkanowy.data.db.entities.ReportingUnit +import io.github.wulkanowy.data.db.entities.Student +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class ReportingUnitLocal @Inject constructor(private val reportingUnitDb: ReportingUnitDao) { + + suspend fun getReportingUnits(student: Student): List { + return reportingUnitDb.load(student.studentId) + } + + suspend fun getReportingUnit(student: Student, unitId: Int): ReportingUnit? { + return reportingUnitDb.loadOne(student.studentId, unitId) + } + + suspend fun saveReportingUnits(reportingUnits: List): List { + return reportingUnitDb.insertAll(reportingUnits) + } + + suspend fun deleteReportingUnits(reportingUnits: List) { + reportingUnitDb.deleteAll(reportingUnits) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/reportingunit/ReportingUnitRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/reportingunit/ReportingUnitRemote.kt new file mode 100644 index 00000000..6b11c2cc --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/reportingunit/ReportingUnitRemote.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.repositories.reportingunit + +import io.github.wulkanowy.data.db.entities.ReportingUnit +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class ReportingUnitRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getReportingUnits(student: Student): List { + return sdk.init(student).getReportingUnits().map { unit -> + ReportingUnit( + studentId = sdk.studentId, + realId = unit.id, + roles = unit.roles, + senderId = unit.senderId, + senderName = unit.senderName, + shortName = unit.short + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/reportingunit/ReportingUnitRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/reportingunit/ReportingUnitRepository.kt new file mode 100644 index 00000000..ff583946 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/reportingunit/ReportingUnitRepository.kt @@ -0,0 +1,38 @@ +package io.github.wulkanowy.data.repositories.reportingunit + +import io.github.wulkanowy.data.db.entities.ReportingUnit +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.uniqueSubtract +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class ReportingUnitRepository @Inject constructor( + private val local: ReportingUnitLocal, + private val remote: ReportingUnitRemote +) { + + suspend fun refreshReportingUnits(student: Student) { + val new = remote.getReportingUnits(student) + val old = local.getReportingUnits(student) + + local.deleteReportingUnits(old.uniqueSubtract(new)) + local.saveReportingUnits(new.uniqueSubtract(old)) + } + + suspend fun getReportingUnits(student: Student): List { + return local.getReportingUnits(student).ifEmpty { + refreshReportingUnits(student) + + local.getReportingUnits(student) + } + } + + suspend fun getReportingUnit(student: Student, unitId: Int): ReportingUnit? { + return local.getReportingUnit(student, unitId) ?: run { + refreshReportingUnits(student) + + return local.getReportingUnit(student, unitId) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/school/SchoolLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/school/SchoolLocal.kt new file mode 100644 index 00000000..bc1b2f44 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/school/SchoolLocal.kt @@ -0,0 +1,22 @@ +package io.github.wulkanowy.data.repositories.school + +import io.github.wulkanowy.data.db.dao.SchoolDao +import io.github.wulkanowy.data.db.entities.School +import io.github.wulkanowy.data.db.entities.Semester +import kotlinx.coroutines.flow.Flow +import javax.inject.Inject + +class SchoolLocal @Inject constructor(private val schoolDb: SchoolDao) { + + suspend fun saveSchool(school: School) { + schoolDb.insertAll(listOf(school)) + } + + suspend fun deleteSchool(school: School) { + schoolDb.deleteAll(listOf(school)) + } + + fun getSchool(semester: Semester): Flow { + return schoolDb.load(semester.studentId, semester.classId) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/school/SchoolRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/school/SchoolRemote.kt new file mode 100644 index 00000000..4d2e0cd6 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/school/SchoolRemote.kt @@ -0,0 +1,27 @@ +package io.github.wulkanowy.data.repositories.school + +import io.github.wulkanowy.data.db.entities.School +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject + +class SchoolRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getSchoolInfo(student: Student, semester: Semester): School { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getSchool() + .let { + School( + studentId = semester.studentId, + classId = semester.classId, + name = it.name, + address = it.address, + contact = it.contact, + headmaster = it.headmaster, + pedagogue = it.pedagogue + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/school/SchoolRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/school/SchoolRepository.kt new file mode 100644 index 00000000..4c84c319 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/school/SchoolRepository.kt @@ -0,0 +1,27 @@ +package io.github.wulkanowy.data.repositories.school + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.networkBoundResource +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class SchoolRepository @Inject constructor( + private val local: SchoolLocal, + private val remote: SchoolRemote +) { + + fun getSchoolInfo(student: Student, semester: Semester, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it == null || forceRefresh }, + query = { local.getSchool(semester) }, + fetch = { remote.getSchoolInfo(student, semester) }, + saveFetchResult = { old, new -> + if (new != old && old != null) { + local.deleteSchool(old) + local.saveSchool(new) + } + local.saveSchool(new) + } + ) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/semester/SemesterLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/semester/SemesterLocal.kt new file mode 100644 index 00000000..8ecf1595 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/semester/SemesterLocal.kt @@ -0,0 +1,23 @@ +package io.github.wulkanowy.data.repositories.semester + +import io.github.wulkanowy.data.db.dao.SemesterDao +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class SemesterLocal @Inject constructor(private val semesterDb: SemesterDao) { + + suspend fun saveSemesters(semesters: List) { + semesterDb.insertSemesters(semesters) + } + + suspend fun deleteSemesters(semesters: List) { + semesterDb.deleteAll(semesters) + } + + suspend fun getSemesters(student: Student): List { + return semesterDb.loadAll(student.studentId, student.classId) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/semester/SemesterRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/semester/SemesterRemote.kt new file mode 100644 index 00000000..e1a920b6 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/semester/SemesterRemote.kt @@ -0,0 +1,29 @@ +package io.github.wulkanowy.data.repositories.semester + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class SemesterRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getSemesters(student: Student): List { + return sdk.init(student).getSemesters().map { + Semester( + studentId = student.studentId, + diaryId = it.diaryId, + diaryName = it.diaryName, + schoolYear = it.schoolYear, + semesterId = it.semesterId, + semesterName = it.semesterNumber, + start = it.start, + end = it.end, + classId = it.classId, + unitId = it.unitId + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/semester/SemesterRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/semester/SemesterRepository.kt new file mode 100644 index 00000000..7a76503f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/semester/SemesterRepository.kt @@ -0,0 +1,54 @@ +package io.github.wulkanowy.data.repositories.semester + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.DispatchersProvider +import io.github.wulkanowy.utils.getCurrentOrLast +import io.github.wulkanowy.utils.isCurrent +import io.github.wulkanowy.utils.uniqueSubtract +import kotlinx.coroutines.withContext +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class SemesterRepository @Inject constructor( + private val remote: SemesterRemote, + private val local: SemesterLocal, + private val dispatchers: DispatchersProvider +) { + + suspend fun getSemesters(student: Student, forceRefresh: Boolean = false, refreshOnNoCurrent: Boolean = false) = withContext(dispatchers.backgroundThread) { + val semesters = local.getSemesters(student) + + if (isShouldFetch(student, semesters, forceRefresh, refreshOnNoCurrent)) { + refreshSemesters(student) + local.getSemesters(student) + } else semesters + } + + private fun isShouldFetch(student: Student, semesters: List, forceRefresh: Boolean, refreshOnNoCurrent: Boolean): Boolean { + val isNoSemesters = semesters.isEmpty() + + val isRefreshOnModeChangeRequired = if (Sdk.Mode.valueOf(student.loginMode) != Sdk.Mode.API) { + semesters.firstOrNull { it.isCurrent }?.diaryId == 0 + } else false + + val isRefreshOnNoCurrentAppropriate = refreshOnNoCurrent && !semesters.any { semester -> semester.isCurrent } + + return forceRefresh || isNoSemesters || isRefreshOnModeChangeRequired || isRefreshOnNoCurrentAppropriate + } + + private suspend fun refreshSemesters(student: Student) { + val new = remote.getSemesters(student) + if (new.isEmpty()) throw IllegalArgumentException("Empty semester list!") + + val old = local.getSemesters(student) + local.deleteSemesters(old.uniqueSubtract(new)) + local.saveSemesters(new.uniqueSubtract(old)) + } + + suspend fun getCurrentSemester(student: Student, forceRefresh: Boolean = false) = withContext(dispatchers.backgroundThread) { + getSemesters(student, forceRefresh).getCurrentOrLast() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/student/StudentLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/student/StudentLocal.kt new file mode 100644 index 00000000..c01d1d04 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/student/StudentLocal.kt @@ -0,0 +1,59 @@ +package io.github.wulkanowy.data.repositories.student + +import android.content.Context +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.data.db.dao.StudentDao +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.DispatchersProvider +import io.github.wulkanowy.utils.security.decrypt +import io.github.wulkanowy.utils.security.encrypt +import kotlinx.coroutines.withContext +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class StudentLocal @Inject constructor( + private val studentDb: StudentDao, + private val dispatchers: DispatchersProvider, + @ApplicationContext private val context: Context +) { + + suspend fun saveStudents(students: List) = withContext(dispatchers.backgroundThread) { + studentDb.insertAll(students.map { + if (Sdk.Mode.valueOf(it.loginMode) != Sdk.Mode.API) it.copy(password = encrypt(it.password, context)) + else it + }) + } + + suspend fun getStudents(decryptPass: Boolean) = withContext(dispatchers.backgroundThread) { + studentDb.loadStudentsWithSemesters().map { + it.apply { + if (decryptPass && Sdk.Mode.valueOf(student.loginMode) != Sdk.Mode.API) student.password = decrypt(student.password) + } + } + } + + suspend fun getStudentById(id: Int) = withContext(dispatchers.backgroundThread) { + studentDb.loadById(id)?.apply { + if (Sdk.Mode.valueOf(loginMode) != Sdk.Mode.API) password = decrypt(password) + } + } + + suspend fun getCurrentStudent(decryptPass: Boolean) = withContext(dispatchers.backgroundThread) { + studentDb.loadCurrent()?.apply { + if (decryptPass && Sdk.Mode.valueOf(loginMode) != Sdk.Mode.API) password = decrypt(password) + } + } + + suspend fun setCurrentStudent(student: Student) = withContext(dispatchers.backgroundThread) { + studentDb.run { + resetCurrent() + updateCurrent(student.id) + } + } + + suspend fun logoutStudent(student: Student) = withContext(dispatchers.backgroundThread) { + studentDb.delete(student) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/student/StudentRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/student/StudentRemote.kt new file mode 100644 index 00000000..dcb12623 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/student/StudentRemote.kt @@ -0,0 +1,23 @@ +package io.github.wulkanowy.data.repositories.student + +import io.github.wulkanowy.data.mappers.mapToEntities +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.sdk.Sdk +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class StudentRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getStudentsMobileApi(token: String, pin: String, symbol: String): List { + return sdk.getStudentsFromMobileApi(token, pin, symbol, "").mapToEntities() + } + + suspend fun getStudentsScrapper(email: String, password: String, scrapperBaseUrl: String, symbol: String): List { + return sdk.getStudentsFromScrapper(email, password, scrapperBaseUrl, symbol).mapToEntities(password) + } + + suspend fun getStudentsHybrid(email: String, password: String, scrapperBaseUrl: String, symbol: String): List { + return sdk.getStudentsHybrid(email, password, scrapperBaseUrl, "", symbol).mapToEntities(password) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/student/StudentRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/student/StudentRepository.kt new file mode 100644 index 00000000..19e0e208 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/student/StudentRepository.kt @@ -0,0 +1,57 @@ +package io.github.wulkanowy.data.repositories.student + +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.exceptions.NoCurrentStudentException +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.data.repositories.semester.SemesterLocal +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class StudentRepository @Inject constructor( + private val local: StudentLocal, + private val semestersLocal: SemesterLocal, + private val remote: StudentRemote +) { + + suspend fun isStudentSaved(): Boolean = local.getStudents(false).isNotEmpty() + + suspend fun isCurrentStudentSet(): Boolean = local.getCurrentStudent(false)?.isCurrent ?: false + + suspend fun getStudentsApi(pin: String, symbol: String, token: String): List { + return remote.getStudentsMobileApi(token, pin, symbol) + } + + suspend fun getStudentsScrapper(email: String, password: String, endpoint: String, symbol: String): List { + return remote.getStudentsScrapper(email, password, endpoint, symbol) + } + + suspend fun getStudentsHybrid(email: String, password: String, endpoint: String, symbol: String): List { + return remote.getStudentsHybrid(email, password, endpoint, symbol) + } + + suspend fun getSavedStudents(decryptPass: Boolean = true): List { + return local.getStudents(decryptPass) + } + + suspend fun getStudentById(id: Int): Student { + return local.getStudentById(id) ?: throw NoCurrentStudentException() + } + + suspend fun getCurrentStudent(decryptPass: Boolean = true): Student { + return local.getCurrentStudent(decryptPass) ?: throw NoCurrentStudentException() + } + + suspend fun saveStudents(studentsWithSemesters: List): List { + semestersLocal.saveSemesters(studentsWithSemesters.flatMap { it.semesters }) + return local.saveStudents(studentsWithSemesters.map { it.student }) + } + + suspend fun switchStudent(studentWithSemesters: StudentWithSemesters) { + return local.setCurrentStudent(studentWithSemesters.student) + } + + suspend fun logoutStudent(student: Student) { + return local.logoutStudent(student) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/subject/SubjectLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/subject/SubjectLocal.kt new file mode 100644 index 00000000..e225a381 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/subject/SubjectLocal.kt @@ -0,0 +1,24 @@ +package io.github.wulkanowy.data.repositories.subject + +import io.github.wulkanowy.data.db.dao.SubjectDao +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Subject +import kotlinx.coroutines.flow.Flow +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class SubjectLocal @Inject constructor(private val subjectDao: SubjectDao) { + + fun getSubjects(semester: Semester): Flow> { + return subjectDao.loadAll(semester.diaryId, semester.studentId) + } + + suspend fun saveSubjects(subjects: List) { + subjectDao.insertAll(subjects) + } + + suspend fun deleteSubjects(subjects: List) { + subjectDao.deleteAll(subjects) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/subject/SubjectRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/subject/SubjectRemote.kt new file mode 100644 index 00000000..624a5a00 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/subject/SubjectRemote.kt @@ -0,0 +1,26 @@ +package io.github.wulkanowy.data.repositories.subject + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.db.entities.Subject +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class SubjectRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getSubjects(student: Student, semester: Semester): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getSubjects() + .map { + Subject( + studentId = semester.studentId, + diaryId = semester.diaryId, + name = it.name, + realId = it.id + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/subject/SubjectRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/subject/SubjectRepository.kt new file mode 100644 index 00000000..60a0c3e7 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/subject/SubjectRepository.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.repositories.subject + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.uniqueSubtract +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class SubjectRepository @Inject constructor( + private val local: SubjectLocal, + private val remote: SubjectRemote +) { + + fun getSubjects(student: Student, semester: Semester, forceRefresh: Boolean = false) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getSubjects(semester) }, + fetch = { remote.getSubjects(student, semester) }, + saveFetchResult = { old, new -> + local.deleteSubjects(old uniqueSubtract new) + local.saveSubjects(new uniqueSubtract old) + } + ) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/teacher/TeacherLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/teacher/TeacherLocal.kt new file mode 100644 index 00000000..908f45a1 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/teacher/TeacherLocal.kt @@ -0,0 +1,22 @@ +package io.github.wulkanowy.data.repositories.teacher + +import io.github.wulkanowy.data.db.dao.TeacherDao +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Teacher +import kotlinx.coroutines.flow.Flow +import javax.inject.Inject + +class TeacherLocal @Inject constructor(private val teacherDb: TeacherDao) { + + suspend fun saveTeachers(teachers: List) { + teacherDb.insertAll(teachers) + } + + suspend fun deleteTeachers(teachers: List) { + teacherDb.deleteAll(teachers) + } + + fun getTeachers(semester: Semester): Flow> { + return teacherDb.loadAll(semester.studentId, semester.classId) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/teacher/TeacherRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/teacher/TeacherRemote.kt new file mode 100644 index 00000000..1d1caa68 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/teacher/TeacherRemote.kt @@ -0,0 +1,27 @@ +package io.github.wulkanowy.data.repositories.teacher + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.db.entities.Teacher +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class TeacherRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getTeachers(student: Student, semester: Semester): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getTeachers(semester.semesterId) + .map { + Teacher( + studentId = semester.studentId, + name = it.name, + subject = it.subject, + shortName = it.short, + classId = semester.classId + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/teacher/TeacherRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/teacher/TeacherRepository.kt new file mode 100644 index 00000000..df25a53e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/teacher/TeacherRepository.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.repositories.teacher + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.uniqueSubtract +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class TeacherRepository @Inject constructor( + private val local: TeacherLocal, + private val remote: TeacherRemote +) { + + fun getTeachers(student: Student, semester: Semester, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getTeachers(semester) }, + fetch = { remote.getTeachers(student, semester) }, + saveFetchResult = { old, new -> + local.deleteTeachers(old uniqueSubtract new) + local.saveTeachers(new uniqueSubtract old) + } + ) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/timetable/TimetableLocal.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/timetable/TimetableLocal.kt new file mode 100644 index 00000000..df4bfb20 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/timetable/TimetableLocal.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.data.repositories.timetable + +import io.github.wulkanowy.data.db.dao.TimetableDao +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Timetable +import kotlinx.coroutines.flow.Flow +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class TimetableLocal @Inject constructor(private val timetableDb: TimetableDao) { + + suspend fun saveTimetable(timetables: List) { + timetableDb.insertAll(timetables) + } + + suspend fun deleteTimetable(timetables: List) { + timetableDb.deleteAll(timetables) + } + + fun getTimetable(semester: Semester, startDate: LocalDate, endDate: LocalDate): Flow> { + return timetableDb.loadAll(semester.diaryId, semester.studentId, startDate, endDate) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/timetable/TimetableRemote.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/timetable/TimetableRemote.kt new file mode 100644 index 00000000..eef8729e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/timetable/TimetableRemote.kt @@ -0,0 +1,40 @@ +package io.github.wulkanowy.data.repositories.timetable + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.db.entities.Timetable +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.init +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class TimetableRemote @Inject constructor(private val sdk: Sdk) { + + suspend fun getTimetable(student: Student, semester: Semester, startDate: LocalDate, endDate: LocalDate): List { + return sdk.init(student).switchDiary(semester.diaryId, semester.schoolYear) + .getTimetable(startDate, endDate) + .map { + Timetable( + studentId = semester.studentId, + diaryId = semester.diaryId, + number = it.number, + start = it.start, + end = it.end, + date = it.date, + subject = it.subject, + subjectOld = it.subjectOld, + group = it.group, + room = it.room, + roomOld = it.roomOld, + teacher = it.teacher, + teacherOld = it.teacherOld, + info = it.info, + isStudentPlan = it.studentPlan, + changes = it.changes, + canceled = it.canceled + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/data/repositories/timetable/TimetableRepository.kt b/app/src/main/java/io/github/wulkanowy/data/repositories/timetable/TimetableRepository.kt new file mode 100644 index 00000000..ee2734aa --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/data/repositories/timetable/TimetableRepository.kt @@ -0,0 +1,41 @@ +package io.github.wulkanowy.data.repositories.timetable + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.services.alarm.TimetableNotificationSchedulerHelper +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.networkBoundResource +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.uniqueSubtract +import kotlinx.coroutines.flow.map +import java.time.LocalDate +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class TimetableRepository @Inject constructor( + private val local: TimetableLocal, + private val remote: TimetableRemote, + private val schedulerHelper: TimetableNotificationSchedulerHelper +) { + + fun getTimetable(student: Student, semester: Semester, start: LocalDate, end: LocalDate, forceRefresh: Boolean) = networkBoundResource( + shouldFetch = { it.isEmpty() || forceRefresh }, + query = { local.getTimetable(semester, start.monday, end.sunday).map { schedulerHelper.scheduleNotifications(it, student); it } }, + fetch = { remote.getTimetable(student, semester, start.monday, end.sunday) }, + saveFetchResult = { old, new -> + local.deleteTimetable(old.uniqueSubtract(new).also { schedulerHelper.cancelScheduled(it) }) + local.saveTimetable(new.uniqueSubtract(old).also { schedulerHelper.scheduleNotifications(it, student) }.map { item -> + item.also { new -> + old.singleOrNull { new.start == it.start }?.let { old -> + return@map new.copy( + room = if (new.room.isEmpty()) old.room else new.room, + teacher = if (new.teacher.isEmpty() && !new.changes && !old.changes) old.teacher else new.teacher + ) + } + } + }) + }, + filterResult = { it.filter { item -> item.date in start..end } } + ) +} diff --git a/app/src/main/java/io/github/wulkanowy/data/sync/SyncContract.java b/app/src/main/java/io/github/wulkanowy/data/sync/SyncContract.java deleted file mode 100644 index 43b37b7e..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/sync/SyncContract.java +++ /dev/null @@ -1,11 +0,0 @@ -package io.github.wulkanowy.data.sync; - -import java.io.IOException; -import java.text.ParseException; - -import io.github.wulkanowy.api.login.NotLoggedInErrorException; - -public interface SyncContract { - - void sync() throws NotLoggedInErrorException, IOException, ParseException; -} diff --git a/app/src/main/java/io/github/wulkanowy/data/sync/grades/GradeSync.java b/app/src/main/java/io/github/wulkanowy/data/sync/grades/GradeSync.java deleted file mode 100644 index e0b38884..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/sync/grades/GradeSync.java +++ /dev/null @@ -1,72 +0,0 @@ -package io.github.wulkanowy.data.sync.grades; - -import java.io.IOException; -import java.text.ParseException; -import java.util.ArrayList; -import java.util.List; - -import javax.inject.Inject; -import javax.inject.Singleton; - -import io.github.wulkanowy.api.Vulcan; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; -import io.github.wulkanowy.data.db.dao.entities.Account; -import io.github.wulkanowy.data.db.dao.entities.DaoSession; -import io.github.wulkanowy.data.db.dao.entities.Grade; -import io.github.wulkanowy.data.db.dao.entities.SubjectDao; -import io.github.wulkanowy.data.db.shared.SharedPrefContract; -import io.github.wulkanowy.data.sync.SyncContract; -import io.github.wulkanowy.utils.DataObjectConverter; -import io.github.wulkanowy.utils.EntitiesCompare; -import io.github.wulkanowy.utils.LogUtils; - -@Singleton -public class GradeSync implements SyncContract { - - private final DaoSession daoSession; - - private final Vulcan vulcan; - - private final SharedPrefContract sharedPref; - - @Inject - GradeSync(DaoSession daoSession, SharedPrefContract sharedPref, Vulcan vulcan) { - this.daoSession = daoSession; - this.sharedPref = sharedPref; - this.vulcan = vulcan; - } - - @Override - public void sync() throws IOException, NotLoggedInErrorException, ParseException { - - long userId = sharedPref.getCurrentUserId(); - - Account account = daoSession.getAccountDao().load(userId); - account.resetGradeList(); - account.resetSubjectList(); - - List gradesFromNet = DataObjectConverter - .gradesToGradeEntities(vulcan.getGradesList().getAll()); - List gradesFromDb = account.getGradeList(); - - List updatedGrades = EntitiesCompare.compareGradeList(gradesFromNet, gradesFromDb); - - daoSession.getGradeDao().deleteInTx(gradesFromDb); - - List lastList = new ArrayList<>(); - - for (Grade grade : updatedGrades) { - grade.setUserId(userId); - grade.setSubjectId(daoSession.getSubjectDao().queryBuilder() - .where(SubjectDao.Properties.Name.eq(grade.getSubject()), - SubjectDao.Properties.UserId.eq(userId)) - .build() - .uniqueOrThrow().getId()); - lastList.add(grade); - } - - daoSession.getGradeDao().insertInTx(lastList); - - LogUtils.debug("Synchronization grades (amount = " + lastList.size() + ")"); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/sync/login/LoginSync.java b/app/src/main/java/io/github/wulkanowy/data/sync/login/LoginSync.java deleted file mode 100644 index 71838ff5..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/sync/login/LoginSync.java +++ /dev/null @@ -1,81 +0,0 @@ -package io.github.wulkanowy.data.sync.login; - -import android.content.Context; - -import java.io.IOException; - -import javax.inject.Inject; -import javax.inject.Singleton; - -import io.github.wulkanowy.api.Vulcan; -import io.github.wulkanowy.api.login.AccountPermissionException; -import io.github.wulkanowy.api.login.BadCredentialsException; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; -import io.github.wulkanowy.api.login.VulcanOfflineException; -import io.github.wulkanowy.data.db.dao.entities.Account; -import io.github.wulkanowy.data.db.dao.entities.DaoSession; -import io.github.wulkanowy.data.db.shared.SharedPrefContract; -import io.github.wulkanowy.di.annotations.ApplicationContext; -import io.github.wulkanowy.utils.LogUtils; -import io.github.wulkanowy.utils.security.CryptoException; -import io.github.wulkanowy.utils.security.Scrambler; - -@Singleton -public class LoginSync implements LoginSyncContract { - - private final DaoSession daoSession; - - private final SharedPrefContract sharedPref; - - private final Vulcan vulcan; - - private final Context context; - - @Inject - LoginSync(DaoSession daoSession, SharedPrefContract sharedPref, - Vulcan vulcan, @ApplicationContext Context context) { - this.daoSession = daoSession; - this.sharedPref = sharedPref; - this.vulcan = vulcan; - this.context = context; - } - - @Override - public void loginUser(String email, String password, String symbol) - throws NotLoggedInErrorException, AccountPermissionException, IOException, - CryptoException, VulcanOfflineException, BadCredentialsException { - - LogUtils.debug("Login new user email=" + email); - - vulcan.login(email, password, symbol); - - Account account = new Account() - .setName(vulcan.getBasicInformation().getPersonalData().getFirstAndLastName()) - .setEmail(email) - .setPassword(Scrambler.encrypt(email, password, context)) - .setSymbol(vulcan.getSymbol()) - .setSnpId(vulcan.getStudentAndParent().getId()); - - sharedPref.setCurrentUserId(daoSession.getAccountDao().insert(account)); - } - - @Override - public void loginCurrentUser() throws NotLoggedInErrorException, AccountPermissionException, - IOException, CryptoException, VulcanOfflineException, BadCredentialsException { - - long userId = sharedPref.getCurrentUserId(); - - if (userId == 0) { - throw new IOException("Can't find logged user"); - } - - LogUtils.debug("Login current user id=" + userId); - - Account account = daoSession.getAccountDao().load(userId); - - vulcan.login(account.getEmail(), - Scrambler.decrypt(account.getEmail(), account.getPassword()), - account.getSymbol(), - account.getSnpId()); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/sync/login/LoginSyncContract.java b/app/src/main/java/io/github/wulkanowy/data/sync/login/LoginSyncContract.java deleted file mode 100644 index 1aed8b1b..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/sync/login/LoginSyncContract.java +++ /dev/null @@ -1,19 +0,0 @@ -package io.github.wulkanowy.data.sync.login; - -import java.io.IOException; - -import io.github.wulkanowy.api.login.AccountPermissionException; -import io.github.wulkanowy.api.login.BadCredentialsException; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; -import io.github.wulkanowy.api.login.VulcanOfflineException; -import io.github.wulkanowy.utils.security.CryptoException; - -public interface LoginSyncContract { - - void loginUser(String email, String password, String symbol) - throws NotLoggedInErrorException, AccountPermissionException, IOException, - CryptoException, VulcanOfflineException, BadCredentialsException; - - void loginCurrentUser() throws NotLoggedInErrorException, AccountPermissionException, IOException, - CryptoException, VulcanOfflineException, BadCredentialsException; -} diff --git a/app/src/main/java/io/github/wulkanowy/data/sync/subjects/SubjectSync.java b/app/src/main/java/io/github/wulkanowy/data/sync/subjects/SubjectSync.java deleted file mode 100644 index d888090b..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/sync/subjects/SubjectSync.java +++ /dev/null @@ -1,61 +0,0 @@ -package io.github.wulkanowy.data.sync.subjects; - -import java.io.IOException; -import java.text.ParseException; -import java.util.ArrayList; -import java.util.List; - -import javax.inject.Inject; -import javax.inject.Singleton; - -import io.github.wulkanowy.api.Vulcan; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; -import io.github.wulkanowy.data.db.dao.entities.DaoSession; -import io.github.wulkanowy.data.db.dao.entities.Subject; -import io.github.wulkanowy.data.db.dao.entities.SubjectDao; -import io.github.wulkanowy.data.db.shared.SharedPrefContract; -import io.github.wulkanowy.data.sync.SyncContract; -import io.github.wulkanowy.utils.DataObjectConverter; -import io.github.wulkanowy.utils.LogUtils; - -@Singleton -public class SubjectSync implements SyncContract { - - private final SubjectDao subjectDao; - - private final Vulcan vulcan; - - private final SharedPrefContract sharedPref; - - @Inject - SubjectSync(DaoSession daoSession, SharedPrefContract sharedPref, Vulcan vulcan) { - this.subjectDao = daoSession.getSubjectDao(); - this.sharedPref = sharedPref; - this.vulcan = vulcan; - } - - @Override - public void sync() throws NotLoggedInErrorException, IOException, ParseException { - - long userId = sharedPref.getCurrentUserId(); - - List subjectsFromNet = DataObjectConverter - .subjectsToSubjectEntities(vulcan.getSubjectsList().getAll()); - - subjectDao.deleteInTx(subjectDao.queryBuilder() - .where(SubjectDao.Properties.UserId.eq(userId)) - .build() - .list()); - - List lastList = new ArrayList<>(); - - for (Subject subject : subjectsFromNet) { - subject.setUserId(userId); - lastList.add(subject); - } - - subjectDao.insertInTx(lastList); - - LogUtils.debug("Synchronization subjects (amount = " + lastList.size() + ")"); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/sync/timetable/TimetableSync.java b/app/src/main/java/io/github/wulkanowy/data/sync/timetable/TimetableSync.java deleted file mode 100644 index dcb048f1..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/sync/timetable/TimetableSync.java +++ /dev/null @@ -1,120 +0,0 @@ -package io.github.wulkanowy.data.sync.timetable; - -import java.io.IOException; -import java.text.ParseException; -import java.util.ArrayList; -import java.util.List; - -import javax.inject.Inject; -import javax.inject.Singleton; - -import io.github.wulkanowy.api.Vulcan; -import io.github.wulkanowy.api.login.NotLoggedInErrorException; -import io.github.wulkanowy.data.db.dao.entities.DaoSession; -import io.github.wulkanowy.data.db.dao.entities.Day; -import io.github.wulkanowy.data.db.dao.entities.DayDao; -import io.github.wulkanowy.data.db.dao.entities.Lesson; -import io.github.wulkanowy.data.db.dao.entities.LessonDao; -import io.github.wulkanowy.data.db.dao.entities.Week; -import io.github.wulkanowy.data.db.dao.entities.WeekDao; -import io.github.wulkanowy.data.db.shared.SharedPrefContract; -import io.github.wulkanowy.utils.DataObjectConverter; -import io.github.wulkanowy.utils.LogUtils; -import io.github.wulkanowy.utils.TimeUtils; - -@Singleton -public class TimetableSync implements TimetableSyncContract { - - private final DaoSession daoSession; - - private final Vulcan vulcan; - - private final SharedPrefContract sharedPref; - - @Inject - TimetableSync(DaoSession daoSession, SharedPrefContract sharedPref, Vulcan vulcan) { - this.daoSession = daoSession; - this.sharedPref = sharedPref; - this.vulcan = vulcan; - } - - @Override - public void syncTimetable(String date) throws NotLoggedInErrorException, IOException, ParseException { - long userId = sharedPref.getCurrentUserId(); - - io.github.wulkanowy.api.generic.Week weekFromNet = - date == null ? vulcan.getTimetable().getWeekTable() - : vulcan.getTimetable().getWeekTable(String.valueOf(TimeUtils.getNetTicks(date))); - - Week weekFromDb = daoSession.getWeekDao().queryBuilder() - .where(WeekDao.Properties.UserId.eq(userId), - WeekDao.Properties.StartDayDate.eq(weekFromNet.getStartDayDate())) - .unique(); - - Long weekId; - - if (weekFromDb == null) { - Week weekFromNetEntity = DataObjectConverter.weekToWeekEntity(weekFromNet).setUserId(userId); - weekId = daoSession.getWeekDao().insert(weekFromNetEntity); - } else { - weekId = weekFromDb.getId(); - } - - List dayListFromNet = weekFromNet.getDays(); - - List updatedLessonList = new ArrayList<>(); - - for (io.github.wulkanowy.api.generic.Day dayFromNet : dayListFromNet) { - Day dayFromNetEntity = DataObjectConverter.dayToDayEntity(dayFromNet); - - Day dayFromDb = daoSession.getDayDao().queryBuilder() - .where(DayDao.Properties.UserId.eq(userId), - DayDao.Properties.WeekId.eq(weekId), - DayDao.Properties.Date.eq(dayFromNetEntity.getDate())) - .unique(); - - dayFromNetEntity.setUserId(userId); - dayFromNetEntity.setWeekId(weekId); - - Long dayId; - - if (dayFromDb != null) { - dayFromNetEntity.setId(dayFromDb.getId()); - daoSession.getDayDao().save(dayFromNetEntity); - dayId = dayFromNetEntity.getId(); - } else { - dayId = daoSession.getDayDao().insert(dayFromNetEntity); - } - - List lessonListFromNetEntities = DataObjectConverter - .lessonsToLessonsEntities(dayFromNet.getLessons()); - - for (Lesson lessonFromNetEntity : lessonListFromNetEntities) { - Lesson lessonFromDb = daoSession.getLessonDao().queryBuilder() - .where(LessonDao.Properties.DayId.eq(dayId), - LessonDao.Properties.Date.eq(lessonFromNetEntity.getDate()), - LessonDao.Properties.StartTime.eq(lessonFromNetEntity.getStartTime()), - LessonDao.Properties.EndTime.eq(lessonFromNetEntity.getEndTime())) - .unique(); - - if (lessonFromDb != null) { - lessonFromNetEntity.setId(lessonFromDb.getId()); - } - - lessonFromNetEntity.setDayId(dayFromNetEntity.getId()); - - if (!"".equals(lessonFromNetEntity.getSubject())) { - updatedLessonList.add(lessonFromNetEntity); - } - } - } - daoSession.getLessonDao().saveInTx(updatedLessonList); - - LogUtils.debug("Synchronization lessons (amount = " + updatedLessonList.size() + ")"); - } - - @Override - public void syncTimetable() throws NotLoggedInErrorException, IOException, ParseException { - syncTimetable(null); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/data/sync/timetable/TimetableSyncContract.java b/app/src/main/java/io/github/wulkanowy/data/sync/timetable/TimetableSyncContract.java deleted file mode 100644 index 4c37d2ec..00000000 --- a/app/src/main/java/io/github/wulkanowy/data/sync/timetable/TimetableSyncContract.java +++ /dev/null @@ -1,13 +0,0 @@ -package io.github.wulkanowy.data.sync.timetable; - -import java.io.IOException; -import java.text.ParseException; - -import io.github.wulkanowy.api.login.NotLoggedInErrorException; - -public interface TimetableSyncContract { - - void syncTimetable(String date) throws NotLoggedInErrorException, IOException, ParseException; - - void syncTimetable() throws NotLoggedInErrorException, IOException, ParseException; -} diff --git a/app/src/main/java/io/github/wulkanowy/di/AppModule.kt b/app/src/main/java/io/github/wulkanowy/di/AppModule.kt new file mode 100644 index 00000000..9133c34e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/di/AppModule.kt @@ -0,0 +1,29 @@ +package io.github.wulkanowy.di + +import android.appwidget.AppWidgetManager +import android.content.Context +import com.yariksoffice.lingver.Lingver +import dagger.Module +import dagger.Provides +import dagger.hilt.InstallIn +import dagger.hilt.android.components.ApplicationComponent +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.utils.DispatchersProvider +import javax.inject.Singleton + +@Module +@InstallIn(ApplicationComponent::class) +internal class AppModule { + + @Singleton + @Provides + fun provideDispatchersProvider() = DispatchersProvider() + + @Singleton + @Provides + fun provideAppWidgetManager(@ApplicationContext context: Context): AppWidgetManager = AppWidgetManager.getInstance(context) + + @Singleton + @Provides + fun provideLingver() = Lingver.getInstance() +} diff --git a/app/src/main/java/io/github/wulkanowy/di/annotations/ActivityContext.java b/app/src/main/java/io/github/wulkanowy/di/annotations/ActivityContext.java deleted file mode 100644 index 2a74c32d..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/annotations/ActivityContext.java +++ /dev/null @@ -1,11 +0,0 @@ -package io.github.wulkanowy.di.annotations; - -import java.lang.annotation.Retention; -import java.lang.annotation.RetentionPolicy; - -import javax.inject.Qualifier; - -@Qualifier -@Retention(RetentionPolicy.RUNTIME) -public @interface ActivityContext { -} diff --git a/app/src/main/java/io/github/wulkanowy/di/annotations/ApplicationContext.java b/app/src/main/java/io/github/wulkanowy/di/annotations/ApplicationContext.java deleted file mode 100644 index 04139d99..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/annotations/ApplicationContext.java +++ /dev/null @@ -1,11 +0,0 @@ -package io.github.wulkanowy.di.annotations; - -import java.lang.annotation.Retention; -import java.lang.annotation.RetentionPolicy; - -import javax.inject.Qualifier; - -@Qualifier -@Retention(RetentionPolicy.RUNTIME) -public @interface ApplicationContext { -} diff --git a/app/src/main/java/io/github/wulkanowy/di/annotations/DatabaseInfo.java b/app/src/main/java/io/github/wulkanowy/di/annotations/DatabaseInfo.java deleted file mode 100644 index fabcefba..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/annotations/DatabaseInfo.java +++ /dev/null @@ -1,11 +0,0 @@ -package io.github.wulkanowy.di.annotations; - -import java.lang.annotation.Retention; -import java.lang.annotation.RetentionPolicy; - -import javax.inject.Qualifier; - -@Qualifier -@Retention(RetentionPolicy.RUNTIME) -public @interface DatabaseInfo { -} diff --git a/app/src/main/java/io/github/wulkanowy/di/annotations/PerActivity.java b/app/src/main/java/io/github/wulkanowy/di/annotations/PerActivity.java deleted file mode 100644 index f103994a..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/annotations/PerActivity.java +++ /dev/null @@ -1,11 +0,0 @@ -package io.github.wulkanowy.di.annotations; - -import java.lang.annotation.Retention; -import java.lang.annotation.RetentionPolicy; - -import javax.inject.Scope; - -@Scope -@Retention(RetentionPolicy.RUNTIME) -public @interface PerActivity { -} diff --git a/app/src/main/java/io/github/wulkanowy/di/annotations/PerFragment.java b/app/src/main/java/io/github/wulkanowy/di/annotations/PerFragment.java deleted file mode 100644 index 98f364f7..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/annotations/PerFragment.java +++ /dev/null @@ -1,11 +0,0 @@ -package io.github.wulkanowy.di.annotations; - -import java.lang.annotation.Retention; -import java.lang.annotation.RetentionPolicy; - -import javax.inject.Scope; - -@Scope -@Retention(RetentionPolicy.RUNTIME) -public @interface PerFragment { -} diff --git a/app/src/main/java/io/github/wulkanowy/di/annotations/SharedPreferencesInfo.java b/app/src/main/java/io/github/wulkanowy/di/annotations/SharedPreferencesInfo.java deleted file mode 100644 index 919c77a0..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/annotations/SharedPreferencesInfo.java +++ /dev/null @@ -1,11 +0,0 @@ -package io.github.wulkanowy.di.annotations; - -import java.lang.annotation.Retention; -import java.lang.annotation.RetentionPolicy; - -import javax.inject.Qualifier; - -@Qualifier -@Retention(RetentionPolicy.RUNTIME) -public @interface SharedPreferencesInfo { -} diff --git a/app/src/main/java/io/github/wulkanowy/di/annotations/SyncGrades.java b/app/src/main/java/io/github/wulkanowy/di/annotations/SyncGrades.java deleted file mode 100644 index 90e6c02f..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/annotations/SyncGrades.java +++ /dev/null @@ -1,11 +0,0 @@ -package io.github.wulkanowy.di.annotations; - -import java.lang.annotation.Retention; -import java.lang.annotation.RetentionPolicy; - -import javax.inject.Qualifier; - -@Qualifier -@Retention(RetentionPolicy.RUNTIME) -public @interface SyncGrades { -} diff --git a/app/src/main/java/io/github/wulkanowy/di/annotations/SyncSubjects.java b/app/src/main/java/io/github/wulkanowy/di/annotations/SyncSubjects.java deleted file mode 100644 index 81d351be..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/annotations/SyncSubjects.java +++ /dev/null @@ -1,11 +0,0 @@ -package io.github.wulkanowy.di.annotations; - -import java.lang.annotation.Retention; -import java.lang.annotation.RetentionPolicy; - -import javax.inject.Qualifier; - -@Qualifier -@Retention(RetentionPolicy.RUNTIME) -public @interface SyncSubjects { -} diff --git a/app/src/main/java/io/github/wulkanowy/di/component/ActivityComponent.java b/app/src/main/java/io/github/wulkanowy/di/component/ActivityComponent.java deleted file mode 100644 index 3365a317..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/component/ActivityComponent.java +++ /dev/null @@ -1,19 +0,0 @@ -package io.github.wulkanowy.di.component; - -import dagger.Component; -import io.github.wulkanowy.di.annotations.PerActivity; -import io.github.wulkanowy.di.modules.ActivityModule; -import io.github.wulkanowy.ui.login.LoginActivity; -import io.github.wulkanowy.ui.main.MainActivity; -import io.github.wulkanowy.ui.splash.SplashActivity; - -@PerActivity -@Component(dependencies = ApplicationComponent.class, modules = ActivityModule.class) -public interface ActivityComponent { - - void inject(SplashActivity splashActivity); - - void inject(LoginActivity loginActivity); - - void inject(MainActivity mainActivity); -} diff --git a/app/src/main/java/io/github/wulkanowy/di/component/ApplicationComponent.java b/app/src/main/java/io/github/wulkanowy/di/component/ApplicationComponent.java deleted file mode 100644 index 3439a949..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/component/ApplicationComponent.java +++ /dev/null @@ -1,26 +0,0 @@ -package io.github.wulkanowy.di.component; - -import android.content.Context; - -import javax.inject.Singleton; - -import dagger.Component; -import io.github.wulkanowy.WulkanowyApp; -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.di.annotations.ApplicationContext; -import io.github.wulkanowy.di.modules.ApplicationModule; -import io.github.wulkanowy.services.SyncJob; - -@Singleton -@Component(modules = ApplicationModule.class) -public interface ApplicationComponent { - - @ApplicationContext - Context getContext(); - - RepositoryContract getRepository(); - - void inject(WulkanowyApp wulkanowyApp); - - void inject(SyncJob syncJob); -} diff --git a/app/src/main/java/io/github/wulkanowy/di/component/FragmentComponent.java b/app/src/main/java/io/github/wulkanowy/di/component/FragmentComponent.java deleted file mode 100644 index 01a0fc02..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/component/FragmentComponent.java +++ /dev/null @@ -1,25 +0,0 @@ -package io.github.wulkanowy.di.component; - -import dagger.Component; -import io.github.wulkanowy.di.annotations.PerFragment; -import io.github.wulkanowy.di.modules.FragmentModule; -import io.github.wulkanowy.ui.main.attendance.AttendanceFragment; -import io.github.wulkanowy.ui.main.dashboard.DashboardFragment; -import io.github.wulkanowy.ui.main.grades.GradesFragment; -import io.github.wulkanowy.ui.main.timetable.TimetableFragment; -import io.github.wulkanowy.ui.main.timetable.TimetableTabFragment; - -@PerFragment -@Component(dependencies = ApplicationComponent.class, modules = FragmentModule.class) -public interface FragmentComponent { - - void inject(GradesFragment gradesFragment); - - void inject(AttendanceFragment attendanceFragment); - - void inject(DashboardFragment dashboardFragment); - - void inject(TimetableFragment timetableFragment); - - void inject(TimetableTabFragment timetableTabFragment); -} diff --git a/app/src/main/java/io/github/wulkanowy/di/modules/ActivityModule.java b/app/src/main/java/io/github/wulkanowy/di/modules/ActivityModule.java deleted file mode 100644 index 53dc1086..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/modules/ActivityModule.java +++ /dev/null @@ -1,64 +0,0 @@ -package io.github.wulkanowy.di.modules; - - -import android.content.Context; -import android.support.v7.app.AppCompatActivity; - -import dagger.Module; -import dagger.Provides; -import io.github.wulkanowy.di.annotations.ActivityContext; -import io.github.wulkanowy.di.annotations.PerActivity; -import io.github.wulkanowy.ui.login.LoginContract; -import io.github.wulkanowy.ui.login.LoginPresenter; -import io.github.wulkanowy.ui.main.MainContract; -import io.github.wulkanowy.ui.main.MainPagerAdapter; -import io.github.wulkanowy.ui.main.MainPresenter; -import io.github.wulkanowy.ui.splash.SplashContract; -import io.github.wulkanowy.ui.splash.SplashPresenter; - -@Module -public class ActivityModule { - - private AppCompatActivity activity; - - public ActivityModule(AppCompatActivity activity) { - this.activity = activity; - } - - @ActivityContext - @Provides - Context provideContext() { - return activity; - } - - @Provides - AppCompatActivity provideActivity() { - return activity; - } - - @PerActivity - @Provides - SplashContract.Presenter provideSplashPresenter - (SplashPresenter splashPresenter) { - return splashPresenter; - } - - @PerActivity - @Provides - LoginContract.Presenter provideLoginPresenter - (LoginPresenter loginPresenter) { - return loginPresenter; - } - - @PerActivity - @Provides - MainContract.Presenter provideMainPresenter - (MainPresenter mainPresenter) { - return mainPresenter; - } - - @Provides - MainPagerAdapter provideMainPagerAdapter() { - return new MainPagerAdapter(activity.getSupportFragmentManager()); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/di/modules/ApplicationModule.java b/app/src/main/java/io/github/wulkanowy/di/modules/ApplicationModule.java deleted file mode 100644 index 58e9909b..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/modules/ApplicationModule.java +++ /dev/null @@ -1,129 +0,0 @@ -package io.github.wulkanowy.di.modules; - -import android.app.Application; -import android.content.Context; - -import com.firebase.jobdispatcher.FirebaseJobDispatcher; -import com.firebase.jobdispatcher.GooglePlayDriver; - -import javax.inject.Singleton; - -import dagger.Module; -import dagger.Provides; -import io.github.wulkanowy.api.Vulcan; -import io.github.wulkanowy.data.Repository; -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.data.db.dao.DbHelper; -import io.github.wulkanowy.data.db.dao.entities.DaoMaster; -import io.github.wulkanowy.data.db.dao.entities.DaoSession; -import io.github.wulkanowy.data.db.resources.AppResources; -import io.github.wulkanowy.data.db.resources.ResourcesContract; -import io.github.wulkanowy.data.db.shared.SharedPref; -import io.github.wulkanowy.data.db.shared.SharedPrefContract; -import io.github.wulkanowy.data.sync.SyncContract; -import io.github.wulkanowy.data.sync.grades.GradeSync; -import io.github.wulkanowy.data.sync.login.LoginSync; -import io.github.wulkanowy.data.sync.login.LoginSyncContract; -import io.github.wulkanowy.data.sync.subjects.SubjectSync; -import io.github.wulkanowy.data.sync.timetable.TimetableSync; -import io.github.wulkanowy.data.sync.timetable.TimetableSyncContract; -import io.github.wulkanowy.di.annotations.ApplicationContext; -import io.github.wulkanowy.di.annotations.DatabaseInfo; -import io.github.wulkanowy.di.annotations.SharedPreferencesInfo; -import io.github.wulkanowy.di.annotations.SyncGrades; -import io.github.wulkanowy.di.annotations.SyncSubjects; -import io.github.wulkanowy.utils.AppConstant; - -@Module -public class ApplicationModule { - - private final Application application; - - public ApplicationModule(Application application) { - this.application = application; - } - - @Provides - Application provideApplication() { - return application; - } - - @ApplicationContext - @Provides - Context provideAppContext() { - return application; - } - - @DatabaseInfo - @Provides - String provideDatabaseName() { - return AppConstant.DATABASE_NAME; - } - - @SharedPreferencesInfo - @Provides - String provideSharedPreferencesName() { - return AppConstant.SHARED_PREFERENCES_NAME; - } - - @Singleton - @Provides - DaoSession provideDaoSession(DbHelper dbHelper) { - return new DaoMaster(dbHelper.getWritableDb()).newSession(); - } - - @Singleton - @Provides - Vulcan provideVulcan() { - return new Vulcan(); - } - - @Singleton - @Provides - RepositoryContract provideRepository(Repository repository) { - return repository; - } - - @Singleton - @Provides - SharedPrefContract provideSharedPref(SharedPref sharedPref) { - return sharedPref; - } - - @Singleton - @Provides - ResourcesContract provideAppResources(AppResources appResources) { - return appResources; - } - - @Singleton - @Provides - LoginSyncContract provideLoginSync(LoginSync loginSync) { - return loginSync; - } - - @SyncGrades - @Singleton - @Provides - SyncContract provideGradesSync(GradeSync gradeSync) { - return gradeSync; - } - - @SyncSubjects - @Singleton - @Provides - SyncContract provideSubjectSync(SubjectSync subjectSync) { - return subjectSync; - } - - @Singleton - @Provides - TimetableSyncContract provideTimetableSync(TimetableSync timetableSync) { - return timetableSync; - } - - @Provides - FirebaseJobDispatcher provideDispatcher() { - return new FirebaseJobDispatcher(new GooglePlayDriver(application)); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/di/modules/FragmentModule.java b/app/src/main/java/io/github/wulkanowy/di/modules/FragmentModule.java deleted file mode 100644 index 8999bca8..00000000 --- a/app/src/main/java/io/github/wulkanowy/di/modules/FragmentModule.java +++ /dev/null @@ -1,76 +0,0 @@ -package io.github.wulkanowy.di.modules; - -import android.support.v4.app.Fragment; - -import dagger.Module; -import dagger.Provides; -import eu.davidea.flexibleadapter.FlexibleAdapter; -import io.github.wulkanowy.di.annotations.PerFragment; -import io.github.wulkanowy.ui.main.attendance.AttendanceContract; -import io.github.wulkanowy.ui.main.attendance.AttendancePresenter; -import io.github.wulkanowy.ui.main.dashboard.DashboardContract; -import io.github.wulkanowy.ui.main.dashboard.DashboardPresenter; -import io.github.wulkanowy.ui.main.grades.GradeHeaderItem; -import io.github.wulkanowy.ui.main.grades.GradesContract; -import io.github.wulkanowy.ui.main.grades.GradesPresenter; -import io.github.wulkanowy.ui.main.timetable.TimetableContract; -import io.github.wulkanowy.ui.main.timetable.TimetableHeaderItem; -import io.github.wulkanowy.ui.main.timetable.TimetablePagerAdapter; -import io.github.wulkanowy.ui.main.timetable.TimetablePresenter; -import io.github.wulkanowy.ui.main.timetable.TimetableTabContract; -import io.github.wulkanowy.ui.main.timetable.TimetableTabPresenter; - -@Module -public class FragmentModule { - - private final Fragment fragment; - - public FragmentModule(Fragment fragment) { - this.fragment = fragment; - } - - @PerFragment - @Provides - GradesContract.Presenter provideGradesPresenter(GradesPresenter gradesPresenter) { - return gradesPresenter; - } - - @PerFragment - @Provides - AttendanceContract.Presenter provideAttendancePresenter(AttendancePresenter attendancePresenter) { - return attendancePresenter; - } - - @PerFragment - @Provides - DashboardContract.Presenter provideDashboardPresenter(DashboardPresenter dashboardPresenter) { - return dashboardPresenter; - } - - @PerFragment - @Provides - TimetableContract.Presenter provideTimetablePresenter(TimetablePresenter timetablePresenter) { - return timetablePresenter; - } - - @PerFragment - @Provides - TimetableTabContract.Presenter provideTimetableTabPresenter(TimetableTabPresenter timetableTabPresenter) { - return timetableTabPresenter; - } - - @Provides - TimetablePagerAdapter provideTimetablePagerAdapter() { - return new TimetablePagerAdapter(fragment.getChildFragmentManager()); - } - - @Provides - FlexibleAdapter provideGradesAdapter() { - return new FlexibleAdapter<>(null); - } - - @Provides - FlexibleAdapter provideTimetableTabAdapter() { - return new FlexibleAdapter<>(null); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/services/HiltBroadcastReceiver.kt b/app/src/main/java/io/github/wulkanowy/services/HiltBroadcastReceiver.kt new file mode 100644 index 00000000..1e795d43 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/HiltBroadcastReceiver.kt @@ -0,0 +1,9 @@ +package io.github.wulkanowy.services + +import android.content.BroadcastReceiver +import android.content.Context +import android.content.Intent + +abstract class HiltBroadcastReceiver : BroadcastReceiver() { + override fun onReceive(context: Context, intent: Intent) {} +} diff --git a/app/src/main/java/io/github/wulkanowy/services/NotificationService.java b/app/src/main/java/io/github/wulkanowy/services/NotificationService.java deleted file mode 100644 index ab721f46..00000000 --- a/app/src/main/java/io/github/wulkanowy/services/NotificationService.java +++ /dev/null @@ -1,55 +0,0 @@ -package io.github.wulkanowy.services; - - -import android.annotation.TargetApi; -import android.app.Notification; -import android.app.NotificationChannel; -import android.app.NotificationManager; -import android.content.Context; -import android.os.Build; -import android.support.v4.app.NotificationCompat; - -import java.util.Random; - -class NotificationService { - - private static final String CHANNEL_ID = "Wulkanowy_New_Grade_Channel"; - - private static final String CHANNEL_NAME = "New Grade Channel"; - - private NotificationManager manager; - - private Context context; - - NotificationService(Context context) { - this.context = context; - if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) { - createChannel(); - } - } - - void notify(Notification notification) { - getManager().notify(new Random().nextInt(1000), notification); - } - - NotificationCompat.Builder notificationBuilder() { - return new NotificationCompat.Builder(context, CHANNEL_ID); - } - - @TargetApi(26) - private void createChannel() { - NotificationChannel notificationChannel = new NotificationChannel(CHANNEL_ID, CHANNEL_NAME, - NotificationManager.IMPORTANCE_HIGH); - notificationChannel.enableLights(true); - notificationChannel.enableVibration(true); - notificationChannel.setLockscreenVisibility(Notification.VISIBILITY_PUBLIC); - getManager().createNotificationChannel(notificationChannel); - } - - private NotificationManager getManager() { - if (manager == null) { - manager = (NotificationManager) context.getSystemService(Context.NOTIFICATION_SERVICE); - } - return manager; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/services/ServicesModule.kt b/app/src/main/java/io/github/wulkanowy/services/ServicesModule.kt new file mode 100644 index 00000000..ac5a84e8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/ServicesModule.kt @@ -0,0 +1,137 @@ +package io.github.wulkanowy.services + +import android.app.AlarmManager +import android.content.Context +import androidx.core.app.NotificationManagerCompat +import androidx.core.content.getSystemService +import androidx.work.WorkManager +import dagger.Binds +import dagger.Module +import dagger.Provides +import dagger.hilt.InstallIn +import dagger.hilt.android.components.ApplicationComponent +import dagger.hilt.android.qualifiers.ApplicationContext +import dagger.multibindings.IntoSet +import io.github.wulkanowy.services.sync.channels.Channel +import io.github.wulkanowy.services.sync.channels.DebugChannel +import io.github.wulkanowy.services.sync.channels.LuckyNumberChannel +import io.github.wulkanowy.services.sync.channels.NewGradesChannel +import io.github.wulkanowy.services.sync.channels.NewMessagesChannel +import io.github.wulkanowy.services.sync.channels.NewNotesChannel +import io.github.wulkanowy.services.sync.channels.PushChannel +import io.github.wulkanowy.services.sync.channels.UpcomingLessonsChannel +import io.github.wulkanowy.services.sync.works.AttendanceSummaryWork +import io.github.wulkanowy.services.sync.works.AttendanceWork +import io.github.wulkanowy.services.sync.works.CompletedLessonWork +import io.github.wulkanowy.services.sync.works.ExamWork +import io.github.wulkanowy.services.sync.works.GradeStatisticsWork +import io.github.wulkanowy.services.sync.works.GradeWork +import io.github.wulkanowy.services.sync.works.HomeworkWork +import io.github.wulkanowy.services.sync.works.LuckyNumberWork +import io.github.wulkanowy.services.sync.works.MessageWork +import io.github.wulkanowy.services.sync.works.NoteWork +import io.github.wulkanowy.services.sync.works.RecipientWork +import io.github.wulkanowy.services.sync.works.TeacherWork +import io.github.wulkanowy.services.sync.works.TimetableWork +import io.github.wulkanowy.services.sync.works.Work +import javax.inject.Singleton + +@Suppress("unused") +@Module +@InstallIn(ApplicationComponent::class) +abstract class ServicesModule { + + companion object { + + @Provides + fun provideWorkManager(@ApplicationContext context: Context) = WorkManager.getInstance(context) + + @Singleton + @Provides + fun provideNotificationManager(@ApplicationContext context: Context) = NotificationManagerCompat.from(context) + + @Singleton + @Provides + fun provideAlarmManager(@ApplicationContext context: Context): AlarmManager = context.getSystemService()!! + } + + @Binds + @IntoSet + abstract fun provideGradeWork(work: GradeWork): Work + + @Binds + @IntoSet + abstract fun provideNoteWork(work: NoteWork): Work + + @Binds + @IntoSet + abstract fun provideAttendanceWork(work: AttendanceWork): Work + + @Binds + @IntoSet + abstract fun provideExamWork(work: ExamWork): Work + + @Binds + @IntoSet + abstract fun provideAttendanceSummaryWork(work: AttendanceSummaryWork): Work + + @Binds + @IntoSet + abstract fun provideTimetableWork(work: TimetableWork): Work + + @Binds + @IntoSet + abstract fun provideTeacherWork(work: TeacherWork): Work + + @Binds + @IntoSet + abstract fun provideLuckyNumberWork(work: LuckyNumberWork): Work + + @Binds + @IntoSet + abstract fun provideCompletedLessonWork(work: CompletedLessonWork): Work + + @Binds + @IntoSet + abstract fun provideHomeworkWork(work: HomeworkWork): Work + + @Binds + @IntoSet + abstract fun provideMessageWork(work: MessageWork): Work + + @Binds + @IntoSet + abstract fun provideRecipientWork(work: RecipientWork): Work + + @Binds + @IntoSet + abstract fun provideGradeStatistics(work: GradeStatisticsWork): Work + + @Binds + @IntoSet + abstract fun provideDebugChannel(channel: DebugChannel): Channel + + @Binds + @IntoSet + abstract fun provideLuckyNumberChannel(channel: LuckyNumberChannel): Channel + + @Binds + @IntoSet + abstract fun provideNewGradesChannel(channel: NewGradesChannel): Channel + + @Binds + @IntoSet + abstract fun provideNewMessageChannel(channel: NewMessagesChannel): Channel + + @Binds + @IntoSet + abstract fun provideNewNotesChannel(channel: NewNotesChannel): Channel + + @Binds + @IntoSet + abstract fun providePushChannel(channel: PushChannel): Channel + + @Binds + @IntoSet + abstract fun provideUpcomingLessonsChannel(channel: UpcomingLessonsChannel): Channel +} diff --git a/app/src/main/java/io/github/wulkanowy/services/SyncJob.java b/app/src/main/java/io/github/wulkanowy/services/SyncJob.java deleted file mode 100644 index ab26fcee..00000000 --- a/app/src/main/java/io/github/wulkanowy/services/SyncJob.java +++ /dev/null @@ -1,114 +0,0 @@ -package io.github.wulkanowy.services; - -import android.app.PendingIntent; -import android.content.Context; -import android.support.v4.app.NotificationCompat; - -import com.firebase.jobdispatcher.Constraint; -import com.firebase.jobdispatcher.FirebaseJobDispatcher; -import com.firebase.jobdispatcher.GooglePlayDriver; -import com.firebase.jobdispatcher.JobParameters; -import com.firebase.jobdispatcher.JobService; -import com.firebase.jobdispatcher.Lifetime; -import com.firebase.jobdispatcher.RetryStrategy; -import com.firebase.jobdispatcher.SimpleJobService; -import com.firebase.jobdispatcher.Trigger; - -import java.util.List; - -import javax.inject.Inject; - -import io.github.wulkanowy.R; -import io.github.wulkanowy.WulkanowyApp; -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.data.db.dao.entities.Grade; -import io.github.wulkanowy.ui.main.MainActivity; -import io.github.wulkanowy.utils.LogUtils; - -public class SyncJob extends SimpleJobService { - - private static final int DEFAULT_INTERVAL_START = 60 * 50; - - private static final int DEFAULT_INTERVAL_END = DEFAULT_INTERVAL_START + (60 * 40); - - public static final String EXTRA_INTENT_KEY = "cardId"; - - private List gradeList; - - @Inject - RepositoryContract repository; - - public static void start(Context context) { - FirebaseJobDispatcher dispatcher = new FirebaseJobDispatcher(new GooglePlayDriver(context)); - - dispatcher.mustSchedule(dispatcher.newJobBuilder() - .setLifetime(Lifetime.FOREVER) - .setService(SyncJob.class) - .setTag("SyncJob") - .setRecurring(true) - .setTrigger(Trigger.executionWindow(DEFAULT_INTERVAL_START, DEFAULT_INTERVAL_END)) - .setConstraints(Constraint.ON_ANY_NETWORK) - .setReplaceCurrent(false) - .setRetryStrategy(RetryStrategy.DEFAULT_EXPONENTIAL) - .build()); - } - - @Override - public void onCreate() { - super.onCreate(); - ((WulkanowyApp) getApplication()).getApplicationComponent().inject(this); - } - - @Override - public int onRunJob(JobParameters job) { - try { - repository.loginCurrentUser(); - repository.syncAll(); - - gradeList = repository.getNewGrades(); - - if (!gradeList.isEmpty()) { - showNotification(); - } - return JobService.RESULT_SUCCESS; - } catch (Exception e) { - LogUtils.error("During background synchronization an error occurred", e); - return JobService.RESULT_FAIL_RETRY; - } - } - - private void showNotification() { - NotificationService service = new NotificationService(getApplicationContext()); - - service.notify(service.notificationBuilder() - .setContentTitle(getStringTitle()) - .setContentText(getStringContent()) - .setSmallIcon(R.drawable.ic_stat_notify) - .setAutoCancel(true) - .setDefaults(NotificationCompat.DEFAULT_ALL) - .setPriority(NotificationCompat.PRIORITY_HIGH) - .setColor(getResources().getColor(R.color.colorPrimary)) - .setContentIntent(PendingIntent.getActivity(getApplicationContext(), 0, - MainActivity.getStartIntent(getApplicationContext()).putExtra(EXTRA_INTENT_KEY, 0) - , 0 - )) - .build()); - } - - private String getStringTitle() { - if (gradeList.size() == 1) { - return getResources().getQuantityString(R.plurals.newGradePlurals, 1); - } else { - return getResources().getQuantityString(R.plurals.newGradePlurals, 2); - } - } - - private String getStringContent() { - if (gradeList.size() == 1) { - return gradeList.get(0).getSubject(); - } else { - return getResources().getQuantityString(R.plurals.receivedNewGradePlurals, - gradeList.size(), gradeList.size()); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/services/alarm/TimetableNotificationReceiver.kt b/app/src/main/java/io/github/wulkanowy/services/alarm/TimetableNotificationReceiver.kt new file mode 100644 index 00000000..592d0919 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/alarm/TimetableNotificationReceiver.kt @@ -0,0 +1,119 @@ +package io.github.wulkanowy.services.alarm + +import android.annotation.SuppressLint +import android.app.PendingIntent +import android.app.PendingIntent.FLAG_UPDATE_CURRENT +import android.content.Context +import android.content.Intent +import android.os.Build +import android.os.Build.VERSION_CODES.N +import androidx.core.app.NotificationCompat +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.services.HiltBroadcastReceiver +import io.github.wulkanowy.services.sync.channels.UpcomingLessonsChannel.Companion.CHANNEL_ID +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.getCompatColor +import io.github.wulkanowy.utils.toLocalDateTime +import kotlinx.coroutines.GlobalScope +import kotlinx.coroutines.flow.launchIn +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +@AndroidEntryPoint +class TimetableNotificationReceiver : HiltBroadcastReceiver() { + + @Inject + lateinit var studentRepository: StudentRepository + + companion object { + const val NOTIFICATION_TYPE_CURRENT = 1 + const val NOTIFICATION_TYPE_UPCOMING = 2 + const val NOTIFICATION_TYPE_LAST_LESSON_CANCELLATION = 3 + + const val NOTIFICATION_ID = "id" + + const val STUDENT_NAME = "student_name" + const val STUDENT_ID = "student_id" + const val LESSON_TYPE = "type" + const val LESSON_TITLE = "title" + const val LESSON_ROOM = "room" + const val LESSON_NEXT_TITLE = "next_title" + const val LESSON_NEXT_ROOM = "next_room" + const val LESSON_START = "start_timestamp" + const val LESSON_END = "end_timestamp" + } + + @SuppressLint("CheckResult") + override fun onReceive(context: Context, intent: Intent) { + super.onReceive(context, intent) + Timber.d("Receiving intent... ${intent.toUri(0)}") + + flowWithResource { + val student = studentRepository.getCurrentStudent(false) + val studentId = intent.getIntExtra(STUDENT_ID, 0) + if (student.studentId == studentId) prepareNotification(context, intent) + else Timber.d("Notification studentId($studentId) differs from current(${student.studentId})") + }.onEach { + if (it.status == Status.ERROR) Timber.e(it.error!!) + }.launchIn(GlobalScope) + } + + private fun prepareNotification(context: Context, intent: Intent) { + val type = intent.getIntExtra(LESSON_TYPE, 0) + val notificationId = intent.getIntExtra(NOTIFICATION_ID, MainView.Section.TIMETABLE.id) + + if (type == NOTIFICATION_TYPE_LAST_LESSON_CANCELLATION) { + return NotificationManagerCompat.from(context).cancel(notificationId) + } + + val studentId = intent.getIntExtra(STUDENT_ID, 0) + val studentName = intent.getStringExtra(STUDENT_NAME) + + val subject = intent.getStringExtra(LESSON_TITLE) + val room = intent.getStringExtra(LESSON_ROOM) + + val start = intent.getLongExtra(LESSON_START, 0) + val end = intent.getLongExtra(LESSON_END, 0) + + val nextSubject = intent.getStringExtra(LESSON_NEXT_TITLE) + val nextRoom = intent.getStringExtra(LESSON_NEXT_ROOM) + + Timber.d("TimetableNotification receive: type: $type, subject: $subject, start: ${start.toLocalDateTime()}, student: $studentId") + + showNotification(context, notificationId, studentName, + if (type == NOTIFICATION_TYPE_CURRENT) end else start, end - start, + context.getString(if (type == NOTIFICATION_TYPE_CURRENT) R.string.timetable_now else R.string.timetable_next, "($room) $subject".removePrefix("()")), + nextSubject?.let { context.getString(R.string.timetable_later, "($nextRoom) $nextSubject".removePrefix("()")) } + ) + } + + private fun showNotification(context: Context, notificationId: Int, studentName: String?, countDown: Long, timeout: Long, title: String, next: String?) { + NotificationManagerCompat.from(context).notify(notificationId, NotificationCompat.Builder(context, CHANNEL_ID) + .setContentTitle(title) + .setContentText(next) + .setAutoCancel(false) + .setOngoing(true) + .setWhen(countDown) + .apply { + if (Build.VERSION.SDK_INT >= N) setUsesChronometer(true) + } + .setTimeoutAfter(timeout) + .setSmallIcon(R.drawable.ic_stat_timetable) + .setColor(context.getCompatColor(R.color.colorPrimary)) + .setStyle(NotificationCompat.InboxStyle().also { + it.setSummaryText(studentName) + it.addLine(next) + }) + .setContentIntent(PendingIntent.getActivity(context, MainView.Section.TIMETABLE.id, + MainActivity.getStartIntent(context, MainView.Section.TIMETABLE, true), FLAG_UPDATE_CURRENT)) + .build() + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/alarm/TimetableNotificationSchedulerHelper.kt b/app/src/main/java/io/github/wulkanowy/services/alarm/TimetableNotificationSchedulerHelper.kt new file mode 100644 index 00000000..8f8782a2 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/alarm/TimetableNotificationSchedulerHelper.kt @@ -0,0 +1,110 @@ +package io.github.wulkanowy.services.alarm + +import android.app.AlarmManager +import android.app.AlarmManager.RTC_WAKEUP +import android.app.PendingIntent +import android.app.PendingIntent.FLAG_UPDATE_CURRENT +import android.content.Context +import android.content.Intent +import androidx.core.app.AlarmManagerCompat +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.db.entities.Timetable +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.LESSON_END +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.LESSON_NEXT_ROOM +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.LESSON_NEXT_TITLE +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.LESSON_ROOM +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.LESSON_START +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.LESSON_TITLE +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.LESSON_TYPE +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.NOTIFICATION_ID +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.NOTIFICATION_TYPE_CURRENT +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.NOTIFICATION_TYPE_LAST_LESSON_CANCELLATION +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.NOTIFICATION_TYPE_UPCOMING +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.STUDENT_ID +import io.github.wulkanowy.services.alarm.TimetableNotificationReceiver.Companion.STUDENT_NAME +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.toTimestamp +import timber.log.Timber +import java.time.LocalDateTime +import java.time.LocalDateTime.now +import javax.inject.Inject + +class TimetableNotificationSchedulerHelper @Inject constructor( + @ApplicationContext private val context: Context, + private val alarmManager: AlarmManager, + private val preferencesRepository: PreferencesRepository +) { + + private fun getRequestCode(time: LocalDateTime, studentId: Int) = (time.toTimestamp() * studentId).toInt() + + private fun getUpcomingLessonTime(index: Int, day: List, lesson: Timetable): LocalDateTime { + return day.getOrNull(index - 1)?.end ?: lesson.start.minusMinutes(30) + } + + fun cancelScheduled(lessons: List, studentId: Int = 1) { + lessons.sortedBy { it.start }.forEachIndexed { index, lesson -> + val upcomingTime = getUpcomingLessonTime(index, lessons, lesson) + cancelScheduledTo(upcomingTime..lesson.start, getRequestCode(upcomingTime, studentId)) + cancelScheduledTo(lesson.start..lesson.end, getRequestCode(lesson.start, studentId)) + + Timber.d("TimetableNotification canceled: type 1 & 2, subject: ${lesson.subject}, start: ${lesson.start}, student: $studentId") + } + } + + private fun cancelScheduledTo(range: ClosedRange, requestCode: Int) { + if (now() in range) cancelNotification() + alarmManager.cancel(PendingIntent.getBroadcast(context, requestCode, Intent(), FLAG_UPDATE_CURRENT)) + } + + fun cancelNotification() = NotificationManagerCompat.from(context).cancel(MainView.Section.TIMETABLE.id) + + fun scheduleNotifications(lessons: List, student: Student) { + if (!preferencesRepository.isUpcomingLessonsNotificationsEnable) return cancelScheduled(lessons, student.studentId) + + lessons.groupBy { it.date } + .map { it.value.sortedBy { lesson -> lesson.start } } + .map { it.filter { lesson -> !lesson.canceled && lesson.isStudentPlan } } + .map { day -> + day.forEachIndexed { index, lesson -> + val intent = createIntent(student, lesson, day.getOrNull(index + 1)) + + if (lesson.start > now()) { + scheduleBroadcast(intent, student.studentId, NOTIFICATION_TYPE_UPCOMING, getUpcomingLessonTime(index, day, lesson)) + } + + if (lesson.end > now()) { + scheduleBroadcast(intent, student.studentId, NOTIFICATION_TYPE_CURRENT, lesson.start) + if (day.lastIndex == index) { + scheduleBroadcast(intent, student.studentId, NOTIFICATION_TYPE_LAST_LESSON_CANCELLATION, lesson.end) + } + } + } + } + } + + private fun createIntent(student: Student, lesson: Timetable, nextLesson: Timetable?): Intent { + return Intent(context, TimetableNotificationReceiver::class.java).apply { + putExtra(STUDENT_ID, student.studentId) + putExtra(STUDENT_NAME, student.studentName) + putExtra(LESSON_ROOM, lesson.room) + putExtra(LESSON_START, lesson.start.toTimestamp()) + putExtra(LESSON_END, lesson.end.toTimestamp()) + putExtra(LESSON_TITLE, lesson.subject) + putExtra(LESSON_NEXT_TITLE, nextLesson?.subject) + putExtra(LESSON_NEXT_ROOM, nextLesson?.room) + } + } + + private fun scheduleBroadcast(intent: Intent, studentId: Int, notificationType: Int, time: LocalDateTime) { + AlarmManagerCompat.setExactAndAllowWhileIdle(alarmManager, RTC_WAKEUP, time.toTimestamp(), + PendingIntent.getBroadcast(context, getRequestCode(time, studentId), intent.also { + it.putExtra(NOTIFICATION_ID, MainView.Section.TIMETABLE.id) + it.putExtra(LESSON_TYPE, notificationType) + }, FLAG_UPDATE_CURRENT) + ) + Timber.d("TimetableNotification scheduled: type: $notificationType, subject: ${intent.getStringExtra(LESSON_TITLE)}, start: $time, student: $studentId") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/SyncManager.kt b/app/src/main/java/io/github/wulkanowy/services/sync/SyncManager.kt new file mode 100644 index 00000000..1d005ae8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/SyncManager.kt @@ -0,0 +1,87 @@ +package io.github.wulkanowy.services.sync + +import android.os.Build.VERSION.SDK_INT +import android.os.Build.VERSION_CODES.O +import androidx.core.app.NotificationManagerCompat +import androidx.lifecycle.asFlow +import androidx.work.BackoffPolicy.EXPONENTIAL +import androidx.work.Constraints +import androidx.work.Data +import androidx.work.ExistingPeriodicWorkPolicy.KEEP +import androidx.work.ExistingPeriodicWorkPolicy.REPLACE +import androidx.work.ExistingWorkPolicy +import androidx.work.NetworkType.CONNECTED +import androidx.work.NetworkType.UNMETERED +import androidx.work.OneTimeWorkRequestBuilder +import androidx.work.PeriodicWorkRequestBuilder +import androidx.work.WorkInfo +import androidx.work.WorkManager +import io.github.wulkanowy.data.db.SharedPrefProvider +import io.github.wulkanowy.data.db.SharedPrefProvider.Companion.APP_VERSION_CODE_KEY +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.services.sync.channels.Channel +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.isHolidays +import kotlinx.coroutines.flow.Flow +import timber.log.Timber +import java.time.LocalDate.now +import java.util.concurrent.TimeUnit.MINUTES +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class SyncManager @Inject constructor( + private val workManager: WorkManager, + private val preferencesRepository: PreferencesRepository, + channels: Set<@JvmSuppressWildcards Channel>, + notificationManager: NotificationManagerCompat, + sharedPrefProvider: SharedPrefProvider, + appInfo: AppInfo +) { + + init { + if (now().isHolidays) stopSyncWorker() + + if (SDK_INT >= O) { + channels.forEach { it.create() } + notificationManager.deleteNotificationChannel("new_entries_channel") + } + + if (sharedPrefProvider.getLong(APP_VERSION_CODE_KEY, -1L) != appInfo.versionCode.toLong()) { + startPeriodicSyncWorker(true) + sharedPrefProvider.putLong(APP_VERSION_CODE_KEY, appInfo.versionCode.toLong(), true) + } + Timber.i("SyncManager was initialized") + } + + fun startPeriodicSyncWorker(restart: Boolean = false) { + if (preferencesRepository.isServiceEnabled && !now().isHolidays) { + workManager.enqueueUniquePeriodicWork(SyncWorker::class.java.simpleName, if (restart) REPLACE else KEEP, + PeriodicWorkRequestBuilder(preferencesRepository.servicesInterval, MINUTES) + .setInitialDelay(10, MINUTES) + .setBackoffCriteria(EXPONENTIAL, 30, MINUTES) + .setConstraints(Constraints.Builder() + .setRequiredNetworkType(if (preferencesRepository.isServicesOnlyWifi) UNMETERED else CONNECTED) + .build()) + .build()) + } + } + + fun startOneTimeSyncWorker(): Flow { + val work = OneTimeWorkRequestBuilder() + .setInputData( + Data.Builder() + .putBoolean("one_time", true) + .build() + ) + .build() + + workManager.enqueueUniqueWork("${SyncWorker::class.java.simpleName}_one_time", ExistingWorkPolicy.REPLACE, work) + + return workManager.getWorkInfoByIdLiveData(work.id).asFlow() + } + + fun stopSyncWorker() { + workManager.cancelUniqueWork(SyncWorker::class.java.simpleName) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/SyncWorker.kt b/app/src/main/java/io/github/wulkanowy/services/sync/SyncWorker.kt new file mode 100644 index 00000000..2ba0435b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/SyncWorker.kt @@ -0,0 +1,83 @@ +package io.github.wulkanowy.services.sync + +import android.content.Context +import androidx.core.app.NotificationCompat +import androidx.core.app.NotificationCompat.BigTextStyle +import androidx.core.app.NotificationCompat.PRIORITY_DEFAULT +import androidx.core.app.NotificationManagerCompat +import androidx.hilt.Assisted +import androidx.hilt.work.WorkerInject +import androidx.work.CoroutineWorker +import androidx.work.Data +import androidx.work.WorkerParameters +import io.github.wulkanowy.R +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.sdk.exception.FeatureNotAvailableException +import io.github.wulkanowy.sdk.scrapper.exception.FeatureDisabledException +import io.github.wulkanowy.services.sync.channels.DebugChannel +import io.github.wulkanowy.services.sync.works.Work +import io.github.wulkanowy.utils.getCompatColor +import kotlinx.coroutines.coroutineScope +import timber.log.Timber +import kotlin.random.Random + +class SyncWorker @WorkerInject constructor( + @Assisted appContext: Context, + @Assisted workerParameters: WorkerParameters, + private val studentRepository: StudentRepository, + private val semesterRepository: SemesterRepository, + private val works: Set<@JvmSuppressWildcards Work>, + private val preferencesRepository: PreferencesRepository, + private val notificationManager: NotificationManagerCompat +) : CoroutineWorker(appContext, workerParameters) { + + override suspend fun doWork() = coroutineScope { + Timber.i("SyncWorker is starting") + + if (!studentRepository.isCurrentStudentSet()) return@coroutineScope Result.failure() + + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student, true) + + val exceptions = works.mapNotNull { work -> + try { + Timber.i("${work::class.java.simpleName} is starting") + work.doWork(student, semester) + Timber.i("${work::class.java.simpleName} result: Success") + null + } catch (e: Throwable) { + Timber.w("${work::class.java.simpleName} result: An exception ${e.message} occurred") + if (e is FeatureDisabledException || e is FeatureNotAvailableException) null + else e + } + } + val result = when { + exceptions.isNotEmpty() && inputData.getBoolean("one_time", false) -> { + Result.failure(Data.Builder() + .putString("error", exceptions.toString()) + .build() + ) + } + exceptions.isNotEmpty() -> Result.retry() + else -> Result.success() + } + + if (preferencesRepository.isDebugNotificationEnable) notify(result) + Timber.i("SyncWorker result: $result") + + result + } + + private fun notify(result: Result) { + notificationManager.notify(Random.nextInt(Int.MAX_VALUE), NotificationCompat.Builder(applicationContext, DebugChannel.CHANNEL_ID) + .setContentTitle("Debug notification") + .setSmallIcon(R.drawable.ic_stat_push) + .setAutoCancel(true) + .setColor(applicationContext.getCompatColor(R.color.colorPrimary)) + .setStyle(BigTextStyle().bigText("${SyncWorker::class.java.simpleName} result: $result")) + .setPriority(PRIORITY_DEFAULT) + .build()) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/channels/Channel.kt b/app/src/main/java/io/github/wulkanowy/services/sync/channels/Channel.kt new file mode 100644 index 00000000..f47c2220 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/channels/Channel.kt @@ -0,0 +1,6 @@ +package io.github.wulkanowy.services.sync.channels + +interface Channel { + + fun create() +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/channels/DebugChannel.kt b/app/src/main/java/io/github/wulkanowy/services/sync/channels/DebugChannel.kt new file mode 100644 index 00000000..2c756519 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/channels/DebugChannel.kt @@ -0,0 +1,33 @@ +package io.github.wulkanowy.services.sync.channels + +import android.annotation.TargetApi +import android.app.Notification.VISIBILITY_PUBLIC +import android.app.NotificationChannel +import android.app.NotificationManager.IMPORTANCE_DEFAULT +import android.content.Context +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import io.github.wulkanowy.utils.AppInfo +import javax.inject.Inject + +@TargetApi(26) +class DebugChannel @Inject constructor( + private val notificationManager: NotificationManagerCompat, + @ApplicationContext private val context: Context, + private val appInfo: AppInfo +) : Channel { + + companion object { + const val CHANNEL_ID = "debug_channel" + } + + override fun create() { + if (!appInfo.isDebug) return + notificationManager.createNotificationChannel( + NotificationChannel(CHANNEL_ID, context.getString(R.string.channel_debug), IMPORTANCE_DEFAULT) + .apply { + lockscreenVisibility = VISIBILITY_PUBLIC + }) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/channels/LuckyNumberChannel.kt b/app/src/main/java/io/github/wulkanowy/services/sync/channels/LuckyNumberChannel.kt new file mode 100644 index 00000000..8025bd76 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/channels/LuckyNumberChannel.kt @@ -0,0 +1,32 @@ +package io.github.wulkanowy.services.sync.channels + +import android.annotation.TargetApi +import android.app.Notification +import android.app.NotificationChannel +import android.app.NotificationManager +import android.content.Context +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import javax.inject.Inject + +@TargetApi(26) +class LuckyNumberChannel @Inject constructor( + private val notificationManager: NotificationManagerCompat, + @ApplicationContext private val context: Context +) : Channel { + + companion object { + const val CHANNEL_ID = "lucky_number_channel" + } + + override fun create() { + notificationManager.createNotificationChannel( + NotificationChannel(CHANNEL_ID, context.getString(R.string.channel_lucky_number), NotificationManager.IMPORTANCE_HIGH) + .apply { + enableLights(true) + enableVibration(true) + lockscreenVisibility = Notification.VISIBILITY_PUBLIC + }) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/channels/NewGradesChannel.kt b/app/src/main/java/io/github/wulkanowy/services/sync/channels/NewGradesChannel.kt new file mode 100644 index 00000000..5d5727d3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/channels/NewGradesChannel.kt @@ -0,0 +1,32 @@ +package io.github.wulkanowy.services.sync.channels + +import android.annotation.TargetApi +import android.app.Notification +import android.app.NotificationChannel +import android.app.NotificationManager +import android.content.Context +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import javax.inject.Inject + +@TargetApi(26) +class NewGradesChannel @Inject constructor( + private val notificationManager: NotificationManagerCompat, + @ApplicationContext private val context: Context +) : Channel { + + companion object { + const val CHANNEL_ID = "new_grade_channel" + } + + override fun create() { + notificationManager.createNotificationChannel( + NotificationChannel(CHANNEL_ID, context.getString(R.string.channel_new_grades), NotificationManager.IMPORTANCE_HIGH) + .apply { + enableLights(true) + enableVibration(true) + lockscreenVisibility = Notification.VISIBILITY_PUBLIC + }) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/channels/NewMessagesChannel.kt b/app/src/main/java/io/github/wulkanowy/services/sync/channels/NewMessagesChannel.kt new file mode 100644 index 00000000..962fbfa2 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/channels/NewMessagesChannel.kt @@ -0,0 +1,32 @@ +package io.github.wulkanowy.services.sync.channels + +import android.annotation.TargetApi +import android.app.Notification +import android.app.NotificationChannel +import android.app.NotificationManager +import android.content.Context +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import javax.inject.Inject + +@TargetApi(26) +class NewMessagesChannel @Inject constructor( + private val notificationManager: NotificationManagerCompat, + @ApplicationContext private val context: Context +) : Channel { + + companion object { + const val CHANNEL_ID = "new_message_channel" + } + + override fun create() { + notificationManager.createNotificationChannel( + NotificationChannel(CHANNEL_ID, context.getString(R.string.channel_new_message), NotificationManager.IMPORTANCE_HIGH) + .apply { + enableLights(true) + enableVibration(true) + lockscreenVisibility = Notification.VISIBILITY_PUBLIC + }) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/channels/NewNotesChannel.kt b/app/src/main/java/io/github/wulkanowy/services/sync/channels/NewNotesChannel.kt new file mode 100644 index 00000000..c6e79b39 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/channels/NewNotesChannel.kt @@ -0,0 +1,32 @@ +package io.github.wulkanowy.services.sync.channels + +import android.annotation.TargetApi +import android.app.Notification +import android.app.NotificationChannel +import android.app.NotificationManager +import android.content.Context +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import javax.inject.Inject + +@TargetApi(26) +class NewNotesChannel @Inject constructor( + private val notificationManager: NotificationManagerCompat, + @ApplicationContext private val context: Context +) : Channel { + + companion object { + const val CHANNEL_ID = "new_notes_channel" + } + + override fun create() { + notificationManager.createNotificationChannel( + NotificationChannel(CHANNEL_ID, context.getString(R.string.channel_new_notes), NotificationManager.IMPORTANCE_HIGH) + .apply { + enableLights(true) + enableVibration(true) + lockscreenVisibility = Notification.VISIBILITY_PUBLIC + }) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/channels/PushChannel.kt b/app/src/main/java/io/github/wulkanowy/services/sync/channels/PushChannel.kt new file mode 100644 index 00000000..1d7376b9 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/channels/PushChannel.kt @@ -0,0 +1,33 @@ +package io.github.wulkanowy.services.sync.channels + +import android.annotation.TargetApi +import android.app.Notification +import android.app.NotificationChannel +import android.app.NotificationManager +import android.content.Context +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import javax.inject.Inject + +@TargetApi(26) +class PushChannel @Inject constructor( + private val notificationManager: NotificationManagerCompat, + @ApplicationContext private val context: Context +) : Channel { + + companion object { + const val CHANNEL_ID = "push_channel" + } + + override fun create() { + notificationManager.createNotificationChannel( + NotificationChannel(CHANNEL_ID, context.getString(R.string.channel_push), NotificationManager.IMPORTANCE_HIGH) + .apply { + enableLights(true) + enableVibration(true) + lockscreenVisibility = Notification.VISIBILITY_PUBLIC + } + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/channels/UpcomingLessonsChannel.kt b/app/src/main/java/io/github/wulkanowy/services/sync/channels/UpcomingLessonsChannel.kt new file mode 100644 index 00000000..41fb6192 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/channels/UpcomingLessonsChannel.kt @@ -0,0 +1,33 @@ +package io.github.wulkanowy.services.sync.channels + +import android.annotation.TargetApi +import android.app.Notification.VISIBILITY_PUBLIC +import android.app.NotificationChannel +import android.app.NotificationManager.IMPORTANCE_DEFAULT +import android.content.Context +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import javax.inject.Inject + +@TargetApi(26) +class UpcomingLessonsChannel @Inject constructor( + private val notificationManager: NotificationManagerCompat, + @ApplicationContext private val context: Context +) : Channel { + + companion object { + const val CHANNEL_ID = "lesson_channel" + } + + override fun create() { + notificationManager.createNotificationChannel( + NotificationChannel(CHANNEL_ID, context.getString(R.string.channel_upcoming_lessons), IMPORTANCE_DEFAULT).apply { + lockscreenVisibility = VISIBILITY_PUBLIC + setShowBadge(false) + enableVibration(false) + setSound(null, null) + } + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/AttendanceSummaryWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/AttendanceSummaryWork.kt new file mode 100644 index 00000000..9e4ab902 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/AttendanceSummaryWork.kt @@ -0,0 +1,16 @@ +package io.github.wulkanowy.services.sync.works + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.attendancesummary.AttendanceSummaryRepository +import io.github.wulkanowy.utils.waitForResult +import javax.inject.Inject + +class AttendanceSummaryWork @Inject constructor( + private val attendanceSummaryRepository: AttendanceSummaryRepository +) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + attendanceSummaryRepository.getAttendanceSummary(student, semester, -1, true).waitForResult() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/AttendanceWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/AttendanceWork.kt new file mode 100644 index 00000000..ecf0be01 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/AttendanceWork.kt @@ -0,0 +1,17 @@ +package io.github.wulkanowy.services.sync.works + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.attendance.AttendanceRepository +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.waitForResult +import java.time.LocalDate.now +import javax.inject.Inject + +class AttendanceWork @Inject constructor(private val attendanceRepository: AttendanceRepository) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + attendanceRepository.getAttendance(student, semester, now().monday, now().sunday, true).waitForResult() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/CompletedLessonWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/CompletedLessonWork.kt new file mode 100644 index 00000000..212ea632 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/CompletedLessonWork.kt @@ -0,0 +1,19 @@ +package io.github.wulkanowy.services.sync.works + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.completedlessons.CompletedLessonsRepository +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.waitForResult +import java.time.LocalDate.now +import javax.inject.Inject + +class CompletedLessonWork @Inject constructor( + private val completedLessonsRepository: CompletedLessonsRepository +) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + completedLessonsRepository.getCompletedLessons(student, semester, now().monday, now().sunday, true).waitForResult() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/ExamWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/ExamWork.kt new file mode 100644 index 00000000..f7d8db0a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/ExamWork.kt @@ -0,0 +1,17 @@ +package io.github.wulkanowy.services.sync.works + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.exam.ExamRepository +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.waitForResult +import java.time.LocalDate.now +import javax.inject.Inject + +class ExamWork @Inject constructor(private val examRepository: ExamRepository) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + examRepository.getExams(student, semester, now().monday, now().sunday, true).waitForResult() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/GradeStatisticsWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/GradeStatisticsWork.kt new file mode 100644 index 00000000..3d61a423 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/GradeStatisticsWork.kt @@ -0,0 +1,20 @@ +package io.github.wulkanowy.services.sync.works + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.gradestatistics.GradeStatisticsRepository +import io.github.wulkanowy.utils.waitForResult +import javax.inject.Inject + +class GradeStatisticsWork @Inject constructor( + private val gradeStatisticsRepository: GradeStatisticsRepository +) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + with(gradeStatisticsRepository) { + getGradesStatistics(student, semester, "Wszystkie", isSemester = true, forceRefresh = true).waitForResult() + getGradesStatistics(student, semester, "Wszystkie", isSemester = false, forceRefresh = true).waitForResult() + getGradesPointsStatistics(student, semester, "Wszystkie", forceRefresh = true).waitForResult() + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/GradeWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/GradeWork.kt new file mode 100644 index 00000000..00bce109 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/GradeWork.kt @@ -0,0 +1,103 @@ +package io.github.wulkanowy.services.sync.works + +import android.app.PendingIntent +import android.app.PendingIntent.FLAG_UPDATE_CURRENT +import android.content.Context +import androidx.core.app.NotificationCompat +import androidx.core.app.NotificationCompat.DEFAULT_ALL +import androidx.core.app.NotificationCompat.PRIORITY_HIGH +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.data.db.entities.GradeSummary +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.grade.GradeRepository +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.services.sync.channels.NewGradesChannel +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.getCompatColor +import io.github.wulkanowy.utils.waitForResult +import kotlinx.coroutines.flow.first +import javax.inject.Inject +import kotlin.random.Random + +class GradeWork @Inject constructor( + @ApplicationContext private val context: Context, + private val notificationManager: NotificationManagerCompat, + private val gradeRepository: GradeRepository, + private val preferencesRepository: PreferencesRepository +) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + gradeRepository.getGrades(student, semester, true, preferencesRepository.isNotificationsEnable).waitForResult() + + gradeRepository.getNotNotifiedGrades(semester).first().let { + if (it.isNotEmpty()) notifyDetails(it) + gradeRepository.updateGrades(it.onEach { grade -> grade.isNotified = true }) + } + + gradeRepository.getNotNotifiedPredictedGrades(semester).first().let { + if (it.isNotEmpty()) notifyPredicted(it) + gradeRepository.updateGradesSummary(it.onEach { grade -> grade.isPredictedGradeNotified = true }) + } + + gradeRepository.getNotNotifiedFinalGrades(semester).first().let { + if (it.isNotEmpty()) notifyFinal(it) + gradeRepository.updateGradesSummary(it.onEach { grade -> grade.isFinalGradeNotified = true }) + } + } + + private fun getNotificationBuilder(): NotificationCompat.Builder { + return NotificationCompat.Builder(context, NewGradesChannel.CHANNEL_ID) + .setSmallIcon(R.drawable.ic_stat_grade) + .setAutoCancel(true) + .setPriority(PRIORITY_HIGH) + .setDefaults(DEFAULT_ALL) + .setColor(context.getCompatColor(R.color.colorPrimary)) + .setContentIntent( + PendingIntent.getActivity(context, MainView.Section.GRADE.id, + MainActivity.getStartIntent(context, MainView.Section.GRADE, true), FLAG_UPDATE_CURRENT)) + } + + private fun notifyDetails(grades: List) { + notificationManager.notify(Random.nextInt(Int.MAX_VALUE), getNotificationBuilder() + .setContentTitle(context.resources.getQuantityString(R.plurals.grade_new_items, grades.size, grades.size)) + .setContentText(context.resources.getQuantityString(R.plurals.grade_notify_new_items, grades.size, grades.size)) + .setStyle(NotificationCompat.InboxStyle().run { + setSummaryText(context.resources.getQuantityString(R.plurals.grade_number_item, grades.size, grades.size)) + grades.forEach { addLine("${it.subject}: ${it.entry}") } + this + }) + .build() + ) + } + + private fun notifyPredicted(gradesSummary: List) { + notificationManager.notify(Random.nextInt(Int.MAX_VALUE), getNotificationBuilder() + .setContentTitle(context.resources.getQuantityString(R.plurals.grade_new_items_predicted, gradesSummary.size, gradesSummary.size)) + .setContentText(context.resources.getQuantityString(R.plurals.grade_notify_new_items_predicted, gradesSummary.size, gradesSummary.size)) + .setStyle(NotificationCompat.InboxStyle().run { + setSummaryText(context.resources.getQuantityString(R.plurals.grade_number_item, gradesSummary.size, gradesSummary.size)) + gradesSummary.forEach { addLine("${it.subject}: ${it.predictedGrade}") } + this + }) + .build() + ) + } + + private fun notifyFinal(gradesSummary: List) { + notificationManager.notify(Random.nextInt(Int.MAX_VALUE), getNotificationBuilder() + .setContentTitle(context.resources.getQuantityString(R.plurals.grade_new_items_final, gradesSummary.size, gradesSummary.size)) + .setContentText(context.resources.getQuantityString(R.plurals.grade_notify_new_items_final, gradesSummary.size, gradesSummary.size)) + .setStyle(NotificationCompat.InboxStyle().run { + setSummaryText(context.resources.getQuantityString(R.plurals.grade_number_item, gradesSummary.size, gradesSummary.size)) + gradesSummary.forEach { addLine("${it.subject}: ${it.finalGrade}") } + this + }) + .build() + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/HomeworkWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/HomeworkWork.kt new file mode 100644 index 00000000..a07f1107 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/HomeworkWork.kt @@ -0,0 +1,17 @@ +package io.github.wulkanowy.services.sync.works + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.homework.HomeworkRepository +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.waitForResult +import java.time.LocalDate.now +import javax.inject.Inject + +class HomeworkWork @Inject constructor(private val homeworkRepository: HomeworkRepository) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + homeworkRepository.getHomework(student, semester, now().monday, now().sunday, true).waitForResult() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/LuckyNumberWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/LuckyNumberWork.kt new file mode 100644 index 00000000..7b9f5ab3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/LuckyNumberWork.kt @@ -0,0 +1,55 @@ +package io.github.wulkanowy.services.sync.works + +import android.app.PendingIntent +import android.app.PendingIntent.FLAG_UPDATE_CURRENT +import android.content.Context +import androidx.core.app.NotificationCompat +import androidx.core.app.NotificationCompat.DEFAULT_ALL +import androidx.core.app.NotificationCompat.PRIORITY_HIGH +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.LuckyNumber +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.luckynumber.LuckyNumberRepository +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.services.sync.channels.LuckyNumberChannel +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.getCompatColor +import io.github.wulkanowy.utils.waitForResult +import javax.inject.Inject +import kotlin.random.Random + +class LuckyNumberWork @Inject constructor( + @ApplicationContext private val context: Context, + private val notificationManager: NotificationManagerCompat, + private val luckyNumberRepository: LuckyNumberRepository, + private val preferencesRepository: PreferencesRepository +) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + luckyNumberRepository.getLuckyNumber(student, true, preferencesRepository.isNotificationsEnable).waitForResult() + + luckyNumberRepository.getNotNotifiedLuckyNumber(student)?.let { + notify(it) + luckyNumberRepository.updateLuckyNumber(it.apply { isNotified = true }) + } + } + + private fun notify(luckyNumber: LuckyNumber) { + notificationManager.notify(Random.nextInt(Int.MAX_VALUE), NotificationCompat.Builder(context, LuckyNumberChannel.CHANNEL_ID) + .setContentTitle(context.getString(R.string.lucky_number_notify_new_item_title)) + .setContentText(context.getString(R.string.lucky_number_notify_new_item, luckyNumber.luckyNumber)) + .setSmallIcon(R.drawable.ic_stat_luckynumber) + .setAutoCancel(true) + .setDefaults(DEFAULT_ALL) + .setPriority(PRIORITY_HIGH) + .setColor(context.getCompatColor(R.color.colorPrimary)) + .setContentIntent( + PendingIntent.getActivity(context, MainView.Section.MESSAGE.id, + MainActivity.getStartIntent(context, MainView.Section.LUCKY_NUMBER, true), FLAG_UPDATE_CURRENT)) + .build()) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/MessageWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/MessageWork.kt new file mode 100644 index 00000000..7b32f13b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/MessageWork.kt @@ -0,0 +1,63 @@ +package io.github.wulkanowy.services.sync.works + +import android.app.PendingIntent +import android.app.PendingIntent.FLAG_UPDATE_CURRENT +import android.content.Context +import androidx.core.app.NotificationCompat +import androidx.core.app.NotificationCompat.DEFAULT_ALL +import androidx.core.app.NotificationCompat.PRIORITY_HIGH +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.message.MessageFolder.RECEIVED +import io.github.wulkanowy.data.repositories.message.MessageRepository +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.services.sync.channels.NewMessagesChannel +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.getCompatColor +import io.github.wulkanowy.utils.waitForResult +import kotlinx.coroutines.flow.first +import javax.inject.Inject +import kotlin.random.Random + +class MessageWork @Inject constructor( + @ApplicationContext private val context: Context, + private val notificationManager: NotificationManagerCompat, + private val messageRepository: MessageRepository, + private val preferencesRepository: PreferencesRepository +) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + messageRepository.getMessages(student, semester, RECEIVED, true, preferencesRepository.isNotificationsEnable).waitForResult() + + messageRepository.getNotNotifiedMessages(student).first().let { + if (it.isNotEmpty()) notify(it) + messageRepository.updateMessages(it.onEach { message -> message.isNotified = true }) + } + } + + private fun notify(messages: List) { + notificationManager.notify(Random.nextInt(Int.MAX_VALUE), NotificationCompat.Builder(context, NewMessagesChannel.CHANNEL_ID) + .setContentTitle(context.resources.getQuantityString(R.plurals.message_new_items, messages.size, messages.size)) + .setContentText(context.resources.getQuantityString(R.plurals.message_notify_new_items, messages.size, messages.size)) + .setSmallIcon(R.drawable.ic_stat_message) + .setAutoCancel(true) + .setDefaults(DEFAULT_ALL) + .setPriority(PRIORITY_HIGH) + .setColor(context.getCompatColor(R.color.colorPrimary)) + .setContentIntent( + PendingIntent.getActivity(context, MainView.Section.MESSAGE.id, + MainActivity.getStartIntent(context, MainView.Section.MESSAGE, true), FLAG_UPDATE_CURRENT) + ) + .setStyle(NotificationCompat.InboxStyle().run { + setSummaryText(context.resources.getQuantityString(R.plurals.message_number_item, messages.size, messages.size)) + messages.forEach { addLine("${it.sender}: ${it.subject}") } + this + }) + .build()) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/NoteWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/NoteWork.kt new file mode 100644 index 00000000..84b80679 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/NoteWork.kt @@ -0,0 +1,62 @@ +package io.github.wulkanowy.services.sync.works + +import android.app.PendingIntent +import android.app.PendingIntent.FLAG_UPDATE_CURRENT +import android.content.Context +import androidx.core.app.NotificationCompat +import androidx.core.app.NotificationCompat.DEFAULT_ALL +import androidx.core.app.NotificationCompat.PRIORITY_HIGH +import androidx.core.app.NotificationManagerCompat +import dagger.hilt.android.qualifiers.ApplicationContext +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Note +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.note.NoteRepository +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.services.sync.channels.NewNotesChannel +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.getCompatColor +import io.github.wulkanowy.utils.waitForResult +import kotlinx.coroutines.flow.first +import javax.inject.Inject +import kotlin.random.Random + +class NoteWork @Inject constructor( + @ApplicationContext private val context: Context, + private val notificationManager: NotificationManagerCompat, + private val noteRepository: NoteRepository, + private val preferencesRepository: PreferencesRepository +) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + noteRepository.getNotes(student, semester, true, preferencesRepository.isNotificationsEnable).waitForResult() + + noteRepository.getNotNotifiedNotes(student).first().let { + if (it.isNotEmpty()) notify(it) + noteRepository.updateNotes(it.onEach { note -> note.isNotified = true }) + } + } + + private fun notify(notes: List) { + notificationManager.notify(Random.nextInt(Int.MAX_VALUE), NotificationCompat.Builder(context, NewNotesChannel.CHANNEL_ID) + .setContentTitle(context.resources.getQuantityString(R.plurals.note_new_items, notes.size, notes.size)) + .setContentText(context.resources.getQuantityString(R.plurals.note_notify_new_items, notes.size, notes.size)) + .setSmallIcon(R.drawable.ic_stat_note) + .setAutoCancel(true) + .setDefaults(DEFAULT_ALL) + .setPriority(PRIORITY_HIGH) + .setColor(context.getCompatColor(R.color.colorPrimary)) + .setContentIntent( + PendingIntent.getActivity(context, MainView.Section.NOTE.id, + MainActivity.getStartIntent(context, MainView.Section.NOTE, true), FLAG_UPDATE_CURRENT)) + .setStyle(NotificationCompat.InboxStyle().run { + setSummaryText(context.resources.getQuantityString(R.plurals.note_number_item, notes.size, notes.size)) + notes.forEach { addLine("${it.teacher}: ${it.category}") } + this + }) + .build()) + } +} + diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/RecipientWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/RecipientWork.kt new file mode 100644 index 00000000..c433c0ac --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/RecipientWork.kt @@ -0,0 +1,23 @@ +package io.github.wulkanowy.services.sync.works + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.recipient.RecipientRepository +import io.github.wulkanowy.data.repositories.reportingunit.ReportingUnitRepository +import javax.inject.Inject + +class RecipientWork @Inject constructor( + private val reportingUnitRepository: ReportingUnitRepository, + private val recipientRepository: RecipientRepository +) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + reportingUnitRepository.refreshReportingUnits(student) + + reportingUnitRepository.getReportingUnits(student).let { units -> + units.map { + recipientRepository.refreshRecipients(student, 2, it) + } + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/TeacherWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/TeacherWork.kt new file mode 100644 index 00000000..a9abdaa7 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/TeacherWork.kt @@ -0,0 +1,14 @@ +package io.github.wulkanowy.services.sync.works + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.teacher.TeacherRepository +import io.github.wulkanowy.utils.waitForResult +import javax.inject.Inject + +class TeacherWork @Inject constructor(private val teacherRepository: TeacherRepository) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + teacherRepository.getTeachers(student, semester, true).waitForResult() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/TimetableWork.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/TimetableWork.kt new file mode 100644 index 00000000..3b8c6f5d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/TimetableWork.kt @@ -0,0 +1,19 @@ +package io.github.wulkanowy.services.sync.works + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.timetable.TimetableRepository +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.waitForResult +import java.time.LocalDate.now +import javax.inject.Inject + +class TimetableWork @Inject constructor( + private val timetableRepository: TimetableRepository +) : Work { + + override suspend fun doWork(student: Student, semester: Semester) { + timetableRepository.getTimetable(student, semester, now().monday, now().sunday, true).waitForResult() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/services/sync/works/Work.kt b/app/src/main/java/io/github/wulkanowy/services/sync/works/Work.kt new file mode 100644 index 00000000..c41f41ce --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/sync/works/Work.kt @@ -0,0 +1,9 @@ +package io.github.wulkanowy.services.sync.works + +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student + +interface Work { + + suspend fun doWork(student: Student, semester: Semester) +} diff --git a/app/src/main/java/io/github/wulkanowy/services/widgets/TimetableWidgetService.kt b/app/src/main/java/io/github/wulkanowy/services/widgets/TimetableWidgetService.kt new file mode 100644 index 00000000..42c6d3bf --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/services/widgets/TimetableWidgetService.kt @@ -0,0 +1,37 @@ +package io.github.wulkanowy.services.widgets + +import android.content.Intent +import android.widget.RemoteViewsService +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.data.db.SharedPrefProvider +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.data.repositories.timetable.TimetableRepository +import io.github.wulkanowy.ui.modules.timetablewidget.TimetableWidgetFactory +import timber.log.Timber +import javax.inject.Inject + +@AndroidEntryPoint +class TimetableWidgetService : RemoteViewsService() { + + @Inject + lateinit var timetableRepo: TimetableRepository + + @Inject + lateinit var studentRepo: StudentRepository + + @Inject + lateinit var semesterRepo: SemesterRepository + + @Inject + lateinit var prefRepository: PreferencesRepository + + @Inject + lateinit var sharedPref: SharedPrefProvider + + override fun onGetViewFactory(intent: Intent?): RemoteViewsFactory { + Timber.d("TimetableWidgetFactory created") + return TimetableWidgetFactory(timetableRepo, studentRepo, semesterRepo, prefRepository, sharedPref, applicationContext, intent) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BaseActivity.java b/app/src/main/java/io/github/wulkanowy/ui/base/BaseActivity.java deleted file mode 100644 index c5c66df0..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/base/BaseActivity.java +++ /dev/null @@ -1,70 +0,0 @@ -package io.github.wulkanowy.ui.base; - -import android.os.Bundle; -import android.support.annotation.Nullable; -import android.support.v7.app.AppCompatActivity; -import android.support.v7.app.AppCompatDelegate; -import android.widget.Toast; - -import butterknife.Unbinder; -import io.github.wulkanowy.R; -import io.github.wulkanowy.WulkanowyApp; -import io.github.wulkanowy.di.component.ActivityComponent; -import io.github.wulkanowy.di.component.DaggerActivityComponent; -import io.github.wulkanowy.di.modules.ActivityModule; -import io.github.wulkanowy.utils.NetworkUtils; - -public abstract class BaseActivity extends AppCompatActivity implements BaseContract.View { - - private ActivityComponent activityComponent; - - private Unbinder unbinder; - - @Override - public void onCreate(@Nullable Bundle savedInstanceState) { - super.onCreate(savedInstanceState); - - AppCompatDelegate.setCompatVectorFromResourcesEnabled(true); - - activityComponent = DaggerActivityComponent.builder() - .activityModule(new ActivityModule(this)) - .applicationComponent(((WulkanowyApp) getApplication()).getApplicationComponent()) - .build(); - } - - @Override - protected void onDestroy() { - super.onDestroy(); - if (unbinder != null) { - unbinder.unbind(); - } - } - - @Override - public void onError(int resId) { - onError(getString(resId)); - } - - @Override - public void onError(String message) { - Toast.makeText(this, message, Toast.LENGTH_SHORT).show(); - } - - @Override - public void onNoNetworkError() { - onError(R.string.noInternet_text); - } - - @Override - public boolean isNetworkConnected() { - return NetworkUtils.isOnline(getApplicationContext()); - } - - public ActivityComponent getActivityComponent() { - return activityComponent; - } - - public void setButterKnife(Unbinder unbinder) { - this.unbinder = unbinder; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BaseActivity.kt b/app/src/main/java/io/github/wulkanowy/ui/base/BaseActivity.kt new file mode 100644 index 00000000..86b6701b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/BaseActivity.kt @@ -0,0 +1,87 @@ +package io.github.wulkanowy.ui.base + +import android.app.ActivityManager +import android.content.Intent.FLAG_ACTIVITY_CLEAR_TASK +import android.content.Intent.FLAG_ACTIVITY_NEW_TASK +import android.os.Build.VERSION.SDK_INT +import android.os.Build.VERSION_CODES.LOLLIPOP +import android.os.Bundle +import android.view.View +import android.widget.Toast +import androidx.appcompat.app.AlertDialog +import androidx.appcompat.app.AppCompatActivity +import androidx.appcompat.app.AppCompatDelegate +import androidx.viewbinding.ViewBinding +import com.google.android.material.snackbar.Snackbar +import com.google.android.material.snackbar.Snackbar.LENGTH_LONG +import io.github.wulkanowy.R +import io.github.wulkanowy.ui.modules.login.LoginActivity +import io.github.wulkanowy.utils.FragmentLifecycleLogger +import io.github.wulkanowy.utils.getThemeAttrColor +import io.github.wulkanowy.utils.lifecycleAwareVariable +import javax.inject.Inject + +abstract class BaseActivity, VB : ViewBinding> : + AppCompatActivity(), BaseView { + + protected var binding: VB by lifecycleAwareVariable() + + @Inject + lateinit var fragmentLifecycleLogger: FragmentLifecycleLogger + + @Inject + lateinit var themeManager: ThemeManager + + protected var messageContainer: View? = null + + abstract var presenter: T + + override fun onCreate(savedInstanceState: Bundle?) { + themeManager.applyActivityTheme(this) + super.onCreate(savedInstanceState) + supportFragmentManager.registerFragmentLifecycleCallbacks(fragmentLifecycleLogger, true) + AppCompatDelegate.setCompatVectorFromResourcesEnabled(true) + + if (SDK_INT >= LOLLIPOP) { + @Suppress("DEPRECATION") + setTaskDescription(ActivityManager.TaskDescription(null, null, getThemeAttrColor(R.attr.colorSurface))) + } + } + + override fun showError(text: String, error: Throwable) { + if (messageContainer != null) { + Snackbar.make(messageContainer!!, text, LENGTH_LONG) + .setAction(R.string.all_details) { showErrorDetailsDialog(error) } + .show() + } else showMessage(text) + } + + override fun showErrorDetailsDialog(error: Throwable) { + ErrorDialog.newInstance(error).show(supportFragmentManager, error.toString()) + } + + override fun showMessage(text: String) { + if (messageContainer != null) Snackbar.make(messageContainer!!, text, LENGTH_LONG).show() + else Toast.makeText(this, text, Toast.LENGTH_LONG).show() + } + + override fun showExpiredDialog() { + AlertDialog.Builder(this) + .setTitle(R.string.main_session_expired) + .setMessage(R.string.main_session_relogin) + .setPositiveButton(R.string.main_log_in) { _, _ -> presenter.onExpiredLoginSelected() } + .setNegativeButton(android.R.string.cancel) { _, _ -> } + .show() + } + + override fun openClearLoginView() { + startActivity(LoginActivity.getStartIntent(this) + .apply { addFlags(FLAG_ACTIVITY_CLEAR_TASK or FLAG_ACTIVITY_NEW_TASK) }) + } + + override fun onDestroy() { + super.onDestroy() + invalidateOptionsMenu() + presenter.onDetachView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BaseContract.java b/app/src/main/java/io/github/wulkanowy/ui/base/BaseContract.java deleted file mode 100644 index 2a4dc569..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/base/BaseContract.java +++ /dev/null @@ -1,27 +0,0 @@ -package io.github.wulkanowy.ui.base; - -import android.support.annotation.StringRes; - -import io.github.wulkanowy.di.annotations.PerActivity; - -public interface BaseContract { - - interface View { - - void onError(@StringRes int resId); - - void onError(String message); - - void onNoNetworkError(); - - boolean isNetworkConnected(); - } - - @PerActivity - interface Presenter { - - void onStart(V view); - - void onDestroy(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BaseDialogFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/base/BaseDialogFragment.kt new file mode 100644 index 00000000..18cd58b4 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/BaseDialogFragment.kt @@ -0,0 +1,31 @@ +package io.github.wulkanowy.ui.base + +import android.widget.Toast +import androidx.fragment.app.DialogFragment +import androidx.viewbinding.ViewBinding +import io.github.wulkanowy.utils.lifecycleAwareVariable + +abstract class BaseDialogFragment : DialogFragment(), BaseView { + + protected var binding: VB by lifecycleAwareVariable() + + override fun showError(text: String, error: Throwable) { + showMessage(text) + } + + override fun showMessage(text: String) { + Toast.makeText(context, text, Toast.LENGTH_LONG).show() + } + + override fun showExpiredDialog() { + (activity as? BaseActivity<*, *>)?.showExpiredDialog() + } + + override fun openClearLoginView() { + (activity as? BaseActivity<*, *>)?.openClearLoginView() + } + + override fun showErrorDetailsDialog(error: Throwable) { + ErrorDialog.newInstance(error).show(childFragmentManager, error.toString()) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BaseExpandableAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/base/BaseExpandableAdapter.kt new file mode 100644 index 00000000..eee4625c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/BaseExpandableAdapter.kt @@ -0,0 +1,58 @@ +package io.github.wulkanowy.ui.base + +import android.util.DisplayMetrics +import androidx.recyclerview.widget.LinearLayoutManager +import androidx.recyclerview.widget.LinearSmoothScroller +import androidx.recyclerview.widget.RecyclerView +import kotlin.math.max +import kotlin.math.min + +abstract class BaseExpandableAdapter : RecyclerView.Adapter() { + + companion object { + private const val MILLISECONDS_PER_INCH = 100f + private const val AUTO_SCROLL_DELAY = 150L + } + + private var recyclerView: RecyclerView? = null + + override fun onAttachedToRecyclerView(recyclerView: RecyclerView) { + super.onAttachedToRecyclerView(recyclerView) + this.recyclerView = recyclerView + } + + override fun onDetachedFromRecyclerView(recyclerView: RecyclerView) { + super.onDetachedFromRecyclerView(recyclerView) + this.recyclerView = null + } + + // original: https://github.com/davideas/FlexibleAdapter/blob/5.1.0/flexible-adapter/src/main/java/eu/davidea/flexibleadapter/FlexibleAdapter.java#L4984-L5011 + protected fun scrollToHeaderWithSubItems(position: Int, subItemsCount: Int) { + val layoutManager = recyclerView!!.layoutManager as LinearLayoutManager + val firstVisibleItem = layoutManager.findFirstCompletelyVisibleItemPosition() + val lastVisibleItem = layoutManager.findLastCompletelyVisibleItemPosition() + val itemsToShow = position + subItemsCount - lastVisibleItem + if (itemsToShow > 0) { + val scrollMax: Int = position - firstVisibleItem + val scrollMin = max(0, position + subItemsCount - lastVisibleItem) + val scrollBy = min(scrollMax, scrollMin) + val scrollTo = firstVisibleItem + scrollBy + scrollToPosition(scrollTo) + } else if (position < firstVisibleItem) { + scrollToPosition(position) + } + } + + private fun scrollToPosition(position: Int) { + recyclerView?.run { + postDelayed({ + layoutManager?.startSmoothScroll(object : LinearSmoothScroller(context) { + override fun getVerticalSnapPreference() = SNAP_TO_START + override fun calculateSpeedPerPixel(displayMetrics: DisplayMetrics) = MILLISECONDS_PER_INCH / displayMetrics.densityDpi + }.apply { + targetPosition = position + }) + }, AUTO_SCROLL_DELAY) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BaseFragment.java b/app/src/main/java/io/github/wulkanowy/ui/base/BaseFragment.java deleted file mode 100644 index efb9d61a..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/base/BaseFragment.java +++ /dev/null @@ -1,104 +0,0 @@ -package io.github.wulkanowy.ui.base; - -import android.content.Context; -import android.os.Bundle; -import android.support.annotation.NonNull; -import android.support.annotation.Nullable; -import android.support.v4.app.Fragment; -import android.view.View; - -import butterknife.Unbinder; -import io.github.wulkanowy.R; -import io.github.wulkanowy.WulkanowyApp; -import io.github.wulkanowy.di.component.DaggerFragmentComponent; -import io.github.wulkanowy.di.component.FragmentComponent; -import io.github.wulkanowy.di.modules.FragmentModule; - -public abstract class BaseFragment extends Fragment implements BaseContract.View { - - private BaseActivity activity; - - private Unbinder unbinder; - - private FragmentComponent fragmentComponent; - - @Override - public void onAttach(Context context) { - super.onAttach(context); - if (context instanceof BaseActivity) { - activity = (BaseActivity) context; - } - - fragmentComponent = DaggerFragmentComponent.builder() - .fragmentModule(new FragmentModule(this)) - .applicationComponent(((WulkanowyApp) activity.getApplication()).getApplicationComponent()) - .build(); - } - - @Override - public void onCreate(@Nullable Bundle savedInstanceState) { - super.onCreate(savedInstanceState); - setHasOptionsMenu(false); - } - - @Override - public void onViewCreated(@NonNull View view, @Nullable Bundle savedInstanceState) { - super.onViewCreated(view, savedInstanceState); - setUpOnViewCreated(view); - } - - @Override - public void onDetach() { - activity = null; - super.onDetach(); - } - - @Override - public void onDestroyView() { - if (unbinder != null) { - unbinder.unbind(); - } - super.onDestroyView(); - } - - @Override - public void onError(int resId) { - onError(getString(resId)); - } - - @Override - public void onError(String message) { - if (activity != null) { - activity.onError(message); - } - } - - @Override - public void onNoNetworkError() { - onError(R.string.noInternet_text); - } - - @Override - public boolean isNetworkConnected() { - return activity != null && activity.isNetworkConnected(); - } - - public void setButterKnife(Unbinder unbinder) { - this.unbinder = unbinder; - } - - public void setTitle(String title) { - if (activity != null) { - activity.setTitle(title); - } - } - - public FragmentComponent getFragmentComponent() { - return fragmentComponent; - } - - - protected void setUpOnViewCreated(View fragmentView) { - // do something on view created - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BaseFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/base/BaseFragment.kt new file mode 100644 index 00000000..c6a2e1d1 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/BaseFragment.kt @@ -0,0 +1,48 @@ +package io.github.wulkanowy.ui.base + +import android.view.View +import androidx.annotation.LayoutRes +import androidx.fragment.app.Fragment +import androidx.viewbinding.ViewBinding +import com.google.android.material.snackbar.Snackbar +import com.google.android.material.snackbar.Snackbar.LENGTH_LONG +import io.github.wulkanowy.R +import io.github.wulkanowy.utils.lifecycleAwareVariable + +abstract class BaseFragment(@LayoutRes layoutId: Int) : Fragment(layoutId), + BaseView { + + protected var binding: VB by lifecycleAwareVariable() + + protected var messageContainer: View? = null + + override fun showError(text: String, error: Throwable) { + if (messageContainer != null) { + Snackbar.make(messageContainer!!, text, LENGTH_LONG) + .setAction(R.string.all_details) { if (isAdded) showErrorDetailsDialog(error) } + .show() + } else { + (activity as? BaseActivity<*, *>)?.showError(text, error) + } + } + + override fun showErrorDetailsDialog(error: Throwable) { + ErrorDialog.newInstance(error).show(childFragmentManager, error.toString()) + } + + override fun showMessage(text: String) { + if (messageContainer != null) { + Snackbar.make(messageContainer!!, text, LENGTH_LONG).show() + } else { + (activity as? BaseActivity<*, *>)?.showMessage(text) + } + } + + override fun showExpiredDialog() { + (activity as? BaseActivity<*, *>)?.showExpiredDialog() + } + + override fun openClearLoginView() { + (activity as? BaseActivity<*, *>)?.openClearLoginView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BaseFragmentPagerAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/base/BaseFragmentPagerAdapter.kt new file mode 100644 index 00000000..5f8bf417 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/BaseFragmentPagerAdapter.kt @@ -0,0 +1,32 @@ +package io.github.wulkanowy.ui.base + +import androidx.fragment.app.Fragment +import androidx.fragment.app.FragmentManager +import androidx.fragment.app.FragmentPagerAdapter + +class BaseFragmentPagerAdapter(private val fragmentManager: FragmentManager) : + FragmentPagerAdapter(fragmentManager, BEHAVIOR_RESUME_ONLY_CURRENT_FRAGMENT) { + + private val pages = mutableMapOf() + + var containerId = 0 + + fun getFragmentInstance(position: Int): Fragment? { + require(containerId != 0) { "Container id is 0" } + return fragmentManager.findFragmentByTag("android:switcher:$containerId:$position") + } + + fun addFragments(fragments: List) { + fragments.forEach { pages[it] = null } + } + + fun addFragmentsWithTitle(pages: Map) { + this.pages.putAll(pages) + } + + override fun getItem(position: Int) = pages.keys.elementAt(position) + + override fun getCount() = pages.size + + override fun getPageTitle(position: Int) = pages.values.elementAt(position) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BasePresenter.java b/app/src/main/java/io/github/wulkanowy/ui/base/BasePresenter.java deleted file mode 100644 index dfb60b6f..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/base/BasePresenter.java +++ /dev/null @@ -1,35 +0,0 @@ -package io.github.wulkanowy.ui.base; - -import javax.inject.Inject; - -import io.github.wulkanowy.data.RepositoryContract; - -public class BasePresenter implements BaseContract.Presenter { - - private final RepositoryContract repository; - - private V view; - - @Inject - public BasePresenter(RepositoryContract repository) { - this.repository = repository; - } - - @Override - public void onStart(V view) { - this.view = view; - } - - @Override - public void onDestroy() { - view = null; - } - - public final RepositoryContract getRepository() { - return repository; - } - - public V getView() { - return view; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BasePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/base/BasePresenter.kt new file mode 100644 index 00000000..aec52425 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/BasePresenter.kt @@ -0,0 +1,83 @@ +package io.github.wulkanowy.ui.base + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.utils.flowWithResource +import kotlinx.coroutines.CoroutineScope +import kotlinx.coroutines.Dispatchers +import kotlinx.coroutines.Job +import kotlinx.coroutines.flow.Flow +import kotlinx.coroutines.flow.launchIn +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import kotlin.coroutines.CoroutineContext + +open class BasePresenter( + protected val errorHandler: ErrorHandler, + protected val studentRepository: StudentRepository +) : CoroutineScope { + + private var job: Job = Job() + + private val jobs = mutableMapOf() + + override val coroutineContext: CoroutineContext + get() = Dispatchers.Main + job + + var view: T? = null + + open fun onAttachView(view: T) { + job = Job() + this.view = view + errorHandler.apply { + showErrorMessage = view::showError + onSessionExpired = view::showExpiredDialog + onNoCurrentStudent = view::openClearLoginView + } + } + + fun onExpiredLoginSelected() { + flowWithResource { + val student = studentRepository.getCurrentStudent(false) + studentRepository.logoutStudent(student) + + val students = studentRepository.getSavedStudents(false) + if (students.isNotEmpty()) { + Timber.i("Switching current student") + studentRepository.switchStudent(students[0]) + } + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Attempt to switch the student after the session expires") + Status.SUCCESS -> { + Timber.i("Switch student result: Open login view") + view?.openClearLoginView() + } + Status.ERROR -> { + Timber.i("Switch student result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch("expired") + } + + fun Flow.launch(individualJobTag: String = "load"): Job { + jobs[individualJobTag]?.cancel() + val job = launchIn(this@BasePresenter) + jobs[individualJobTag] = job + Timber.d("Job $individualJobTag launched in ${this@BasePresenter.javaClass.simpleName}: $job") + return job + } + + fun cancelJobs(vararg names: String) { + names.forEach { + jobs[it]?.cancel() + } + } + + open fun onDetachView() { + view = null + job.cancel() + errorHandler.clear() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/BaseView.kt b/app/src/main/java/io/github/wulkanowy/ui/base/BaseView.kt new file mode 100644 index 00000000..0f4df92c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/BaseView.kt @@ -0,0 +1,14 @@ +package io.github.wulkanowy.ui.base + +interface BaseView { + + fun showError(text: String, error: Throwable) + + fun showMessage(text: String) + + fun showExpiredDialog() + + fun openClearLoginView() + + fun showErrorDetailsDialog(error: Throwable) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/ErrorDialog.kt b/app/src/main/java/io/github/wulkanowy/ui/base/ErrorDialog.kt new file mode 100644 index 00000000..8d6739a1 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/ErrorDialog.kt @@ -0,0 +1,121 @@ +package io.github.wulkanowy.ui.base + +import android.content.ClipData +import android.content.ClipboardManager +import android.os.Bundle +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import android.widget.HorizontalScrollView +import android.widget.Toast +import android.widget.Toast.LENGTH_LONG +import androidx.appcompat.app.AlertDialog +import androidx.core.content.getSystemService +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.databinding.DialogErrorBinding +import io.github.wulkanowy.sdk.exception.FeatureNotAvailableException +import io.github.wulkanowy.sdk.scrapper.exception.FeatureDisabledException +import io.github.wulkanowy.sdk.scrapper.exception.ServiceUnavailableException +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.getString +import io.github.wulkanowy.utils.openAppInMarket +import io.github.wulkanowy.utils.openEmailClient +import io.github.wulkanowy.utils.openInternetBrowser +import java.io.InterruptedIOException +import java.io.PrintWriter +import java.io.StringWriter +import java.net.SocketTimeoutException +import java.net.UnknownHostException +import javax.inject.Inject + +@AndroidEntryPoint +class ErrorDialog : BaseDialogFragment() { + + private lateinit var error: Throwable + + @Inject + lateinit var appInfo: AppInfo + + companion object { + private const val ARGUMENT_KEY = "Data" + + fun newInstance(error: Throwable): ErrorDialog { + return ErrorDialog().apply { + arguments = Bundle().apply { putSerializable(ARGUMENT_KEY, error) } + } + } + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setStyle(STYLE_NO_TITLE, 0) + arguments?.run { + error = getSerializable(ARGUMENT_KEY) as Throwable + } + } + + override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { + return DialogErrorBinding.inflate(inflater).apply { binding = this }.root + } + + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + + val stringWriter = StringWriter().apply { + error.printStackTrace(PrintWriter(this)) + } + + with(binding) { + errorDialogContent.text = stringWriter.toString() + with(errorDialogHorizontalScroll) { + post { fullScroll(HorizontalScrollView.FOCUS_LEFT) } + } + errorDialogCopy.setOnClickListener { + val clip = ClipData.newPlainText("wulkanowy", stringWriter.toString()) + activity?.getSystemService()?.setPrimaryClip(clip) + + Toast.makeText(context, R.string.all_copied, LENGTH_LONG).show() + } + errorDialogCancel.setOnClickListener { dismiss() } + errorDialogReport.setOnClickListener { + openConfirmDialog { openEmailClient(stringWriter.toString()) } + } + errorDialogMessage.text = resources.getString(error) + errorDialogReport.isEnabled = when (error) { + is UnknownHostException, + is InterruptedIOException, + is SocketTimeoutException, + is ServiceUnavailableException, + is FeatureDisabledException, + is FeatureNotAvailableException -> false + else -> true + } + } + } + + private fun openConfirmDialog(callback: () -> Unit) { + AlertDialog.Builder(requireContext()) + .setTitle(R.string.dialog_error_check_update) + .setMessage(R.string.dialog_error_check_update_message) + .setNeutralButton(R.string.about_feedback) { _, _ -> callback() } + .setPositiveButton(R.string.dialog_error_check_update) { _, _ -> + requireContext().openAppInMarket(::showMessage) + } + .show() + } + + private fun openEmailClient(content: String) { + requireContext().openEmailClient( + chooserTitle = getString(R.string.about_feedback), + email = "wulkanowyinc@gmail.com", + subject = "Zgłoszenie błędu", + body = requireContext().getString(R.string.about_feedback_template, + "${appInfo.systemManufacturer} ${appInfo.systemModel}", appInfo.systemVersion.toString(), appInfo.versionName + ) + "\n" + content, + onActivityNotFound = { + requireContext().openInternetBrowser("https://github.com/wulkanowy/wulkanowy/issues", ::showMessage) + } + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/ErrorHandler.kt b/app/src/main/java/io/github/wulkanowy/ui/base/ErrorHandler.kt new file mode 100644 index 00000000..946e661b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/ErrorHandler.kt @@ -0,0 +1,39 @@ +package io.github.wulkanowy.ui.base + +import android.content.res.Resources +import com.chuckerteam.chucker.api.ChuckerCollector +import io.github.wulkanowy.data.exceptions.NoCurrentStudentException +import io.github.wulkanowy.sdk.scrapper.login.BadCredentialsException +import io.github.wulkanowy.utils.getString +import io.github.wulkanowy.utils.security.ScramblerException +import timber.log.Timber +import javax.inject.Inject + +open class ErrorHandler @Inject constructor(protected val resources: Resources, private val chuckerCollector: ChuckerCollector) { + + var showErrorMessage: (String, Throwable) -> Unit = { _, _ -> } + + var onSessionExpired: () -> Unit = {} + + var onNoCurrentStudent: () -> Unit = {} + + fun dispatch(error: Throwable) { + chuckerCollector.onError(error.javaClass.simpleName, error) + Timber.e(error, "An exception occurred while the Wulkanowy was running") + proceed(error) + } + + protected open fun proceed(error: Throwable) { + showErrorMessage(resources.getString(error), error) + when (error) { + is ScramblerException, is BadCredentialsException -> onSessionExpired() + is NoCurrentStudentException -> onNoCurrentStudent() + } + } + + open fun clear() { + showErrorMessage = { _, _ -> } + onSessionExpired = {} + onNoCurrentStudent = {} + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/ThemeManager.kt b/app/src/main/java/io/github/wulkanowy/ui/base/ThemeManager.kt new file mode 100644 index 00000000..50134861 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/ThemeManager.kt @@ -0,0 +1,40 @@ +package io.github.wulkanowy.ui.base + +import android.content.pm.PackageManager.GET_ACTIVITIES +import androidx.appcompat.app.AppCompatActivity +import androidx.appcompat.app.AppCompatDelegate +import androidx.appcompat.app.AppCompatDelegate.MODE_NIGHT_FOLLOW_SYSTEM +import androidx.appcompat.app.AppCompatDelegate.MODE_NIGHT_NO +import androidx.appcompat.app.AppCompatDelegate.MODE_NIGHT_YES +import io.github.wulkanowy.R +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +class ThemeManager @Inject constructor(private val preferencesRepository: PreferencesRepository) { + + fun applyActivityTheme(activity: AppCompatActivity) { + if (isThemeApplicable(activity)) { + applyDefaultTheme() + if (preferencesRepository.appTheme == "black") activity.setTheme(R.style.WulkanowyTheme_Black) + } + } + + fun applyDefaultTheme() { + AppCompatDelegate.setDefaultNightMode( + when (val theme = preferencesRepository.appTheme) { + "light" -> MODE_NIGHT_NO + "dark", "black" -> MODE_NIGHT_YES + "system" -> MODE_NIGHT_FOLLOW_SYSTEM + else -> throw IllegalArgumentException("Wrong theme: $theme") + } + ) + } + + private fun isThemeApplicable(activity: AppCompatActivity): Boolean { + return activity.packageManager.getPackageInfo(activity.packageName, GET_ACTIVITIES) + .activities.singleOrNull { it.name == activity::class.java.canonicalName }?.theme + .let { it == R.style.WulkanowyTheme_Black || it == R.style.WulkanowyTheme_NoActionBar } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/base/WidgetConfigureAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/base/WidgetConfigureAdapter.kt new file mode 100644 index 00000000..cefe6ed7 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/base/WidgetConfigureAdapter.kt @@ -0,0 +1,46 @@ +package io.github.wulkanowy.ui.base + +import android.annotation.SuppressLint +import android.graphics.PorterDuff +import android.view.LayoutInflater +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.databinding.ItemAccountBinding +import io.github.wulkanowy.utils.getThemeAttrColor +import javax.inject.Inject + +class WidgetConfigureAdapter @Inject constructor() : RecyclerView.Adapter() { + + var items = emptyList>() + + var onClickListener: (Student) -> Unit = {} + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemAccountBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + @SuppressLint("SetTextI18n") + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val (student, isCurrent) = items[position] + + with(holder.binding) { + accountItemName.text = "${student.studentName} ${student.className}" + accountItemSchool.text = student.schoolName + + with(accountItemImage) { + val colorImage = if (isCurrent) context.getThemeAttrColor(R.attr.colorPrimary) + else context.getThemeAttrColor(R.attr.colorOnSurface, 153) + + setColorFilter(colorImage, PorterDuff.Mode.SRC_IN) + } + + root.setOnClickListener { onClickListener(student) } + } + } + + class ItemViewHolder(val binding: ItemAccountBinding) : RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/login/LoginActivity.java b/app/src/main/java/io/github/wulkanowy/ui/login/LoginActivity.java deleted file mode 100644 index 26d1c146..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/login/LoginActivity.java +++ /dev/null @@ -1,223 +0,0 @@ -package io.github.wulkanowy.ui.login; - -import android.animation.Animator; -import android.animation.AnimatorListenerAdapter; -import android.content.Context; -import android.content.Intent; -import android.os.Bundle; -import android.support.design.widget.Snackbar; -import android.support.design.widget.TextInputLayout; -import android.view.View; -import android.view.inputmethod.EditorInfo; -import android.widget.ArrayAdapter; -import android.widget.AutoCompleteTextView; -import android.widget.EditText; -import android.widget.TextView; - -import javax.inject.Inject; - -import butterknife.BindView; -import butterknife.ButterKnife; -import butterknife.OnClick; -import butterknife.OnEditorAction; -import io.github.wulkanowy.R; -import io.github.wulkanowy.ui.base.BaseActivity; -import io.github.wulkanowy.ui.main.MainActivity; -import io.github.wulkanowy.utils.AppConstant; -import io.github.wulkanowy.utils.CommonUtils; -import io.github.wulkanowy.utils.KeyboardUtils; - -public class LoginActivity extends BaseActivity implements LoginContract.View { - - @BindView(R.id.login_activity_email_edit) - EditText emailView; - - @BindView(R.id.login_activity_pass_edit) - EditText passwordView; - - @BindView(R.id.login_activity_symbol_edit) - AutoCompleteTextView symbolView; - - @BindView(R.id.login_activity_form_scroll) - View loginFormView; - - @BindView(R.id.login_activity_progress_container) - View loadingBarView; - - @BindView(R.id.login_activity_progress_text) - TextView loginProgressText; - - @BindView(R.id.login_activity_symbol_text_input) - TextInputLayout symbolLayout; - - @Inject - LoginContract.Presenter presenter; - - private EditText requestedView; - - public static Intent getStartIntent(Context context) { - return new Intent(context, LoginActivity.class); - } - - @Override - public void onCreate(Bundle savedInstanceState) { - super.onCreate(savedInstanceState); - setContentView(R.layout.activity_login); - - setButterKnife(ButterKnife.bind(this)); - getActivityComponent().inject(this); - - presenter.onStart(this); - - setUpOnCreate(); - - } - - protected void setUpOnCreate() { - symbolView.setAdapter(new ArrayAdapter<>(this, android.R.layout.simple_list_item_1, - getResources().getStringArray(R.array.symbols))); - } - - @OnClick(R.id.login_activity_sign_button) - void onLoginButtonClick() { - presenter.attemptLogin( - emailView.getText().toString(), - passwordView.getText().toString(), - symbolView.getText().toString()); - } - - @OnEditorAction(value = {R.id.login_activity_symbol_edit, R.id.login_activity_pass_edit}) - boolean onEditorAction(int id) { - if (id == EditorInfo.IME_ACTION_DONE || id == EditorInfo.IME_NULL) { - onLoginButtonClick(); - return true; - } - return false; - } - - @OnClick(R.id.login_activity_create_text) - void onCreateAccountButtonClick() { - CommonUtils.openInternalBrowserViewer(getApplicationContext(), - AppConstant.VULCAN_CREATE_ACCOUNT_URL); - } - - @OnClick(R.id.login_activity_forgot_text) - void onForgotPasswordButtonClick() { - CommonUtils.openInternalBrowserViewer(getApplicationContext(), - AppConstant.VULCAN_FORGOT_PASS_URL); - } - - @Override - public void setErrorEmailRequired() { - emailView.requestFocus(); - emailView.setError(getString(R.string.error_field_required)); - requestedView = emailView; - } - - @Override - public void setErrorEmailInvalid() { - emailView.requestFocus(); - emailView.setError(getString(R.string.error_invalid_email)); - requestedView = emailView; - } - - @Override - public void setErrorPassRequired() { - passwordView.requestFocus(); - passwordView.setError(getString(R.string.error_field_required)); - requestedView = passwordView; - } - - @Override - public void setErrorPassInvalid() { - passwordView.requestFocus(); - passwordView.setError(getString(R.string.error_invalid_password)); - requestedView = passwordView; - } - - @Override - public void setErrorPassIncorrect() { - passwordView.requestFocus(); - passwordView.setError(getString(R.string.error_incorrect_password)); - requestedView = passwordView; - } - - @Override - public void setErrorSymbolRequired() { - symbolLayout.setVisibility(View.VISIBLE); - symbolView.setError(getString(R.string.error_bad_account_permission)); - symbolView.requestFocus(); - requestedView = symbolView; - } - - @Override - public void resetViewErrors() { - emailView.setError(null); - passwordView.setError(null); - } - - @Override - public void showSoftInput() { - KeyboardUtils.showSoftInput(requestedView, this); - } - - @Override - public void hideSoftInput() { - KeyboardUtils.hideSoftInput(this); - } - - @Override - public void onError(String message) { - Snackbar.make(findViewById(R.id.login_activity_container), message, - Snackbar.LENGTH_LONG).show(); - } - - @Override - public void setStepOneLoginProgress() { - onLoginProgressUpdate("1", getString(R.string.step_login)); - } - - @Override - public void setStepTwoLoginProgress() { - onLoginProgressUpdate("2", getString(R.string.step_synchronization)); - } - - @Override - public void openMainActivity() { - startActivity(MainActivity.getStartIntent(this)); - finish(); - } - - @Override - public void showLoginProgress(final boolean show) { - int animTime = getResources().getInteger(android.R.integer.config_shortAnimTime); - - loginFormView.setVisibility(show ? View.GONE : View.VISIBLE); - loginFormView.animate().setDuration(animTime).alpha( - show ? 0 : 1).setListener(new AnimatorListenerAdapter() { - @Override - public void onAnimationEnd(Animator animation) { - loginFormView.setVisibility(show ? View.GONE : View.VISIBLE); - } - }); - - loadingBarView.setVisibility(show ? View.VISIBLE : View.GONE); - loadingBarView.animate().setDuration(animTime).alpha( - show ? 1 : 0).setListener(new AnimatorListenerAdapter() { - @Override - public void onAnimationEnd(Animator animation) { - loadingBarView.setVisibility(show ? View.VISIBLE : View.GONE); - } - }); - } - - @Override - public void onDestroy() { - super.onDestroy(); - presenter.onDestroy(); - } - - private void onLoginProgressUpdate(String step, String message) { - loginProgressText.setText(String.format("%1$s/2 - %2$s...", step, message)); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/login/LoginContract.java b/app/src/main/java/io/github/wulkanowy/ui/login/LoginContract.java deleted file mode 100644 index fa074896..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/login/LoginContract.java +++ /dev/null @@ -1,53 +0,0 @@ -package io.github.wulkanowy.ui.login; - -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.di.annotations.PerActivity; -import io.github.wulkanowy.ui.base.BaseContract; - -public interface LoginContract { - interface View extends BaseContract.View { - - void setErrorEmailRequired(); - - void setErrorPassRequired(); - - void setErrorSymbolRequired(); - - void setErrorEmailInvalid(); - - void setErrorPassInvalid(); - - void setErrorPassIncorrect(); - - void resetViewErrors(); - - void setStepOneLoginProgress(); - - void setStepTwoLoginProgress(); - - void openMainActivity(); - - void showLoginProgress(boolean show); - - void showSoftInput(); - - void hideSoftInput(); - - } - - @PerActivity - interface Presenter extends BaseContract.Presenter { - - void attemptLogin(String email, String password, String symbol); - - void onStartAsync(); - - void onLoginProgress(int step); - - void onEndAsync(boolean success, Exception exception); - - void onCanceledAsync(); - - RepositoryContract getRepository(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/login/LoginPresenter.java b/app/src/main/java/io/github/wulkanowy/ui/login/LoginPresenter.java deleted file mode 100644 index c8e84725..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/login/LoginPresenter.java +++ /dev/null @@ -1,143 +0,0 @@ -package io.github.wulkanowy.ui.login; - -import android.text.TextUtils; - -import java.util.LinkedHashMap; - -import javax.inject.Inject; - -import io.github.wulkanowy.api.login.AccountPermissionException; -import io.github.wulkanowy.api.login.BadCredentialsException; -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.ui.base.BasePresenter; -import io.github.wulkanowy.utils.AppConstant; - -public class LoginPresenter extends BasePresenter - implements LoginContract.Presenter { - - private LoginTask loginAsync; - - @Inject - LoginPresenter(RepositoryContract repository) { - super(repository); - } - - @Override - public void onDestroy() { - super.onDestroy(); - if (loginAsync != null) { - loginAsync.cancel(true); - loginAsync = null; - } - } - - @Override - public void attemptLogin(String email, String password, String symbol) { - getView().resetViewErrors(); - - if (!isAllFieldCorrect(password, email)) { - getView().showSoftInput(); - return; - } - - if (getView().isNetworkConnected()) { - // Dopóki używamy AsyncTask presenter będzie musiał "wiedzieć" o AsyncTaskach - loginAsync = new LoginTask(this, - email, - password, - getNormalizedSymbol(symbol)); - loginAsync.execute(); - - } else { - getView().onNoNetworkError(); - } - - getView().hideSoftInput(); - } - - @Override - public void onStartAsync() { - getView().showLoginProgress(true); - } - - @Override - public void onLoginProgress(int step) { - if (step == 1) { - getView().setStepOneLoginProgress(); - } else if (step == 2) { - getView().setStepTwoLoginProgress(); - } - } - - @Override - public void onEndAsync(boolean success, Exception exception) { - if (success) { - getView().openMainActivity(); - } else if (exception instanceof BadCredentialsException) { - getView().setErrorPassIncorrect(); - getView().showSoftInput(); - getView().showLoginProgress(false); - } else if (exception instanceof AccountPermissionException) { - getView().setErrorSymbolRequired(); - getView().showSoftInput(); - getView().showLoginProgress(false); - } else { - getView().onError(getRepository().getErrorLoginMessage(exception)); - getView().showLoginProgress(false); - } - - } - - @Override - public void onCanceledAsync() { - getView().showLoginProgress(false); - } - - private boolean isEmailValid(String email) { - return email.contains("@") || email.contains("\\\\"); - } - - private boolean isPasswordValid(String password) { - return password.length() > 4; - } - - private String getNormalizedSymbol(String symbol) { - if (TextUtils.isEmpty(symbol)) { - return AppConstant.DEFAULT_SYMBOL; - } - - String[] keys = getRepository().getSymbolsKeysArray(); - String[] values = getRepository().getSymbolsValuesArray(); - LinkedHashMap map = new LinkedHashMap<>(); - - for (int i = 0; i < Math.min(keys.length, values.length); ++i) { - map.put(keys[i], values[i]); - } - - if (map.containsKey(symbol)) { - return map.get(symbol); - } - return AppConstant.DEFAULT_SYMBOL; - } - - private boolean isAllFieldCorrect(String password, String email) { - boolean correct = true; - - if (TextUtils.isEmpty(password)) { - getView().setErrorPassRequired(); - correct = false; - } else if (!isPasswordValid(password)) { - getView().setErrorPassInvalid(); - correct = false; - } - - if (TextUtils.isEmpty(email)) { - getView().setErrorEmailRequired(); - correct = false; - } else if (!isEmailValid(email)) { - getView().setErrorEmailInvalid(); - correct = false; - } - return correct; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/login/LoginTask.java b/app/src/main/java/io/github/wulkanowy/ui/login/LoginTask.java deleted file mode 100644 index 441b8d8d..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/login/LoginTask.java +++ /dev/null @@ -1,58 +0,0 @@ -package io.github.wulkanowy.ui.login; - -import android.os.AsyncTask; - -public class LoginTask extends AsyncTask { - - private String email; - - private String password; - - private String symbol; - - private LoginContract.Presenter presenter; - - private Exception exception; - - LoginTask(LoginContract.Presenter presenter, String email, String password, String symbol) { - this.presenter = presenter; - this.email = email; - this.password = password; - this.symbol = symbol; - } - - @Override - protected void onPreExecute() { - presenter.onStartAsync(); - } - - @Override - protected Boolean doInBackground(Void... params) { - try { - publishProgress(1); - presenter.getRepository().loginUser(email, password, symbol); - - publishProgress(2); - presenter.getRepository().syncAll(); - } catch (Exception e) { - exception = e; - return false; - } - return true; - } - - @Override - protected void onProgressUpdate(Integer... progress) { - presenter.onLoginProgress(progress[0]); - } - - @Override - protected void onPostExecute(Boolean success) { - presenter.onEndAsync(success, exception); - } - - @Override - protected void onCancelled() { - presenter.onCanceledAsync(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/MainActivity.java b/app/src/main/java/io/github/wulkanowy/ui/main/MainActivity.java deleted file mode 100644 index d4c0b9da..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/MainActivity.java +++ /dev/null @@ -1,153 +0,0 @@ -package io.github.wulkanowy.ui.main; - -import android.content.Context; -import android.content.Intent; -import android.graphics.Color; -import android.os.Bundle; -import android.support.v7.app.ActionBar; -import android.view.View; - -import com.aurelhubert.ahbottomnavigation.AHBottomNavigation; -import com.aurelhubert.ahbottomnavigation.AHBottomNavigationItem; -import com.aurelhubert.ahbottomnavigation.AHBottomNavigationViewPager; - -import javax.inject.Inject; - -import butterknife.BindView; -import butterknife.ButterKnife; -import io.github.wulkanowy.R; -import io.github.wulkanowy.services.SyncJob; -import io.github.wulkanowy.ui.base.BaseActivity; -import io.github.wulkanowy.ui.main.dashboard.DashboardFragment; -import io.github.wulkanowy.ui.main.grades.GradesFragment; -import io.github.wulkanowy.ui.main.timetable.TimetableFragment; - -public class MainActivity extends BaseActivity implements MainContract.View, - AHBottomNavigation.OnTabSelectedListener, OnFragmentIsReadyListener { - - private int initTabPosition = 0; - - @BindView(R.id.main_activity_nav) - AHBottomNavigation bottomNavigation; - - @BindView(R.id.main_activity_view_pager) - AHBottomNavigationViewPager viewPager; - - @BindView(R.id.main_activity_progress_bar) - View progressBar; - - @Inject - MainPagerAdapter pagerAdapter; - - @Inject - MainContract.Presenter presenter; - - public static Intent getStartIntent(Context context) { - return new Intent(context, MainActivity.class); - } - - @Override - public void onCreate(Bundle savedInstanceState) { - super.onCreate(savedInstanceState); - setContentView(R.layout.activity_main); - - initTabPosition = getIntent().getIntExtra(SyncJob.EXTRA_INTENT_KEY, initTabPosition); - - getActivityComponent().inject(this); - setButterKnife(ButterKnife.bind(this)); - - presenter.onStart(this); - - initiationViewPager(); - initiationBottomNav(); - } - - @Override - public void showProgressBar(boolean show) { - progressBar.setVisibility(show ? View.VISIBLE : View.INVISIBLE); - viewPager.setVisibility(show ? View.INVISIBLE : View.VISIBLE); - bottomNavigation.setVisibility(show ? View.INVISIBLE : View.VISIBLE); - } - - @Override - public void showActionBar() { - ActionBar actionBar = getSupportActionBar(); - if (actionBar != null) { - actionBar.show(); - } - } - - @Override - public void hideActionBar() { - ActionBar actionBar = getSupportActionBar(); - if (actionBar != null) { - actionBar.hide(); - } - } - - @Override - public boolean onTabSelected(int position, boolean wasSelected) { - presenter.onTabSelected(position, wasSelected); - return true; - } - - @Override - public void setCurrentPage(int position) { - viewPager.setCurrentItem(position, false); - } - - @Override - public void onFragmentIsReady() { - presenter.onFragmentIsReady(); - } - - private void initiationBottomNav() { - bottomNavigation.addItem(new AHBottomNavigationItem( - getString(R.string.grades_text), - getResources().getDrawable(R.drawable.ic_menu_grade_26dp) - )); - bottomNavigation.addItem(new AHBottomNavigationItem( - getString(R.string.attendance_text), - getResources().getDrawable(R.drawable.ic_menu_attendance_24dp) - )); - bottomNavigation.addItem(new AHBottomNavigationItem( - getString(R.string.dashboard_text), - getResources().getDrawable(R.drawable.ic_menu_dashboard_24dp) - )); - bottomNavigation.addItem(new AHBottomNavigationItem( - getString(R.string.lessonplan_text), - getResources().getDrawable(R.drawable.ic_menu_timetable_24dp) - )); - bottomNavigation.addItem(new AHBottomNavigationItem( - getString(R.string.settings_text), - getResources().getDrawable(R.drawable.ic_menu_other_24dp) - )); - - bottomNavigation.setAccentColor(getResources().getColor(R.color.colorPrimary)); - bottomNavigation.setInactiveColor(Color.BLACK); - bottomNavigation.setBackgroundColor(getResources().getColor(R.color.colorBackgroundBottomNav)); - bottomNavigation.setTitleState(AHBottomNavigation.TitleState.ALWAYS_SHOW); - bottomNavigation.setOnTabSelectedListener(this); - bottomNavigation.setCurrentItem(initTabPosition); - bottomNavigation.setBehaviorTranslationEnabled(false); - } - - private void initiationViewPager() { - pagerAdapter.addFragment(new GradesFragment()); - pagerAdapter.addFragment(new DashboardFragment()); - pagerAdapter.addFragment(new DashboardFragment()); - pagerAdapter.addFragment(new TimetableFragment()); - pagerAdapter.addFragment(new DashboardFragment()); - - viewPager.setPagingEnabled(false); - viewPager.setAdapter(pagerAdapter); - viewPager.setOffscreenPageLimit(4); - viewPager.setCurrentItem(initTabPosition, false); - } - - @Override - protected void onDestroy() { - super.onDestroy(); - presenter.onDestroy(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/MainContract.java b/app/src/main/java/io/github/wulkanowy/ui/main/MainContract.java deleted file mode 100644 index cb1d5d7c..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/MainContract.java +++ /dev/null @@ -1,26 +0,0 @@ -package io.github.wulkanowy.ui.main; - -import io.github.wulkanowy.di.annotations.PerActivity; -import io.github.wulkanowy.ui.base.BaseContract; - -public interface MainContract { - - interface View extends BaseContract.View { - - void setCurrentPage(int position); - - void showProgressBar(boolean show); - - void showActionBar(); - - void hideActionBar(); - } - - @PerActivity - interface Presenter extends BaseContract.Presenter { - - void onTabSelected(int position, boolean wasSelected); - - void onFragmentIsReady(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/MainPagerAdapter.java b/app/src/main/java/io/github/wulkanowy/ui/main/MainPagerAdapter.java deleted file mode 100644 index fcc51fb5..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/MainPagerAdapter.java +++ /dev/null @@ -1,31 +0,0 @@ -package io.github.wulkanowy.ui.main; - -import android.support.v4.app.Fragment; -import android.support.v4.app.FragmentManager; -import android.support.v4.app.FragmentStatePagerAdapter; - -import java.util.ArrayList; -import java.util.List; - -public class MainPagerAdapter extends FragmentStatePagerAdapter { - - private List fragmentList = new ArrayList<>(); - - public MainPagerAdapter(FragmentManager fragmentManager) { - super(fragmentManager); - } - - void addFragment(Fragment fragment) { - fragmentList.add(fragment); - } - - @Override - public Fragment getItem(int position) { - return fragmentList.get(position); - } - - @Override - public int getCount() { - return fragmentList.size(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/MainPresenter.java b/app/src/main/java/io/github/wulkanowy/ui/main/MainPresenter.java deleted file mode 100644 index 149e49e2..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/MainPresenter.java +++ /dev/null @@ -1,44 +0,0 @@ -package io.github.wulkanowy.ui.main; - - -import javax.inject.Inject; - -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.ui.base.BasePresenter; - -public class MainPresenter extends BasePresenter - implements MainContract.Presenter { - - private int fragmentCount = 0; - - @Inject - MainPresenter(RepositoryContract repository) { - super(repository); - } - - @Override - public void onStart(MainContract.View view) { - super.onStart(view); - getView().showProgressBar(true); - getView().hideActionBar(); - } - - @Override - public void onTabSelected(int position, boolean wasSelected) { - if (!wasSelected) { - getView().setCurrentPage(position); - } - } - - @Override - public void onFragmentIsReady() { - if (fragmentCount < 5) { - fragmentCount++; - } - - if (fragmentCount == 5) { - getView().showActionBar(); - getView().showProgressBar(false); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/OnFragmentIsReadyListener.java b/app/src/main/java/io/github/wulkanowy/ui/main/OnFragmentIsReadyListener.java deleted file mode 100644 index 21e3ba12..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/OnFragmentIsReadyListener.java +++ /dev/null @@ -1,6 +0,0 @@ -package io.github.wulkanowy.ui.main; - -public interface OnFragmentIsReadyListener { - - void onFragmentIsReady(); -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/attendance/AttendanceContract.java b/app/src/main/java/io/github/wulkanowy/ui/main/attendance/AttendanceContract.java deleted file mode 100644 index fe403717..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/attendance/AttendanceContract.java +++ /dev/null @@ -1,23 +0,0 @@ -package io.github.wulkanowy.ui.main.attendance; - -import io.github.wulkanowy.di.annotations.PerFragment; -import io.github.wulkanowy.ui.base.BaseContract; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; - -public interface AttendanceContract { - - interface View extends BaseContract.View { - - void setActivityTitle(); - - boolean isMenuVisible(); - } - - @PerFragment - interface Presenter extends BaseContract.Presenter { - - void onStart(View view, OnFragmentIsReadyListener listener); - - void onFragmentVisible(boolean isVisible); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/attendance/AttendanceFragment.java b/app/src/main/java/io/github/wulkanowy/ui/main/attendance/AttendanceFragment.java deleted file mode 100644 index 6010d108..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/attendance/AttendanceFragment.java +++ /dev/null @@ -1,59 +0,0 @@ -package io.github.wulkanowy.ui.main.attendance; - -import android.os.Bundle; -import android.support.annotation.NonNull; -import android.view.LayoutInflater; -import android.view.View; -import android.view.ViewGroup; - -import javax.inject.Inject; - -import butterknife.ButterKnife; -import io.github.wulkanowy.R; -import io.github.wulkanowy.di.component.FragmentComponent; -import io.github.wulkanowy.ui.base.BaseFragment; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; - -public class AttendanceFragment extends BaseFragment implements AttendanceContract.View { - - @Inject - AttendanceContract.Presenter presenter; - - public AttendanceFragment() { - // empty constructor for fragment - } - - @Override - public View onCreateView(@NonNull LayoutInflater inflater, ViewGroup container, - Bundle savedInstanceState) { - View view = inflater.inflate(R.layout.fragment_attendance, container, false); - - FragmentComponent component = getFragmentComponent(); - if (component != null) { - component.inject(this); - setButterKnife(ButterKnife.bind(this, view)); - presenter.onStart(this, (OnFragmentIsReadyListener) getActivity()); - } - - return view; - } - - @Override - public void setMenuVisibility(boolean menuVisible) { - super.setMenuVisibility(menuVisible); - if (presenter != null) { - presenter.onFragmentVisible(menuVisible); - } - } - - @Override - public void setActivityTitle() { - setTitle(getString(R.string.dashboard_text)); - } - - @Override - public void onDestroyView() { - super.onDestroyView(); - presenter.onDestroy(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/attendance/AttendancePresenter.java b/app/src/main/java/io/github/wulkanowy/ui/main/attendance/AttendancePresenter.java deleted file mode 100644 index da43e320..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/attendance/AttendancePresenter.java +++ /dev/null @@ -1,37 +0,0 @@ -package io.github.wulkanowy.ui.main.attendance; - -import javax.inject.Inject; - -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.ui.base.BasePresenter; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; - -public class AttendancePresenter extends BasePresenter - implements AttendanceContract.Presenter { - - private OnFragmentIsReadyListener listener; - - @Inject - AttendancePresenter(RepositoryContract repository) { - super(repository); - } - - @Override - public void onStart(AttendanceContract.View view, OnFragmentIsReadyListener listener) { - super.onStart(view); - this.listener = listener; - - if (getView().isMenuVisible()) { - getView().setActivityTitle(); - } - - this.listener.onFragmentIsReady(); - } - - @Override - public void onFragmentVisible(boolean isVisible) { - if (isVisible) { - getView().setActivityTitle(); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/dashboard/DashboardContract.java b/app/src/main/java/io/github/wulkanowy/ui/main/dashboard/DashboardContract.java deleted file mode 100644 index 2488eb95..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/dashboard/DashboardContract.java +++ /dev/null @@ -1,23 +0,0 @@ -package io.github.wulkanowy.ui.main.dashboard; - -import io.github.wulkanowy.di.annotations.PerActivity; -import io.github.wulkanowy.ui.base.BaseContract; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; - -public interface DashboardContract { - - interface View extends BaseContract.View { - - void setActivityTitle(); - - boolean isMenuVisible(); - } - - @PerActivity - interface Presenter extends BaseContract.Presenter { - - void onStart(View view, OnFragmentIsReadyListener listener); - - void onFragmentVisible(boolean isVisible); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/dashboard/DashboardFragment.java b/app/src/main/java/io/github/wulkanowy/ui/main/dashboard/DashboardFragment.java deleted file mode 100644 index 0832b5fb..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/dashboard/DashboardFragment.java +++ /dev/null @@ -1,48 +0,0 @@ -package io.github.wulkanowy.ui.main.dashboard; - -import android.os.Bundle; -import android.support.annotation.NonNull; -import android.view.LayoutInflater; -import android.view.View; -import android.view.ViewGroup; - -import javax.inject.Inject; - -import butterknife.ButterKnife; -import io.github.wulkanowy.R; -import io.github.wulkanowy.di.component.FragmentComponent; -import io.github.wulkanowy.ui.base.BaseFragment; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; - -public class DashboardFragment extends BaseFragment implements DashboardContract.View { - - @Inject - DashboardContract.Presenter presenter; - - @Override - public View onCreateView(@NonNull LayoutInflater inflater, ViewGroup container, - Bundle savedInstanceState) { - View view = inflater.inflate(R.layout.fragment_board, container, false); - - FragmentComponent component = getFragmentComponent(); - if (component != null) { - component.inject(this); - setButterKnife(ButterKnife.bind(this, view)); - presenter.onStart(this, (OnFragmentIsReadyListener) getActivity()); - } - return view; - } - - @Override - public void setMenuVisibility(boolean menuVisible) { - super.setMenuVisibility(menuVisible); - if (presenter != null) { - presenter.onFragmentVisible(menuVisible); - } - } - - @Override - public void setActivityTitle() { - setTitle(getString(R.string.dashboard_text)); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/dashboard/DashboardPresenter.java b/app/src/main/java/io/github/wulkanowy/ui/main/dashboard/DashboardPresenter.java deleted file mode 100644 index 58d89b39..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/dashboard/DashboardPresenter.java +++ /dev/null @@ -1,37 +0,0 @@ -package io.github.wulkanowy.ui.main.dashboard; - -import javax.inject.Inject; - -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.ui.base.BasePresenter; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; - -public class DashboardPresenter extends BasePresenter - implements DashboardContract.Presenter { - - private OnFragmentIsReadyListener listener; - - @Inject - DashboardPresenter(RepositoryContract repository) { - super(repository); - } - - @Override - public void onStart(DashboardContract.View view, OnFragmentIsReadyListener listener) { - super.onStart(view); - this.listener = listener; - - if (getView().isMenuVisible()) { - getView().setActivityTitle(); - } - - this.listener.onFragmentIsReady(); - } - - @Override - public void onFragmentVisible(boolean isVisible) { - if (isVisible) { - getView().setActivityTitle(); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradeHeaderItem.java b/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradeHeaderItem.java deleted file mode 100644 index 5edabb7b..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradeHeaderItem.java +++ /dev/null @@ -1,117 +0,0 @@ -package io.github.wulkanowy.ui.main.grades; - - -import android.content.res.Resources; -import android.view.View; -import android.widget.TextView; - -import org.apache.commons.lang3.builder.EqualsBuilder; -import org.apache.commons.lang3.builder.HashCodeBuilder; - -import java.util.List; - -import butterknife.BindView; -import butterknife.ButterKnife; -import eu.davidea.flexibleadapter.FlexibleAdapter; -import eu.davidea.flexibleadapter.items.AbstractExpandableHeaderItem; -import eu.davidea.viewholders.ExpandableViewHolder; -import io.github.wulkanowy.R; -import io.github.wulkanowy.data.db.dao.entities.Subject; -import io.github.wulkanowy.utils.AverageCalculator; - -public class GradeHeaderItem - extends AbstractExpandableHeaderItem { - - private Subject subject; - - GradeHeaderItem(Subject subject) { - this.subject = subject; - } - - @Override - public boolean equals(Object o) { - if (this == o) return true; - - if (o == null || getClass() != o.getClass()) return false; - - GradeHeaderItem that = (GradeHeaderItem) o; - - return new EqualsBuilder() - .append(subject, that.subject) - .isEquals(); - } - - @Override - public int hashCode() { - return new HashCodeBuilder(17, 37) - .append(subject) - .toHashCode(); - } - - @Override - public int getLayoutRes() { - return R.layout.grade_header; - } - - @Override - public HeaderViewHolder createViewHolder(View view, FlexibleAdapter adapter) { - return new HeaderViewHolder(view, adapter); - } - - @Override - public void bindViewHolder(FlexibleAdapter adapter, HeaderViewHolder holder, int position, List payloads) { - holder.onBind(subject, getSubItems()); - } - - static class HeaderViewHolder extends ExpandableViewHolder { - - @BindView(R.id.grade_header_subject_text) - TextView subjectName; - - @BindView(R.id.grade_header_average_text) - TextView averageText; - - @BindView(R.id.grade_header_number_of_grade_text) - TextView numberText; - - @BindView(R.id.grade_header_alert_image) - View alertImage; - - Resources resources; - - HeaderViewHolder(View view, FlexibleAdapter adapter) { - super(view, adapter); - ButterKnife.bind(this, view); - resources = view.getResources(); - view.setOnClickListener(this); - } - - void onBind(Subject item, List subItems) { - subjectName.setText(item.getName()); - numberText.setText(resources.getQuantityString(R.plurals.numberOfGradesPlurals, - subItems.size(), subItems.size())); - averageText.setText(getGradesAverageString(item)); - alertImage.setVisibility(isSubItemsRead(subItems) ? View.INVISIBLE : View.VISIBLE); - alertImage.setTag(item.getName()); - } - - private boolean isSubItemsRead(List subItems) { - boolean isRead = true; - - for (GradesSubItem item : subItems) { - isRead = item.getGrade().getRead(); - } - return isRead; - } - - private String getGradesAverageString(Subject item) { - float average = AverageCalculator.calculate(item.getGradeList()); - - if (average < 0) { - return resources.getString(R.string.info_no_average); - } else { - return resources.getString(R.string.info_average_grades, average); - } - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesContract.java b/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesContract.java deleted file mode 100644 index 7deabb5e..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesContract.java +++ /dev/null @@ -1,40 +0,0 @@ -package io.github.wulkanowy.ui.main.grades; - -import android.support.v4.widget.SwipeRefreshLayout; - -import java.util.List; - -import io.github.wulkanowy.di.annotations.PerActivity; -import io.github.wulkanowy.ui.base.BaseContract; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; - -public interface GradesContract { - - interface View extends BaseContract.View, SwipeRefreshLayout.OnRefreshListener { - - void updateAdapterList(List headerItems); - - void showNoItem(boolean show); - - void onRefreshSuccessNoGrade(); - - void onRefreshSuccess(int number); - - void hideRefreshingBar(); - - void setActivityTitle(); - - boolean isMenuVisible(); - - } - - @PerActivity - interface Presenter extends BaseContract.Presenter { - - void onFragmentVisible(boolean isVisible); - - void onRefresh(); - - void onStart(View view, OnFragmentIsReadyListener listener); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesDialogFragment.java b/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesDialogFragment.java deleted file mode 100644 index 0d9a699f..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesDialogFragment.java +++ /dev/null @@ -1,116 +0,0 @@ -package io.github.wulkanowy.ui.main.grades; - - -import android.os.Bundle; -import android.support.annotation.NonNull; -import android.support.annotation.Nullable; -import android.support.v4.app.DialogFragment; -import android.view.LayoutInflater; -import android.view.View; -import android.view.ViewGroup; -import android.widget.TextView; - -import butterknife.BindView; -import butterknife.ButterKnife; -import butterknife.OnClick; -import io.github.wulkanowy.R; -import io.github.wulkanowy.data.db.dao.entities.Grade; -import io.github.wulkanowy.utils.CommonUtils; - -public class GradesDialogFragment extends DialogFragment { - - private static final String ARGUMENT_KEY = "Item"; - - private Grade grade; - - @BindView(R.id.grade_dialog_value) - TextView value; - - @BindView(R.id.grade_dialog_subject) - TextView subject; - - @BindView(R.id.grade_dialog_description_value) - TextView description; - - @BindView(R.id.grade_dialog_weight_value) - TextView weight; - - @BindView(R.id.grade_dialog_teacher_value) - TextView teacher; - - @BindView(R.id.grade_dialog_color_value) - TextView color; - - @BindView(R.id.grade_dialog_date_value) - TextView date; - - public GradesDialogFragment() { - //empty constructor for fragment - } - - public static GradesDialogFragment newInstance(Grade item) { - GradesDialogFragment dialogFragment = new GradesDialogFragment(); - - Bundle bundle = new Bundle(); - bundle.putSerializable(ARGUMENT_KEY, item); - - dialogFragment.setArguments(bundle); - - return dialogFragment; - } - - @Override - public void onCreate(@Nullable Bundle savedInstanceState) { - super.onCreate(savedInstanceState); - if (getArguments() != null) { - grade = (Grade) getArguments().getSerializable(ARGUMENT_KEY); - } - } - - @Nullable - @Override - public View onCreateView(@NonNull LayoutInflater inflater, @Nullable ViewGroup container, @Nullable Bundle savedInstanceState) { - View view = inflater.inflate(R.layout.grade_dialog, container, false); - - ButterKnife.bind(this, view); - - subject.setText(grade.getSubject()); - value.setText(grade.getValue()); - value.setBackgroundResource(grade.getValueColor()); - weight.setText(grade.getWeight()); - date.setText(grade.getDate()); - color.setText(CommonUtils.colorHexToColorName(grade.getColor())); - teacher.setText(getTeacherString()); - description.setText(getDescriptionString()); - - - return view; - } - - @OnClick(R.id.grade_dialog_close_button) - void onClickClose() { - dismiss(); - } - - private String getDescriptionString() { - if ("".equals(grade.getDescription())) { - if (!"".equals(grade.getSymbol())) { - return grade.getSymbol(); - } else { - return getString(R.string.noDescription_text); - } - } else if (!"".equals(grade.getSymbol())) { - return String.format("%1$s - %2$s", grade.getSymbol(), grade.getDescription()); - } else { - return grade.getDescription(); - } - } - - private String getTeacherString() { - if (grade.getTeacher() != null && !"".equals(grade.getTeacher())) { - return grade.getTeacher(); - } else { - return getString(R.string.generic_app_no_data); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesFragment.java b/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesFragment.java deleted file mode 100644 index bd44f298..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesFragment.java +++ /dev/null @@ -1,133 +0,0 @@ -package io.github.wulkanowy.ui.main.grades; - -import android.os.Bundle; -import android.support.annotation.NonNull; -import android.support.annotation.Nullable; -import android.support.design.widget.Snackbar; -import android.support.v4.widget.SwipeRefreshLayout; -import android.support.v7.widget.RecyclerView; -import android.view.LayoutInflater; -import android.view.View; -import android.view.ViewGroup; - -import java.util.List; - -import javax.inject.Inject; - -import butterknife.BindView; -import butterknife.ButterKnife; -import eu.davidea.flexibleadapter.FlexibleAdapter; -import eu.davidea.flexibleadapter.common.SmoothScrollLinearLayoutManager; -import io.github.wulkanowy.R; -import io.github.wulkanowy.di.component.FragmentComponent; -import io.github.wulkanowy.ui.base.BaseFragment; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; - -public class GradesFragment extends BaseFragment implements GradesContract.View { - - @BindView(R.id.grade_fragment_recycler) - RecyclerView recyclerView; - - @BindView(R.id.grade_fragment_no_item_container) - View noItemView; - - @BindView(R.id.grade_fragment_swipe_refresh) - SwipeRefreshLayout refreshLayout; - - @Inject - FlexibleAdapter adapter; - - @Inject - GradesContract.Presenter presenter; - - public GradesFragment() { - // empty constructor for fragment - } - - @Nullable - @Override - public View onCreateView(@NonNull LayoutInflater inflater, @Nullable ViewGroup container, @Nullable Bundle savedInstanceState) { - View view = inflater.inflate(R.layout.fragment_grades, container, false); - - FragmentComponent component = getFragmentComponent(); - if (component != null) { - component.inject(this); - setButterKnife(ButterKnife.bind(this, view)); - presenter.onStart(this, (OnFragmentIsReadyListener) getActivity()); - } - - return view; - } - - @Override - protected void setUpOnViewCreated(View fragmentView) { - noItemView.setVisibility(View.GONE); - - adapter.setAutoCollapseOnExpand(true); - adapter.setAutoScrollOnExpand(true); - adapter.expandItemsAtStartUp(); - - recyclerView.setLayoutManager(new SmoothScrollLinearLayoutManager(fragmentView.getContext())); - recyclerView.setAdapter(adapter); - - refreshLayout.setColorSchemeResources(android.R.color.black); - refreshLayout.setOnRefreshListener(this); - } - - @Override - public void setMenuVisibility(boolean menuVisible) { - super.setMenuVisibility(menuVisible); - if (presenter != null) { - presenter.onFragmentVisible(menuVisible); - } - } - - @Override - public void setActivityTitle() { - setTitle(getString(R.string.grades_text)); - } - - @Override - public void onRefresh() { - presenter.onRefresh(); - } - - @Override - public void showNoItem(boolean show) { - noItemView.setVisibility(show ? View.VISIBLE : View.INVISIBLE); - } - - @Override - public void hideRefreshingBar() { - refreshLayout.setRefreshing(false); - } - - @Override - public void updateAdapterList(List headerItems) { - adapter.updateDataSet(headerItems); - } - - @Override - public void onRefreshSuccessNoGrade() { - onError(R.string.snackbar_no_grades); - } - - @Override - public void onRefreshSuccess(int number) { - onError(getString(R.string.snackbar_new_grade, number)); - } - - @Override - public void onError(String message) { - if (getActivity() != null) { - Snackbar.make(getActivity().findViewById(R.id.main_activity_view_pager), - message, Snackbar.LENGTH_LONG).show(); - } - } - - @Override - public void onDestroyView() { - presenter.onDestroy(); - super.onDestroyView(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesPresenter.java b/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesPresenter.java deleted file mode 100644 index cae2fbcb..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesPresenter.java +++ /dev/null @@ -1,157 +0,0 @@ -package io.github.wulkanowy.ui.main.grades; - -import java.util.ArrayList; -import java.util.List; - -import javax.inject.Inject; - -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.data.db.dao.entities.Grade; -import io.github.wulkanowy.data.db.dao.entities.Subject; -import io.github.wulkanowy.ui.base.BasePresenter; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; -import io.github.wulkanowy.utils.async.AbstractTask; -import io.github.wulkanowy.utils.async.AsyncListeners; - -public class GradesPresenter extends BasePresenter - implements GradesContract.Presenter, AsyncListeners.OnRefreshListener, - AsyncListeners.OnFirstLoadingListener { - - private AbstractTask refreshTask; - - private AbstractTask loadingTask; - - private OnFragmentIsReadyListener listener; - - private List headerItems = new ArrayList<>(); - - private boolean isFirstSight = false; - - @Inject - GradesPresenter(RepositoryContract repository) { - super(repository); - } - - @Override - public void onStart(GradesContract.View view, OnFragmentIsReadyListener listener) { - super.onStart(view); - this.listener = listener; - - if (getView().isMenuVisible()) { - getView().setActivityTitle(); - } - - if (!isFirstSight) { - isFirstSight = true; - - loadingTask = new AbstractTask(); - loadingTask.setOnFirstLoadingListener(this); - loadingTask.execute(); - } - } - - @Override - public void onFragmentVisible(boolean isVisible) { - if (isVisible) { - getView().setActivityTitle(); - } - } - - @Override - public void onRefresh() { - if (getView().isNetworkConnected()) { - refreshTask = new AbstractTask(); - refreshTask.setOnRefreshListener(this); - refreshTask.execute(); - } else { - getView().onNoNetworkError(); - getView().hideRefreshingBar(); - } - } - - @Override - public void onDoInBackgroundRefresh() throws Exception { - getRepository().loginCurrentUser(); - getRepository().syncSubjects(); - getRepository().syncGrades(); - } - - @Override - public void onCanceledRefreshAsync() { - getView().hideRefreshingBar(); - } - - @Override - public void onEndRefreshAsync(boolean success, Exception exception) { - if (success) { - loadingTask = new AbstractTask(); - loadingTask.setOnFirstLoadingListener(this); - loadingTask.execute(); - - int numberOfNewGrades = getRepository().getNewGrades().size(); - - if (numberOfNewGrades <= 0) { - getView().onRefreshSuccessNoGrade(); - } else { - getView().onRefreshSuccess(numberOfNewGrades); - } - } else { - getView().onError(getRepository().getErrorLoginMessage(exception)); - } - getView().hideRefreshingBar(); - } - - @Override - public void onDoInBackgroundLoading() throws Exception { - List subjectList = getRepository().getCurrentUser().getSubjectList(); - - headerItems = new ArrayList<>(); - - for (Subject subject : subjectList) { - List gradeList = subject.getGradeList(); - - if (!gradeList.isEmpty()) { - GradeHeaderItem headerItem = new GradeHeaderItem(subject); - - List subItems = new ArrayList<>(); - - for (Grade grade : gradeList) { - subItems.add(new GradesSubItem(headerItem, grade)); - } - - headerItem.setSubItems(subItems); - headerItem.setExpanded(false); - headerItems.add(headerItem); - } - } - } - - @Override - public void onCanceledLoadingAsync() { - // do nothing - } - - @Override - public void onEndLoadingAsync(boolean result, Exception exception) { - if (headerItems.isEmpty()) { - getView().showNoItem(true); - } else { - getView().updateAdapterList(headerItems); - getView().showNoItem(false); - listener.onFragmentIsReady(); - } - } - - @Override - public void onDestroy() { - super.onDestroy(); - if (refreshTask != null) { - refreshTask.cancel(true); - refreshTask = null; - } - if (loadingTask != null) { - loadingTask.cancel(true); - loadingTask = null; - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesSubItem.java b/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesSubItem.java deleted file mode 100644 index c252bb2a..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/grades/GradesSubItem.java +++ /dev/null @@ -1,150 +0,0 @@ -package io.github.wulkanowy.ui.main.grades; - -import android.app.Activity; -import android.content.Context; -import android.support.v4.app.DialogFragment; -import android.support.v4.app.FragmentActivity; -import android.view.View; -import android.widget.TextView; - -import org.apache.commons.lang3.builder.EqualsBuilder; -import org.apache.commons.lang3.builder.HashCodeBuilder; - -import java.util.List; - -import butterknife.BindView; -import butterknife.ButterKnife; -import eu.davidea.flexibleadapter.FlexibleAdapter; -import eu.davidea.flexibleadapter.items.AbstractSectionableItem; -import eu.davidea.viewholders.FlexibleViewHolder; -import io.github.wulkanowy.R; -import io.github.wulkanowy.data.db.dao.entities.Grade; - -public class GradesSubItem - extends AbstractSectionableItem { - - private Grade grade; - - private static int numberOfNotReadGrade; - - GradesSubItem(GradeHeaderItem header, Grade grade) { - super(header); - this.grade = grade; - } - - public Grade getGrade() { - return grade; - } - - @Override - public boolean equals(Object o) { - if (this == o) return true; - - if (o == null || getClass() != o.getClass()) return false; - - GradesSubItem that = (GradesSubItem) o; - - return new EqualsBuilder() - .append(grade, that.grade) - .isEquals(); - } - - @Override - public int hashCode() { - return new HashCodeBuilder(17, 37) - .append(grade) - .toHashCode(); - } - - @Override - public int getLayoutRes() { - return R.layout.grade_subitem; - } - - @Override - public SubItemViewHolder createViewHolder(View view, FlexibleAdapter adapter) { - return new SubItemViewHolder(view, adapter); - } - - @Override - public void bindViewHolder(FlexibleAdapter adapter, SubItemViewHolder holder, int position, List payloads) { - holder.onBind(grade); - } - - static class SubItemViewHolder extends FlexibleViewHolder { - - @BindView(R.id.grade_subitem_value) - TextView value; - - @BindView(R.id.grade_subitem_description) - TextView description; - - @BindView(R.id.grade_subitem_date) - TextView date; - - @BindView(R.id.grade_subitem_alert_image) - View alert; - - private Context context; - - private Grade item; - - SubItemViewHolder(View view, FlexibleAdapter adapter) { - super(view, adapter); - ButterKnife.bind(this, view); - context = view.getContext(); - view.setOnClickListener(this); - } - - void onBind(Grade item) { - this.item = item; - - value.setText(item.getValue()); - value.setBackgroundResource(item.getValueColor()); - date.setText(item.getDate()); - description.setText(getDescriptionString()); - alert.setVisibility(item.getRead() ? View.INVISIBLE : View.VISIBLE); - - if (!item.getRead()) { - numberOfNotReadGrade++; - } - } - - @Override - public void onClick(View view) { - super.onClick(view); - showDialog(); - - if (!item.getRead()) { - numberOfNotReadGrade--; - - if (numberOfNotReadGrade == 0) { - ((Activity) context).findViewById(R.id.grade_fragment_container) - .findViewWithTag(item.getSubject()).setVisibility(View.INVISIBLE); - } - item.setIsNew(false); - item.setRead(true); - item.update(); - alert.setVisibility(View.INVISIBLE); - } - } - - private String getDescriptionString() { - if (item.getDescription() == null || "".equals(item.getDescription())) { - if (!"".equals(item.getSymbol())) { - return item.getSymbol(); - } else { - return context.getString(R.string.noDescription_text); - } - } else { - return item.getDescription(); - } - } - - private void showDialog() { - GradesDialogFragment dialogFragment = GradesDialogFragment.newInstance(item); - dialogFragment.setStyle(DialogFragment.STYLE_NO_TITLE, 0); - dialogFragment.show(((FragmentActivity) context).getSupportFragmentManager(), item.toString()); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TabsData.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TabsData.java deleted file mode 100644 index 156d1759..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TabsData.java +++ /dev/null @@ -1,37 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - -import android.support.v4.app.Fragment; - -import java.util.ArrayList; -import java.util.List; - -class TabsData { - - private List fragments = new ArrayList<>(); - - private List titles = new ArrayList<>(); - - Fragment getFragment(int index) { - return fragments.get(index); - } - - void addFragment(Fragment fragment) { - if (fragment != null) { - fragments.add(fragment); - } - } - - int getFragmentsCount() { - return fragments.size(); - } - - String getTitle(int index) { - return titles.get(index); - } - - void addTitle(String title) { - if (title != null) { - titles.add(title); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableContract.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableContract.java deleted file mode 100644 index 18fa33f9..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableContract.java +++ /dev/null @@ -1,35 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - -import io.github.wulkanowy.di.annotations.PerActivity; -import io.github.wulkanowy.ui.base.BaseContract; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; - -public interface TimetableContract { - - interface View extends BaseContract.View { - - void setActivityTitle(); - - void scrollViewPagerToPosition(int position); - - void setTabDataToAdapter(TabsData tabsData); - - void setAdapterWithTabLayout(); - - void setChildFragmentSelected(int position, boolean selected); - - boolean isMenuVisible(); - } - - @PerActivity - interface Presenter extends BaseContract.Presenter { - - void onFragmentVisible(boolean isVisible); - - void onTabSelected(int position); - - void onTabUnselected(int position); - - void onStart(View view, OnFragmentIsReadyListener listener); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableDialogFragment.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableDialogFragment.java deleted file mode 100644 index cfc1e073..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableDialogFragment.java +++ /dev/null @@ -1,127 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - -import android.os.Bundle; -import android.support.annotation.NonNull; -import android.support.annotation.Nullable; -import android.support.v4.app.DialogFragment; -import android.view.LayoutInflater; -import android.view.View; -import android.view.ViewGroup; -import android.widget.TextView; - -import org.apache.commons.lang3.StringUtils; - -import butterknife.BindView; -import butterknife.ButterKnife; -import butterknife.OnClick; -import io.github.wulkanowy.R; -import io.github.wulkanowy.data.db.dao.entities.Lesson; - -public class TimetableDialogFragment extends DialogFragment { - - private static final String ARGUMENT_KEY = "Item"; - - private Lesson lesson; - - @BindView(R.id.timetable_dialog_lesson_value) - TextView lessonName; - - @BindView(R.id.timetable_dialog_teacher_value) - TextView teacher; - - @BindView(R.id.timetable_dialog_group_value) - TextView group; - - @BindView(R.id.timetable_dialog_room_value) - TextView room; - - @BindView(R.id.timetable_dialog_time_value) - TextView time; - - @BindView(R.id.timetable_dialog_description_value) - TextView description; - - @BindView(R.id.timetable_dialog_description) - View descriptionLabel; - - @BindView(R.id.timetable_dialog_teacher) - View teacherLabel; - - @BindView(R.id.timetable_dialog_group) - View groupLabel; - - public TimetableDialogFragment() { - //empty constructor for fragment - } - - public static TimetableDialogFragment newInstance(Lesson lesson) { - TimetableDialogFragment dialogFragment = new TimetableDialogFragment(); - - Bundle bundle = new Bundle(); - bundle.putSerializable(ARGUMENT_KEY, lesson); - - dialogFragment.setArguments(bundle); - - return dialogFragment; - } - - @Override - public void onCreate(@Nullable Bundle savedInstanceState) { - super.onCreate(savedInstanceState); - if (getArguments() != null) { - lesson = (Lesson) getArguments().getSerializable(ARGUMENT_KEY); - } - } - - @Nullable - @Override - public View onCreateView(@NonNull LayoutInflater inflater, @Nullable ViewGroup container, @Nullable Bundle savedInstanceState) { - View view = inflater.inflate(R.layout.timetable_dialog, container, false); - - ButterKnife.bind(this, view); - - if (!lesson.getSubject().isEmpty()) { - lessonName.setText(lesson.getSubject()); - } - - if (!lesson.getTeacher().isEmpty()) { - teacher.setText(lesson.getTeacher()); - } else { - teacher.setVisibility(View.GONE); - teacherLabel.setVisibility(View.GONE); - } - - if (!lesson.getGroupName().isEmpty()) { - group.setText(lesson.getGroupName()); - } else { - group.setVisibility(View.GONE); - groupLabel.setVisibility(View.GONE); - } - - if (!lesson.getRoom().isEmpty()) { - room.setText(lesson.getRoom()); - } - - if (!lesson.getEndTime().isEmpty() && !lesson.getStartTime().isEmpty()) { - time.setText(getTimeString()); - } - - if (!lesson.getDescription().isEmpty()) { - description.setText(StringUtils.capitalize(lesson.getDescription())); - } else { - description.setVisibility(View.GONE); - descriptionLabel.setVisibility(View.GONE); - } - - return view; - } - - private String getTimeString() { - return String.format("%1$s - %2$s", lesson.getStartTime(), lesson.getEndTime()); - } - - @OnClick(R.id.timetable_dialog_close) - void onClickCloseButton() { - dismiss(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableFragment.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableFragment.java deleted file mode 100644 index a9a83391..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableFragment.java +++ /dev/null @@ -1,114 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - -import android.os.Bundle; -import android.support.annotation.NonNull; -import android.support.annotation.Nullable; -import android.support.design.widget.Snackbar; -import android.support.design.widget.TabLayout; -import android.support.v4.view.ViewPager; -import android.view.LayoutInflater; -import android.view.View; -import android.view.ViewGroup; - -import javax.inject.Inject; - -import butterknife.BindView; -import butterknife.ButterKnife; -import io.github.wulkanowy.R; -import io.github.wulkanowy.di.component.FragmentComponent; -import io.github.wulkanowy.ui.base.BaseFragment; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; - -public class TimetableFragment extends BaseFragment implements TimetableContract.View, TabLayout.OnTabSelectedListener { - - @BindView(R.id.timetable_fragment_viewpager) - ViewPager viewPager; - - @BindView(R.id.timetable_fragment_tab_layout) - TabLayout tabLayout; - - @Inject - TimetablePagerAdapter pagerAdapter; - - @Inject - TimetableContract.Presenter presenter; - - @Nullable - @Override - public View onCreateView(@NonNull LayoutInflater inflater, @Nullable ViewGroup container, @Nullable Bundle savedInstanceState) { - View view = inflater.inflate(R.layout.fragment_timetable, container, false); - - FragmentComponent component = getFragmentComponent(); - if (component != null) { - component.inject(this); - setButterKnife(ButterKnife.bind(this, view)); - presenter.onStart(this, (OnFragmentIsReadyListener) getActivity()); - } - return view; - } - - @Override - public void setMenuVisibility(boolean menuVisible) { - super.setMenuVisibility(menuVisible); - if (presenter != null) { - presenter.onFragmentVisible(menuVisible); - } - } - - @Override - public void onTabSelected(TabLayout.Tab tab) { - presenter.onTabSelected(tab.getPosition()); - } - - @Override - public void onTabUnselected(TabLayout.Tab tab) { - presenter.onTabUnselected(tab.getPosition()); - } - - @Override - public void onTabReselected(TabLayout.Tab tab) { - //do nothing - } - - @Override - public void setTabDataToAdapter(TabsData tabsData) { - pagerAdapter.setTabsData(tabsData); - } - - @Override - public void setAdapterWithTabLayout() { - viewPager.setAdapter(pagerAdapter); - - tabLayout.setupWithViewPager(viewPager); - tabLayout.addOnTabSelectedListener(this); - } - - @Override - public void setChildFragmentSelected(int position, boolean selected) { - ((TimetableTabFragment) pagerAdapter.getItem(position)).setSelected(selected); - } - - @Override - public void scrollViewPagerToPosition(int position) { - viewPager.setCurrentItem(position, false); - } - - @Override - public void setActivityTitle() { - setTitle(getString(R.string.lessonplan_text)); - } - - @Override - public void onError(String message) { - if (getActivity() != null) { - Snackbar.make(getActivity().findViewById(R.id.main_activity_view_pager), - message, Snackbar.LENGTH_LONG).show(); - } - } - - @Override - public void onDestroyView() { - presenter.onDestroy(); - super.onDestroyView(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableHeaderItem.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableHeaderItem.java deleted file mode 100644 index c418d9ac..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableHeaderItem.java +++ /dev/null @@ -1,100 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - -import android.view.View; -import android.widget.ImageView; -import android.widget.TextView; - -import org.apache.commons.lang3.StringUtils; -import org.apache.commons.lang3.builder.EqualsBuilder; -import org.apache.commons.lang3.builder.HashCodeBuilder; - -import java.util.List; - -import butterknife.BindView; -import butterknife.ButterKnife; -import eu.davidea.flexibleadapter.FlexibleAdapter; -import eu.davidea.flexibleadapter.items.AbstractExpandableHeaderItem; -import eu.davidea.viewholders.ExpandableViewHolder; -import io.github.wulkanowy.R; -import io.github.wulkanowy.data.db.dao.entities.Day; - -public class TimetableHeaderItem - extends AbstractExpandableHeaderItem { - - private Day day; - - TimetableHeaderItem(Day day) { - this.day = day; - } - - @Override - public boolean equals(Object o) { - if (this == o) return true; - - if (o == null || getClass() != o.getClass()) return false; - - TimetableHeaderItem that = (TimetableHeaderItem) o; - - return new EqualsBuilder() - .append(day, that.day) - .isEquals(); - } - - @Override - public int hashCode() { - return new HashCodeBuilder(17, 37) - .append(day) - .toHashCode(); - } - - @Override - public int getLayoutRes() { - return R.layout.timetable_header; - } - - @Override - public HeaderViewHolder createViewHolder(View view, FlexibleAdapter adapter) { - return new HeaderViewHolder(view, adapter); - } - - @Override - public void bindViewHolder(FlexibleAdapter adapter, HeaderViewHolder holder, int position, List payloads) { - holder.onBind(day, getSubItems()); - } - - static class HeaderViewHolder extends ExpandableViewHolder { - - @BindView(R.id.timetable_header_day) - TextView dayName; - - @BindView(R.id.timetable_header_date) - TextView date; - - @BindView(R.id.timetable_header_alert_image) - ImageView alert; - - HeaderViewHolder(View view, FlexibleAdapter adapter) { - super(view, adapter); - view.setOnClickListener(this); - ButterKnife.bind(this, view); - } - - void onBind(Day item, List subItems) { - dayName.setText(StringUtils.capitalize(item.getDayName())); - date.setText(item.getDate()); - alert.setVisibility(isSubItemNewMovedInOrChanged(subItems) ? View.VISIBLE : View.INVISIBLE); - } - - private boolean isSubItemNewMovedInOrChanged(List subItems) { - boolean isAlertActive = false; - - for (TimetableSubItem subItem : subItems) { - if (subItem.getLesson().getIsMovedOrCanceled() || - subItem.getLesson().getIsNewMovedInOrChanged()) { - isAlertActive = true; - } - } - return isAlertActive; - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetablePagerAdapter.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetablePagerAdapter.java deleted file mode 100644 index 24e7582d..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetablePagerAdapter.java +++ /dev/null @@ -1,36 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - -import android.support.annotation.Nullable; -import android.support.v4.app.Fragment; -import android.support.v4.app.FragmentManager; -import android.support.v4.app.FragmentStatePagerAdapter; - -public class TimetablePagerAdapter extends FragmentStatePagerAdapter { - - private TabsData tabsData; - - public TimetablePagerAdapter(FragmentManager fragmentManager) { - super(fragmentManager); - } - - void setTabsData(TabsData tabsData) { - this.tabsData = tabsData; - } - - @Override - public Fragment getItem(int position) { - return tabsData.getFragment(position); - } - - - @Override - public int getCount() { - return tabsData.getFragmentsCount(); - } - - @Nullable - @Override - public CharSequence getPageTitle(int position) { - return tabsData.getTitle(position); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetablePresenter.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetablePresenter.java deleted file mode 100644 index bee323dd..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetablePresenter.java +++ /dev/null @@ -1,107 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - -import java.util.ArrayList; -import java.util.List; - -import javax.inject.Inject; - -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.ui.base.BasePresenter; -import io.github.wulkanowy.ui.main.OnFragmentIsReadyListener; -import io.github.wulkanowy.utils.TimeUtils; -import io.github.wulkanowy.utils.async.AbstractTask; -import io.github.wulkanowy.utils.async.AsyncListeners; - -public class TimetablePresenter extends BasePresenter - implements TimetableContract.Presenter, AsyncListeners.OnFirstLoadingListener { - - private AbstractTask loadingTask; - - private List dates = new ArrayList<>(); - - private TabsData tabsData = new TabsData(); - - private OnFragmentIsReadyListener listener; - - private int positionToScroll; - - private boolean isFirstSight = false; - - @Inject - TimetablePresenter(RepositoryContract repository) { - super(repository); - } - - @Override - public void onStart(TimetableContract.View view, OnFragmentIsReadyListener listener) { - super.onStart(view); - this.listener = listener; - - if (getView().isMenuVisible()) { - getView().setActivityTitle(); - } - - if (dates.isEmpty()) { - dates = TimeUtils.getMondaysFromCurrentSchoolYear(); - } - positionToScroll = dates.indexOf(TimeUtils.getDateOfCurrentMonday(true)); - - if (!isFirstSight) { - isFirstSight = true; - - loadingTask = new AbstractTask(); - loadingTask.setOnFirstLoadingListener(this); - loadingTask.execute(); - } - } - - @Override - public void onFragmentVisible(boolean isVisible) { - if (isVisible) { - getView().setActivityTitle(); - } - } - - @Override - public void onTabSelected(int position) { - getView().setChildFragmentSelected(position, true); - } - - @Override - public void onTabUnselected(int position) { - getView().setChildFragmentSelected(position, false); - } - - @Override - public void onDoInBackgroundLoading() throws Exception { - for (String date : dates) { - tabsData.addTitle(date); - tabsData.addFragment(TimetableTabFragment.newInstance(date)); - } - } - - @Override - public void onCanceledLoadingAsync() { - //do nothing - - } - - @Override - public void onEndLoadingAsync(boolean result, Exception exception) { - if (result) { - getView().setTabDataToAdapter(tabsData); - getView().setAdapterWithTabLayout(); - getView().scrollViewPagerToPosition(positionToScroll); - listener.onFragmentIsReady(); - } - } - - @Override - public void onDestroy() { - super.onDestroy(); - if (loadingTask != null) { - loadingTask.cancel(true); - loadingTask = null; - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableSubItem.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableSubItem.java deleted file mode 100644 index b4212940..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableSubItem.java +++ /dev/null @@ -1,123 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - -import android.content.Context; -import android.graphics.Paint; -import android.support.v4.app.DialogFragment; -import android.support.v4.app.FragmentActivity; -import android.view.View; -import android.widget.ImageView; -import android.widget.TextView; - -import java.util.List; - -import butterknife.BindView; -import butterknife.ButterKnife; -import eu.davidea.flexibleadapter.FlexibleAdapter; -import eu.davidea.flexibleadapter.items.AbstractSectionableItem; -import eu.davidea.viewholders.FlexibleViewHolder; -import io.github.wulkanowy.R; -import io.github.wulkanowy.data.db.dao.entities.Lesson; - - -public class TimetableSubItem - extends AbstractSectionableItem { - - private Lesson lesson; - - public TimetableSubItem(TimetableHeaderItem header, Lesson lesson) { - super(header); - this.lesson = lesson; - } - - public Lesson getLesson() { - return lesson; - } - - @Override - public boolean equals(Object o) { - return this == o; - } - - @Override - public int getLayoutRes() { - return R.layout.timetable_subitem; - } - - @Override - public SubItemViewHolder createViewHolder(View view, FlexibleAdapter adapter) { - return new SubItemViewHolder(view, adapter); - } - - @Override - public void bindViewHolder(FlexibleAdapter adapter, SubItemViewHolder holder, int position, List payloads) { - holder.onBind(lesson); - } - - static class SubItemViewHolder extends FlexibleViewHolder { - - @BindView(R.id.timetable_subItem_lesson) - TextView lessonName; - - @BindView(R.id.timetable_subItem_number_of_lesson) - TextView numberOfLesson; - - @BindView(R.id.timetable_subItem_time) - TextView lessonTime; - - @BindView(R.id.timetable_subItem_room) - TextView room; - - @BindView(R.id.timetable_subItem_alert_image) - ImageView alert; - - private Context context; - - private Lesson item; - - SubItemViewHolder(View view, FlexibleAdapter adapter) { - super(view, adapter); - ButterKnife.bind(this, view); - context = view.getContext(); - view.setOnClickListener(this); - } - - void onBind(Lesson lesson) { - item = lesson; - - lessonName.setText(lesson.getSubject()); - lessonTime.setText(getLessonTimeString()); - numberOfLesson.setText(lesson.getNumber()); - room.setText(getRoomString()); - alert.setVisibility(lesson.getIsMovedOrCanceled() || lesson.getIsNewMovedInOrChanged() - ? View.VISIBLE : View.INVISIBLE); - lessonName.setPaintFlags(lesson.getIsMovedOrCanceled() ? lessonName.getPaintFlags() - | Paint.STRIKE_THRU_TEXT_FLAG : - lessonName.getPaintFlags() & (~Paint.STRIKE_THRU_TEXT_FLAG)); - room.setText(getRoomString()); - } - - @Override - public void onClick(View view) { - super.onClick(view); - showDialog(); - } - - private String getLessonTimeString() { - return String.format("%1$s - %2$s", item.getStartTime(), item.getEndTime()); - } - - private String getRoomString() { - if (!item.getRoom().isEmpty()) { - return context.getString(R.string.timetable_subitem_room, item.getRoom()); - } else { - return item.getRoom(); - } - } - - private void showDialog() { - TimetableDialogFragment dialogFragment = TimetableDialogFragment.newInstance(item); - dialogFragment.setStyle(DialogFragment.STYLE_NO_TITLE, 0); - dialogFragment.show(((FragmentActivity) context).getSupportFragmentManager(), item.toString()); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableTabContract.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableTabContract.java deleted file mode 100644 index fbffdb12..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableTabContract.java +++ /dev/null @@ -1,30 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - -import java.util.List; - -import io.github.wulkanowy.ui.base.BaseContract; - -public interface TimetableTabContract { - - interface View extends BaseContract.View { - - void updateAdapterList(List headerItems); - - void onRefreshSuccess(); - - void hideRefreshingBar(); - - void showProgressBar(boolean show); - } - - interface Presenter extends BaseContract.Presenter { - - void onFragmentSelected(boolean isSelected); - - void setArgumentDate(String date); - - void onStart(View view, boolean isPrimary); - - void onRefresh(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableTabFragment.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableTabFragment.java deleted file mode 100644 index 10f3163a..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableTabFragment.java +++ /dev/null @@ -1,145 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - -import android.os.Bundle; -import android.support.annotation.NonNull; -import android.support.annotation.Nullable; -import android.support.design.widget.Snackbar; -import android.support.v4.widget.SwipeRefreshLayout; -import android.support.v7.widget.RecyclerView; -import android.view.LayoutInflater; -import android.view.View; -import android.view.ViewGroup; - -import java.util.List; - -import javax.inject.Inject; - -import butterknife.BindView; -import butterknife.ButterKnife; -import eu.davidea.flexibleadapter.FlexibleAdapter; -import eu.davidea.flexibleadapter.common.SmoothScrollLinearLayoutManager; -import io.github.wulkanowy.R; -import io.github.wulkanowy.di.component.FragmentComponent; -import io.github.wulkanowy.ui.base.BaseFragment; - -public class TimetableTabFragment extends BaseFragment implements TimetableTabContract.View, - SwipeRefreshLayout.OnRefreshListener { - - private static final String ARGUMENT_KEY = "Date"; - - private boolean isPrimary = false; - - private boolean isSelected = false; - - @BindView(R.id.timetable_tab_fragment_recycler) - RecyclerView recyclerView; - - @BindView(R.id.timetable_tab_fragment_swipe_refresh) - SwipeRefreshLayout refreshLayout; - - @BindView(R.id.timetable_tab_fragment_progress_bar) - View progressBar; - - @Inject - TimetableTabContract.Presenter presenter; - - @Inject - FlexibleAdapter adapter; - - public static TimetableTabFragment newInstance(String date) { - TimetableTabFragment fragmentTab = new TimetableTabFragment(); - - Bundle bundle = new Bundle(); - bundle.putString(ARGUMENT_KEY, date); - fragmentTab.setArguments(bundle); - - return fragmentTab; - } - - @Nullable - @Override - public View onCreateView(@NonNull LayoutInflater inflater, @Nullable ViewGroup container, @Nullable Bundle savedInstanceState) { - View view = inflater.inflate(R.layout.fragment_timetable_tab, container, false); - - FragmentComponent component = getFragmentComponent(); - if (component != null) { - component.inject(this); - setButterKnife(ButterKnife.bind(this, view)); - - if (getArguments() != null) { - presenter.setArgumentDate(getArguments().getString(ARGUMENT_KEY)); - } - - presenter.onStart(this, isPrimary); - } - return view; - } - - @Override - protected void setUpOnViewCreated(View fragmentView) { - adapter.setAutoCollapseOnExpand(true); - adapter.setAutoScrollOnExpand(true); - adapter.expandItemsAtStartUp(); - - recyclerView.setLayoutManager(new SmoothScrollLinearLayoutManager(fragmentView.getContext())); - recyclerView.setAdapter(adapter); - - refreshLayout.setColorSchemeResources(android.R.color.black); - refreshLayout.setOnRefreshListener(this); - - } - - @Override - public void updateAdapterList(List headerItems) { - adapter.updateDataSet(headerItems); - } - - @Override - public void setMenuVisibility(boolean menuVisible) { - super.setMenuVisibility(menuVisible); - if (presenter != null && getView() != null) { - presenter.onFragmentSelected(isSelected); - } else if (isSelected) { - isPrimary = true; - } - } - - @Override - public void onRefresh() { - presenter.onRefresh(); - } - - @Override - public void onRefreshSuccess() { - onError(R.string.timetable_refresh_success); - } - - @Override - public void hideRefreshingBar() { - refreshLayout.setRefreshing(false); - } - - @Override - public void showProgressBar(boolean show) { - progressBar.setVisibility(show ? View.VISIBLE : View.INVISIBLE); - } - - public void setSelected(boolean selected) { - isSelected = selected; - } - - @Override - public void onError(String message) { - if (getActivity() != null) { - Snackbar.make(getActivity().findViewById(R.id.main_activity_view_pager), - message, Snackbar.LENGTH_LONG).show(); - } - } - - @Override - public void onDestroyView() { - isPrimary = false; - presenter.onDestroy(); - super.onDestroyView(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableTabPresenter.java b/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableTabPresenter.java deleted file mode 100644 index 5872b4d0..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/main/timetable/TimetableTabPresenter.java +++ /dev/null @@ -1,155 +0,0 @@ -package io.github.wulkanowy.ui.main.timetable; - - -import java.util.ArrayList; -import java.util.List; - -import javax.inject.Inject; - -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.data.db.dao.entities.Day; -import io.github.wulkanowy.data.db.dao.entities.Lesson; -import io.github.wulkanowy.data.db.dao.entities.Week; -import io.github.wulkanowy.ui.base.BasePresenter; -import io.github.wulkanowy.utils.async.AbstractTask; -import io.github.wulkanowy.utils.async.AsyncListeners; - -public class TimetableTabPresenter extends BasePresenter - implements TimetableTabContract.Presenter, AsyncListeners.OnRefreshListener, - AsyncListeners.OnFirstLoadingListener { - - private AbstractTask refreshTask; - - private AbstractTask loadingTask; - - private List headerItems = new ArrayList<>(); - - private String date; - - private boolean isFirstSight = false; - - @Inject - TimetableTabPresenter(RepositoryContract repository) { - super(repository); - } - - @Override - public void onStart(TimetableTabContract.View view, boolean isPrimary) { - super.onStart(view); - getView().showProgressBar(true); - onFragmentSelected(isPrimary); - } - - @Override - public void onFragmentSelected(boolean isSelected) { - if (!isFirstSight && isSelected) { - isFirstSight = true; - - loadingTask = new AbstractTask(); - loadingTask.setOnFirstLoadingListener(this); - loadingTask.execute(); - } - } - - @Override - public void onRefresh() { - if (getView().isNetworkConnected()) { - refreshTask = new AbstractTask(); - refreshTask.setOnRefreshListener(this); - refreshTask.execute(); - } else { - getView().onNoNetworkError(); - getView().hideRefreshingBar(); - } - } - - @Override - public void onDoInBackgroundRefresh() throws Exception { - syncData(); - } - - @Override - public void onCanceledRefreshAsync() { - // do nothing - } - - @Override - public void onEndRefreshAsync(boolean result, Exception exception) { - if (result) { - loadingTask = new AbstractTask(); - loadingTask.setOnFirstLoadingListener(this); - loadingTask.execute(); - - getView().onRefreshSuccess(); - } else { - getView().onError(getRepository().getErrorLoginMessage(exception)); - } - getView().hideRefreshingBar(); - } - - @Override - public void onDoInBackgroundLoading() throws Exception { - Week week = getRepository().getWeek(date); - - if (week == null) { - syncData(); - week = getRepository().getWeek(date); - } - - List dayList = week.getDayList(); - - headerItems = new ArrayList<>(); - - for (Day day : dayList) { - TimetableHeaderItem headerItem = new TimetableHeaderItem(day); - - List lessonList = day.getLessons(); - - List subItems = new ArrayList<>(); - - for (Lesson lesson : lessonList) { - subItems.add(new TimetableSubItem(headerItem, lesson)); - } - - headerItem.setSubItems(subItems); - headerItem.setExpanded(false); - headerItems.add(headerItem); - } - } - - @Override - public void onCanceledLoadingAsync() { - // do nothing - } - - @Override - public void onEndLoadingAsync(boolean result, Exception exception) { - getView().updateAdapterList(headerItems); - getView().showProgressBar(false); - } - - @Override - public void setArgumentDate(String date) { - this.date = date; - } - - private void syncData() throws Exception { - getRepository().loginCurrentUser(); - getRepository().syncTimetable(date); - } - - @Override - public void onDestroy() { - super.onDestroy(); - isFirstSight = false; - - if (refreshTask != null) { - refreshTask.cancel(true); - refreshTask = null; - } - if (loadingTask != null) { - loadingTask.cancel(true); - loadingTask = null; - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutAdapter.kt new file mode 100644 index 00000000..35dec3b4 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutAdapter.kt @@ -0,0 +1,72 @@ +package io.github.wulkanowy.ui.modules.about + +import android.graphics.drawable.Drawable +import android.view.LayoutInflater +import android.view.ViewGroup +import androidx.core.content.res.ResourcesCompat +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.databinding.ItemAboutBinding +import io.github.wulkanowy.databinding.ScrollableHeaderAboutBinding +import javax.inject.Inject + +class AboutAdapter @Inject constructor() : RecyclerView.Adapter() { + + private enum class ViewType(val id: Int) { + ITEM_HEADER(1), + ITEM_ELEMENT(2) + } + + var items = emptyList>() + + var onClickListener: (name: String) -> Unit = {} + + override fun getItemCount() = items.size + 1 + + override fun getItemViewType(position: Int) = when (position) { + 0 -> ViewType.ITEM_HEADER.id + else -> ViewType.ITEM_ELEMENT.id + } + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + + return when (viewType) { + ViewType.ITEM_HEADER.id -> HeaderViewHolder(ScrollableHeaderAboutBinding.inflate(inflater, parent, false)) + ViewType.ITEM_ELEMENT.id -> ItemViewHolder(ItemAboutBinding.inflate(inflater, parent, false)) + else -> throw IllegalStateException() + } + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + when (holder) { + is HeaderViewHolder -> bindHeaderViewHolder(holder.binding) + is ItemViewHolder -> bindItemViewHolder(holder.binding, position - 1) + } + } + + private fun bindHeaderViewHolder(binding: ScrollableHeaderAboutBinding) { + with(binding.aboutScrollableHeaderIcon) { + setImageDrawable(ResourcesCompat.getDrawableForDensity( + context.resources, context.applicationInfo.icon, 640, null) + ) + } + } + + private fun bindItemViewHolder(binding: ItemAboutBinding, position: Int) { + val (title, summary, image) = items[position] + + with(binding) { + aboutItemImage.setImageDrawable(image) + aboutItemTitle.text = title + aboutItemSummary.text = summary + + root.setOnClickListener { onClickListener(title) } + } + } + + private class HeaderViewHolder(val binding: ScrollableHeaderAboutBinding) : + RecyclerView.ViewHolder(binding.root) + + private class ItemViewHolder(val binding: ItemAboutBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutFragment.kt new file mode 100644 index 00000000..5ec1a66e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutFragment.kt @@ -0,0 +1,154 @@ +package io.github.wulkanowy.ui.modules.about + +import android.graphics.drawable.Drawable +import android.os.Bundle +import android.view.View +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.databinding.FragmentAboutBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.about.contributor.ContributorFragment +import io.github.wulkanowy.ui.modules.about.license.LicenseFragment +import io.github.wulkanowy.ui.modules.about.logviewer.LogViewerFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.getCompatDrawable +import io.github.wulkanowy.utils.openAppInMarket +import io.github.wulkanowy.utils.openEmailClient +import io.github.wulkanowy.utils.openInternetBrowser +import javax.inject.Inject + +@AndroidEntryPoint +class AboutFragment : BaseFragment(R.layout.fragment_about), AboutView, + MainView.TitledView { + + @Inject + lateinit var presenter: AboutPresenter + + @Inject + lateinit var aboutAdapter: AboutAdapter + + @Inject + lateinit var appInfo: AppInfo + + override val versionRes: Triple? + get() = context?.run { + Triple(getString(R.string.about_version), "${appInfo.versionName} (${appInfo.versionCode})", getCompatDrawable(R.drawable.ic_all_about)) + } + + override val creatorsRes: Triple? + get() = context?.run { + Triple(getString(R.string.about_contributor), getString(R.string.about_contributor_summary), getCompatDrawable(R.drawable.ic_about_creator)) + } + + override val feedbackRes: Triple? + get() = context?.run { + Triple(getString(R.string.about_feedback), getString(R.string.about_feedback_summary), getCompatDrawable(R.drawable.ic_about_feedback)) + } + + override val faqRes: Triple? + get() = context?.run { + Triple(getString(R.string.about_faq), getString(R.string.about_faq_summary), getCompatDrawable(R.drawable.ic_about_faq)) + } + + override val discordRes: Triple? + get() = context?.run { + Triple(getString(R.string.about_discord), getString(R.string.about_discord_summary), getCompatDrawable(R.drawable.ic_about_discord)) + } + + override val homepageRes: Triple? + get() = context?.run { + Triple(getString(R.string.about_homepage), getString(R.string.about_homepage_summary), getCompatDrawable(R.drawable.ic_about_homepage)) + } + + override val licensesRes: Triple? + get() = context?.run { + Triple(getString(R.string.about_licenses), getString(R.string.about_licenses_summary), getCompatDrawable(R.drawable.ic_about_licenses)) + } + + override val privacyRes: Triple? + get() = context?.run { + Triple(getString(R.string.about_privacy), getString(R.string.about_privacy_summary), getCompatDrawable(R.drawable.ic_about_privacy)) + } + + override val titleStringId get() = R.string.about_title + + companion object { + fun newInstance() = AboutFragment() + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentAboutBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + aboutAdapter.onClickListener = presenter::onItemSelected + + with(binding.aboutRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = aboutAdapter + } + } + + override fun updateData(data: List>) { + with(aboutAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun openAppInMarket() { + context?.openAppInMarket(::showMessage) + } + + override fun openLogViewer() { + (activity as? MainActivity)?.pushView(LogViewerFragment.newInstance()) + } + + override fun openDiscordInvite() { + context?.openInternetBrowser("https://discord.gg/vccAQBr", ::showMessage) + } + + override fun openHomepage() { + context?.openInternetBrowser("https://wulkanowy.github.io/", ::showMessage) + } + + override fun openEmailClient() { + requireContext().openEmailClient( + chooserTitle = getString(R.string.about_feedback), + email = "wulkanowyinc@gmail.com", + subject = "Zgłoszenie błędu", + body = getString(R.string.about_feedback_template, + "${appInfo.systemManufacturer} ${appInfo.systemModel}", appInfo.systemVersion.toString(), appInfo.versionName + ), + onActivityNotFound = { + requireContext().openInternetBrowser("https://github.com/wulkanowy/wulkanowy/issues", ::showMessage) + } + ) + } + + override fun openFaqPage() { + context?.openInternetBrowser("https://wulkanowy.github.io/czesto-zadawane-pytania", ::showMessage) + } + + override fun openLicenses() { + (activity as? MainActivity)?.pushView(LicenseFragment.newInstance()) + } + + override fun openCreators() { + (activity as? MainActivity)?.pushView(ContributorFragment.newInstance()) + } + + override fun openPrivacyPolicy() { + context?.openInternetBrowser("https://wulkanowy.github.io/polityka-prywatnosci.html", ::showMessage) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutPresenter.kt new file mode 100644 index 00000000..24e59d36 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutPresenter.kt @@ -0,0 +1,87 @@ +package io.github.wulkanowy.ui.modules.about + +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import timber.log.Timber +import javax.inject.Inject + +class AboutPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val appInfo: AppInfo, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: AboutView) { + super.onAttachView(view) + view.initView() + Timber.i("About view was initialized") + loadData() + } + + fun onItemSelected(name: String) { + view?.run { + when (name) { + versionRes?.first -> { + Timber.i("Opening log viewer") + if (appInfo.isDebug) openLogViewer() + else openAppInMarket() + analytics.logEvent("about_open", "name" to "log_viewer") + } + feedbackRes?.first -> { + Timber.i("Opening email client") + openEmailClient() + analytics.logEvent("about_open", "name" to "feedback") + } + faqRes?.first -> { + Timber.i("Opening faq page") + openFaqPage() + analytics.logEvent("about_open", "name" to "faq") + } + discordRes?.first -> { + Timber.i("Opening discord") + openDiscordInvite() + analytics.logEvent("about_open", "name" to "discord") + } + homepageRes?.first -> { + Timber.i("Opening homepage") + openHomepage() + analytics.logEvent("about_open", "name" to "homepage") + } + licensesRes?.first -> { + Timber.i("Opening licenses view") + openLicenses() + analytics.logEvent("about_open", "name" to "licenses") + } + creatorsRes?.first -> { + Timber.i("Opening creators view") + openCreators() + analytics.logEvent("about_open", "name" to "creators") + } + privacyRes?.first -> { + Timber.i("Opening privacy page ") + openPrivacyPolicy() + analytics.logEvent("about_open", "name" to "privacy") + } + } + } + } + + private fun loadData() { + view?.run { + updateData(listOfNotNull( + versionRes, + creatorsRes, + feedbackRes, + faqRes, + discordRes, + homepageRes, + licensesRes, + privacyRes + )) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutView.kt new file mode 100644 index 00000000..4c4b002f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/AboutView.kt @@ -0,0 +1,45 @@ +package io.github.wulkanowy.ui.modules.about + +import android.graphics.drawable.Drawable +import io.github.wulkanowy.ui.base.BaseView + +interface AboutView : BaseView { + + val versionRes: Triple? + + val creatorsRes: Triple? + + val feedbackRes: Triple? + + val faqRes: Triple? + + val discordRes: Triple? + + val homepageRes: Triple? + + val licensesRes: Triple? + + val privacyRes: Triple? + + fun initView() + + fun updateData(data: List>) + + fun openAppInMarket() + + fun openLogViewer() + + fun openDiscordInvite() + + fun openEmailClient() + + fun openFaqPage() + + fun openHomepage() + + fun openLicenses() + + fun openCreators() + + fun openPrivacyPolicy() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorAdapter.kt new file mode 100644 index 00000000..b6755c6a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorAdapter.kt @@ -0,0 +1,41 @@ +package io.github.wulkanowy.ui.modules.about.contributor + +import android.view.LayoutInflater +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import coil.load +import coil.transform.RoundedCornersTransformation +import io.github.wulkanowy.data.pojos.Contributor +import io.github.wulkanowy.databinding.ItemContributorBinding +import javax.inject.Inject + +class ContributorAdapter @Inject constructor() : + RecyclerView.Adapter() { + + var items = emptyList() + + var onClickListener: (Contributor) -> Unit = {} + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemContributorBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val item = items[position] + + with(holder.binding) { + creatorItemName.text = item.displayName + creatorItemAvatar.load("https://github.com/${item.githubUsername}.png") { + transformations(RoundedCornersTransformation(8f)) + crossfade(true) + } + + root.setOnClickListener { onClickListener(item) } + } + } + + class ItemViewHolder(val binding: ItemContributorBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorFragment.kt new file mode 100644 index 00000000..5d7e076c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorFragment.kt @@ -0,0 +1,73 @@ +package io.github.wulkanowy.ui.modules.about.contributor + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.pojos.Contributor +import io.github.wulkanowy.databinding.FragmentContributorBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.widgets.DividerItemDecoration +import io.github.wulkanowy.utils.openInternetBrowser +import javax.inject.Inject + +@AndroidEntryPoint +class ContributorFragment : BaseFragment(R.layout.fragment_contributor), + ContributorView, MainView.TitledView { + + @Inject + lateinit var presenter: ContributorPresenter + + @Inject + lateinit var creatorsAdapter: ContributorAdapter + + override val titleStringId get() = R.string.contributors_title + + companion object { + fun newInstance() = ContributorFragment() + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentContributorBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + with(binding.creatorRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = creatorsAdapter + addItemDecoration(DividerItemDecoration(context)) + } + creatorsAdapter.onClickListener = presenter::onItemSelected + binding.creatorSeeMore.setOnClickListener { presenter.onSeeMoreClick() } + } + + override fun updateData(data: List) { + with(creatorsAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun openUserGithubPage(username: String) { + context?.openInternetBrowser("https://github.com/${username}", ::showMessage) + } + + override fun openGithubContributorsPage() { + context?.openInternetBrowser("https://github.com/wulkanowy/wulkanowy/graphs/contributors", ::showMessage) + } + + override fun showProgress(show: Boolean) { + binding.creatorProgress.visibility = if (show) VISIBLE else GONE + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorPresenter.kt new file mode 100644 index 00000000..78fdb43a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorPresenter.kt @@ -0,0 +1,45 @@ +package io.github.wulkanowy.ui.modules.about.contributor + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.pojos.Contributor +import io.github.wulkanowy.data.repositories.appcreator.AppCreatorRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.flowWithResource +import kotlinx.coroutines.flow.onEach +import javax.inject.Inject + +class ContributorPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val appCreatorRepository: AppCreatorRepository +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: ContributorView) { + super.onAttachView(view) + view.initView() + loadData() + } + + fun onItemSelected(contributor: Contributor) { + view?.openUserGithubPage(contributor.githubUsername) + } + + fun onSeeMoreClick() { + view?.openGithubContributorsPage() + } + + private fun loadData() { + flowWithResource { appCreatorRepository.getAppCreators() }.onEach { + when (it.status) { + Status.LOADING -> view?.showProgress(true) + Status.SUCCESS -> view?.run { + showProgress(false) + updateData(it.data!!) + } + Status.ERROR -> errorHandler.dispatch(it.error!!) + } + }.launch() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorView.kt new file mode 100644 index 00000000..8007e4e3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/contributor/ContributorView.kt @@ -0,0 +1,17 @@ +package io.github.wulkanowy.ui.modules.about.contributor + +import io.github.wulkanowy.data.pojos.Contributor +import io.github.wulkanowy.ui.base.BaseView + +interface ContributorView : BaseView { + + fun initView() + + fun updateData(data: List) + + fun openUserGithubPage(username: String) + + fun openGithubContributorsPage() + + fun showProgress(show: Boolean) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicenseAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicenseAdapter.kt new file mode 100644 index 00000000..6ae06bbe --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicenseAdapter.kt @@ -0,0 +1,34 @@ +package io.github.wulkanowy.ui.modules.about.license + +import android.view.LayoutInflater +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import com.mikepenz.aboutlibraries.entity.Library +import io.github.wulkanowy.databinding.ItemLicenseBinding +import javax.inject.Inject + +class LicenseAdapter @Inject constructor() : RecyclerView.Adapter() { + + var items = emptyList() + + var onClickListener: (Library) -> Unit = {} + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemLicenseBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val item = items[position] + + with(holder.binding) { + licenseItemName.text = item.libraryName + licenseItemSummary.text = item.licenses?.firstOrNull()?.licenseName?.takeIf { it.isNotBlank() } ?: item.libraryVersion + + root.setOnClickListener { onClickListener(item) } + } + } + + class ItemViewHolder(val binding: ItemLicenseBinding) : RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicenseFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicenseFragment.kt new file mode 100644 index 00000000..cdd29b41 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicenseFragment.kt @@ -0,0 +1,83 @@ +package io.github.wulkanowy.ui.modules.about.license + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import androidx.appcompat.app.AlertDialog +import androidx.core.text.parseAsHtml +import androidx.recyclerview.widget.LinearLayoutManager +import com.mikepenz.aboutlibraries.Libs +import com.mikepenz.aboutlibraries.entity.Library +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.databinding.FragmentLicenseBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainView +import javax.inject.Inject + +@AndroidEntryPoint +class LicenseFragment : BaseFragment(R.layout.fragment_license), + LicenseView, MainView.TitledView { + + @Inject + lateinit var presenter: LicensePresenter + + @Inject + lateinit var licenseAdapter: LicenseAdapter + + private val libs by lazy { Libs(requireContext()) } + + override val titleStringId get() = R.string.license_title + + override val appLibraries: ArrayList? + get() = context?.let { + libs.prepareLibraries(it, emptyArray(), emptyArray(), autoDetect = true, checkCachedDetection = true, sort = true) + } + + companion object { + fun newInstance() = LicenseFragment() + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentLicenseBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + licenseAdapter.onClickListener = presenter::onItemSelected + + with(binding.licenseRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = licenseAdapter + } + } + + override fun updateData(data: List) { + with(licenseAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun openLicense(licenseHtml: String) { + context?.let { + AlertDialog.Builder(it).apply { + setTitle(R.string.license_dialog_title) + setMessage(licenseHtml.parseAsHtml()) + setPositiveButton(android.R.string.ok) { _, _ -> } + show() + } + } + } + + override fun showProgress(show: Boolean) { + binding.licenseProgress.visibility = if (show) VISIBLE else GONE + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicensePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicensePresenter.kt new file mode 100644 index 00000000..18d257ee --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicensePresenter.kt @@ -0,0 +1,47 @@ +package io.github.wulkanowy.ui.modules.about.license + +import com.mikepenz.aboutlibraries.entity.Library +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.DispatchersProvider +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import kotlinx.coroutines.flow.onEach +import kotlinx.coroutines.withContext +import timber.log.Timber +import javax.inject.Inject + +class LicensePresenter @Inject constructor( + private val dispatchers: DispatchersProvider, + errorHandler: ErrorHandler, + studentRepository: StudentRepository +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: LicenseView) { + super.onAttachView(view) + view.initView() + loadData() + } + + fun onItemSelected(library: Library) { + view?.run { library.licenses?.firstOrNull()?.licenseDescription?.let { openLicense(it) } } + } + + private fun loadData() { + flowWithResource { + withContext(dispatchers.backgroundThread) { + view?.appLibraries.orEmpty() + } + }.onEach { + when (it.status) { + Status.LOADING -> Timber.d("License data load started") + Status.SUCCESS -> view?.updateData(it.data!!) + Status.ERROR -> errorHandler.dispatch(it.error!!) + } + }.afterLoading { + view?.showProgress(false) + }.launch() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicenseView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicenseView.kt new file mode 100644 index 00000000..0680dbb7 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/license/LicenseView.kt @@ -0,0 +1,17 @@ +package io.github.wulkanowy.ui.modules.about.license + +import com.mikepenz.aboutlibraries.entity.Library +import io.github.wulkanowy.ui.base.BaseView + +interface LicenseView : BaseView { + + val appLibraries: ArrayList? + + fun initView() + + fun updateData(data: List) + + fun openLicense(licenseHtml: String) + + fun showProgress(show: Boolean) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerAdapter.kt new file mode 100644 index 00000000..45c304aa --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerAdapter.kt @@ -0,0 +1,22 @@ +package io.github.wulkanowy.ui.modules.about.logviewer + +import android.view.ViewGroup +import android.widget.TextView +import androidx.recyclerview.widget.RecyclerView + +class LogViewerAdapter : RecyclerView.Adapter() { + + var lines = emptyList() + + class ViewHolder(val textView: TextView) : RecyclerView.ViewHolder(textView) + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): ViewHolder { + return ViewHolder(TextView(parent.context)) + } + + override fun getItemCount() = lines.size + + override fun onBindViewHolder(holder: ViewHolder, position: Int) { + holder.textView.text = lines[position] + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerFragment.kt new file mode 100644 index 00000000..cf40975e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerFragment.kt @@ -0,0 +1,96 @@ +package io.github.wulkanowy.ui.modules.about.logviewer + +import android.content.Intent +import android.content.Intent.EXTRA_EMAIL +import android.content.Intent.EXTRA_STREAM +import android.content.Intent.FLAG_GRANT_READ_URI_PERMISSION +import android.net.Uri +import android.os.Build.VERSION.SDK_INT +import android.os.Build.VERSION_CODES.LOLLIPOP +import android.os.Bundle +import android.view.Menu +import android.view.MenuInflater +import android.view.MenuItem +import android.view.View +import androidx.core.content.FileProvider +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.BuildConfig.APPLICATION_ID +import io.github.wulkanowy.R +import io.github.wulkanowy.databinding.FragmentLogviewerBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainView +import java.io.File +import javax.inject.Inject + +@AndroidEntryPoint +class LogViewerFragment : BaseFragment(R.layout.fragment_logviewer), + LogViewerView, MainView.TitledView { + + @Inject + lateinit var presenter: LogViewerPresenter + + private val logAdapter = LogViewerAdapter() + + override val titleStringId: Int + get() = R.string.logviewer_title + + companion object { + fun newInstance() = LogViewerFragment() + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setHasOptionsMenu(true) + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentLogviewerBinding.bind(view) + messageContainer = binding.logViewerRecycler + presenter.onAttachView(this) + } + + override fun onCreateOptionsMenu(menu: Menu, inflater: MenuInflater) { + inflater.inflate(R.menu.action_menu_logviewer, menu) + } + + override fun onOptionsItemSelected(item: MenuItem): Boolean { + return if (item.itemId == R.id.logViewerMenuShare) presenter.onShareLogsSelected() + else false + } + + override fun initView() { + with(binding.logViewerRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = logAdapter + } + + binding.logViewRefreshButton.setOnClickListener { presenter.onRefreshClick() } + } + + override fun setLines(lines: List) { + logAdapter.lines = lines + logAdapter.notifyDataSetChanged() + binding.logViewerRecycler.scrollToPosition(lines.size - 1) + } + + override fun shareLogs(files: List) { + val intent = Intent(Intent.ACTION_SEND_MULTIPLE).apply { + type = "text/plain" + putExtra(EXTRA_EMAIL, arrayOf("wulkanowyinc@gmail.com")) + addFlags(FLAG_GRANT_READ_URI_PERMISSION) + putParcelableArrayListExtra(EXTRA_STREAM, ArrayList(files.map { + if (SDK_INT < LOLLIPOP) Uri.fromFile(it) + else FileProvider.getUriForFile(requireContext(), "$APPLICATION_ID.fileprovider", it) + })) + } + + startActivity(Intent.createChooser(intent, getString(R.string.logviewer_share))) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerPresenter.kt new file mode 100644 index 00000000..85eae8e6 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerPresenter.kt @@ -0,0 +1,61 @@ +package io.github.wulkanowy.ui.modules.about.logviewer + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.logger.LoggerRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.flowWithResource +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class LogViewerPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val loggerRepository: LoggerRepository +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: LogViewerView) { + super.onAttachView(view) + view.initView() + loadLogFile() + } + + fun onShareLogsSelected(): Boolean { + flowWithResource { loggerRepository.getLogFiles() }.onEach { + when (it.status) { + Status.LOADING -> Timber.d("Loading logs files started") + Status.SUCCESS -> { + Timber.i("Loading logs files result: ${it.data!!.joinToString { file -> file.name }}") + view?.shareLogs(it.data) + } + Status.ERROR -> { + Timber.i("Loading logs files result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch("share") + return true + } + + fun onRefreshClick() { + loadLogFile() + } + + private fun loadLogFile() { + flowWithResource { loggerRepository.getLastLogLines() }.onEach { + when (it.status) { + Status.LOADING -> Timber.d("Loading last log file started") + Status.SUCCESS -> { + Timber.i("Loading last log file result: load ${it.data!!.size} lines") + view?.setLines(it.data) + } + Status.ERROR -> { + Timber.i("Loading last log file result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch("file") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerView.kt new file mode 100644 index 00000000..bd98c24f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/about/logviewer/LogViewerView.kt @@ -0,0 +1,13 @@ +package io.github.wulkanowy.ui.modules.about.logviewer + +import io.github.wulkanowy.ui.base.BaseView +import java.io.File + +interface LogViewerView : BaseView { + + fun initView() + + fun setLines(lines: List) + + fun shareLogs(files: List) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/account/Account.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/account/Account.kt new file mode 100644 index 00000000..dbcb499e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/account/Account.kt @@ -0,0 +1,3 @@ +package io.github.wulkanowy.ui.modules.account + +data class Account(val email: String, val isParent: Boolean) diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountAdapter.kt new file mode 100644 index 00000000..7ecb4139 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountAdapter.kt @@ -0,0 +1,93 @@ +package io.github.wulkanowy.ui.modules.account + +import android.annotation.SuppressLint +import android.graphics.PorterDuff +import android.view.LayoutInflater +import android.view.View.GONE +import android.view.View.VISIBLE +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.databinding.HeaderAccountBinding +import io.github.wulkanowy.databinding.ItemAccountBinding +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.utils.getThemeAttrColor +import javax.inject.Inject + +class AccountAdapter @Inject constructor() : RecyclerView.Adapter() { + + var items = emptyList>() + + var onClickListener: (StudentWithSemesters) -> Unit = {} + + override fun getItemCount() = items.size + + override fun getItemViewType(position: Int) = items[position].viewType.id + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + + return when (viewType) { + AccountItem.ViewType.HEADER.id -> HeaderViewHolder(HeaderAccountBinding.inflate(inflater, parent, false)) + AccountItem.ViewType.ITEM.id -> ItemViewHolder(ItemAccountBinding.inflate(inflater, parent, false)) + else -> throw IllegalStateException() + } + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + when (holder) { + is HeaderViewHolder -> bindHeaderViewHolder(holder.binding, items[position].value as Account) + is ItemViewHolder -> bindItemViewHolder(holder.binding, items[position].value as StudentWithSemesters) + } + } + + private fun bindHeaderViewHolder(binding: HeaderAccountBinding, account: Account) { + with(binding) { + accountHeaderEmail.text = account.email + accountHeaderType.setText(if (account.isParent) R.string.account_type_parent else R.string.account_type_student) + } + } + + @SuppressLint("SetTextI18n") + private fun bindItemViewHolder(binding: ItemAccountBinding, studentWithSemesters: StudentWithSemesters) { + val student = studentWithSemesters.student + val semesters = studentWithSemesters.semesters + val diary = semesters.maxByOrNull { it.semesterId } + + with(binding) { + accountItemName.text = "${student.studentName} ${diary?.diaryName.orEmpty()}" + accountItemSchool.text = studentWithSemesters.student.schoolName + with(accountItemLoginMode) { + visibility = when (Sdk.Mode.valueOf(student.loginMode)) { + Sdk.Mode.API -> { + setText(R.string.account_login_mobile_api) + VISIBLE + } + Sdk.Mode.HYBRID -> { + setText(R.string.account_login_hybrid) + VISIBLE + } + Sdk.Mode.SCRAPPER -> { + GONE + } + } + } + + with(accountItemImage) { + val colorImage = if (student.isCurrent) context.getThemeAttrColor(R.attr.colorPrimary) + else context.getThemeAttrColor(R.attr.colorOnSurface, 153) + + setColorFilter(colorImage, PorterDuff.Mode.SRC_IN) + } + + root.setOnClickListener { onClickListener(studentWithSemesters) } + } + } + + class HeaderViewHolder(val binding: HeaderAccountBinding) : + RecyclerView.ViewHolder(binding.root) + + class ItemViewHolder(val binding: ItemAccountBinding) : RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountDialog.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountDialog.kt new file mode 100644 index 00000000..1fa87268 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountDialog.kt @@ -0,0 +1,102 @@ +package io.github.wulkanowy.ui.modules.account + +import android.os.Bundle +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import android.widget.Toast +import android.widget.Toast.LENGTH_LONG +import androidx.appcompat.app.AlertDialog +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.databinding.DialogAccountBinding +import io.github.wulkanowy.ui.base.BaseDialogFragment +import io.github.wulkanowy.ui.modules.login.LoginActivity +import javax.inject.Inject + +@AndroidEntryPoint +class AccountDialog : BaseDialogFragment(), AccountView { + + @Inject + lateinit var presenter: AccountPresenter + + @Inject + lateinit var accountAdapter: AccountAdapter + + companion object { + fun newInstance() = AccountDialog() + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setStyle(STYLE_NO_TITLE, 0) + } + + override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { + return DialogAccountBinding.inflate(inflater).apply { binding = this }.root + } + + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + presenter.onAttachView(this) + } + + override fun initView() { + accountAdapter.onClickListener = presenter::onItemSelected + + with(binding) { + accountDialogAdd.setOnClickListener { presenter.onAddSelected() } + accountDialogRemove.setOnClickListener { presenter.onRemoveSelected() } + accountDialogRecycler.apply { + layoutManager = LinearLayoutManager(context) + adapter = accountAdapter + } + } + } + + override fun updateData(data: List>) { + with(accountAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun showError(text: String, error: Throwable) { + showMessage(text) + } + + override fun showMessage(text: String) { + Toast.makeText(context, text, LENGTH_LONG).show() + } + + override fun dismissView() { + dismiss() + } + + override fun openLoginView() { + activity?.let { + startActivity(LoginActivity.getStartIntent(it)) + } + } + + override fun showConfirmDialog() { + context?.let { + AlertDialog.Builder(it) + .setTitle(R.string.account_logout_student) + .setMessage(R.string.account_confirm) + .setPositiveButton(R.string.account_logout) { _, _ -> presenter.onLogoutConfirm() } + .setNegativeButton(android.R.string.cancel) { _, _ -> } + .show() + } + } + + override fun recreateMainView() { + activity?.recreate() + } + + override fun onDestroy() { + presenter.onDetachView() + super.onDestroy() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountItem.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountItem.kt new file mode 100644 index 00000000..05a4a69c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountItem.kt @@ -0,0 +1,9 @@ +package io.github.wulkanowy.ui.modules.account + +data class AccountItem(val value: T, val viewType: ViewType) { + + enum class ViewType(val id: Int) { + HEADER(1), + ITEM(2) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountPresenter.kt new file mode 100644 index 00000000..4eaee429 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountPresenter.kt @@ -0,0 +1,115 @@ +package io.github.wulkanowy.ui.modules.account + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.services.sync.SyncManager +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class AccountPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val syncManager: SyncManager +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: AccountView) { + super.onAttachView(view) + view.initView() + Timber.i("Account dialog view was initialized") + loadData() + } + + fun onAddSelected() { + Timber.i("Select add account") + view?.openLoginView() + } + + fun onRemoveSelected() { + Timber.i("Select remove account") + view?.showConfirmDialog() + } + + fun onLogoutConfirm() { + flowWithResource { + val student = studentRepository.getCurrentStudent(false) + studentRepository.logoutStudent(student) + + val students = studentRepository.getSavedStudents(false) + if (students.isNotEmpty()) { + studentRepository.switchStudent(students[0]) + } + students + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Attempt to logout current user ") + Status.SUCCESS -> view?.run { + if (it.data!!.isEmpty()) { + Timber.i("Logout result: Open login view") + syncManager.stopSyncWorker() + openClearLoginView() + } else { + Timber.i("Logout result: Switch to another student") + recreateMainView() + } + } + Status.ERROR -> { + Timber.i("Logout result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.dismissView() + }.launch("logout") + } + + fun onItemSelected(studentWithSemesters: StudentWithSemesters) { + Timber.i("Select student item ${studentWithSemesters.student.id}") + if (studentWithSemesters.student.isCurrent) { + view?.dismissView() + } else flowWithResource { studentRepository.switchStudent(studentWithSemesters) }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Attempt to change a student") + Status.SUCCESS -> { + Timber.i("Change a student result: Success") + view?.recreateMainView() + } + Status.ERROR -> { + Timber.i("Change a student result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.dismissView() + }.launch("switch") + } + + private fun createAccountItems(items: List): List> { + return items.groupBy { Account(it.student.email, it.student.isParent) }.map { (account, students) -> + listOf(AccountItem(account, AccountItem.ViewType.HEADER)) + students.map { student -> + AccountItem(student, AccountItem.ViewType.ITEM) + } + }.flatten() + } + + private fun loadData() { + flowWithResource { studentRepository.getSavedStudents(false) }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading account data started") + Status.SUCCESS -> { + Timber.i("Loading account result: Success") + view?.updateData(createAccountItems(it.data!!)) + } + Status.ERROR -> { + Timber.i("Loading account result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountView.kt new file mode 100644 index 00000000..a1f8086c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/account/AccountView.kt @@ -0,0 +1,19 @@ +package io.github.wulkanowy.ui.modules.account + +import io.github.wulkanowy.ui.base.BaseView + +interface AccountView : BaseView { + + fun initView() + + fun updateData(data: List>) + + fun dismissView() + + fun showConfirmDialog() + + fun openLoginView() + + fun recreateMainView() +} + diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceAdapter.kt new file mode 100644 index 00000000..a63d5045 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceAdapter.kt @@ -0,0 +1,80 @@ +package io.github.wulkanowy.ui.modules.attendance + +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.core.view.isVisible +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Attendance +import io.github.wulkanowy.data.repositories.attendance.SentExcuseStatus +import io.github.wulkanowy.databinding.ItemAttendanceBinding +import javax.inject.Inject + +class AttendanceAdapter @Inject constructor() : + RecyclerView.Adapter() { + + var items = emptyList() + + var excuseActionMode: Boolean = false + + var onClickListener: (Attendance) -> Unit = {} + + var onExcuseCheckboxSelect: (attendanceItem: Attendance, checked: Boolean) -> Unit = { _, _ -> } + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemAttendanceBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val item = items[position] + + with(holder.binding) { + attendanceItemNumber.text = item.number.toString() + attendanceItemSubject.text = item.subject + attendanceItemDescription.text = item.name + attendanceItemAlert.visibility = item.run { if (absence && !excused) View.VISIBLE else View.INVISIBLE } + attendanceItemNumber.visibility = View.GONE + attendanceItemExcuseInfo.visibility = View.GONE + attendanceItemExcuseCheckbox.visibility = View.GONE + attendanceItemExcuseCheckbox.isChecked = false + attendanceItemExcuseCheckbox.setOnCheckedChangeListener { _, checked -> + onExcuseCheckboxSelect(item, checked) + } + + when (if (item.excuseStatus != null) SentExcuseStatus.valueOf(item.excuseStatus) else null) { + SentExcuseStatus.WAITING -> { + attendanceItemExcuseInfo.setImageResource(R.drawable.ic_excuse_waiting) + attendanceItemExcuseInfo.visibility = View.VISIBLE + attendanceItemAlert.visibility = View.INVISIBLE + } + SentExcuseStatus.DENIED -> { + attendanceItemExcuseInfo.setImageResource(R.drawable.ic_excuse_denied) + attendanceItemExcuseInfo.visibility = View.VISIBLE + } + else -> { + if (item.excusable && excuseActionMode) { + attendanceItemNumber.visibility = View.GONE + attendanceItemExcuseCheckbox.visibility = View.VISIBLE + } else { + attendanceItemNumber.visibility = View.VISIBLE + attendanceItemExcuseCheckbox.visibility = View.GONE + } + } + } + root.setOnClickListener { + onClickListener(item) + + with(attendanceItemExcuseCheckbox) { + if (excuseActionMode && isVisible) { + isChecked = !isChecked + } + } + } + } + } + + class ItemViewHolder(val binding: ItemAttendanceBinding) : RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceDialog.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceDialog.kt new file mode 100644 index 00000000..97b76e81 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceDialog.kt @@ -0,0 +1,52 @@ +package io.github.wulkanowy.ui.modules.attendance + +import android.os.Bundle +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.fragment.app.DialogFragment +import io.github.wulkanowy.data.db.entities.Attendance +import io.github.wulkanowy.databinding.DialogAttendanceBinding +import io.github.wulkanowy.utils.lifecycleAwareVariable +import io.github.wulkanowy.utils.toFormattedString + +class AttendanceDialog : DialogFragment() { + + private var binding: DialogAttendanceBinding by lifecycleAwareVariable() + + private lateinit var attendance: Attendance + + companion object { + private const val ARGUMENT_KEY = "Item" + + fun newInstance(exam: Attendance): AttendanceDialog { + return AttendanceDialog().apply { + arguments = Bundle().apply { putSerializable(ARGUMENT_KEY, exam) } + } + } + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setStyle(STYLE_NO_TITLE, 0) + arguments?.run { + attendance = getSerializable(ARGUMENT_KEY) as Attendance + } + } + + override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { + return DialogAttendanceBinding.inflate(inflater).apply { binding = this }.root + } + + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + + with(binding) { + attendanceDialogSubject.text = attendance.subject + attendanceDialogDescription.text = attendance.name + attendanceDialogDate.text = attendance.date.toFormattedString() + attendanceDialogNumber.text = attendance.number.toString() + attendanceDialogClose.setOnClickListener { dismiss() } + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceFragment.kt new file mode 100644 index 00000000..c7caef06 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceFragment.kt @@ -0,0 +1,271 @@ +package io.github.wulkanowy.ui.modules.attendance + +import android.content.DialogInterface.BUTTON_POSITIVE +import android.os.Bundle +import android.view.LayoutInflater +import android.view.Menu +import android.view.MenuInflater +import android.view.MenuItem +import android.view.View +import android.view.View.GONE +import android.view.View.INVISIBLE +import android.view.View.VISIBLE +import androidx.appcompat.app.AlertDialog +import androidx.appcompat.view.ActionMode +import androidx.recyclerview.widget.LinearLayoutManager +import com.wdullaer.materialdatetimepicker.date.DatePickerDialog +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Attendance +import io.github.wulkanowy.databinding.DialogExcuseBinding +import io.github.wulkanowy.databinding.FragmentAttendanceBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.attendance.summary.AttendanceSummaryFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.widgets.DividerItemDecoration +import io.github.wulkanowy.utils.SchooldaysRangeLimiter +import io.github.wulkanowy.utils.dpToPx +import java.time.LocalDate +import javax.inject.Inject + +@AndroidEntryPoint +class AttendanceFragment : BaseFragment(R.layout.fragment_attendance), AttendanceView, MainView.MainChildView, + MainView.TitledView { + + @Inject + lateinit var presenter: AttendancePresenter + + @Inject + lateinit var attendanceAdapter: AttendanceAdapter + + override val excuseSuccessString: String + get() = getString(R.string.attendance_excuse_success) + + override val excuseNoSelectionString: String + get() = getString(R.string.attendance_excuse_no_selection) + + companion object { + private const val SAVED_DATE_KEY = "CURRENT_DATE" + + fun newInstance() = AttendanceFragment() + } + + override val titleStringId get() = R.string.attendance_title + + override val isViewEmpty get() = attendanceAdapter.items.isEmpty() + + override val currentStackSize get() = (activity as? MainActivity)?.currentStackSize + + override val excuseActionMode: Boolean get() = attendanceAdapter.excuseActionMode + + private var actionMode: ActionMode? = null + private val actionModeCallback = object : ActionMode.Callback { + override fun onCreateActionMode(mode: ActionMode, menu: Menu): Boolean { + val inflater = mode.menuInflater + inflater.inflate(R.menu.context_menu_excuse, menu) + return true + } + + override fun onPrepareActionMode(mode: ActionMode, menu: Menu): Boolean { + mode.title = getString(R.string.attendance_excuse_title) + return presenter.onPrepareActionMode() + } + + override fun onDestroyActionMode(mode: ActionMode) { + presenter.onDestroyActionMode() + actionMode = null + } + + override fun onActionItemClicked(mode: ActionMode, menu: MenuItem): Boolean { + return when (menu.itemId) { + R.id.excuseMenuSubmit -> presenter.onExcuseSubmitButtonClick() + else -> false + } + } + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setHasOptionsMenu(true) + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentAttendanceBinding.bind(view) + messageContainer = binding.attendanceRecycler + presenter.onAttachView(this, savedInstanceState?.getLong(SAVED_DATE_KEY)) + } + + override fun initView() { + with(attendanceAdapter) { + onClickListener = presenter::onAttendanceItemSelected + onExcuseCheckboxSelect = presenter::onExcuseCheckboxSelect + } + + with(binding.attendanceRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = attendanceAdapter + addItemDecoration(DividerItemDecoration(context)) + } + + with(binding) { + attendanceSwipe.setOnRefreshListener(presenter::onSwipeRefresh) + attendanceErrorRetry.setOnClickListener { presenter.onRetry() } + attendanceErrorDetails.setOnClickListener { presenter.onDetailsClick() } + + attendancePreviousButton.setOnClickListener { presenter.onPreviousDay() } + attendanceNavDate.setOnClickListener { presenter.onPickDate() } + attendanceNextButton.setOnClickListener { presenter.onNextDay() } + + attendanceExcuseButton.setOnClickListener { presenter.onExcuseButtonClick() } + + attendanceNavContainer.setElevationCompat(requireContext().dpToPx(8f)) + } + } + + override fun onCreateOptionsMenu(menu: Menu, inflater: MenuInflater) { + inflater.inflate(R.menu.action_menu_attendance, menu) + } + + override fun onOptionsItemSelected(item: MenuItem): Boolean { + return if (item.itemId == R.id.attendanceMenuSummary) presenter.onSummarySwitchSelected() + else false + } + + override fun updateData(data: List) { + with(attendanceAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun updateNavigationDay(date: String) { + binding.attendanceNavDate.text = date + } + + override fun clearData() { + with(attendanceAdapter) { + items = emptyList() + notifyDataSetChanged() + } + } + + override fun resetView() { + binding.attendanceRecycler.smoothScrollToPosition(0) + } + + override fun onFragmentReselected() { + if (::presenter.isInitialized) presenter.onViewReselected() + } + + override fun onFragmentChanged() { + if (::presenter.isInitialized) presenter.onMainViewChanged() + } + + override fun popView() { + (activity as? MainActivity)?.popView() + } + + override fun showEmpty(show: Boolean) { + binding.attendanceEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.attendanceError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.attendanceErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.attendanceProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.attendanceSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding. attendanceRecycler.visibility = if (show) VISIBLE else GONE + } + + override fun hideRefresh() { + binding.attendanceSwipe.isRefreshing = false + } + + override fun showPreButton(show: Boolean) { + binding.attendancePreviousButton.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showNextButton(show: Boolean) { + binding. attendanceNextButton.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showExcuseButton(show: Boolean) { + binding.attendanceExcuseButton.visibility = if (show) VISIBLE else GONE + } + + override fun showAttendanceDialog(lesson: Attendance) { + (activity as? MainActivity)?.showDialogFragment(AttendanceDialog.newInstance(lesson)) + } + + override fun showDatePickerDialog(currentDate: LocalDate) { + val dateSetListener = DatePickerDialog.OnDateSetListener { _, year, month, dayOfMonth -> + presenter.onDateSet(year, month + 1, dayOfMonth) + } + val datePickerDialog = DatePickerDialog.newInstance(dateSetListener, + currentDate.year, currentDate.monthValue - 1, currentDate.dayOfMonth) + + with(datePickerDialog) { + setDateRangeLimiter(SchooldaysRangeLimiter()) + version = DatePickerDialog.Version.VERSION_2 + scrollOrientation = DatePickerDialog.ScrollOrientation.VERTICAL + show(this@AttendanceFragment.parentFragmentManager, null) + } + } + + override fun showExcuseDialog() { + val dialogBinding = DialogExcuseBinding.inflate(LayoutInflater.from(context)) + AlertDialog.Builder(requireContext()) + .setTitle(R.string.attendance_excuse_title) + .setView(dialogBinding.root) + .setNegativeButton(android.R.string.cancel) { _, _ -> } + .create() + .apply { + setButton(BUTTON_POSITIVE, getString(R.string.attendance_excuse_dialog_submit)) { _, _ -> + presenter.onExcuseDialogSubmit(dialogBinding.excuseReason.text?.toString().orEmpty()) + } + }.show() + } + + override fun openSummaryView() { + (activity as? MainActivity)?.pushView(AttendanceSummaryFragment.newInstance()) + } + + override fun startActionMode() { + actionMode = (activity as MainActivity?)?.startSupportActionMode(actionModeCallback) + } + + override fun showExcuseCheckboxes(show: Boolean) { + attendanceAdapter.apply { + excuseActionMode = show + notifyDataSetChanged() + } + } + + override fun finishActionMode() { + actionMode?.finish() + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putLong(SAVED_DATE_KEY, presenter.currentDate.toEpochDay()) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendancePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendancePresenter.kt new file mode 100644 index 00000000..158f08ba --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendancePresenter.kt @@ -0,0 +1,296 @@ +package io.github.wulkanowy.ui.modules.attendance + +import android.annotation.SuppressLint +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Attendance +import io.github.wulkanowy.data.repositories.attendance.AttendanceRepository +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.flowWithResourceIn +import io.github.wulkanowy.utils.getLastSchoolDayIfHoliday +import io.github.wulkanowy.utils.isHolidays +import io.github.wulkanowy.utils.nextSchoolDay +import io.github.wulkanowy.utils.previousOrSameSchoolDay +import io.github.wulkanowy.utils.previousSchoolDay +import io.github.wulkanowy.utils.toFormattedString +import kotlinx.coroutines.flow.catch +import kotlinx.coroutines.flow.flow +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import java.time.LocalDate +import java.time.LocalDate.now +import java.time.LocalDate.ofEpochDay +import javax.inject.Inject + +class AttendancePresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val attendanceRepository: AttendanceRepository, + private val semesterRepository: SemesterRepository, + private val prefRepository: PreferencesRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private var baseDate: LocalDate = now().previousOrSameSchoolDay + + lateinit var currentDate: LocalDate + private set + + private lateinit var lastError: Throwable + + private val attendanceToExcuseList = mutableListOf() + + fun onAttachView(view: AttendanceView, date: Long?) { + super.onAttachView(view) + view.initView() + Timber.i("Attendance view was initialized") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData(ofEpochDay(date ?: baseDate.toEpochDay())) + if (currentDate.isHolidays) setBaseDateOnHolidays() + reloadView() + } + + fun onPreviousDay() { + view?.finishActionMode() + attendanceToExcuseList.clear() + loadData(currentDate.previousSchoolDay) + reloadView() + } + + fun onNextDay() { + view?.finishActionMode() + attendanceToExcuseList.clear() + loadData(currentDate.nextSchoolDay) + reloadView() + } + + fun onPickDate() { + view?.showDatePickerDialog(currentDate) + } + + fun onDateSet(year: Int, month: Int, day: Int) { + loadData(LocalDate.of(year, month, day)) + reloadView() + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the attendance") + loadData(currentDate, true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(currentDate, true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onViewReselected() { + Timber.i("Attendance view is reselected") + view?.also { view -> + if (view.currentStackSize == 1) { + baseDate.also { + if (currentDate != it) { + loadData(it) + reloadView() + } else if (!view.isViewEmpty) view.resetView() + } + } else view.popView() + } + } + + fun onMainViewChanged() { + view?.finishActionMode() + } + + fun onAttendanceItemSelected(attendance: Attendance) { + view?.apply { + if (!excuseActionMode) { + Timber.i("Select attendance item ${attendance.id}") + showAttendanceDialog(attendance) + } + } + } + + fun onExcuseButtonClick() { + view?.startActionMode() + } + + fun onExcuseCheckboxSelect(attendanceItem: Attendance, checked: Boolean) { + if (checked) attendanceToExcuseList.add(attendanceItem) + else attendanceToExcuseList.remove(attendanceItem) + } + + fun onExcuseSubmitButtonClick(): Boolean { + view?.apply { + return if (attendanceToExcuseList.isNotEmpty()) { + showExcuseDialog() + true + } else { + showMessage(excuseNoSelectionString) + false + } + } + return false + } + + fun onExcuseDialogSubmit(reason: String) { + view?.finishActionMode() + excuseAbsence(if (reason != "") reason else null, attendanceToExcuseList.toList()) + } + + fun onPrepareActionMode(): Boolean { + view?.apply { + showExcuseCheckboxes(true) + showExcuseButton(false) + } + attendanceToExcuseList.clear() + return true + } + + fun onDestroyActionMode() { + view?.apply { + showExcuseCheckboxes(false) + showExcuseButton(true) + } + } + + fun onSummarySwitchSelected(): Boolean { + view?.openSummaryView() + return true + } + + private fun setBaseDateOnHolidays() { + flow { + val student = studentRepository.getCurrentStudent() + emit(semesterRepository.getCurrentSemester(student)) + }.catch { + Timber.i("Loading semester result: An exception occurred") + }.onEach { + baseDate = baseDate.getLastSchoolDayIfHoliday(it.schoolYear) + currentDate = baseDate + reloadNavigation() + }.launch("holidays") + } + + private fun loadData(date: LocalDate, forceRefresh: Boolean = false) { + Timber.i("Loading attendance data started") + currentDate = date + + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + attendanceRepository.getAttendance(student, semester, date, date, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> view?.showExcuseButton(false) + Status.SUCCESS -> { + Timber.i("Loading attendance result: Success") + view?.apply { + updateData(it.data!!.let { items -> + if (prefRepository.isShowPresent) items + else items.filter { item -> !item.presence } + }.sortedBy { item -> item.number }) + showEmpty(it.data.isEmpty()) + showErrorView(false) + showContent(it.data.isNotEmpty()) + showExcuseButton(it.data.any { item -> item.excusable }) + } + analytics.logEvent( + "load_data", + "type" to "attendance", + "items" to it.data!!.size + ) + } + Status.ERROR -> { + Timber.i("Loading attendance result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + } + }.launch() + } + + private fun excuseAbsence(reason: String?, toExcuseList: List) { + flowWithResource { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + attendanceRepository.excuseForAbsence(student, semester, toExcuseList, reason) + }.onEach { + when (it.status) { + Status.LOADING -> view?.run { + Timber.i("Excusing absence started") + showProgress(true) + showContent(false) + showExcuseButton(false) + } + Status.SUCCESS -> { + Timber.i("Excusing for absence result: Success") + analytics.logEvent("excuse_absence", "items" to attendanceToExcuseList.size) + attendanceToExcuseList.clear() + view?.run { + showExcuseButton(false) + showMessage(excuseSuccessString) + showContent(true) + showProgress(false) + } + loadData(currentDate, forceRefresh = true) + } + Status.ERROR -> { + Timber.i("Excusing for absence result: An exception occurred") + errorHandler.dispatch(it.error!!) + loadData(currentDate) + } + } + }.launch("excuse") + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + private fun reloadView() { + Timber.i("Reload attendance view with the date ${currentDate.toFormattedString()}") + view?.apply { + showProgress(true) + enableSwipe(false) + showContent(false) + showEmpty(false) + showErrorView(false) + clearData() + reloadNavigation() + } + } + + @SuppressLint("DefaultLocale") + private fun reloadNavigation() { + view?.apply { + showPreButton(!currentDate.minusDays(1).isHolidays) + showNextButton(!currentDate.plusDays(1).isHolidays) + updateNavigationDay(currentDate.toFormattedString("EEEE, dd.MM").capitalize()) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceView.kt new file mode 100644 index 00000000..d54fb8bf --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/AttendanceView.kt @@ -0,0 +1,64 @@ +package io.github.wulkanowy.ui.modules.attendance + +import io.github.wulkanowy.data.db.entities.Attendance +import io.github.wulkanowy.ui.base.BaseView +import java.time.LocalDate + +interface AttendanceView : BaseView { + + val isViewEmpty: Boolean + + val currentStackSize: Int? + + val excuseSuccessString: String + + val excuseNoSelectionString: String + + val excuseActionMode: Boolean + + fun initView() + + fun updateData(data: List) + + fun updateNavigationDay(date: String) + + fun clearData() + + fun hideRefresh() + + fun resetView() + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) + + fun showPreButton(show: Boolean) + + fun showNextButton(show: Boolean) + + fun showExcuseButton(show: Boolean) + + fun showAttendanceDialog(lesson: Attendance) + + fun showDatePickerDialog(currentDate: LocalDate) + + fun showExcuseDialog() + + fun openSummaryView() + + fun startActionMode() + + fun showExcuseCheckboxes(show: Boolean) + + fun finishActionMode() + + fun popView() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryAdapter.kt new file mode 100644 index 00000000..4250a910 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryAdapter.kt @@ -0,0 +1,101 @@ +package io.github.wulkanowy.ui.modules.attendance.summary + +import android.view.LayoutInflater +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.AttendanceSummary +import io.github.wulkanowy.databinding.ItemAttendanceSummaryBinding +import io.github.wulkanowy.databinding.ScrollableHeaderAttendanceSummaryBinding +import io.github.wulkanowy.utils.calculatePercentage +import io.github.wulkanowy.utils.getFormattedName +import java.time.Month +import java.util.Locale +import javax.inject.Inject + +class AttendanceSummaryAdapter @Inject constructor() : + RecyclerView.Adapter() { + + private enum class ViewType(val id: Int) { + HEADER(1), + ITEM(2) + } + + var items = emptyList() + + override fun getItemCount() = if (items.isNotEmpty()) items.size + 2 else 0 + + override fun getItemViewType(position: Int) = when (position) { + 0 -> ViewType.HEADER.id + else -> ViewType.ITEM.id + } + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + + return when (viewType) { + ViewType.HEADER.id -> HeaderViewHolder(ScrollableHeaderAttendanceSummaryBinding.inflate(inflater, parent, false)) + ViewType.ITEM.id -> ItemViewHolder(ItemAttendanceSummaryBinding.inflate(inflater, parent, false)) + else -> throw IllegalStateException() + } + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + when (holder) { + is HeaderViewHolder -> bindHeaderViewHolder(holder.binding) + is ItemViewHolder -> bindItemViewHolder(holder.binding, position - 2) + } + } + + private fun bindHeaderViewHolder(binding: ScrollableHeaderAttendanceSummaryBinding) { + binding.attendanceSummaryScrollableHeaderPercentage.text = formatPercentage(items.calculatePercentage()) + } + + private fun bindItemViewHolder(binding: ItemAttendanceSummaryBinding, position: Int) { + val item = if (position == -1) getTotalItem() else items[position] + + with(binding) { + attendanceSummaryMonth.text = when (position) { + -1 -> root.context.getString(R.string.attendance_summary_total) + else -> item.month.getFormattedName() + } + attendanceSummaryPercentage.text = when (position) { + -1 -> formatPercentage(items.calculatePercentage()) + else -> formatPercentage(item.calculatePercentage()) + } + + attendanceSummaryPresent.text = item.presence.toString() + attendanceSummaryAbsenceUnexcused.text = item.absence.toString() + attendanceSummaryAbsenceExcused.text = item.absenceExcused.toString() + attendanceSummaryAbsenceSchool.text = item.absenceForSchoolReasons.toString() + attendanceSummaryExemption.text = item.exemption.toString() + attendanceSummaryLatenessUnexcused.text = item.lateness.toString() + attendanceSummaryLatenessExcused.text = item.latenessExcused.toString() + } + } + + private fun getTotalItem() = AttendanceSummary( + month = Month.APRIL, + presence = items.sumBy { it.presence }, + absence = items.sumBy { it.absence }, + absenceExcused = items.sumBy { it.absenceExcused }, + absenceForSchoolReasons = items.sumBy { it.absenceForSchoolReasons }, + exemption = items.sumBy { it.exemption }, + lateness = items.sumBy { it.lateness }, + latenessExcused = items.sumBy { it.latenessExcused }, + diaryId = -1, + studentId = -1, + subjectId = -1 + ) + + private fun formatPercentage(percentage: Double): String { + return if (percentage == 0.0) "0%" + else "${String.format(Locale.FRANCE, "%.2f", percentage)}%" + } + + class HeaderViewHolder(val binding: ScrollableHeaderAttendanceSummaryBinding) : + RecyclerView.ViewHolder(binding.root) + + class ItemViewHolder(val binding: ItemAttendanceSummaryBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryFragment.kt new file mode 100644 index 00000000..2f862237 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryFragment.kt @@ -0,0 +1,137 @@ +package io.github.wulkanowy.ui.modules.attendance.summary + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.INVISIBLE +import android.view.View.VISIBLE +import android.widget.ArrayAdapter +import android.widget.TextView +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.AttendanceSummary +import io.github.wulkanowy.databinding.FragmentAttendanceSummaryBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.dpToPx +import io.github.wulkanowy.utils.setOnItemSelectedListener +import javax.inject.Inject + +@AndroidEntryPoint +class AttendanceSummaryFragment : + BaseFragment(R.layout.fragment_attendance_summary), + AttendanceSummaryView, MainView.TitledView { + + @Inject + lateinit var presenter: AttendanceSummaryPresenter + + @Inject + lateinit var attendanceSummaryAdapter: AttendanceSummaryAdapter + + private lateinit var subjectsAdapter: ArrayAdapter + + companion object { + private const val SAVED_SUBJECT_KEY = "CURRENT_SUBJECT" + + fun newInstance() = AttendanceSummaryFragment() + } + + override val titleStringId get() = R.string.attendance_title + + override val isViewEmpty get() = attendanceSummaryAdapter.items.isEmpty() + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentAttendanceSummaryBinding.bind(view) + messageContainer = binding.attendanceSummaryRecycler + presenter.onAttachView(this, savedInstanceState?.getInt(SAVED_SUBJECT_KEY)) + } + + override fun initView() { + with(binding.attendanceSummaryRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = attendanceSummaryAdapter + } + + with(binding) { + attendanceSummarySwipe.setOnRefreshListener(presenter::onSwipeRefresh) + attendanceSummaryErrorRetry.setOnClickListener { presenter.onRetry() } + attendanceSummaryErrorDetails.setOnClickListener { presenter.onDetailsClick() } + } + + subjectsAdapter = ArrayAdapter(requireContext(), android.R.layout.simple_spinner_item, mutableListOf()) + subjectsAdapter.setDropDownViewResource(R.layout.item_attendance_summary_subject) + + with(binding.attendanceSummarySubjects) { + adapter = subjectsAdapter + setOnItemSelectedListener { presenter.onSubjectSelected(it?.text?.toString()) } + } + + binding.attendanceSummarySubjectsContainer.setElevationCompat(requireContext().dpToPx(1f)) + } + + override fun updateSubjects(data: ArrayList) { + with(subjectsAdapter) { + clear() + addAll(data) + notifyDataSetChanged() + } + } + + override fun updateDataSet(data: List) { + with(attendanceSummaryAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun clearView() { + with(attendanceSummaryAdapter) { + items = emptyList() + notifyDataSetChanged() + } + } + + override fun showEmpty(show: Boolean) { + binding.attendanceSummaryEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.attendanceSummaryError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.attendanceSummaryErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.attendanceSummaryProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.attendanceSummarySwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.attendanceSummaryRecycler.visibility = if (show) VISIBLE else GONE + } + + override fun showSubjects(show: Boolean) { + binding.attendanceSummarySubjectsContainer.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun hideRefresh() { + binding.attendanceSummarySwipe.isRefreshing = false + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putInt(SAVED_SUBJECT_KEY, presenter.currentSubjectId) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryPresenter.kt new file mode 100644 index 00000000..e5dce9ac --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryPresenter.kt @@ -0,0 +1,151 @@ +package io.github.wulkanowy.ui.modules.attendance.summary + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Subject +import io.github.wulkanowy.data.repositories.attendancesummary.AttendanceSummaryRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.data.repositories.subject.SubjectRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import java.time.Month +import javax.inject.Inject + +class AttendanceSummaryPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val attendanceSummaryRepository: AttendanceSummaryRepository, + private val subjectRepository: SubjectRepository, + private val semesterRepository: SemesterRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private var subjects = emptyList() + + var currentSubjectId = -1 + private set + + private lateinit var lastError: Throwable + + fun onAttachView(view: AttendanceSummaryView, subjectId: Int?) { + super.onAttachView(view) + view.initView() + Timber.i("Attendance summary view was initialized with subject id ${subjectId ?: -1}") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData(subjectId ?: -1) + loadSubjects() + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the attendance summary") + loadData(currentSubjectId, true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(currentSubjectId, true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onSubjectSelected(name: String?) { + Timber.i("Select attendance summary subject $name") + view?.run { + showContent(false) + showProgress(true) + enableSwipe(false) + showEmpty(false) + showErrorView(false) + clearView() + } + (subjects.singleOrNull { it.name == name }?.realId ?: -1).let { + if (it != currentSubjectId) loadData(it) + } + } + + private fun loadData(subjectId: Int, forceRefresh: Boolean = false) { + currentSubjectId = subjectId + + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + attendanceSummaryRepository.getAttendanceSummary(student, semester, subjectId, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading attendance summary data started") + Status.SUCCESS -> { + Timber.i("Loading attendance summary result: Success") + view?.apply { + showEmpty(it.data!!.isEmpty()) + showContent(it.data.isNotEmpty()) + updateDataSet(it.data.sortedByDescending { item -> + if (item.month.value <= Month.JUNE.value) item.month.value + 12 else item.month.value + }) + } + analytics.logEvent( + "load_data", + "type" to "attendance_summary", + "items" to it.data!!.size, + "item_id" to subjectId + ) + } + Status.ERROR -> { + Timber.i("Loading attendance summary result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + private fun loadSubjects() { + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + subjectRepository.getSubjects(student, semester) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading attendance summary subjects started") + Status.SUCCESS -> { + subjects = it.data!! + + Timber.i("Loading attendance summary subjects result: Success") + view?.run { + view?.updateSubjects(ArrayList(it.data.map { subject -> subject.name })) + showSubjects(true) + } + } + Status.ERROR -> { + Timber.i("Loading attendance summary subjects result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch("subjects") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryView.kt new file mode 100644 index 00000000..dd4053c7 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/attendance/summary/AttendanceSummaryView.kt @@ -0,0 +1,33 @@ +package io.github.wulkanowy.ui.modules.attendance.summary + +import io.github.wulkanowy.data.db.entities.AttendanceSummary +import io.github.wulkanowy.ui.base.BaseView + +interface AttendanceSummaryView : BaseView { + + val isViewEmpty: Boolean + + fun initView() + + fun hideRefresh() + + fun showContent(show: Boolean) + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun updateDataSet(data: List) + + fun updateSubjects(data: ArrayList) + + fun showSubjects(show: Boolean) + + fun clearView() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamAdapter.kt new file mode 100644 index 00000000..53558739 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamAdapter.kt @@ -0,0 +1,65 @@ +package io.github.wulkanowy.ui.modules.exam + +import android.annotation.SuppressLint +import android.view.LayoutInflater +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.data.db.entities.Exam +import io.github.wulkanowy.databinding.HeaderExamBinding +import io.github.wulkanowy.databinding.ItemExamBinding +import io.github.wulkanowy.utils.toFormattedString +import io.github.wulkanowy.utils.weekDayName +import java.time.LocalDate +import javax.inject.Inject + +class ExamAdapter @Inject constructor() : RecyclerView.Adapter() { + + var items = emptyList>() + + var onClickListener: (Exam) -> Unit = {} + + override fun getItemCount() = items.size + + override fun getItemViewType(position: Int) = items[position].viewType.id + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + + return when (viewType) { + ExamItem.ViewType.HEADER.id -> HeaderViewHolder(HeaderExamBinding.inflate(inflater, parent, false)) + ExamItem.ViewType.ITEM.id -> ItemViewHolder(ItemExamBinding.inflate(inflater, parent, false)) + else -> throw IllegalStateException() + } + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + when (holder) { + is HeaderViewHolder -> bindHeaderViewHolder(holder.binding, items[position].value as LocalDate) + is ItemViewHolder -> bindItemViewHolder(holder.binding, items[position].value as Exam) + } + } + + @SuppressLint("DefaultLocale") + private fun bindHeaderViewHolder(binding: HeaderExamBinding, date: LocalDate) { + with(binding) { + examHeaderDay.text = date.weekDayName.capitalize() + examHeaderDate.text = date.toFormattedString() + } + } + + private fun bindItemViewHolder(binding: ItemExamBinding, exam: Exam) { + with(binding) { + examItemSubject.text = exam.subject + examItemTeacher.text = exam.teacher + examItemType.text = exam.type + + root.setOnClickListener { onClickListener(exam) } + } + } + + private class HeaderViewHolder(val binding: HeaderExamBinding) : + RecyclerView.ViewHolder(binding.root) + + private class ItemViewHolder(val binding: ItemExamBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamDialog.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamDialog.kt new file mode 100644 index 00000000..c1a6f1f0 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamDialog.kt @@ -0,0 +1,54 @@ +package io.github.wulkanowy.ui.modules.exam + +import android.os.Bundle +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.fragment.app.DialogFragment +import io.github.wulkanowy.data.db.entities.Exam +import io.github.wulkanowy.databinding.DialogExamBinding +import io.github.wulkanowy.utils.lifecycleAwareVariable +import io.github.wulkanowy.utils.toFormattedString + +class ExamDialog : DialogFragment() { + + private var binding: DialogExamBinding by lifecycleAwareVariable() + + private lateinit var exam: Exam + + companion object { + private const val ARGUMENT_KEY = "Item" + + fun newInstance(exam: Exam): ExamDialog { + return ExamDialog().apply { + arguments = Bundle().apply { putSerializable(ARGUMENT_KEY, exam) } + } + } + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setStyle(STYLE_NO_TITLE, 0) + arguments?.run { + exam = getSerializable(ARGUMENT_KEY) as Exam + } + } + + override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { + return DialogExamBinding.inflate(inflater).apply { binding = this }.root + } + + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + + with(binding) { + examDialogSubjectValue.text = exam.subject + examDialogTypeValue.text = exam.type + examDialogTeacherValue.text = exam.teacher + examDialogDateValue.text = exam.entryDate.toFormattedString() + examDialogDescriptionValue.text = exam.description + + examDialogClose.setOnClickListener { dismiss() } + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamFragment.kt new file mode 100644 index 00000000..000da00f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamFragment.kt @@ -0,0 +1,143 @@ +package io.github.wulkanowy.ui.modules.exam + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.INVISIBLE +import android.view.View.VISIBLE +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Exam +import io.github.wulkanowy.databinding.FragmentExamBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.widgets.DividerItemDecoration +import io.github.wulkanowy.utils.dpToPx +import javax.inject.Inject + +@AndroidEntryPoint +class ExamFragment : BaseFragment(R.layout.fragment_exam), ExamView, + MainView.MainChildView, MainView.TitledView { + + @Inject + lateinit var presenter: ExamPresenter + + @Inject + lateinit var examAdapter: ExamAdapter + + companion object { + private const val SAVED_DATE_KEY = "CURRENT_DATE" + + fun newInstance() = ExamFragment() + } + + override val titleStringId get() = R.string.exam_title + + override val isViewEmpty get() = examAdapter.items.isEmpty() + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentExamBinding.bind(view) + messageContainer = binding.examRecycler + presenter.onAttachView(this, savedInstanceState?.getLong(SAVED_DATE_KEY)) + } + + override fun initView() { + examAdapter.onClickListener = presenter::onExamItemSelected + + with(binding.examRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = examAdapter + addItemDecoration(DividerItemDecoration(context)) + } + + with(binding) { + examSwipe.setOnRefreshListener(presenter::onSwipeRefresh) + examErrorRetry.setOnClickListener { presenter.onRetry() } + examErrorDetails.setOnClickListener { presenter.onDetailsClick() } + + examPreviousButton.setOnClickListener { presenter.onPreviousWeek() } + examNextButton.setOnClickListener { presenter.onNextWeek() } + + examNavContainer.setElevationCompat(requireContext().dpToPx(8f)) + } + } + + override fun hideRefresh() { + binding.examSwipe.isRefreshing = false + } + + override fun updateData(data: List>) { + with(examAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun updateNavigationWeek(date: String) { + binding.examNavDate.text = date + } + + override fun clearData() { + with(examAdapter) { + items = emptyList() + notifyDataSetChanged() + } + } + + override fun resetView() { + binding.examRecycler.scrollToPosition(0) + } + + override fun onFragmentReselected() { + if (::presenter.isInitialized) presenter.onViewReselected() + } + + override fun showEmpty(show: Boolean) { + binding.examEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.examError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.examErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.examProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.examSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.examRecycler.visibility = if (show) VISIBLE else GONE + } + + override fun showPreButton(show: Boolean) { + binding.examPreviousButton.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showNextButton(show: Boolean) { + binding.examNextButton.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showExamDialog(exam: Exam) { + (activity as? MainActivity)?.showDialogFragment(ExamDialog.newInstance(exam)) + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putLong(SAVED_DATE_KEY, presenter.currentDate.toEpochDay()) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamItem.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamItem.kt new file mode 100644 index 00000000..579e3720 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamItem.kt @@ -0,0 +1,9 @@ +package io.github.wulkanowy.ui.modules.exam + +data class ExamItem(val value: T, val viewType: ViewType) { + + enum class ViewType(val id: Int) { + HEADER(1), + ITEM(2) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamPresenter.kt new file mode 100644 index 00000000..f63316a8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamPresenter.kt @@ -0,0 +1,186 @@ +package io.github.wulkanowy.ui.modules.exam + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Exam +import io.github.wulkanowy.data.repositories.exam.ExamRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import io.github.wulkanowy.utils.getLastSchoolDayIfHoliday +import io.github.wulkanowy.utils.isHolidays +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.nextOrSameSchoolDay +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.toFormattedString +import kotlinx.coroutines.flow.catch +import kotlinx.coroutines.flow.flow +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import java.time.LocalDate +import java.time.LocalDate.now +import java.time.LocalDate.ofEpochDay +import javax.inject.Inject + +class ExamPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val examRepository: ExamRepository, + private val semesterRepository: SemesterRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private var baseDate: LocalDate = now().nextOrSameSchoolDay + + lateinit var currentDate: LocalDate + private set + + private lateinit var lastError: Throwable + + fun onAttachView(view: ExamView, date: Long?) { + super.onAttachView(view) + view.initView() + Timber.i("Exam view was initialized") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData(ofEpochDay(date ?: baseDate.toEpochDay())) + if (currentDate.isHolidays) setBaseDateOnHolidays() + reloadView() + } + + fun onPreviousWeek() { + loadData(currentDate.minusDays(7)) + reloadView() + } + + fun onNextWeek() { + loadData(currentDate.plusDays(7)) + reloadView() + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the exam") + loadData(currentDate, true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(currentDate, true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onExamItemSelected(exam: Exam) { + Timber.i("Select exam item ${exam.id}") + view?.showExamDialog(exam) + } + + fun onViewReselected() { + Timber.i("Exam view is reselected") + baseDate.also { + if (currentDate != it) { + loadData(it) + reloadView() + } else if (view?.isViewEmpty == false) view?.resetView() + } + } + + private fun setBaseDateOnHolidays() { + flow { + val student = studentRepository.getCurrentStudent() + emit(semesterRepository.getCurrentSemester(student)) + }.catch { + Timber.i("Loading semester result: An exception occurred") + }.onEach { + baseDate = baseDate.getLastSchoolDayIfHoliday(it.schoolYear) + currentDate = baseDate + reloadNavigation() + }.launch("holidays") + } + + private fun loadData(date: LocalDate, forceRefresh: Boolean = false) { + currentDate = date + + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + examRepository.getExams(student, semester, currentDate.monday, currentDate.sunday, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading exam data started") + Status.SUCCESS -> { + Timber.i("Loading exam result: Success") + view?.apply { + updateData(createExamItems(it.data!!)) + showEmpty(it.data.isEmpty()) + showErrorView(false) + showContent(it.data.isNotEmpty()) + } + analytics.logEvent( + "load_data", + "type" to "exam", + "items" to it.data!!.size + ) + } + Status.ERROR -> { + Timber.i("Loading exam result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + private fun createExamItems(items: List): List> { + return items.groupBy { it.date }.toSortedMap().map { (date, exams) -> + listOf(ExamItem(date, ExamItem.ViewType.HEADER)) + exams.reversed().map { exam -> + ExamItem(exam, ExamItem.ViewType.ITEM) + } + }.flatten() + } + + private fun reloadView() { + Timber.i("Reload exam view with the date ${currentDate.toFormattedString()}") + view?.apply { + showProgress(true) + enableSwipe(false) + showContent(false) + showEmpty(false) + showErrorView(false) + clearData() + reloadNavigation() + } + } + + private fun reloadNavigation() { + view?.apply { + showPreButton(!currentDate.minusDays(7).isHolidays) + showNextButton(!currentDate.plusDays(7).isHolidays) + updateNavigationWeek("${currentDate.monday.toFormattedString("dd.MM")} - " + + currentDate.sunday.toFormattedString("dd.MM")) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamView.kt new file mode 100644 index 00000000..00429bae --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/exam/ExamView.kt @@ -0,0 +1,39 @@ +package io.github.wulkanowy.ui.modules.exam + +import io.github.wulkanowy.data.db.entities.Exam +import io.github.wulkanowy.ui.base.BaseView + +interface ExamView : BaseView { + + val isViewEmpty: Boolean + + fun initView() + + fun updateData(data: List>) + + fun updateNavigationWeek(date: String) + + fun clearData() + + fun hideRefresh() + + fun resetView() + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) + + fun showNextButton(show: Boolean) + + fun showPreButton(show: Boolean) + + fun showExamDialog(exam: Exam) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeAverageMode.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeAverageMode.kt new file mode 100644 index 00000000..1960c3df --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeAverageMode.kt @@ -0,0 +1,11 @@ +package io.github.wulkanowy.ui.modules.grade + +enum class GradeAverageMode(val value: String) { + ALL_YEAR("all_year"), + ONE_SEMESTER("only_one_semester"), + BOTH_SEMESTERS("both_semesters"); + + companion object { + fun getByValue(value: String) = values().firstOrNull { it.value == value } ?: ONE_SEMESTER + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeAverageProvider.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeAverageProvider.kt new file mode 100644 index 00000000..5d0a310f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeAverageProvider.kt @@ -0,0 +1,136 @@ +package io.github.wulkanowy.ui.modules.grade + +import io.github.wulkanowy.data.Resource +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.data.db.entities.GradeSummary +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.grade.GradeRepository +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.ui.modules.grade.GradeAverageMode.ALL_YEAR +import io.github.wulkanowy.ui.modules.grade.GradeAverageMode.BOTH_SEMESTERS +import io.github.wulkanowy.ui.modules.grade.GradeAverageMode.ONE_SEMESTER +import io.github.wulkanowy.utils.calcAverage +import io.github.wulkanowy.utils.changeModifier +import io.github.wulkanowy.utils.flowWithResourceIn +import kotlinx.coroutines.FlowPreview +import kotlinx.coroutines.flow.Flow +import kotlinx.coroutines.flow.distinctUntilChanged +import kotlinx.coroutines.flow.filter +import kotlinx.coroutines.flow.flatMapConcat +import kotlinx.coroutines.flow.flowOf +import kotlinx.coroutines.flow.map +import javax.inject.Inject + +@OptIn(FlowPreview::class) +class GradeAverageProvider @Inject constructor( + private val semesterRepository: SemesterRepository, + private val gradeRepository: GradeRepository, + private val preferencesRepository: PreferencesRepository +) { + + private val plusModifier get() = preferencesRepository.gradePlusModifier + + private val minusModifier get() = preferencesRepository.gradeMinusModifier + + fun getGradesDetailsWithAverage(student: Student, semesterId: Int, forceRefresh: Boolean) = flowWithResourceIn { + val semesters = semesterRepository.getSemesters(student) + + when (preferencesRepository.gradeAverageMode) { + ONE_SEMESTER -> getSemesterDetailsWithAverage(student, semesters.single { it.semesterId == semesterId }, forceRefresh) + BOTH_SEMESTERS -> calculateBothSemestersAverage(student, semesters, semesterId, forceRefresh) + ALL_YEAR -> calculateAllYearAverage(student, semesters, semesterId, forceRefresh) + } + }.distinctUntilChanged() + + private fun calculateBothSemestersAverage(student: Student, semesters: List, semesterId: Int, forceRefresh: Boolean): Flow>> { + val selectedSemester = semesters.single { it.semesterId == semesterId } + val firstSemester = semesters.single { it.diaryId == selectedSemester.diaryId && it.semesterName == 1 } + + return getSemesterDetailsWithAverage(student, selectedSemester, forceRefresh).flatMapConcat { selectedDetails -> + val isAnyAverage = selectedDetails.data.orEmpty().any { it.average != .0 } + + if (selectedSemester != firstSemester) { + getSemesterDetailsWithAverage(student, firstSemester, forceRefresh).map { secondDetails -> + secondDetails.copy(data = selectedDetails.data?.map { selected -> + val second = secondDetails.data.orEmpty().singleOrNull { it.subject == selected.subject } + selected.copy(average = if (!isAnyAverage || preferencesRepository.gradeAverageForceCalc) { + val selectedGrades = selected.grades.updateModifiers(student).calcAverage() + (selectedGrades + (second?.grades?.updateModifiers(student)?.calcAverage() ?: selectedGrades)) / 2 + } else (selected.average + (second?.average ?: selected.average)) / 2) + }) + }.filter { it.status != Status.LOADING }.filter { it.data != null } + } else flowOf(selectedDetails) + } + } + + private fun calculateAllYearAverage(student: Student, semesters: List, semesterId: Int, forceRefresh: Boolean): Flow>> { + val selectedSemester = semesters.single { it.semesterId == semesterId } + val firstSemester = semesters.single { it.diaryId == selectedSemester.diaryId && it.semesterName == 1 } + + return getSemesterDetailsWithAverage(student, selectedSemester, forceRefresh).flatMapConcat { selectedDetails -> + val isAnyAverage = selectedDetails.data.orEmpty().any { it.average != .0 } + + if (selectedSemester != firstSemester) { + getSemesterDetailsWithAverage(student, firstSemester, forceRefresh).map { secondDetails -> + secondDetails.copy(data = selectedDetails.data?.map { selected -> + val second = secondDetails.data.orEmpty().singleOrNull { it.subject == selected.subject } + selected.copy(average = if (!isAnyAverage || preferencesRepository.gradeAverageForceCalc) { + (selected.grades.updateModifiers(student) + second?.grades?.updateModifiers(student).orEmpty()).calcAverage() + } else selected.average) + }) + }.filter { it.status != Status.LOADING }.filter { it.data != null } + } else flowOf(selectedDetails) + } + } + + private fun getSemesterDetailsWithAverage(student: Student, semester: Semester, forceRefresh: Boolean): Flow>> { + return gradeRepository.getGrades(student, semester, forceRefresh = forceRefresh).map { res -> + val (details, summaries) = res.data ?: null to null + val isAnyAverage = summaries.orEmpty().any { it.average != .0 } + val allGrades = details.orEmpty().groupBy { it.subject } + + Resource(res.status, summaries?.emulateEmptySummaries(student, semester, allGrades.toList(), isAnyAverage)?.map { summary -> + val grades = allGrades[summary.subject].orEmpty() + GradeDetailsWithAverage( + subject = summary.subject, + average = if (!isAnyAverage || preferencesRepository.gradeAverageForceCalc) { + grades.updateModifiers(student).calcAverage() + } else summary.average, + points = summary.pointsSum, + summary = summary, + grades = grades + ) + }, res.error) + } + } + + private fun List.emulateEmptySummaries(student: Student, semester: Semester, grades: List>>, calcAverage: Boolean): List { + if (isNotEmpty() && size > grades.size) return this + + return grades.mapIndexed { i, (subject, details) -> + singleOrNull { it.subject == subject }?.let { return@mapIndexed it } + GradeSummary( + studentId = student.studentId, + semesterId = semester.semesterId, + position = i, + subject = subject, + predictedGrade = "", + finalGrade = "", + proposedPoints = "", + finalPoints = "", + pointsSum = "", + average = if (calcAverage) details.updateModifiers(student).calcAverage() else .0 + ) + } + } + + private fun List.updateModifiers(student: Student): List { + return if (student.loginMode == Sdk.Mode.SCRAPPER.name) { + map { it.changeModifier(plusModifier, minusModifier) } + } else this + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeDetailsWithAverage.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeDetailsWithAverage.kt new file mode 100644 index 00000000..3f5d706b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeDetailsWithAverage.kt @@ -0,0 +1,12 @@ +package io.github.wulkanowy.ui.modules.grade + +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.data.db.entities.GradeSummary + +data class GradeDetailsWithAverage( + val subject: String, + val average: Double, + val points: String, + val summary: GradeSummary, + val grades: List +) diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeFragment.kt new file mode 100644 index 00000000..0678e13e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeFragment.kt @@ -0,0 +1,173 @@ +package io.github.wulkanowy.ui.modules.grade + +import android.os.Bundle +import android.view.Menu +import android.view.MenuInflater +import android.view.MenuItem +import android.view.View +import android.view.View.INVISIBLE +import android.view.View.VISIBLE +import androidx.appcompat.app.AlertDialog +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.databinding.FragmentGradeBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.base.BaseFragmentPagerAdapter +import io.github.wulkanowy.ui.modules.grade.details.GradeDetailsFragment +import io.github.wulkanowy.ui.modules.grade.statistics.GradeStatisticsFragment +import io.github.wulkanowy.ui.modules.grade.summary.GradeSummaryFragment +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.dpToPx +import io.github.wulkanowy.utils.setOnSelectPageListener +import javax.inject.Inject + +@AndroidEntryPoint +class GradeFragment : BaseFragment(R.layout.fragment_grade), GradeView, + MainView.MainChildView, MainView.TitledView { + + @Inject + lateinit var presenter: GradePresenter + + private val pagerAdapter by lazy { BaseFragmentPagerAdapter(childFragmentManager) } + + private var semesterSwitchMenu: MenuItem? = null + + companion object { + private const val SAVED_SEMESTER_KEY = "CURRENT_SEMESTER" + + fun newInstance() = GradeFragment() + } + + override val titleStringId get() = R.string.grade_title + + override var subtitleString = "" + + override val currentPageIndex get() = binding.gradeViewPager.currentItem + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setHasOptionsMenu(true) + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentGradeBinding.bind(view) + presenter.onAttachView(this, savedInstanceState?.getInt(SAVED_SEMESTER_KEY)) + } + + override fun onCreateOptionsMenu(menu: Menu, inflater: MenuInflater) { + inflater.inflate(R.menu.action_menu_grade, menu) + semesterSwitchMenu = menu.findItem(R.id.gradeMenuSemester) + presenter.onCreateMenu() + } + + override fun initView() { + with(pagerAdapter) { + containerId = binding.gradeViewPager.id + addFragmentsWithTitle(mapOf( + GradeDetailsFragment.newInstance() to getString(R.string.all_details), + GradeSummaryFragment.newInstance() to getString(R.string.grade_menu_summary), + GradeStatisticsFragment.newInstance() to getString(R.string.grade_menu_statistics) + )) + } + + with(binding.gradeViewPager) { + adapter = pagerAdapter + offscreenPageLimit = 3 + setOnSelectPageListener(presenter::onPageSelected) + } + + with(binding.gradeTabLayout) { + setupWithViewPager(binding.gradeViewPager) + setElevationCompat(context.dpToPx(4f)) + } + + with(binding) { + gradeErrorRetry.setOnClickListener { presenter.onRetry() } + gradeErrorDetails.setOnClickListener { presenter.onDetailsClick() } + } + } + + override fun onOptionsItemSelected(item: MenuItem): Boolean { + return if (item.itemId == R.id.gradeMenuSemester) presenter.onSemesterSwitch() + else false + } + + override fun onFragmentReselected() { + if (::presenter.isInitialized) presenter.onViewReselected() + } + + override fun showContent(show: Boolean) { + with(binding) { + gradeViewPager.visibility = if (show) VISIBLE else INVISIBLE + gradeTabLayout.visibility = if (show) VISIBLE else INVISIBLE + } + } + + override fun showProgress(show: Boolean) { + binding.gradeProgress.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showErrorView(show: Boolean) { + binding.gradeError.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun setErrorDetails(message: String) { + binding.gradeErrorMessage.text = message + } + + override fun showSemesterSwitch(show: Boolean) { + semesterSwitchMenu?.isVisible = show + } + + override fun showSemesterDialog(selectedIndex: Int) { + val choices = arrayOf( + getString(R.string.grade_semester, 1), + getString(R.string.grade_semester, 2) + ) + + AlertDialog.Builder(requireContext()) + .setSingleChoiceItems(choices, selectedIndex) { dialog, which -> + presenter.onSemesterSelected(which) + dialog.dismiss() + } + .setTitle(R.string.grade_switch_semester) + .setNegativeButton(android.R.string.cancel) { _, _ -> } + .show() + } + + override fun setCurrentSemesterName(semester: Int, schoolYear: Int) { + subtitleString = getString(R.string.grade_subtitle, semester, schoolYear, schoolYear + 1) + (activity as MainView).setViewSubTitle(subtitleString) + } + + fun onChildRefresh() { + presenter.onChildViewRefresh() + } + + fun onChildFragmentLoaded(semesterId: Int) { + presenter.onChildViewLoaded(semesterId) + } + + override fun notifyChildLoadData(index: Int, semesterId: Int, forceRefresh: Boolean) { + (pagerAdapter.getFragmentInstance(index) as? GradeView.GradeChildView)?.onParentLoadData(semesterId, forceRefresh) + } + + override fun notifyChildParentReselected(index: Int) { + (pagerAdapter.getFragmentInstance(index) as? GradeView.GradeChildView)?.onParentReselected() + } + + override fun notifyChildSemesterChange(index: Int) { + (pagerAdapter.getFragmentInstance(index) as? GradeView.GradeChildView)?.onParentChangeSemester() + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putInt(SAVED_SEMESTER_KEY, presenter.selectedIndex) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradePresenter.kt new file mode 100644 index 00000000..d4c9f210 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradePresenter.kt @@ -0,0 +1,153 @@ +package io.github.wulkanowy.ui.modules.grade + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Semester +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.getCurrentOrLast +import kotlinx.coroutines.delay +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class GradePresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val semesterRepository: SemesterRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + var selectedIndex = 0 + private set + + private var schoolYear = 0 + + private var semesters = emptyList() + + private val loadedSemesterId = mutableMapOf() + + private lateinit var lastError: Throwable + + fun onAttachView(view: GradeView, savedIndex: Int?) { + super.onAttachView(view) + selectedIndex = savedIndex ?: 0 + view.initView() + Timber.i("Grade view was initialized with $selectedIndex index") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData() + } + + fun onCreateMenu() { + if (semesters.isEmpty()) view?.showSemesterSwitch(false) + } + + fun onViewReselected() { + Timber.i("Grade view is reselected") + view?.run { notifyChildParentReselected(currentPageIndex) } + } + + fun onSemesterSwitch(): Boolean { + if (semesters.isNotEmpty()) view?.showSemesterDialog(selectedIndex - 1) + return true + } + + fun onSemesterSelected(index: Int) { + if (selectedIndex != index - 1) { + Timber.i("Change semester in grade view to ${index + 1}") + selectedIndex = index + 1 + loadedSemesterId.clear() + view?.let { + it.setCurrentSemesterName(index + 1, schoolYear) + notifyChildrenSemesterChange() + loadChild(it.currentPageIndex) + } + analytics.logEvent("changed_semester", "number" to index + 1) + } + } + + fun onChildViewRefresh() { + view?.let { loadChild(it.currentPageIndex, true) } + } + + fun onChildViewLoaded(semesterId: Int) { + view?.apply { + showContent(true) + showProgress(false) + showErrorView(false) + loadedSemesterId[currentPageIndex] = semesterId + } + } + + fun onPageSelected(index: Int) { + if (semesters.isNotEmpty()) loadChild(index) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData() + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + private fun loadData() { + flowWithResource { + val student = studentRepository.getCurrentStudent() + delay(200) + semesterRepository.getSemesters(student, refreshOnNoCurrent = true) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading grade data started") + Status.SUCCESS -> { + val current = it.data!!.getCurrentOrLast() + selectedIndex = if (selectedIndex == 0) current.semesterName else selectedIndex + schoolYear = current.schoolYear + semesters = it.data.filter { semester -> semester.diaryId == current.diaryId } + view?.setCurrentSemesterName(current.semesterName, schoolYear) + + view?.run { + Timber.i("Loading grade result: Attempt load index $currentPageIndex") + loadChild(currentPageIndex) + showErrorView(false) + showSemesterSwitch(true) + } + } + Status.ERROR -> { + Timber.i("Loading grade result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + lastError = error + view?.run { + showProgress(false) + showErrorView(true) + setErrorDetails(message) + } + } + + private fun loadChild(index: Int, forceRefresh: Boolean = false) { + Timber.d("Load grade tab child. Selected semester: $selectedIndex, semesters: ${semesters.joinToString { it.semesterName.toString() }}") + semesters.first { it.semesterName == selectedIndex }.semesterId.also { + if (forceRefresh || loadedSemesterId[index] != it) { + Timber.i("Load grade child view index: $index") + view?.notifyChildLoadData(index, it, forceRefresh) + } + } + } + + private fun notifyChildrenSemesterChange() { + for (i in 0..2) view?.notifyChildSemesterChange(i) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeView.kt new file mode 100644 index 00000000..7b52daa8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/GradeView.kt @@ -0,0 +1,39 @@ +package io.github.wulkanowy.ui.modules.grade + +import io.github.wulkanowy.ui.base.BaseView + +interface GradeView : BaseView { + + val currentPageIndex: Int + + fun initView() + + fun showContent(show: Boolean) + + fun showProgress(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showSemesterSwitch(show: Boolean) + + fun showSemesterDialog(selectedIndex: Int) + + fun setCurrentSemesterName(semester: Int, schoolYear: Int) + + fun notifyChildLoadData(index: Int, semesterId: Int, forceRefresh: Boolean) + + fun notifyChildParentReselected(index: Int) + + fun notifyChildSemesterChange(index: Int) + + interface GradeChildView { + + fun onParentChangeSemester() + + fun onParentLoadData(semesterId: Int, forceRefresh: Boolean) + + fun onParentReselected() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsAdapter.kt new file mode 100644 index 00000000..c129d948 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsAdapter.kt @@ -0,0 +1,198 @@ +package io.github.wulkanowy.ui.modules.grade.details + +import android.annotation.SuppressLint +import android.content.res.Resources +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.recyclerview.widget.DiffUtil +import androidx.recyclerview.widget.RecyclerView +import androidx.recyclerview.widget.RecyclerView.NO_POSITION +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.databinding.HeaderGradeDetailsBinding +import io.github.wulkanowy.databinding.ItemGradeDetailsBinding +import io.github.wulkanowy.ui.base.BaseExpandableAdapter +import io.github.wulkanowy.utils.getBackgroundColor +import io.github.wulkanowy.utils.toFormattedString +import timber.log.Timber +import javax.inject.Inject + +class GradeDetailsAdapter @Inject constructor() : BaseExpandableAdapter() { + + private var headers = mutableListOf() + + private var items = mutableListOf() + + private var expandedPosition = NO_POSITION + + private var isExpandable = false + + var onClickListener: (Grade, position: Int) -> Unit = { _, _ -> } + + var colorTheme = "" + + fun setDataItems(data: List, isExpanded: Boolean = isExpandable) { + headers = data.filter { it.viewType == ViewType.HEADER }.toMutableList() + items = if (isExpanded) headers else data.toMutableList() + isExpandable = isExpanded + expandedPosition = NO_POSITION + } + + fun updateDetailsItem(position: Int, grade: Grade) { + if (items.getOrNull(position)?.viewType != ViewType.ITEM) { + Timber.e("Trying to update item $position on list ${items.size} size, expanded position: $expandedPosition") + return + } + items[position] = GradeDetailsItem(grade, ViewType.ITEM) + notifyItemChanged(position) + } + + fun getHeaderItem(subject: String): GradeDetailsItem { + val candidates = headers.filter { (it.value as GradeDetailsHeader).subject == subject } + + if (candidates.size > 1) { + Timber.e("Header with subject $subject found ${candidates.size} times! Expanded: $expandedPosition. Items: $candidates") + } + + return candidates.first() + } + + fun updateHeaderItem(item: GradeDetailsItem) { + val headerPosition = headers.indexOf(item) + val itemPosition = items.indexOf(item) + + if (headerPosition == NO_POSITION || itemPosition == NO_POSITION) { + Timber.e("Invalid update header positions! Header: $headerPosition, item: $itemPosition") + } + + headers[headerPosition] = item + items[itemPosition] = item + notifyItemChanged(itemPosition) + } + + fun collapseAll() { + if (expandedPosition != -1) { + refreshList(headers) + expandedPosition = NO_POSITION + } + } + + @Synchronized + private fun refreshList(newItems: MutableList) { + val diffCallback = GradeDetailsDiffUtil(items, newItems) + val diffResult = DiffUtil.calculateDiff(diffCallback) + items = newItems + diffResult.dispatchUpdatesTo(this) + } + + override fun getItemCount() = items.size + + override fun getItemViewType(position: Int) = items[position].viewType.id + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + + return when (viewType) { + ViewType.HEADER.id -> HeaderViewHolder(HeaderGradeDetailsBinding.inflate(inflater, parent, false)) + ViewType.ITEM.id -> ItemViewHolder(ItemGradeDetailsBinding.inflate(inflater, parent, false)) + else -> throw IllegalStateException() + } + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + when (holder) { + is HeaderViewHolder -> bindHeaderViewHolder( + holder = holder, + header = items[position].value as GradeDetailsHeader, + position = position + ) + is ItemViewHolder -> bindItemViewHolder( + holder = holder, + grade = items[position].value as Grade + ) + } + } + + private fun bindHeaderViewHolder(holder: HeaderViewHolder, header: GradeDetailsHeader, position: Int) { + val headerPosition = headers.indexOf(items[position]) + val adapterPosition = holder.adapterPosition + + with(holder.binding) { + gradeHeaderDivider.visibility = if (adapterPosition == 0) View.GONE else View.VISIBLE + with(gradeHeaderSubject) { + text = header.subject + maxLines = if (headerPosition == expandedPosition) 2 else 1 + } + gradeHeaderAverage.text = formatAverage(header.average, root.context.resources) + gradeHeaderPointsSum.text = root.context.getString(R.string.grade_points_sum, header.pointsSum) + gradeHeaderPointsSum.visibility = if (!header.pointsSum.isNullOrEmpty()) View.VISIBLE else View.GONE + gradeHeaderNumber.text = root.context.resources.getQuantityString(R.plurals.grade_number_item, header.grades.size, header.grades.size) + gradeHeaderNote.visibility = if (header.newGrades > 0) View.VISIBLE else View.GONE + if (header.newGrades > 0) gradeHeaderNote.text = header.newGrades.toString(10) + + gradeHeaderContainer.isEnabled = isExpandable + gradeHeaderContainer.setOnClickListener { + expandedPosition = if (expandedPosition == adapterPosition) -1 else adapterPosition + + if (expandedPosition != NO_POSITION) { + refreshList(headers.toMutableList().apply { + addAll(headerPosition + 1, header.grades) + }) + scrollToHeaderWithSubItems(headerPosition, header.grades.size) + } else { + refreshList(headers) + } + } + } + } + + private fun formatAverage(average: Double?, resources: Resources): String { + return if (average == null || average == .0) resources.getString(R.string.grade_no_average) + else resources.getString(R.string.grade_average, average) + } + + @SuppressLint("SetTextI18n") + private fun bindItemViewHolder(holder: ItemViewHolder, grade: Grade) { + with(holder.binding) { + gradeItemValue.run { + text = grade.entry + setBackgroundResource(grade.getBackgroundColor(colorTheme)) + } + gradeItemDescription.text = when { + grade.description.isNotBlank() -> grade.description + grade.gradeSymbol.isNotBlank() -> grade.gradeSymbol + else -> root.context.getString(R.string.all_no_description) + } + gradeItemDate.text = grade.date.toFormattedString() + gradeItemWeight.text = "${root.context.getString(R.string.grade_weight)}: ${grade.weight}" + gradeItemNote.visibility = if (!grade.isRead) View.VISIBLE else View.GONE + + root.setOnClickListener { + holder.adapterPosition.let { if (it != NO_POSITION) onClickListener(grade, it) } + } + } + } + + private class HeaderViewHolder(val binding: HeaderGradeDetailsBinding) : + RecyclerView.ViewHolder(binding.root) + + private class ItemViewHolder(val binding: ItemGradeDetailsBinding) : + RecyclerView.ViewHolder(binding.root) + + class GradeDetailsDiffUtil(private val old: List, private val new: List) : + DiffUtil.Callback() { + + override fun getOldListSize() = old.size + + override fun getNewListSize() = new.size + + override fun areItemsTheSame(oldItemPosition: Int, newItemPosition: Int): Boolean { + return old[oldItemPosition] == new[newItemPosition] + } + + override fun areContentsTheSame(oldItemPosition: Int, newItemPosition: Int): Boolean { + return old[oldItemPosition] == new[newItemPosition] + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsDialog.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsDialog.kt new file mode 100644 index 00000000..698aff3e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsDialog.kt @@ -0,0 +1,95 @@ +package io.github.wulkanowy.ui.modules.grade.details + +import android.os.Bundle +import android.view.LayoutInflater +import android.view.View +import android.view.View.GONE +import android.view.ViewGroup +import androidx.fragment.app.DialogFragment +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.databinding.DialogGradeBinding +import io.github.wulkanowy.utils.colorStringId +import io.github.wulkanowy.utils.getBackgroundColor +import io.github.wulkanowy.utils.getGradeColor +import io.github.wulkanowy.utils.lifecycleAwareVariable +import io.github.wulkanowy.utils.toFormattedString + +class GradeDetailsDialog : DialogFragment() { + + private var binding: DialogGradeBinding by lifecycleAwareVariable() + + private lateinit var grade: Grade + + private lateinit var colorScheme: String + + companion object { + private const val ARGUMENT_KEY = "Item" + private const val COLOR_SCHEME_KEY = "Scheme" + + fun newInstance(grade: Grade, colorScheme: String): GradeDetailsDialog { + return GradeDetailsDialog().apply { + arguments = Bundle().apply { + putSerializable(ARGUMENT_KEY, grade) + putString(COLOR_SCHEME_KEY, colorScheme) + } + } + } + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setStyle(STYLE_NO_TITLE, 0) + arguments?.run { + grade = getSerializable(ARGUMENT_KEY) as Grade + colorScheme = getString(COLOR_SCHEME_KEY) ?: "default" + } + } + + override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { + return DialogGradeBinding.inflate(inflater).apply { binding = this }.root + } + + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + + with(binding) { + gradeDialogSubject.text = grade.subject + + gradeDialogColorAndWeightValue.run { + text = context.getString(R.string.grade_weight_value, grade.weight) + setBackgroundResource(grade.getGradeColor()) + } + + gradeDialogDateValue.text = grade.date.toFormattedString() + gradeDialogColorValue.text = getString(grade.colorStringId) + + gradeDialogCommentValue.apply { + if (grade.comment.isBlank()) { + visibility = GONE + gradeDialogComment.visibility = GONE + } else text = grade.comment + } + + gradeDialogValue.run { + text = grade.entry + setBackgroundResource(grade.getBackgroundColor(colorScheme)) + } + + gradeDialogTeacherValue.text = if (grade.teacher.isBlank()) { + getString(R.string.all_no_data) + } else grade.teacher + + gradeDialogDescriptionValue.text = grade.run { + when { + description.isBlank() && gradeSymbol.isNotBlank() -> gradeSymbol + description.isBlank() && gradeSymbol.isBlank() -> getString(R.string.all_no_description) + gradeSymbol.isNotBlank() && description.isNotBlank() -> "$gradeSymbol - $description" + else -> description + } + } + + gradeDialogClose.setOnClickListener { dismiss() } + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsFragment.kt new file mode 100644 index 00000000..ef9a932e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsFragment.kt @@ -0,0 +1,174 @@ +package io.github.wulkanowy.ui.modules.grade.details + +import android.os.Bundle +import android.view.Menu +import android.view.MenuInflater +import android.view.MenuItem +import android.view.View +import android.view.View.GONE +import android.view.View.INVISIBLE +import android.view.View.VISIBLE +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.databinding.FragmentGradeDetailsBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.grade.GradeFragment +import io.github.wulkanowy.ui.modules.grade.GradeView +import io.github.wulkanowy.ui.modules.main.MainActivity +import javax.inject.Inject + +@AndroidEntryPoint +class GradeDetailsFragment : + BaseFragment(R.layout.fragment_grade_details), GradeDetailsView, + GradeView.GradeChildView { + + @Inject + lateinit var presenter: GradeDetailsPresenter + + @Inject + lateinit var gradeDetailsAdapter: GradeDetailsAdapter + + private var gradeDetailsMenu: Menu? = null + + companion object { + fun newInstance() = GradeDetailsFragment() + } + + override val isViewEmpty + get() = gradeDetailsAdapter.itemCount == 0 + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setHasOptionsMenu(true) + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentGradeDetailsBinding.bind(view) + messageContainer = binding.gradeDetailsRecycler + presenter.onAttachView(this) + } + + override fun onCreateOptionsMenu(menu: Menu, inflater: MenuInflater) { + inflater.inflate(R.menu.action_menu_grade_details, menu) + gradeDetailsMenu = menu + presenter.updateMarkAsDoneButton() + } + + override fun initView() { + gradeDetailsAdapter.onClickListener = presenter::onGradeItemSelected + + with(binding) { + with(gradeDetailsRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = gradeDetailsAdapter + } + gradeDetailsSwipe.setOnRefreshListener { presenter.onSwipeRefresh() } + gradeDetailsErrorRetry.setOnClickListener { presenter.onRetry() } + gradeDetailsErrorDetails.setOnClickListener { presenter.onDetailsClick() } + } + } + + override fun onOptionsItemSelected(item: MenuItem): Boolean { + return if (item.itemId == R.id.gradeDetailsMenuRead) presenter.onMarkAsReadSelected() + else false + } + + override fun updateData(data: List, isGradeExpandable: Boolean, gradeColorTheme: String) { + with(gradeDetailsAdapter) { + colorTheme = gradeColorTheme + setDataItems(data, isGradeExpandable) + notifyDataSetChanged() + } + } + + override fun updateItem(item: Grade, position: Int) { + gradeDetailsAdapter.updateDetailsItem(position, item) + } + + override fun clearView() { + with(gradeDetailsAdapter) { + setDataItems(mutableListOf()) + notifyDataSetChanged() + } + } + + override fun collapseAllItems() { + gradeDetailsAdapter.collapseAll() + } + + override fun scrollToStart() { + binding.gradeDetailsRecycler.smoothScrollToPosition(0) + } + + override fun getHeaderOfItem(subject: String): GradeDetailsItem { + return gradeDetailsAdapter.getHeaderItem(subject) + } + + override fun updateHeaderItem(item: GradeDetailsItem) { + gradeDetailsAdapter.updateHeaderItem(item) + } + + override fun showProgress(show: Boolean) { + binding.gradeDetailsProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.gradeDetailsSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.gradeDetailsRecycler.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showEmpty(show: Boolean) { + binding.gradeDetailsEmpty.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showErrorView(show: Boolean) { + binding.gradeDetailsError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.gradeDetailsErrorMessage.text = message + } + + override fun showRefresh(show: Boolean) { + binding.gradeDetailsSwipe.isRefreshing = show + } + + override fun showGradeDialog(grade: Grade, colorScheme: String) { + (activity as? MainActivity)?.showDialogFragment(GradeDetailsDialog.newInstance(grade, colorScheme)) + } + + override fun onParentLoadData(semesterId: Int, forceRefresh: Boolean) { + presenter.onParentViewLoadData(semesterId, forceRefresh) + } + + override fun onParentReselected() { + presenter.onParentViewReselected() + } + + override fun onParentChangeSemester() { + presenter.onParentViewChangeSemester() + } + + override fun notifyParentDataLoaded(semesterId: Int) { + (parentFragment as? GradeFragment)?.onChildFragmentLoaded(semesterId) + } + + override fun notifyParentRefresh() { + (parentFragment as? GradeFragment)?.onChildRefresh() + } + + override fun enableMarkAsDoneButton(enable: Boolean) { + gradeDetailsMenu?.findItem(R.id.gradeDetailsMenuRead)?.isEnabled = enable + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsItem.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsItem.kt new file mode 100644 index 00000000..28197496 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsItem.kt @@ -0,0 +1,19 @@ +package io.github.wulkanowy.ui.modules.grade.details + +enum class ViewType(val id: Int) { + HEADER(1), + ITEM(2) +} + +data class GradeDetailsItem( + val value: Any, + val viewType: ViewType +) + +data class GradeDetailsHeader( + val subject: String, + val average: Double?, + val pointsSum: String?, + var newGrades: Int, + val grades: List +) diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsPresenter.kt new file mode 100644 index 00000000..a3651793 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsPresenter.kt @@ -0,0 +1,218 @@ +package io.github.wulkanowy.ui.modules.grade.details + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.data.repositories.grade.GradeRepository +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.ui.modules.grade.GradeAverageProvider +import io.github.wulkanowy.ui.modules.grade.GradeDetailsWithAverage +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.flowWithResourceIn +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class GradeDetailsPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val gradeRepository: GradeRepository, + private val semesterRepository: SemesterRepository, + private val preferencesRepository: PreferencesRepository, + private val averageProvider: GradeAverageProvider, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private var newGradesAmount: Int = 0 + + private var currentSemesterId = 0 + + private lateinit var lastError: Throwable + + override fun onAttachView(view: GradeDetailsView) { + super.onAttachView(view) + view.initView() + errorHandler.showErrorMessage = ::showErrorViewOnError + } + + fun onParentViewLoadData(semesterId: Int, forceRefresh: Boolean) { + currentSemesterId = semesterId + + loadData(semesterId, forceRefresh) + if (!forceRefresh) view?.showErrorView(false) + } + + fun onGradeItemSelected(grade: Grade, position: Int) { + Timber.i("Select grade item ${grade.id}, position: $position") + view?.apply { + showGradeDialog(grade, preferencesRepository.gradeColorTheme) + if (!grade.isRead) { + grade.isRead = true + updateItem(grade, position) + getHeaderOfItem(grade.subject).let { header -> + (header.value as GradeDetailsHeader).newGrades-- + updateHeaderItem(header) + } + newGradesAmount-- + updateMarkAsDoneButton() + updateGrade(grade) + } + } + } + + fun onMarkAsReadSelected(): Boolean { + flowWithResource { + val student = studentRepository.getCurrentStudent() + val semesters = semesterRepository.getSemesters(student) + val semester = semesters.first { item -> item.semesterId == currentSemesterId } + val unreadGrades = gradeRepository.getUnreadGrades(semester).first() + + Timber.i("Mark as read ${unreadGrades.size} grades") + gradeRepository.updateGrades(unreadGrades.map { it.apply { isRead = true } }) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Select mark grades as read") + Status.SUCCESS -> Timber.i("Mark as read result: Success") + Status.ERROR -> { + Timber.i("Mark as read result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch("mark") + return true + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the grade details") + view?.notifyParentRefresh() + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + view?.notifyParentRefresh() + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onParentViewReselected() { + view?.run { + if (!isViewEmpty) { + if (preferencesRepository.isGradeExpandable) collapseAllItems() + scrollToStart() + } + } + } + + fun onParentViewChangeSemester() { + view?.run { + showProgress(true) + enableSwipe(false) + showRefresh(false) + showContent(false) + showEmpty(false) + clearView() + } + cancelJobs("load") + } + + fun updateMarkAsDoneButton() { + view?.enableMarkAsDoneButton(newGradesAmount > 0) + } + + private fun loadData(semesterId: Int, forceRefresh: Boolean) { + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + averageProvider.getGradesDetailsWithAverage(student, semesterId, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading grade details data started") + Status.SUCCESS -> { + Timber.i("Loading grade details result: Success") + newGradesAmount = it.data!!.sumBy { item -> item.grades.sumBy { grade -> if (!grade.isRead) 1 else 0 } } + updateMarkAsDoneButton() + val items = createGradeItems(it.data) + view?.run { + showEmpty(items.isEmpty()) + showErrorView(false) + showContent(items.isNotEmpty()) + updateData( + data = items, + isGradeExpandable = preferencesRepository.isGradeExpandable, + gradeColorTheme = preferencesRepository.gradeColorTheme + ) + } + analytics.logEvent( + "load_data", + "type" to "grade_details", + "items" to it.data.size + ) + } + Status.ERROR -> { + Timber.i("Loading grade details result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + showRefresh(false) + showProgress(false) + enableSwipe(true) + notifyParentDataLoaded(semesterId) + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + private fun createGradeItems(items: List): List { + return items + .filter { it.grades.isNotEmpty() } + .sortedBy { it.subject } + .map { (subject, average, points, _, grades) -> + val subItems = grades + .sortedByDescending { it.date } + .map { GradeDetailsItem(it, ViewType.ITEM) } + + listOf(GradeDetailsItem(GradeDetailsHeader( + subject = subject, + average = average, + pointsSum = points, + newGrades = grades.filter { grade -> !grade.isRead }.size, + grades = subItems + ), ViewType.HEADER)) + if (preferencesRepository.isGradeExpandable) emptyList() else subItems + }.flatten() + } + + private fun updateGrade(grade: Grade) { + flowWithResource { gradeRepository.updateGrade(grade) }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Attempt to update grade ${grade.id}") + Status.SUCCESS -> Timber.i("Update grade result: Success") + Status.ERROR -> { + Timber.i("Update grade result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch("update") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsView.kt new file mode 100644 index 00000000..e71fcc3c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/details/GradeDetailsView.kt @@ -0,0 +1,47 @@ +package io.github.wulkanowy.ui.modules.grade.details + +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.ui.base.BaseView + +interface GradeDetailsView : BaseView { + + val isViewEmpty: Boolean + + fun initView() + + fun updateData(data: List, isGradeExpandable: Boolean, gradeColorTheme: String) + + fun updateItem(item: Grade, position: Int) + + fun updateHeaderItem(item: GradeDetailsItem) + + fun clearView() + + fun scrollToStart() + + fun collapseAllItems() + + fun showGradeDialog(grade: Grade, colorScheme: String) + + fun showContent(show: Boolean) + + fun showEmpty(show: Boolean) + + fun showProgress(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun enableSwipe(enable: Boolean) + + fun showRefresh(show: Boolean) + + fun notifyParentDataLoaded(semesterId: Int) + + fun notifyParentRefresh() + + fun enableMarkAsDoneButton(enable: Boolean) + + fun getHeaderOfItem(subject: String): GradeDetailsItem +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsAdapter.kt new file mode 100644 index 00000000..dbb60910 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsAdapter.kt @@ -0,0 +1,208 @@ +package io.github.wulkanowy.ui.modules.grade.statistics + +import android.graphics.Color +import android.view.LayoutInflater +import android.view.View.GONE +import android.view.View.VISIBLE +import android.view.ViewGroup +import androidx.core.content.ContextCompat +import androidx.recyclerview.widget.RecyclerView +import com.github.mikephil.charting.components.Legend +import com.github.mikephil.charting.components.LegendEntry +import com.github.mikephil.charting.data.BarData +import com.github.mikephil.charting.data.BarDataSet +import com.github.mikephil.charting.data.BarEntry +import com.github.mikephil.charting.data.PieData +import com.github.mikephil.charting.data.PieDataSet +import com.github.mikephil.charting.data.PieEntry +import com.github.mikephil.charting.formatter.ValueFormatter +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.GradePointsStatistics +import io.github.wulkanowy.data.db.entities.GradeStatistics +import io.github.wulkanowy.data.pojos.GradeStatisticsItem +import io.github.wulkanowy.databinding.ItemGradeStatisticsBarBinding +import io.github.wulkanowy.databinding.ItemGradeStatisticsPieBinding +import io.github.wulkanowy.utils.getThemeAttrColor +import javax.inject.Inject + +class GradeStatisticsAdapter @Inject constructor() : + RecyclerView.Adapter() { + + var items = emptyList() + + var theme: String = "vulcan" + + var showAllSubjectsOnList: Boolean = false + + private val vulcanGradeColors = listOf( + 6 to R.color.grade_vulcan_six, + 5 to R.color.grade_vulcan_five, + 4 to R.color.grade_vulcan_four, + 3 to R.color.grade_vulcan_three, + 2 to R.color.grade_vulcan_two, + 1 to R.color.grade_vulcan_one + ) + + private val materialGradeColors = listOf( + 6 to R.color.grade_material_six, + 5 to R.color.grade_material_five, + 4 to R.color.grade_material_four, + 3 to R.color.grade_material_three, + 2 to R.color.grade_material_two, + 1 to R.color.grade_material_one + ) + + private val gradePointsColors = listOf( + Color.parseColor("#37c69c"), + Color.parseColor("#d8b12a") + ) + + private val gradeLabels = listOf( + "6, 6-", "5, 5-, 5+", "4, 4-, 4+", "3, 3-, 3+", "2, 2-, 2+", "1, 1+" + ) + + override fun getItemCount() = if (showAllSubjectsOnList) items.size else (if (items.isEmpty()) 0 else 1) + + override fun getItemViewType(position: Int) = items[position].type.id + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + return when (viewType) { + ViewType.PARTIAL.id, ViewType.SEMESTER.id -> PieViewHolder(ItemGradeStatisticsPieBinding.inflate(inflater, parent, false)) + ViewType.POINTS.id -> BarViewHolder(ItemGradeStatisticsBarBinding.inflate(inflater, parent, false)) + else -> throw IllegalStateException() + } + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + when (holder) { + is PieViewHolder -> bindPieChart(holder, items[position].partial) + is BarViewHolder -> bindBarChart(holder, items[position].points!!) + } + } + + private fun bindPieChart(holder: PieViewHolder, partials: List) { + with(holder.binding.gradeStatisticsPieTitle) { + text = partials.firstOrNull()?.subject + visibility = if (items.size == 1 || !showAllSubjectsOnList) GONE else VISIBLE + } + + val gradeColors = when (theme) { + "vulcan" -> vulcanGradeColors + else -> materialGradeColors + } + + val dataset = PieDataSet(partials.map { + PieEntry(it.amount.toFloat(), it.grade.toString()) + }, "Legenda") + + with(dataset) { + valueTextSize = 12f + sliceSpace = 1f + valueTextColor = Color.WHITE + setColors(partials.map { + gradeColors.single { color -> color.first == it.grade }.second + }.toIntArray(), holder.binding.root.context) + } + + with(holder.binding.gradeStatisticsPie) { + setTouchEnabled(false) + if (partials.size == 1) animateXY(1000, 1000) + data = PieData(dataset).apply { + setValueFormatter(object : ValueFormatter() { + override fun getPieLabel(value: Float, pieEntry: PieEntry): String { + return resources.getQuantityString(R.plurals.grade_number_item, value.toInt(), value.toInt()) + } + }) + } + with(legend) { + textColor = context.getThemeAttrColor(android.R.attr.textColorPrimary) + setCustom(gradeLabels.mapIndexed { i, it -> + LegendEntry().apply { + label = it + formColor = ContextCompat.getColor(context, gradeColors[i].second) + form = Legend.LegendForm.SQUARE + } + }) + } + + minAngleForSlices = 25f + description.isEnabled = false + centerText = partials.fold(0) { acc, it -> acc + it.amount } + .let { resources.getQuantityString(R.plurals.grade_number_item, it, it) } + + setHoleColor(context.getThemeAttrColor(android.R.attr.windowBackground)) + setCenterTextColor(context.getThemeAttrColor(android.R.attr.textColorPrimary)) + invalidate() + } + } + + private fun bindBarChart(holder: BarViewHolder, points: GradePointsStatistics) { + with(holder.binding.gradeStatisticsBarTitle) { + text = points.subject + visibility = if (items.size == 1) GONE else VISIBLE + } + + val dataset = BarDataSet(listOf( + BarEntry(1f, points.others.toFloat()), + BarEntry(2f, points.student.toFloat()) + ), "Legenda") + + with(dataset) { + valueTextSize = 12f + valueTextColor = holder.binding.root.context.getThemeAttrColor(android.R.attr.textColorPrimary) + valueFormatter = object : ValueFormatter() { + override fun getBarLabel(barEntry: BarEntry) = "${barEntry.y}%" + } + colors = gradePointsColors + } + + with(holder.binding.gradeStatisticsBar) { + setTouchEnabled(false) + if (items.size == 1) animateXY(1000, 1000) + data = BarData(dataset).apply { + barWidth = 0.5f + setFitBars(true) + } + legend.setCustom(listOf( + LegendEntry().apply { + label = "Średnia klasy" + formColor = gradePointsColors[0] + form = Legend.LegendForm.SQUARE + }, + LegendEntry().apply { + label = "Uczeń" + formColor = gradePointsColors[1] + form = Legend.LegendForm.SQUARE + } + )) + legend.textColor = context.getThemeAttrColor(android.R.attr.textColorPrimary) + + description.isEnabled = false + + holder.binding.root.context.getThemeAttrColor(android.R.attr.textColorPrimary).let { + axisLeft.textColor = it + axisRight.textColor = it + } + xAxis.setDrawLabels(false) + xAxis.setDrawGridLines(false) + with(axisLeft) { + axisMinimum = 0f + axisMaximum = 100f + labelCount = 11 + } + with(axisRight) { + axisMinimum = 0f + axisMaximum = 100f + labelCount = 11 + } + invalidate() + } + } + + private class PieViewHolder(val binding: ItemGradeStatisticsPieBinding) : + RecyclerView.ViewHolder(binding.root) + + private class BarViewHolder(val binding: ItemGradeStatisticsBarBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsFragment.kt new file mode 100644 index 00000000..75050249 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsFragment.kt @@ -0,0 +1,168 @@ +package io.github.wulkanowy.ui.modules.grade.statistics + +import android.os.Bundle +import android.view.View +import android.widget.ArrayAdapter +import android.widget.TextView +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.pojos.GradeStatisticsItem +import io.github.wulkanowy.databinding.FragmentGradeStatisticsBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.grade.GradeFragment +import io.github.wulkanowy.ui.modules.grade.GradeView +import io.github.wulkanowy.utils.dpToPx +import io.github.wulkanowy.utils.setOnItemSelectedListener +import javax.inject.Inject + +@AndroidEntryPoint +class GradeStatisticsFragment : + BaseFragment(R.layout.fragment_grade_statistics), + GradeStatisticsView, GradeView.GradeChildView { + + @Inject + lateinit var presenter: GradeStatisticsPresenter + + @Inject + lateinit var statisticsAdapter: GradeStatisticsAdapter + + private lateinit var subjectsAdapter: ArrayAdapter + + companion object { + private const val SAVED_CHART_TYPE = "CURRENT_TYPE" + + fun newInstance() = GradeStatisticsFragment() + } + + override val isViewEmpty get() = statisticsAdapter.items.isEmpty() + + override val currentType + get() = when (binding.gradeStatisticsTypeSwitch.checkedRadioButtonId) { + R.id.gradeStatisticsTypeSemester -> ViewType.SEMESTER + R.id.gradeStatisticsTypePartial -> ViewType.PARTIAL + else -> ViewType.POINTS + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentGradeStatisticsBinding.bind(view) + messageContainer = binding.gradeStatisticsSwipe + presenter.onAttachView(this, savedInstanceState?.getSerializable(SAVED_CHART_TYPE) as? ViewType) + } + + override fun initView() { + with(binding.gradeStatisticsRecycler) { + layoutManager = LinearLayoutManager(requireContext()) + adapter = statisticsAdapter + } + + subjectsAdapter = ArrayAdapter(requireContext(), android.R.layout.simple_spinner_item, mutableListOf()) + subjectsAdapter.setDropDownViewResource(R.layout.item_attendance_summary_subject) + + with(binding.gradeStatisticsSubjects) { + adapter = subjectsAdapter + setOnItemSelectedListener { presenter.onSubjectSelected(it?.text?.toString()) } + } + + with(binding) { + gradeStatisticsSubjectsContainer.setElevationCompat(requireContext().dpToPx(1f)) + + gradeStatisticsSwipe.setOnRefreshListener(presenter::onSwipeRefresh) + gradeStatisticsErrorRetry.setOnClickListener { presenter.onRetry() } + gradeStatisticsErrorDetails.setOnClickListener { presenter.onDetailsClick() } + } + } + + override fun updateSubjects(data: ArrayList) { + with(subjectsAdapter) { + clear() + addAll(data) + notifyDataSetChanged() + } + } + + override fun updateData(items: List, theme: String, showAllSubjectsOnStatisticsList: Boolean) { + with(statisticsAdapter) { + this.showAllSubjectsOnList = showAllSubjectsOnStatisticsList + this.theme = theme + this.items = items + notifyDataSetChanged() + } + } + + override fun showSubjects(show: Boolean) { + binding.gradeStatisticsSubjectsContainer.visibility = if (show) View.VISIBLE else View.GONE + } + + override fun clearView() { + statisticsAdapter.items = emptyList() + } + + override fun resetView() { + binding.gradeStatisticsScroll.scrollTo(0, 0) + } + + override fun showContent(show: Boolean) { + binding.gradeStatisticsRecycler.visibility = if (show) View.VISIBLE else View.GONE + } + + override fun showEmpty(show: Boolean) { + binding.gradeStatisticsEmpty.visibility = if (show) View.VISIBLE else View.INVISIBLE + } + + override fun showErrorView(show: Boolean) { + binding.gradeStatisticsError.visibility = if (show) View.VISIBLE else View.GONE + } + + override fun setErrorDetails(message: String) { + binding.gradeStatisticsErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.gradeStatisticsProgress.visibility = if (show) View.VISIBLE else View.GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.gradeStatisticsSwipe.isEnabled = enable + } + + override fun showRefresh(show: Boolean) { + binding.gradeStatisticsSwipe.isRefreshing = show + } + + override fun onParentLoadData(semesterId: Int, forceRefresh: Boolean) { + presenter.onParentViewLoadData(semesterId, forceRefresh) + } + + override fun onParentReselected() { + presenter.onParentViewReselected() + } + + override fun onParentChangeSemester() { + presenter.onParentViewChangeSemester() + } + + override fun notifyParentDataLoaded(semesterId: Int) { + (parentFragment as? GradeFragment)?.onChildFragmentLoaded(semesterId) + } + + override fun notifyParentRefresh() { + (parentFragment as? GradeFragment)?.onChildRefresh() + } + + override fun onResume() { + super.onResume() + binding.gradeStatisticsTypeSwitch.setOnCheckedChangeListener { _, _ -> presenter.onTypeChange() } + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putSerializable(SAVED_CHART_TYPE, presenter.currentType) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsPresenter.kt new file mode 100644 index 00000000..112f4c58 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsPresenter.kt @@ -0,0 +1,204 @@ +package io.github.wulkanowy.ui.modules.grade.statistics + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Subject +import io.github.wulkanowy.data.repositories.gradestatistics.GradeStatisticsRepository +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.data.repositories.subject.SubjectRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class GradeStatisticsPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val gradeStatisticsRepository: GradeStatisticsRepository, + private val subjectRepository: SubjectRepository, + private val semesterRepository: SemesterRepository, + private val preferencesRepository: PreferencesRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private var subjects = emptyList() + + private var currentSemesterId = 0 + + private var currentSubjectName: String = "Wszystkie" + + private lateinit var lastError: Throwable + + var currentType: ViewType = ViewType.PARTIAL + private set + + fun onAttachView(view: GradeStatisticsView, type: ViewType?) { + super.onAttachView(view) + currentType = type ?: ViewType.PARTIAL + view.initView() + errorHandler.showErrorMessage = ::showErrorViewOnError + } + + fun onParentViewLoadData(semesterId: Int, forceRefresh: Boolean) { + currentSemesterId = semesterId + loadSubjects() + if (!forceRefresh) view?.showErrorView(false) + loadDataByType(semesterId, currentSubjectName, currentType, forceRefresh) + } + + fun onParentViewReselected() { + view?.run { + if (!isViewEmpty) resetView() + } + } + + fun onParentViewChangeSemester() { + view?.run { + showProgress(true) + enableSwipe(false) + showRefresh(false) + showContent(false) + showErrorView(false) + showEmpty(false) + clearView() + } + cancelJobs("load") + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the grade stats") + view?.notifyParentRefresh() + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + view?.notifyParentRefresh() + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onSubjectSelected(name: String?) { + Timber.i("Select grade stats subject $name") + view?.run { + showContent(false) + showProgress(true) + enableSwipe(false) + showEmpty(false) + showErrorView(false) + clearView() + } + (subjects.singleOrNull { it.name == name }?.name)?.let { + if (it != currentSubjectName) loadDataByType(currentSemesterId, it, currentType) + } + } + + fun onTypeChange() { + val type = view?.currentType ?: ViewType.POINTS + Timber.i("Select grade stats semester: $type") + cancelJobs("load") + view?.run { + showContent(false) + showProgress(true) + enableSwipe(false) + showEmpty(false) + showErrorView(false) + clearView() + } + loadDataByType(currentSemesterId, currentSubjectName, type) + } + + private fun loadSubjects() { + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + subjectRepository.getSubjects(student, semester) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading grade stats subjects started") + Status.SUCCESS -> { + subjects = it.data!! + + Timber.i("Loading grade stats subjects result: Success") + view?.run { + view?.updateSubjects(ArrayList(it.data.map { subject -> subject.name })) + showSubjects(!preferencesRepository.showAllSubjectsOnStatisticsList) + } + } + Status.ERROR -> { + Timber.i("Loading grade stats subjects result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch("subjects") + } + + private fun loadDataByType(semesterId: Int, subjectName: String, type: ViewType, forceRefresh: Boolean = false) { + currentSubjectName = if (preferencesRepository.showAllSubjectsOnStatisticsList) "Wszystkie" else subjectName + currentType = type + + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semesters = semesterRepository.getSemesters(student) + val semester = semesters.first { item -> item.semesterId == semesterId } + + with(gradeStatisticsRepository) { + when (type) { + ViewType.SEMESTER -> getGradesStatistics(student, semester, currentSubjectName, true, forceRefresh) + ViewType.PARTIAL -> getGradesStatistics(student, semester, currentSubjectName, false, forceRefresh) + ViewType.POINTS -> getGradesPointsStatistics(student, semester, currentSubjectName, forceRefresh) + } + } + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading grade stats data started") + Status.SUCCESS -> { + Timber.i("Loading grade stats result: Success") + view?.run { + showEmpty(it.data!!.isEmpty()) + showContent(it.data.isNotEmpty()) + showErrorView(false) + updateData(it.data, preferencesRepository.gradeColorTheme, preferencesRepository.showAllSubjectsOnStatisticsList) + showSubjects(!preferencesRepository.showAllSubjectsOnStatisticsList) + } + analytics.logEvent( + "load_data", + "type" to "grade_statistics", + "items" to it.data!!.size + ) + } + Status.ERROR -> { + Timber.i("Loading grade stats result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + showRefresh(false) + showProgress(false) + enableSwipe(true) + notifyParentDataLoaded(semesterId) + } + }.launch("load") + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsView.kt new file mode 100644 index 00000000..26b4a119 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/GradeStatisticsView.kt @@ -0,0 +1,41 @@ +package io.github.wulkanowy.ui.modules.grade.statistics + +import io.github.wulkanowy.data.pojos.GradeStatisticsItem +import io.github.wulkanowy.ui.base.BaseView + +interface GradeStatisticsView : BaseView { + + val isViewEmpty: Boolean + + val currentType: ViewType + + fun initView() + + fun updateSubjects(data: ArrayList) + + fun updateData(items: List, theme: String, showAllSubjectsOnStatisticsList: Boolean) + + fun showSubjects(show: Boolean) + + fun notifyParentDataLoaded(semesterId: Int) + + fun notifyParentRefresh() + + fun clearView() + + fun resetView() + + fun showContent(show: Boolean) + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showRefresh(show: Boolean) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/ViewType.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/ViewType.kt new file mode 100644 index 00000000..02e95b0e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/statistics/ViewType.kt @@ -0,0 +1,7 @@ +package io.github.wulkanowy.ui.modules.grade.statistics + +enum class ViewType(val id: Int) { + SEMESTER(1), + PARTIAL(2), + POINTS(3) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryAdapter.kt new file mode 100644 index 00000000..ccebe94f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryAdapter.kt @@ -0,0 +1,85 @@ +package io.github.wulkanowy.ui.modules.grade.summary + +import android.annotation.SuppressLint +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.data.db.entities.GradeSummary +import io.github.wulkanowy.databinding.ItemGradeSummaryBinding +import io.github.wulkanowy.databinding.ScrollableHeaderGradeSummaryBinding +import io.github.wulkanowy.utils.calcAverage +import java.util.Locale +import javax.inject.Inject + +class GradeSummaryAdapter @Inject constructor() : RecyclerView.Adapter() { + + private enum class ViewType(val id: Int) { + HEADER(1), + ITEM(2) + } + + var items = emptyList() + + override fun getItemCount() = items.size + if (items.isNotEmpty()) 1 else 0 + + override fun getItemViewType(position: Int) = when (position) { + 0 -> ViewType.HEADER.id + else -> ViewType.ITEM.id + } + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + + return when (viewType) { + ViewType.HEADER.id -> HeaderViewHolder(ScrollableHeaderGradeSummaryBinding.inflate(inflater, parent, false)) + ViewType.ITEM.id -> ItemViewHolder(ItemGradeSummaryBinding.inflate(inflater, parent, false)) + else -> throw IllegalStateException() + } + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + when (holder) { + is HeaderViewHolder -> bindHeaderViewHolder(holder.binding) + is ItemViewHolder -> bindItemViewHolder(holder.binding, items[position - 1]) + } + } + + private fun bindHeaderViewHolder(binding: ScrollableHeaderGradeSummaryBinding) { + if (items.isEmpty()) return + + with(binding) { + gradeSummaryScrollableHeaderFinal.text = formatAverage(items.calcAverage()) + gradeSummaryScrollableHeaderCalculated.text = formatAverage(items + .filter { value -> value.average != 0.0 } + .map { values -> values.average } + .reversed() // fix average precision + .average() + ) + } + } + + @SuppressLint("SetTextI18n") + private fun bindItemViewHolder(binding: ItemGradeSummaryBinding, item: GradeSummary) { + with(binding) { + gradeSummaryItemTitle.text = item.subject + gradeSummaryItemPoints.text = item.pointsSum + gradeSummaryItemAverage.text = formatAverage(item.average, "") + gradeSummaryItemPredicted.text = "${item.predictedGrade} ${item.proposedPoints}".trim() + gradeSummaryItemFinal.text = "${item.finalGrade} ${item.finalPoints}".trim() + + gradeSummaryItemPointsContainer.visibility = if (item.pointsSum.isBlank()) View.GONE else View.VISIBLE + } + } + + private fun formatAverage(average: Double, defaultValue: String = "-- --"): String { + return if (average == 0.0) defaultValue + else String.format(Locale.FRANCE, "%.2f", average) + } + + private class HeaderViewHolder(val binding: ScrollableHeaderGradeSummaryBinding) : + RecyclerView.ViewHolder(binding.root) + + private class ItemViewHolder(val binding: ItemGradeSummaryBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryFragment.kt new file mode 100644 index 00000000..4d12dcd5 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryFragment.kt @@ -0,0 +1,131 @@ +package io.github.wulkanowy.ui.modules.grade.summary + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.INVISIBLE +import android.view.View.VISIBLE +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.GradeSummary +import io.github.wulkanowy.databinding.FragmentGradeSummaryBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.grade.GradeFragment +import io.github.wulkanowy.ui.modules.grade.GradeView +import javax.inject.Inject + +@AndroidEntryPoint +class GradeSummaryFragment : + BaseFragment(R.layout.fragment_grade_summary), GradeSummaryView, + GradeView.GradeChildView { + + @Inject + lateinit var presenter: GradeSummaryPresenter + + @Inject + lateinit var gradeSummaryAdapter: GradeSummaryAdapter + + companion object { + fun newInstance() = GradeSummaryFragment() + } + + override val isViewEmpty + get() = gradeSummaryAdapter.items.isEmpty() + + override val predictedString + get() = getString(R.string.grade_summary_predicted_grade) + + override val finalString + get() = getString(R.string.grade_summary_final_grade) + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentGradeSummaryBinding.bind(view) + messageContainer = binding.gradeSummaryRecycler + presenter.onAttachView(this) + } + + override fun initView() { + with(binding.gradeSummaryRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = gradeSummaryAdapter + } + with(binding) { + gradeSummarySwipe.setOnRefreshListener { presenter.onSwipeRefresh() } + gradeSummaryErrorRetry.setOnClickListener { presenter.onRetry() } + gradeSummaryErrorDetails.setOnClickListener { presenter.onDetailsClick() } + } + } + + override fun updateData(data: List) { + with(gradeSummaryAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun clearView() { + with(gradeSummaryAdapter) { + items = emptyList() + notifyDataSetChanged() + } + } + + override fun resetView() { + binding.gradeSummaryRecycler.scrollToPosition(0) + } + + override fun showContent(show: Boolean) { + binding.gradeSummaryRecycler.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showEmpty(show: Boolean) { + binding.gradeSummaryEmpty.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showErrorView(show: Boolean) { + binding.gradeSummaryError.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun setErrorDetails(message: String) { + binding.gradeSummaryErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.gradeSummaryProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.gradeSummarySwipe.isEnabled = enable + } + + override fun showRefresh(show: Boolean) { + binding.gradeSummarySwipe.isRefreshing = show + } + + override fun onParentLoadData(semesterId: Int, forceRefresh: Boolean) { + presenter.onParentViewLoadData(semesterId, forceRefresh) + } + + override fun onParentReselected() { + presenter.onParentViewReselected() + } + + override fun onParentChangeSemester() { + presenter.onParentViewChangeSemester() + } + + override fun notifyParentDataLoaded(semesterId: Int) { + (parentFragment as? GradeFragment)?.onChildFragmentLoaded(semesterId) + } + + override fun notifyParentRefresh() { + (parentFragment as? GradeFragment)?.onChildRefresh() + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryPresenter.kt new file mode 100644 index 00000000..caa3cb84 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryPresenter.kt @@ -0,0 +1,137 @@ +package io.github.wulkanowy.ui.modules.grade.summary + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.GradeSummary +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.ui.modules.grade.GradeAverageProvider +import io.github.wulkanowy.ui.modules.grade.GradeDetailsWithAverage +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class GradeSummaryPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val averageProvider: GradeAverageProvider, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private lateinit var lastError: Throwable + + override fun onAttachView(view: GradeSummaryView) { + super.onAttachView(view) + view.initView() + errorHandler.showErrorMessage = ::showErrorViewOnError + } + + fun onParentViewLoadData(semesterId: Int, forceRefresh: Boolean) { + Timber.i("Loading grade summary data started") + + loadData(semesterId, forceRefresh) + if (!forceRefresh) view?.showErrorView(false) + } + + private fun loadData(semesterId: Int, forceRefresh: Boolean) { + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + averageProvider.getGradesDetailsWithAverage(student, semesterId, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading grade summary started") + Status.SUCCESS -> { + Timber.i("Loading grade summary result: Success") + val items = createGradeSummaryItems(it.data!!) + view?.run { + showEmpty(items.isEmpty()) + showContent(items.isNotEmpty()) + showErrorView(false) + updateData(items) + } + analytics.logEvent( + "load_data", + "type" to "grade_summary", + "items" to it.data.size + ) + } + Status.ERROR -> { + Timber.i("Loading grade summary result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + showRefresh(false) + showProgress(false) + enableSwipe(true) + notifyParentDataLoaded(semesterId) + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the grade summary") + view?.notifyParentRefresh() + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + view?.notifyParentRefresh() + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onParentViewReselected() { + view?.run { + if (!isViewEmpty) resetView() + } + } + + fun onParentViewChangeSemester() { + view?.run { + showProgress(true) + enableSwipe(false) + showRefresh(false) + showContent(false) + showEmpty(false) + clearView() + } + cancelJobs("load") + } + + private fun createGradeSummaryItems(items: List): List { + return items + .filter { !checkEmpty(it) } + .sortedBy { it.subject } + .map { it.summary.copy(average = it.average) } + } + + private fun checkEmpty(gradeSummary: GradeDetailsWithAverage): Boolean { + return gradeSummary.run { + summary.finalGrade.isBlank() + && summary.predictedGrade.isBlank() + && average == .0 + && points.isBlank() + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryView.kt new file mode 100644 index 00000000..974d9141 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/grade/summary/GradeSummaryView.kt @@ -0,0 +1,39 @@ +package io.github.wulkanowy.ui.modules.grade.summary + +import io.github.wulkanowy.data.db.entities.GradeSummary +import io.github.wulkanowy.ui.base.BaseView + +interface GradeSummaryView : BaseView { + + val isViewEmpty: Boolean + + val predictedString: String + + val finalString: String + + fun initView() + + fun updateData(data: List) + + fun resetView() + + fun clearView() + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showRefresh(show: Boolean) + + fun showContent(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showEmpty(show: Boolean) + + fun notifyParentDataLoaded(semesterId: Int) + + fun notifyParentRefresh() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkAdapter.kt new file mode 100644 index 00000000..8ae06aeb --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkAdapter.kt @@ -0,0 +1,67 @@ +package io.github.wulkanowy.ui.modules.homework + +import android.annotation.SuppressLint +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.databinding.HeaderHomeworkBinding +import io.github.wulkanowy.databinding.ItemHomeworkBinding +import io.github.wulkanowy.utils.toFormattedString +import io.github.wulkanowy.utils.weekDayName +import java.time.LocalDate +import javax.inject.Inject + +class HomeworkAdapter @Inject constructor() : RecyclerView.Adapter() { + + var items = emptyList>() + + var onClickListener: (Homework) -> Unit = {} + + override fun getItemCount() = items.size + + override fun getItemViewType(position: Int) = items[position].viewType.id + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + + return when (viewType) { + HomeworkItem.ViewType.HEADER.id -> HeaderViewHolder(HeaderHomeworkBinding.inflate(inflater, parent, false)) + HomeworkItem.ViewType.ITEM.id -> ItemViewHolder(ItemHomeworkBinding.inflate(inflater, parent, false)) + else -> throw IllegalStateException() + } + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + when (holder) { + is HeaderViewHolder -> bindHeaderViewHolder(holder.binding, items[position].value as LocalDate) + is ItemViewHolder -> bindItemViewHolder(holder.binding, items[position].value as Homework) + } + } + + @SuppressLint("DefaultLocale") + private fun bindHeaderViewHolder(binding: HeaderHomeworkBinding, date: LocalDate) { + with(binding) { + homeworkHeaderDay.text = date.weekDayName.capitalize() + homeworkHeaderDate.text = date.toFormattedString() + } + } + + private fun bindItemViewHolder(binding: ItemHomeworkBinding, homework: Homework) { + with(binding) { + homeworkItemSubject.text = homework.subject + homeworkItemTeacher.text = homework.teacher + homeworkItemContent.text = homework.content + homeworkItemCheckImage.visibility = if (homework.isDone) View.VISIBLE else View.GONE + homeworkItemAttachmentImage.visibility = if (!homework.isDone && homework.attachments.isNotEmpty()) View.VISIBLE else View.GONE + + root.setOnClickListener { onClickListener(homework) } + } + } + + class HeaderViewHolder(val binding: HeaderHomeworkBinding) : + RecyclerView.ViewHolder(binding.root) + + class ItemViewHolder(val binding: ItemHomeworkBinding) : RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkFragment.kt new file mode 100644 index 00000000..e1d7ac52 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkFragment.kt @@ -0,0 +1,135 @@ +package io.github.wulkanowy.ui.modules.homework + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.databinding.FragmentHomeworkBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.homework.details.HomeworkDetailsDialog +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.widgets.DividerItemDecoration +import io.github.wulkanowy.utils.dpToPx +import javax.inject.Inject + +@AndroidEntryPoint +class HomeworkFragment : BaseFragment(R.layout.fragment_homework), + HomeworkView, MainView.TitledView { + + @Inject + lateinit var presenter: HomeworkPresenter + + @Inject + lateinit var homeworkAdapter: HomeworkAdapter + + companion object { + private const val SAVED_DATE_KEY = "CURRENT_DATE" + + fun newInstance() = HomeworkFragment() + } + + override val titleStringId get() = R.string.homework_title + + override val isViewEmpty get() = homeworkAdapter.items.isEmpty() + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentHomeworkBinding.bind(view) + messageContainer = binding.homeworkRecycler + presenter.onAttachView(this, savedInstanceState?.getLong(SAVED_DATE_KEY)) + } + + override fun initView() { + homeworkAdapter.onClickListener = presenter::onHomeworkItemSelected + + with(binding.homeworkRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = homeworkAdapter + addItemDecoration(DividerItemDecoration(context)) + } + + with(binding) { + homeworkSwipe.setOnRefreshListener(presenter::onSwipeRefresh) + homeworkErrorRetry.setOnClickListener { presenter.onRetry() } + homeworkErrorDetails.setOnClickListener { presenter.onDetailsClick() } + + homeworkPreviousButton.setOnClickListener { presenter.onPreviousDay() } + homeworkNextButton.setOnClickListener { presenter.onNextDay() } + + homeworkNavContainer.setElevationCompat(requireContext().dpToPx(8f)) + } + } + + override fun updateData(data: List>) { + with(homeworkAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun clearData() { + with(homeworkAdapter) { + items = emptyList() + notifyDataSetChanged() + } + } + + override fun updateNavigationWeek(date: String) { + binding.homeworkNavDate.text = date + } + + override fun hideRefresh() { + binding.homeworkSwipe.isRefreshing = false + } + + override fun showEmpty(show: Boolean) { + binding.homeworkEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.homeworkError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.homeworkErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.homeworkProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.homeworkSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.homeworkRecycler.visibility = if (show) VISIBLE else GONE + } + + override fun showPreButton(show: Boolean) { + binding.homeworkPreviousButton.visibility = if (show) VISIBLE else View.INVISIBLE + } + + override fun showNextButton(show: Boolean) { + binding.homeworkNextButton.visibility = if (show) VISIBLE else View.INVISIBLE + } + + override fun showTimetableDialog(homework: Homework) { + (activity as? MainActivity)?.showDialogFragment(HomeworkDetailsDialog.newInstance(homework)) + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putLong(SAVED_DATE_KEY, presenter.currentDate.toEpochDay()) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkItem.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkItem.kt new file mode 100644 index 00000000..7e003958 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkItem.kt @@ -0,0 +1,9 @@ +package io.github.wulkanowy.ui.modules.homework + +data class HomeworkItem(val value: T, val viewType: ViewType) { + + enum class ViewType(val id: Int) { + HEADER(1), + ITEM(2) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkPresenter.kt new file mode 100644 index 00000000..8af0d83f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkPresenter.kt @@ -0,0 +1,175 @@ +package io.github.wulkanowy.ui.modules.homework + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.data.repositories.homework.HomeworkRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import io.github.wulkanowy.utils.getLastSchoolDayIfHoliday +import io.github.wulkanowy.utils.isHolidays +import io.github.wulkanowy.utils.monday +import io.github.wulkanowy.utils.nextOrSameSchoolDay +import io.github.wulkanowy.utils.sunday +import io.github.wulkanowy.utils.toFormattedString +import kotlinx.coroutines.flow.catch +import kotlinx.coroutines.flow.flow +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import java.time.LocalDate +import java.time.LocalDate.ofEpochDay +import javax.inject.Inject + +class HomeworkPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val homeworkRepository: HomeworkRepository, + private val semesterRepository: SemesterRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private var baseDate: LocalDate = LocalDate.now().nextOrSameSchoolDay + + lateinit var currentDate: LocalDate + private set + + private lateinit var lastError: Throwable + + fun onAttachView(view: HomeworkView, date: Long?) { + super.onAttachView(view) + view.initView() + Timber.i("Homework view was initialized") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData(ofEpochDay(date ?: baseDate.toEpochDay())) + if (currentDate.isHolidays) setBaseDateOnHolidays() + reloadView() + } + + fun onPreviousDay() { + loadData(currentDate.minusDays(7)) + reloadView() + } + + fun onNextDay() { + loadData(currentDate.plusDays(7)) + reloadView() + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the homework") + loadData(currentDate, true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(currentDate, true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onHomeworkItemSelected(homework: Homework) { + Timber.i("Select homework item ${homework.id}") + view?.showTimetableDialog(homework) + } + + private fun setBaseDateOnHolidays() { + flow { + val student = studentRepository.getCurrentStudent() + emit(semesterRepository.getCurrentSemester(student)) + }.catch { + Timber.i("Loading semester result: An exception occurred") + }.onEach { + baseDate = baseDate.getLastSchoolDayIfHoliday(it.schoolYear) + currentDate = baseDate + reloadNavigation() + }.launch("holidays") + } + + private fun loadData(date: LocalDate, forceRefresh: Boolean = false) { + currentDate = date + + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + homeworkRepository.getHomework(student, semester, date, date, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading homework data started") + Status.SUCCESS -> { + Timber.i("Loading homework result: Success") + view?.apply { + updateData(createHomeworkItem(it.data!!)) + showEmpty(it.data.isEmpty()) + showErrorView(false) + showContent(it.data.isNotEmpty()) + } + analytics.logEvent( + "load_data", + "type" to "homework", + "items" to it.data!!.size + ) + } + Status.ERROR -> { + Timber.i("Loading homework result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + private fun createHomeworkItem(items: List): List> { + return items.groupBy { it.date }.toSortedMap().map { (date, exams) -> + listOf(HomeworkItem(date, HomeworkItem.ViewType.HEADER)) + exams.reversed().map { exam -> + HomeworkItem(exam, HomeworkItem.ViewType.ITEM) + } + }.flatten() + } + + private fun reloadView() { + Timber.i("Reload homework view with the date ${currentDate.toFormattedString()}") + view?.apply { + showProgress(true) + enableSwipe(false) + showContent(false) + showEmpty(false) + showErrorView(false) + clearData() + reloadNavigation() + } + } + + private fun reloadNavigation() { + view?.apply { + showPreButton(!currentDate.minusDays(7).isHolidays) + showNextButton(!currentDate.plusDays(7).isHolidays) + updateNavigationWeek("${currentDate.monday.toFormattedString("dd.MM")} - " + + currentDate.sunday.toFormattedString("dd.MM")) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkView.kt new file mode 100644 index 00000000..2a678cd4 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/HomeworkView.kt @@ -0,0 +1,37 @@ +package io.github.wulkanowy.ui.modules.homework + +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.ui.base.BaseView + +interface HomeworkView : BaseView { + + val isViewEmpty: Boolean + + fun initView() + + fun updateData(data: List>) + + fun clearData() + + fun updateNavigationWeek(date: String) + + fun hideRefresh() + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) + + fun showPreButton(show: Boolean) + + fun showNextButton(show: Boolean) + + fun showTimetableDialog(homework: Homework) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsAdapter.kt new file mode 100644 index 00000000..5d6ee162 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsAdapter.kt @@ -0,0 +1,102 @@ +package io.github.wulkanowy.ui.modules.homework.details + +import android.view.LayoutInflater +import android.view.View.GONE +import android.view.View.VISIBLE +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.databinding.ItemHomeworkDialogAttachmentBinding +import io.github.wulkanowy.databinding.ItemHomeworkDialogAttachmentsHeaderBinding +import io.github.wulkanowy.databinding.ItemHomeworkDialogDetailsBinding +import io.github.wulkanowy.utils.toFormattedString +import javax.inject.Inject + +class HomeworkDetailsAdapter @Inject constructor() : + RecyclerView.Adapter() { + + private enum class ViewType(val id: Int) { + DETAILS(1), + ATTACHMENTS_HEADER(2), + ATTACHMENT(3) + } + + private var attachments = emptyList>() + + var homework: Homework? = null + set(value) { + field = value + attachments = value?.attachments.orEmpty() + } + + var onAttachmentClickListener: (url: String) -> Unit = {} + + var onFullScreenClickListener = {} + + var onFullScreenExitClickListener = {} + + override fun getItemCount() = 1 + if (attachments.isNotEmpty()) attachments.size + 1 else 0 + + override fun getItemViewType(position: Int) = when (position) { + 0 -> ViewType.DETAILS.id + 1 -> ViewType.ATTACHMENTS_HEADER.id + else -> ViewType.ATTACHMENT.id + } + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + + return when (viewType) { + ViewType.ATTACHMENTS_HEADER.id -> AttachmentsHeaderViewHolder(ItemHomeworkDialogAttachmentsHeaderBinding.inflate(inflater, parent, false)) + ViewType.ATTACHMENT.id -> AttachmentViewHolder(ItemHomeworkDialogAttachmentBinding.inflate(inflater, parent, false)) + else -> DetailsViewHolder(ItemHomeworkDialogDetailsBinding.inflate(inflater, parent, false)) + } + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + when (holder) { + is DetailsViewHolder -> bindDetailsViewHolder(holder) + is AttachmentViewHolder -> bindAttachmentViewHolder(holder, position - 2) + } + } + + private fun bindDetailsViewHolder(holder: DetailsViewHolder) { + with(holder.binding) { + homeworkDialogDate.text = homework?.date?.toFormattedString() + homeworkDialogEntryDate.text = homework?.entryDate?.toFormattedString() + homeworkDialogSubject.text = homework?.subject + homeworkDialogTeacher.text = homework?.teacher + homeworkDialogContent.text = homework?.content + homeworkDialogFullScreen.setOnClickListener { + homeworkDialogFullScreen.visibility = GONE + homeworkDialogFullScreenExit.visibility = VISIBLE + onFullScreenClickListener() + } + homeworkDialogFullScreenExit.setOnClickListener { + homeworkDialogFullScreen.visibility = VISIBLE + homeworkDialogFullScreenExit.visibility = GONE + onFullScreenExitClickListener() + } + } + } + + private fun bindAttachmentViewHolder(holder: AttachmentViewHolder, position: Int) { + val item = attachments[position] + + with(holder.binding) { + homeworkDialogAttachment.text = item.second + root.setOnClickListener { + onAttachmentClickListener(item.first) + } + } + } + + class DetailsViewHolder(val binding: ItemHomeworkDialogDetailsBinding) : + RecyclerView.ViewHolder(binding.root) + + class AttachmentsHeaderViewHolder(val binding: ItemHomeworkDialogAttachmentsHeaderBinding) : + RecyclerView.ViewHolder(binding.root) + + class AttachmentViewHolder(val binding: ItemHomeworkDialogAttachmentBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsDialog.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsDialog.kt new file mode 100644 index 00000000..78abfffd --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsDialog.kt @@ -0,0 +1,84 @@ +package io.github.wulkanowy.ui.modules.homework.details + +import android.annotation.SuppressLint +import android.os.Bundle +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import android.view.ViewGroup.LayoutParams.MATCH_PARENT +import android.view.ViewGroup.LayoutParams.WRAP_CONTENT +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.databinding.DialogHomeworkBinding +import io.github.wulkanowy.ui.base.BaseDialogFragment +import io.github.wulkanowy.utils.openInternetBrowser +import javax.inject.Inject + +@AndroidEntryPoint +class HomeworkDetailsDialog : BaseDialogFragment(), HomeworkDetailsView { + + @Inject + lateinit var presenter: HomeworkDetailsPresenter + + @Inject + lateinit var detailsAdapter: HomeworkDetailsAdapter + + private lateinit var homework: Homework + + companion object { + private const val ARGUMENT_KEY = "Item" + + fun newInstance(homework: Homework): HomeworkDetailsDialog { + return HomeworkDetailsDialog().apply { + arguments = Bundle().apply { putSerializable(ARGUMENT_KEY, homework) } + } + } + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setStyle(STYLE_NO_TITLE, 0) + arguments?.run { + homework = getSerializable(ARGUMENT_KEY) as Homework + } + } + + override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { + return DialogHomeworkBinding.inflate(inflater).apply { binding = this }.root + } + + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + presenter.onAttachView(this) + } + + @SuppressLint("SetTextI18n") + override fun initView() { + with(binding) { + homeworkDialogRead.text = view?.context?.getString(if (homework.isDone) R.string.homework_mark_as_undone else R.string.homework_mark_as_done) + homeworkDialogRead.setOnClickListener { presenter.toggleDone(homework) } + homeworkDialogClose.setOnClickListener { dismiss() } + } + + with(binding.homeworkDialogRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = detailsAdapter.apply { + onAttachmentClickListener = { context.openInternetBrowser(it, ::showMessage) } + onFullScreenClickListener = { dialog?.window?.setLayout(MATCH_PARENT, MATCH_PARENT) } + onFullScreenExitClickListener = { dialog?.window?.setLayout(WRAP_CONTENT, WRAP_CONTENT) } + homework = this@HomeworkDetailsDialog.homework + } + } + } + + override fun updateMarkAsDoneLabel(isDone: Boolean) { + binding.homeworkDialogRead.text = view?.context?.getString(if (isDone) R.string.homework_mark_as_undone else R.string.homework_mark_as_done) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsPresenter.kt new file mode 100644 index 00000000..a53d38e8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsPresenter.kt @@ -0,0 +1,44 @@ +package io.github.wulkanowy.ui.modules.homework.details + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Homework +import io.github.wulkanowy.data.repositories.homework.HomeworkRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.flowWithResource +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class HomeworkDetailsPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val homeworkRepository: HomeworkRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: HomeworkDetailsView) { + super.onAttachView(view) + view.initView() + Timber.i("Homework details view was initialized") + } + + fun toggleDone(homework: Homework) { + flowWithResource { homeworkRepository.toggleDone(homework) }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Homework details update start") + Status.SUCCESS -> { + Timber.i("Homework details update: Success") + view?.updateMarkAsDoneLabel(homework.isDone) + analytics.logEvent("homework_mark_as_done") + } + Status.ERROR -> { + Timber.i("Homework details update result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch("toggle") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsView.kt new file mode 100644 index 00000000..697f2233 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/homework/details/HomeworkDetailsView.kt @@ -0,0 +1,10 @@ +package io.github.wulkanowy.ui.modules.homework.details + +import io.github.wulkanowy.ui.base.BaseView + +interface HomeworkDetailsView : BaseView { + + fun initView() + + fun updateMarkAsDoneLabel(isDone: Boolean) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginActivity.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginActivity.kt new file mode 100644 index 00000000..749989e3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginActivity.kt @@ -0,0 +1,108 @@ +package io.github.wulkanowy.ui.modules.login + +import android.content.Context +import android.content.Intent +import android.os.Bundle +import android.view.MenuItem +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.databinding.ActivityLoginBinding +import io.github.wulkanowy.ui.base.BaseActivity +import io.github.wulkanowy.ui.base.BaseFragmentPagerAdapter +import io.github.wulkanowy.ui.modules.login.advanced.LoginAdvancedFragment +import io.github.wulkanowy.ui.modules.login.form.LoginFormFragment +import io.github.wulkanowy.ui.modules.login.recover.LoginRecoverFragment +import io.github.wulkanowy.ui.modules.login.studentselect.LoginStudentSelectFragment +import io.github.wulkanowy.ui.modules.login.symbol.LoginSymbolFragment +import io.github.wulkanowy.utils.setOnSelectPageListener +import javax.inject.Inject + +@AndroidEntryPoint +class LoginActivity : BaseActivity(), LoginView { + + @Inject + override lateinit var presenter: LoginPresenter + + private val loginAdapter = BaseFragmentPagerAdapter(supportFragmentManager) + + companion object { + + fun getStartIntent(context: Context) = Intent(context, LoginActivity::class.java) + } + + override val currentViewIndex get() = binding.loginViewpager.currentItem + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setContentView(ActivityLoginBinding.inflate(layoutInflater).apply { binding = this }.root) + setSupportActionBar(binding.loginToolbar) + messageContainer = binding.loginContainer + + presenter.onAttachView(this) + } + + override fun initView() { + with(requireNotNull(supportActionBar)) { + setDisplayHomeAsUpEnabled(true) + setDisplayShowTitleEnabled(false) + } + + with(loginAdapter) { + containerId = binding.loginViewpager.id + addFragments(listOf( + LoginFormFragment.newInstance(), + LoginSymbolFragment.newInstance(), + LoginStudentSelectFragment.newInstance(), + LoginAdvancedFragment.newInstance(), + LoginRecoverFragment.newInstance() + )) + } + + with(binding.loginViewpager) { + offscreenPageLimit = 2 + adapter = loginAdapter + setOnSelectPageListener(presenter::onViewSelected) + } + } + + override fun onOptionsItemSelected(item: MenuItem): Boolean { + if (item.itemId == android.R.id.home) onBackPressed() + return true + } + + override fun switchView(index: Int) { + binding.loginViewpager.setCurrentItem(index, false) + } + + override fun showActionBar(show: Boolean) { + supportActionBar?.run { if (show) show() else hide() } + } + + override fun onBackPressed() { + presenter.onBackPressed { super.onBackPressed() } + } + + override fun notifyInitSymbolFragment(loginData: Triple) { + (loginAdapter.getFragmentInstance(1) as? LoginSymbolFragment)?.onParentInitSymbolFragment(loginData) + } + + override fun notifyInitStudentSelectFragment(studentsWithSemesters: List) { + (loginAdapter.getFragmentInstance(2) as? LoginStudentSelectFragment)?.onParentInitStudentSelectFragment(studentsWithSemesters) + } + + fun onFormFragmentAccountLogged(studentsWithSemesters: List, loginData: Triple) { + presenter.onFormViewAccountLogged(studentsWithSemesters, loginData) + } + + fun onSymbolFragmentAccountLogged(studentsWithSemesters: List) { + presenter.onSymbolViewAccountLogged(studentsWithSemesters) + } + + fun onAdvancedLoginClick() { + presenter.onAdvancedLoginClick() + } + + fun onRecoverClick() { + presenter.onRecoverClick() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginErrorHandler.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginErrorHandler.kt new file mode 100644 index 00000000..f30825cf --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginErrorHandler.kt @@ -0,0 +1,50 @@ +package io.github.wulkanowy.ui.modules.login + +import android.content.res.Resources +import android.database.sqlite.SQLiteConstraintException +import com.chuckerteam.chucker.api.ChuckerCollector +import io.github.wulkanowy.R +import io.github.wulkanowy.sdk.mobile.exception.InvalidPinException +import io.github.wulkanowy.sdk.mobile.exception.InvalidSymbolException +import io.github.wulkanowy.sdk.mobile.exception.InvalidTokenException +import io.github.wulkanowy.sdk.mobile.exception.TokenDeadException +import io.github.wulkanowy.sdk.scrapper.login.BadCredentialsException +import io.github.wulkanowy.ui.base.ErrorHandler +import javax.inject.Inject + +class LoginErrorHandler @Inject constructor( + resources: Resources, + chuckerCollector: ChuckerCollector +) : ErrorHandler(resources, chuckerCollector) { + + var onBadCredentials: () -> Unit = {} + + var onInvalidToken: (String) -> Unit = {} + + var onInvalidPin: (String) -> Unit = {} + + var onInvalidSymbol: (String) -> Unit = {} + + var onStudentDuplicate: (String) -> Unit = {} + + override fun proceed(error: Throwable) { + when (error) { + is BadCredentialsException -> onBadCredentials() + is SQLiteConstraintException -> onStudentDuplicate(resources.getString(R.string.login_duplicate_student)) + is TokenDeadException -> onInvalidToken(resources.getString(R.string.login_expired_token)) + is InvalidTokenException -> onInvalidToken(resources.getString(R.string.login_invalid_token)) + is InvalidPinException -> onInvalidPin(resources.getString(R.string.login_invalid_pin)) + is InvalidSymbolException -> onInvalidSymbol(resources.getString(R.string.login_invalid_symbol)) + else -> super.proceed(error) + } + } + + override fun clear() { + super.clear() + onBadCredentials = {} + onStudentDuplicate = {} + onInvalidToken = {} + onInvalidPin = {} + onInvalidSymbol = {} + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginPresenter.kt new file mode 100644 index 00000000..7e731772 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginPresenter.kt @@ -0,0 +1,72 @@ +package io.github.wulkanowy.ui.modules.login + +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import timber.log.Timber +import javax.inject.Inject + +class LoginPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: LoginView) { + super.onAttachView(view) + with(view) { + initView() + showActionBar(false) + } + Timber.i("Login view was initialized") + } + + fun onFormViewAccountLogged(studentsWithSemesters: List, loginData: Triple) { + view?.apply { + if (studentsWithSemesters.isEmpty()) { + Timber.i("Switch to symbol form") + notifyInitSymbolFragment(loginData) + switchView(1) + } else { + Timber.i("Switch to student select") + notifyInitStudentSelectFragment(studentsWithSemesters) + switchView(2) + } + } + } + + fun onSymbolViewAccountLogged(studentsWithSemesters: List) { + view?.apply { + Timber.i("Switch to student select") + notifyInitStudentSelectFragment(studentsWithSemesters) + switchView(2) + } + } + + fun onAdvancedLoginClick() { + view?.switchView(3) + } + + fun onRecoverClick() { + view?.switchView(4) + } + + fun onViewSelected(index: Int) { + view?.apply { + when (index) { + 0 -> showActionBar(false) + 1, 2, 3, 4 -> showActionBar(true) + } + } + } + + fun onBackPressed(default: () -> Unit) { + Timber.i("Back pressed in login view") + view?.apply { + when (currentViewIndex) { + 1, 2, 3, 4 -> switchView(0) + else -> default() + } + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginView.kt new file mode 100644 index 00000000..2a5cf316 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/LoginView.kt @@ -0,0 +1,19 @@ +package io.github.wulkanowy.ui.modules.login + +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.ui.base.BaseView + +interface LoginView : BaseView { + + val currentViewIndex: Int + + fun initView() + + fun switchView(index: Int) + + fun showActionBar(show: Boolean) + + fun notifyInitSymbolFragment(loginData: Triple) + + fun notifyInitStudentSelectFragment(studentsWithSemesters: List) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/advanced/LoginAdvancedFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/advanced/LoginAdvancedFragment.kt new file mode 100644 index 00000000..9231914c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/advanced/LoginAdvancedFragment.kt @@ -0,0 +1,315 @@ +package io.github.wulkanowy.ui.modules.login.advanced + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import android.widget.ArrayAdapter +import androidx.core.widget.doOnTextChanged +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.databinding.FragmentLoginAdvancedBinding +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.login.LoginActivity +import io.github.wulkanowy.ui.modules.login.form.LoginSymbolAdapter +import io.github.wulkanowy.utils.hideSoftInput +import io.github.wulkanowy.utils.setOnEditorDoneSignIn +import io.github.wulkanowy.utils.showSoftInput +import javax.inject.Inject + +@AndroidEntryPoint +class LoginAdvancedFragment : + BaseFragment(R.layout.fragment_login_advanced), + LoginAdvancedView { + + @Inject + lateinit var presenter: LoginAdvancedPresenter + + companion object { + fun newInstance() = LoginAdvancedFragment() + } + + override val formLoginType: String + get() = when (binding.loginTypeSwitch.checkedRadioButtonId) { + R.id.loginTypeApi -> "API" + R.id.loginTypeScrapper -> "SCRAPPER" + else -> "HYBRID" + } + + override val formUsernameValue: String + get() = binding.loginFormUsername.text.toString().trim() + + override val formPassValue: String + get() = binding.loginFormPass.text.toString().trim() + + private lateinit var hostKeys: Array + + private lateinit var hostValues: Array + + private lateinit var hostSymbols: Array + + override val formHostValue: String + get() = hostValues.getOrNull(hostKeys.indexOf(binding.loginFormHost.text.toString())).orEmpty() + + override val formHostSymbol: String + get() = hostSymbols.getOrNull(hostKeys.indexOf(binding.loginFormHost.text.toString())).orEmpty() + + override val formPinValue: String + get() = binding.loginFormPin.text.toString().trim() + + override val formSymbolValue: String + get() = binding.loginFormSymbol.text.toString().trim() + + override val formTokenValue: String + get() = binding.loginFormToken.text.toString().trim() + + override val nicknameLabel: String + get() = getString(R.string.login_nickname_hint) + + override val emailLabel: String + get() = getString(R.string.login_email_hint) + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentLoginAdvancedBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + hostKeys = resources.getStringArray(R.array.hosts_keys) + hostValues = resources.getStringArray(R.array.hosts_values) + hostSymbols = resources.getStringArray(R.array.hosts_symbols) + + with(binding) { + loginFormUsername.doOnTextChanged { _, _, _, _ -> presenter.onUsernameTextChanged() } + loginFormPass.doOnTextChanged { _, _, _, _ -> presenter.onPassTextChanged() } + loginFormPin.doOnTextChanged { _, _, _, _ -> presenter.onPinTextChanged() } + loginFormSymbol.doOnTextChanged { _, _, _, _ -> presenter.onSymbolTextChanged() } + loginFormToken.doOnTextChanged { _, _, _, _ -> presenter.onTokenTextChanged() } + loginFormHost.setOnItemClickListener { _, _, _, _ -> presenter.onHostSelected() } + loginFormSignIn.setOnClickListener { presenter.onSignInClick() } + + loginTypeSwitch.setOnCheckedChangeListener { _, checkedId -> + presenter.onLoginModeSelected(when (checkedId) { + R.id.loginTypeApi -> Sdk.Mode.API + R.id.loginTypeScrapper -> Sdk.Mode.SCRAPPER + else -> Sdk.Mode.HYBRID + }) + } + + loginFormPin.setOnEditorDoneSignIn { loginFormSignIn.callOnClick() } + loginFormPass.setOnEditorDoneSignIn { loginFormSignIn.callOnClick() } + + loginFormSymbol.setAdapter(ArrayAdapter(requireContext(), android.R.layout.simple_list_item_1, resources.getStringArray(R.array.symbols_values))) + } + + with(binding.loginFormHost) { + setText(hostKeys.getOrNull(0).orEmpty()) + setAdapter(LoginSymbolAdapter(context, R.layout.support_simple_spinner_dropdown_item, hostKeys)) + setOnClickListener { if (binding.loginFormContainer.visibility == GONE) dismissDropDown() } + } + } + + override fun showMobileApiWarningMessage() { + binding.loginFormAdvancedWarningInfo.text = getString(R.string.login_advanced_warning_mobile_api) + } + + override fun showScraperWarningMessage() { + binding.loginFormAdvancedWarningInfo.text = getString(R.string.login_advanced_warning_scraper) + } + + override fun showHybridWarningMessage() { + binding.loginFormAdvancedWarningInfo.text = getString(R.string.login_advanced_warning_hybrid) + } + + override fun setDefaultCredentials(username: String, pass: String, symbol: String, token: String, pin: String) { + with(binding) { + loginFormUsername.setText(username) + loginFormPass.setText(pass) + loginFormToken.setText(token) + loginFormSymbol.setText(symbol) + loginFormPin.setText(pin) + } + } + + override fun setUsernameLabel(label: String) { + binding.loginFormUsernameLayout.hint = label + } + + override fun setSymbol(symbol: String) { + binding.loginFormSymbol.setText(symbol) + } + + override fun setErrorUsernameRequired() { + with(binding.loginFormUsernameLayout) { + requestFocus() + error = getString(R.string.login_field_required) + } + } + + override fun setErrorLoginRequired() { + with(binding.loginFormUsernameLayout) { + requestFocus() + error = getString(R.string.login_invalid_login) + } + } + + override fun setErrorEmailRequired() { + with(binding.loginFormUsernameLayout) { + requestFocus() + error = getString(R.string.login_invalid_email) + } + } + + override fun setErrorPassRequired(focus: Boolean) { + with(binding.loginFormPassLayout) { + if (focus) requestFocus() + error = getString(R.string.login_field_required) + } + } + + override fun setErrorPassInvalid(focus: Boolean) { + with(binding.loginFormPassLayout) { + if (focus) requestFocus() + error = getString(R.string.login_invalid_password) + } + } + + override fun setErrorPassIncorrect() { + with(binding.loginFormPassLayout) { + requestFocus() + error = getString(R.string.login_incorrect_password) + } + } + + override fun setErrorPinRequired() { + with(binding.loginFormPinLayout) { + requestFocus() + error = getString(R.string.login_field_required) + } + } + + override fun setErrorPinInvalid(message: String) { + with(binding.loginFormPinLayout) { + requestFocus() + error = message + } + } + + override fun setErrorSymbolRequired() { + with(binding.loginFormSymbolLayout) { + requestFocus() + error = getString(R.string.login_field_required) + } + } + + override fun setErrorSymbolInvalid(message: String) { + with(binding.loginFormSymbolLayout) { + requestFocus() + error = message + } + } + + override fun setErrorTokenRequired() { + with(binding.loginFormTokenLayout) { + requestFocus() + error = getString(R.string.login_field_required) + } + } + + override fun setErrorTokenInvalid(message: String) { + with(binding.loginFormTokenLayout) { + requestFocus() + error = message + } + } + + override fun clearUsernameError() { + binding.loginFormUsernameLayout.error = null + } + + override fun clearPassError() { + binding.loginFormPassLayout.error = null + } + + override fun clearPinKeyError() { + binding.loginFormPinLayout.error = null + } + + override fun clearSymbolError() { + binding.loginFormSymbolLayout.error = null + } + + override fun clearTokenError() { + binding.loginFormTokenLayout.error = null + } + + override fun showOnlyHybridModeInputs() { + with(binding) { + loginFormUsernameLayout.visibility = VISIBLE + loginFormPassLayout.visibility = VISIBLE + loginFormHostLayout.visibility = VISIBLE + loginFormPinLayout.visibility = GONE + loginFormSymbolLayout.visibility = VISIBLE + loginFormTokenLayout.visibility = GONE + } + } + + override fun showOnlyScrapperModeInputs() { + with(binding) { + loginFormUsernameLayout.visibility = VISIBLE + loginFormPassLayout.visibility = VISIBLE + loginFormHostLayout.visibility = VISIBLE + loginFormPinLayout.visibility = GONE + loginFormSymbolLayout.visibility = VISIBLE + loginFormTokenLayout.visibility = GONE + } + } + + override fun showOnlyMobileApiModeInputs() { + with(binding) { + loginFormUsernameLayout.visibility = GONE + loginFormPassLayout.visibility = GONE + loginFormHostLayout.visibility = GONE + loginFormPinLayout.visibility = VISIBLE + loginFormSymbolLayout.visibility = VISIBLE + loginFormTokenLayout.visibility = VISIBLE + } + } + + override fun showSoftKeyboard() { + activity?.showSoftInput() + } + + override fun hideSoftKeyboard() { + activity?.hideSoftInput() + } + + override fun showProgress(show: Boolean) { + binding.loginFormProgress.visibility = if (show) VISIBLE else GONE + } + + override fun showContent(show: Boolean) { + binding.loginFormContainer.visibility = if (show) VISIBLE else GONE + } + + override fun notifyParentAccountLogged(studentsWithSemesters: List) { + (activity as? LoginActivity)?.onFormFragmentAccountLogged(studentsWithSemesters, Triple( + binding.loginFormUsername.text.toString(), + binding.loginFormPass.text.toString(), + resources.getStringArray(R.array.hosts_values)[1] + )) + } + + override fun onResume() { + super.onResume() + presenter.updateUsernameLabel() + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/advanced/LoginAdvancedPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/advanced/LoginAdvancedPresenter.kt new file mode 100644 index 00000000..dfe82ad8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/advanced/LoginAdvancedPresenter.kt @@ -0,0 +1,239 @@ +package io.github.wulkanowy.ui.modules.login.advanced + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.sdk.Sdk +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.modules.login.LoginErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.ifNullOrBlank +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class LoginAdvancedPresenter @Inject constructor( + studentRepository: StudentRepository, + private val loginErrorHandler: LoginErrorHandler, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(loginErrorHandler, studentRepository) { + + override fun onAttachView(view: LoginAdvancedView) { + super.onAttachView(view) + view.run { + initView() + showOnlyScrapperModeInputs() + with(loginErrorHandler) { + onBadCredentials = ::onBadCredentials + onInvalidToken = ::onInvalidToken + onInvalidSymbol = ::onInvalidSymbol + onInvalidPin = ::onInvalidPin + } + } + } + + private fun onBadCredentials() { + view?.run { + setErrorPassIncorrect() + showSoftKeyboard() + Timber.i("Entered wrong username or password") + } + } + + private fun onInvalidToken(message: String) { + view?.run { + setErrorTokenInvalid(message) + showSoftKeyboard() + Timber.i("Entered invalid token") + } + } + + private fun onInvalidSymbol(message: String) { + view?.run { + setErrorSymbolInvalid(message) + showSoftKeyboard() + Timber.i("Entered invalid symbol") + } + } + + private fun onInvalidPin(message: String) { + view?.run { + setErrorPinInvalid(message) + showSoftKeyboard() + Timber.i("Entered invalid PIN") + } + } + + fun updateUsernameLabel() { + view?.apply { + setUsernameLabel(if ("vulcan" in formHostValue || "fakelog" in formHostValue) emailLabel else nicknameLabel) + } + } + + fun onHostSelected() { + view?.apply { + clearPassError() + clearUsernameError() + if (formHostValue.contains("fakelog")) { + setDefaultCredentials("jan@fakelog.cf", "jan123", "powiatwulkanowy", "FK100000", "999999") + } + setSymbol(formHostSymbol) + updateUsernameLabel() + } + } + + fun onLoginModeSelected(type: Sdk.Mode) { + view?.run { + when (type) { + Sdk.Mode.API -> { + showOnlyMobileApiModeInputs() + showMobileApiWarningMessage() + } + Sdk.Mode.SCRAPPER -> { + showOnlyScrapperModeInputs() + showScraperWarningMessage() + } + Sdk.Mode.HYBRID -> { + showOnlyHybridModeInputs() + showHybridWarningMessage() + } + } + } + } + + fun onPassTextChanged() { + view?.clearPassError() + } + + fun onUsernameTextChanged() { + view?.clearUsernameError() + } + + fun onPinTextChanged() { + view?.clearPinKeyError() + } + + fun onSymbolTextChanged() { + view?.clearSymbolError() + } + + fun onTokenTextChanged() { + view?.clearTokenError() + } + + fun onSignInClick() { + if (!validateCredentials()) return + + flowWithResource { getStudentsAppropriatesToLoginType() }.onEach { + when (it.status) { + Status.LOADING -> view?.run { + Timber.i("Login started") + hideSoftKeyboard() + showProgress(true) + showContent(false) + } + Status.SUCCESS -> { + Timber.i("Login result: Success") + analytics.logEvent("registration_form", + "success" to true, + "students" to it.data!!.size, + "error" to "No error" + ) + view?.notifyParentAccountLogged(it.data) + } + Status.ERROR -> { + Timber.i("Login result: An exception occurred") + analytics.logEvent( + "registration_form", + "success" to false, "students" to -1, + "error" to it.error!!.message.ifNullOrBlank { "No message" } + ) + loginErrorHandler.dispatch(it.error) + } + } + }.afterLoading { + view?.apply { + showProgress(false) + showContent(true) + } + }.launch("login") + } + + private suspend fun getStudentsAppropriatesToLoginType(): List { + val email = view?.formUsernameValue.orEmpty() + val password = view?.formPassValue.orEmpty() + val endpoint = view?.formHostValue.orEmpty() + + val pin = view?.formPinValue.orEmpty() + val symbol = view?.formSymbolValue.orEmpty() + val token = view?.formTokenValue.orEmpty() + + return when (Sdk.Mode.valueOf(view?.formLoginType.orEmpty())) { + Sdk.Mode.API -> studentRepository.getStudentsApi(pin, symbol, token) + Sdk.Mode.SCRAPPER -> studentRepository.getStudentsScrapper(email, password, endpoint, symbol) + Sdk.Mode.HYBRID -> studentRepository.getStudentsHybrid(email, password, endpoint, symbol) + } + } + + private fun validateCredentials(): Boolean { + val login = view?.formUsernameValue.orEmpty() + val password = view?.formPassValue.orEmpty() + + val host = view?.formHostValue.orEmpty() + + val pin = view?.formPinValue.orEmpty() + val symbol = view?.formSymbolValue.orEmpty() + val token = view?.formTokenValue.orEmpty() + + var isCorrect = true + + when (Sdk.Mode.valueOf(view?.formLoginType ?: "")) { + Sdk.Mode.API -> { + if (pin.isEmpty()) { + view?.setErrorPinRequired() + isCorrect = false + } + + if (symbol.isEmpty()) { + view?.setErrorSymbolRequired() + isCorrect = false + } + + if (token.isEmpty()) { + view?.setErrorTokenRequired() + isCorrect = false + } + } + Sdk.Mode.HYBRID, Sdk.Mode.SCRAPPER -> { + if (login.isEmpty()) { + view?.setErrorUsernameRequired() + isCorrect = false + } else { + if ("@" in login && "standard" !in host) { + view?.setErrorLoginRequired() + isCorrect = false + } + + if ("@" !in login && "standard" in host) { + view?.setErrorEmailRequired() + isCorrect = false + } + } + + if (password.isEmpty()) { + view?.setErrorPassRequired(focus = isCorrect) + isCorrect = false + } + + if (password.length < 6 && password.isNotEmpty()) { + view?.setErrorPassInvalid(focus = isCorrect) + isCorrect = false + } + } + } + + return isCorrect + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/advanced/LoginAdvancedView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/advanced/LoginAdvancedView.kt new file mode 100644 index 00000000..029a6b4d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/advanced/LoginAdvancedView.kt @@ -0,0 +1,91 @@ +package io.github.wulkanowy.ui.modules.login.advanced + +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.ui.base.BaseView + +interface LoginAdvancedView : BaseView { + + val formUsernameValue: String + + val formPassValue: String + + val formHostValue: String + + val formHostSymbol: String + + val formLoginType: String + + val formPinValue: String + + val formSymbolValue: String + + val formTokenValue: String + + val nicknameLabel: String + + val emailLabel: String + + fun initView() + + fun showMobileApiWarningMessage() + + fun showScraperWarningMessage() + + fun showHybridWarningMessage() + + fun setDefaultCredentials(username: String, pass: String, symbol: String, token: String, pin: String) + + fun setUsernameLabel(label: String) + + fun setSymbol(symbol: String) + + fun setErrorUsernameRequired() + + fun setErrorLoginRequired() + + fun setErrorEmailRequired() + + fun setErrorPassRequired(focus: Boolean) + + fun setErrorPassInvalid(focus: Boolean) + + fun setErrorPassIncorrect() + + fun clearUsernameError() + + fun clearPassError() + + fun clearPinKeyError() + + fun clearSymbolError() + + fun clearTokenError() + + fun showSoftKeyboard() + + fun hideSoftKeyboard() + + fun showProgress(show: Boolean) + + fun showContent(show: Boolean) + + fun notifyParentAccountLogged(studentsWithSemesters: List) + + fun setErrorPinRequired() + + fun setErrorPinInvalid(message: String) + + fun setErrorSymbolRequired() + + fun setErrorSymbolInvalid(message: String) + + fun setErrorTokenRequired() + + fun setErrorTokenInvalid(message: String) + + fun showOnlyHybridModeInputs() + + fun showOnlyScrapperModeInputs() + + fun showOnlyMobileApiModeInputs() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginFormFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginFormFragment.kt new file mode 100644 index 00000000..41345686 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginFormFragment.kt @@ -0,0 +1,222 @@ +package io.github.wulkanowy.ui.modules.login.form + +import android.annotation.SuppressLint +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import androidx.core.widget.doOnTextChanged +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.databinding.FragmentLoginFormBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.login.LoginActivity +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.hideSoftInput +import io.github.wulkanowy.utils.openEmailClient +import io.github.wulkanowy.utils.openInternetBrowser +import io.github.wulkanowy.utils.setOnEditorDoneSignIn +import io.github.wulkanowy.utils.showSoftInput +import javax.inject.Inject + +@AndroidEntryPoint +class LoginFormFragment : BaseFragment(R.layout.fragment_login_form), + LoginFormView { + + @Inject + lateinit var presenter: LoginFormPresenter + + @Inject + lateinit var appInfo: AppInfo + + companion object { + fun newInstance() = LoginFormFragment() + } + + override val formUsernameValue: String + get() = binding.loginFormUsername.text.toString() + + override val formPassValue: String + get() = binding.loginFormPass.text.toString() + + override val formHostValue: String + get() = hostValues.getOrNull(hostKeys.indexOf(binding.loginFormHost.text.toString())).orEmpty() + + override val formHostSymbol: String + get() = hostSymbols.getOrNull(hostKeys.indexOf(binding.loginFormHost.text.toString())).orEmpty() + + override val nicknameLabel: String + get() = getString(R.string.login_nickname_hint) + + override val emailLabel: String + get() = getString(R.string.login_email_hint) + + private lateinit var hostKeys: Array + + private lateinit var hostValues: Array + + private lateinit var hostSymbols: Array + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentLoginFormBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + hostKeys = resources.getStringArray(R.array.hosts_keys) + hostValues = resources.getStringArray(R.array.hosts_values) + hostSymbols = resources.getStringArray(R.array.hosts_symbols) + + with(binding) { + loginFormUsername.doOnTextChanged { _, _, _, _ -> presenter.onUsernameTextChanged() } + loginFormPass.doOnTextChanged { _, _, _, _ -> presenter.onPassTextChanged() } + loginFormHost.setOnItemClickListener { _, _, _, _ -> presenter.onHostSelected() } + loginFormSignIn.setOnClickListener { presenter.onSignInClick() } + loginFormAdvancedButton.setOnClickListener { presenter.onAdvancedLoginClick() } + loginFormPrivacyLink.setOnClickListener { presenter.onPrivacyLinkClick() } + loginFormFaq.setOnClickListener { presenter.onFaqClick() } + loginFormContactEmail.setOnClickListener { presenter.onEmailClick() } + loginFormRecoverLink.setOnClickListener { presenter.onRecoverClick() } + loginFormPass.setOnEditorDoneSignIn { loginFormSignIn.callOnClick() } + } + + with(binding.loginFormHost) { + setText(hostKeys.getOrNull(0).orEmpty()) + setAdapter(LoginSymbolAdapter(context, R.layout.support_simple_spinner_dropdown_item, hostKeys)) + setOnClickListener { if (binding.loginFormContainer.visibility == GONE) dismissDropDown() } + } + } + + override fun setCredentials(username: String, pass: String) { + with(binding) { + loginFormUsername.setText(username) + loginFormPass.setText(pass) + } + } + + override fun setUsernameLabel(label: String) { + binding.loginFormUsernameLayout.hint = label + } + + override fun setErrorUsernameRequired() { + with(binding.loginFormUsernameLayout) { + requestFocus() + error = getString(R.string.login_field_required) + } + } + + override fun setErrorLoginRequired() { + with(binding.loginFormUsernameLayout) { + requestFocus() + error = getString(R.string.login_invalid_login) + } + } + + override fun setErrorEmailRequired() { + with(binding.loginFormUsernameLayout) { + requestFocus() + error = getString(R.string.login_invalid_email) + } + } + + override fun setErrorPassRequired(focus: Boolean) { + with(binding.loginFormPassLayout) { + if (focus) requestFocus() + error = getString(R.string.login_field_required) + } + } + + override fun setErrorPassInvalid(focus: Boolean) { + with(binding.loginFormPassLayout) { + if (focus) requestFocus() + error = getString(R.string.login_invalid_password) + } + } + + override fun setErrorPassIncorrect() { + with(binding.loginFormPassLayout) { + requestFocus() + error = getString(R.string.login_incorrect_password) + } + } + + override fun clearUsernameError() { + binding.loginFormUsernameLayout.error = null + } + + override fun clearPassError() { + binding.loginFormPassLayout.error = null + } + + override fun showSoftKeyboard() { + activity?.showSoftInput() + } + + override fun hideSoftKeyboard() { + activity?.hideSoftInput() + } + + override fun showProgress(show: Boolean) { + binding.loginFormProgress.visibility = if (show) VISIBLE else GONE + } + + override fun showContent(show: Boolean) { + binding.loginFormContainer.visibility = if (show) VISIBLE else GONE + } + + @SuppressLint("SetTextI18n") + override fun showVersion() { + binding.loginFormVersion.text = "v${appInfo.versionName}" + } + + override fun notifyParentAccountLogged(studentsWithSemesters: List, loginData: Triple) { + (activity as? LoginActivity)?.onFormFragmentAccountLogged(studentsWithSemesters, loginData) + } + + override fun openPrivacyPolicyPage() { + context?.openInternetBrowser("https://wulkanowy.github.io/polityka-prywatnosci.html", ::showMessage) + } + + override fun showContact(show: Boolean) { + binding.loginFormContact.visibility = if (show) VISIBLE else GONE + } + + override fun openAdvancedLogin() { + (activity as? LoginActivity)?.onAdvancedLoginClick() + } + + override fun onRecoverClick() { + (activity as? LoginActivity)?.onRecoverClick() + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } + + override fun openFaqPage() { + context?.openInternetBrowser("https://wulkanowy.github.io/czesto-zadawane-pytania/dlaczego-nie-moge-sie-zalogowac", ::showMessage) + } + + override fun onResume() { + super.onResume() + presenter.updateUsernameLabel() + } + + override fun openEmail(lastError: String) { + context?.openEmailClient( + chooserTitle = requireContext().getString(R.string.login_email_intent_title), + email = "wulkanowyinc@gmail.com", + subject = requireContext().getString(R.string.login_email_subject), + body = requireContext().getString(R.string.login_email_text, + "${appInfo.systemManufacturer} ${appInfo.systemModel}", + appInfo.systemVersion.toString(), + appInfo.versionName, + "$formHostValue/$formHostSymbol", + lastError + ) + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginFormPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginFormPresenter.kt new file mode 100644 index 00000000..b921140c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginFormPresenter.kt @@ -0,0 +1,161 @@ +package io.github.wulkanowy.ui.modules.login.form + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.modules.login.LoginErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.ifNullOrBlank +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class LoginFormPresenter @Inject constructor( + studentRepository: StudentRepository, + private val loginErrorHandler: LoginErrorHandler, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(loginErrorHandler, studentRepository) { + + private var lastError: Throwable? = null + + override fun onAttachView(view: LoginFormView) { + super.onAttachView(view) + view.run { + initView() + showContact(false) + showVersion() + + loginErrorHandler.onBadCredentials = { + setErrorPassIncorrect() + showSoftKeyboard() + Timber.i("Entered wrong username or password") + } + } + } + + fun onPrivacyLinkClick() { + view?.openPrivacyPolicyPage() + } + + fun onAdvancedLoginClick() { + view?.openAdvancedLogin() + } + + fun onHostSelected() { + view?.apply { + clearPassError() + clearUsernameError() + if (formHostValue.contains("fakelog")) { + setCredentials("jan@fakelog.cf", "jan123") + } + updateUsernameLabel() + } + } + + fun updateUsernameLabel() { + view?.run { + setUsernameLabel(if ("standard" in formHostValue) emailLabel else nicknameLabel) + } + } + + fun onPassTextChanged() { + view?.clearPassError() + } + + fun onUsernameTextChanged() { + view?.clearUsernameError() + } + + fun onSignInClick() { + val email = view?.formUsernameValue.orEmpty().trim() + val password = view?.formPassValue.orEmpty().trim() + val host = view?.formHostValue.orEmpty().trim() + val symbol = view?.formHostSymbol.orEmpty().trim() + + if (!validateCredentials(email, password, host)) return + + flowWithResource { studentRepository.getStudentsScrapper(email, password, host, symbol) }.onEach { + when (it.status) { + Status.LOADING -> view?.run { + Timber.i("Login started") + hideSoftKeyboard() + showProgress(true) + showContent(false) + } + Status.SUCCESS -> { + Timber.i("Login result: Success") + analytics.logEvent( + "registration_form", + "success" to true, + "students" to it.data!!.size, + "scrapperBaseUrl" to host, + "error" to "No error" + ) + view?.notifyParentAccountLogged(it.data, Triple(email, password, host)) + } + Status.ERROR -> { + Timber.i("Login result: An exception occurred") + analytics.logEvent( + "registration_form", + "success" to false, + "students" to -1, + "scrapperBaseUrl" to host, + "error" to it.error!!.message.ifNullOrBlank { "No message" }) + loginErrorHandler.dispatch(it.error) + lastError = it.error + view?.showContact(true) + } + } + }.afterLoading { + view?.apply { + showProgress(false) + showContent(true) + } + }.launch("login") + } + + fun onFaqClick() { + view?.openFaqPage() + } + + fun onEmailClick() { + view?.openEmail(lastError?.message.ifNullOrBlank { "none" }) + } + + fun onRecoverClick() { + view?.onRecoverClick() + } + + private fun validateCredentials(login: String, password: String, host: String): Boolean { + var isCorrect = true + + if (login.isEmpty()) { + view?.setErrorUsernameRequired() + isCorrect = false + } else { + if ("@" in login && "standard" !in host) { + view?.setErrorLoginRequired() + isCorrect = false + } + + if ("@" !in login && "standard" in host) { + view?.setErrorEmailRequired() + isCorrect = false + } + } + + if (password.isEmpty()) { + view?.setErrorPassRequired(focus = isCorrect) + isCorrect = false + } + + if (password.length < 6 && password.isNotEmpty()) { + view?.setErrorPassInvalid(focus = isCorrect) + isCorrect = false + } + + return isCorrect + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginFormView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginFormView.kt new file mode 100644 index 00000000..77e66538 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginFormView.kt @@ -0,0 +1,65 @@ +package io.github.wulkanowy.ui.modules.login.form + +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.ui.base.BaseView + +interface LoginFormView : BaseView { + + fun initView() + + val formUsernameValue: String + + val formPassValue: String + + val formHostValue: String + + val formHostSymbol: String + + val nicknameLabel: String + + val emailLabel: String + + fun setCredentials(username: String, pass: String) + + fun setUsernameLabel(label: String) + + fun setErrorUsernameRequired() + + fun setErrorLoginRequired() + + fun setErrorEmailRequired() + + fun setErrorPassRequired(focus: Boolean) + + fun setErrorPassInvalid(focus: Boolean) + + fun setErrorPassIncorrect() + + fun clearUsernameError() + + fun clearPassError() + + fun showSoftKeyboard() + + fun hideSoftKeyboard() + + fun showProgress(show: Boolean) + + fun showContent(show: Boolean) + + fun showVersion() + + fun notifyParentAccountLogged(studentsWithSemesters: List, loginData: Triple) + + fun openPrivacyPolicyPage() + + fun showContact(show: Boolean) + + fun openFaqPage() + + fun openEmail(lastError: String) + + fun openAdvancedLogin() + + fun onRecoverClick() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginSymbolAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginSymbolAdapter.kt new file mode 100644 index 00000000..87fa038e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/form/LoginSymbolAdapter.kt @@ -0,0 +1,16 @@ +package io.github.wulkanowy.ui.modules.login.form + +import android.content.Context +import android.widget.ArrayAdapter +import android.widget.Filter + +class LoginSymbolAdapter(context: Context, resource: Int, objects: Array) : + ArrayAdapter(context, resource, objects) { + + override fun getFilter() = object : Filter() { + + override fun performFiltering(constraint: CharSequence?) = null + + override fun publishResults(constraint: CharSequence?, results: FilterResults?) {} + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/LoginRecoverFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/LoginRecoverFragment.kt new file mode 100644 index 00000000..f0c9652f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/LoginRecoverFragment.kt @@ -0,0 +1,212 @@ +package io.github.wulkanowy.ui.modules.login.recover + +import android.annotation.SuppressLint +import android.graphics.Color +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import android.webkit.JavascriptInterface +import android.webkit.WebView +import android.webkit.WebViewClient +import androidx.core.widget.doOnTextChanged +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.databinding.FragmentLoginRecoverBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.login.LoginActivity +import io.github.wulkanowy.ui.modules.login.form.LoginSymbolAdapter +import io.github.wulkanowy.utils.hideSoftInput +import io.github.wulkanowy.utils.showSoftInput +import javax.inject.Inject + +@AndroidEntryPoint +class LoginRecoverFragment : + BaseFragment(R.layout.fragment_login_recover), LoginRecoverView { + + private var _binding: FragmentLoginRecoverBinding? = null + + private val bindingLocal: FragmentLoginRecoverBinding get() = _binding!! + + @Inject + lateinit var presenter: LoginRecoverPresenter + + companion object { + fun newInstance() = LoginRecoverFragment() + } + + private lateinit var hostKeys: Array + + private lateinit var hostValues: Array + + private lateinit var hostSymbols: Array + + override val recoverHostValue: String + get() = hostValues.getOrNull(hostKeys.indexOf(bindingLocal.loginRecoverHost.text.toString())).orEmpty() + + override val formHostSymbol: String + get() = hostSymbols.getOrNull(hostKeys.indexOf(bindingLocal.loginRecoverHost.text.toString())).orEmpty() + + override val recoverNameValue: String + get() = bindingLocal.loginRecoverName.text.toString().trim() + + override val emailHintString: String + get() = getString(R.string.login_email_hint) + + override val loginPeselEmailHintString: String + get() = getString(R.string.login_login_pesel_email_hint) + + override val invalidEmailString: String + get() = getString(R.string.login_invalid_email) + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + _binding = FragmentLoginRecoverBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + hostKeys = resources.getStringArray(R.array.hosts_keys) + hostValues = resources.getStringArray(R.array.hosts_values) + hostSymbols = resources.getStringArray(R.array.hosts_symbols) + + with(bindingLocal) { + loginRecoverWebView.setBackgroundColor(Color.TRANSPARENT) + loginRecoverName.doOnTextChanged { _, _, _, _ -> presenter.onNameTextChanged() } + loginRecoverHost.setOnItemClickListener { _, _, _, _ -> presenter.onHostSelected() } + loginRecoverButton.setOnClickListener { presenter.onRecoverClick() } + loginRecoverErrorRetry.setOnClickListener { presenter.onRecoverClick() } + loginRecoverErrorDetails.setOnClickListener { presenter.onDetailsClick() } + loginRecoverLogin.setOnClickListener { (activity as LoginActivity).switchView(0) } + } + + with(bindingLocal.loginRecoverHost) { + setText(hostKeys.getOrNull(0).orEmpty()) + setAdapter(LoginSymbolAdapter(context, R.layout.support_simple_spinner_dropdown_item, hostKeys)) + setOnClickListener { if (bindingLocal.loginRecoverFormContainer.visibility == GONE) dismissDropDown() } + } + } + + override fun setDefaultCredentials(username: String) { + bindingLocal.loginRecoverName.setText(username) + } + + override fun setErrorNameRequired() { + with(bindingLocal.loginRecoverNameLayout) { + requestFocus() + error = getString(R.string.login_field_required) + } + } + + override fun setUsernameHint(hint: String) { + bindingLocal.loginRecoverNameLayout.hint = hint + } + + override fun setUsernameError(message: String) { + with(bindingLocal.loginRecoverNameLayout) { + requestFocus() + error = message + } + } + + override fun clearUsernameError() { + bindingLocal.loginRecoverNameLayout.error = null + } + + override fun showProgress(show: Boolean) { + bindingLocal.loginRecoverProgress.visibility = if (show) VISIBLE else GONE + } + + override fun showRecoverForm(show: Boolean) { + bindingLocal.loginRecoverFormContainer.visibility = if (show) VISIBLE else GONE + } + + override fun showCaptcha(show: Boolean) { + bindingLocal.loginRecoverCaptchaContainer.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + bindingLocal.loginRecoverError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + bindingLocal.loginRecoverErrorMessage.text = message + } + + override fun showSuccessView(show: Boolean) { + bindingLocal.loginRecoverSuccess.visibility = if (show) VISIBLE else GONE + } + + override fun setSuccessTitle(title: String) { + bindingLocal.loginRecoverSuccessTitle.text = title + } + + override fun setSuccessMessage(message: String) { + bindingLocal.loginRecoverSuccessMessage.text = message + } + + override fun showSoftKeyboard() { + activity?.showSoftInput() + } + + override fun hideSoftKeyboard() { + activity?.hideSoftInput() + } + + @SuppressLint("SetJavaScriptEnabled", "AddJavascriptInterface") + override fun loadReCaptcha(siteKey: String, url: String) { + val html = """ +
+ + + """.trimIndent() + + with(bindingLocal.loginRecoverWebView) { + settings.javaScriptEnabled = true + webViewClient = object : WebViewClient() { + private var recoverWebViewSuccess: Boolean = true + + override fun onPageFinished(view: WebView?, url: String?) { + if (recoverWebViewSuccess) { + showCaptcha(true) + showProgress(false) + } else { + showProgress(false) + showErrorView(true) + } + } + + override fun onReceivedError(view: WebView, errorCode: Int, description: String, failingUrl: String) { + recoverWebViewSuccess = false + } + } + + loadDataWithBaseURL(url, html, "text/html", "UTF-8", null) + addJavascriptInterface(object { + + @Suppress("UNUSED") + @JavascriptInterface + fun captchaCallback(reCaptchaResponse: String) { + activity?.runOnUiThread { + presenter.onReCaptchaVerified(reCaptchaResponse) + } + } + }, "Android") + } + } + + override fun onResume() { + super.onResume() + presenter.updateFields() + } + + override fun onDestroyView() { + bindingLocal.loginRecoverWebView.destroy() + _binding = null + presenter.onDetachView() + + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/LoginRecoverPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/LoginRecoverPresenter.kt new file mode 100644 index 00000000..e5837705 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/LoginRecoverPresenter.kt @@ -0,0 +1,157 @@ +package io.github.wulkanowy.ui.modules.login.recover + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.recover.RecoverRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.ifNullOrBlank +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class LoginRecoverPresenter @Inject constructor( + studentRepository: StudentRepository, + private val loginErrorHandler: RecoverErrorHandler, + private val analytics: FirebaseAnalyticsHelper, + private val recoverRepository: RecoverRepository +) : BasePresenter(loginErrorHandler, studentRepository) { + + private lateinit var lastError: Throwable + + override fun onAttachView(view: LoginRecoverView) { + super.onAttachView(view) + view.initView() + + with(loginErrorHandler) { + showErrorMessage = ::showErrorMessage + onInvalidUsername = ::onInvalidUsername + onInvalidCaptcha = ::onInvalidCaptcha + } + } + + fun onNameTextChanged() { + view?.clearUsernameError() + } + + fun onHostSelected() { + view?.run { + if ("fakelog" in recoverHostValue) setDefaultCredentials("jan@fakelog.cf") + clearUsernameError() + updateFields() + } + } + + fun updateFields() { + view?.run { + setUsernameHint(if ("standard" in recoverHostValue) emailHintString else loginPeselEmailHintString) + } + } + + fun onRecoverClick() { + val username = view?.recoverNameValue.orEmpty() + val host = view?.recoverHostValue.orEmpty() + val symbol = view?.formHostSymbol.orEmpty() + + if (!validateInput(username, host)) return + + flowWithResource { recoverRepository.getReCaptchaSiteKey(host, symbol.ifBlank { "Default" }) }.onEach { + when (it.status) { + Status.LOADING -> view?.run { + hideSoftKeyboard() + showRecoverForm(false) + showProgress(true) + showErrorView(false) + showCaptcha(false) + } + Status.SUCCESS -> view?.run { + loadReCaptcha(url = it.data!!.first, siteKey = it.data.second) + showProgress(false) + showErrorView(false) + showCaptcha(true) + } + Status.ERROR -> { + Timber.i("Obtain captcha site key result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launch("captcha") + } + + private fun validateInput(username: String, host: String): Boolean { + var isCorrect = true + + if (username.isEmpty()) { + view?.setErrorNameRequired() + isCorrect = false + } + + if ("standard" in host && "@" !in username) { + view?.setUsernameError(view?.invalidEmailString.orEmpty()) + isCorrect = false + } + + return isCorrect + } + + fun onReCaptchaVerified(reCaptchaResponse: String) { + val username = view?.recoverNameValue.orEmpty() + val host = view?.recoverHostValue.orEmpty() + val symbol = view?.formHostSymbol.ifNullOrBlank { "Default" } + + flowWithResource { recoverRepository.sendRecoverRequest(host, symbol, username, reCaptchaResponse) }.onEach { + when (it.status) { + Status.LOADING -> view?.run { + showProgress(true) + showRecoverForm(false) + showCaptcha(false) + } + Status.SUCCESS -> view?.run { + showSuccessView(true) + setSuccessTitle(it.data!!.substringBefore(". ")) + setSuccessMessage(it.data.substringAfter(". ")) + analytics.logEvent("account_recover", "register" to host, "symbol" to symbol, "success" to true) + } + Status.ERROR -> { + Timber.i("Send recover request result: An exception occurred") + errorHandler.dispatch(it.error!!) + analytics.logEvent("account_recover", "register" to host, "symbol" to symbol, "success" to false) + } + } + }.afterLoading { + view?.showProgress(false) + }.launch("verified") + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + private fun showErrorMessage(message: String, error: Throwable) { + view?.run { + lastError = error + showProgress(false) + setErrorDetails(message) + showErrorView(true) + } + } + + private fun onInvalidUsername(message: String) { + view?.run { + setUsernameError(message) + showRecoverForm(true) + } + } + + private fun onInvalidCaptcha(message: String, error: Throwable) { + view?.run { + lastError = error + setErrorDetails(message) + showCaptcha(false) + showRecoverForm(false) + showErrorView(true) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/LoginRecoverView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/LoginRecoverView.kt new file mode 100644 index 00000000..2e21d335 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/LoginRecoverView.kt @@ -0,0 +1,52 @@ +package io.github.wulkanowy.ui.modules.login.recover + +import io.github.wulkanowy.ui.base.BaseView + +interface LoginRecoverView : BaseView { + + val recoverHostValue: String + + val formHostSymbol: String + + val recoverNameValue: String + + val emailHintString: String + + val loginPeselEmailHintString: String + + val invalidEmailString: String + + fun initView() + + fun setDefaultCredentials(username: String) + + fun clearUsernameError() + + fun setErrorNameRequired() + + fun setUsernameHint(hint: String) + + fun setUsernameError(message: String) + + fun showSoftKeyboard() + + fun hideSoftKeyboard() + + fun showProgress(show: Boolean) + + fun showRecoverForm(show: Boolean) + + fun showCaptcha(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showSuccessView(show: Boolean) + + fun setSuccessMessage(message: String) + + fun setSuccessTitle(title: String) + + fun loadReCaptcha(siteKey: String, url: String) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/RecoverErrorHandler.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/RecoverErrorHandler.kt new file mode 100644 index 00000000..110dd82e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/recover/RecoverErrorHandler.kt @@ -0,0 +1,32 @@ +package io.github.wulkanowy.ui.modules.login.recover + +import android.content.res.Resources +import com.chuckerteam.chucker.api.ChuckerCollector +import io.github.wulkanowy.sdk.scrapper.exception.InvalidCaptchaException +import io.github.wulkanowy.sdk.scrapper.exception.InvalidEmailException +import io.github.wulkanowy.sdk.scrapper.exception.NoAccountFoundException +import io.github.wulkanowy.ui.base.ErrorHandler +import javax.inject.Inject + +class RecoverErrorHandler @Inject constructor( + resources: Resources, + chuckerCollector: ChuckerCollector +) : ErrorHandler(resources, chuckerCollector) { + + var onInvalidUsername: (String) -> Unit = {} + + var onInvalidCaptcha: (String, Throwable) -> Unit = { _, _ -> } + + override fun proceed(error: Throwable) { + when (error) { + is InvalidEmailException, is NoAccountFoundException -> onInvalidUsername(error.localizedMessage.orEmpty()) + is InvalidCaptchaException -> onInvalidCaptcha(error.localizedMessage.orEmpty(), error) + else -> super.proceed(error) + } + } + + override fun clear() { + super.clear() + onInvalidUsername = {} + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectAdapter.kt new file mode 100644 index 00000000..c046c2ff --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectAdapter.kt @@ -0,0 +1,66 @@ +package io.github.wulkanowy.ui.modules.login.studentselect + +import android.annotation.SuppressLint +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.databinding.ItemLoginStudentSelectBinding +import javax.inject.Inject + +class LoginStudentSelectAdapter @Inject constructor() : + RecyclerView.Adapter() { + + private val checkedList = mutableMapOf() + + var items = emptyList>() + set(value) { + field = value + checkedList.clear() + } + + var onClickListener: (StudentWithSemesters, alreadySaved: Boolean) -> Unit = { _, _ -> } + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemLoginStudentSelectBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + @SuppressLint("SetTextI18n") + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val (studentAndSemesters, alreadySaved) = items[position] + val student = studentAndSemesters.student + val semesters = studentAndSemesters.semesters + val diary = semesters.maxByOrNull { it.semesterId } + + with(holder.binding) { + loginItemName.text = "${student.studentName} ${diary?.diaryName.orEmpty()}" + loginItemSchool.text = student.schoolName + loginItemName.isEnabled = !alreadySaved + loginItemSchool.isEnabled = !alreadySaved + loginItemSignedIn.visibility = if (alreadySaved) View.VISIBLE else View.GONE + + with(loginItemCheck) { + isEnabled = !alreadySaved + keyListener = null + isChecked = checkedList[position] ?: false + } + + root.setOnClickListener { + onClickListener(studentAndSemesters, alreadySaved) + + with(loginItemCheck) { + if (isEnabled) { + isChecked = !isChecked + checkedList[position] = isChecked + } + } + } + } + } + + class ItemViewHolder(val binding: ItemLoginStudentSelectBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectFragment.kt new file mode 100644 index 00000000..e71fc0f6 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectFragment.kt @@ -0,0 +1,119 @@ +package io.github.wulkanowy.ui.modules.login.studentselect + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.databinding.FragmentLoginStudentSelectBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.openEmailClient +import io.github.wulkanowy.utils.openInternetBrowser +import java.io.Serializable +import javax.inject.Inject + +@AndroidEntryPoint +class LoginStudentSelectFragment : + BaseFragment(R.layout.fragment_login_student_select), + LoginStudentSelectView { + + @Inject + lateinit var presenter: LoginStudentSelectPresenter + + @Inject + lateinit var loginAdapter: LoginStudentSelectAdapter + + @Inject + lateinit var appInfo: AppInfo + + companion object { + const val SAVED_STUDENTS = "STUDENTS" + + fun newInstance() = LoginStudentSelectFragment() + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentLoginStudentSelectBinding.bind(view) + presenter.onAttachView(this, savedInstanceState?.getSerializable(SAVED_STUDENTS)) + } + + override fun initView() { + loginAdapter.onClickListener = presenter::onItemSelected + + with(binding) { + loginStudentSelectSignIn.setOnClickListener { presenter.onSignIn() } + loginStudentSelectContactDiscord.setOnClickListener { presenter.onDiscordClick() } + loginStudentSelectContactEmail.setOnClickListener { presenter.onEmailClick() } + + with(loginStudentSelectRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = loginAdapter + } + } + } + + override fun updateData(data: List>) { + with(loginAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun openMainView() { + activity?.let { startActivity(MainActivity.getStartIntent(context = it, clear = true)) } + } + + override fun showProgress(show: Boolean) { + binding.loginStudentSelectProgress.visibility = if (show) VISIBLE else GONE + } + + override fun showContent(show: Boolean) { + binding.loginStudentSelectContent.visibility = if (show) VISIBLE else GONE + } + + override fun enableSignIn(enable: Boolean) { + binding.loginStudentSelectSignIn.isEnabled = enable + } + + fun onParentInitStudentSelectFragment(studentsWithSemesters: List) { + presenter.onParentInitStudentSelectView(studentsWithSemesters) + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putSerializable(SAVED_STUDENTS, presenter.students as Serializable) + } + + override fun showContact(show: Boolean) { + binding.loginStudentSelectContact.visibility = if (show) VISIBLE else GONE + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } + + override fun openDiscordInvite() { + context?.openInternetBrowser("https://discord.gg/vccAQBr", ::showMessage) + } + + override fun openEmail(lastError: String) { + context?.openEmailClient( + chooserTitle = requireContext().getString(R.string.login_email_intent_title), + email = "wulkanowyinc@gmail.com", + subject = requireContext().getString(R.string.login_email_subject), + body = requireContext().getString(R.string.login_email_text, appInfo.systemModel, + appInfo.systemVersion.toString(), + appInfo.versionName, + "Select users to log in", + lastError + ) + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectPresenter.kt new file mode 100644 index 00000000..1384f25a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectPresenter.kt @@ -0,0 +1,147 @@ +package io.github.wulkanowy.ui.modules.login.studentselect + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.modules.login.LoginErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.ifNullOrBlank +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import java.io.Serializable +import javax.inject.Inject + +class LoginStudentSelectPresenter @Inject constructor( + studentRepository: StudentRepository, + private val loginErrorHandler: LoginErrorHandler, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(loginErrorHandler, studentRepository) { + + private var lastError: Throwable? = null + + var students = emptyList() + + private val selectedStudents = mutableListOf() + + fun onAttachView(view: LoginStudentSelectView, students: Serializable?) { + super.onAttachView(view) + with(view) { + initView() + showContact(false) + enableSignIn(false) + loginErrorHandler.onStudentDuplicate = { + showMessage(it) + Timber.i("The student already registered in the app was selected") + } + } + + if (students is List<*> && students.isNotEmpty()) { + loadData(students.filterIsInstance()) + } + } + + fun onSignIn() { + registerStudents(selectedStudents) + } + + fun onParentInitStudentSelectView(studentsWithSemesters: List) { + loadData(studentsWithSemesters) + if (studentsWithSemesters.size == 1) registerStudents(studentsWithSemesters) + } + + fun onItemSelected(studentWithSemester: StudentWithSemesters, alreadySaved: Boolean) { + if (alreadySaved) return + + selectedStudents + .removeAll { it == studentWithSemester } + .let { if (!it) selectedStudents.add(studentWithSemester) } + + view?.enableSignIn(selectedStudents.isNotEmpty()) + } + + private fun compareStudents(a: Student, b: Student): Boolean { + return a.email == b.email + && a.symbol == b.symbol + && a.studentId == b.studentId + && a.schoolSymbol == b.schoolSymbol + && a.classId == b.classId + } + + private fun loadData(studentsWithSemesters: List) { + resetSelectedState() + this.students = studentsWithSemesters + + flowWithResource { studentRepository.getSavedStudents(false) }.onEach { + when (it.status) { + Status.LOADING -> Timber.d("Login student select students load started") + Status.SUCCESS -> view?.updateData(studentsWithSemesters.map { studentWithSemesters -> + studentWithSemesters to it.data!!.any { item -> compareStudents(studentWithSemesters.student, item.student) } + }) + Status.ERROR -> { + errorHandler.dispatch(it.error!!) + lastError = it.error + view?.updateData(studentsWithSemesters.map { student -> student to false }) + } + } + }.launch() + } + + private fun resetSelectedState() { + selectedStudents.clear() + view?.enableSignIn(false) + } + + private fun registerStudents(studentsWithSemesters: List) { + flowWithResource { + val savedStudents = studentRepository.saveStudents(studentsWithSemesters) + val firstRegistered = studentsWithSemesters.first().apply { student.id = savedStudents.first() } + studentRepository.switchStudent(firstRegistered) + }.onEach { + when (it.status) { + Status.LOADING -> view?.run { + Timber.i("Registration started") + showProgress(true) + showContent(false) + } + Status.SUCCESS -> { + Timber.i("Registration result: Success") + view?.openMainView() + logRegisterEvent(studentsWithSemesters) + } + Status.ERROR -> { + Timber.i("Registration result: An exception occurred ") + view?.apply { + showProgress(false) + showContent(true) + showContact(true) + } + lastError = it.error + loginErrorHandler.dispatch(it.error!!) + logRegisterEvent(studentsWithSemesters, it.error) + } + } + }.launch("register") + } + + fun onDiscordClick() { + view?.openDiscordInvite() + } + + fun onEmailClick() { + view?.openEmail(lastError?.message.ifNullOrBlank { "empty" }) + } + + private fun logRegisterEvent(studentsWithSemesters: List, error: Throwable? = null) { + studentsWithSemesters.forEach { student -> + analytics.logEvent( + "registration_student_select", + "success" to (error != null), + "scrapperBaseUrl" to student.student.scrapperBaseUrl, + "symbol" to student.student.symbol, + "error" to (error?.message?.ifBlank { "No message" } ?: "No error")) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectView.kt new file mode 100644 index 00000000..f2acd76c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/studentselect/LoginStudentSelectView.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.ui.modules.login.studentselect + +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.ui.base.BaseView + +interface LoginStudentSelectView : BaseView { + + fun initView() + + fun updateData(data: List>) + + fun openMainView() + + fun showProgress(show: Boolean) + + fun showContent(show: Boolean) + + fun enableSignIn(enable: Boolean) + + fun showContact(show: Boolean) + + fun openDiscordInvite() + + fun openEmail(lastError: String) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/symbol/LoginSymbolFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/symbol/LoginSymbolFragment.kt new file mode 100644 index 00000000..e2c37db6 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/symbol/LoginSymbolFragment.kt @@ -0,0 +1,147 @@ +package io.github.wulkanowy.ui.modules.login.symbol + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import android.view.inputmethod.EditorInfo.IME_ACTION_DONE +import android.view.inputmethod.EditorInfo.IME_NULL +import android.widget.ArrayAdapter +import androidx.core.widget.doOnTextChanged +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.databinding.FragmentLoginSymbolBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.login.LoginActivity +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.hideSoftInput +import io.github.wulkanowy.utils.openEmailClient +import io.github.wulkanowy.utils.openInternetBrowser +import io.github.wulkanowy.utils.showSoftInput +import javax.inject.Inject + +@AndroidEntryPoint +class LoginSymbolFragment : + BaseFragment(R.layout.fragment_login_symbol), LoginSymbolView { + + @Inject + lateinit var presenter: LoginSymbolPresenter + + @Inject + lateinit var appInfo: AppInfo + + companion object { + private const val SAVED_LOGIN_DATA = "LOGIN_DATA" + + fun newInstance() = LoginSymbolFragment() + } + + override val symbolNameError: CharSequence? + get() = binding.loginSymbolNameLayout.error + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentLoginSymbolBinding.bind(view) + presenter.onAttachView(this, savedInstanceState?.getSerializable(SAVED_LOGIN_DATA)) + } + + override fun initView() { + with(binding) { + loginSymbolSignIn.setOnClickListener { presenter.attemptLogin(loginSymbolName.text.toString()) } + loginSymbolFaq.setOnClickListener { presenter.onFaqClick() } + loginSymbolContactEmail.setOnClickListener { presenter.onEmailClick() } + + loginSymbolName.doOnTextChanged { _, _, _, _ -> presenter.onSymbolTextChanged() } + + loginSymbolName.apply { + setOnEditorActionListener { _, id, _ -> + if (id == IME_ACTION_DONE || id == IME_NULL) loginSymbolSignIn.callOnClick() else false + } + setAdapter(ArrayAdapter(context, android.R.layout.simple_list_item_1, resources.getStringArray(R.array.symbols_values))) + } + } + } + + fun onParentInitSymbolFragment(loginData: Triple) { + presenter.onParentInitSymbolView(loginData) + } + + override fun setErrorSymbolIncorrect() { + binding.loginSymbolNameLayout.apply { + requestFocus() + error = getString(R.string.login_incorrect_symbol) + } + } + + override fun setErrorSymbolRequire() { + binding.loginSymbolNameLayout.apply { + requestFocus() + error = getString(R.string.login_field_required) + } + } + + override fun clearSymbolError() { + binding.loginSymbolNameLayout.error = null + } + + override fun clearAndFocusSymbol() { + binding.loginSymbolNameLayout.apply { + editText?.text = null + requestFocus() + } + } + + override fun showSoftKeyboard() { + activity?.showSoftInput() + } + + override fun hideSoftKeyboard() { + activity?.hideSoftInput() + } + + override fun showProgress(show: Boolean) { + binding.loginSymbolProgress.visibility = if (show) VISIBLE else GONE + } + + override fun showContent(show: Boolean) { + binding.loginSymbolContainer.visibility = if (show) VISIBLE else GONE + } + + override fun notifyParentAccountLogged(studentsWithSemesters: List) { + (activity as? LoginActivity)?.onSymbolFragmentAccountLogged(studentsWithSemesters) + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putSerializable(SAVED_LOGIN_DATA, presenter.loginData) + } + + override fun showContact(show: Boolean) { + binding.loginSymbolContact.visibility = if (show) VISIBLE else GONE + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } + + override fun openFaqPage() { + context?.openInternetBrowser("https://wulkanowy.github.io/czesto-zadawane-pytania/co-to-jest-symbol", ::showMessage) + } + + override fun openEmail(host: String, lastError: String) { + context?.openEmailClient( + chooserTitle = requireContext().getString(R.string.login_email_intent_title), + email = "wulkanowyinc@gmail.com", + subject = requireContext().getString(R.string.login_email_subject), + body = requireContext().getString(R.string.login_email_text, + "${appInfo.systemManufacturer} ${appInfo.systemModel}", + appInfo.systemVersion.toString(), + appInfo.versionName, + "$host/${binding.loginSymbolName.text}", + lastError + ) + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/symbol/LoginSymbolPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/symbol/LoginSymbolPresenter.kt new file mode 100644 index 00000000..a2cda4fc --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/symbol/LoginSymbolPresenter.kt @@ -0,0 +1,116 @@ +package io.github.wulkanowy.ui.modules.login.symbol + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.modules.login.LoginErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.ifNullOrBlank +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import java.io.Serializable +import javax.inject.Inject + +class LoginSymbolPresenter @Inject constructor( + studentRepository: StudentRepository, + private val loginErrorHandler: LoginErrorHandler, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(loginErrorHandler, studentRepository) { + + private var lastError: Throwable? = null + + var loginData: Triple? = null + + @Suppress("UNCHECKED_CAST") + fun onAttachView(view: LoginSymbolView, savedLoginData: Serializable?) { + super.onAttachView(view) + view.run { + initView() + showContact(false) + } + if (savedLoginData is Triple<*, *, *>) { + loginData = savedLoginData as Triple + } + } + + fun onSymbolTextChanged() { + view?.apply { if (symbolNameError != null) clearSymbolError() } + } + + fun attemptLogin(symbol: String) { + if (loginData == null) throw IllegalArgumentException("Login data is null") + + if (symbol.isBlank()) { + view?.setErrorSymbolRequire() + return + } + + flowWithResource { studentRepository.getStudentsScrapper(loginData!!.first, loginData!!.second, loginData!!.third, symbol) }.onEach { + when (it.status) { + Status.LOADING -> view?.run { + Timber.i("Login with symbol started") + hideSoftKeyboard() + showProgress(true) + showContent(false) + } + Status.SUCCESS -> { + view?.run { + if (it.data!!.isEmpty()) { + Timber.i("Login with symbol result: Empty student list") + setErrorSymbolIncorrect() + view?.showContact(true) + } else { + Timber.i("Login with symbol result: Success") + notifyParentAccountLogged(it.data) + } + } + analytics.logEvent( + "registration_symbol", + "success" to true, + "students" to it.data!!.size, + "scrapperBaseUrl" to loginData?.third, + "symbol" to symbol, + "error" to "No error" + ) + } + Status.ERROR -> { + Timber.i("Login with symbol result: An exception occurred") + analytics.logEvent( + "registration_symbol", + "success" to false, + "students" to -1, + "scrapperBaseUrl" to loginData?.third, + "symbol" to symbol, + "error" to it.error!!.message.ifNullOrBlank { "No message" } + ) + loginErrorHandler.dispatch(it.error) + lastError = it.error + view?.showContact(true) + } + } + }.afterLoading { + view?.apply { + showProgress(false) + showContent(true) + } + }.launch("login") + } + + fun onParentInitSymbolView(loginData: Triple) { + this.loginData = loginData + view?.apply { + clearAndFocusSymbol() + showSoftKeyboard() + } + } + + fun onFaqClick() { + view?.openFaqPage() + } + + fun onEmailClick() { + view?.openEmail(loginData?.third.orEmpty(), lastError?.message.ifNullOrBlank { "empty" }) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/login/symbol/LoginSymbolView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/login/symbol/LoginSymbolView.kt new file mode 100644 index 00000000..830c77d1 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/login/symbol/LoginSymbolView.kt @@ -0,0 +1,35 @@ +package io.github.wulkanowy.ui.modules.login.symbol + +import io.github.wulkanowy.data.db.entities.StudentWithSemesters +import io.github.wulkanowy.ui.base.BaseView + +interface LoginSymbolView : BaseView { + + val symbolNameError: CharSequence? + + fun initView() + + fun setErrorSymbolIncorrect() + + fun setErrorSymbolRequire() + + fun clearSymbolError() + + fun clearAndFocusSymbol() + + fun showSoftKeyboard() + + fun hideSoftKeyboard() + + fun showProgress(show: Boolean) + + fun showContent(show: Boolean) + + fun notifyParentAccountLogged(studentsWithSemesters: List) + + fun showContact(show: Boolean) + + fun openFaqPage() + + fun openEmail(host: String, lastError: String) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumber/LuckyNumberFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumber/LuckyNumberFragment.kt new file mode 100644 index 00000000..0f1d836d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumber/LuckyNumberFragment.kt @@ -0,0 +1,83 @@ +package io.github.wulkanowy.ui.modules.luckynumber + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.LuckyNumber +import io.github.wulkanowy.databinding.FragmentLuckyNumberBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainView +import javax.inject.Inject + +@AndroidEntryPoint +class LuckyNumberFragment : + BaseFragment(R.layout.fragment_lucky_number), LuckyNumberView, + MainView.TitledView { + + @Inject + lateinit var presenter: LuckyNumberPresenter + + companion object { + fun newInstance() = LuckyNumberFragment() + } + + override val titleStringId: Int + get() = R.string.lucky_number_title + + override val isViewEmpty get() = binding.luckyNumberText.text.isBlank() + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentLuckyNumberBinding.bind(view) + messageContainer = binding.luckyNumberSwipe + presenter.onAttachView(this) + } + + override fun initView() { + with(binding) { + luckyNumberSwipe.setOnRefreshListener { presenter.onSwipeRefresh() } + luckyNumberErrorRetry.setOnClickListener { presenter.onRetry() } + luckyNumberErrorDetails.setOnClickListener { presenter.onDetailsClick() } + } + } + + override fun updateData(data: LuckyNumber) { + binding.luckyNumberText.text = data.luckyNumber.toString() + } + + override fun hideRefresh() { + binding.luckyNumberSwipe.isRefreshing = false + } + + override fun showEmpty(show: Boolean) { + binding.luckyNumberEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.luckyNumberError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.luckyNumberErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.luckyNumberProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.luckyNumberSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.luckyNumberContent.visibility = if (show) VISIBLE else GONE + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumber/LuckyNumberPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumber/LuckyNumberPresenter.kt new file mode 100644 index 00000000..90aea441 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumber/LuckyNumberPresenter.kt @@ -0,0 +1,107 @@ +package io.github.wulkanowy.ui.modules.luckynumber + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.luckynumber.LuckyNumberRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class LuckyNumberPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val luckyNumberRepository: LuckyNumberRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private lateinit var lastError: Throwable + + override fun onAttachView(view: LuckyNumberView) { + super.onAttachView(view) + view.run { + initView() + showContent(false) + enableSwipe(false) + } + Timber.i("Lucky number view was initialized") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData() + } + + private fun loadData(forceRefresh: Boolean = false) { + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + luckyNumberRepository.getLuckyNumber(student, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading lucky number started") + Status.SUCCESS -> { + if (it.data != null) { + Timber.i("Loading lucky number result: Success") + view?.apply { + updateData(it.data) + showContent(true) + showEmpty(false) + showErrorView(false) + } + analytics.logEvent( + "load_item", + "type" to "lucky_number", + "number" to it.data.luckyNumber + ) + } else { + Timber.i("Loading lucky number result: No lucky number found") + view?.run { + showContent(false) + showEmpty(true) + showErrorView(false) + } + } + } + Status.ERROR -> { + Timber.i("Loading lucky number result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the lucky number") + loadData(true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumber/LuckyNumberView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumber/LuckyNumberView.kt new file mode 100644 index 00000000..a680c83e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumber/LuckyNumberView.kt @@ -0,0 +1,27 @@ +package io.github.wulkanowy.ui.modules.luckynumber + +import io.github.wulkanowy.data.db.entities.LuckyNumber +import io.github.wulkanowy.ui.base.BaseView + +interface LuckyNumberView : BaseView { + + val isViewEmpty: Boolean + + fun initView() + + fun updateData(data: LuckyNumber) + + fun hideRefresh() + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetConfigureActivity.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetConfigureActivity.kt new file mode 100644 index 00000000..692615d9 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetConfigureActivity.kt @@ -0,0 +1,108 @@ +package io.github.wulkanowy.ui.modules.luckynumberwidget + +import android.appwidget.AppWidgetManager.ACTION_APPWIDGET_UPDATE +import android.appwidget.AppWidgetManager.EXTRA_APPWIDGET_ID +import android.appwidget.AppWidgetManager.EXTRA_APPWIDGET_IDS +import android.content.Intent +import android.os.Build +import android.os.Bundle +import android.widget.Toast +import androidx.appcompat.app.AlertDialog +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.databinding.ActivityWidgetConfigureBinding +import io.github.wulkanowy.ui.base.BaseActivity +import io.github.wulkanowy.ui.base.WidgetConfigureAdapter +import io.github.wulkanowy.ui.modules.login.LoginActivity +import io.github.wulkanowy.utils.AppInfo +import javax.inject.Inject + +@AndroidEntryPoint +class LuckyNumberWidgetConfigureActivity : + BaseActivity(), + LuckyNumberWidgetConfigureView { + + @Inject + lateinit var configureAdapter: WidgetConfigureAdapter + + @Inject + override lateinit var presenter: LuckyNumberWidgetConfigurePresenter + + @Inject + lateinit var appInfo: AppInfo + + private var dialog: AlertDialog? = null + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setResult(RESULT_CANCELED) + setContentView(ActivityWidgetConfigureBinding.inflate(layoutInflater).apply { binding = this }.root) + + intent.extras.let { + presenter.onAttachView(this, it?.getInt(EXTRA_APPWIDGET_ID)) + } + } + + override fun initView() { + with(binding.widgetConfigureRecycler) { + adapter = configureAdapter + layoutManager = LinearLayoutManager(context) + } + + configureAdapter.onClickListener = presenter::onItemSelect + } + + override fun showThemeDialog() { + var items = arrayOf( + getString(R.string.widget_timetable_theme_light), + getString(R.string.widget_timetable_theme_dark) + ) + if (appInfo.systemVersion >= Build.VERSION_CODES.Q) items += (getString(R.string.widget_timetable_theme_system)) + + dialog = AlertDialog.Builder(this, R.style.WulkanowyTheme_WidgetAccountSwitcher) + .setTitle(R.string.widget_timetable_theme_title) + .setOnDismissListener { presenter.onDismissThemeView() } + .setSingleChoiceItems(items, -1) { _, which -> + presenter.onThemeSelect(which) + } + .show() + } + + override fun updateData(data: List>) { + with(configureAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun updateLuckyNumberWidget(widgetId: Int) { + sendBroadcast(Intent(this, LuckyNumberWidgetProvider::class.java) + .apply { + action = ACTION_APPWIDGET_UPDATE + putExtra(EXTRA_APPWIDGET_IDS, intArrayOf(widgetId)) + }) + } + + override fun setSuccessResult(widgetId: Int) { + setResult(RESULT_OK, Intent().apply { putExtra(EXTRA_APPWIDGET_ID, widgetId) }) + } + + override fun showError(text: String, error: Throwable) { + Toast.makeText(this, text, Toast.LENGTH_LONG).show() + } + + override fun finishView() { + finish() + } + + override fun openLoginView() { + startActivity(LoginActivity.getStartIntent(this)) + } + + override fun onDestroy() { + super.onDestroy() + dialog?.dismiss() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetConfigurePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetConfigurePresenter.kt new file mode 100644 index 00000000..574120b3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetConfigurePresenter.kt @@ -0,0 +1,83 @@ +package io.github.wulkanowy.ui.modules.luckynumberwidget + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.SharedPrefProvider +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.ui.modules.luckynumberwidget.LuckyNumberWidgetProvider.Companion.getStudentWidgetKey +import io.github.wulkanowy.ui.modules.luckynumberwidget.LuckyNumberWidgetProvider.Companion.getThemeWidgetKey +import io.github.wulkanowy.utils.flowWithResource +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class LuckyNumberWidgetConfigurePresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val sharedPref: SharedPrefProvider +) : BasePresenter(errorHandler, studentRepository) { + + private var appWidgetId: Int? = null + + private var selectedStudent: Student? = null + + fun onAttachView(view: LuckyNumberWidgetConfigureView, appWidgetId: Int?) { + super.onAttachView(view) + this.appWidgetId = appWidgetId + view.initView() + loadData() + } + + fun onItemSelect(student: Student) { + selectedStudent = student + view?.showThemeDialog() + } + + fun onThemeSelect(index: Int) { + appWidgetId?.let { + sharedPref.putLong(getThemeWidgetKey(it), index.toLong()) + } + registerStudent(selectedStudent) + } + + fun onDismissThemeView() { + view?.finishView() + } + + private fun loadData() { + flowWithResource { studentRepository.getSavedStudents(false) }.onEach { + when (it.status) { + Status.LOADING -> Timber.d("Lucky number widget configure students data load") + Status.SUCCESS -> { + val widgetId = appWidgetId?.let { id -> sharedPref.getLong(getStudentWidgetKey(id), 0) } + when { + it.data!!.isEmpty() -> view?.openLoginView() + it.data.size == 1 -> { + selectedStudent = it.data.single().student + view?.showThemeDialog() + } + else -> view?.updateData(it.data.map { entity -> + entity.student to (entity.student.id == widgetId) + }) + } + } + Status.ERROR -> errorHandler.dispatch(it.error!!) + } + }.launch() + } + + private fun registerStudent(student: Student?) { + requireNotNull(student) + + appWidgetId?.let { id -> + sharedPref.putLong(getStudentWidgetKey(id), student.id) + view?.run { + updateLuckyNumberWidget(id) + setSuccessResult(id) + } + } + view?.finishView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetConfigureView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetConfigureView.kt new file mode 100644 index 00000000..c8c348ed --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetConfigureView.kt @@ -0,0 +1,21 @@ +package io.github.wulkanowy.ui.modules.luckynumberwidget + +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.ui.base.BaseView + +interface LuckyNumberWidgetConfigureView : BaseView { + + fun initView() + + fun showThemeDialog() + + fun updateData(data: List>) + + fun updateLuckyNumberWidget(widgetId: Int) + + fun setSuccessResult(widgetId: Int) + + fun finishView() + + fun openLoginView() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetProvider.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetProvider.kt new file mode 100644 index 00000000..b7f4b740 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/luckynumberwidget/LuckyNumberWidgetProvider.kt @@ -0,0 +1,163 @@ +package io.github.wulkanowy.ui.modules.luckynumberwidget + +import android.app.PendingIntent +import android.app.PendingIntent.FLAG_UPDATE_CURRENT +import android.appwidget.AppWidgetManager +import android.appwidget.AppWidgetManager.OPTION_APPWIDGET_MAX_HEIGHT +import android.appwidget.AppWidgetManager.OPTION_APPWIDGET_MIN_WIDTH +import android.appwidget.AppWidgetProvider +import android.content.Context +import android.content.res.Configuration +import android.os.Bundle +import android.view.View.GONE +import android.view.View.VISIBLE +import android.widget.RemoteViews +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.SharedPrefProvider +import io.github.wulkanowy.data.exceptions.NoCurrentStudentException +import io.github.wulkanowy.data.repositories.luckynumber.LuckyNumberRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.toFirstResult +import kotlinx.coroutines.runBlocking +import timber.log.Timber +import javax.inject.Inject + +@AndroidEntryPoint +class LuckyNumberWidgetProvider : AppWidgetProvider() { + + @Inject + lateinit var studentRepository: StudentRepository + + @Inject + lateinit var luckyNumberRepository: LuckyNumberRepository + + @Inject + lateinit var sharedPref: SharedPrefProvider + + companion object { + + fun getStudentWidgetKey(appWidgetId: Int) = "lucky_number_widget_student_$appWidgetId" + + fun getThemeWidgetKey(appWidgetId: Int) = "lucky_number_widget_theme_$appWidgetId" + + fun getHeightWidgetKey(appWidgetId: Int) = "lucky_number_widget_height_$appWidgetId" + + fun getWidthWidgetKey(appWidgetId: Int) = "lucky_number_widget_width_$appWidgetId" + } + + override fun onUpdate(context: Context, appWidgetManager: AppWidgetManager, appWidgetIds: IntArray?) { + super.onUpdate(context, appWidgetManager, appWidgetIds) + appWidgetIds?.forEach { appWidgetId -> + + val luckyNumber = getLuckyNumber(sharedPref.getLong(getStudentWidgetKey(appWidgetId), 0), appWidgetId) + val appIntent = PendingIntent.getActivity(context, MainView.Section.LUCKY_NUMBER.id, + MainActivity.getStartIntent(context, MainView.Section.LUCKY_NUMBER, true), FLAG_UPDATE_CURRENT) + + val remoteView = RemoteViews(context.packageName, getCorrectLayoutId(appWidgetId, context)).apply { + setTextViewText(R.id.luckyNumberWidgetNumber, luckyNumber?.luckyNumber?.toString() ?: "#") + setOnClickPendingIntent(R.id.luckyNumberWidgetContainer, appIntent) + } + + setStyles(remoteView, appWidgetId) + appWidgetManager.updateAppWidget(appWidgetId, remoteView) + } + } + + override fun onDeleted(context: Context?, appWidgetIds: IntArray?) { + super.onDeleted(context, appWidgetIds) + appWidgetIds?.forEach { appWidgetId -> + with(sharedPref) { + delete(getHeightWidgetKey(appWidgetId)) + delete(getStudentWidgetKey(appWidgetId)) + delete(getThemeWidgetKey(appWidgetId)) + delete(getWidthWidgetKey(appWidgetId)) + } + } + } + + override fun onAppWidgetOptionsChanged(context: Context, appWidgetManager: AppWidgetManager, appWidgetId: Int, newOptions: Bundle?) { + super.onAppWidgetOptionsChanged(context, appWidgetManager, appWidgetId, newOptions) + + val remoteView = RemoteViews(context.packageName, getCorrectLayoutId(appWidgetId, context)) + + setStyles(remoteView, appWidgetId, newOptions) + appWidgetManager.updateAppWidget(appWidgetId, remoteView) + } + + private fun setStyles(views: RemoteViews, appWidgetId: Int, options: Bundle? = null) { + val width = options?.getInt(OPTION_APPWIDGET_MIN_WIDTH) ?: sharedPref.getLong(getWidthWidgetKey(appWidgetId), 74).toInt() + val height = options?.getInt(OPTION_APPWIDGET_MAX_HEIGHT) ?: sharedPref.getLong(getHeightWidgetKey(appWidgetId), 74).toInt() + + with(sharedPref) { + putLong(getWidthWidgetKey(appWidgetId), width.toLong()) + putLong(getHeightWidgetKey(appWidgetId), height.toLong()) + } + + val rows = getCellsForSize(height) + val cols = getCellsForSize(width) + + Timber.d("New lucky number widget measurement: %dx%d", width, height) + Timber.d("Widget size: $cols x $rows") + + when { + 1 == cols && 1 == rows -> views.setVisibility(imageTop = false, imageLeft = false) + 1 == cols && 1 < rows -> views.setVisibility(imageTop = true, imageLeft = false) + 1 < cols && 1 == rows -> views.setVisibility(imageTop = false, imageLeft = true) + 1 == cols && 1 == rows -> views.setVisibility(imageTop = true, imageLeft = false) + 2 == cols && 1 == rows -> views.setVisibility(imageTop = false, imageLeft = true) + else -> views.setVisibility(imageTop = false, imageLeft = false, title = true) + } + } + + private fun RemoteViews.setVisibility(imageTop: Boolean, imageLeft: Boolean, title: Boolean = false) { + setViewVisibility(R.id.luckyNumberWidgetImageTop, if (imageTop) VISIBLE else GONE) + setViewVisibility(R.id.luckyNumberWidgetImageLeft, if (imageLeft) VISIBLE else GONE) + setViewVisibility(R.id.luckyNumberWidgetTitle, if (title) VISIBLE else GONE) + setViewVisibility(R.id.luckyNumberWidgetNumber, VISIBLE) + } + + private fun getCellsForSize(size: Int): Int { + var n = 2 + while (74 * n - 30 < size) ++n + return n - 1 + } + + private fun getLuckyNumber(studentId: Long, appWidgetId: Int) = runBlocking { + try { + val students = studentRepository.getSavedStudents() + val student = students.singleOrNull { it.student.id == studentId }?.student + val currentStudent = when { + student != null -> student + studentId != 0L && studentRepository.isCurrentStudentSet() -> { + studentRepository.getCurrentStudent(false).also { + sharedPref.putLong(getStudentWidgetKey(appWidgetId), it.id) + } + } + else -> null + } + + currentStudent?.let { + luckyNumberRepository.getLuckyNumber(it, false).toFirstResult().data + } + } catch (e: Exception) { + if (e.cause !is NoCurrentStudentException) { + Timber.e(e, "An error has occurred in lucky number provider") + } + null + } + } + + private fun getCorrectLayoutId(appWidgetId: Int, context: Context): Int { + val savedTheme = sharedPref.getLong(getThemeWidgetKey(appWidgetId), 0) + val isSystemDarkMode = context.resources.configuration.uiMode and Configuration.UI_MODE_NIGHT_MASK == Configuration.UI_MODE_NIGHT_YES + + return if (savedTheme == 1L || (savedTheme == 2L && isSystemDarkMode)) { + R.layout.widget_luckynumber_dark + } else { + R.layout.widget_luckynumber + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/main/MainActivity.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/main/MainActivity.kt new file mode 100644 index 00000000..03560889 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/main/MainActivity.kt @@ -0,0 +1,209 @@ +package io.github.wulkanowy.ui.modules.main + +import android.content.Context +import android.content.Intent +import android.content.Intent.FLAG_ACTIVITY_CLEAR_TASK +import android.content.Intent.FLAG_ACTIVITY_NEW_TASK +import android.os.Build.VERSION.SDK_INT +import android.os.Build.VERSION_CODES.LOLLIPOP +import android.os.Bundle +import android.view.Menu +import android.view.MenuItem +import androidx.core.view.ViewCompat +import androidx.fragment.app.DialogFragment +import androidx.fragment.app.Fragment +import com.aurelhubert.ahbottomnavigation.AHBottomNavigation.TitleState.ALWAYS_SHOW +import com.aurelhubert.ahbottomnavigation.AHBottomNavigationItem +import com.google.android.material.elevation.ElevationOverlayProvider +import com.ncapdevi.fragnav.FragNavController +import com.ncapdevi.fragnav.FragNavController.Companion.HIDE +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.databinding.ActivityMainBinding +import io.github.wulkanowy.ui.base.BaseActivity +import io.github.wulkanowy.ui.modules.account.AccountDialog +import io.github.wulkanowy.ui.modules.attendance.AttendanceFragment +import io.github.wulkanowy.ui.modules.exam.ExamFragment +import io.github.wulkanowy.ui.modules.grade.GradeFragment +import io.github.wulkanowy.ui.modules.homework.HomeworkFragment +import io.github.wulkanowy.ui.modules.luckynumber.LuckyNumberFragment +import io.github.wulkanowy.ui.modules.message.MessageFragment +import io.github.wulkanowy.ui.modules.more.MoreFragment +import io.github.wulkanowy.ui.modules.note.NoteFragment +import io.github.wulkanowy.ui.modules.timetable.TimetableFragment +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.dpToPx +import io.github.wulkanowy.utils.getThemeAttrColor +import io.github.wulkanowy.utils.safelyPopFragments +import io.github.wulkanowy.utils.setOnViewChangeListener +import timber.log.Timber +import javax.inject.Inject + +@AndroidEntryPoint +class MainActivity : BaseActivity(), MainView { + + @Inject + override lateinit var presenter: MainPresenter + + @Inject + lateinit var analytics: FirebaseAnalyticsHelper + + private val overlayProvider by lazy { ElevationOverlayProvider(this) } + + private val navController = FragNavController(supportFragmentManager, R.id.mainFragmentContainer) + + companion object { + const val EXTRA_START_MENU = "extraStartMenu" + + fun getStartIntent(context: Context, startMenu: MainView.Section? = null, clear: Boolean = false): Intent { + return Intent(context, MainActivity::class.java) + .apply { + if (clear) flags = FLAG_ACTIVITY_NEW_TASK or FLAG_ACTIVITY_CLEAR_TASK + startMenu?.let { putExtra(EXTRA_START_MENU, it) } + } + } + } + + override val isRootView get() = navController.isRootFragment + + override val currentStackSize get() = navController.currentStack?.size + + override val currentViewTitle get() = (navController.currentFrag as? MainView.TitledView)?.titleStringId?.let { getString(it) } + + override val currentViewSubtitle get() = (navController.currentFrag as? MainView.TitledView)?.subtitleString + + override var startMenuIndex = 0 + + override var startMenuMoreIndex = -1 + + private val moreMenuFragments = mapOf( + MainView.Section.MESSAGE.id to MessageFragment.newInstance(), + MainView.Section.HOMEWORK.id to HomeworkFragment.newInstance(), + MainView.Section.NOTE.id to NoteFragment.newInstance(), + MainView.Section.LUCKY_NUMBER.id to LuckyNumberFragment.newInstance() + ) + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setContentView(ActivityMainBinding.inflate(layoutInflater).apply { binding = this }.root) + setSupportActionBar(binding.mainToolbar) + messageContainer = binding.mainFragmentContainer + + presenter.onAttachView(this, intent.getSerializableExtra(EXTRA_START_MENU) as? MainView.Section) + + with(navController) { + initialize(startMenuIndex, savedInstanceState) + pushFragment(moreMenuFragments[startMenuMoreIndex]) + } + } + + override fun onCreateOptionsMenu(menu: Menu?): Boolean { + menuInflater.inflate(R.menu.action_menu_main, menu) + return true + } + + override fun initView() { + with(binding.mainToolbar) { + if (SDK_INT >= LOLLIPOP) stateListAnimator = null + setBackgroundColor(overlayProvider.compositeOverlayWithThemeSurfaceColorIfNeeded(dpToPx(4f))) + } + + with(binding.mainBottomNav) { + addItems(listOf( + AHBottomNavigationItem(R.string.grade_title, R.drawable.ic_main_grade, 0), + AHBottomNavigationItem(R.string.attendance_title, R.drawable.ic_main_attendance, 0), + AHBottomNavigationItem(R.string.exam_title, R.drawable.ic_main_exam, 0), + AHBottomNavigationItem(R.string.timetable_title, R.drawable.ic_main_timetable, 0), + AHBottomNavigationItem(R.string.more_title, R.drawable.ic_main_more, 0) + )) + accentColor = getThemeAttrColor(R.attr.colorPrimary) + inactiveColor = getThemeAttrColor(R.attr.colorOnSurface, 153) + defaultBackgroundColor = overlayProvider.compositeOverlayWithThemeSurfaceColorIfNeeded(dpToPx(8f)) + titleState = ALWAYS_SHOW + currentItem = startMenuIndex + isBehaviorTranslationEnabled = false + setTitleTextSizeInSp(10f, 10f) + setOnTabSelectedListener(presenter::onTabSelected) + } + + with(navController) { + setOnViewChangeListener(presenter::onViewChange) + fragmentHideStrategy = HIDE + rootFragments = listOf( + GradeFragment.newInstance(), + AttendanceFragment.newInstance(), + ExamFragment.newInstance(), + TimetableFragment.newInstance(), + MoreFragment.newInstance() + ) + } + } + + override fun setCurrentScreen(name: String?) { + analytics.setCurrentScreen(this, name) + } + + override fun onOptionsItemSelected(item: MenuItem?): Boolean { + return if (item?.itemId == R.id.mainMenuAccount) presenter.onAccountManagerSelected() + else false + } + + override fun onSupportNavigateUp(): Boolean { + return presenter.onUpNavigate() + } + + override fun switchMenuView(position: Int) { + navController.switchTab(position) + } + + override fun setViewTitle(title: String) { + supportActionBar?.title = title + } + + override fun setViewSubTitle(subtitle: String?) { + supportActionBar?.subtitle = subtitle + } + + override fun showHomeArrow(show: Boolean) { + supportActionBar?.setDisplayHomeAsUpEnabled(show) + } + + override fun showAccountPicker() { + navController.showDialogFragment(AccountDialog.newInstance()) + } + + override fun showActionBarElevation(show: Boolean) { + ViewCompat.setElevation(binding.mainToolbar, if (show) dpToPx(4f) else 0f) + } + + override fun notifyMenuViewReselected() { + (navController.currentStack?.getOrNull(0) as? MainView.MainChildView)?.onFragmentReselected() + } + + override fun notifyMenuViewChanged() { + Timber.d("Menu view changed") + (navController.currentStack?.getOrNull(0) as? MainView.MainChildView)?.onFragmentChanged() + } + + fun showDialogFragment(dialog: DialogFragment) { + navController.showDialogFragment(dialog) + } + + fun pushView(fragment: Fragment) { + navController.pushFragment(fragment) + } + + override fun popView(depth: Int) { + navController.safelyPopFragments(depth) + } + + override fun onBackPressed() { + presenter.onBackPressed { super.onBackPressed() } + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + navController.onSaveInstanceState(outState) + intent.removeExtra(EXTRA_START_MENU) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/main/MainPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/main/MainPresenter.kt new file mode 100644 index 00000000..8d5c9d67 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/main/MainPresenter.kt @@ -0,0 +1,92 @@ +package io.github.wulkanowy.ui.modules.main + +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.services.sync.SyncManager +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.ui.modules.main.MainView.Section.GRADE +import io.github.wulkanowy.ui.modules.main.MainView.Section.MESSAGE +import io.github.wulkanowy.ui.modules.main.MainView.Section.SCHOOL +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import timber.log.Timber +import javax.inject.Inject + +class MainPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val prefRepository: PreferencesRepository, + private val syncManager: SyncManager, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + fun onAttachView(view: MainView, initMenu: MainView.Section?) { + super.onAttachView(view) + view.apply { + getProperViewIndexes(initMenu).let { (main, more) -> + startMenuIndex = main + startMenuMoreIndex = more + } + initView() + Timber.i("Main view was initialized with $startMenuIndex menu index and $startMenuMoreIndex more index") + } + + syncManager.startPeriodicSyncWorker() + analytics.logEvent("app_open", "destination" to initMenu?.name) + } + + fun onViewChange(section: MainView.Section?, name: String?) { + view?.apply { + setCurrentScreen(name) + showActionBarElevation(section != GRADE && section != MESSAGE && section != SCHOOL) + currentViewTitle?.let { setViewTitle(it) } + currentViewSubtitle?.let { setViewSubTitle(it.ifBlank { null }) } + currentStackSize?.let { + if (it > 1) showHomeArrow(true) + else showHomeArrow(false) + } + } + } + + fun onAccountManagerSelected(): Boolean { + Timber.i("Select account manager") + view?.showAccountPicker() + return true + } + + fun onUpNavigate(): Boolean { + Timber.i("Up navigate pressed") + view?.popView() + return true + } + + fun onBackPressed(default: () -> Unit) { + Timber.i("Back pressed in main view") + view?.run { + if (isRootView) default() + else popView() + } + } + + fun onTabSelected(index: Int, wasSelected: Boolean): Boolean { + return view?.run { + Timber.i("Switch main tab index: $index, reselected: $wasSelected") + if (wasSelected) { + notifyMenuViewReselected() + false + } else { + notifyMenuViewChanged() + switchMenuView(index) + true + } + } == true + } + + private fun getProperViewIndexes(initMenu: MainView.Section?): Pair { + return when (initMenu?.id) { + in 0..3 -> initMenu!!.id to -1 + in 4..10 -> 4 to initMenu!!.id + else -> prefRepository.startMenuIndex to -1 + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/main/MainView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/main/MainView.kt new file mode 100644 index 00000000..7e583147 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/main/MainView.kt @@ -0,0 +1,71 @@ +package io.github.wulkanowy.ui.modules.main + +import io.github.wulkanowy.ui.base.BaseView + +interface MainView : BaseView { + + var startMenuIndex: Int + + var startMenuMoreIndex: Int + + val isRootView: Boolean + + val currentViewTitle: String? + + val currentViewSubtitle: String? + + val currentStackSize: Int? + + fun initView() + + fun switchMenuView(position: Int) + + fun showHomeArrow(show: Boolean) + + fun showAccountPicker() + + fun setCurrentScreen(name: String?) + + fun showActionBarElevation(show: Boolean) + + fun notifyMenuViewReselected() + + fun notifyMenuViewChanged() + + fun setViewTitle(title: String) + + fun setViewSubTitle(subtitle: String?) + + fun popView(depth: Int = 1) + + interface MainChildView { + + fun onFragmentReselected() + + fun onFragmentChanged() {} + } + + interface TitledView { + + val titleStringId: Int + + var subtitleString: String + get() = "" + set(_) {} + } + + enum class Section(val id: Int) { + GRADE(0), + ATTENDANCE(1), + EXAM(2), + TIMETABLE(3), + MORE(4), + MESSAGE(5), + HOMEWORK(6), + NOTE(7), + LUCKY_NUMBER(8), + SETTINGS(9), + ABOUT(10), + SCHOOL(11) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/MessageFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/MessageFragment.kt new file mode 100644 index 00000000..16e0184a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/MessageFragment.kt @@ -0,0 +1,100 @@ +package io.github.wulkanowy.ui.modules.message + +import android.os.Bundle +import android.view.View +import android.view.View.INVISIBLE +import android.view.View.VISIBLE +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.repositories.message.MessageFolder.RECEIVED +import io.github.wulkanowy.data.repositories.message.MessageFolder.SENT +import io.github.wulkanowy.data.repositories.message.MessageFolder.TRASHED +import io.github.wulkanowy.databinding.FragmentMessageBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.base.BaseFragmentPagerAdapter +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.modules.message.send.SendMessageActivity +import io.github.wulkanowy.ui.modules.message.tab.MessageTabFragment +import io.github.wulkanowy.utils.dpToPx +import io.github.wulkanowy.utils.setOnSelectPageListener +import javax.inject.Inject + +@AndroidEntryPoint +class MessageFragment : BaseFragment(R.layout.fragment_message), + MessageView, MainView.TitledView { + + @Inject + lateinit var presenter: MessagePresenter + + private val pagerAdapter by lazy { BaseFragmentPagerAdapter(childFragmentManager) } + + companion object { + fun newInstance() = MessageFragment() + } + + override val titleStringId get() = R.string.message_title + + override val currentPageIndex get() = binding.messageViewPager.currentItem + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentMessageBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + with(pagerAdapter) { + containerId = binding.messageViewPager.id + addFragmentsWithTitle(mapOf( + MessageTabFragment.newInstance(RECEIVED) to getString(R.string.message_inbox), + MessageTabFragment.newInstance(SENT) to getString(R.string.message_sent), + MessageTabFragment.newInstance(TRASHED) to getString(R.string.message_trash) + )) + } + + with(binding.messageViewPager) { + adapter = pagerAdapter + offscreenPageLimit = 2 + setOnSelectPageListener(presenter::onPageSelected) + } + + with(binding.messageTabLayout) { + setupWithViewPager(binding.messageViewPager) + setElevationCompat(context.dpToPx(4f)) + } + + binding.openSendMessageButton.setOnClickListener { presenter.onSendMessageButtonClicked() } + } + + override fun showContent(show: Boolean) { + with(binding) { + messageViewPager.visibility = if (show) VISIBLE else INVISIBLE + messageTabLayout.visibility = if (show) VISIBLE else INVISIBLE + } + } + + override fun showProgress(show: Boolean) { + binding.messageProgress.visibility = if (show) VISIBLE else INVISIBLE + } + + fun onChildFragmentLoaded() { + presenter.onChildViewLoaded() + } + + override fun notifyChildMessageDeleted(tabId: Int) { + (pagerAdapter.getFragmentInstance(tabId) as? MessageTabFragment)?.onParentDeleteMessage() + } + + override fun notifyChildLoadData(index: Int, forceRefresh: Boolean) { + (pagerAdapter.getFragmentInstance(index) as? MessageTabFragment)?.onParentLoadData(forceRefresh) + } + + override fun openSendMessage() { + context?.let { it.startActivity(SendMessageActivity.getStartIntent(it)) } + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/MessagePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/MessagePresenter.kt new file mode 100644 index 00000000..0fb454b3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/MessagePresenter.kt @@ -0,0 +1,49 @@ +package io.github.wulkanowy.ui.modules.message + +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import kotlinx.coroutines.delay +import kotlinx.coroutines.launch +import timber.log.Timber +import javax.inject.Inject + +class MessagePresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: MessageView) { + super.onAttachView(view) + launch { + delay(150) + view.initView() + Timber.i("Message view was initialized") + loadData() + } + } + + fun onPageSelected(index: Int) { + loadChild(index) + } + + private fun loadData() { + view?.run { loadChild(currentPageIndex) } + } + + private fun loadChild(index: Int, forceRefresh: Boolean = false) { + Timber.i("Load message child view index: $index") + view?.notifyChildLoadData(index, forceRefresh) + } + + fun onChildViewLoaded() { + view?.apply { + showContent(true) + showProgress(false) + } + } + + fun onSendMessageButtonClicked() { + view?.openSendMessage() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/MessageView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/MessageView.kt new file mode 100644 index 00000000..2aa4d78e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/MessageView.kt @@ -0,0 +1,20 @@ +package io.github.wulkanowy.ui.modules.message + +import io.github.wulkanowy.ui.base.BaseView + +interface MessageView : BaseView { + + val currentPageIndex: Int + + fun initView() + + fun showContent(show: Boolean) + + fun showProgress(show: Boolean) + + fun notifyChildLoadData(index: Int, forceRefresh: Boolean) + + fun notifyChildMessageDeleted(tabId: Int) + + fun openSendMessage() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewAdapter.kt new file mode 100644 index 00000000..206a7460 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewAdapter.kt @@ -0,0 +1,91 @@ +package io.github.wulkanowy.ui.modules.message.preview + +import android.annotation.SuppressLint +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.MessageAttachment +import io.github.wulkanowy.data.db.entities.MessageWithAttachment +import io.github.wulkanowy.databinding.ItemMessageAttachmentBinding +import io.github.wulkanowy.databinding.ItemMessageDividerBinding +import io.github.wulkanowy.databinding.ItemMessagePreviewBinding +import io.github.wulkanowy.utils.openInternetBrowser +import io.github.wulkanowy.utils.toFormattedString +import javax.inject.Inject + +class MessagePreviewAdapter @Inject constructor() : + RecyclerView.Adapter() { + + enum class ViewType(val id: Int) { + MESSAGE(1), + DIVIDER(2), + ATTACHMENT(3) + } + + var messageWithAttachment: MessageWithAttachment? = null + set(value) { + field = value + attachments = value?.attachments.orEmpty() + } + + private var attachments: List = emptyList() + + override fun getItemCount() = if (messageWithAttachment == null) 0 else attachments.size + 1 + if (attachments.isNotEmpty()) 1 else 0 + + override fun getItemViewType(position: Int) = when (position) { + 0 -> ViewType.MESSAGE.id + 1 -> ViewType.DIVIDER.id + else -> ViewType.ATTACHMENT.id + } + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + + return when (viewType) { + ViewType.MESSAGE.id -> MessageViewHolder(ItemMessagePreviewBinding.inflate(inflater, parent, false)) + ViewType.DIVIDER.id -> DividerViewHolder(ItemMessageDividerBinding.inflate(inflater, parent, false)) + ViewType.ATTACHMENT.id -> AttachmentViewHolder(ItemMessageAttachmentBinding.inflate(inflater, parent, false)) + else -> throw IllegalStateException() + } + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + when (holder) { + is MessageViewHolder -> bindMessage(holder, requireNotNull(messageWithAttachment).message) + is AttachmentViewHolder -> bindAttachment(holder, requireNotNull(messageWithAttachment).attachments[position - 2]) + } + } + + @SuppressLint("SetTextI18n") + private fun bindMessage(holder: MessageViewHolder, message: Message) { + with(holder.binding) { + messagePreviewSubject.text = message.subject.ifBlank { root.context.getString(R.string.message_no_subject) } + messagePreviewDate.text = root.context.getString(R.string.message_date, message.date.toFormattedString("yyyy-MM-dd HH:mm:ss")) + messagePreviewContent.text = message.content + messagePreviewFromSender.text = message.sender + messagePreviewToRecipient.text = message.recipient + } + } + + private fun bindAttachment(holder: AttachmentViewHolder, attachment: MessageAttachment) { + with(holder.binding) { + messagePreviewAttachment.visibility = View.VISIBLE + messagePreviewAttachment.text = attachment.filename + root.setOnClickListener { + root.context.openInternetBrowser(attachment.url) { } + } + } + } + + class MessageViewHolder(val binding: ItemMessagePreviewBinding) : + RecyclerView.ViewHolder(binding.root) + + class DividerViewHolder(val binding: ItemMessageDividerBinding) : + RecyclerView.ViewHolder(binding.root) + + class AttachmentViewHolder(val binding: ItemMessageAttachmentBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewFragment.kt new file mode 100644 index 00000000..740f4927 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewFragment.kt @@ -0,0 +1,216 @@ +package io.github.wulkanowy.ui.modules.message.preview + +import android.os.Build +import android.os.Bundle +import android.print.PrintAttributes +import android.print.PrintManager +import android.view.Menu +import android.view.MenuInflater +import android.view.MenuItem +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import android.webkit.WebResourceRequest +import android.webkit.WebView +import android.webkit.WebViewClient +import androidx.annotation.RequiresApi +import androidx.core.content.getSystemService +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.MessageWithAttachment +import io.github.wulkanowy.databinding.FragmentMessagePreviewBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.modules.message.send.SendMessageActivity +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.shareText +import javax.inject.Inject + +@AndroidEntryPoint +class MessagePreviewFragment : + BaseFragment(R.layout.fragment_message_preview), + MessagePreviewView, MainView.TitledView { + + @Inject + lateinit var presenter: MessagePreviewPresenter + + @Inject + lateinit var previewAdapter: MessagePreviewAdapter + + @Inject + lateinit var appInfo: AppInfo + + private var menuReplyButton: MenuItem? = null + + private var menuForwardButton: MenuItem? = null + + private var menuDeleteButton: MenuItem? = null + + private var menuShareButton: MenuItem? = null + + private var menuPrintButton: MenuItem? = null + + override val titleStringId: Int + get() = R.string.message_title + + override val deleteMessageSuccessString: String + get() = getString(R.string.message_delete_success) + + override val messageNoSubjectString: String + get() = getString(R.string.message_no_subject) + + override val printHTML: String + get() = requireContext().assets.open("message-print-page.html").bufferedReader().use { it.readText() } + + companion object { + const val MESSAGE_ID_KEY = "message_id" + + fun newInstance(message: Message): MessagePreviewFragment { + return MessagePreviewFragment().apply { + arguments = Bundle().apply { putSerializable(MESSAGE_ID_KEY, message) } + } + } + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setHasOptionsMenu(true) + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentMessagePreviewBinding.bind(view) + messageContainer = binding.messagePreviewContainer + presenter.onAttachView(this, (savedInstanceState ?: arguments)?.getSerializable(MESSAGE_ID_KEY) as? Message) + } + + override fun initView() { + binding.messagePreviewErrorDetails.setOnClickListener { presenter.onDetailsClick() } + + with(binding.messagePreviewRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = previewAdapter + } + } + + override fun onCreateOptionsMenu(menu: Menu, inflater: MenuInflater) { + inflater.inflate(R.menu.action_menu_message_preview, menu) + menuReplyButton = menu.findItem(R.id.messagePreviewMenuReply) + menuForwardButton = menu.findItem(R.id.messagePreviewMenuForward) + menuDeleteButton = menu.findItem(R.id.messagePreviewMenuDelete) + menuShareButton = menu.findItem(R.id.messagePreviewMenuShare) + menuPrintButton = menu.findItem(R.id.messagePreviewMenuPrint) + presenter.onCreateOptionsMenu() + } + + override fun onOptionsItemSelected(item: MenuItem): Boolean { + return when (item.itemId) { + R.id.messagePreviewMenuReply -> presenter.onReply() + R.id.messagePreviewMenuForward -> presenter.onForward() + R.id.messagePreviewMenuDelete -> presenter.onMessageDelete() + R.id.messagePreviewMenuShare -> presenter.onShare() + R.id.messagePreviewMenuPrint -> presenter.onPrint() + else -> false + } + } + + override fun setMessageWithAttachment(item: MessageWithAttachment) { + with(previewAdapter) { + messageWithAttachment = item + notifyDataSetChanged() + } + } + + override fun showProgress(show: Boolean) { + binding.messagePreviewProgress.visibility = if (show) VISIBLE else GONE + } + + override fun showContent(show: Boolean) { + binding.messagePreviewRecycler.visibility = if (show) VISIBLE else GONE + } + + override fun showOptions(show: Boolean) { + menuReplyButton?.isVisible = show + menuForwardButton?.isVisible = show + menuDeleteButton?.isVisible = show + menuShareButton?.isVisible = show + menuPrintButton?.isVisible = show && appInfo.systemVersion >= Build.VERSION_CODES.LOLLIPOP + } + + override fun setDeletedOptionsLabels() { + menuDeleteButton?.setTitle(R.string.message_delete_forever) + } + + override fun setNotDeletedOptionsLabels() { + menuDeleteButton?.setTitle(R.string.message_move_to_bin) + } + + override fun showErrorView(show: Boolean) { + binding.messagePreviewError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.messagePreviewErrorMessage.text = message + } + + override fun setErrorRetryCallback(callback: () -> Unit) { + binding.messagePreviewErrorRetry.setOnClickListener { callback() } + } + + override fun openMessageReply(message: Message?) { + context?.let { it.startActivity(SendMessageActivity.getStartIntent(it, message, true)) } + } + + override fun openMessageForward(message: Message?) { + context?.let { it.startActivity(SendMessageActivity.getStartIntent(it, message)) } + } + + override fun shareText(text: String, subject: String) { + context?.shareText(text, subject) + } + + @RequiresApi(Build.VERSION_CODES.LOLLIPOP) + override fun printDocument(html: String, jobName: String) { + val webView = WebView(activity) + webView.webViewClient = object : WebViewClient() { + + override fun shouldOverrideUrlLoading(view: WebView, request: WebResourceRequest) = false + + override fun onPageFinished(view: WebView, url: String) { + createWebPrintJob(view, jobName) + } + } + + webView.loadDataWithBaseURL("file:///android_asset/", html, "text/HTML", "UTF-8", null) + } + + @RequiresApi(Build.VERSION_CODES.LOLLIPOP) + private fun createWebPrintJob(webView: WebView, jobName: String) { + activity?.getSystemService()?.let { printManager -> + val printAdapter = webView.createPrintDocumentAdapter(jobName) + + printManager.print( + jobName, + printAdapter, + PrintAttributes.Builder().build() + ) + } + } + + override fun popView() { + (activity as MainActivity).popView() + } + + override fun onSaveInstanceState(outState: Bundle) { + outState.putSerializable(MESSAGE_ID_KEY, presenter.message) + super.onSaveInstanceState(outState) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewPresenter.kt new file mode 100644 index 00000000..d261d1ee --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewPresenter.kt @@ -0,0 +1,223 @@ +package io.github.wulkanowy.ui.modules.message.preview + +import android.annotation.SuppressLint +import android.os.Build +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.MessageAttachment +import io.github.wulkanowy.data.repositories.message.MessageFolder +import io.github.wulkanowy.data.repositories.message.MessageRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.flowWithResourceIn +import io.github.wulkanowy.utils.toFormattedString +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class MessagePreviewPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val messageRepository: MessageRepository, + private val analytics: FirebaseAnalyticsHelper, + private var appInfo: AppInfo +) : BasePresenter(errorHandler, studentRepository) { + + var message: Message? = null + + var attachments: List? = null + + private lateinit var lastError: Throwable + + private var retryCallback: () -> Unit = {} + + fun onAttachView(view: MessagePreviewView, message: Message?) { + super.onAttachView(view) + view.initView() + errorHandler.showErrorMessage = ::showErrorViewOnError + this.message = message + loadData(requireNotNull(message)) + } + + private fun onMessageLoadRetry(message: Message) { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(message) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + private fun loadData(message: Message) { + flowWithResourceIn { + val student = studentRepository.getStudentById(message.studentId) + messageRepository.getMessage(student, message, true) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading message ${message.messageId} preview started") + Status.SUCCESS -> { + Timber.i("Loading message ${it.data!!.message.messageId} preview result: Success ") + this@MessagePreviewPresenter.message = it.data.message + this@MessagePreviewPresenter.attachments = it.data.attachments + view?.apply { + setMessageWithAttachment(it.data) + initOptions() + } + analytics.logEvent( + "load_item", + "type" to "message_preview", + "length" to it.data.message.content.length + ) + } + Status.ERROR -> { + Timber.i("Loading message ${message.messageId} preview result: An exception occurred ") + retryCallback = { onMessageLoadRetry(message) } + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.showProgress(false) + }.launch() + } + + fun onReply(): Boolean { + return if (message != null) { + view?.openMessageReply(message) + true + } else false + } + + fun onForward(): Boolean { + return if (message != null) { + view?.openMessageForward(message) + true + } else false + } + + fun onShare(): Boolean { + message?.let { + var text = "Temat: ${it.subject.ifBlank { view?.messageNoSubjectString.orEmpty() }}\n" + when (it.sender.isNotEmpty()) { + true -> "Od: ${it.sender}\n" + false -> "Do: ${it.recipient}\n" + } + "Data: ${it.date.toFormattedString("yyyy-MM-dd HH:mm:ss")}\n\n${it.content}" + + attachments?.let { attachments -> + if (attachments.isNotEmpty()) { + text += "\n\nZałączniki:" + + attachments.forEach { attachment -> + text += "\n${attachment.filename}: ${attachment.url}" + } + } + } + + view?.shareText(text, "FW: ${it.subject.ifBlank { view?.messageNoSubjectString.orEmpty() }}") + return true + } + return false + } + + @SuppressLint("NewApi") + fun onPrint(): Boolean { + if (appInfo.systemVersion < Build.VERSION_CODES.LOLLIPOP) return false + message?.let { + val dateString = it.date.toFormattedString("yyyy-MM-dd HH:mm:ss") + val infoContent = "

Data wysłania

$dateString
" + when { + it.sender.isNotEmpty() -> "

Od

${it.sender}
" + else -> "

Do

${it.recipient}
" + } + + val messageContent = "

${it.content}

" + .replace(Regex("[\\n\\r]{2,}"), "

") + .replace(Regex("[\\n\\r]"), "
") + + val jobName = "Wiadomość " + when { + it.sender.isNotEmpty() -> "od ${it.sender}" + else -> "do ${it.recipient}" + } + " $dateString: ${it.subject.ifBlank { view?.messageNoSubjectString.orEmpty() }} | Wulkanowy" + + view?.apply { + val html = printHTML + .replace("%SUBJECT%", it.subject.ifBlank { view?.messageNoSubjectString.orEmpty() }) + .replace("%CONTENT%", messageContent) + .replace("%INFO%", infoContent) + printDocument(html, jobName) + } + return true + } + return false + } + + private fun deleteMessage() { + message ?: return + + view?.run { + showContent(false) + showProgress(true) + showOptions(false) + showErrorView(false) + } + + flowWithResource { + val student = studentRepository.getCurrentStudent() + messageRepository.deleteMessage(student, message!!) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.d("Message ${message?.id} delete started") + Status.SUCCESS -> { + Timber.d("Message ${message?.id} delete success") + view?.run { + showMessage(deleteMessageSuccessString) + popView() + } + } + Status.ERROR -> { + Timber.d("Message ${message?.id} delete failed") + retryCallback = { onMessageDelete() } + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.showProgress(false) + }.launch("delete") + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + lastError = error + setErrorDetails(message) + showErrorView(true) + setErrorRetryCallback { retryCallback() } + } + } + + fun onMessageDelete(): Boolean { + deleteMessage() + return true + } + + private fun initOptions() { + view?.apply { + showOptions(message != null) + message?.let { + when (it.folderId == MessageFolder.TRASHED.id) { + true -> setDeletedOptionsLabels() + false -> setNotDeletedOptionsLabels() + } + } + + } + } + + fun onCreateOptionsMenu() { + initOptions() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewView.kt new file mode 100644 index 00000000..fa6d735e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/preview/MessagePreviewView.kt @@ -0,0 +1,47 @@ +package io.github.wulkanowy.ui.modules.message.preview + +import android.os.Build +import androidx.annotation.RequiresApi +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.MessageWithAttachment +import io.github.wulkanowy.ui.base.BaseView + +interface MessagePreviewView : BaseView { + + val deleteMessageSuccessString: String + + val messageNoSubjectString: String + + val printHTML: String + + fun initView() + + fun setMessageWithAttachment(item: MessageWithAttachment) + + fun showProgress(show: Boolean) + + fun showContent(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun setErrorRetryCallback(callback: () -> Unit) + + fun showOptions(show: Boolean) + + fun setDeletedOptionsLabels() + + fun setNotDeletedOptionsLabels() + + fun openMessageReply(message: Message?) + + fun openMessageForward(message: Message?) + + fun shareText(text: String, subject: String) + + @RequiresApi(Build.VERSION_CODES.LOLLIPOP) + fun printDocument(html: String, jobName: String) + + fun popView() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/RecipientChipItem.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/RecipientChipItem.kt new file mode 100644 index 00000000..dd2d2b9b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/RecipientChipItem.kt @@ -0,0 +1,14 @@ +package io.github.wulkanowy.ui.modules.message.send + +import io.github.wulkanowy.data.db.entities.Recipient +import io.github.wulkanowy.materialchipsinput.ChipItem + +data class RecipientChipItem( + + override val title: String, + + override val summary: String, + + val recipient: Recipient + +) : ChipItem diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/SendMessageActivity.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/SendMessageActivity.kt new file mode 100644 index 00000000..2267279c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/SendMessageActivity.kt @@ -0,0 +1,182 @@ +package io.github.wulkanowy.ui.modules.message.send + +import android.content.Context +import android.content.Intent +import android.graphics.Rect +import android.os.Bundle +import android.view.Menu +import android.view.MenuItem +import android.view.TouchDelegate +import android.view.View.GONE +import android.view.View.VISIBLE +import android.widget.Toast +import android.widget.Toast.LENGTH_LONG +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.ReportingUnit +import io.github.wulkanowy.databinding.ActivitySendMessageBinding +import io.github.wulkanowy.ui.base.BaseActivity +import io.github.wulkanowy.utils.dpToPx +import io.github.wulkanowy.utils.hideSoftInput +import io.github.wulkanowy.utils.showSoftInput +import javax.inject.Inject + +@AndroidEntryPoint +class SendMessageActivity : BaseActivity(), SendMessageView { + + @Inject + override lateinit var presenter: SendMessagePresenter + + companion object { + private const val EXTRA_MESSAGE = "EXTRA_MESSAGE" + + private const val EXTRA_REPLY = "EXTRA_REPLY" + + fun getStartIntent(context: Context) = Intent(context, SendMessageActivity::class.java) + + fun getStartIntent(context: Context, message: Message?, reply: Boolean = false): Intent { + return getStartIntent(context) + .putExtra(EXTRA_MESSAGE, message) + .putExtra(EXTRA_REPLY, reply) + } + } + + override val isDropdownListVisible: Boolean + get() = binding.sendMessageTo.isDropdownListVisible + + @Suppress("UNCHECKED_CAST") + override val formRecipientsData: List + get() = binding.sendMessageTo.addedChipItems as List + + override val formSubjectValue: String + get() = binding.sendMessageSubject.text.toString() + + override val formContentValue: String + get() = binding.sendMessageMessageContent.text.toString() + + override val messageRequiredRecipients: String + get() = getString(R.string.message_required_recipients) + + override val messageContentMinLength: String + get() = getString(R.string.message_content_min_length) + + override val messageSuccess: String + get() = getString(R.string.message_send_successful) + + public override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setContentView(ActivitySendMessageBinding.inflate(layoutInflater).apply { binding = this }.root) + setSupportActionBar(binding.sendMessageToolbar) + supportActionBar?.setDisplayHomeAsUpEnabled(true) + messageContainer = binding.sendMessageContainer + + presenter.onAttachView(this, intent.getSerializableExtra(EXTRA_MESSAGE) as? Message, intent.getSerializableExtra(EXTRA_REPLY) as? Boolean) + } + + override fun initView() { + setUpExtendedHitArea() + with(binding) { + sendMessageScroll.setOnTouchListener { _, _ -> presenter.onTouchScroll() } + sendMessageTo.onTextChangeListener = presenter::onRecipientsTextChange + } + } + + override fun onCreateOptionsMenu(menu: Menu?): Boolean { + menuInflater.inflate(R.menu.action_menu_send_message, menu) + return true + } + + override fun onOptionsItemSelected(item: MenuItem?): Boolean { + return if (item?.itemId == R.id.sendMessageMenuSend) presenter.onSend() + else false + } + + override fun onSupportNavigateUp(): Boolean { + return presenter.onUpNavigate() + } + + override fun setReportingUnit(unit: ReportingUnit) { + binding.sendMessageFrom.text = unit.senderName + } + + override fun setRecipients(recipients: List) { + binding.sendMessageTo.filterableChipItems = recipients + } + + override fun setSelectedRecipients(recipients: List) { + binding.sendMessageTo.addChips(recipients) + } + + override fun showProgress(show: Boolean) { + binding.sendMessageProgress.visibility = if (show) VISIBLE else GONE + } + + override fun showContent(show: Boolean) { + binding.sendMessageContent.visibility = if (show) VISIBLE else GONE + } + + override fun showEmpty(show: Boolean) { + binding.sendMessageEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showActionBar(show: Boolean) { + supportActionBar?.apply { if (show) show() else hide() } + } + + override fun setSubject(subject: String) { + binding.sendMessageSubject.setText(subject) + } + + override fun setContent(content: String) { + binding.sendMessageMessageContent.setText(content) + } + + override fun showMessage(text: String) { + Toast.makeText(this, text, LENGTH_LONG).show() + } + + override fun showSoftInput(show: Boolean) { + if (show) showSoftInput() else hideSoftInput() + } + + override fun hideDropdownList() { + binding.sendMessageTo.hideDropdownList() + } + + override fun scrollToRecipients() { + with(binding.sendMessageScroll) { + post { + scrollTo(0, binding.sendMessageTo.bottom - dpToPx(53f).toInt()) + } + } + } + + override fun popView() { + finish() + } + + private fun setUpExtendedHitArea() { + fun extendHitArea() { + val containerHitRect = Rect().apply { + binding.sendMessageContent.getHitRect(this) + } + + val contentHitRect = Rect().apply { + binding.sendMessageMessageContent.getHitRect(this) + } + + contentHitRect.top = contentHitRect.bottom + contentHitRect.bottom = containerHitRect.bottom + + binding.sendMessageContent.touchDelegate = TouchDelegate(contentHitRect, binding.sendMessageMessageContent) + } + + with(binding.sendMessageMessageContent) { + post { + addOnLayoutChangeListener { _, _, _, _, _, _, _, _, _ -> extendHitArea() } + extendHitArea() + } + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/SendMessagePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/SendMessagePresenter.kt new file mode 100644 index 00000000..f877c809 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/SendMessagePresenter.kt @@ -0,0 +1,206 @@ +package io.github.wulkanowy.ui.modules.message.send + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.db.entities.Recipient +import io.github.wulkanowy.data.repositories.message.MessageRepository +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.recipient.RecipientRepository +import io.github.wulkanowy.data.repositories.reportingunit.ReportingUnitRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.toFormattedString +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class SendMessagePresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val semesterRepository: SemesterRepository, + private val messageRepository: MessageRepository, + private val reportingUnitRepository: ReportingUnitRepository, + private val recipientRepository: RecipientRepository, + private val preferencesRepository: PreferencesRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + fun onAttachView(view: SendMessageView, message: Message?, reply: Boolean?) { + super.onAttachView(view) + view.initView() + Timber.i("Send message view was initialized") + loadData(message, reply) + with(view) { + message?.let { + setSubject(when (reply) { + true -> "RE: " + else -> "FW: " + } + message.subject) + if (preferencesRepository.fillMessageContent || reply != true) { + setContent( + when (reply) { + true -> "\n\n" + else -> "" + } + when (message.sender.isNotEmpty()) { + true -> "Od: ${message.sender}\n" + false -> "Do: ${message.recipient}\n" + } + "Data: ${message.date.toFormattedString("yyyy-MM-dd HH:mm:ss")}\n\n${message.content}") + } + } + } + } + + fun onTouchScroll(): Boolean { + return view?.run { + if (isDropdownListVisible) { + hideDropdownList() + true + } else false + } == true + } + + fun onRecipientsTextChange(text: String) { + if (text.isBlank()) return + view?.scrollToRecipients() + } + + fun onUpNavigate(): Boolean { + view?.popView() + return true + } + + fun onSend(): Boolean { + view?.run { + when { + formRecipientsData.isEmpty() -> showMessage(messageRequiredRecipients) + formContentValue.length < 3 -> showMessage(messageContentMinLength) + else -> { + sendMessage( + subject = formSubjectValue, + content = formContentValue, + recipients = formRecipientsData.map { it.recipient } + ) + return true + } + } + } + return false + } + + private fun loadData(message: Message?, reply: Boolean?) { + flowWithResource { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + val unit = reportingUnitRepository.getReportingUnit(student, semester.unitId) + + Timber.i("Loading recipients started") + val recipients = when { + unit != null -> recipientRepository.getRecipients(student, 2, unit) + else -> listOf() + }.let { createChips(it) } + Timber.i("Loading recipients result: Success, fetched %d recipients", recipients.size) + + Timber.i("Loading message recipients started") + val messageRecipients = when { + message != null && reply == true -> recipientRepository.getMessageRecipients(student, message) + else -> emptyList() + }.let { createChips(it) } + Timber.i("Loaded message recipients to reply result: Success, fetched %d recipients", messageRecipients.size) + + Triple(unit, recipients, messageRecipients) + }.onEach { + when (it.status) { + Status.LOADING -> view?.run { + Timber.i("Loading recipients started") + showProgress(true) + showContent(false) + } + Status.SUCCESS -> it.data!!.let { (reportingUnit, recipientChips, selectedRecipientChips) -> + view?.run { + if (reportingUnit != null) { + setReportingUnit(reportingUnit) + setRecipients(recipientChips) + if (selectedRecipientChips.isNotEmpty()) setSelectedRecipients(selectedRecipientChips) + showContent(true) + } else { + Timber.i("Loading recipients result: Can't find the reporting unit") + view?.showEmpty(true) + } + } + } + Status.ERROR -> { + Timber.i("Loading recipients result: An exception occurred") + view?.showContent(true) + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { showProgress(false) } + }.launch() + } + + private fun sendMessage(subject: String, content: String, recipients: List) { + flowWithResource { + val student = studentRepository.getCurrentStudent() + messageRepository.sendMessage(student, subject, content, recipients) + }.onEach { + when (it.status) { + Status.LOADING -> view?.run { + Timber.i("Sending message started") + showSoftInput(false) + showContent(false) + showProgress(true) + showActionBar(false) + } + Status.SUCCESS -> { + Timber.i("Sending message result: Success") + view?.run { + showMessage(messageSuccess) + popView() + } + analytics.logEvent("send_message", "recipients" to recipients.size) + } + Status.ERROR -> { + Timber.i("Sending message result: An exception occurred") + view?.run { + showContent(true) + showProgress(false) + showActionBar(true) + } + errorHandler.dispatch(it.error!!) + } + } + }.launch("send") + } + + private fun createChips(recipients: List): List { + fun generateCorrectSummary(recipientRealName: String): String { + val substring = recipientRealName.substringBeforeLast("-") + return when { + substring == recipientRealName -> recipientRealName + substring.indexOf("(") != -1 -> { + recipientRealName.indexOf("(") + .let { recipientRealName.substring(if (it != -1) it else 0) } + } + substring.indexOf("[") != -1 -> { + recipientRealName.indexOf("[") + .let { recipientRealName.substring(if (it != -1) it else 0) } + } + else -> recipientRealName.substringAfter("-") + }.trim() + } + + return recipients.map { + RecipientChipItem( + title = it.name, + summary = generateCorrectSummary(it.realName), + recipient = it + ) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/SendMessageView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/SendMessageView.kt new file mode 100644 index 00000000..2839f9ce --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/send/SendMessageView.kt @@ -0,0 +1,49 @@ +package io.github.wulkanowy.ui.modules.message.send + +import io.github.wulkanowy.data.db.entities.ReportingUnit +import io.github.wulkanowy.ui.base.BaseView + +interface SendMessageView : BaseView { + + val isDropdownListVisible: Boolean + + val formRecipientsData: List + + val formSubjectValue: String + + val formContentValue: String + + val messageRequiredRecipients: String + + val messageContentMinLength: String + + val messageSuccess: String + + fun initView() + + fun setReportingUnit(unit: ReportingUnit) + + fun setRecipients(recipients: List) + + fun setSelectedRecipients(recipients: List) + + fun showProgress(show: Boolean) + + fun showContent(show: Boolean) + + fun showEmpty(show: Boolean) + + fun showActionBar(show: Boolean) + + fun setSubject(subject: String) + + fun setContent(content: String) + + fun showSoftInput(show: Boolean) + + fun hideDropdownList() + + fun scrollToRecipients() + + fun popView() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabAdapter.kt new file mode 100644 index 00000000..e9b34da3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabAdapter.kt @@ -0,0 +1,81 @@ +package io.github.wulkanowy.ui.modules.message.tab + +import android.graphics.Typeface +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.recyclerview.widget.DiffUtil +import androidx.recyclerview.widget.RecyclerView +import androidx.recyclerview.widget.RecyclerView.NO_POSITION +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.repositories.message.MessageFolder +import io.github.wulkanowy.databinding.ItemMessageBinding +import io.github.wulkanowy.utils.toFormattedString +import javax.inject.Inject + +class MessageTabAdapter @Inject constructor() : + RecyclerView.Adapter() { + + var onClickListener: (Message, position: Int) -> Unit = { _, _ -> } + + var onChangesDetectedListener = {} + + private var items = mutableListOf() + + fun setDataItems(data: List) { + if (items.size != data.size) onChangesDetectedListener() + val diffResult = DiffUtil.calculateDiff(MessageTabDiffUtil(items, data)) + items = data.toMutableList() + diffResult.dispatchUpdatesTo(this) + } + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemMessageBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val item = items[position] + + with(holder.binding) { + val style = if (item.unread) Typeface.BOLD else Typeface.NORMAL + + messageItemAuthor.run { + text = if (item.folderId == MessageFolder.SENT.id) item.recipient else item.sender + setTypeface(null, style) + } + messageItemSubject.run { + text = if (item.subject.isNotBlank()) item.subject else context.getString(R.string.message_no_subject) + setTypeface(null, style) + } + messageItemDate.run { + text = item.date.toFormattedString() + setTypeface(null, style) + } + messageItemAttachmentIcon.visibility = if (item.hasAttachments) View.VISIBLE else View.GONE + + root.setOnClickListener { + holder.adapterPosition.let { if (it != NO_POSITION) onClickListener(item, it) } + } + } + } + + class ItemViewHolder(val binding: ItemMessageBinding) : RecyclerView.ViewHolder(binding.root) + + private class MessageTabDiffUtil(private val old: List, private val new: List) : + DiffUtil.Callback() { + override fun getOldListSize(): Int = old.size + + override fun getNewListSize(): Int = new.size + + override fun areItemsTheSame(oldItemPosition: Int, newItemPosition: Int): Boolean { + return old[oldItemPosition].id == new[newItemPosition].id + } + + override fun areContentsTheSame(oldItemPosition: Int, newItemPosition: Int): Boolean { + return old[oldItemPosition] == new[newItemPosition] + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabFragment.kt new file mode 100644 index 00000000..44ad4bf1 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabFragment.kt @@ -0,0 +1,160 @@ +package io.github.wulkanowy.ui.modules.message.tab + +import android.os.Bundle +import android.view.Menu +import android.view.MenuInflater +import android.view.View +import android.view.View.GONE +import android.view.View.INVISIBLE +import android.view.View.VISIBLE +import androidx.appcompat.widget.SearchView +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.repositories.message.MessageFolder +import io.github.wulkanowy.databinding.FragmentMessageTabBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.message.MessageFragment +import io.github.wulkanowy.ui.modules.message.preview.MessagePreviewFragment +import io.github.wulkanowy.ui.widgets.DividerItemDecoration +import kotlinx.coroutines.FlowPreview +import javax.inject.Inject + +@AndroidEntryPoint +class MessageTabFragment : BaseFragment(R.layout.fragment_message_tab), + MessageTabView { + + @Inject + lateinit var presenter: MessageTabPresenter + + @Inject + lateinit var tabAdapter: MessageTabAdapter + + companion object { + const val MESSAGE_TAB_FOLDER_ID = "message_tab_folder_id" + + fun newInstance(folder: MessageFolder): MessageTabFragment { + return MessageTabFragment().apply { + arguments = Bundle().apply { + putString(MESSAGE_TAB_FOLDER_ID, folder.name) + } + } + } + } + + override val isViewEmpty + get() = tabAdapter.itemCount == 0 + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setHasOptionsMenu(true) + } + + @FlowPreview + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentMessageTabBinding.bind(view) + messageContainer = binding.messageTabRecycler + presenter.onAttachView(this, MessageFolder.valueOf( + (savedInstanceState ?: arguments)?.getString(MESSAGE_TAB_FOLDER_ID).orEmpty() + )) + } + + override fun initView() { + with(tabAdapter) { + onClickListener = presenter::onMessageItemSelected + onChangesDetectedListener = ::resetListPosition + } + + with(binding.messageTabRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = tabAdapter + addItemDecoration(DividerItemDecoration(context)) + } + with(binding) { + messageTabSwipe.setOnRefreshListener { presenter.onSwipeRefresh() } + messageTabErrorRetry.setOnClickListener { presenter.onRetry() } + messageTabErrorDetails.setOnClickListener { presenter.onDetailsClick() } + } + } + + override fun onCreateOptionsMenu(menu: Menu, inflater: MenuInflater) { + super.onCreateOptionsMenu(menu, inflater) + inflater.inflate(R.menu.action_menu_message_tab, menu) + + val searchView = menu.findItem(R.id.action_search).actionView as SearchView + searchView.queryHint = getString(R.string.all_search_hint) + searchView.maxWidth = Int.MAX_VALUE + searchView.setOnQueryTextListener(object : SearchView.OnQueryTextListener { + override fun onQueryTextSubmit(query: String) = false + override fun onQueryTextChange(query: String): Boolean { + presenter.onSearchQueryTextChange(query) + return true + } + }) + } + + override fun updateData(data: List) { + tabAdapter.setDataItems(data) + } + + override fun showProgress(show: Boolean) { + binding.messageTabProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.messageTabSwipe.isEnabled = enable + } + + override fun resetListPosition() { + binding.messageTabRecycler.scrollToPosition(0) + } + + override fun showContent(show: Boolean) { + binding.messageTabRecycler.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showEmpty(show: Boolean) { + binding.messageTabEmpty.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showErrorView(show: Boolean) { + binding.messageTabError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.messageTabErrorMessage.text = message + } + + override fun showRefresh(show: Boolean) { + binding.messageTabSwipe.isRefreshing = show + } + + override fun openMessage(message: Message) { + (activity as? MainActivity)?.pushView(MessagePreviewFragment.newInstance(message)) + } + + override fun notifyParentDataLoaded() { + (parentFragment as? MessageFragment)?.onChildFragmentLoaded() + } + + fun onParentLoadData(forceRefresh: Boolean) { + presenter.onParentViewLoadData(forceRefresh) + } + + fun onParentDeleteMessage() { + presenter.onDeleteMessage() + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putString(MESSAGE_TAB_FOLDER_ID, presenter.folder.name) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabPresenter.kt new file mode 100644 index 00000000..79062dcf --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabPresenter.kt @@ -0,0 +1,214 @@ +package io.github.wulkanowy.ui.modules.message.tab + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.data.repositories.message.MessageFolder +import io.github.wulkanowy.data.repositories.message.MessageRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import io.github.wulkanowy.utils.toFormattedString +import kotlinx.coroutines.FlowPreview +import kotlinx.coroutines.channels.Channel +import kotlinx.coroutines.flow.catch +import kotlinx.coroutines.flow.collect +import kotlinx.coroutines.flow.consumeAsFlow +import kotlinx.coroutines.flow.debounce +import kotlinx.coroutines.flow.map +import kotlinx.coroutines.flow.onEach +import kotlinx.coroutines.launch +import me.xdrop.fuzzywuzzy.FuzzySearch +import timber.log.Timber +import java.util.Locale +import javax.inject.Inject +import kotlin.math.pow + +class MessageTabPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val messageRepository: MessageRepository, + private val semesterRepository: SemesterRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + lateinit var folder: MessageFolder + + private lateinit var lastError: Throwable + + private var lastSearchQuery = "" + + private var messages = emptyList() + + private val searchChannel = Channel() + + @FlowPreview + fun onAttachView(view: MessageTabView, folder: MessageFolder) { + super.onAttachView(view) + view.initView() + initializeSearchStream() + errorHandler.showErrorMessage = ::showErrorViewOnError + this.folder = folder + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the $folder message") + onParentViewLoadData(true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onDeleteMessage() { + loadData(true) + } + + fun onParentViewLoadData(forceRefresh: Boolean) { + loadData(forceRefresh) + } + + fun onMessageItemSelected(message: Message, position: Int) { + Timber.i("Select message ${message.id} item (position: $position)") + view?.openMessage(message) + } + + private fun loadData(forceRefresh: Boolean) { + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + messageRepository.getMessages(student, semester, folder, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading $folder message data started") + Status.SUCCESS -> { + Timber.i("Loading $folder message result: Success") + messages = it.data!! + updateData(getFilteredData(lastSearchQuery)) + analytics.logEvent( + "load_data", + "type" to "messages", + "items" to it.data.size, + "folder" to folder.name + ) + } + Status.ERROR -> { + Timber.i("Loading $folder message result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + showRefresh(false) + showProgress(false) + enableSwipe(true) + notifyParentDataLoaded() + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + fun onSearchQueryTextChange(query: String) { + launch { + searchChannel.send(query) + } + } + + @FlowPreview + private fun initializeSearchStream() { + launch { + searchChannel.consumeAsFlow() + .debounce(250) + .map { query -> + lastSearchQuery = query + getFilteredData(query) + } + .catch { Timber.e(it) } + .collect { + Timber.d("Applying filter. Full list: ${messages.size}, filtered: ${it.size}") + updateData(it) + view?.resetListPosition() + } + } + } + + private fun getFilteredData(query: String): List { + return if (query.trim().isEmpty()) { + messages.sortedByDescending { it.date } + } else { + messages + .map { it to calculateMatchRatio(it, query) } + .sortedByDescending { it.second } + .filter { it.second > 5000 } + .map { it.first } + } + } + + private fun updateData(data: List) { + view?.run { + showEmpty(data.isEmpty()) + showContent(data.isNotEmpty()) + showErrorView(false) + updateData(data) + } + } + + private fun calculateMatchRatio(message: Message, query: String): Int { + val subjectRatio = FuzzySearch.tokenSortPartialRatio( + query.toLowerCase(Locale.getDefault()), + message.subject + ) + + val senderOrRecipientRatio = FuzzySearch.tokenSortPartialRatio( + query.toLowerCase(Locale.getDefault()), + if (message.sender.isNotEmpty()) message.sender.toLowerCase(Locale.getDefault()) + else message.recipient.toLowerCase(Locale.getDefault()) + ) + + val dateRatio = listOf( + FuzzySearch.ratio( + query.toLowerCase(Locale.getDefault()), + message.date.toFormattedString("dd.MM").toLowerCase(Locale.getDefault()) + ), + FuzzySearch.ratio( + query.toLowerCase(Locale.getDefault()), + message.date.toFormattedString("dd.MM.yyyy").toLowerCase(Locale.getDefault()) + ), + FuzzySearch.ratio( + query.toLowerCase(Locale.getDefault()), + message.date.toFormattedString("d MMMM").toLowerCase(Locale.getDefault()) + ), + FuzzySearch.ratio( + query.toLowerCase(Locale.getDefault()), + message.date.toFormattedString("d MMMM yyyy").toLowerCase(Locale.getDefault()) + ) + ).maxOrNull() ?: 0 + + + return (subjectRatio.toDouble().pow(2) + + senderOrRecipientRatio.toDouble().pow(2) + + dateRatio.toDouble().pow(2) * 2 + ).toInt() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabView.kt new file mode 100644 index 00000000..fe9b6007 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/message/tab/MessageTabView.kt @@ -0,0 +1,33 @@ +package io.github.wulkanowy.ui.modules.message.tab + +import io.github.wulkanowy.data.db.entities.Message +import io.github.wulkanowy.ui.base.BaseView + +interface MessageTabView : BaseView { + + val isViewEmpty: Boolean + + fun initView() + + fun resetListPosition() + + fun updateData(data: List) + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showRefresh(show: Boolean) + + fun openMessage(message: Message) + + fun notifyParentDataLoaded() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDeviceAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDeviceAdapter.kt new file mode 100644 index 00000000..4bc3097d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDeviceAdapter.kt @@ -0,0 +1,38 @@ +package io.github.wulkanowy.ui.modules.mobiledevice + +import android.view.LayoutInflater +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.data.db.entities.MobileDevice +import io.github.wulkanowy.databinding.ItemMobileDeviceBinding +import io.github.wulkanowy.utils.toFormattedString +import javax.inject.Inject + +class MobileDeviceAdapter @Inject constructor() : + RecyclerView.Adapter() { + + var items = mutableListOf() + + var onDeviceUnregisterListener: (device: MobileDevice, position: Int) -> Unit = { _, _ -> } + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemMobileDeviceBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val device = items[position] + + with(holder.binding) { + mobileDeviceItemDate.text = device.date.toFormattedString("dd.MM.yyyy HH:mm:ss") + mobileDeviceItemName.text = device.name + mobileDeviceItemUnregister.setOnClickListener { + onDeviceUnregisterListener(device, position) + } + } + } + + class ItemViewHolder(val binding: ItemMobileDeviceBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDeviceFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDeviceFragment.kt new file mode 100644 index 00000000..8065e9b6 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDeviceFragment.kt @@ -0,0 +1,139 @@ +package io.github.wulkanowy.ui.modules.mobiledevice + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import androidx.core.view.postDelayed +import androidx.recyclerview.widget.LinearLayoutManager +import com.google.android.material.snackbar.Snackbar +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.MobileDevice +import io.github.wulkanowy.databinding.FragmentMobileDeviceBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.modules.mobiledevice.token.MobileDeviceTokenDialog +import io.github.wulkanowy.ui.widgets.DividerItemDecoration +import javax.inject.Inject + +@AndroidEntryPoint +class MobileDeviceFragment : + BaseFragment(R.layout.fragment_mobile_device), MobileDeviceView, + MainView.TitledView { + + @Inject + lateinit var presenter: MobileDevicePresenter + + @Inject + lateinit var devicesAdapter: MobileDeviceAdapter + + companion object { + fun newInstance() = MobileDeviceFragment() + } + + override val titleStringId: Int + get() = R.string.mobile_devices_title + + override val isViewEmpty: Boolean + get() = devicesAdapter.items.isEmpty() + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentMobileDeviceBinding.bind(view) + messageContainer = binding.mobileDevicesRecycler + presenter.onAttachView(this) + } + + override fun initView() { + devicesAdapter.onDeviceUnregisterListener = presenter::onUnregisterDevice + + with(binding.mobileDevicesRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = devicesAdapter + addItemDecoration(DividerItemDecoration(context)) + } + + with(binding) { + mobileDevicesSwipe.setOnRefreshListener { presenter.onSwipeRefresh() } + mobileDevicesErrorRetry.setOnClickListener { presenter.onRetry() } + mobileDevicesErrorDetails.setOnClickListener { presenter.onDetailsClick() } + mobileDeviceAddButton.setOnClickListener { presenter.onRegisterDevice() } + } + } + + override fun updateData(data: List) { + with(devicesAdapter) { + items = data.toMutableList() + notifyDataSetChanged() + } + } + + override fun deleteItem(device: MobileDevice, position: Int) { + with(devicesAdapter) { + items.removeAt(position) + notifyItemRemoved(position) + notifyItemRangeChanged(position, itemCount) + } + } + + override fun restoreDeleteItem(device: MobileDevice, position: Int) { + with(devicesAdapter) { + items.add(position, device) + notifyItemInserted(position) + notifyItemRangeChanged(position, itemCount) + } + } + + override fun showUndo(device: MobileDevice, position: Int) { + var confirmed = true + + Snackbar.make(binding.mobileDevicesRecycler, getString(R.string.mobile_device_removed), 3000) + .setAction(R.string.all_undo) { + confirmed = false + presenter.onUnregisterCancelled(device, position) + }.show() + + view?.postDelayed(3000) { + if (confirmed) presenter.onUnregisterConfirmed(device) + } + } + + override fun hideRefresh() { + binding.mobileDevicesSwipe.isRefreshing = false + } + + override fun showProgress(show: Boolean) { + binding.mobileDevicesProgress.visibility = if (show) VISIBLE else GONE + } + + override fun showEmpty(show: Boolean) { + binding.mobileDevicesEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.mobileDevicesError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.mobileDevicesErrorMessage.text = message + } + + override fun enableSwipe(enable: Boolean) { + binding.mobileDevicesSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.mobileDevicesRecycler.visibility = if (show) VISIBLE else GONE + } + + override fun showTokenDialog() { + (activity as? MainActivity)?.showDialogFragment(MobileDeviceTokenDialog.newInstance()) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDevicePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDevicePresenter.kt new file mode 100644 index 00000000..6314c2c3 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDevicePresenter.kt @@ -0,0 +1,141 @@ +package io.github.wulkanowy.ui.modules.mobiledevice + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.MobileDevice +import io.github.wulkanowy.data.repositories.mobiledevice.MobileDeviceRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.flowWithResourceIn +import kotlinx.coroutines.flow.launchIn +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class MobileDevicePresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val semesterRepository: SemesterRepository, + private val mobileDeviceRepository: MobileDeviceRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private lateinit var lastError: Throwable + + override fun onAttachView(view: MobileDeviceView) { + super.onAttachView(view) + view.initView() + Timber.i("Mobile device view was initialized") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData() + } + + fun onSwipeRefresh() { + loadData(true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + private fun loadData(forceRefresh: Boolean = false) { + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + mobileDeviceRepository.getDevices(student, semester, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading mobile devices data started") + Status.SUCCESS -> { + Timber.i("Loading mobile devices result: Success") + view?.run { + updateData(it.data!!) + showContent(it.data.isNotEmpty()) + showEmpty(it.data.isEmpty()) + showErrorView(false) + } + analytics.logEvent( + "load_data", + "type" to "devices", + "items" to it.data!!.size + ) + } + Status.ERROR -> { + Timber.i("Loading mobile devices result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + fun onRegisterDevice() { + view?.showTokenDialog() + } + + fun onUnregisterDevice(device: MobileDevice, position: Int) { + view?.run { + deleteItem(device, position) + showUndo(device, position) + showEmpty(isViewEmpty) + } + } + + fun onUnregisterCancelled(device: MobileDevice, position: Int) { + view?.run { + restoreDeleteItem(device, position) + showEmpty(isViewEmpty) + } + } + + fun onUnregisterConfirmed(device: MobileDevice) { + flowWithResource { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + mobileDeviceRepository.unregisterDevice(student, semester, device) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Unregister device started") + Status.SUCCESS -> { + Timber.i("Unregister device result: Success") + view?.run { + showProgress(false) + enableSwipe(true) + } + } + Status.ERROR -> { + Timber.i("Unregister device result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launchIn(this) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDeviceView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDeviceView.kt new file mode 100644 index 00000000..ec2d3f87 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/MobileDeviceView.kt @@ -0,0 +1,35 @@ +package io.github.wulkanowy.ui.modules.mobiledevice + +import io.github.wulkanowy.data.db.entities.MobileDevice +import io.github.wulkanowy.ui.base.BaseView + +interface MobileDeviceView : BaseView { + + val isViewEmpty: Boolean + + fun initView() + + fun updateData(data: List) + + fun deleteItem(device: MobileDevice, position: Int) + + fun restoreDeleteItem(device: MobileDevice, position: Int) + + fun showUndo(device: MobileDevice, position: Int) + + fun hideRefresh() + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showTokenDialog() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/token/MobileDeviceTokenDialog.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/token/MobileDeviceTokenDialog.kt new file mode 100644 index 00000000..48150d8d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/token/MobileDeviceTokenDialog.kt @@ -0,0 +1,91 @@ +package io.github.wulkanowy.ui.modules.mobiledevice.token + +import android.content.ClipData +import android.content.ClipboardManager +import android.graphics.BitmapFactory +import android.os.Bundle +import android.util.Base64 +import android.view.LayoutInflater +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import android.view.ViewGroup +import android.widget.Toast +import androidx.core.content.getSystemService +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.pojos.MobileDeviceToken +import io.github.wulkanowy.databinding.DialogMobileDeviceBinding +import io.github.wulkanowy.ui.base.BaseDialogFragment +import javax.inject.Inject + +@AndroidEntryPoint +class MobileDeviceTokenDialog : BaseDialogFragment(), MobileDeviceTokenVIew { + + @Inject + lateinit var presenter: MobileDeviceTokenPresenter + + companion object { + fun newInstance(): MobileDeviceTokenDialog = MobileDeviceTokenDialog() + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setStyle(STYLE_NO_TITLE, 0) + } + + override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { + return DialogMobileDeviceBinding.inflate(inflater).apply { binding = this }.root + } + + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + presenter.onAttachView(this) + } + + override fun initView() { + binding.mobileDeviceDialogClose.setOnClickListener { dismiss() } + } + + override fun updateData(token: MobileDeviceToken) { + with(binding.mobileDeviceDialogToken) { + text = token.token + setOnClickListener { clickCopy(token.token) } + } + with(binding.mobileDeviceDialogSymbol) { + text = token.symbol + setOnClickListener { clickCopy(token.symbol) } + } + with(binding.mobileDeviceDialogPin) { + text = token.pin + setOnClickListener { clickCopy(token.pin) } + } + + binding.mobileDeviceQr.setImageBitmap(Base64.decode(token.qr, Base64.DEFAULT).let { + BitmapFactory.decodeByteArray(it, 0, it.size) + }) + } + + private fun clickCopy(text: String) { + val clip = ClipData.newPlainText("wulkanowy", text) + activity?.getSystemService()?.setPrimaryClip(clip) + Toast.makeText(context, R.string.all_copied, Toast.LENGTH_LONG).show() + } + + override fun hideLoading() { + binding.mobileDeviceDialogProgress.visibility = GONE + } + + override fun showContent() { + binding.mobileDeviceDialogContent.visibility = VISIBLE + } + + override fun closeDialog() { + dismiss() + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/token/MobileDeviceTokenPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/token/MobileDeviceTokenPresenter.kt new file mode 100644 index 00000000..f6d0de99 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/token/MobileDeviceTokenPresenter.kt @@ -0,0 +1,57 @@ +package io.github.wulkanowy.ui.modules.mobiledevice.token + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.mobiledevice.MobileDeviceRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class MobileDeviceTokenPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val semesterRepository: SemesterRepository, + private val mobileDeviceRepository: MobileDeviceRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: MobileDeviceTokenVIew) { + super.onAttachView(view) + view.initView() + Timber.i("Mobile device view was initialized") + loadData() + } + + private fun loadData() { + flowWithResource { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + mobileDeviceRepository.getToken(student, semester) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Mobile device registration data started") + Status.SUCCESS -> { + Timber.i("Mobile device registration result: Success") + view?.run { + updateData(it.data!!) + showContent() + } + analytics.logEvent("device_register", "symbol" to it.data!!.token.substring(0, 3)) + } + Status.ERROR -> { + Timber.i("Mobile device registration result: An exception occurred") + view?.closeDialog() + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.hideLoading() + }.launch() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/token/MobileDeviceTokenVIew.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/token/MobileDeviceTokenVIew.kt new file mode 100644 index 00000000..950f8bcf --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/mobiledevice/token/MobileDeviceTokenVIew.kt @@ -0,0 +1,17 @@ +package io.github.wulkanowy.ui.modules.mobiledevice.token + +import io.github.wulkanowy.data.pojos.MobileDeviceToken +import io.github.wulkanowy.ui.base.BaseView + +interface MobileDeviceTokenVIew : BaseView { + + fun initView() + + fun hideLoading() + + fun showContent() + + fun closeDialog() + + fun updateData(token: MobileDeviceToken) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/more/MoreAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/more/MoreAdapter.kt new file mode 100644 index 00000000..70587b0c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/more/MoreAdapter.kt @@ -0,0 +1,34 @@ +package io.github.wulkanowy.ui.modules.more + +import android.graphics.drawable.Drawable +import android.view.LayoutInflater +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.databinding.ItemMoreBinding +import javax.inject.Inject + +class MoreAdapter @Inject constructor() : RecyclerView.Adapter() { + + var items = emptyList>() + + var onClickListener: (name: String) -> Unit = {} + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemMoreBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val (title, drawable) = items[position] + + with(holder.binding) { + moreItemTitle.text = title + moreItemImage.setImageDrawable(drawable) + + root.setOnClickListener { onClickListener(title) } + } + } + + class ItemViewHolder(val binding: ItemMoreBinding) : RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/more/MoreFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/more/MoreFragment.kt new file mode 100644 index 00000000..1bdcc26f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/more/MoreFragment.kt @@ -0,0 +1,131 @@ +package io.github.wulkanowy.ui.modules.more + +import android.graphics.drawable.Drawable +import android.os.Bundle +import android.view.View +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.databinding.FragmentMoreBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.about.AboutFragment +import io.github.wulkanowy.ui.modules.homework.HomeworkFragment +import io.github.wulkanowy.ui.modules.luckynumber.LuckyNumberFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.modules.message.MessageFragment +import io.github.wulkanowy.ui.modules.mobiledevice.MobileDeviceFragment +import io.github.wulkanowy.ui.modules.note.NoteFragment +import io.github.wulkanowy.ui.modules.schoolandteachers.SchoolAndTeachersFragment +import io.github.wulkanowy.ui.modules.settings.SettingsFragment +import io.github.wulkanowy.utils.getCompatDrawable +import javax.inject.Inject + +@AndroidEntryPoint +class MoreFragment : BaseFragment(R.layout.fragment_more), MoreView, + MainView.TitledView, MainView.MainChildView { + + @Inject + lateinit var presenter: MorePresenter + + @Inject + lateinit var moreAdapter: MoreAdapter + + companion object { + fun newInstance() = MoreFragment() + } + + override val titleStringId: Int + get() = R.string.more_title + + override val messagesRes: Pair? + get() = context?.run { getString(R.string.message_title) to getCompatDrawable(R.drawable.ic_more_messages) } + + override val homeworkRes: Pair? + get() = context?.run { getString(R.string.homework_title) to getCompatDrawable(R.drawable.ic_more_homework) } + + override val noteRes: Pair? + get() = context?.run { getString(R.string.note_title) to getCompatDrawable(R.drawable.ic_more_note) } + + override val luckyNumberRes: Pair? + get() = context?.run { getString(R.string.lucky_number_title) to getCompatDrawable(R.drawable.ic_more_lucky_number) } + + override val mobileDevicesRes: Pair? + get() = context?.run { getString(R.string.mobile_devices_title) to getCompatDrawable(R.drawable.ic_more_mobile_devices) } + + override val schoolAndTeachersRes: Pair? + get() = context?.run { getString(R.string.schoolandteachers_title) to getCompatDrawable((R.drawable.ic_more_schoolandteachers)) } + + override val settingsRes: Pair? + get() = context?.run { getString(R.string.settings_title) to getCompatDrawable(R.drawable.ic_more_settings) } + + override val aboutRes: Pair? + get() = context?.run { getString(R.string.about_title) to getCompatDrawable(R.drawable.ic_all_about) } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentMoreBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + moreAdapter.onClickListener = presenter::onItemSelected + + with(binding.moreRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = moreAdapter + } + } + + override fun onFragmentReselected() { + if (::presenter.isInitialized) presenter.onViewReselected() + } + + override fun updateData(data: List>) { + with(moreAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun openMessagesView() { + (activity as? MainActivity)?.pushView(MessageFragment.newInstance()) + } + + override fun openHomeworkView() { + (activity as? MainActivity)?.pushView(HomeworkFragment.newInstance()) + } + + override fun openNoteView() { + (activity as? MainActivity)?.pushView(NoteFragment.newInstance()) + } + + override fun openLuckyNumberView() { + (activity as? MainActivity)?.pushView(LuckyNumberFragment.newInstance()) + } + + override fun openMobileDevicesView() { + (activity as? MainActivity)?.pushView(MobileDeviceFragment.newInstance()) + } + + override fun openSchoolAndTeachersView() { + (activity as? MainActivity)?.pushView(SchoolAndTeachersFragment.newInstance()) + } + + override fun openSettingsView() { + (activity as? MainActivity)?.pushView(SettingsFragment.newInstance()) + } + + override fun openAboutView() { + (activity as? MainActivity)?.pushView(AboutFragment.newInstance()) + } + + override fun popView(depth: Int) { + (activity as? MainActivity)?.popView(depth) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/more/MorePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/more/MorePresenter.kt new file mode 100644 index 00000000..6d80f418 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/more/MorePresenter.kt @@ -0,0 +1,57 @@ +package io.github.wulkanowy.ui.modules.more + +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import timber.log.Timber +import javax.inject.Inject + +class MorePresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: MoreView) { + super.onAttachView(view) + view.initView() + Timber.i("More view was initialized") + loadData() + } + + fun onItemSelected(title: String) { + Timber.i("Select more item \"${title}\"") + view?.run { + when (title) { + messagesRes?.first -> openMessagesView() + homeworkRes?.first -> openHomeworkView() + noteRes?.first -> openNoteView() + luckyNumberRes?.first -> openLuckyNumberView() + mobileDevicesRes?.first -> openMobileDevicesView() + schoolAndTeachersRes?.first -> openSchoolAndTeachersView() + settingsRes?.first -> openSettingsView() + aboutRes?.first -> openAboutView() + } + } + } + + fun onViewReselected() { + Timber.i("More view is reselected") + view?.popView(2) + } + + private fun loadData() { + Timber.i("Load items for more view") + view?.run { + updateData(listOfNotNull( + messagesRes, + homeworkRes, + noteRes, + luckyNumberRes, + mobileDevicesRes, + schoolAndTeachersRes, + settingsRes, + aboutRes + )) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/more/MoreView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/more/MoreView.kt new file mode 100644 index 00000000..922afdfd --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/more/MoreView.kt @@ -0,0 +1,45 @@ +package io.github.wulkanowy.ui.modules.more + +import android.graphics.drawable.Drawable +import io.github.wulkanowy.ui.base.BaseView + +interface MoreView : BaseView { + + val messagesRes: Pair? + + val homeworkRes: Pair? + + val noteRes: Pair? + + val luckyNumberRes: Pair? + + val mobileDevicesRes: Pair? + + val schoolAndTeachersRes: Pair? + + val settingsRes: Pair? + + val aboutRes: Pair? + + fun initView() + + fun updateData(data: List>) + + fun openSettingsView() + + fun openAboutView() + + fun popView(depth: Int) + + fun openMessagesView() + + fun openHomeworkView() + + fun openNoteView() + + fun openLuckyNumberView() + + fun openMobileDevicesView() + + fun openSchoolAndTeachersView() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteAdapter.kt new file mode 100644 index 00000000..48482cb7 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteAdapter.kt @@ -0,0 +1,60 @@ +package io.github.wulkanowy.ui.modules.note + +import android.annotation.SuppressLint +import android.graphics.Typeface +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.core.content.ContextCompat +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Note +import io.github.wulkanowy.databinding.ItemNoteBinding +import io.github.wulkanowy.sdk.scrapper.notes.NoteCategory +import io.github.wulkanowy.utils.getThemeAttrColor +import io.github.wulkanowy.utils.toFormattedString +import javax.inject.Inject + +class NoteAdapter @Inject constructor() : RecyclerView.Adapter() { + + var items = mutableListOf() + + var onClickListener: (Note, position: Int) -> Unit = { _, _ -> } + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemNoteBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + @SuppressLint("SetTextI18n") + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val item = items[position] + + with(holder.binding) { + with(noteItemDate) { + text = item.date.toFormattedString() + setTypeface(null, if (item.isRead) Typeface.NORMAL else Typeface.BOLD) + } + with(noteItemType) { + text = item.category + setTypeface(null, if (item.isRead) Typeface.NORMAL else Typeface.BOLD) + } + with(noteItemPoints) { + text = "${if (item.points > 0) "+" else ""}${item.points}" + visibility = if (item.isPointsShow) View.VISIBLE else View.GONE + setTextColor(when (NoteCategory.getByValue(item.categoryType)) { + NoteCategory.POSITIVE -> ContextCompat.getColor(context, R.color.note_positive) + NoteCategory.NEGATIVE -> ContextCompat.getColor(context, R.color.note_negative) + else -> context.getThemeAttrColor(android.R.attr.textColorPrimary) + }) + } + noteItemTeacher.text = item.teacher + noteItemContent.text = item.content + + root.setOnClickListener { onClickListener(item, position) } + } + } + + class ItemViewHolder(val binding: ItemNoteBinding) : RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteDialog.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteDialog.kt new file mode 100644 index 00000000..e016fe0b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteDialog.kt @@ -0,0 +1,70 @@ +package io.github.wulkanowy.ui.modules.note + +import android.annotation.SuppressLint +import android.os.Bundle +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.core.content.ContextCompat +import androidx.fragment.app.DialogFragment +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Note +import io.github.wulkanowy.databinding.DialogNoteBinding +import io.github.wulkanowy.sdk.scrapper.notes.NoteCategory +import io.github.wulkanowy.utils.getThemeAttrColor +import io.github.wulkanowy.utils.lifecycleAwareVariable +import io.github.wulkanowy.utils.toFormattedString + +class NoteDialog : DialogFragment() { + + private var binding: DialogNoteBinding by lifecycleAwareVariable() + + private lateinit var note: Note + + companion object { + private const val ARGUMENT_KEY = "Item" + + fun newInstance(exam: Note): NoteDialog { + return NoteDialog().apply { + arguments = Bundle().apply { putSerializable(ARGUMENT_KEY, exam) } + } + } + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setStyle(STYLE_NO_TITLE, 0) + arguments?.run { + note = getSerializable(ARGUMENT_KEY) as Note + } + } + + override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { + return DialogNoteBinding.inflate(inflater).apply { binding = this }.root + } + + @SuppressLint("SetTextI18n") + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + + with(binding) { + noteDialogDate.text = note.date.toFormattedString() + noteDialogCategory.text = note.category + noteDialogTeacher.text = note.teacher + noteDialogContent.text = note.content + } + + if (note.isPointsShow) { + with(binding.noteDialogPoints) { + text = "${if (note.points > 0) "+" else ""}${note.points}" + setTextColor(when (NoteCategory.getByValue(note.categoryType)) { + NoteCategory.POSITIVE -> ContextCompat.getColor(requireContext(), R.color.note_positive) + NoteCategory.NEGATIVE -> ContextCompat.getColor(requireContext(), R.color.note_negative) + else -> requireContext().getThemeAttrColor(android.R.attr.textColorPrimary) + }) + } + } + + binding.noteDialogClose.setOnClickListener { dismiss() } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteFragment.kt new file mode 100644 index 00000000..079285a8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteFragment.kt @@ -0,0 +1,116 @@ +package io.github.wulkanowy.ui.modules.note + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Note +import io.github.wulkanowy.databinding.FragmentNoteBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.widgets.DividerItemDecoration +import javax.inject.Inject + +@AndroidEntryPoint +class NoteFragment : BaseFragment(R.layout.fragment_note), NoteView, + MainView.TitledView { + + @Inject + lateinit var presenter: NotePresenter + + @Inject + lateinit var noteAdapter: NoteAdapter + + companion object { + fun newInstance() = NoteFragment() + } + + override val titleStringId: Int + get() = R.string.note_title + + override val isViewEmpty: Boolean + get() = noteAdapter.items.isEmpty() + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentNoteBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + noteAdapter.onClickListener = presenter::onNoteItemSelected + + with(binding.noteRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = noteAdapter + addItemDecoration(DividerItemDecoration(context)) + } + with(binding) { + noteSwipe.setOnRefreshListener { presenter.onSwipeRefresh() } + noteErrorRetry.setOnClickListener { presenter.onRetry() } + noteErrorDetails.setOnClickListener { presenter.onDetailsClick() } + } + } + + override fun showNoteDialog(note: Note) { + (activity as? MainActivity)?.showDialogFragment(NoteDialog.newInstance(note)) + } + + override fun updateData(data: List) { + with(noteAdapter) { + items = data.toMutableList() + notifyDataSetChanged() + } + } + + override fun updateItem(item: Note, position: Int) { + with(noteAdapter) { + items[position] = item + notifyItemChanged(position) + } + } + + override fun clearData() { + with(noteAdapter) { + items = mutableListOf() + notifyDataSetChanged() + } + } + + override fun showEmpty(show: Boolean) { + binding.noteEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.noteError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.noteErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.noteProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.noteSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.noteRecycler.visibility = if (show) VISIBLE else GONE + } + + override fun hideRefresh() { + binding.noteSwipe.isRefreshing = false + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/note/NotePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/note/NotePresenter.kt new file mode 100644 index 00000000..db3b495a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/note/NotePresenter.kt @@ -0,0 +1,125 @@ +package io.github.wulkanowy.ui.modules.note + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Note +import io.github.wulkanowy.data.repositories.note.NoteRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResource +import io.github.wulkanowy.utils.flowWithResourceIn +import kotlinx.coroutines.flow.launchIn +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class NotePresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val noteRepository: NoteRepository, + private val semesterRepository: SemesterRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private lateinit var lastError: Throwable + + override fun onAttachView(view: NoteView) { + super.onAttachView(view) + view.initView() + Timber.i("Note view was initialized") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData() + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the note") + loadData(true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + private fun loadData(forceRefresh: Boolean = false) { + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + noteRepository.getNotes(student, semester, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading note data started") + Status.SUCCESS -> { + Timber.i("Loading note result: Success") + view?.apply { + updateData(it.data!!.sortedByDescending { item -> item.date }) + showEmpty(it.data.isEmpty()) + showErrorView(false) + showContent(it.data.isNotEmpty()) + } + analytics.logEvent( + "load_data", + "type" to "note", + "items" to it.data!!.size + ) + } + Status.ERROR -> { + Timber.i("Loading note result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + fun onNoteItemSelected(note: Note, position: Int) { + Timber.i("Select note item ${note.id}") + view?.run { + showNoteDialog(note) + if (!note.isRead) { + note.isRead = true + updateItem(note, position) + updateNote(note) + } + } + } + + private fun updateNote(note: Note) { + flowWithResource { noteRepository.updateNote(note) }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Attempt to update note ${note.id}") + Status.SUCCESS -> Timber.i("Update note result: Success") + Status.ERROR -> { + Timber.i("Update note result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.launchIn(this) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteView.kt new file mode 100644 index 00000000..a7cbab8f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/note/NoteView.kt @@ -0,0 +1,33 @@ +package io.github.wulkanowy.ui.modules.note + +import io.github.wulkanowy.data.db.entities.Note +import io.github.wulkanowy.ui.base.BaseView + +interface NoteView : BaseView { + + val isViewEmpty: Boolean + + fun initView() + + fun updateData(data: List) + + fun updateItem(item: Note, position: Int) + + fun clearData() + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) + + fun hideRefresh() + + fun showNoteDialog(note: Note) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersChildView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersChildView.kt new file mode 100644 index 00000000..b5eedb6f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersChildView.kt @@ -0,0 +1,8 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers + +interface SchoolAndTeachersChildView { + + fun notifyParentDataLoaded() + + fun onParentLoadData(forceRefresh: Boolean) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersFragment.kt new file mode 100644 index 00000000..c1c56961 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersFragment.kt @@ -0,0 +1,87 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers + +import android.os.Bundle +import android.view.View +import android.view.View.INVISIBLE +import android.view.View.VISIBLE +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.databinding.FragmentSchoolandteachersBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.base.BaseFragmentPagerAdapter +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.modules.schoolandteachers.school.SchoolFragment +import io.github.wulkanowy.ui.modules.schoolandteachers.teacher.TeacherFragment +import io.github.wulkanowy.utils.dpToPx +import io.github.wulkanowy.utils.setOnSelectPageListener +import javax.inject.Inject + +@AndroidEntryPoint +class SchoolAndTeachersFragment : + BaseFragment(R.layout.fragment_schoolandteachers), + SchoolAndTeachersView, MainView.TitledView { + + @Inject + lateinit var presenter: SchoolAndTeachersPresenter + + private val pagerAdapter by lazy { BaseFragmentPagerAdapter(childFragmentManager) } + + companion object { + fun newInstance() = SchoolAndTeachersFragment() + } + + override val titleStringId: Int get() = R.string.schoolandteachers_title + + override val currentPageIndex get() = binding.schoolandteachersViewPager.currentItem + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentSchoolandteachersBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + with(pagerAdapter) { + containerId = binding.schoolandteachersViewPager.id + addFragmentsWithTitle(mapOf( + SchoolFragment.newInstance() to getString(R.string.school_title), + TeacherFragment.newInstance() to getString(R.string.teachers_title) + )) + } + + with(binding.schoolandteachersViewPager) { + adapter = pagerAdapter + offscreenPageLimit = 2 + setOnSelectPageListener(presenter::onPageSelected) + } + + with(binding.schoolandteachersTabLayout) { + setupWithViewPager(binding.schoolandteachersViewPager) + setElevationCompat(context.dpToPx(4f)) + } + } + + override fun showContent(show: Boolean) { + with(binding) { + schoolandteachersViewPager.visibility = if (show) VISIBLE else INVISIBLE + schoolandteachersTabLayout.visibility = if (show) VISIBLE else INVISIBLE + } + } + + override fun showProgress(show: Boolean) { + binding.schoolandteachersProgress.visibility = if (show) VISIBLE else INVISIBLE + } + + fun onChildFragmentLoaded() { + presenter.onChildViewLoaded() + } + + override fun notifyChildLoadData(index: Int, forceRefresh: Boolean) { + (pagerAdapter.getFragmentInstance(index) as? SchoolAndTeachersChildView)?.onParentLoadData(forceRefresh) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersPresenter.kt new file mode 100644 index 00000000..305f4e7d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersPresenter.kt @@ -0,0 +1,45 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers + +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import kotlinx.coroutines.delay +import kotlinx.coroutines.launch +import timber.log.Timber +import javax.inject.Inject + +class SchoolAndTeachersPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: SchoolAndTeachersView) { + super.onAttachView(view) + launch { + delay(150) + view.initView() + Timber.i("Message view was initialized") + loadData() + } + } + + fun onPageSelected(index: Int) { + loadChild(index) + } + + private fun loadData() { + view?.run { loadChild(currentPageIndex) } + } + + private fun loadChild(index: Int, forceRefresh: Boolean = false) { + Timber.i("Load schoolandteachers child view index: $index") + view?.notifyChildLoadData(index, forceRefresh) + } + + fun onChildViewLoaded() { + view?.apply { + showContent(true) + showProgress(false) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersView.kt new file mode 100644 index 00000000..594441ec --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/SchoolAndTeachersView.kt @@ -0,0 +1,16 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers + +import io.github.wulkanowy.ui.base.BaseView + +interface SchoolAndTeachersView : BaseView { + + val currentPageIndex: Int + + fun initView() + + fun showContent(show: Boolean) + + fun showProgress(show: Boolean) + + fun notifyChildLoadData(index: Int, forceRefresh: Boolean) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/school/SchoolFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/school/SchoolFragment.kt new file mode 100644 index 00000000..d3f11007 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/school/SchoolFragment.kt @@ -0,0 +1,111 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers.school + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.School +import io.github.wulkanowy.databinding.FragmentSchoolBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.modules.schoolandteachers.SchoolAndTeachersChildView +import io.github.wulkanowy.ui.modules.schoolandteachers.SchoolAndTeachersFragment +import io.github.wulkanowy.utils.openDialer +import io.github.wulkanowy.utils.openNavigation +import javax.inject.Inject + +@AndroidEntryPoint +class SchoolFragment : BaseFragment(R.layout.fragment_school), SchoolView, + MainView.TitledView, SchoolAndTeachersChildView { + + @Inject + lateinit var presenter: SchoolPresenter + + override val titleStringId get() = R.string.school_title + + override val isViewEmpty get() = binding.schoolName.text.isBlank() + + companion object { + fun newInstance() = SchoolFragment() + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentSchoolBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + with(binding) { + schoolSwipe.setOnRefreshListener { presenter.onSwipeRefresh() } + schoolErrorRetry.setOnClickListener { presenter.onRetry() } + schoolErrorDetails.setOnClickListener { presenter.onDetailsClick() } + + schoolAddressButton.setOnClickListener { presenter.onAddressSelected() } + schoolTelephoneButton.setOnClickListener { presenter.onTelephoneSelected() } + } + } + + override fun updateData(data: School) { + with(binding) { + schoolName.text = data.name + schoolAddress.text = data.address.ifBlank { "-" } + schoolAddressButton.visibility = if (data.address.isNotBlank()) VISIBLE else GONE + schoolTelephone.text = data.contact.ifBlank { "-" } + schoolTelephoneButton.visibility = if (data.contact.isNotBlank()) VISIBLE else GONE + schoolHeadmaster.text = data.headmaster + schoolPedagogue.text = data.pedagogue + } + } + + override fun showEmpty(show: Boolean) { + binding.schoolEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.schoolError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.schoolErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.schoolProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.schoolSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.schoolContent.visibility = if (show) VISIBLE else GONE + } + + override fun hideRefresh() { + binding.schoolSwipe.isRefreshing = false + } + + override fun notifyParentDataLoaded() { + (parentFragment as? SchoolAndTeachersFragment)?.onChildFragmentLoaded() + } + + override fun onParentLoadData(forceRefresh: Boolean) { + presenter.onParentViewLoadData(forceRefresh) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } + + override fun openMapsLocation(location: String) { + context?.openNavigation(location) + } + + override fun dialPhone(phone: String) { + context?.openDialer(phone) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/school/SchoolPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/school/SchoolPresenter.kt new file mode 100644 index 00000000..4cda5d33 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/school/SchoolPresenter.kt @@ -0,0 +1,120 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers.school + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.school.SchoolRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class SchoolPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val semesterRepository: SemesterRepository, + private val schoolRepository: SchoolRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private var address: String? = null + + private var contact: String? = null + + private lateinit var lastError: Throwable + + override fun onAttachView(view: SchoolView) { + super.onAttachView(view) + view.initView() + Timber.i("School view was initialized") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData() + } + + fun onSwipeRefresh() { + loadData(true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onParentViewLoadData(forceRefresh: Boolean) { + loadData(forceRefresh) + } + + fun onAddressSelected() { + address?.let { view?.openMapsLocation(it) } + } + + fun onTelephoneSelected() { + contact?.let { view?.dialPhone(it) } + } + + private fun loadData(forceRefresh: Boolean = false) { + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + schoolRepository.getSchoolInfo(student, semester, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading school info started") + Status.SUCCESS -> if (it.data != null) { + Timber.i("Loading teachers result: Success") + view?.run { + address = it.data.address.ifBlank { null } + contact = it.data.contact.ifBlank { null } + updateData(it.data) + showContent(true) + showEmpty(false) + showErrorView(false) + } + analytics.logEvent( + "load_item", + "type" to "school" + ) + } else view?.run { + Timber.i("Loading school result: No school info found") + showContent(!isViewEmpty) + showEmpty(isViewEmpty) + showErrorView(false) + } + Status.ERROR -> { + Timber.i("Loading school result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + notifyParentDataLoaded() + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + showContent(false) + } else showError(message, error) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/school/SchoolView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/school/SchoolView.kt new file mode 100644 index 00000000..c42c2f91 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/school/SchoolView.kt @@ -0,0 +1,32 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers.school + +import io.github.wulkanowy.data.db.entities.School +import io.github.wulkanowy.ui.base.BaseView +import io.github.wulkanowy.ui.modules.schoolandteachers.SchoolAndTeachersChildView + +interface SchoolView : BaseView, SchoolAndTeachersChildView { + + val isViewEmpty: Boolean + + fun initView() + + fun updateData(data: School) + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) + + fun hideRefresh() + + fun openMapsLocation(location: String) + + fun dialPhone(phone: String) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherAdapter.kt new file mode 100644 index 00000000..8deeae05 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherAdapter.kt @@ -0,0 +1,40 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers.teacher + +import android.annotation.SuppressLint +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Teacher +import io.github.wulkanowy.databinding.ItemTeacherBinding +import javax.inject.Inject + +class TeacherAdapter @Inject constructor() : RecyclerView.Adapter() { + + var items = emptyList() + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemTeacherBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + @SuppressLint("SetTextI18n") + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val teacher = items[position] + + with(holder.binding) { + teacherItemName.text = teacher.name + teacherItemSubject.text = if (teacher.subject.isNotBlank()) teacher.subject else root.context.getString(R.string.teacher_no_subject) + if (teacher.shortName.isNotBlank()) { + teacherItemShortName.visibility = View.VISIBLE + teacherItemShortName.text = "[${teacher.shortName}]" + } else { + teacherItemShortName.visibility = View.GONE + } + } + } + + class ItemViewHolder(val binding: ItemTeacherBinding) : RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherFragment.kt new file mode 100644 index 00000000..5914945b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherFragment.kt @@ -0,0 +1,107 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers.teacher + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Teacher +import io.github.wulkanowy.databinding.FragmentTeacherBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.modules.schoolandteachers.SchoolAndTeachersChildView +import io.github.wulkanowy.ui.modules.schoolandteachers.SchoolAndTeachersFragment +import io.github.wulkanowy.ui.widgets.DividerItemDecoration +import javax.inject.Inject + +@AndroidEntryPoint +class TeacherFragment : BaseFragment(R.layout.fragment_teacher), + TeacherView, MainView.TitledView, SchoolAndTeachersChildView { + + @Inject + lateinit var presenter: TeacherPresenter + + @Inject + lateinit var teacherAdapter: TeacherAdapter + + companion object { + fun newInstance() = TeacherFragment() + } + + override val titleStringId: Int + get() = R.string.teachers_title + + override val noSubjectString get() = getString(R.string.teacher_no_subject) + + override val isViewEmpty: Boolean + get() = teacherAdapter.items.isEmpty() + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentTeacherBinding.bind(view) + presenter.onAttachView(this) + } + + override fun initView() { + with(binding.teacherRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = teacherAdapter + addItemDecoration(DividerItemDecoration(context)) + } + with(binding) { + teacherSwipe.setOnRefreshListener { presenter.onSwipeRefresh() } + teacherErrorRetry.setOnClickListener { presenter.onRetry() } + teacherErrorDetails.setOnClickListener { presenter.onDetailsClick() } + } + } + + override fun updateData(data: List) { + with(teacherAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun showEmpty(show: Boolean) { + binding.teacherEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.teacherError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.teacherErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.teacherProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.teacherSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.teacherRecycler.visibility = if (show) VISIBLE else GONE + } + + override fun hideRefresh() { + binding.teacherSwipe.isRefreshing = false + } + + override fun notifyParentDataLoaded() { + (parentFragment as? SchoolAndTeachersFragment)?.onChildFragmentLoaded() + } + + override fun onParentLoadData(forceRefresh: Boolean) { + presenter.onParentViewLoadData(forceRefresh) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherPresenter.kt new file mode 100644 index 00000000..ff02116b --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherPresenter.kt @@ -0,0 +1,101 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers.teacher + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.data.repositories.teacher.TeacherRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class TeacherPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val semesterRepository: SemesterRepository, + private val teacherRepository: TeacherRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private lateinit var lastError: Throwable + + override fun onAttachView(view: TeacherView) { + super.onAttachView(view) + view.initView() + Timber.i("Teacher view was initialized") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData() + } + + fun onSwipeRefresh() { + loadData(true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData() + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onParentViewLoadData(forceRefresh: Boolean) { + loadData(forceRefresh) + } + + private fun loadData(forceRefresh: Boolean = false) { + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + teacherRepository.getTeachers(student, semester, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading teachers data started") + Status.SUCCESS -> { + Timber.i("Loading teachers result: Success") + view?.run { + updateData(it.data!!.filter { item -> item.name.isNotBlank() }) + showContent(it.data.isNotEmpty()) + showEmpty(it.data.isEmpty()) + showErrorView(false) + } + analytics.logEvent( + "load_data", + "type" to "teachers", + "items" to it.data!!.size + ) + } + Status.ERROR -> { + Timber.i("Loading teachers result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + notifyParentDataLoaded() + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherView.kt new file mode 100644 index 00000000..c655bfad --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/schoolandteachers/teacher/TeacherView.kt @@ -0,0 +1,30 @@ +package io.github.wulkanowy.ui.modules.schoolandteachers.teacher + +import io.github.wulkanowy.data.db.entities.Teacher +import io.github.wulkanowy.ui.base.BaseView +import io.github.wulkanowy.ui.modules.schoolandteachers.SchoolAndTeachersChildView + +interface TeacherView : BaseView, SchoolAndTeachersChildView { + + val isViewEmpty: Boolean + + val noSubjectString: String + + fun initView() + + fun updateData(data: List) + + fun hideRefresh() + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/settings/SettingsFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/settings/SettingsFragment.kt new file mode 100644 index 00000000..6f4a695d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/settings/SettingsFragment.kt @@ -0,0 +1,149 @@ +package io.github.wulkanowy.ui.modules.settings + +import android.content.Context +import android.content.SharedPreferences +import android.os.Bundle +import androidx.appcompat.app.AlertDialog +import androidx.preference.Preference +import androidx.preference.PreferenceFragmentCompat +import com.thelittlefireman.appkillermanager.AppKillerManager +import com.thelittlefireman.appkillermanager.exceptions.NoActionFoundException +import com.yariksoffice.lingver.Lingver +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.ui.base.BaseActivity +import io.github.wulkanowy.ui.base.ErrorDialog +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.openInternetBrowser +import javax.inject.Inject + +@AndroidEntryPoint +class SettingsFragment : PreferenceFragmentCompat(), + SharedPreferences.OnSharedPreferenceChangeListener, + MainView.TitledView, SettingsView { + + @Inject + lateinit var presenter: SettingsPresenter + + @Inject + lateinit var appInfo: AppInfo + + @Inject + lateinit var lingver: Lingver + + companion object { + fun newInstance() = SettingsFragment() + } + + override val titleStringId get() = R.string.settings_title + + override val syncSuccessString get() = getString(R.string.pref_services_message_sync_success) + + override val syncFailedString get() = getString(R.string.pref_services_message_sync_failed) + + override fun onAttach(context: Context) { + super.onAttach(context) + } + + override fun initView() { + findPreference(getString(R.string.pref_key_services_force_sync))?.run { + onPreferenceClickListener = Preference.OnPreferenceClickListener { + presenter.onSyncNowClicked() + true + } + } + findPreference(getString(R.string.pref_key_notifications_fix_issues))?.run { + isVisible = AppKillerManager.isDeviceSupported() && AppKillerManager.isAnyActionAvailable(requireContext()) + setOnPreferenceClickListener { + presenter.onFixSyncIssuesClicked() + true + } + } + } + + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + presenter.onAttachView(this) + } + + override fun onCreatePreferences(savedInstanceState: Bundle?, rootKey: String?) { + setPreferencesFromResource(R.xml.scheme_preferences, rootKey) + findPreference(getString(R.string.pref_key_notification_debug))?.isVisible = appInfo.isDebug + } + + override fun onSharedPreferenceChanged(sharedPreferences: SharedPreferences, key: String) { + presenter.onSharedPreferenceChanged(key) + } + + override fun recreateView() { + activity?.recreate() + } + + override fun updateLanguage(langCode: String) { + lingver.setLocale(requireContext(), langCode) + } + + override fun setServicesSuspended(serviceEnablesKey: String, isHolidays: Boolean) { + findPreference(serviceEnablesKey)?.run { + summary = if (isHolidays) getString(R.string.pref_services_suspended) else "" + isEnabled = !isHolidays + } + } + + override fun setSyncInProgress(inProgress: Boolean) { + if (activity == null || !isAdded) return + + findPreference(getString(R.string.pref_key_services_force_sync))?.run { + isEnabled = !inProgress + summary = if (inProgress) getString(R.string.pref_services_sync_in_progress) else "" + } + } + + override fun showError(text: String, error: Throwable) { + (activity as? BaseActivity<*, *>)?.showError(text, error) + } + + override fun showMessage(text: String) { + (activity as? BaseActivity<*, *>)?.showMessage(text) + } + + override fun showExpiredDialog() { + (activity as? BaseActivity<*, *>)?.showExpiredDialog() + } + + override fun openClearLoginView() { + (activity as? BaseActivity<*, *>)?.openClearLoginView() + } + + override fun showErrorDetailsDialog(error: Throwable) { + ErrorDialog.newInstance(error).show(childFragmentManager, error.toString()) + } + + override fun showFixSyncDialog() { + AlertDialog.Builder(requireContext()) + .setTitle(R.string.pref_notify_fix_sync_issues) + .setMessage(R.string.pref_notify_fix_sync_issues_message) + .setNegativeButton(android.R.string.cancel) { _, _ -> } + .setPositiveButton(R.string.pref_notify_fix_sync_issues_settings_button) { _, _ -> + try { + AppKillerManager.doActionPowerSaving(requireContext()) + AppKillerManager.doActionAutoStart(requireContext()) + AppKillerManager.doActionNotification(requireContext()) + } catch (e: NoActionFoundException) { + requireContext().openInternetBrowser("https://dontkillmyapp.com/${AppKillerManager.getDevice()?.manufacturer}", ::showMessage) + } + } + .show() + } + + override fun onResume() { + super.onResume() + preferenceScreen.sharedPreferences.registerOnSharedPreferenceChangeListener(this) + } + + override fun onPause() { + super.onPause() + preferenceScreen.sharedPreferences.unregisterOnSharedPreferenceChangeListener(this) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/settings/SettingsPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/settings/SettingsPresenter.kt new file mode 100644 index 00000000..3d1e063e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/settings/SettingsPresenter.kt @@ -0,0 +1,86 @@ +package io.github.wulkanowy.ui.modules.settings + +import androidx.work.WorkInfo +import com.chuckerteam.chucker.api.ChuckerCollector +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.services.alarm.TimetableNotificationSchedulerHelper +import io.github.wulkanowy.services.sync.SyncManager +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.AppInfo +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.isHolidays +import kotlinx.coroutines.flow.catch +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import java.time.LocalDate.now +import javax.inject.Inject + +class SettingsPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val preferencesRepository: PreferencesRepository, + private val timetableNotificationHelper: TimetableNotificationSchedulerHelper, + private val analytics: FirebaseAnalyticsHelper, + private val syncManager: SyncManager, + private val chuckerCollector: ChuckerCollector, + private val appInfo: AppInfo +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: SettingsView) { + super.onAttachView(view) + Timber.i("Settings view was initialized") + view.setServicesSuspended(preferencesRepository.serviceEnableKey, now().isHolidays) + view.initView() + } + + fun onSharedPreferenceChanged(key: String) { + Timber.i("Change settings $key") + + preferencesRepository.apply { + when (key) { + serviceEnableKey -> with(syncManager) { if (isServiceEnabled) startPeriodicSyncWorker() else stopSyncWorker() } + servicesIntervalKey, servicesOnlyWifiKey -> syncManager.startPeriodicSyncWorker(true) + isDebugNotificationEnableKey -> chuckerCollector.showNotification = isDebugNotificationEnable + appThemeKey -> view?.recreateView() + isUpcomingLessonsNotificationsEnableKey -> if (!isUpcomingLessonsNotificationsEnable) timetableNotificationHelper.cancelNotification() + appLanguageKey -> view?.run { + updateLanguage(if (appLanguage == "system") appInfo.systemLanguage else appLanguage) + recreateView() + } + } + } + analytics.logEvent("setting_changed", "name" to key) + } + + fun onSyncNowClicked() { + view?.run { + syncManager.startOneTimeSyncWorker().onEach { workInfo -> + when (workInfo.state) { + WorkInfo.State.ENQUEUED -> { + setSyncInProgress(true) + Timber.i("Setting sync now started") + analytics.logEvent("sync_now", "status" to "started") + } + WorkInfo.State.SUCCEEDED -> { + showMessage(syncSuccessString) + analytics.logEvent("sync_now", "status" to "success") + } + WorkInfo.State.FAILED -> { + showError(syncFailedString, Throwable(workInfo.outputData.getString("error"))) + analytics.logEvent("sync_now", "status" to "failed") + } + else -> Timber.d("Sync now state: ${workInfo.state}") + } + if (workInfo.state.isFinished) setSyncInProgress(false) + }.catch { + Timber.e(it, "Sync now failed") + }.launch("sync") + } + } + + fun onFixSyncIssuesClicked() { + view?.showFixSyncDialog() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/settings/SettingsView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/settings/SettingsView.kt new file mode 100644 index 00000000..b647c0b7 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/settings/SettingsView.kt @@ -0,0 +1,22 @@ +package io.github.wulkanowy.ui.modules.settings + +import io.github.wulkanowy.ui.base.BaseView + +interface SettingsView : BaseView { + + val syncSuccessString: String + + val syncFailedString: String + + fun initView() + + fun recreateView() + + fun updateLanguage(langCode: String) + + fun setServicesSuspended(serviceEnablesKey: String, isHolidays: Boolean) + + fun setSyncInProgress(inProgress: Boolean) + + fun showFixSyncDialog() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/splash/SplashActivity.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/splash/SplashActivity.kt new file mode 100644 index 00000000..7fc20d23 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/splash/SplashActivity.kt @@ -0,0 +1,37 @@ +package io.github.wulkanowy.ui.modules.splash + +import android.os.Bundle +import android.widget.Toast +import android.widget.Toast.LENGTH_LONG +import androidx.viewbinding.ViewBinding +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.ui.base.BaseActivity +import io.github.wulkanowy.ui.modules.login.LoginActivity +import io.github.wulkanowy.ui.modules.main.MainActivity +import javax.inject.Inject + +@AndroidEntryPoint +class SplashActivity : BaseActivity(), SplashView { + + @Inject + override lateinit var presenter: SplashPresenter + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + presenter.onAttachView(this) + } + + override fun openLoginView() { + startActivity(LoginActivity.getStartIntent(this)) + finish() + } + + override fun openMainView() { + startActivity(MainActivity.getStartIntent(this)) + finish() + } + + override fun showError(text: String, error: Throwable) { + Toast.makeText(this, text, LENGTH_LONG).show() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/splash/SplashPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/splash/SplashPresenter.kt new file mode 100644 index 00000000..d16ca4a8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/splash/SplashPresenter.kt @@ -0,0 +1,30 @@ +package io.github.wulkanowy.ui.modules.splash + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.flowWithResource +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class SplashPresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository +) : BasePresenter(errorHandler, studentRepository) { + + override fun onAttachView(view: SplashView) { + super.onAttachView(view) + flowWithResource { studentRepository.isCurrentStudentSet() }.onEach { + when (it.status) { + Status.LOADING -> Timber.d("Is current user set check started") + Status.SUCCESS -> with(view) { + if (it.data!!) openMainView() + else openLoginView() + } + Status.ERROR -> errorHandler.dispatch(it.error!!) + } + }.launch() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/splash/SplashView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/splash/SplashView.kt new file mode 100644 index 00000000..9efd8123 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/splash/SplashView.kt @@ -0,0 +1,10 @@ +package io.github.wulkanowy.ui.modules.splash + +import io.github.wulkanowy.ui.base.BaseView + +interface SplashView : BaseView { + + fun openLoginView() + + fun openMainView() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableAdapter.kt new file mode 100644 index 00000000..d87f0620 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableAdapter.kt @@ -0,0 +1,299 @@ +package io.github.wulkanowy.ui.modules.timetable + +import android.graphics.Paint +import android.view.LayoutInflater +import android.view.View.GONE +import android.view.View.VISIBLE +import android.view.ViewGroup +import android.widget.TextView +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Timetable +import io.github.wulkanowy.databinding.ItemTimetableBinding +import io.github.wulkanowy.databinding.ItemTimetableSmallBinding +import io.github.wulkanowy.utils.getThemeAttrColor +import io.github.wulkanowy.utils.isJustFinished +import io.github.wulkanowy.utils.isShowTimeUntil +import io.github.wulkanowy.utils.left +import io.github.wulkanowy.utils.toFormattedString +import io.github.wulkanowy.utils.until +import timber.log.Timber +import java.time.LocalDateTime +import java.util.Timer +import javax.inject.Inject +import kotlin.concurrent.timer + +class TimetableAdapter @Inject constructor() : RecyclerView.Adapter() { + + private enum class ViewType(val id: Int) { + ITEM_NORMAL(1), + ITEM_SMALL(2) + } + + var items = mutableListOf() + set(value) { + field = value + resetTimers() + } + + var onClickListener: (Timetable) -> Unit = {} + + var showWholeClassPlan: String = "no" + + var showTimers: Boolean = false + + private val timers = mutableMapOf() + + private fun resetTimers() { + Timber.d("Timetable timers reset") + with(timers) { + forEach { (_, timer) -> timer.cancel() } + clear() + } + } + + override fun getItemCount() = items.size + + override fun getItemViewType(position: Int) = when { + !items[position].isStudentPlan && showWholeClassPlan == "small" -> ViewType.ITEM_SMALL.id + else -> ViewType.ITEM_NORMAL.id + } + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): RecyclerView.ViewHolder { + val inflater = LayoutInflater.from(parent.context) + + return when (viewType) { + ViewType.ITEM_NORMAL.id -> ItemViewHolder(ItemTimetableBinding.inflate(inflater, parent, false)) + ViewType.ITEM_SMALL.id -> SmallItemViewHolder(ItemTimetableSmallBinding.inflate(inflater, parent, false)) + else -> throw IllegalStateException() + } + } + + override fun onDetachedFromRecyclerView(recyclerView: RecyclerView) { + super.onDetachedFromRecyclerView(recyclerView) + resetTimers() + } + + override fun onBindViewHolder(holder: RecyclerView.ViewHolder, position: Int) { + val lesson = items[position] + + when (holder) { + is ItemViewHolder -> bindNormalView(holder.binding, lesson, position) + is SmallItemViewHolder -> bindSmallView(holder.binding, lesson) + } + } + + private fun bindSmallView(binding: ItemTimetableSmallBinding, lesson: Timetable) { + with(binding) { + timetableSmallItemNumber.text = lesson.number.toString() + timetableSmallItemSubject.text = lesson.subject + timetableSmallItemTimeStart.text = lesson.start.toFormattedString("HH:mm") + timetableSmallItemRoom.text = lesson.room + timetableSmallItemTeacher.text = lesson.teacher + + bindSubjectStyle(timetableSmallItemSubject, lesson) + bindSmallDescription(binding, lesson) + bindSmallColors(binding, lesson) + + root.setOnClickListener { onClickListener(lesson) } + } + } + + private fun bindNormalView(binding: ItemTimetableBinding, lesson: Timetable, position: Int) { + with(binding) { + timetableItemNumber.text = lesson.number.toString() + timetableItemSubject.text = lesson.subject + timetableItemRoom.text = lesson.room + timetableItemTeacher.text = lesson.teacher + timetableItemTimeStart.text = lesson.start.toFormattedString("HH:mm") + timetableItemTimeFinish.text = lesson.end.toFormattedString("HH:mm") + + bindSubjectStyle(timetableItemSubject, lesson) + bindNormalDescription(binding, lesson) + bindNormalColors(binding, lesson) + + if (lesson.isStudentPlan && showTimers) timers[position] = timer(period = 1000) { + root.post { updateTimeLeft(binding, lesson, position) } + } else { + // reset item on set changed + timetableItemTimeUntil.visibility = GONE + timetableItemTimeLeft.visibility = GONE + } + + root.setOnClickListener { onClickListener(lesson) } + } + } + + private fun getPreviousLesson(position: Int): LocalDateTime? { + return items.filter { it.isStudentPlan }.getOrNull(position - 1 - items.filterIndexed { i, item -> i < position && !item.isStudentPlan }.size)?.let { + if (!it.canceled && it.isStudentPlan) it.end + else null + } + } + + private fun updateTimeLeft(binding: ItemTimetableBinding, lesson: Timetable, position: Int) { + val isShowTimeUntil = lesson.isShowTimeUntil(getPreviousLesson(position)) + val until = lesson.until + val left = lesson.left + val isJustFinished = lesson.isJustFinished + + with(binding) { + when { + // before lesson + isShowTimeUntil -> { + Timber.d("Show time until lesson: $position") + timetableItemTimeLeft.visibility = GONE + with(timetableItemTimeUntil) { + visibility = VISIBLE + text = context.getString(R.string.timetable_time_until, + if (until.seconds <= 60) { + context.getString(R.string.timetable_seconds, until.seconds.toString(10)) + } else { + context.getString(R.string.timetable_minutes, until.toMinutes().toString(10)) + } + ) + } + } + // after lesson start + left != null -> { + Timber.d("Show time left lesson: $position") + timetableItemTimeUntil.visibility = GONE + with(timetableItemTimeLeft) { + visibility = VISIBLE + text = context.getString( + R.string.timetable_time_left, + if (left.seconds < 60) { + context.getString(R.string.timetable_seconds, left.seconds.toString(10)) + } else { + context.getString(R.string.timetable_minutes, left.toMinutes().toString(10)) + } + ) + } + } + // right after lesson finish + isJustFinished -> { + Timber.d("Show just finished lesson: $position") + timetableItemTimeUntil.visibility = GONE + timetableItemTimeLeft.visibility = VISIBLE + timetableItemTimeLeft.text = root.context.getString(R.string.timetable_finished) + } + else -> { + timetableItemTimeUntil.visibility = GONE + timetableItemTimeLeft.visibility = GONE + } + } + } + } + + private fun bindSubjectStyle(subjectView: TextView, lesson: Timetable) { + subjectView.paintFlags = if (lesson.canceled) subjectView.paintFlags or Paint.STRIKE_THRU_TEXT_FLAG + else subjectView.paintFlags and Paint.STRIKE_THRU_TEXT_FLAG.inv() + } + + private fun bindSmallDescription(binding: ItemTimetableSmallBinding, lesson: Timetable) { + with(binding) { + if (lesson.info.isNotBlank() && !lesson.changes) { + timetableSmallItemDescription.visibility = VISIBLE + timetableSmallItemDescription.text = lesson.info + + timetableSmallItemRoom.visibility = GONE + timetableSmallItemTeacher.visibility = GONE + + timetableSmallItemDescription.setTextColor(root.context.getThemeAttrColor( + if (lesson.canceled) R.attr.colorPrimary + else R.attr.colorTimetableChange + )) + } else { + timetableSmallItemDescription.visibility = GONE + timetableSmallItemRoom.visibility = VISIBLE + timetableSmallItemTeacher.visibility = VISIBLE + } + } + } + + private fun bindNormalDescription(binding: ItemTimetableBinding, lesson: Timetable) { + with(binding) { + if (lesson.info.isNotBlank() && !lesson.changes) { + timetableItemDescription.visibility = VISIBLE + timetableItemDescription.text = lesson.info + + timetableItemRoom.visibility = GONE + timetableItemTeacher.visibility = GONE + + timetableItemDescription.setTextColor(root.context.getThemeAttrColor( + if (lesson.canceled) R.attr.colorPrimary + else R.attr.colorTimetableChange + )) + } else { + timetableItemDescription.visibility = GONE + timetableItemRoom.visibility = VISIBLE + timetableItemTeacher.visibility = VISIBLE + } + } + } + + private fun bindSmallColors(binding: ItemTimetableSmallBinding, lesson: Timetable) { + with(binding) { + if (lesson.canceled) { + updateNumberAndSubjectCanceledColor(timetableSmallItemNumber, timetableSmallItemSubject) + } else { + updateNumberColor(timetableSmallItemNumber, lesson) + updateSubjectColor(timetableSmallItemSubject, lesson) + updateRoomColor(timetableSmallItemRoom, lesson) + updateTeacherColor(timetableSmallItemTeacher, lesson) + } + } + } + + private fun bindNormalColors(binding: ItemTimetableBinding, lesson: Timetable) { + with(binding) { + if (lesson.canceled) { + updateNumberAndSubjectCanceledColor(timetableItemNumber, timetableItemSubject) + } else { + updateNumberColor(timetableItemNumber, lesson) + updateSubjectColor(timetableItemSubject, lesson) + updateRoomColor(timetableItemRoom, lesson) + updateTeacherColor(timetableItemTeacher, lesson) + } + } + } + + private fun updateNumberAndSubjectCanceledColor(numberView: TextView, subjectView: TextView) { + numberView.setTextColor(numberView.context.getThemeAttrColor(R.attr.colorPrimary)) + subjectView.setTextColor(subjectView.context.getThemeAttrColor(R.attr.colorPrimary)) + } + + private fun updateNumberColor(numberView: TextView, lesson: Timetable) { + numberView.setTextColor(numberView.context.getThemeAttrColor( + if (lesson.changes || lesson.info.isNotBlank()) R.attr.colorTimetableChange + else android.R.attr.textColorPrimary + )) + } + + private fun updateSubjectColor(subjectView: TextView, lesson: Timetable) { + subjectView.setTextColor(subjectView.context.getThemeAttrColor( + if (lesson.subjectOld.isNotBlank() && lesson.subjectOld != lesson.subject) R.attr.colorTimetableChange + else android.R.attr.textColorPrimary + )) + } + + private fun updateRoomColor(roomView: TextView, lesson: Timetable) { + roomView.setTextColor(roomView.context.getThemeAttrColor( + if (lesson.roomOld.isNotBlank() && lesson.roomOld != lesson.room) R.attr.colorTimetableChange + else android.R.attr.textColorSecondary + )) + } + + private fun updateTeacherColor(teacherTextView: TextView, lesson: Timetable) { + teacherTextView.setTextColor(teacherTextView.context.getThemeAttrColor( + if (lesson.teacherOld.isNotBlank() && lesson.teacherOld != lesson.teacher) R.attr.colorTimetableChange + else android.R.attr.textColorSecondary + )) + } + + private class ItemViewHolder(val binding: ItemTimetableBinding) : + RecyclerView.ViewHolder(binding.root) + + private class SmallItemViewHolder(val binding: ItemTimetableSmallBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableDialog.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableDialog.kt new file mode 100644 index 00000000..f7d5b1ed --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableDialog.kt @@ -0,0 +1,172 @@ +package io.github.wulkanowy.ui.modules.timetable + +import android.annotation.SuppressLint +import android.graphics.Paint.STRIKE_THRU_TEXT_FLAG +import android.os.Bundle +import android.view.LayoutInflater +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import android.view.ViewGroup +import androidx.fragment.app.DialogFragment +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Timetable +import io.github.wulkanowy.databinding.DialogTimetableBinding +import io.github.wulkanowy.utils.getThemeAttrColor +import io.github.wulkanowy.utils.lifecycleAwareVariable +import io.github.wulkanowy.utils.toFormattedString +import java.time.LocalDateTime + +class TimetableDialog : DialogFragment() { + + private var binding: DialogTimetableBinding by lifecycleAwareVariable() + + private lateinit var lesson: Timetable + + companion object { + private const val ARGUMENT_KEY = "Item" + + fun newInstance(exam: Timetable): TimetableDialog { + return TimetableDialog().apply { + arguments = Bundle().apply { putSerializable(ARGUMENT_KEY, exam) } + } + } + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setStyle(STYLE_NO_TITLE, 0) + arguments?.run { + lesson = getSerializable(ARGUMENT_KEY) as Timetable + } + } + + override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { + return DialogTimetableBinding.inflate(inflater).apply { binding = this }.root + } + + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + + with(lesson) { + setInfo(info, teacher, canceled, changes) + setSubject(subject, subjectOld) + setTeacher(teacher, teacherOld) + setGroup(group) + setRoom(room, roomOld) + setTime(start, end) + } + + binding.timetableDialogClose.setOnClickListener { dismiss() } + } + + private fun setSubject(subject: String, subjectOld: String) { + with(binding) { + timetableDialogSubject.text = subject + if (subjectOld.isNotBlank() && subjectOld != subject) { + timetableDialogSubject.run { + paintFlags = paintFlags or STRIKE_THRU_TEXT_FLAG + text = subjectOld + } + timetableDialogSubjectNew.run { + visibility = VISIBLE + text = subject + } + } + } + } + + private fun setInfo(info: String, teacher: String, canceled: Boolean, changes: Boolean) { + with(binding) { + when { + info.isNotBlank() -> { + if (canceled) { + timetableDialogChangesTitle.setTextColor(requireContext().getThemeAttrColor(R.attr.colorPrimary)) + timetableDialogChanges.setTextColor(requireContext().getThemeAttrColor(R.attr.colorPrimary)) + } else { + timetableDialogChangesTitle.setTextColor(requireContext().getThemeAttrColor(R.attr.colorTimetableChange)) + timetableDialogChanges.setTextColor(requireContext().getThemeAttrColor(R.attr.colorTimetableChange)) + } + + timetableDialogChanges.text = when { + canceled && !changes -> "Lekcja odwołana: $info" + changes && teacher.isNotBlank() -> "Zastępstwo: $teacher" + changes && teacher.isBlank() -> "Zastępstwo, ${info.decapitalize()}" + else -> info.capitalize() + } + } + else -> { + timetableDialogChangesTitle.visibility = GONE + timetableDialogChanges.visibility = GONE + } + } + } + } + + private fun setTeacher(teacher: String, teacherOld: String) { + with(binding) { + when { + teacherOld.isNotBlank() && teacherOld != teacher -> { + timetableDialogTeacher.run { + visibility = VISIBLE + paintFlags = paintFlags or STRIKE_THRU_TEXT_FLAG + text = teacherOld + } + if (teacher.isNotBlank()) { + timetableDialogTeacherNew.run { + visibility = VISIBLE + text = teacher + } + } + } + teacher.isNotBlank() -> timetableDialogTeacher.text = teacher + else -> { + timetableDialogTeacherTitle.visibility = GONE + timetableDialogTeacher.visibility = GONE + } + } + } + } + + private fun setGroup(group: String) { + with(binding) { + when { + group.isNotBlank() -> timetableDialogGroup.text = group + else -> { + timetableDialogGroupTitle.visibility = GONE + timetableDialogGroup.visibility = GONE + } + } + } + } + + private fun setRoom(room: String, roomOld: String) { + with(binding) { + when { + roomOld.isNotBlank() && roomOld != room -> { + timetableDialogRoom.run { + visibility = VISIBLE + paintFlags = paintFlags or STRIKE_THRU_TEXT_FLAG + text = roomOld + } + if (room.isNotBlank()) { + timetableDialogRoomNew.run { + visibility = VISIBLE + text = room + } + } + } + room.isNotBlank() -> timetableDialogRoom.text = room + else -> { + timetableDialogRoomTitle.visibility = GONE + timetableDialogRoom.visibility = GONE + } + } + } + } + + @SuppressLint("SetTextI18n") + private fun setTime(start: LocalDateTime, end: LocalDateTime) { + binding.timetableDialogTime.text = "${start.toFormattedString("HH:mm")} - ${end.toFormattedString("HH:mm")}" + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableFragment.kt new file mode 100644 index 00000000..2c5e136d --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableFragment.kt @@ -0,0 +1,191 @@ +package io.github.wulkanowy.ui.modules.timetable + +import android.os.Bundle +import android.view.Menu +import android.view.MenuInflater +import android.view.MenuItem +import android.view.View +import android.view.View.GONE +import android.view.View.VISIBLE +import androidx.recyclerview.widget.LinearLayoutManager +import com.wdullaer.materialdatetimepicker.date.DatePickerDialog +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Timetable +import io.github.wulkanowy.databinding.FragmentTimetableBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.modules.timetable.completed.CompletedLessonsFragment +import io.github.wulkanowy.ui.widgets.DividerItemDecoration +import io.github.wulkanowy.utils.SchooldaysRangeLimiter +import io.github.wulkanowy.utils.dpToPx +import java.time.LocalDate +import javax.inject.Inject + +@AndroidEntryPoint +class TimetableFragment : BaseFragment(R.layout.fragment_timetable), + TimetableView, MainView.MainChildView, MainView.TitledView { + + @Inject + lateinit var presenter: TimetablePresenter + + @Inject + lateinit var timetableAdapter: TimetableAdapter + + companion object { + private const val SAVED_DATE_KEY = "CURRENT_DATE" + + fun newInstance() = TimetableFragment() + } + + override val titleStringId get() = R.string.timetable_title + + override val isViewEmpty get() = timetableAdapter.items.isEmpty() + + override val currentStackSize get() = (activity as? MainActivity)?.currentStackSize + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setHasOptionsMenu(true) + } + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentTimetableBinding.bind(view) + messageContainer = binding.timetableRecycler + presenter.onAttachView(this, savedInstanceState?.getLong(SAVED_DATE_KEY)) + } + + override fun initView() { + timetableAdapter.onClickListener = presenter::onTimetableItemSelected + + with(binding.timetableRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = timetableAdapter + addItemDecoration(DividerItemDecoration(context)) + } + + with(binding) { + timetableSwipe.setOnRefreshListener(presenter::onSwipeRefresh) + timetableErrorRetry.setOnClickListener { presenter.onRetry() } + timetableErrorDetails.setOnClickListener { presenter.onDetailsClick() } + + timetablePreviousButton.setOnClickListener { presenter.onPreviousDay() } + timetableNavDate.setOnClickListener { presenter.onPickDate() } + timetableNextButton.setOnClickListener { presenter.onNextDay() } + + timetableNavContainer.setElevationCompat(requireContext().dpToPx(8f)) + } + } + + override fun onCreateOptionsMenu(menu: Menu, inflater: MenuInflater) { + inflater.inflate(R.menu.action_menu_timetable, menu) + } + + override fun onOptionsItemSelected(item: MenuItem): Boolean { + return if (item.itemId == R.id.timetableMenuCompletedLessons) presenter.onCompletedLessonsSwitchSelected() + else false + } + + override fun updateData(data: List, showWholeClassPlanType: String, showTimetableTimers: Boolean) { + with(timetableAdapter) { + items = data.toMutableList() + showTimers = showTimetableTimers + showWholeClassPlan = showWholeClassPlanType + notifyDataSetChanged() + } + } + + override fun clearData() { + with(timetableAdapter) { + items = mutableListOf() + notifyDataSetChanged() + } + } + + override fun updateNavigationDay(date: String) { + binding.timetableNavDate.text = date + } + + override fun hideRefresh() { + binding.timetableSwipe.isRefreshing = false + } + + override fun resetView() { + binding.timetableRecycler.smoothScrollToPosition(0) + } + + override fun onFragmentReselected() { + if (::presenter.isInitialized) presenter.onViewReselected() + } + + override fun popView() { + (activity as? MainActivity)?.popView() + } + + override fun showEmpty(show: Boolean) { + binding.timetableEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.timetableError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.timetableErrorMessage.text = message + } + + override fun showProgress(show: Boolean) { + binding.timetableProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.timetableSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.timetableRecycler.visibility = if (show) VISIBLE else GONE + } + + override fun showPreButton(show: Boolean) { + binding.timetablePreviousButton.visibility = if (show) VISIBLE else View.INVISIBLE + } + + override fun showNextButton(show: Boolean) { + binding.timetableNextButton.visibility = if (show) VISIBLE else View.INVISIBLE + } + + override fun showTimetableDialog(lesson: Timetable) { + (activity as? MainActivity)?.showDialogFragment(TimetableDialog.newInstance(lesson)) + } + + override fun showDatePickerDialog(currentDate: LocalDate) { + val dateSetListener = DatePickerDialog.OnDateSetListener { _, year, month, dayOfMonth -> + presenter.onDateSet(year, month + 1, dayOfMonth) + } + val datePickerDialog = DatePickerDialog.newInstance(dateSetListener, + currentDate.year, currentDate.monthValue - 1, currentDate.dayOfMonth) + + with(datePickerDialog) { + setDateRangeLimiter(SchooldaysRangeLimiter()) + version = DatePickerDialog.Version.VERSION_2 + scrollOrientation = DatePickerDialog.ScrollOrientation.VERTICAL + show(this@TimetableFragment.parentFragmentManager, null) + } + } + + override fun openCompletedLessonsView() { + (activity as? MainActivity)?.pushView(CompletedLessonsFragment.newInstance()) + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putLong(SAVED_DATE_KEY, presenter.currentDate.toEpochDay()) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetablePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetablePresenter.kt new file mode 100644 index 00000000..8581b73c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetablePresenter.kt @@ -0,0 +1,207 @@ +package io.github.wulkanowy.ui.modules.timetable + +import android.annotation.SuppressLint +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.Timetable +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.data.repositories.timetable.TimetableRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import io.github.wulkanowy.utils.getLastSchoolDayIfHoliday +import io.github.wulkanowy.utils.isHolidays +import io.github.wulkanowy.utils.nextOrSameSchoolDay +import io.github.wulkanowy.utils.nextSchoolDay +import io.github.wulkanowy.utils.previousSchoolDay +import io.github.wulkanowy.utils.toFormattedString +import kotlinx.coroutines.flow.catch +import kotlinx.coroutines.flow.flow +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import java.lang.NullPointerException +import java.time.LocalDate +import java.time.LocalDate.now +import java.time.LocalDate.of +import java.time.LocalDate.ofEpochDay +import javax.inject.Inject + +class TimetablePresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val timetableRepository: TimetableRepository, + private val semesterRepository: SemesterRepository, + private val prefRepository: PreferencesRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(errorHandler, studentRepository) { + + private var baseDate: LocalDate = now().nextOrSameSchoolDay + + lateinit var currentDate: LocalDate + private set + + private lateinit var lastError: Throwable + + fun onAttachView(view: TimetableView, date: Long?) { + super.onAttachView(view) + view.initView() + Timber.i("Timetable was initialized") + errorHandler.showErrorMessage = ::showErrorViewOnError + loadData(ofEpochDay(date ?: baseDate.toEpochDay())) + if (currentDate.isHolidays) setBaseDateOnHolidays() + reloadView() + } + + fun onPreviousDay() { + loadData(currentDate.previousSchoolDay) + reloadView() + } + + fun onNextDay() { + loadData(currentDate.nextSchoolDay) + reloadView() + } + + fun onPickDate() { + view?.showDatePickerDialog(currentDate) + } + + fun onDateSet(year: Int, month: Int, day: Int) { + loadData(of(year, month, day)) + reloadView() + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the timetable") + loadData(currentDate, true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(currentDate, true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onViewReselected() { + Timber.i("Timetable view is reselected") + view?.also { view -> + if (view.currentStackSize == 1) { + baseDate.also { + if (currentDate != it) { + loadData(it) + reloadView() + } else if (!view.isViewEmpty) view.resetView() + } + } else view.popView() + } + } + + fun onTimetableItemSelected(lesson: Timetable) { + Timber.i("Select timetable item ${lesson.id}") + view?.showTimetableDialog(lesson) + } + + fun onCompletedLessonsSwitchSelected(): Boolean { + view?.openCompletedLessonsView() + return true + } + + private fun setBaseDateOnHolidays() { + flow { + val student = studentRepository.getCurrentStudent() + emit(semesterRepository.getCurrentSemester(student)) + }.catch { + Timber.i("Loading semester result: An exception occurred") + }.onEach { + baseDate = baseDate.getLastSchoolDayIfHoliday(it.schoolYear) + currentDate = baseDate + reloadNavigation() + }.launch("holidays") + } + + private fun loadData(date: LocalDate, forceRefresh: Boolean = false) { + currentDate = date + + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + timetableRepository.getTimetable(student, semester, date, date, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading timetable data started") + Status.SUCCESS -> { + Timber.i("Loading timetable result: Success") + view?.apply { + updateData( + showWholeClassPlanType = prefRepository.showWholeClassPlan, + showTimetableTimers = prefRepository.showTimetableTimers, + data = it.data!! + .filter { item -> if (prefRepository.showWholeClassPlan == "no") item.isStudentPlan else true } + .sortedWith(compareBy({ item -> item.number }, { item -> !item.isStudentPlan })) + ) + showEmpty(it.data.isEmpty()) + showErrorView(false) + showContent(it.data.isNotEmpty()) + } + analytics.logEvent( + "load_data", + "type" to "timetable", + "items" to it.data!!.size + ) + } + Status.ERROR -> { + Timber.i("Loading timetable result: An exception occurred") + errorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + private fun reloadView() { + Timber.i("Reload timetable view with the date ${currentDate.toFormattedString()}") + view?.apply { + showProgress(true) + enableSwipe(false) + showContent(false) + showEmpty(false) + showErrorView(false) + clearData() + reloadNavigation() + } + } + + @SuppressLint("DefaultLocale") + private fun reloadNavigation() { + view?.apply { + showPreButton(!currentDate.minusDays(1).isHolidays) + showNextButton(!currentDate.plusDays(1).isHolidays) + updateNavigationDay(currentDate.toFormattedString("EEEE, dd.MM").capitalize()) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableView.kt new file mode 100644 index 00000000..fe34f1ee --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/TimetableView.kt @@ -0,0 +1,48 @@ +package io.github.wulkanowy.ui.modules.timetable + +import io.github.wulkanowy.data.db.entities.Timetable +import io.github.wulkanowy.ui.base.BaseView +import java.time.LocalDate + +interface TimetableView : BaseView { + + val isViewEmpty: Boolean + + val currentStackSize: Int? + + fun initView() + + fun updateData(data: List, showWholeClassPlanType: String, showTimetableTimers: Boolean) + + fun updateNavigationDay(date: String) + + fun clearData() + + fun hideRefresh() + + fun resetView() + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) + + fun showPreButton(show: Boolean) + + fun showNextButton(show: Boolean) + + fun showTimetableDialog(lesson: Timetable) + + fun showDatePickerDialog(currentDate: LocalDate) + + fun popView() + + fun openCompletedLessonsView() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonDialog.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonDialog.kt new file mode 100644 index 00000000..56ea16cf --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonDialog.kt @@ -0,0 +1,83 @@ +package io.github.wulkanowy.ui.modules.timetable.completed + +import android.annotation.SuppressLint +import android.os.Bundle +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.fragment.app.DialogFragment +import io.github.wulkanowy.data.db.entities.CompletedLesson +import io.github.wulkanowy.databinding.DialogLessonCompletedBinding +import io.github.wulkanowy.utils.lifecycleAwareVariable + +class CompletedLessonDialog : DialogFragment() { + + private var binding: DialogLessonCompletedBinding by lifecycleAwareVariable() + + private lateinit var completedLesson: CompletedLesson + + companion object { + private const val ARGUMENT_KEY = "Item" + + fun newInstance(exam: CompletedLesson): CompletedLessonDialog { + return CompletedLessonDialog().apply { + arguments = Bundle().apply { putSerializable(ARGUMENT_KEY, exam) } + } + } + } + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setStyle(STYLE_NO_TITLE, 0) + arguments?.run { + completedLesson = getSerializable(ARGUMENT_KEY) as CompletedLesson + } + } + + override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { + return DialogLessonCompletedBinding.inflate(inflater).apply { binding = this }.root + } + + @SuppressLint("SetTextI18n") + override fun onActivityCreated(savedInstanceState: Bundle?) { + super.onActivityCreated(savedInstanceState) + + with(binding) { + completedLessonDialogSubject.text = completedLesson.subject + completedLessonDialogTopic.text = completedLesson.topic + completedLessonDialogTeacher.text = completedLesson.teacher + completedLessonDialogAbsence.text = completedLesson.absence + completedLessonDialogChanges.text = completedLesson.substitution + completedLessonDialogResources.text = completedLesson.resources + } + + completedLesson.substitution.let { + if (it.isBlank()) { + with(binding) { + completedLessonDialogChangesTitle.visibility = View.GONE + completedLessonDialogChanges.visibility = View.GONE + } + } else binding.completedLessonDialogChanges.text = it + } + + completedLesson.absence.let { + if (it.isBlank()) { + with(binding) { + completedLessonDialogAbsenceTitle.visibility = View.GONE + completedLessonDialogAbsence.visibility = View.GONE + } + } else binding.completedLessonDialogAbsence.text = it + } + + completedLesson.resources.let { + if (it.isBlank()) { + with(binding) { + completedLessonDialogResourcesTitle.visibility = View.GONE + completedLessonDialogResources.visibility = View.GONE + } + } else binding.completedLessonDialogResources.text = it + } + + binding.completedLessonDialogClose.setOnClickListener { dismiss() } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsAdapter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsAdapter.kt new file mode 100644 index 00000000..3399a8a2 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsAdapter.kt @@ -0,0 +1,45 @@ +package io.github.wulkanowy.ui.modules.timetable.completed + +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.CompletedLesson +import io.github.wulkanowy.databinding.ItemCompletedLessonBinding +import io.github.wulkanowy.utils.getThemeAttrColor +import javax.inject.Inject + +class CompletedLessonsAdapter @Inject constructor() : + RecyclerView.Adapter() { + + var items = emptyList() + + var onClickListener: (CompletedLesson) -> Unit = {} + + override fun getItemCount() = items.size + + override fun onCreateViewHolder(parent: ViewGroup, viewType: Int) = ItemViewHolder( + ItemCompletedLessonBinding.inflate(LayoutInflater.from(parent.context), parent, false) + ) + + override fun onBindViewHolder(holder: ItemViewHolder, position: Int) { + val item = items[position] + + with(holder.binding) { + completedLessonItemNumber.text = item.number.toString() + completedLessonItemNumber.setTextColor(root.context.getThemeAttrColor( + if (item.substitution.isNotEmpty()) R.attr.colorTimetableChange + else android.R.attr.textColorPrimary + )) + completedLessonItemSubject.text = item.subject + completedLessonItemTopic.text = item.topic + completedLessonItemAlert.visibility = if (item.substitution.isNotEmpty()) View.VISIBLE else View.GONE + + root.setOnClickListener { onClickListener(item) } + } + } + + class ItemViewHolder(val binding: ItemCompletedLessonBinding) : + RecyclerView.ViewHolder(binding.root) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsErrorHandler.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsErrorHandler.kt new file mode 100644 index 00000000..767c2f31 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsErrorHandler.kt @@ -0,0 +1,27 @@ +package io.github.wulkanowy.ui.modules.timetable.completed + +import android.content.res.Resources +import com.chuckerteam.chucker.api.ChuckerCollector +import io.github.wulkanowy.sdk.scrapper.exception.FeatureDisabledException +import io.github.wulkanowy.ui.base.ErrorHandler +import javax.inject.Inject + +class CompletedLessonsErrorHandler @Inject constructor( + resources: Resources, + chuckerCollector: ChuckerCollector +) : ErrorHandler(resources, chuckerCollector) { + + var onFeatureDisabled: () -> Unit = {} + + override fun proceed(error: Throwable) { + when (error) { + is FeatureDisabledException -> onFeatureDisabled() + else -> super.proceed(error) + } + } + + override fun clear() { + super.clear() + onFeatureDisabled = {} + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsFragment.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsFragment.kt new file mode 100644 index 00000000..5b77fc1f --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsFragment.kt @@ -0,0 +1,163 @@ +package io.github.wulkanowy.ui.modules.timetable.completed + +import android.os.Bundle +import android.view.View +import android.view.View.GONE +import android.view.View.INVISIBLE +import android.view.View.VISIBLE +import androidx.recyclerview.widget.LinearLayoutManager +import com.wdullaer.materialdatetimepicker.date.DatePickerDialog +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.CompletedLesson +import io.github.wulkanowy.databinding.FragmentTimetableCompletedBinding +import io.github.wulkanowy.ui.base.BaseFragment +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.widgets.DividerItemDecoration +import io.github.wulkanowy.utils.SchooldaysRangeLimiter +import io.github.wulkanowy.utils.dpToPx +import io.github.wulkanowy.utils.getCompatDrawable +import java.time.LocalDate +import javax.inject.Inject + +@AndroidEntryPoint +class CompletedLessonsFragment : + BaseFragment(R.layout.fragment_timetable_completed), + CompletedLessonsView, MainView.TitledView { + + @Inject + lateinit var presenter: CompletedLessonsPresenter + + @Inject + lateinit var completedLessonsAdapter: CompletedLessonsAdapter + + companion object { + private const val SAVED_DATE_KEY = "CURRENT_DATE" + + fun newInstance() = CompletedLessonsFragment() + } + + override val titleStringId get() = R.string.completed_lessons_title + + override val isViewEmpty get() = completedLessonsAdapter.items.isEmpty() + + override fun onViewCreated(view: View, savedInstanceState: Bundle?) { + super.onViewCreated(view, savedInstanceState) + binding = FragmentTimetableCompletedBinding.bind(view) + messageContainer = binding.completedLessonsRecycler + presenter.onAttachView(this, savedInstanceState?.getLong(SAVED_DATE_KEY)) + } + + override fun initView() { + completedLessonsAdapter.onClickListener = presenter::onCompletedLessonsItemSelected + + with(binding.completedLessonsRecycler) { + layoutManager = LinearLayoutManager(context) + adapter = completedLessonsAdapter + addItemDecoration(DividerItemDecoration(context)) + } + + with(binding) { + completedLessonsSwipe.setOnRefreshListener(presenter::onSwipeRefresh) + completedLessonErrorRetry.setOnClickListener { presenter.onRetry() } + completedLessonErrorDetails.setOnClickListener { presenter.onDetailsClick() } + + completedLessonsPreviousButton.setOnClickListener { presenter.onPreviousDay() } + completedLessonsNavDate.setOnClickListener { presenter.onPickDate() } + completedLessonsNextButton.setOnClickListener { presenter.onNextDay() } + + completedLessonsNavContainer.setElevationCompat(requireContext().dpToPx(8f)) + } + } + + override fun updateData(data: List) { + with(completedLessonsAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun clearData() { + with(completedLessonsAdapter) { + items = emptyList() + notifyDataSetChanged() + } + } + + override fun updateNavigationDay(date: String) { + binding.completedLessonsNavDate.text = date + } + + override fun hideRefresh() { + binding.completedLessonsSwipe.isRefreshing = false + } + + override fun showEmpty(show: Boolean) { + binding.completedLessonsEmpty.visibility = if (show) VISIBLE else GONE + } + + override fun showErrorView(show: Boolean) { + binding.completedLessonError.visibility = if (show) VISIBLE else GONE + } + + override fun setErrorDetails(message: String) { + binding.completedLessonErrorMessage.text = message + } + + override fun showFeatureDisabled() { + with(binding) { + completedLessonsInfo.text = getString(R.string.error_feature_disabled) + completedLessonsInfoImage.setImageDrawable(requireContext().getCompatDrawable(R.drawable.ic_all_close_circle)) + } + } + + override fun showProgress(show: Boolean) { + binding.completedLessonsProgress.visibility = if (show) VISIBLE else GONE + } + + override fun enableSwipe(enable: Boolean) { + binding.completedLessonsSwipe.isEnabled = enable + } + + override fun showContent(show: Boolean) { + binding.completedLessonsRecycler.visibility = if (show) VISIBLE else GONE + } + + override fun showPreButton(show: Boolean) { + binding.completedLessonsPreviousButton.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showNextButton(show: Boolean) { + binding.completedLessonsNextButton.visibility = if (show) VISIBLE else INVISIBLE + } + + override fun showCompletedLessonDialog(completedLesson: CompletedLesson) { + (activity as? MainActivity)?.showDialogFragment(CompletedLessonDialog.newInstance(completedLesson)) + } + + override fun showDatePickerDialog(currentDate: LocalDate) { + val dateSetListener = DatePickerDialog.OnDateSetListener { _, year, month, dayOfMonth -> + presenter.onDateSet(year, month + 1, dayOfMonth) + } + val datePickerDialog = DatePickerDialog.newInstance(dateSetListener, + currentDate.year, currentDate.monthValue - 1, currentDate.dayOfMonth) + + with(datePickerDialog) { + setDateRangeLimiter(SchooldaysRangeLimiter()) + version = DatePickerDialog.Version.VERSION_2 + scrollOrientation = DatePickerDialog.ScrollOrientation.VERTICAL + show(this@CompletedLessonsFragment.parentFragmentManager, null) + } + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + outState.putLong(SAVED_DATE_KEY, presenter.currentDate.toEpochDay()) + } + + override fun onDestroyView() { + presenter.onDetachView() + super.onDestroyView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsPresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsPresenter.kt new file mode 100644 index 00000000..f1c2cedc --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsPresenter.kt @@ -0,0 +1,182 @@ +package io.github.wulkanowy.ui.modules.timetable.completed + +import android.annotation.SuppressLint +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.entities.CompletedLesson +import io.github.wulkanowy.data.repositories.completedlessons.CompletedLessonsRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.afterLoading +import io.github.wulkanowy.utils.flowWithResourceIn +import io.github.wulkanowy.utils.getLastSchoolDayIfHoliday +import io.github.wulkanowy.utils.isHolidays +import io.github.wulkanowy.utils.nextOrSameSchoolDay +import io.github.wulkanowy.utils.nextSchoolDay +import io.github.wulkanowy.utils.previousSchoolDay +import io.github.wulkanowy.utils.toFormattedString +import kotlinx.coroutines.flow.catch +import kotlinx.coroutines.flow.flow +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import java.time.LocalDate +import java.time.LocalDate.now +import java.time.LocalDate.ofEpochDay +import javax.inject.Inject + +class CompletedLessonsPresenter @Inject constructor( + studentRepository: StudentRepository, + private val completedLessonsErrorHandler: CompletedLessonsErrorHandler, + private val semesterRepository: SemesterRepository, + private val completedLessonsRepository: CompletedLessonsRepository, + private val analytics: FirebaseAnalyticsHelper +) : BasePresenter(completedLessonsErrorHandler, studentRepository) { + + private var baseDate: LocalDate = now().nextOrSameSchoolDay + + lateinit var currentDate: LocalDate + private set + + private lateinit var lastError: Throwable + + fun onAttachView(view: CompletedLessonsView, date: Long?) { + super.onAttachView(view) + Timber.i("Completed lessons is attached") + view.initView() + completedLessonsErrorHandler.showErrorMessage = ::showErrorViewOnError + completedLessonsErrorHandler.onFeatureDisabled = { + this.view?.showFeatureDisabled() + this.view?.showEmpty(true) + Timber.i("Completed lessons feature disabled by school") + } + loadData(ofEpochDay(date ?: baseDate.toEpochDay())) + if (currentDate.isHolidays) setBaseDateOnHolidays() + reloadView() + } + + fun onPreviousDay() { + loadData(currentDate.previousSchoolDay) + reloadView() + } + + fun onNextDay() { + loadData(currentDate.nextSchoolDay) + reloadView() + } + + fun onPickDate() { + view?.showDatePickerDialog(currentDate) + } + + fun onDateSet(year: Int, month: Int, day: Int) { + loadData(LocalDate.of(year, month, day)) + reloadView() + } + + fun onSwipeRefresh() { + Timber.i("Force refreshing the completed lessons") + loadData(currentDate, true) + } + + fun onRetry() { + view?.run { + showErrorView(false) + showProgress(true) + } + loadData(currentDate, true) + } + + fun onDetailsClick() { + view?.showErrorDetailsDialog(lastError) + } + + fun onCompletedLessonsItemSelected(completedLesson: CompletedLesson) { + Timber.i("Select completed lessons item ${completedLesson.id}") + view?.showCompletedLessonDialog(completedLesson) + } + + private fun setBaseDateOnHolidays() { + flow { + val student = studentRepository.getCurrentStudent() + emit(semesterRepository.getCurrentSemester(student)) + }.catch { + Timber.i("Loading semester result: An exception occurred") + }.onEach { + baseDate = baseDate.getLastSchoolDayIfHoliday(it.schoolYear) + currentDate = baseDate + reloadNavigation() + }.launch("holidays") + } + + private fun loadData(date: LocalDate, forceRefresh: Boolean = false) { + currentDate = date + + flowWithResourceIn { + val student = studentRepository.getCurrentStudent() + val semester = semesterRepository.getCurrentSemester(student) + completedLessonsRepository.getCompletedLessons(student, semester, date, date, forceRefresh) + }.onEach { + when (it.status) { + Status.LOADING -> Timber.i("Loading completed lessons data started") + Status.SUCCESS -> { + Timber.i("Loading completed lessons lessons result: Success") + view?.apply { + updateData(it.data!!.sortedBy { item -> item.number }) + showEmpty(it.data.isEmpty()) + showErrorView(false) + showContent(it.data.isNotEmpty()) + } + analytics.logEvent( + "load_data", + "type" to "completed_lessons", + "items" to it.data!!.size + ) + } + Status.ERROR -> { + Timber.i("Loading completed lessons result: An exception occurred") + completedLessonsErrorHandler.dispatch(it.error!!) + } + } + }.afterLoading { + view?.run { + hideRefresh() + showProgress(false) + enableSwipe(true) + } + }.launch() + } + + private fun showErrorViewOnError(message: String, error: Throwable) { + view?.run { + if (isViewEmpty) { + lastError = error + setErrorDetails(message) + showErrorView(true) + showEmpty(false) + } else showError(message, error) + } + } + + private fun reloadView() { + Timber.i("Reload completed lessons view with the date ${currentDate.toFormattedString()}") + view?.apply { + showProgress(true) + enableSwipe(false) + showContent(false) + showEmpty(false) + showErrorView(false) + clearData() + reloadNavigation() + } + } + + @SuppressLint("DefaultLocale") + private fun reloadNavigation() { + view?.apply { + showPreButton(!currentDate.minusDays(1).isHolidays) + showNextButton(!currentDate.plusDays(1).isHolidays) + updateNavigationDay(currentDate.toFormattedString("EEEE, dd.MM").capitalize()) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsView.kt new file mode 100644 index 00000000..7e92cc63 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetable/completed/CompletedLessonsView.kt @@ -0,0 +1,42 @@ +package io.github.wulkanowy.ui.modules.timetable.completed + +import io.github.wulkanowy.data.db.entities.CompletedLesson +import io.github.wulkanowy.ui.base.BaseView +import java.time.LocalDate + +interface CompletedLessonsView : BaseView { + + val isViewEmpty: Boolean + + fun initView() + + fun updateData(data: List) + + fun clearData() + + fun updateNavigationDay(date: String) + + fun hideRefresh() + + fun showEmpty(show: Boolean) + + fun showErrorView(show: Boolean) + + fun setErrorDetails(message: String) + + fun showFeatureDisabled() + + fun showProgress(show: Boolean) + + fun enableSwipe(enable: Boolean) + + fun showContent(show: Boolean) + + fun showPreButton(show: Boolean) + + fun showNextButton(show: Boolean) + + fun showCompletedLessonDialog(completedLesson: CompletedLesson) + + fun showDatePickerDialog(currentDate: LocalDate) +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetConfigureActivity.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetConfigureActivity.kt new file mode 100644 index 00000000..23d1f27a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetConfigureActivity.kt @@ -0,0 +1,110 @@ +package io.github.wulkanowy.ui.modules.timetablewidget + +import android.appwidget.AppWidgetManager.ACTION_APPWIDGET_UPDATE +import android.appwidget.AppWidgetManager.EXTRA_APPWIDGET_ID +import android.appwidget.AppWidgetManager.EXTRA_APPWIDGET_IDS +import android.content.Intent +import android.os.Build +import android.os.Bundle +import android.widget.Toast +import android.widget.Toast.LENGTH_LONG +import androidx.appcompat.app.AlertDialog +import androidx.recyclerview.widget.LinearLayoutManager +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.databinding.ActivityWidgetConfigureBinding +import io.github.wulkanowy.ui.base.BaseActivity +import io.github.wulkanowy.ui.base.WidgetConfigureAdapter +import io.github.wulkanowy.ui.modules.login.LoginActivity +import io.github.wulkanowy.ui.modules.timetablewidget.TimetableWidgetProvider.Companion.EXTRA_FROM_PROVIDER +import io.github.wulkanowy.utils.AppInfo +import javax.inject.Inject + +@AndroidEntryPoint +class TimetableWidgetConfigureActivity : + BaseActivity(), + TimetableWidgetConfigureView { + + @Inject + lateinit var configureAdapter: WidgetConfigureAdapter + + @Inject + override lateinit var presenter: TimetableWidgetConfigurePresenter + + @Inject + lateinit var appInfo: AppInfo + + private var dialog: AlertDialog? = null + + override public fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + setResult(RESULT_CANCELED) + setContentView(ActivityWidgetConfigureBinding.inflate(layoutInflater).apply { binding = this }.root) + + intent.extras.let { + presenter.onAttachView(this, it?.getInt(EXTRA_APPWIDGET_ID), it?.getBoolean(EXTRA_FROM_PROVIDER)) + } + } + + override fun initView() { + with(binding.widgetConfigureRecycler) { + adapter = configureAdapter + layoutManager = LinearLayoutManager(context) + } + + configureAdapter.onClickListener = presenter::onItemSelect + } + + override fun showThemeDialog() { + var items = arrayOf( + getString(R.string.widget_timetable_theme_light), + getString(R.string.widget_timetable_theme_dark) + ) + if (appInfo.systemVersion >= Build.VERSION_CODES.Q) items += getString(R.string.widget_timetable_theme_system) + + dialog = AlertDialog.Builder(this, R.style.WulkanowyTheme_WidgetAccountSwitcher) + .setTitle(R.string.widget_timetable_theme_title) + .setOnDismissListener { presenter.onDismissThemeView() } + .setSingleChoiceItems(items, -1) { _, which -> + presenter.onThemeSelect(which) + } + .show() + } + + override fun updateData(data: List>) { + with(configureAdapter) { + items = data + notifyDataSetChanged() + } + } + + override fun updateTimetableWidget(widgetId: Int) { + sendBroadcast(Intent(this, TimetableWidgetProvider::class.java) + .apply { + action = ACTION_APPWIDGET_UPDATE + putExtra(EXTRA_APPWIDGET_IDS, intArrayOf(widgetId)) + }) + } + + override fun setSuccessResult(widgetId: Int) { + setResult(RESULT_OK, Intent().apply { putExtra(EXTRA_APPWIDGET_ID, widgetId) }) + } + + override fun showError(text: String, error: Throwable) { + Toast.makeText(this, text, LENGTH_LONG).show() + } + + override fun finishView() { + finish() + } + + override fun openLoginView() { + startActivity(LoginActivity.getStartIntent(this)) + } + + override fun onDestroy() { + super.onDestroy() + dialog?.dismiss() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetConfigurePresenter.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetConfigurePresenter.kt new file mode 100644 index 00000000..2274ecb9 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetConfigurePresenter.kt @@ -0,0 +1,88 @@ +package io.github.wulkanowy.ui.modules.timetablewidget + +import io.github.wulkanowy.data.Status +import io.github.wulkanowy.data.db.SharedPrefProvider +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.ui.base.BasePresenter +import io.github.wulkanowy.ui.base.ErrorHandler +import io.github.wulkanowy.ui.modules.timetablewidget.TimetableWidgetProvider.Companion.getStudentWidgetKey +import io.github.wulkanowy.ui.modules.timetablewidget.TimetableWidgetProvider.Companion.getThemeWidgetKey +import io.github.wulkanowy.utils.flowWithResource +import kotlinx.coroutines.flow.onEach +import timber.log.Timber +import javax.inject.Inject + +class TimetableWidgetConfigurePresenter @Inject constructor( + errorHandler: ErrorHandler, + studentRepository: StudentRepository, + private val sharedPref: SharedPrefProvider +) : BasePresenter(errorHandler, studentRepository) { + + private var appWidgetId: Int? = null + + private var isFromProvider = false + + private var selectedStudent: Student? = null + + fun onAttachView(view: TimetableWidgetConfigureView, appWidgetId: Int?, isFromProvider: Boolean?) { + super.onAttachView(view) + this.appWidgetId = appWidgetId + this.isFromProvider = isFromProvider ?: false + view.initView() + loadData() + } + + fun onItemSelect(student: Student) { + selectedStudent = student + + if (isFromProvider) registerStudent(selectedStudent) + else view?.showThemeDialog() + } + + fun onThemeSelect(index: Int) { + appWidgetId?.let { + sharedPref.putLong(getThemeWidgetKey(it), index.toLong()) + } + registerStudent(selectedStudent) + } + + fun onDismissThemeView() { + view?.finishView() + } + + private fun loadData() { + flowWithResource { studentRepository.getSavedStudents(false) }.onEach { + when (it.status) { + Status.LOADING -> Timber.d("Timetable widget configure students data load") + Status.SUCCESS -> { + val widgetId = appWidgetId?.let { id -> sharedPref.getLong(getStudentWidgetKey(id), 0) } + when { + it.data!!.isEmpty() -> view?.openLoginView() + it.data.size == 1 && !isFromProvider -> { + selectedStudent = it.data.single().student + view?.showThemeDialog() + } + else -> view?.updateData(it.data.map { entity -> + entity.student to (entity.student.id == widgetId) + }) + } + } + Status.ERROR -> errorHandler.dispatch(it.error!!) + } + }.launch() + } + + private fun registerStudent(student: Student?) { + requireNotNull(student) + + appWidgetId?.let { id -> + sharedPref.putLong(getStudentWidgetKey(id), student.id) + view?.run { + updateTimetableWidget(id) + setSuccessResult(id) + } + } + view?.finishView() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetConfigureView.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetConfigureView.kt new file mode 100644 index 00000000..056225ab --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetConfigureView.kt @@ -0,0 +1,21 @@ +package io.github.wulkanowy.ui.modules.timetablewidget + +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.ui.base.BaseView + +interface TimetableWidgetConfigureView : BaseView { + + fun initView() + + fun updateData(data: List>) + + fun updateTimetableWidget(widgetId: Int) + + fun showThemeDialog() + + fun setSuccessResult(widgetId: Int) + + fun finishView() + + fun openLoginView() +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetFactory.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetFactory.kt new file mode 100644 index 00000000..c7b4d4a8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetFactory.kt @@ -0,0 +1,218 @@ +package io.github.wulkanowy.ui.modules.timetablewidget + +import android.annotation.SuppressLint +import android.appwidget.AppWidgetManager.EXTRA_APPWIDGET_ID +import android.content.Context +import android.content.Intent +import android.graphics.Paint.ANTI_ALIAS_FLAG +import android.graphics.Paint.STRIKE_THRU_TEXT_FLAG +import android.view.View.GONE +import android.view.View.VISIBLE +import android.widget.AdapterView.INVALID_POSITION +import android.widget.RemoteViews +import android.widget.RemoteViewsService +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.SharedPrefProvider +import io.github.wulkanowy.data.db.entities.Timetable +import io.github.wulkanowy.data.repositories.preferences.PreferencesRepository +import io.github.wulkanowy.data.repositories.semester.SemesterRepository +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.data.repositories.timetable.TimetableRepository +import io.github.wulkanowy.ui.modules.timetablewidget.TimetableWidgetProvider.Companion.getCurrentThemeWidgetKey +import io.github.wulkanowy.ui.modules.timetablewidget.TimetableWidgetProvider.Companion.getDateWidgetKey +import io.github.wulkanowy.ui.modules.timetablewidget.TimetableWidgetProvider.Companion.getStudentWidgetKey +import io.github.wulkanowy.utils.getCompatColor +import io.github.wulkanowy.utils.toFirstResult +import io.github.wulkanowy.utils.toFormattedString +import kotlinx.coroutines.runBlocking +import timber.log.Timber +import java.time.LocalDate + +class TimetableWidgetFactory( + private val timetableRepository: TimetableRepository, + private val studentRepository: StudentRepository, + private val semesterRepository: SemesterRepository, + private val prefRepository: PreferencesRepository, + private val sharedPref: SharedPrefProvider, + private val context: Context, + private val intent: Intent? +) : RemoteViewsService.RemoteViewsFactory { + + private var lessons = emptyList() + + private var savedCurrentTheme: Long? = null + + private var primaryColor: Int? = null + + private var textColor: Int? = null + + private var timetableChangeColor: Int? = null + + override fun getLoadingView() = null + + override fun hasStableIds() = true + + override fun getCount() = lessons.size + + override fun getViewTypeCount() = 2 + + override fun getItemId(position: Int) = position.toLong() + + override fun onCreate() {} + + override fun onDestroy() {} + + override fun onDataSetChanged() { + intent?.extras?.getInt(EXTRA_APPWIDGET_ID)?.let { appWidgetId -> + val date = LocalDate.ofEpochDay(sharedPref.getLong(getDateWidgetKey(appWidgetId), 0)) + val studentId = sharedPref.getLong(getStudentWidgetKey(appWidgetId), 0) + + updateTheme(appWidgetId) + lessons = getLessons(date, studentId) + } + } + + private fun updateTheme(appWidgetId: Int) { + savedCurrentTheme = sharedPref.getLong(getCurrentThemeWidgetKey(appWidgetId), 0) + + if (savedCurrentTheme == 0L) { + primaryColor = R.color.colorPrimary + textColor = android.R.color.black + timetableChangeColor = R.color.timetable_change_dark + } else { + primaryColor = R.color.colorPrimaryLight + textColor = android.R.color.white + timetableChangeColor = R.color.timetable_change_light + } + } + + private fun getItemLayout(lesson: Timetable): Int { + return when { + prefRepository.showWholeClassPlan == "small" && !lesson.isStudentPlan -> { + if (savedCurrentTheme == 0L) R.layout.item_widget_timetable_small + else R.layout.item_widget_timetable_small_dark + } + savedCurrentTheme == 1L -> R.layout.item_widget_timetable_dark + else -> R.layout.item_widget_timetable + } + } + + private fun getLessons(date: LocalDate, studentId: Long) = try { + runBlocking { + if (!studentRepository.isStudentSaved()) return@runBlocking emptyList() + + val students = studentRepository.getSavedStudents() + val student = students.singleOrNull { it.student.id == studentId }?.student + ?: return@runBlocking emptyList() + + val semester = semesterRepository.getCurrentSemester(student) + timetableRepository.getTimetable(student, semester, date, date, false) + .toFirstResult().data.orEmpty() + .sortedWith(compareBy({ it.number }, { !it.isStudentPlan })) + .filter { if (prefRepository.showWholeClassPlan == "no") it.isStudentPlan else true } + } + } catch (e: Exception) { + Timber.e(e, "An error has occurred in timetable widget factory") + emptyList() + } + + @SuppressLint("DefaultLocale") + override fun getViewAt(position: Int): RemoteViews? { + if (position == INVALID_POSITION || lessons.getOrNull(position) == null) return null + + val lesson = lessons[position] + return RemoteViews(context.packageName, getItemLayout(lesson)).apply { + setTextViewText(R.id.timetableWidgetItemSubject, lesson.subject) + setTextViewText(R.id.timetableWidgetItemNumber, lesson.number.toString()) + setTextViewText(R.id.timetableWidgetItemTimeStart, lesson.start.toFormattedString("HH:mm")) + setTextViewText(R.id.timetableWidgetItemTimeFinish, lesson.end.toFormattedString("HH:mm")) + + updateDescription(this, lesson) + + if (lesson.canceled) { + updateStylesCanceled(this) + } else { + updateStylesNotCanceled(this, lesson) + } + + setOnClickFillInIntent(R.id.timetableWidgetItemContainer, Intent()) + } + } + + private fun updateDescription(remoteViews: RemoteViews, lesson: Timetable) { + with(remoteViews) { + if (lesson.info.isNotBlank() && !lesson.changes) { + setTextViewText(R.id.timetableWidgetItemDescription, lesson.info) + setViewVisibility(R.id.timetableWidgetItemDescription, VISIBLE) + setViewVisibility(R.id.timetableWidgetItemRoom, GONE) + setViewVisibility(R.id.timetableWidgetItemTeacher, GONE) + } else { + setViewVisibility(R.id.timetableWidgetItemDescription, GONE) + setViewVisibility(R.id.timetableWidgetItemRoom, VISIBLE) + setViewVisibility(R.id.timetableWidgetItemTeacher, VISIBLE) + } + } + } + + private fun updateStylesCanceled(remoteViews: RemoteViews) { + with(remoteViews) { + setInt(R.id.timetableWidgetItemSubject, "setPaintFlags", + STRIKE_THRU_TEXT_FLAG or ANTI_ALIAS_FLAG) + setTextColor(R.id.timetableWidgetItemNumber, context.getCompatColor(primaryColor!!)) + setTextColor(R.id.timetableWidgetItemSubject, context.getCompatColor(primaryColor!!)) + setTextColor(R.id.timetableWidgetItemDescription, context.getCompatColor(primaryColor!!)) + } + } + + private fun updateStylesNotCanceled(remoteViews: RemoteViews, lesson: Timetable) { + with(remoteViews) { + setInt(R.id.timetableWidgetItemSubject, "setPaintFlags", ANTI_ALIAS_FLAG) + setTextColor(R.id.timetableWidgetItemSubject, context.getCompatColor(textColor!!)) + setTextColor(R.id.timetableWidgetItemDescription, context.getCompatColor(timetableChangeColor!!)) + + updateNotCanceledLessonNumberColor(this, lesson) + updateNotCanceledSubjectColor(this, lesson) + + val teacherChange = lesson.teacherOld.isNotBlank() && lesson.teacher != lesson.teacherOld + updateNotCanceledRoom(this, lesson, teacherChange) + updateNotCanceledTeacher(this, lesson, teacherChange) + } + } + + private fun updateNotCanceledLessonNumberColor(remoteViews: RemoteViews, lesson: Timetable) { + remoteViews.setTextColor(R.id.timetableWidgetItemNumber, context.getCompatColor( + if (lesson.changes || (lesson.info.isNotBlank() && !lesson.canceled)) timetableChangeColor!! + else textColor!! + )) + } + + private fun updateNotCanceledSubjectColor(remoteViews: RemoteViews, lesson: Timetable) { + remoteViews.setTextColor(R.id.timetableWidgetItemSubject, context.getCompatColor( + if (lesson.subjectOld.isNotBlank() && lesson.subject != lesson.subjectOld) timetableChangeColor!! + else textColor!! + )) + } + + private fun updateNotCanceledRoom(remoteViews: RemoteViews, lesson: Timetable, teacherChange: Boolean) { + with(remoteViews) { + if (lesson.room.isNotBlank()) { + setTextViewText(R.id.timetableWidgetItemRoom, + if (teacherChange) lesson.room + else "${context.getString(R.string.timetable_room)} ${lesson.room}" + ) + + setTextColor(R.id.timetableWidgetItemRoom, context.getCompatColor( + if (lesson.roomOld.isNotBlank() && lesson.room != lesson.roomOld) timetableChangeColor!! + else textColor!! + )) + } else setTextViewText(R.id.timetableWidgetItemRoom, "") + } + } + + private fun updateNotCanceledTeacher(remoteViews: RemoteViews, lesson: Timetable, teacherChange: Boolean) { + remoteViews.setTextViewText(R.id.timetableWidgetItemTeacher, + if (teacherChange) lesson.teacher + else "" + ) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetProvider.kt b/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetProvider.kt new file mode 100644 index 00000000..60ad9d5c --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/modules/timetablewidget/TimetableWidgetProvider.kt @@ -0,0 +1,204 @@ +package io.github.wulkanowy.ui.modules.timetablewidget + +import android.annotation.SuppressLint +import android.app.PendingIntent +import android.app.PendingIntent.FLAG_UPDATE_CURRENT +import android.appwidget.AppWidgetManager +import android.appwidget.AppWidgetManager.ACTION_APPWIDGET_DELETED +import android.appwidget.AppWidgetManager.ACTION_APPWIDGET_UPDATE +import android.appwidget.AppWidgetManager.EXTRA_APPWIDGET_ID +import android.appwidget.AppWidgetManager.EXTRA_APPWIDGET_IDS +import android.content.Context +import android.content.Intent +import android.content.Intent.FLAG_ACTIVITY_CLEAR_TASK +import android.content.Intent.FLAG_ACTIVITY_NEW_TASK +import android.content.res.Configuration +import android.widget.RemoteViews +import dagger.hilt.android.AndroidEntryPoint +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.SharedPrefProvider +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.data.exceptions.NoCurrentStudentException +import io.github.wulkanowy.data.repositories.student.StudentRepository +import io.github.wulkanowy.services.HiltBroadcastReceiver +import io.github.wulkanowy.services.widgets.TimetableWidgetService +import io.github.wulkanowy.ui.modules.main.MainActivity +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.utils.FirebaseAnalyticsHelper +import io.github.wulkanowy.utils.nextOrSameSchoolDay +import io.github.wulkanowy.utils.nextSchoolDay +import io.github.wulkanowy.utils.previousSchoolDay +import io.github.wulkanowy.utils.toFormattedString +import kotlinx.coroutines.GlobalScope +import kotlinx.coroutines.launch +import timber.log.Timber +import java.time.LocalDate +import java.time.LocalDate.now +import javax.inject.Inject + +@AndroidEntryPoint +class TimetableWidgetProvider : HiltBroadcastReceiver() { + + @Inject + lateinit var appWidgetManager: AppWidgetManager + + @Inject + lateinit var studentRepository: StudentRepository + + @Inject + lateinit var sharedPref: SharedPrefProvider + + @Inject + lateinit var analytics: FirebaseAnalyticsHelper + + companion object { + + private const val EXTRA_TOGGLED_WIDGET_ID = "extraToggledWidget" + + private const val EXTRA_BUTTON_TYPE = "extraButtonType" + + private const val BUTTON_NEXT = "buttonNext" + + private const val BUTTON_PREV = "buttonPrev" + + private const val BUTTON_RESET = "buttonReset" + + const val EXTRA_FROM_PROVIDER = "extraFromProvider" + + fun getDateWidgetKey(appWidgetId: Int) = "timetable_widget_date_$appWidgetId" + + fun getStudentWidgetKey(appWidgetId: Int) = "timetable_widget_student_$appWidgetId" + + fun getThemeWidgetKey(appWidgetId: Int) = "timetable_widget_theme_$appWidgetId" + + fun getCurrentThemeWidgetKey(appWidgetId: Int) = "timetable_widget_current_theme_$appWidgetId" + } + + override fun onReceive(context: Context, intent: Intent) { + super.onReceive(context, intent) + GlobalScope.launch { + when (intent.action) { + ACTION_APPWIDGET_UPDATE -> onUpdate(context, intent) + ACTION_APPWIDGET_DELETED -> onDelete(intent) + } + } + } + + private suspend fun onUpdate(context: Context, intent: Intent) { + if (intent.getStringExtra(EXTRA_BUTTON_TYPE) === null) { + intent.getIntArrayExtra(EXTRA_APPWIDGET_IDS)?.forEach { appWidgetId -> + val student = getStudent(sharedPref.getLong(getStudentWidgetKey(appWidgetId), 0), appWidgetId) + updateWidget(context, appWidgetId, now().nextOrSameSchoolDay, student) + } + } else { + val buttonType = intent.getStringExtra(EXTRA_BUTTON_TYPE) + val toggledWidgetId = intent.getIntExtra(EXTRA_TOGGLED_WIDGET_ID, 0) + val student = getStudent(sharedPref.getLong(getStudentWidgetKey(toggledWidgetId), 0), toggledWidgetId) + val savedDate = LocalDate.ofEpochDay(sharedPref.getLong(getDateWidgetKey(toggledWidgetId), 0)) + val date = when (buttonType) { + BUTTON_RESET -> now().nextOrSameSchoolDay + BUTTON_NEXT -> savedDate.nextSchoolDay + BUTTON_PREV -> savedDate.previousSchoolDay + else -> now().nextOrSameSchoolDay + } + if (!buttonType.isNullOrBlank()) analytics.logEvent("changed_timetable_widget_day", "button" to buttonType) + updateWidget(context, toggledWidgetId, date, student) + } + } + + private fun onDelete(intent: Intent) { + val appWidgetId = intent.getIntExtra(EXTRA_APPWIDGET_ID, 0) + + if (appWidgetId != 0) { + with(sharedPref) { + delete(getStudentWidgetKey(appWidgetId)) + delete(getDateWidgetKey(appWidgetId)) + delete(getThemeWidgetKey(appWidgetId)) + delete(getCurrentThemeWidgetKey(appWidgetId)) + } + } + } + + @SuppressLint("DefaultLocale") + private fun updateWidget(context: Context, appWidgetId: Int, date: LocalDate, student: Student?) { + val savedConfigureTheme = sharedPref.getLong(getThemeWidgetKey(appWidgetId), 0) + val isSystemDarkMode = context.resources.configuration.uiMode and Configuration.UI_MODE_NIGHT_MASK == Configuration.UI_MODE_NIGHT_YES + var currentTheme = 0L + var layoutId = R.layout.widget_timetable + + if (savedConfigureTheme == 1L || (savedConfigureTheme == 2L && isSystemDarkMode)) { + currentTheme = 1L + layoutId = R.layout.widget_timetable_dark + } + + val nextNavIntent = createNavIntent(context, appWidgetId, appWidgetId, BUTTON_NEXT) + val prevNavIntent = createNavIntent(context, -appWidgetId, appWidgetId, BUTTON_PREV) + val resetNavIntent = createNavIntent(context, Int.MAX_VALUE - appWidgetId, appWidgetId, BUTTON_RESET) + val adapterIntent = Intent(context, TimetableWidgetService::class.java) + .apply { + putExtra(EXTRA_APPWIDGET_ID, appWidgetId) + //make Intent unique + action = appWidgetId.toString() + } + val accountIntent = PendingIntent.getActivity(context, -Int.MAX_VALUE + appWidgetId, + Intent(context, TimetableWidgetConfigureActivity::class.java).apply { + addFlags(FLAG_ACTIVITY_NEW_TASK or FLAG_ACTIVITY_CLEAR_TASK) + putExtra(EXTRA_APPWIDGET_ID, appWidgetId) + putExtra(EXTRA_FROM_PROVIDER, true) + }, FLAG_UPDATE_CURRENT) + val appIntent = PendingIntent.getActivity(context, MainView.Section.TIMETABLE.id, + MainActivity.getStartIntent(context, MainView.Section.TIMETABLE, true), FLAG_UPDATE_CURRENT) + + val remoteView = RemoteViews(context.packageName, layoutId).apply { + setEmptyView(R.id.timetableWidgetList, R.id.timetableWidgetEmpty) + setTextViewText(R.id.timetableWidgetDate, date.toFormattedString("EEEE, dd.MM").capitalize()) + setTextViewText(R.id.timetableWidgetName, student?.studentName ?: context.getString(R.string.all_no_data)) + setRemoteAdapter(R.id.timetableWidgetList, adapterIntent) + setOnClickPendingIntent(R.id.timetableWidgetNext, nextNavIntent) + setOnClickPendingIntent(R.id.timetableWidgetPrev, prevNavIntent) + setOnClickPendingIntent(R.id.timetableWidgetDate, resetNavIntent) + setOnClickPendingIntent(R.id.timetableWidgetName, resetNavIntent) + setOnClickPendingIntent(R.id.timetableWidgetAccount, accountIntent) + setPendingIntentTemplate(R.id.timetableWidgetList, appIntent) + } + + with(sharedPref) { + putLong(getCurrentThemeWidgetKey(appWidgetId), currentTheme) + putLong(getDateWidgetKey(appWidgetId), date.toEpochDay(), true) + } + + with(appWidgetManager) { + updateAppWidget(appWidgetId, remoteView) + notifyAppWidgetViewDataChanged(appWidgetId, R.id.timetableWidgetList) + Timber.d("TimetableWidgetProvider updated") + } + } + + private fun createNavIntent(context: Context, code: Int, appWidgetId: Int, buttonType: String): PendingIntent { + return PendingIntent.getBroadcast(context, code, + Intent(context, TimetableWidgetProvider::class.java).apply { + action = ACTION_APPWIDGET_UPDATE + putExtra(EXTRA_BUTTON_TYPE, buttonType) + putExtra(EXTRA_TOGGLED_WIDGET_ID, appWidgetId) + }, FLAG_UPDATE_CURRENT) + } + + private suspend fun getStudent(studentId: Long, appWidgetId: Int) = try { + val students = studentRepository.getSavedStudents(false) + val student = students.singleOrNull { it -> it.student.id == studentId }?.student + when { + student != null -> student + studentId != 0L && studentRepository.isCurrentStudentSet() -> { + studentRepository.getCurrentStudent(false).also { + sharedPref.putLong(getStudentWidgetKey(appWidgetId), it.id) + } + } + else -> null + } + } catch (e: Exception) { + if (e.cause !is NoCurrentStudentException) { + Timber.e(e, "An error has occurred in timetable widget provider") + } + null + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/splash/SplashActivity.java b/app/src/main/java/io/github/wulkanowy/ui/splash/SplashActivity.java deleted file mode 100644 index c9f98d5e..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/splash/SplashActivity.java +++ /dev/null @@ -1,50 +0,0 @@ -package io.github.wulkanowy.ui.splash; - -import android.os.Bundle; - -import javax.inject.Inject; - -import butterknife.ButterKnife; -import io.github.wulkanowy.services.SyncJob; -import io.github.wulkanowy.ui.base.BaseActivity; -import io.github.wulkanowy.ui.login.LoginActivity; -import io.github.wulkanowy.ui.main.MainActivity; - -public class SplashActivity extends BaseActivity implements SplashContract.View { - - @Inject - SplashContract.Presenter presenter; - - @Override - public void onCreate(Bundle savedInstanceState) { - super.onCreate(savedInstanceState); - - getActivityComponent().inject(this); - setButterKnife(ButterKnife.bind(this)); - - presenter.onStart(this); - } - - @Override - protected void onDestroy() { - presenter.onDestroy(); - super.onDestroy(); - } - - @Override - public void openLoginActivity() { - startActivity(LoginActivity.getStartIntent(this)); - finish(); - } - - @Override - public void openMainActivity() { - startActivity(MainActivity.getStartIntent(this)); - finish(); - } - - @Override - public void startSyncService() { - SyncJob.start(getApplicationContext()); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/splash/SplashContract.java b/app/src/main/java/io/github/wulkanowy/ui/splash/SplashContract.java deleted file mode 100644 index a69deb03..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/splash/SplashContract.java +++ /dev/null @@ -1,21 +0,0 @@ -package io.github.wulkanowy.ui.splash; - - -import io.github.wulkanowy.di.annotations.PerActivity; -import io.github.wulkanowy.ui.base.BaseContract; - -public interface SplashContract { - - interface View extends BaseContract.View { - - void openLoginActivity(); - - void openMainActivity(); - - void startSyncService(); - } - - @PerActivity - interface Presenter extends BaseContract.Presenter { - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/splash/SplashPresenter.java b/app/src/main/java/io/github/wulkanowy/ui/splash/SplashPresenter.java deleted file mode 100644 index c3d81215..00000000 --- a/app/src/main/java/io/github/wulkanowy/ui/splash/SplashPresenter.java +++ /dev/null @@ -1,29 +0,0 @@ -package io.github.wulkanowy.ui.splash; - -import android.support.annotation.NonNull; - -import javax.inject.Inject; - -import io.github.wulkanowy.data.RepositoryContract; -import io.github.wulkanowy.ui.base.BasePresenter; - -public class SplashPresenter extends BasePresenter - implements SplashContract.Presenter { - - @Inject - SplashPresenter(RepositoryContract repository) { - super(repository); - } - - @Override - public void onStart(@NonNull SplashContract.View activity) { - super.onStart(activity); - getView().startSyncService(); - - if (getRepository().getCurrentUserId() == 0) { - getView().openLoginActivity(); - } else { - getView().openMainActivity(); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/ui/widgets/DividerItemDecoration.kt b/app/src/main/java/io/github/wulkanowy/ui/widgets/DividerItemDecoration.kt new file mode 100644 index 00000000..b0b6999e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/widgets/DividerItemDecoration.kt @@ -0,0 +1,27 @@ +package io.github.wulkanowy.ui.widgets + +import android.content.Context +import android.graphics.Canvas +import android.view.View +import androidx.recyclerview.widget.DividerItemDecoration +import androidx.recyclerview.widget.RecyclerView + +class DividerItemDecoration(context: Context) : DividerItemDecoration(context, VERTICAL) { + + override fun onDraw(canvas: Canvas, parent: RecyclerView, state: RecyclerView.State) { + canvas.save() + val dividerLeft = parent.paddingLeft + val dividerRight = parent.width - parent.paddingRight + val childCount = parent.childCount + + for (i in 0..childCount - 2) { + val child: View = parent.getChildAt(i) + val params = child.layoutParams as RecyclerView.LayoutParams + val dividerTop: Int = child.bottom + params.bottomMargin + val dividerBottom = dividerTop + drawable!!.intrinsicHeight + drawable?.setBounds(dividerLeft, dividerTop, dividerRight, dividerBottom) + drawable?.draw(canvas) + } + canvas.restore() + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/widgets/FittedScrollableTabLayout.kt b/app/src/main/java/io/github/wulkanowy/ui/widgets/FittedScrollableTabLayout.kt new file mode 100644 index 00000000..0f121dc5 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/widgets/FittedScrollableTabLayout.kt @@ -0,0 +1,33 @@ +package io.github.wulkanowy.ui.widgets + +import android.content.Context +import android.util.AttributeSet +import android.view.ViewGroup + +/** + * @see Tabs don't fit to screen with tabmode=scrollable, Even with a Custom Tab Layout + */ +class FittedScrollableTabLayout : MaterialTabLayout { + + constructor(context: Context) : super(context) + + constructor(context: Context, attrs: AttributeSet) : super(context, attrs) + + constructor(context: Context, attrs: AttributeSet, defStyleAttr: Int) : super(context, attrs, defStyleAttr) + + override fun onMeasure(widthMeasureSpec: Int, heightMeasureSpec: Int) { + setMeasuredDimension(widthMeasureSpec, heightMeasureSpec) + val tabLayout = getChildAt(0) as ViewGroup + val childCount = tabLayout.childCount + + if (childCount == 0) return + + val tabMinWidth = context.resources.displayMetrics.widthPixels / childCount + + for (i in 0 until childCount) { + tabLayout.getChildAt(i).minimumWidth = tabMinWidth + } + + super.onMeasure(widthMeasureSpec, heightMeasureSpec) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/widgets/MaterialLinearLayout.kt b/app/src/main/java/io/github/wulkanowy/ui/widgets/MaterialLinearLayout.kt new file mode 100644 index 00000000..a04922e5 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/widgets/MaterialLinearLayout.kt @@ -0,0 +1,39 @@ +package io.github.wulkanowy.ui.widgets + +import android.content.Context +import android.os.Build.VERSION.SDK_INT +import android.os.Build.VERSION_CODES.LOLLIPOP +import android.util.AttributeSet +import android.widget.LinearLayout +import androidx.core.view.ViewCompat +import com.google.android.material.elevation.ElevationOverlayProvider +import com.google.android.material.shape.MaterialShapeDrawable + +class MaterialLinearLayout : LinearLayout { + + constructor(context: Context) : super(context) + + constructor(context: Context, attr: AttributeSet) : super(context, attr) + + constructor(context: Context, attr: AttributeSet, defStyleAttr: Int) : super(context, attr, defStyleAttr) + + init { + val drawable = MaterialShapeDrawable.createWithElevationOverlay(context, ViewCompat.getElevation(this)) + ViewCompat.setBackground(this, drawable) + } + + override fun setElevation(elevation: Float) { + super.setElevation(elevation) + if (background is MaterialShapeDrawable) { + (background as MaterialShapeDrawable).elevation = elevation + } + } + + fun setElevationCompat(elevation: Float) { + if (SDK_INT >= LOLLIPOP) { + setElevation(elevation) + } else { + setBackgroundColor(ElevationOverlayProvider(context).compositeOverlayWithThemeSurfaceColorIfNeeded(elevation)) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/ui/widgets/MaterialTabLayout.kt b/app/src/main/java/io/github/wulkanowy/ui/widgets/MaterialTabLayout.kt new file mode 100644 index 00000000..e19d0111 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/ui/widgets/MaterialTabLayout.kt @@ -0,0 +1,25 @@ +package io.github.wulkanowy.ui.widgets + +import android.content.Context +import android.os.Build.VERSION.SDK_INT +import android.os.Build.VERSION_CODES.LOLLIPOP +import android.util.AttributeSet +import com.google.android.material.elevation.ElevationOverlayProvider +import com.google.android.material.tabs.TabLayout + +open class MaterialTabLayout : TabLayout { + + constructor(context: Context) : super(context) + + constructor(context: Context, attr: AttributeSet) : super(context, attr) + + constructor(context: Context, attr: AttributeSet, defStyleAttr: Int) : super(context, attr, defStyleAttr) + + fun setElevationCompat(elevation: Float) { + if (SDK_INT >= LOLLIPOP) { + setElevation(elevation) + } else { + setBackgroundColor(ElevationOverlayProvider(context).compositeOverlayWithThemeSurfaceColorIfNeeded(elevation)) + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/ActivityExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/ActivityExtension.kt new file mode 100644 index 00000000..e9cac72e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/ActivityExtension.kt @@ -0,0 +1,15 @@ +package io.github.wulkanowy.utils + +import android.app.Activity +import android.view.inputmethod.InputMethodManager +import androidx.core.content.getSystemService + +fun Activity.showSoftInput() { + getSystemService()?.let { manager -> + currentFocus?.let { manager.showSoftInput(it, 0) } + } +} + +fun Activity.hideSoftInput() { + getSystemService()?.hideSoftInputFromWindow(window.decorView.applicationWindowToken, 0) +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/AppConstant.java b/app/src/main/java/io/github/wulkanowy/utils/AppConstant.java deleted file mode 100644 index 27d76e75..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/AppConstant.java +++ /dev/null @@ -1,25 +0,0 @@ -package io.github.wulkanowy.utils; - -public final class AppConstant { - - public static final String APP_NAME = "Wulkanowy"; - - public static final String DATABASE_NAME = "wulkanowy_db"; - - public static final String SHARED_PREFERENCES_NAME = "user_data"; - - - public static final String VULCAN_CREATE_ACCOUNT_URL = - "https://cufs.vulcan.net.pl/Default/AccountManage/CreateAccount"; - - public static final String VULCAN_FORGOT_PASS_URL = - "https://cufs.vulcan.net.pl/Default/AccountManage/UnlockAccount"; - - public static final String DEFAULT_SYMBOL = "Default"; - - public static final String DATE_PATTERN = "yyyy-MM-dd"; - - private AppConstant() { - throw new IllegalStateException("Utility class"); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/AppInfo.kt b/app/src/main/java/io/github/wulkanowy/utils/AppInfo.kt new file mode 100644 index 00000000..1098a9a0 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/AppInfo.kt @@ -0,0 +1,31 @@ +package io.github.wulkanowy.utils + +import android.content.res.Resources +import android.os.Build.MANUFACTURER +import android.os.Build.MODEL +import android.os.Build.VERSION.SDK_INT +import io.github.wulkanowy.BuildConfig.DEBUG +import io.github.wulkanowy.BuildConfig.VERSION_CODE +import io.github.wulkanowy.BuildConfig.VERSION_NAME +import javax.inject.Inject +import javax.inject.Singleton + +@Singleton +open class AppInfo @Inject constructor() { + + open val isDebug get() = DEBUG + + open val versionCode get() = VERSION_CODE + + open val versionName get() = VERSION_NAME + + open val systemVersion get() = SDK_INT + + open val systemManufacturer: String get() = MANUFACTURER + + open val systemModel: String get() = MODEL + + @Suppress("DEPRECATION") + open val systemLanguage: String + get() = Resources.getSystem().configuration.locale.language +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/AttendanceExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/AttendanceExtension.kt new file mode 100644 index 00000000..c2b1efaa --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/AttendanceExtension.kt @@ -0,0 +1,26 @@ +package io.github.wulkanowy.utils + +import io.github.wulkanowy.data.db.entities.AttendanceSummary + +/** + * [UONET+ - Zasady tworzenia podsumowań liczb uczniów obecnych i nieobecnych w tabeli frekwencji] + * (https://www.vulcan.edu.pl/vulcang_files/user/AABW/AABW-PDF/uonetplus/uonetplus_Frekwencja-liczby-obecnych-nieobecnych.pdf) + */ + +private inline val AttendanceSummary.allPresences: Double + get() = presence.toDouble() + absenceForSchoolReasons + lateness + latenessExcused + +private inline val AttendanceSummary.allAbsences: Double + get() = absence.toDouble() + absenceExcused + +fun AttendanceSummary.calculatePercentage() = calculatePercentage(allPresences, allAbsences) + +fun List.calculatePercentage(): Double { + return calculatePercentage(sumByDouble { it.allPresences }, sumByDouble { it.allAbsences }) +} + +private fun calculatePercentage(presence: Double, absence: Double): Double { + return if ((presence + absence) == 0.0) 0.0 else (presence / (presence + absence)) * 100 +} + + diff --git a/app/src/main/java/io/github/wulkanowy/utils/AverageCalculator.java b/app/src/main/java/io/github/wulkanowy/utils/AverageCalculator.java deleted file mode 100644 index cc33e65a..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/AverageCalculator.java +++ /dev/null @@ -1,61 +0,0 @@ -package io.github.wulkanowy.utils; - -import java.util.List; - -import io.github.wulkanowy.data.db.dao.entities.Grade; - -public final class AverageCalculator { - - private AverageCalculator() { - throw new IllegalStateException("Utility class"); - } - - public static float calculate(List gradeList) { - - float counter = 0f; - float denominator = 0f; - - for (Grade grade : gradeList) { - int integerWeight = getIntegerForWeightOfGrade(grade.getWeight()); - float floatValue = getMathematicalValueOfGrade(grade.getValue()); - - if (floatValue != -1f) { - counter += floatValue * integerWeight; - denominator += integerWeight; - } - } - - if (counter == 0f) { - return -1f; - } else { - return counter / denominator; - } - } - - private static float getMathematicalValueOfGrade(String valueOfGrade) { - if (valueOfGrade.matches("[-|+|=]{0,2}[0-6]") - || valueOfGrade.matches("[0-6][-|+|=]{0,2}")) { - if (valueOfGrade.matches("[-][0-6]") - || valueOfGrade.matches("[0-6][-]")) { - String replacedValue = valueOfGrade.replaceAll("[-]", ""); - return Float.valueOf(replacedValue) - 0.33f; - } else if (valueOfGrade.matches("[+][0-6]") - || valueOfGrade.matches("[0-6][+]")) { - String replacedValue = valueOfGrade.replaceAll("[+]", ""); - return Float.valueOf((replacedValue)) + 0.33f; - } else if (valueOfGrade.matches("[-|=]{1,2}[0-6]") - || valueOfGrade.matches("[0-6][-|=]{1,2}")) { - String replacedValue = valueOfGrade.replaceAll("[-|=]{1,2}", ""); - return Float.valueOf((replacedValue)) - 0.5f; - } else { - return Float.valueOf(valueOfGrade); - } - } else { - return -1; - } - } - - private static int getIntegerForWeightOfGrade(String weightOfGrade) { - return Integer.valueOf(weightOfGrade.substring(0, weightOfGrade.length() - 3)); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/CommonUtils.java b/app/src/main/java/io/github/wulkanowy/utils/CommonUtils.java deleted file mode 100644 index 9680817e..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/CommonUtils.java +++ /dev/null @@ -1,40 +0,0 @@ -package io.github.wulkanowy.utils; - -import android.content.Context; -import android.net.Uri; -import android.support.customtabs.CustomTabsIntent; - -import io.github.wulkanowy.R; - -public final class CommonUtils { - - private CommonUtils() { - throw new IllegalStateException("Utility class"); - } - - public static void openInternalBrowserViewer(Context context, String url) { - CustomTabsIntent.Builder builder = new CustomTabsIntent.Builder(); - builder.setToolbarColor(context.getResources().getColor(R.color.colorPrimary)); - CustomTabsIntent customTabsIntent = builder.build(); - customTabsIntent.launchUrl(context, Uri.parse(url)); - } - - public static int colorHexToColorName(String hexColor) { - switch (hexColor) { - case "000000": - return R.string.color_black_text; - - case "F04C4C": - return R.string.color_red_text; - - case "20A4F7": - return R.string.color_blue_text; - - case "6ECD07": - return R.string.color_green_text; - - default: - return R.string.noColor_text; - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/ContextExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/ContextExtension.kt new file mode 100644 index 00000000..cf715e65 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/ContextExtension.kt @@ -0,0 +1,87 @@ +package io.github.wulkanowy.utils + +import android.content.Context +import android.content.Intent +import android.net.Uri +import android.util.DisplayMetrics.DENSITY_DEFAULT +import androidx.annotation.AttrRes +import androidx.annotation.ColorInt +import androidx.annotation.ColorRes +import androidx.annotation.DrawableRes +import androidx.core.content.ContextCompat +import androidx.core.graphics.ColorUtils +import io.github.wulkanowy.BuildConfig.APPLICATION_ID + +@ColorInt +fun Context.getThemeAttrColor(@AttrRes colorAttr: Int): Int { + val array = obtainStyledAttributes(null, intArrayOf(colorAttr)) + return try { + array.getColor(0, 0) + } finally { + array.recycle() + } +} + +@ColorInt +fun Context.getThemeAttrColor(@AttrRes colorAttr: Int, alpha: Int): Int { + return ColorUtils.setAlphaComponent(getThemeAttrColor(colorAttr), alpha) +} + +@ColorInt +fun Context.getCompatColor(@ColorRes colorRes: Int) = ContextCompat.getColor(this, colorRes) + +fun Context.getCompatDrawable(@DrawableRes drawableRes: Int) = ContextCompat.getDrawable(this, drawableRes) + +fun Context.openInternetBrowser(uri: String, onActivityNotFound: (uri: String) -> Unit) { + Intent.parseUri(uri, 0).let { + if (it.resolveActivity(packageManager) != null) startActivity(it) + else onActivityNotFound(uri) + } +} + +fun Context.openAppInMarket(onActivityNotFound: (uri: String) -> Unit) { + openInternetBrowser("market://details?id=${APPLICATION_ID}") { + openInternetBrowser("https://github.com/wulkanowy/wulkanowy/releases", onActivityNotFound) + } +} + +fun Context.openEmailClient(chooserTitle: String, email: String, subject: String, body: String, onActivityNotFound: () -> Unit = {}) { + val intent = Intent(Intent.ACTION_SENDTO, Uri.parse("mailto:")).apply { + putExtra(Intent.EXTRA_EMAIL, arrayOf(email)) + putExtra(Intent.EXTRA_SUBJECT, subject) + putExtra(Intent.EXTRA_TEXT, body) + } + + if (intent.resolveActivity(packageManager) != null) { + startActivity(Intent.createChooser(intent, chooserTitle)) + } else onActivityNotFound() +} + +fun Context.openNavigation(location: String) { + val intentUri = Uri.parse("geo:0,0?q=${Uri.encode(location)}") + val intent = Intent(Intent.ACTION_VIEW, intentUri) + if (intent.resolveActivity(packageManager) != null) { + startActivity(intent) + } +} + +fun Context.openDialer(phone: String) { + val intentUri = Uri.parse("tel:$phone") + val intent = Intent(Intent.ACTION_DIAL, intentUri) + startActivity(intent) +} + +fun Context.shareText(text: String, subject: String?) { + val sendIntent: Intent = Intent().apply { + action = Intent.ACTION_SEND + putExtra(Intent.EXTRA_TEXT, text) + if (subject != null) { + putExtra(Intent.EXTRA_SUBJECT, subject) + } + type = "text/plain" + } + val shareIntent = Intent.createChooser(sendIntent, null) + startActivity(shareIntent) +} + +fun Context.dpToPx(dp: Float) = dp * resources.displayMetrics.densityDpi / DENSITY_DEFAULT diff --git a/app/src/main/java/io/github/wulkanowy/utils/DataObjectConverter.java b/app/src/main/java/io/github/wulkanowy/utils/DataObjectConverter.java deleted file mode 100644 index 1dd5f641..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/DataObjectConverter.java +++ /dev/null @@ -1,106 +0,0 @@ -package io.github.wulkanowy.utils; - - -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.data.db.dao.entities.Day; -import io.github.wulkanowy.data.db.dao.entities.Grade; -import io.github.wulkanowy.data.db.dao.entities.Lesson; -import io.github.wulkanowy.data.db.dao.entities.Subject; -import io.github.wulkanowy.data.db.dao.entities.Week; - -public final class DataObjectConverter { - - private DataObjectConverter() { - throw new IllegalStateException("Utility class"); - } - - public static List subjectsToSubjectEntities(List subjectList) { - - List subjectEntityList = new ArrayList<>(); - - for (io.github.wulkanowy.api.grades.Subject subject : subjectList) { - Subject subjectEntity = new Subject() - .setName(subject.getName()) - .setPredictedRating(subject.getPredictedRating()) - .setFinalRating(subject.getFinalRating()); - subjectEntityList.add(subjectEntity); - } - - return subjectEntityList; - } - - public static List gradesToGradeEntities(List gradeList) { - - List gradeEntityList = new ArrayList<>(); - - for (io.github.wulkanowy.api.grades.Grade grade : gradeList) { - Grade gradeEntity = new Grade() - .setSubject(grade.getSubject()) - .setValue(grade.getValue()) - .setColor(grade.getColor()) - .setSymbol(grade.getSymbol()) - .setDescription(grade.getDescription()) - .setWeight(grade.getWeight()) - .setDate(grade.getDate()) - .setTeacher(grade.getTeacher()) - .setSemester(grade.getSemester()); - - gradeEntityList.add(gradeEntity); - } - return gradeEntityList; - } - - public static Week weekToWeekEntity(io.github.wulkanowy.api.generic.Week week) { - return new Week().setStartDayDate(week.getStartDayDate()); - } - - public static Day dayToDayEntity(io.github.wulkanowy.api.generic.Day day) { - return new Day() - .setDate(day.getDate()) - .setDayName(day.getDayName()) - .setFreeDay(day.isFreeDay()) - .setFreeDayName(day.getFreeDayName()); - } - - - public static List daysToDaysEntities(List dayList) { - - List dayEntityList = new ArrayList<>(); - - for (io.github.wulkanowy.api.generic.Day day : dayList) { - dayEntityList.add(dayToDayEntity(day)); - } - return dayEntityList; - } - - public static Lesson lessonToLessonEntity(io.github.wulkanowy.api.generic.Lesson lesson) { - return new Lesson() - .setNumber(lesson.getNumber()) - .setSubject(lesson.getSubject()) - .setTeacher(lesson.getTeacher()) - .setRoom(lesson.getRoom()) - .setDescription(lesson.getDescription()) - .setGroupName(lesson.getGroupName()) - .setStartTime(lesson.getStartTime()) - .setEndTime(lesson.getEndTime()) - .setDate(lesson.getDate()) - .setEmpty(lesson.isEmpty()) - .setDivisionIntoGroups(lesson.isDivisionIntoGroups()) - .setPlanning(lesson.isPlanning()) - .setRealized(lesson.isRealized()) - .setMovedOrCanceled(lesson.isMovedOrCanceled()) - .setNewMovedInOrChanged(lesson.isNewMovedInOrChanged()); - } - - public static List lessonsToLessonsEntities(List lessonList) { - - List lessonEntityList = new ArrayList<>(); - - for (io.github.wulkanowy.api.generic.Lesson lesson : lessonList) { - lessonEntityList.add(lessonToLessonEntity(lesson)); - } - return lessonEntityList; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/DispatchersProvider.kt b/app/src/main/java/io/github/wulkanowy/utils/DispatchersProvider.kt new file mode 100644 index 00000000..ecc8e05e --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/DispatchersProvider.kt @@ -0,0 +1,10 @@ +package io.github.wulkanowy.utils + +import kotlinx.coroutines.CoroutineDispatcher +import kotlinx.coroutines.Dispatchers + +open class DispatchersProvider { + + open val backgroundThread: CoroutineDispatcher + get() = Dispatchers.IO +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/EditTextExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/EditTextExtension.kt new file mode 100644 index 00000000..58c93729 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/EditTextExtension.kt @@ -0,0 +1,10 @@ +package io.github.wulkanowy.utils + +import android.view.inputmethod.EditorInfo +import android.widget.EditText + +fun EditText.setOnEditorDoneSignIn(callback: () -> Boolean) { + setOnEditorActionListener { _, id, _ -> + if (id == EditorInfo.IME_ACTION_DONE || id == EditorInfo.IME_NULL) callback() else false + } +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/EntitiesCompare.java b/app/src/main/java/io/github/wulkanowy/utils/EntitiesCompare.java deleted file mode 100644 index 5681bad1..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/EntitiesCompare.java +++ /dev/null @@ -1,42 +0,0 @@ -package io.github.wulkanowy.utils; - -import org.apache.commons.collections4.CollectionUtils; - -import java.util.ArrayList; -import java.util.List; - -import io.github.wulkanowy.data.db.dao.entities.Grade; - -public final class EntitiesCompare { - - private EntitiesCompare() { - throw new IllegalStateException("Utility class"); - } - - public static List compareGradeList(List newList, List oldList) { - - List addedOrUpdatedGradeList = new ArrayList<>(CollectionUtils - .removeAll(newList, oldList)); - List updatedList = new ArrayList<>(CollectionUtils - .removeAll(newList, addedOrUpdatedGradeList)); - List lastList = new ArrayList<>(); - - for (Grade grade : addedOrUpdatedGradeList) { - if (!oldList.isEmpty()) { - grade.setRead(false); - } - grade.setIsNew(true); - updatedList.add(grade); - } - - for (Grade updateGrade : updatedList) { - for (Grade oldGrade : oldList) { - if (updateGrade.equals(oldGrade)) { - updateGrade.setRead(oldGrade.getRead()); - } - } - lastList.add(updateGrade); - } - return lastList; - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/FlowUtils.kt b/app/src/main/java/io/github/wulkanowy/utils/FlowUtils.kt new file mode 100644 index 00000000..31499405 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/FlowUtils.kt @@ -0,0 +1,102 @@ +package io.github.wulkanowy.utils + +import io.github.wulkanowy.data.Resource +import io.github.wulkanowy.data.Status +import kotlinx.coroutines.flow.Flow +import kotlinx.coroutines.flow.catch +import kotlinx.coroutines.flow.collect +import kotlinx.coroutines.flow.emitAll +import kotlinx.coroutines.flow.filter +import kotlinx.coroutines.flow.first +import kotlinx.coroutines.flow.flow +import kotlinx.coroutines.flow.map +import kotlinx.coroutines.flow.onEach +import kotlinx.coroutines.flow.takeWhile + +inline fun networkBoundResource( + showSavedOnLoading: Boolean = true, + crossinline query: () -> Flow, + crossinline fetch: suspend (ResultType) -> RequestType, + crossinline saveFetchResult: suspend (old: ResultType, new: RequestType) -> Unit, + crossinline onFetchFailed: (Throwable) -> Unit = { Unit }, + crossinline shouldFetch: (ResultType) -> Boolean = { true }, + crossinline filterResult: (ResultType) -> ResultType = { it } +) = flow { + emit(Resource.loading()) + + val data = query().first() + emitAll(if (shouldFetch(data)) { + if (showSavedOnLoading) emit(Resource.loading(filterResult(data))) + + try { + saveFetchResult(data, fetch(data)) + query().map { Resource.success(filterResult(it)) } + } catch (throwable: Throwable) { + onFetchFailed(throwable) + query().map { Resource.error(throwable, filterResult(it)) } + } + } else { + query().map { Resource.success(filterResult(it)) } + }) +} + +@JvmName("networkBoundResourceWithMap") +inline fun networkBoundResource( + showSavedOnLoading: Boolean = true, + crossinline query: () -> Flow, + crossinline fetch: suspend (ResultType) -> RequestType, + crossinline saveFetchResult: suspend (old: ResultType, new: RequestType) -> Unit, + crossinline onFetchFailed: (Throwable) -> Unit = { Unit }, + crossinline shouldFetch: (ResultType) -> Boolean = { true }, + crossinline mapResult: (ResultType) -> T +) = flow { + emit(Resource.loading()) + + val data = query().first() + emitAll(if (shouldFetch(data)) { + if (showSavedOnLoading) emit(Resource.loading(mapResult(data))) + + try { + saveFetchResult(data, fetch(data)) + query().map { Resource.success(mapResult(it)) } + } catch (throwable: Throwable) { + onFetchFailed(throwable) + query().map { Resource.error(throwable, mapResult(it)) } + } + } else { + query().map { Resource.success(mapResult(it)) } + }) +} + +fun flowWithResource(block: suspend () -> T) = flow { + emit(Resource.loading()) + emit(try { + Resource.success(block()) + } catch (e: Throwable) { + Resource.error(e) + }) +} + +fun flowWithResourceIn(block: suspend () -> Flow>) = flow { + emit(Resource.loading()) + + try { + block() + .catch { emit(Resource.error(it)) } + .collect { + if (it.status != Status.LOADING) { // LOADING is already emitted + emit(it) + } + } + } catch (e: Throwable) { + emit(Resource.error(e)) + } +} + +fun Flow>.afterLoading(callback: () -> Unit) = onEach { + if (it.status != Status.LOADING) callback() +} + +suspend fun Flow>.toFirstResult() = filter { it.status != Status.LOADING }.first() + +suspend fun Flow>.waitForResult() = takeWhile { it.status == Status.LOADING }.collect() diff --git a/app/src/main/java/io/github/wulkanowy/utils/FragNavControlerExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/FragNavControlerExtension.kt new file mode 100644 index 00000000..9dc1e18a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/FragNavControlerExtension.kt @@ -0,0 +1,21 @@ +package io.github.wulkanowy.utils + +import androidx.fragment.app.Fragment +import com.ncapdevi.fragnav.FragNavController +import io.github.wulkanowy.ui.modules.main.MainView + +inline fun FragNavController.setOnViewChangeListener(crossinline listener: (section: MainView.Section?, name: String?) -> Unit) { + transactionListener = object : FragNavController.TransactionListener { + override fun onFragmentTransaction(fragment: Fragment?, transactionType: FragNavController.TransactionType) { + listener(fragment?.toSection(), fragment?.let { it::class.java.simpleName }) + } + + override fun onTabTransaction(fragment: Fragment?, index: Int) { + listener(fragment?.toSection(), fragment?.let { it::class.java.simpleName }) + } + } +} + +fun FragNavController.safelyPopFragments(depth: Int) { + if (!isRootFragment) popFragments(depth) +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/FragmentExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/FragmentExtension.kt new file mode 100644 index 00000000..0b71c964 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/FragmentExtension.kt @@ -0,0 +1,34 @@ +package io.github.wulkanowy.utils + +import androidx.fragment.app.Fragment +import io.github.wulkanowy.ui.modules.about.AboutFragment +import io.github.wulkanowy.ui.modules.attendance.AttendanceFragment +import io.github.wulkanowy.ui.modules.exam.ExamFragment +import io.github.wulkanowy.ui.modules.grade.GradeFragment +import io.github.wulkanowy.ui.modules.homework.HomeworkFragment +import io.github.wulkanowy.ui.modules.luckynumber.LuckyNumberFragment +import io.github.wulkanowy.ui.modules.main.MainView +import io.github.wulkanowy.ui.modules.message.MessageFragment +import io.github.wulkanowy.ui.modules.more.MoreFragment +import io.github.wulkanowy.ui.modules.note.NoteFragment +import io.github.wulkanowy.ui.modules.schoolandteachers.SchoolAndTeachersFragment +import io.github.wulkanowy.ui.modules.settings.SettingsFragment +import io.github.wulkanowy.ui.modules.timetable.TimetableFragment + +fun Fragment.toSection(): MainView.Section? { + return when (this) { + is GradeFragment -> MainView.Section.GRADE + is AttendanceFragment -> MainView.Section.ATTENDANCE + is ExamFragment -> MainView.Section.EXAM + is TimetableFragment -> MainView.Section.TIMETABLE + is MoreFragment -> MainView.Section.MORE + is MessageFragment -> MainView.Section.MESSAGE + is HomeworkFragment -> MainView.Section.HOMEWORK + is NoteFragment -> MainView.Section.NOTE + is LuckyNumberFragment -> MainView.Section.LUCKY_NUMBER + is SettingsFragment -> MainView.Section.SETTINGS + is AboutFragment -> MainView.Section.ABOUT + is SchoolAndTeachersFragment -> MainView.Section.SCHOOL + else -> null + } +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/GradeExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/GradeExtension.kt new file mode 100644 index 00000000..c57b6247 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/GradeExtension.kt @@ -0,0 +1,78 @@ +package io.github.wulkanowy.utils + +import io.github.wulkanowy.R +import io.github.wulkanowy.data.db.entities.Grade +import io.github.wulkanowy.data.db.entities.GradeSummary + +fun List.calcAverage(): Double { + var counter = 0.0 + var denominator = 0.0 + + forEach { + counter += (it.value + it.modifier) * it.weightValue + denominator += it.weightValue + } + return if (denominator != 0.0) counter / denominator else 0.0 +} + +@JvmName("calcSummaryAverage") +fun List.calcAverage(): Double { + return asSequence().mapNotNull { + if (it.finalGrade.matches("[0-6]".toRegex())) it.finalGrade.toDouble() else null + }.average().let { if (it.isNaN()) 0.0 else it } +} + +fun Grade.getBackgroundColor(theme: String): Int { + return when (theme) { + "grade_color" -> getGradeColor() + "material" -> when (value.toInt()) { + 6 -> R.color.grade_material_six + 5 -> R.color.grade_material_five + 4 -> R.color.grade_material_four + 3 -> R.color.grade_material_three + 2 -> R.color.grade_material_two + 1 -> R.color.grade_material_one + else -> R.color.grade_material_default + } + else -> when (value.toInt()) { + 6 -> R.color.grade_vulcan_six + 5 -> R.color.grade_vulcan_five + 4 -> R.color.grade_vulcan_four + 3 -> R.color.grade_vulcan_three + 2 -> R.color.grade_vulcan_two + 1 -> R.color.grade_vulcan_one + else -> R.color.grade_vulcan_default + } + } +} + +fun Grade.getGradeColor(): Int { + return when (color) { + "000000" -> R.color.grade_black + "F04C4C" -> R.color.grade_red + "20A4F7" -> R.color.grade_blue + "6ECD07" -> R.color.grade_green + "B16CF1" -> R.color.grade_purple + else -> R.color.grade_material_default + } +} + +inline val Grade.colorStringId: Int + get() { + return when (color) { + "000000" -> R.string.all_black + "F04C4C" -> R.string.all_red + "20A4F7" -> R.string.all_blue + "6ECD07" -> R.string.all_green + "B16CF1" -> R.string.all_purple + else -> R.string.all_empty_color + } + } + +fun Grade.changeModifier(plusModifier: Double, minusModifier: Double): Grade { + return when { + modifier > 0 -> copy(modifier = plusModifier) + modifier < 0 -> copy(modifier = -minusModifier) + else -> this + } +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/KeyboardUtils.java b/app/src/main/java/io/github/wulkanowy/utils/KeyboardUtils.java deleted file mode 100644 index 6be1b76f..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/KeyboardUtils.java +++ /dev/null @@ -1,33 +0,0 @@ -package io.github.wulkanowy.utils; - -import android.app.Activity; -import android.content.Context; -import android.view.inputmethod.InputMethodManager; -import android.widget.EditText; - -public final class KeyboardUtils { - - private KeyboardUtils() { - throw new IllegalStateException("Utility class"); - } - - public static void hideSoftInput(Activity activity) { - InputMethodManager manager = (InputMethodManager) - activity.getSystemService(Context.INPUT_METHOD_SERVICE); - if (manager != null) { - manager.hideSoftInputFromWindow(activity.getWindow() - .getDecorView().getApplicationWindowToken(), 0); - } - } - - public static void showSoftInput(EditText editText, Context context) { - editText.setFocusable(true); - editText.setFocusableInTouchMode(true); - editText.requestFocus(); - InputMethodManager inputMethodManager = (InputMethodManager) context - .getSystemService(Context.INPUT_METHOD_SERVICE); - if (inputMethodManager != null) { - inputMethodManager.showSoftInput(editText, 0); - } - } -} \ No newline at end of file diff --git a/app/src/main/java/io/github/wulkanowy/utils/LifecycleAwareVariable.kt b/app/src/main/java/io/github/wulkanowy/utils/LifecycleAwareVariable.kt new file mode 100644 index 00000000..b96faeb2 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/LifecycleAwareVariable.kt @@ -0,0 +1,55 @@ +package io.github.wulkanowy.utils + +import androidx.appcompat.app.AppCompatActivity +import androidx.fragment.app.Fragment +import androidx.lifecycle.Lifecycle +import androidx.lifecycle.LifecycleObserver +import androidx.lifecycle.OnLifecycleEvent +import kotlin.properties.ReadWriteProperty +import kotlin.reflect.KProperty + +class LifecycleAwareVariable : ReadWriteProperty, LifecycleObserver { + + private var _value: T? = null + + override fun setValue(thisRef: Fragment, property: KProperty<*>, value: T) { + thisRef.viewLifecycleOwner.lifecycle.removeObserver(this) + _value = value + thisRef.viewLifecycleOwner.lifecycle.addObserver(this) + } + + override fun getValue(thisRef: Fragment, property: KProperty<*>) = _value + ?: throw IllegalStateException("Trying to call an lifecycle-aware value outside of the view lifecycle, or the value has not been initialized") + + @Suppress("unused") + @OnLifecycleEvent(Lifecycle.Event.ON_DESTROY) + fun onDestroyView() { + _value = null + } +} + +class LifecycleAwareVariableActivity : ReadWriteProperty, LifecycleObserver { + + private var _value: T? = null + + override fun setValue(thisRef: AppCompatActivity, property: KProperty<*>, value: T) { + thisRef.lifecycle.removeObserver(this) + _value = value + thisRef.lifecycle.addObserver(this) + } + + override fun getValue(thisRef: AppCompatActivity, property: KProperty<*>) = _value + ?: throw IllegalStateException("Trying to call an lifecycle-aware value outside of the view lifecycle, or the value has not been initialized") + + @Suppress("unused") + @OnLifecycleEvent(Lifecycle.Event.ON_DESTROY) + fun onDestroyView() { + _value = null + } +} + + +@Suppress("unused") +fun Fragment.lifecycleAwareVariable() = LifecycleAwareVariable() + +fun lifecycleAwareVariable() = LifecycleAwareVariableActivity() diff --git a/app/src/main/java/io/github/wulkanowy/utils/ListExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/ListExtension.kt new file mode 100644 index 00000000..4374aeb4 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/ListExtension.kt @@ -0,0 +1,9 @@ +package io.github.wulkanowy.utils + +infix fun List.uniqueSubtract(other: List): List { + val list = toMutableList() + other.forEach { + list.remove(it) + } + return list.toList() +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/LogUtils.java b/app/src/main/java/io/github/wulkanowy/utils/LogUtils.java deleted file mode 100644 index f3b5b3ec..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/LogUtils.java +++ /dev/null @@ -1,22 +0,0 @@ -package io.github.wulkanowy.utils; - -import android.util.Log; - -public final class LogUtils { - - private LogUtils() { - throw new IllegalStateException("Utility class"); - } - - public static void debug(String message) { - Log.d(AppConstant.APP_NAME, message); - } - - public static void error(String message, Throwable throwable) { - Log.e(AppConstant.APP_NAME, message, throwable); - } - - public static void error(String message) { - Log.e(AppConstant.APP_NAME, message); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/LoggerUtils.kt b/app/src/main/java/io/github/wulkanowy/utils/LoggerUtils.kt new file mode 100644 index 00000000..fc352849 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/LoggerUtils.kt @@ -0,0 +1,104 @@ +package io.github.wulkanowy.utils + +import android.app.Activity +import android.app.Application +import android.content.Context +import android.os.Bundle +import android.view.View +import androidx.fragment.app.Fragment +import androidx.fragment.app.FragmentManager +import timber.log.Timber +import javax.inject.Inject +import javax.inject.Singleton + +class DebugLogTree : Timber.DebugTree() { + + override fun log(priority: Int, tag: String?, message: String, t: Throwable?) { + super.log(priority, "Wulkanowy", message, t) + } +} + +private fun Bundle?.checkSavedState() = if (this == null) "(STATE IS NULL)" else "(STATE IS NOT NULL)" + +class ActivityLifecycleLogger : Application.ActivityLifecycleCallbacks { + + override fun onActivityPaused(activity: Activity?) { + activity?.let { Timber.d("${it::class.java.simpleName} PAUSED") } + } + + override fun onActivityResumed(activity: Activity?) { + activity?.let { Timber.d("${it::class.java.simpleName} RESUMED") } + } + + override fun onActivityStarted(activity: Activity?) { + activity?.let { Timber.d("${it::class.java.simpleName} STARTED") } + } + + override fun onActivityDestroyed(activity: Activity?) { + activity?.let { Timber.d("${it::class.java.simpleName} DESTROYED") } + } + + override fun onActivitySaveInstanceState(activity: Activity?, outState: Bundle?) { + activity?.let { Timber.d("${it::class.java.simpleName} SAVED INSTANCE STATE") } + } + + override fun onActivityStopped(activity: Activity?) { + activity?.let { Timber.d("${it::class.java.simpleName} STOPPED") } + } + + override fun onActivityCreated(activity: Activity?, savedInstanceState: Bundle?) { + activity?.let { Timber.d("${it::class.java.simpleName} CREATED ${savedInstanceState.checkSavedState()}") } + } +} + +@Singleton +class FragmentLifecycleLogger @Inject constructor() : FragmentManager.FragmentLifecycleCallbacks() { + + override fun onFragmentViewCreated(fm: FragmentManager, f: Fragment, v: View, savedInstanceState: Bundle?) { + Timber.d("${f::class.java.simpleName} VIEW CREATED ${savedInstanceState.checkSavedState()}") + } + + override fun onFragmentStopped(fm: FragmentManager, f: Fragment) { + Timber.d("${f::class.java.simpleName} STOPPED") + } + + override fun onFragmentCreated(fm: FragmentManager, f: Fragment, savedInstanceState: Bundle?) { + Timber.d("${f::class.java.simpleName} CREATED ${savedInstanceState.checkSavedState()}") + } + + override fun onFragmentResumed(fm: FragmentManager, f: Fragment) { + Timber.d("${f::class.java.simpleName} RESUMED") + } + + override fun onFragmentAttached(fm: FragmentManager, f: Fragment, context: Context) { + Timber.d("${f::class.java.simpleName} ATTACHED") + } + + override fun onFragmentDestroyed(fm: FragmentManager, f: Fragment) { + Timber.d("${f::class.java.simpleName} DESTROYED") + } + + override fun onFragmentSaveInstanceState(fm: FragmentManager, f: Fragment, outState: Bundle) { + Timber.d("${f::class.java.simpleName} SAVED INSTANCE STATE") + } + + override fun onFragmentStarted(fm: FragmentManager, f: Fragment) { + Timber.d("${f::class.java.simpleName} STARTED") + } + + override fun onFragmentViewDestroyed(fm: FragmentManager, f: Fragment) { + Timber.d("${f::class.java.simpleName} VIEW DESTROYED") + } + + override fun onFragmentActivityCreated(fm: FragmentManager, f: Fragment, savedInstanceState: Bundle?) { + Timber.d("${f::class.java.simpleName} ACTIVITY CREATED ${savedInstanceState.checkSavedState()}") + } + + override fun onFragmentPaused(fm: FragmentManager, f: Fragment) { + Timber.d("${f::class.java.simpleName} PAUSED") + } + + override fun onFragmentDetached(fm: FragmentManager, f: Fragment) { + Timber.d("${f::class.java.simpleName} DETACHED") + } +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/NetworkUtils.java b/app/src/main/java/io/github/wulkanowy/utils/NetworkUtils.java deleted file mode 100644 index a1484eb9..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/NetworkUtils.java +++ /dev/null @@ -1,18 +0,0 @@ -package io.github.wulkanowy.utils; - -import android.content.Context; -import android.net.ConnectivityManager; - -public final class NetworkUtils { - - private NetworkUtils() { - throw new IllegalStateException("Utility class"); - } - - public static boolean isOnline(Context context) { - ConnectivityManager connectivityManager = - (ConnectivityManager) context.getSystemService(Context.CONNECTIVITY_SERVICE); - return connectivityManager != null && connectivityManager.getActiveNetworkInfo() != null - && connectivityManager.getActiveNetworkInfo().isConnectedOrConnecting(); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/ResourcesExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/ResourcesExtension.kt new file mode 100644 index 00000000..de9f656a --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/ResourcesExtension.kt @@ -0,0 +1,23 @@ +package io.github.wulkanowy.utils + +import android.content.res.Resources +import io.github.wulkanowy.R +import io.github.wulkanowy.sdk.exception.FeatureNotAvailableException +import io.github.wulkanowy.sdk.scrapper.exception.FeatureDisabledException +import io.github.wulkanowy.sdk.scrapper.exception.ServiceUnavailableException +import io.github.wulkanowy.sdk.scrapper.login.NotLoggedInException +import io.github.wulkanowy.sdk.scrapper.login.PasswordChangeRequiredException +import java.io.InterruptedIOException +import java.net.SocketTimeoutException +import java.net.UnknownHostException + +fun Resources.getString(error: Throwable) = when (error) { + is UnknownHostException -> getString(R.string.error_no_internet) + is SocketTimeoutException, is InterruptedIOException -> getString(R.string.error_timeout) + is NotLoggedInException -> getString(R.string.error_login_failed) + is PasswordChangeRequiredException -> getString(R.string.error_password_change_required) + is ServiceUnavailableException -> getString(R.string.error_service_unavailable) + is FeatureDisabledException -> getString(R.string.error_feature_disabled) + is FeatureNotAvailableException -> getString(R.string.error_feature_not_available) + else -> getString(R.string.error_unknown) +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/RootChecker.java b/app/src/main/java/io/github/wulkanowy/utils/RootChecker.java deleted file mode 100644 index 9c23c217..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/RootChecker.java +++ /dev/null @@ -1,38 +0,0 @@ -package io.github.wulkanowy.utils; - -import android.os.Build; - -import java.io.File; - -public final class RootChecker { - - private RootChecker() { - throw new IllegalStateException("Utility class"); - } - - public static boolean isRooted() { - return checkOne() || checkTwo() || checkThree(); - } - - private static boolean checkOne() { - return Build.TAGS != null && Build.TAGS.contains("test-keys"); - } - - private static boolean checkTwo() { - return new File("/system/app/Superuser.apk").exists(); - } - - private static boolean checkThree() { - String[] commands = {"/system/xbin/which su", "/system/bin/which su", "which su"}; - for (String command : commands) { - try { - Runtime.getRuntime().exec(command); - return true; - } catch (Exception e) { - // ignore - } - } - return false; - } - -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/SchooldaysRangeLimiter.kt b/app/src/main/java/io/github/wulkanowy/utils/SchooldaysRangeLimiter.kt new file mode 100644 index 00000000..e7c51745 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/SchooldaysRangeLimiter.kt @@ -0,0 +1,51 @@ +package io.github.wulkanowy.utils + +import android.os.Parcel +import android.os.Parcelable +import com.wdullaer.materialdatetimepicker.date.DateRangeLimiter +import java.time.DayOfWeek +import java.time.LocalDate +import java.util.Calendar + +@Suppress("UNUSED_PARAMETER") +class SchooldaysRangeLimiter : DateRangeLimiter { + + private val now = LocalDate.now() + + override fun setToNearestDate(day: Calendar): Calendar = day + + override fun isOutOfRange(year: Int, month: Int, day: Int): Boolean { + val date = LocalDate.of(year, month + 1, day) + val dayOfWeek = date.dayOfWeek + return dayOfWeek == DayOfWeek.SUNDAY || date.isHolidays + } + + override fun getStartDate(): Calendar { + val startYear = if (now.monthValue <= 6) now.year - 1 else now.year + val startOfSchoolYear = now.withYear(startYear).firstSchoolDay + + val calendar = Calendar.getInstance() + calendar.set(startOfSchoolYear.year, startOfSchoolYear.monthValue - 1, startOfSchoolYear.dayOfMonth) + return calendar + } + + override fun getEndDate(): Calendar { + val endYear = if (now.monthValue > 6) now.year + 1 else now.year + val endOfSchoolYear = now.withYear(endYear).lastSchoolDay + + val calendar = Calendar.getInstance() + calendar.set(endOfSchoolYear.year, endOfSchoolYear.monthValue - 1, endOfSchoolYear.dayOfMonth) + return calendar + } + + override fun writeToParcel(parcel: Parcel, flags: Int) {} + + override fun describeContents() = 0 + + companion object CREATOR : Parcelable.Creator { + + override fun createFromParcel(parcel: Parcel): SchooldaysRangeLimiter = SchooldaysRangeLimiter() + + override fun newArray(size: Int): Array = arrayOfNulls(size) + } +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/SdkExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/SdkExtension.kt new file mode 100644 index 00000000..63a30db8 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/SdkExtension.kt @@ -0,0 +1,31 @@ +package io.github.wulkanowy.utils + +import io.github.wulkanowy.data.db.entities.Student +import io.github.wulkanowy.sdk.Sdk +import timber.log.Timber + +fun Sdk.init(student: Student): Sdk { + email = student.email + password = student.password + symbol = student.symbol + schoolSymbol = student.schoolSymbol + studentId = student.studentId + classId = student.classId + + if (Sdk.Mode.valueOf(student.loginMode) != Sdk.Mode.API) { + scrapperBaseUrl = student.scrapperBaseUrl + loginType = Sdk.ScrapperLoginType.valueOf(student.loginType) + } + loginId = student.userLoginId + + mode = Sdk.Mode.valueOf(student.loginMode) + mobileBaseUrl = student.mobileBaseUrl + certKey = student.certificateKey + privateKey = student.privateKey + + emptyCookieJarInterceptor = true + + Timber.d("Sdk in ${student.loginMode} mode reinitialized") + + return this +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/SemesterExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/SemesterExtension.kt new file mode 100644 index 00000000..6e11a8b2 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/SemesterExtension.kt @@ -0,0 +1,19 @@ +package io.github.wulkanowy.utils + +import io.github.wulkanowy.data.db.entities.Semester +import java.time.LocalDate.now + +inline val Semester.isCurrent: Boolean + get() = now() in start..end + +fun List.getCurrentOrLast(): Semester { + if (isEmpty()) throw RuntimeException("Empty semester list") + + // when there is only one current semester + singleOrNull { it.isCurrent }?.let { return it } + + // when there is more than one current semester - find one with higher id + singleOrNull { semester -> semester.semesterId == maxByOrNull { it.semesterId }?.semesterId }?.let { return it } + + throw IllegalArgumentException("Duplicated last semester! Semesters: ${joinToString(separator = "\n")}") +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/SpinnerExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/SpinnerExtension.kt new file mode 100644 index 00000000..1f721690 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/SpinnerExtension.kt @@ -0,0 +1,23 @@ +package io.github.wulkanowy.utils + +import android.view.View +import android.widget.AdapterView +import android.widget.Spinner + +/** + * @see How to keep onItemSelected from firing off on a newly instantiated Spinner? + */ +@Suppress("UNCHECKED_CAST") +inline fun Spinner.setOnItemSelectedListener(crossinline listener: (view: T?) -> Unit) { + onItemSelectedListener = object : AdapterView.OnItemSelectedListener { + override fun onNothingSelected(parent: AdapterView<*>?) {} + override fun onItemSelected(parent: AdapterView<*>?, view: View?, position: Int, id: Long) { + onItemSelectedListener = object : AdapterView.OnItemSelectedListener { + override fun onNothingSelected(parent: AdapterView<*>?) {} + override fun onItemSelected(parent: AdapterView<*>?, view: View?, position: Int, id: Long) { + listener(view as T?) + } + } + } + } +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/StringExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/StringExtension.kt new file mode 100644 index 00000000..65167fd7 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/StringExtension.kt @@ -0,0 +1,3 @@ +package io.github.wulkanowy.utils + +inline fun String?.ifNullOrBlank(defaultValue: () -> String) = if (this.isNullOrBlank()) defaultValue() else this diff --git a/app/src/main/java/io/github/wulkanowy/utils/TimeExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/TimeExtension.kt new file mode 100644 index 00000000..d1aba160 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/TimeExtension.kt @@ -0,0 +1,131 @@ +package io.github.wulkanowy.utils + +import android.annotation.SuppressLint +import java.time.DayOfWeek.FRIDAY +import java.time.DayOfWeek.MONDAY +import java.time.DayOfWeek.SATURDAY +import java.time.DayOfWeek.SUNDAY +import java.time.Instant.ofEpochMilli +import java.time.LocalDate +import java.time.LocalDateTime +import java.time.LocalDateTime.ofInstant +import java.time.Month +import java.time.ZoneId +import java.time.ZoneOffset +import java.time.format.DateTimeFormatter.ofPattern +import java.time.format.TextStyle.FULL_STANDALONE +import java.time.format.TextStyle.* +import java.time.temporal.TemporalAdjusters.firstInMonth +import java.time.temporal.TemporalAdjusters.next +import java.time.temporal.TemporalAdjusters.previous +import java.util.Locale + +private const val DATE_PATTERN = "dd.MM.yyyy" + +fun String.toLocalDate(format: String = DATE_PATTERN): LocalDate = LocalDate.parse(this, ofPattern(format)) + +fun LocalDateTime.toTimestamp() = atZone(ZoneId.systemDefault()).withZoneSameInstant(ZoneOffset.UTC).toInstant().toEpochMilli() + +fun Long.toLocalDateTime(): LocalDateTime = ofInstant(ofEpochMilli(this), ZoneId.systemDefault()) + +fun LocalDate.toFormattedString(format: String = DATE_PATTERN): String = format(ofPattern(format)) + +fun LocalDateTime.toFormattedString(format: String = DATE_PATTERN): String = format(ofPattern(format)) + +@SuppressLint("DefaultLocale") +fun Month.getFormattedName(): String { + return getDisplayName(FULL, Locale.getDefault()) + .let { + when (it) { + "stycznia" -> "Styczeń" + "lutego" -> "Luty" + "marca" -> "Marzec" + "kwietnia" -> "Kwiecień" + "maja" -> "Maj" + "czerwca" -> "Czerwiec" + "lipca" -> "Lipiec" + "sierpnia" -> "Sierpień" + "września" -> "Wrzesień" + "października" -> "Październik" + "listopada" -> "Listopad" + "grudnia" -> "Grudzień" + else -> it + } + }.capitalize() +} + +inline val LocalDate.nextSchoolDay: LocalDate + get() { + return when (dayOfWeek) { + FRIDAY, SATURDAY, SUNDAY -> with(next(MONDAY)) + else -> plusDays(1) + } + } + +inline val LocalDate.previousSchoolDay: LocalDate + get() { + return when (dayOfWeek) { + SATURDAY, SUNDAY, MONDAY -> with(previous(FRIDAY)) + else -> minusDays(1) + } + } + +inline val LocalDate.nextOrSameSchoolDay: LocalDate + get() { + return when (dayOfWeek) { + SATURDAY, SUNDAY -> with(next(MONDAY)) + else -> this + } + } + +inline val LocalDate.previousOrSameSchoolDay: LocalDate + get() { + return when (dayOfWeek) { + SATURDAY, SUNDAY -> with(previous(FRIDAY)) + else -> this + } + } + +inline val LocalDate.weekDayName: String + get() = format(ofPattern("EEEE", Locale.getDefault())) + +inline val LocalDate.monday: LocalDate + get() = with(MONDAY) + +inline val LocalDate.sunday: LocalDate + get() = with(SUNDAY) + +/** + * [Dz.U. 2016 poz. 1335](http://prawo.sejm.gov.pl/isap.nsf/DocDetails.xsp?id=WDU20160001335) + */ +inline val LocalDate.isHolidays: Boolean + get() = isBefore(firstSchoolDay) && isAfter(lastSchoolDay) + +inline val LocalDate.firstSchoolDay: LocalDate + get() = LocalDate.of(year, 9, 1).run { + when (dayOfWeek) { + FRIDAY, SATURDAY, SUNDAY -> with(firstInMonth(MONDAY)) + else -> this + } + } + +inline val LocalDate.lastSchoolDay: LocalDate + get() = LocalDate.of(year, 6, 20) + .with(next(FRIDAY)) + +private fun Int.getSchoolYearByMonth(monthValue: Int): Int { + return when (monthValue) { + in 9..12 -> this + else -> this + 1 + } +} + +fun LocalDate.getLastSchoolDayIfHoliday(schoolYear: Int): LocalDate { + val date = LocalDate.of(schoolYear.getSchoolYearByMonth(monthValue), monthValue, dayOfMonth) + + if (date.isHolidays) { + return date.lastSchoolDay + } + + return date +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/TimeUtils.java b/app/src/main/java/io/github/wulkanowy/utils/TimeUtils.java deleted file mode 100644 index 717ed42a..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/TimeUtils.java +++ /dev/null @@ -1,89 +0,0 @@ -package io.github.wulkanowy.utils; - -import org.joda.time.DateTime; -import org.joda.time.DateTimeConstants; -import org.joda.time.LocalDate; - -import java.text.ParseException; -import java.text.SimpleDateFormat; -import java.util.ArrayList; -import java.util.Calendar; -import java.util.Date; -import java.util.List; -import java.util.Locale; -import java.util.TimeZone; - -import static io.github.wulkanowy.utils.AppConstant.DATE_PATTERN; - -public final class TimeUtils { - - private static final long TICKS_AT_EPOCH = 621355968000000000L; - - private static final long TICKS_PER_MILLISECOND = 10000; - - private TimeUtils() { - throw new IllegalStateException("Utility class"); - } - - public static long getNetTicks(Date date) { - Calendar calendar = Calendar.getInstance(); - calendar.setTime(date); - - return (calendar.getTimeInMillis() * TICKS_PER_MILLISECOND) + TICKS_AT_EPOCH; - } - - public static long getNetTicks(String dateString) throws ParseException { - return getNetTicks(dateString, DATE_PATTERN); - } - - public static long getNetTicks(String dateString, String dateFormat) throws ParseException { - SimpleDateFormat format = new SimpleDateFormat(dateFormat, Locale.ROOT); - format.setTimeZone(TimeZone.getTimeZone("UTC")); - Date dateObject = format.parse(dateString); - - return getNetTicks(dateObject); - } - - public static Date getDate(long netTicks) { - return new Date((netTicks - TICKS_AT_EPOCH) / TICKS_PER_MILLISECOND); - } - - public static List getMondaysFromCurrentSchoolYear() { - LocalDate startDate = new LocalDate(getCurrentSchoolYear(), 9, 1); - LocalDate endDate = new LocalDate(getCurrentSchoolYear() + 1, 8, 31); - - List dateList = new ArrayList<>(); - - LocalDate thisMonday = startDate.withDayOfWeek(DateTimeConstants.MONDAY); - - if (startDate.isAfter(thisMonday)) { - startDate = thisMonday.plusWeeks(1); - } else { - startDate = thisMonday; - } - - while (startDate.isBefore(endDate)) { - dateList.add(startDate.toString(DATE_PATTERN)); - startDate = startDate.plusWeeks(1); - } - return dateList; - } - - public static int getCurrentSchoolYear() { - DateTime dateTime = new DateTime(); - return dateTime.getMonthOfYear() <= 8 ? dateTime.getYear() - 1 : dateTime.getYear(); - } - - public static String getDateOfCurrentMonday(boolean normalize) { - DateTime currentDate = new DateTime(); - - if (currentDate.getDayOfWeek() == DateTimeConstants.SATURDAY && normalize) { - currentDate = currentDate.plusDays(2); - } else if (currentDate.getDayOfWeek() == DateTimeConstants.SUNDAY && normalize) { - currentDate = currentDate.plusDays(1); - } else { - currentDate = currentDate.withDayOfWeek(DateTimeConstants.MONDAY); - } - return currentDate.toString(DATE_PATTERN); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/TimetableExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/TimetableExtension.kt new file mode 100644 index 00000000..f3591306 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/TimetableExtension.kt @@ -0,0 +1,29 @@ +package io.github.wulkanowy.utils + +import io.github.wulkanowy.data.db.entities.Timetable +import java.time.Duration +import java.time.Duration.between +import java.time.LocalDateTime +import java.time.LocalDateTime.now + +fun Timetable.isShowTimeUntil(previousLessonEnd: LocalDateTime?) = when { + !isStudentPlan -> false + canceled -> false + now().isAfter(start) -> false + previousLessonEnd != null && now().isBefore(previousLessonEnd) -> false + else -> between(now(), start) <= Duration.ofMinutes(60) +} + +inline val Timetable.left: Duration? + get() = when { + canceled -> null + !isStudentPlan -> null + end.isAfter(now()) && start.isBefore(now()) -> between(now(), end) + else -> null + } + +inline val Timetable.until: Duration + get() = between(now(), start) + +inline val Timetable.isJustFinished: Boolean + get() = end.isBefore(now()) && end.plusSeconds(15).isAfter(now()) && !canceled diff --git a/app/src/main/java/io/github/wulkanowy/utils/ViewPagerExtension.kt b/app/src/main/java/io/github/wulkanowy/utils/ViewPagerExtension.kt new file mode 100644 index 00000000..6a5ad880 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/ViewPagerExtension.kt @@ -0,0 +1,13 @@ +package io.github.wulkanowy.utils + +import androidx.viewpager.widget.ViewPager + +inline fun ViewPager.setOnSelectPageListener(crossinline selectListener: (position: Int) -> Unit) { + addOnPageChangeListener(object : ViewPager.OnPageChangeListener { + override fun onPageSelected(position: Int) { + selectListener(position) + } + override fun onPageScrollStateChanged(state: Int) {} + override fun onPageScrolled(position: Int, positionOffset: Float, positionOffsetPixels: Int) {} + }) +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/async/AbstractTask.java b/app/src/main/java/io/github/wulkanowy/utils/async/AbstractTask.java deleted file mode 100644 index 5106d641..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/async/AbstractTask.java +++ /dev/null @@ -1,63 +0,0 @@ -package io.github.wulkanowy.utils.async; - -import android.os.AsyncTask; - -import io.github.wulkanowy.utils.LogUtils; - -public class AbstractTask extends AsyncTask { - - private Exception exception; - - private AsyncListeners.OnRefreshListener onRefreshListener; - - private AsyncListeners.OnFirstLoadingListener onFirstLoadingListener; - - public void setOnFirstLoadingListener(AsyncListeners.OnFirstLoadingListener onFirstLoadingListener) { - this.onFirstLoadingListener = onFirstLoadingListener; - } - - public void setOnRefreshListener(AsyncListeners.OnRefreshListener onRefreshListener) { - this.onRefreshListener = onRefreshListener; - } - - @Override - protected Boolean doInBackground(Void... voids) { - try { - if (onFirstLoadingListener != null) { - onFirstLoadingListener.onDoInBackgroundLoading(); - } else if (onRefreshListener != null) { - onRefreshListener.onDoInBackgroundRefresh(); - } else { - LogUtils.error("AbstractTask does not have a listener assigned"); - } - return true; - } catch (Exception e) { - exception = e; - return false; - } - } - - @Override - protected void onCancelled() { - super.onCancelled(); - if (onFirstLoadingListener != null) { - onFirstLoadingListener.onCanceledLoadingAsync(); - } else if (onRefreshListener != null) { - onRefreshListener.onCanceledRefreshAsync(); - } else { - LogUtils.error("AbstractTask does not have a listener assigned"); - } - } - - @Override - protected void onPostExecute(Boolean result) { - super.onPostExecute(result); - if (onFirstLoadingListener != null) { - onFirstLoadingListener.onEndLoadingAsync(result, exception); - } else if (onRefreshListener != null) { - onRefreshListener.onEndRefreshAsync(result, exception); - } else { - LogUtils.error("AbstractTask does not have a listener assigned"); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/async/AsyncListeners.java b/app/src/main/java/io/github/wulkanowy/utils/async/AsyncListeners.java deleted file mode 100644 index 0d33c57c..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/async/AsyncListeners.java +++ /dev/null @@ -1,23 +0,0 @@ -package io.github.wulkanowy.utils.async; - -public interface AsyncListeners { - - interface OnRefreshListener { - - void onDoInBackgroundRefresh() throws Exception; - - void onCanceledRefreshAsync(); - - void onEndRefreshAsync(boolean result, Exception exception); - - } - - interface OnFirstLoadingListener { - - void onDoInBackgroundLoading() throws Exception; - - void onCanceledLoadingAsync(); - - void onEndLoadingAsync(boolean result, Exception exception); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/security/CryptoException.java b/app/src/main/java/io/github/wulkanowy/utils/security/CryptoException.java deleted file mode 100644 index 1ee4a9fa..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/security/CryptoException.java +++ /dev/null @@ -1,9 +0,0 @@ -package io.github.wulkanowy.utils.security; - - -public class CryptoException extends Exception { - - public CryptoException(String message) { - super(message); - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/security/Scrambler.java b/app/src/main/java/io/github/wulkanowy/utils/security/Scrambler.java deleted file mode 100644 index 93da1d0b..00000000 --- a/app/src/main/java/io/github/wulkanowy/utils/security/Scrambler.java +++ /dev/null @@ -1,184 +0,0 @@ -package io.github.wulkanowy.utils.security; - - -import android.annotation.TargetApi; -import android.content.Context; -import android.os.Build; -import android.security.KeyPairGeneratorSpec; -import android.security.keystore.KeyGenParameterSpec; -import android.security.keystore.KeyProperties; -import android.util.Base64; - -import org.apache.commons.lang3.ArrayUtils; - -import java.io.ByteArrayInputStream; -import java.io.ByteArrayOutputStream; -import java.math.BigInteger; -import java.security.KeyPairGenerator; -import java.security.KeyStore; -import java.security.interfaces.RSAPublicKey; -import java.security.spec.AlgorithmParameterSpec; -import java.util.ArrayList; -import java.util.Calendar; - -import javax.crypto.Cipher; -import javax.crypto.CipherInputStream; -import javax.crypto.CipherOutputStream; -import javax.security.auth.x500.X500Principal; - -import io.github.wulkanowy.utils.LogUtils; -import io.github.wulkanowy.utils.RootChecker; - -public final class Scrambler { - - private static final String ANDROID_KEYSTORE = "AndroidKeyStore"; - - private static KeyStore keyStore; - - private Scrambler() { - throw new IllegalStateException("Utility class"); - } - - public static String encrypt(String email, String plainText, Context context) - throws CryptoException { - - if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.JELLY_BEAN_MR2) { - loadKeyStore(); - generateNewKey(email, context); - return encryptString(email, plainText); - } else { - if (RootChecker.isRooted()) { - return new String(Base64.encode(plainText.getBytes(), Base64.DEFAULT)); - } else { - throw new UnsupportedOperationException("Stored data in this devices " + - "isn't safe because android is rooted"); - } - } - } - - public static String decrypt(String email, String encryptedText) throws CryptoException { - if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.JELLY_BEAN_MR2) { - loadKeyStore(); - return decryptString(email, encryptedText); - } else { - return new String(Base64.decode(encryptedText, Base64.DEFAULT)); - } - } - - private static void loadKeyStore() throws CryptoException { - try { - keyStore = KeyStore.getInstance(ANDROID_KEYSTORE); - keyStore.load(null); - } catch (Exception e) { - throw new CryptoException(e.getMessage()); - } - } - - @SuppressWarnings("deprecation") - @TargetApi(18) - private static void generateNewKey(String alias, Context context) throws CryptoException { - - Calendar start = Calendar.getInstance(); - Calendar end = Calendar.getInstance(); - - AlgorithmParameterSpec spec; - - end.add(Calendar.YEAR, 10); - if (!"".equals(alias)) { - try { - if (!keyStore.containsAlias(alias)) { - if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) { - spec = new KeyGenParameterSpec.Builder(alias, - KeyProperties.PURPOSE_ENCRYPT | KeyProperties.PURPOSE_DECRYPT) - .setEncryptionPaddings(KeyProperties.ENCRYPTION_PADDING_RSA_PKCS1) - .setDigests(KeyProperties.DIGEST_SHA256) - .setSignaturePaddings(KeyProperties.SIGNATURE_PADDING_RSA_PKCS1) - .setCertificateNotBefore(start.getTime()) - .setCertificateNotAfter(end.getTime()) - .build(); - - } else { - spec = new KeyPairGeneratorSpec.Builder(context) - .setAlias(alias) - .setSubject(new X500Principal("CN=" + alias)) - .setSerialNumber(BigInteger.TEN) - .setStartDate(start.getTime()) - .setEndDate(end.getTime()) - .build(); - } - - KeyPairGenerator keyPairGenerator = KeyPairGenerator.getInstance("RSA", - ANDROID_KEYSTORE); - keyPairGenerator.initialize(spec); - keyPairGenerator.generateKeyPair(); - } - } catch (Exception e) { - throw new CryptoException(e.getMessage()); - } - } else { - throw new CryptoException("GenerateNewKey - String is empty"); - } - - LogUtils.debug("Key pair are create"); - - } - - private static String encryptString(String alias, String text) throws CryptoException { - - if (!alias.isEmpty() && !text.isEmpty()) { - try { - KeyStore.PrivateKeyEntry privateKeyEntry = (KeyStore.PrivateKeyEntry) keyStore.getEntry(alias, null); - RSAPublicKey publicKey = (RSAPublicKey) privateKeyEntry.getCertificate().getPublicKey(); - - Cipher input = Cipher.getInstance("RSA/ECB/PKCS1Padding"); - input.init(Cipher.ENCRYPT_MODE, publicKey); - - ByteArrayOutputStream outputStream = new ByteArrayOutputStream(); - CipherOutputStream cipherOutputStream = new CipherOutputStream( - outputStream, input); - cipherOutputStream.write(text.getBytes("UTF-8")); - cipherOutputStream.close(); - - byte[] values = outputStream.toByteArray(); - - return Base64.encodeToString(values, Base64.DEFAULT); - - } catch (Exception e) { - throw new CryptoException(e.getMessage()); - } - } else { - throw new CryptoException("EncryptString - String is empty"); - } - } - - private static String decryptString(String alias, String text) throws CryptoException { - - if (!alias.isEmpty() && !text.isEmpty()) { - try { - KeyStore.PrivateKeyEntry privateKeyEntry = (KeyStore.PrivateKeyEntry) keyStore.getEntry(alias, null); - - Cipher output = Cipher.getInstance("RSA/ECB/PKCS1Padding"); - output.init(Cipher.DECRYPT_MODE, privateKeyEntry.getPrivateKey()); - - CipherInputStream cipherInputStream = new CipherInputStream( - new ByteArrayInputStream(Base64.decode(text, Base64.DEFAULT)), output); - - ArrayList values = new ArrayList<>(); - - int nextByte; - - while ((nextByte = cipherInputStream.read()) != -1) { - values.add((byte) nextByte); - } - - Byte[] bytes = values.toArray(new Byte[values.size()]); - - return new String(ArrayUtils.toPrimitive(bytes), 0, bytes.length, "UTF-8"); - } catch (Exception e) { - throw new CryptoException(e.getMessage()); - } - } else { - throw new CryptoException("EncryptString - String is empty"); - } - } -} diff --git a/app/src/main/java/io/github/wulkanowy/utils/security/Scrambler.kt b/app/src/main/java/io/github/wulkanowy/utils/security/Scrambler.kt new file mode 100644 index 00000000..264f4542 --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/security/Scrambler.kt @@ -0,0 +1,148 @@ +@file:Suppress("DEPRECATION") + +package io.github.wulkanowy.utils.security + +import android.annotation.TargetApi +import android.content.Context +import android.os.Build.VERSION.SDK_INT +import android.os.Build.VERSION_CODES.JELLY_BEAN_MR2 +import android.os.Build.VERSION_CODES.M +import android.security.KeyPairGeneratorSpec +import android.security.keystore.KeyGenParameterSpec +import android.security.keystore.KeyProperties.DIGEST_SHA256 +import android.security.keystore.KeyProperties.DIGEST_SHA512 +import android.security.keystore.KeyProperties.ENCRYPTION_PADDING_RSA_OAEP +import android.security.keystore.KeyProperties.PURPOSE_DECRYPT +import android.security.keystore.KeyProperties.PURPOSE_ENCRYPT +import android.util.Base64.DEFAULT +import android.util.Base64.decode +import android.util.Base64.encode +import android.util.Base64.encodeToString +import timber.log.Timber +import java.io.ByteArrayInputStream +import java.io.ByteArrayOutputStream +import java.math.BigInteger +import java.nio.charset.Charset +import java.security.KeyPairGenerator +import java.security.KeyStore +import java.security.spec.MGF1ParameterSpec.SHA1 +import java.util.Calendar +import java.util.Calendar.YEAR +import javax.crypto.Cipher +import javax.crypto.Cipher.DECRYPT_MODE +import javax.crypto.Cipher.ENCRYPT_MODE +import javax.crypto.CipherInputStream +import javax.crypto.CipherOutputStream +import javax.crypto.spec.OAEPParameterSpec +import javax.crypto.spec.PSource.PSpecified +import javax.security.auth.x500.X500Principal + +private const val KEYSTORE_NAME = "AndroidKeyStore" + +private const val KEY_ALIAS = "wulkanowy_password" + +private val KEY_CHARSET = Charset.forName("UTF-8") + +private val isKeyPairExists: Boolean + get() = keyStore.getKey(KEY_ALIAS, null) != null + +private val keyStore: KeyStore + get() = KeyStore.getInstance(KEYSTORE_NAME).apply { load(null) } + +private val cipher: Cipher + get() { + return if (SDK_INT >= M) Cipher.getInstance("RSA/ECB/OAEPWithSHA-256AndMGF1Padding", "AndroidKeyStoreBCWorkaround") + else Cipher.getInstance("RSA/ECB/PKCS1Padding", "AndroidOpenSSL") + } + +fun encrypt(plainText: String, context: Context): String { + if (plainText.isEmpty()) throw ScramblerException("Text to be encrypted is empty") + + if (SDK_INT < JELLY_BEAN_MR2) { + return String(encode(plainText.toByteArray(KEY_CHARSET), DEFAULT), KEY_CHARSET) + } + + return try { + if (!isKeyPairExists) generateKeyPair(context) + + cipher.let { + if (SDK_INT >= M) { + OAEPParameterSpec("SHA-256", "MGF1", SHA1, PSpecified.DEFAULT).let { spec -> + it.init(ENCRYPT_MODE, keyStore.getCertificate(KEY_ALIAS).publicKey, spec) + } + } else it.init(ENCRYPT_MODE, keyStore.getCertificate(KEY_ALIAS).publicKey) + + ByteArrayOutputStream().let { output -> + CipherOutputStream(output, it).apply { + write(plainText.toByteArray(KEY_CHARSET)) + close() + } + encodeToString(output.toByteArray(), DEFAULT) + } + } + } catch (exception: Exception) { + Timber.e(exception, "An error occurred while encrypting text") + String(encode(plainText.toByteArray(KEY_CHARSET), DEFAULT), KEY_CHARSET) + } +} + +fun decrypt(cipherText: String): String { + if (cipherText.isEmpty()) throw ScramblerException("Text to be encrypted is empty") + + return try { + if (SDK_INT < JELLY_BEAN_MR2 || cipherText.length < 250) { + return String(decode(cipherText.toByteArray(KEY_CHARSET), DEFAULT), KEY_CHARSET) + } + + if (!isKeyPairExists) throw ScramblerException("KeyPair doesn't exist") + + cipher.let { + if (SDK_INT >= M) { + OAEPParameterSpec("SHA-256", "MGF1", SHA1, PSpecified.DEFAULT).let { spec -> + it.init(DECRYPT_MODE, keyStore.getKey(KEY_ALIAS, null), spec) + } + } else it.init(DECRYPT_MODE, keyStore.getKey(KEY_ALIAS, null)) + + CipherInputStream(ByteArrayInputStream(decode(cipherText, DEFAULT)), it).let { input -> + val values = ArrayList() + var nextByte = 0 + while ({ nextByte = input.read(); nextByte }() != -1) { + values.add(nextByte.toByte()) + } + val bytes = ByteArray(values.size) + for (i in bytes.indices) { + bytes[i] = values[i] + } + String(bytes, 0, bytes.size, KEY_CHARSET) + } + } + } catch (e: Exception) { + throw ScramblerException("An error occurred while decrypting text", e) + } +} + +@TargetApi(JELLY_BEAN_MR2) +private fun generateKeyPair(context: Context) { + (if (SDK_INT >= M) { + KeyGenParameterSpec.Builder(KEY_ALIAS, PURPOSE_DECRYPT or PURPOSE_ENCRYPT) + .setDigests(DIGEST_SHA256, DIGEST_SHA512) + .setEncryptionPaddings(ENCRYPTION_PADDING_RSA_OAEP) + .setCertificateSerialNumber(BigInteger.TEN) + .setCertificateSubject(X500Principal("CN=Wulkanowy")) + .build() + } else { + KeyPairGeneratorSpec.Builder(context) + .setAlias(KEY_ALIAS) + .setSubject(X500Principal("CN=Wulkanowy")) + .setSerialNumber(BigInteger.TEN) + .setStartDate(Calendar.getInstance().time) + .setEndDate(Calendar.getInstance().apply { add(YEAR, 99) }.time) + .build() + }).let { + KeyPairGenerator.getInstance("RSA", KEYSTORE_NAME).apply { + initialize(it) + genKeyPair() + } + } + Timber.i("A new KeyPair has been generated") +} diff --git a/app/src/main/java/io/github/wulkanowy/utils/security/ScramblerException.kt b/app/src/main/java/io/github/wulkanowy/utils/security/ScramblerException.kt new file mode 100644 index 00000000..59f830fa --- /dev/null +++ b/app/src/main/java/io/github/wulkanowy/utils/security/ScramblerException.kt @@ -0,0 +1,6 @@ +package io.github.wulkanowy.utils.security + +class ScramblerException : Exception { + constructor(message: String, cause: Throwable) : super(message, cause) + constructor(message: String) : super(message) +} diff --git a/app/src/main/play/contact-email.txt b/app/src/main/play/contact-email.txt new file mode 100644 index 00000000..851521eb --- /dev/null +++ b/app/src/main/play/contact-email.txt @@ -0,0 +1 @@ +wulkanowyinc@gmail.com diff --git a/app/src/main/play/contact-phone.txt b/app/src/main/play/contact-phone.txt new file mode 100644 index 00000000..552e53a5 --- /dev/null +++ b/app/src/main/play/contact-phone.txt @@ -0,0 +1 @@ ++48733393622 diff --git a/app/src/main/play/contact-website.txt b/app/src/main/play/contact-website.txt new file mode 100644 index 00000000..53f7bee6 --- /dev/null +++ b/app/src/main/play/contact-website.txt @@ -0,0 +1 @@ +https://wulkanowy.github.io/ diff --git a/app/src/main/play/default-language.txt b/app/src/main/play/default-language.txt new file mode 100644 index 00000000..1134c4d5 --- /dev/null +++ b/app/src/main/play/default-language.txt @@ -0,0 +1 @@ +pl-PL diff --git a/app/src/main/play/listings/pl-PL/full-description.txt b/app/src/main/play/listings/pl-PL/full-description.txt new file mode 100644 index 00000000..641b7706 --- /dev/null +++ b/app/src/main/play/listings/pl-PL/full-description.txt @@ -0,0 +1,14 @@ +Aplikacja jest przeznaczona dla użytkowników dziennika VULCAN UONET+. + +Wyróżnione cechy i funkcje: +- obliczanie średniej ważonej, +- procentowy podgląd frekwencji, +- szczęśliwy numerek, +- podgląd lekcji zrealizowanych, +- ciemny motyw. +- brak reklam, +- tryb offline, +- powiadomienia. + +GitHub: https://github.com/wulkanowy/wulkanowy +Discord: https://discord.gg/vccAQBr diff --git a/app/src/main/play/listings/pl-PL/graphics/feature-graphic/feature.png b/app/src/main/play/listings/pl-PL/graphics/feature-graphic/feature.png new file mode 100644 index 00000000..094b25b6 Binary files /dev/null and b/app/src/main/play/listings/pl-PL/graphics/feature-graphic/feature.png differ diff --git a/app/src/main/play/listings/pl-PL/graphics/icon/icon.png b/app/src/main/play/listings/pl-PL/graphics/icon/icon.png new file mode 100644 index 00000000..8c33c2f9 Binary files /dev/null and b/app/src/main/play/listings/pl-PL/graphics/icon/icon.png differ diff --git a/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/1-grades.png b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/1-grades.png new file mode 100644 index 00000000..56768bf5 Binary files /dev/null and b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/1-grades.png differ diff --git a/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/2-timetable-dialog.png b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/2-timetable-dialog.png new file mode 100644 index 00000000..83d9353a Binary files /dev/null and b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/2-timetable-dialog.png differ diff --git a/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/3-exams.png b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/3-exams.png new file mode 100644 index 00000000..f83a7af8 Binary files /dev/null and b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/3-exams.png differ diff --git a/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/4-timetable-widget.png b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/4-timetable-widget.png new file mode 100644 index 00000000..90d5fef4 Binary files /dev/null and b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/4-timetable-widget.png differ diff --git a/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/5-messages.png b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/5-messages.png new file mode 100644 index 00000000..eadbf2db Binary files /dev/null and b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/5-messages.png differ diff --git a/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/6-account-switcher.png b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/6-account-switcher.png new file mode 100644 index 00000000..2a11a3db Binary files /dev/null and b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/6-account-switcher.png differ diff --git a/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/7-class-grades.png b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/7-class-grades.png new file mode 100644 index 00000000..d9b2f1c7 Binary files /dev/null and b/app/src/main/play/listings/pl-PL/graphics/phone-screenshots/7-class-grades.png differ diff --git a/app/src/main/play/listings/pl-PL/short-description.txt b/app/src/main/play/listings/pl-PL/short-description.txt new file mode 100644 index 00000000..c850c159 --- /dev/null +++ b/app/src/main/play/listings/pl-PL/short-description.txt @@ -0,0 +1 @@ +Nieoficjalna aplikacja ucznia i rodzica dla dziennika VULCAN UONET+ diff --git a/app/src/main/play/listings/pl-PL/title.txt b/app/src/main/play/listings/pl-PL/title.txt new file mode 100644 index 00000000..2d53a62a --- /dev/null +++ b/app/src/main/play/listings/pl-PL/title.txt @@ -0,0 +1 @@ +Wulkanowy Dzienniczek diff --git a/app/src/main/play/release-notes/pl-PL/default.txt b/app/src/main/play/release-notes/pl-PL/default.txt new file mode 100644 index 00000000..d0e2c823 --- /dev/null +++ b/app/src/main/play/release-notes/pl-PL/default.txt @@ -0,0 +1,7 @@ +Wersja 0.20.2 +- naprawiliśmy powiadomienie o szczęśliwym numerku +- naprawiliśmy przełączanie na nowy rok szkolny +- naprawiliśmy funkcję resetowania hasła +- dodaliśmy dziennik e-Skarżysko + +Pełna lista zmian: https://github.com/wulkanowy/wulkanowy/releases diff --git a/app/src/main/res/drawable-anydpi-v24/ic_stat_grade.xml b/app/src/main/res/drawable-anydpi-v24/ic_stat_grade.xml new file mode 100644 index 00000000..21b406fd --- /dev/null +++ b/app/src/main/res/drawable-anydpi-v24/ic_stat_grade.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable-anydpi-v24/ic_stat_luckynumber.xml b/app/src/main/res/drawable-anydpi-v24/ic_stat_luckynumber.xml new file mode 100644 index 00000000..bee1c707 --- /dev/null +++ b/app/src/main/res/drawable-anydpi-v24/ic_stat_luckynumber.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable-anydpi-v24/ic_stat_message.xml b/app/src/main/res/drawable-anydpi-v24/ic_stat_message.xml new file mode 100644 index 00000000..89a8aef2 --- /dev/null +++ b/app/src/main/res/drawable-anydpi-v24/ic_stat_message.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable-anydpi-v24/ic_stat_note.xml b/app/src/main/res/drawable-anydpi-v24/ic_stat_note.xml new file mode 100644 index 00000000..0f335336 --- /dev/null +++ b/app/src/main/res/drawable-anydpi-v24/ic_stat_note.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable-hdpi/ic_stat_grade.png b/app/src/main/res/drawable-hdpi/ic_stat_grade.png new file mode 100644 index 00000000..d97efb5d Binary files /dev/null and b/app/src/main/res/drawable-hdpi/ic_stat_grade.png differ diff --git a/app/src/main/res/drawable-hdpi/ic_stat_luckynumber.png b/app/src/main/res/drawable-hdpi/ic_stat_luckynumber.png new file mode 100644 index 00000000..b91c4ae6 Binary files /dev/null and b/app/src/main/res/drawable-hdpi/ic_stat_luckynumber.png differ diff --git a/app/src/main/res/drawable-hdpi/ic_stat_message.png b/app/src/main/res/drawable-hdpi/ic_stat_message.png new file mode 100644 index 00000000..ce0fdabc Binary files /dev/null and b/app/src/main/res/drawable-hdpi/ic_stat_message.png differ diff --git a/app/src/main/res/drawable-hdpi/ic_stat_note.png b/app/src/main/res/drawable-hdpi/ic_stat_note.png new file mode 100644 index 00000000..7318c419 Binary files /dev/null and b/app/src/main/res/drawable-hdpi/ic_stat_note.png differ diff --git a/app/src/main/res/drawable-hdpi/ic_stat_notify.png b/app/src/main/res/drawable-hdpi/ic_stat_notify.png deleted file mode 100644 index 34544980..00000000 Binary files a/app/src/main/res/drawable-hdpi/ic_stat_notify.png and /dev/null differ diff --git a/app/src/main/res/drawable-hdpi/ic_stat_push.png b/app/src/main/res/drawable-hdpi/ic_stat_push.png new file mode 100644 index 00000000..84578183 Binary files /dev/null and b/app/src/main/res/drawable-hdpi/ic_stat_push.png differ diff --git a/app/src/main/res/drawable-hdpi/ic_stat_timetable.png b/app/src/main/res/drawable-hdpi/ic_stat_timetable.png new file mode 100644 index 00000000..201419d5 Binary files /dev/null and b/app/src/main/res/drawable-hdpi/ic_stat_timetable.png differ diff --git a/app/src/main/res/drawable-hdpi/ic_widget_account.png b/app/src/main/res/drawable-hdpi/ic_widget_account.png new file mode 100644 index 00000000..4cb5ac89 Binary files /dev/null and b/app/src/main/res/drawable-hdpi/ic_widget_account.png differ diff --git a/app/src/main/res/drawable-mdpi/ic_stat_grade.png b/app/src/main/res/drawable-mdpi/ic_stat_grade.png new file mode 100644 index 00000000..c85b2702 Binary files /dev/null and b/app/src/main/res/drawable-mdpi/ic_stat_grade.png differ diff --git a/app/src/main/res/drawable-mdpi/ic_stat_luckynumber.png b/app/src/main/res/drawable-mdpi/ic_stat_luckynumber.png new file mode 100644 index 00000000..bfced4eb Binary files /dev/null and b/app/src/main/res/drawable-mdpi/ic_stat_luckynumber.png differ diff --git a/app/src/main/res/drawable-mdpi/ic_stat_message.png b/app/src/main/res/drawable-mdpi/ic_stat_message.png new file mode 100644 index 00000000..b357b321 Binary files /dev/null and b/app/src/main/res/drawable-mdpi/ic_stat_message.png differ diff --git a/app/src/main/res/drawable-mdpi/ic_stat_note.png b/app/src/main/res/drawable-mdpi/ic_stat_note.png new file mode 100644 index 00000000..55a4fbbf Binary files /dev/null and b/app/src/main/res/drawable-mdpi/ic_stat_note.png differ diff --git a/app/src/main/res/drawable-mdpi/ic_stat_notify.png b/app/src/main/res/drawable-mdpi/ic_stat_notify.png deleted file mode 100644 index 5564049a..00000000 Binary files a/app/src/main/res/drawable-mdpi/ic_stat_notify.png and /dev/null differ diff --git a/app/src/main/res/drawable-mdpi/ic_stat_push.png b/app/src/main/res/drawable-mdpi/ic_stat_push.png new file mode 100644 index 00000000..d1e954b0 Binary files /dev/null and b/app/src/main/res/drawable-mdpi/ic_stat_push.png differ diff --git a/app/src/main/res/drawable-mdpi/ic_stat_timetable.png b/app/src/main/res/drawable-mdpi/ic_stat_timetable.png new file mode 100644 index 00000000..dcfe95f2 Binary files /dev/null and b/app/src/main/res/drawable-mdpi/ic_stat_timetable.png differ diff --git a/app/src/main/res/drawable-mdpi/ic_widget_account.png b/app/src/main/res/drawable-mdpi/ic_widget_account.png new file mode 100644 index 00000000..237a6b6c Binary files /dev/null and b/app/src/main/res/drawable-mdpi/ic_widget_account.png differ diff --git a/app/src/main/res/drawable-night/background_header_note.xml b/app/src/main/res/drawable-night/background_header_note.xml new file mode 100644 index 00000000..6b594e7c --- /dev/null +++ b/app/src/main/res/drawable-night/background_header_note.xml @@ -0,0 +1,5 @@ + + + + + diff --git a/app/src/main/res/drawable-night/ic_all_divider.xml b/app/src/main/res/drawable-night/ic_all_divider.xml new file mode 100644 index 00000000..cd444a28 --- /dev/null +++ b/app/src/main/res/drawable-night/ic_all_divider.xml @@ -0,0 +1,9 @@ + + + + diff --git a/app/src/main/res/drawable-v23/img_splash_logo.png b/app/src/main/res/drawable-v23/img_splash_logo.png new file mode 100644 index 00000000..61489d81 Binary files /dev/null and b/app/src/main/res/drawable-v23/img_splash_logo.png differ diff --git a/app/src/main/res/drawable-v23/layer_splash_background.xml b/app/src/main/res/drawable-v23/layer_splash_background.xml new file mode 100644 index 00000000..1b4b64ec --- /dev/null +++ b/app/src/main/res/drawable-v23/layer_splash_background.xml @@ -0,0 +1,12 @@ + + + + + + + + diff --git a/app/src/main/res/drawable-v23/splash_background.xml b/app/src/main/res/drawable-v23/splash_background.xml deleted file mode 100644 index 611bb2a7..00000000 --- a/app/src/main/res/drawable-v23/splash_background.xml +++ /dev/null @@ -1,15 +0,0 @@ - - - - - - - - - - - diff --git a/app/src/main/res/drawable-xhdpi/ic_stat_grade.png b/app/src/main/res/drawable-xhdpi/ic_stat_grade.png new file mode 100644 index 00000000..c55ca7fd Binary files /dev/null and b/app/src/main/res/drawable-xhdpi/ic_stat_grade.png differ diff --git a/app/src/main/res/drawable-xhdpi/ic_stat_luckynumber.png b/app/src/main/res/drawable-xhdpi/ic_stat_luckynumber.png new file mode 100644 index 00000000..49e502ac Binary files /dev/null and b/app/src/main/res/drawable-xhdpi/ic_stat_luckynumber.png differ diff --git a/app/src/main/res/drawable-xhdpi/ic_stat_message.png b/app/src/main/res/drawable-xhdpi/ic_stat_message.png new file mode 100644 index 00000000..0e67ade3 Binary files /dev/null and b/app/src/main/res/drawable-xhdpi/ic_stat_message.png differ diff --git a/app/src/main/res/drawable-xhdpi/ic_stat_note.png b/app/src/main/res/drawable-xhdpi/ic_stat_note.png new file mode 100644 index 00000000..ea674a79 Binary files /dev/null and b/app/src/main/res/drawable-xhdpi/ic_stat_note.png differ diff --git a/app/src/main/res/drawable-xhdpi/ic_stat_notify.png b/app/src/main/res/drawable-xhdpi/ic_stat_notify.png deleted file mode 100644 index fabb8760..00000000 Binary files a/app/src/main/res/drawable-xhdpi/ic_stat_notify.png and /dev/null differ diff --git a/app/src/main/res/drawable-xhdpi/ic_stat_push.png b/app/src/main/res/drawable-xhdpi/ic_stat_push.png new file mode 100644 index 00000000..79b38e63 Binary files /dev/null and b/app/src/main/res/drawable-xhdpi/ic_stat_push.png differ diff --git a/app/src/main/res/drawable-xhdpi/ic_stat_timetable.png b/app/src/main/res/drawable-xhdpi/ic_stat_timetable.png new file mode 100644 index 00000000..7264bd92 Binary files /dev/null and b/app/src/main/res/drawable-xhdpi/ic_stat_timetable.png differ diff --git a/app/src/main/res/drawable-xhdpi/ic_widget_account.png b/app/src/main/res/drawable-xhdpi/ic_widget_account.png new file mode 100644 index 00000000..0ea798a8 Binary files /dev/null and b/app/src/main/res/drawable-xhdpi/ic_widget_account.png differ diff --git a/app/src/main/res/drawable-xxhdpi/ic_stat_grade.png b/app/src/main/res/drawable-xxhdpi/ic_stat_grade.png new file mode 100644 index 00000000..eeb6fa41 Binary files /dev/null and b/app/src/main/res/drawable-xxhdpi/ic_stat_grade.png differ diff --git a/app/src/main/res/drawable-xxhdpi/ic_stat_luckynumber.png b/app/src/main/res/drawable-xxhdpi/ic_stat_luckynumber.png new file mode 100644 index 00000000..9bab1373 Binary files /dev/null and b/app/src/main/res/drawable-xxhdpi/ic_stat_luckynumber.png differ diff --git a/app/src/main/res/drawable-xxhdpi/ic_stat_message.png b/app/src/main/res/drawable-xxhdpi/ic_stat_message.png new file mode 100644 index 00000000..2e881824 Binary files /dev/null and b/app/src/main/res/drawable-xxhdpi/ic_stat_message.png differ diff --git a/app/src/main/res/drawable-xxhdpi/ic_stat_note.png b/app/src/main/res/drawable-xxhdpi/ic_stat_note.png new file mode 100644 index 00000000..174e1509 Binary files /dev/null and b/app/src/main/res/drawable-xxhdpi/ic_stat_note.png differ diff --git a/app/src/main/res/drawable-xxhdpi/ic_stat_notify.png b/app/src/main/res/drawable-xxhdpi/ic_stat_notify.png deleted file mode 100644 index c1d78d46..00000000 Binary files a/app/src/main/res/drawable-xxhdpi/ic_stat_notify.png and /dev/null differ diff --git a/app/src/main/res/drawable-xxhdpi/ic_stat_push.png b/app/src/main/res/drawable-xxhdpi/ic_stat_push.png new file mode 100644 index 00000000..bc33cb5b Binary files /dev/null and b/app/src/main/res/drawable-xxhdpi/ic_stat_push.png differ diff --git a/app/src/main/res/drawable-xxhdpi/ic_stat_timetable.png b/app/src/main/res/drawable-xxhdpi/ic_stat_timetable.png new file mode 100644 index 00000000..1fb37b09 Binary files /dev/null and b/app/src/main/res/drawable-xxhdpi/ic_stat_timetable.png differ diff --git a/app/src/main/res/drawable-xxhdpi/ic_widget_account.png b/app/src/main/res/drawable-xxhdpi/ic_widget_account.png new file mode 100644 index 00000000..0f8933b1 Binary files /dev/null and b/app/src/main/res/drawable-xxhdpi/ic_widget_account.png differ diff --git a/app/src/main/res/drawable-xxxhdpi/ic_stat_notify.png b/app/src/main/res/drawable-xxxhdpi/ic_stat_notify.png deleted file mode 100644 index ee89e601..00000000 Binary files a/app/src/main/res/drawable-xxxhdpi/ic_stat_notify.png and /dev/null differ diff --git a/app/src/main/res/drawable-xxxhdpi/ic_stat_push.png b/app/src/main/res/drawable-xxxhdpi/ic_stat_push.png new file mode 100644 index 00000000..b354bd06 Binary files /dev/null and b/app/src/main/res/drawable-xxxhdpi/ic_stat_push.png differ diff --git a/app/src/main/res/drawable-xxxhdpi/ic_stat_timetable.png b/app/src/main/res/drawable-xxxhdpi/ic_stat_timetable.png new file mode 100644 index 00000000..a95cc4f5 Binary files /dev/null and b/app/src/main/res/drawable-xxxhdpi/ic_stat_timetable.png differ diff --git a/app/src/main/res/drawable/background_header_note.xml b/app/src/main/res/drawable/background_header_note.xml new file mode 100644 index 00000000..c21e55c6 --- /dev/null +++ b/app/src/main/res/drawable/background_header_note.xml @@ -0,0 +1,5 @@ + + + + + diff --git a/app/src/main/res/drawable/background_luckynumber_widget.xml b/app/src/main/res/drawable/background_luckynumber_widget.xml new file mode 100644 index 00000000..f29744d0 --- /dev/null +++ b/app/src/main/res/drawable/background_luckynumber_widget.xml @@ -0,0 +1,6 @@ + + + + + diff --git a/app/src/main/res/drawable/background_luckynumber_widget_dark.xml b/app/src/main/res/drawable/background_luckynumber_widget_dark.xml new file mode 100644 index 00000000..fa15fd85 --- /dev/null +++ b/app/src/main/res/drawable/background_luckynumber_widget_dark.xml @@ -0,0 +1,6 @@ + + + + + diff --git a/app/src/main/res/drawable/background_timetable_time_left.xml b/app/src/main/res/drawable/background_timetable_time_left.xml new file mode 100644 index 00000000..0f332611 --- /dev/null +++ b/app/src/main/res/drawable/background_timetable_time_left.xml @@ -0,0 +1,5 @@ + + + + + diff --git a/app/src/main/res/drawable/ic_about_creator.xml b/app/src/main/res/drawable/ic_about_creator.xml new file mode 100644 index 00000000..c3daf609 --- /dev/null +++ b/app/src/main/res/drawable/ic_about_creator.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_about_discord.xml b/app/src/main/res/drawable/ic_about_discord.xml new file mode 100644 index 00000000..bcca42bf --- /dev/null +++ b/app/src/main/res/drawable/ic_about_discord.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_about_faq.xml b/app/src/main/res/drawable/ic_about_faq.xml new file mode 100644 index 00000000..d6ab255b --- /dev/null +++ b/app/src/main/res/drawable/ic_about_faq.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_about_feedback.xml b/app/src/main/res/drawable/ic_about_feedback.xml new file mode 100644 index 00000000..a348cb6a --- /dev/null +++ b/app/src/main/res/drawable/ic_about_feedback.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_about_homepage.xml b/app/src/main/res/drawable/ic_about_homepage.xml new file mode 100644 index 00000000..1ec60812 --- /dev/null +++ b/app/src/main/res/drawable/ic_about_homepage.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_about_licenses.xml b/app/src/main/res/drawable/ic_about_licenses.xml new file mode 100644 index 00000000..1a052734 --- /dev/null +++ b/app/src/main/res/drawable/ic_about_licenses.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_about_privacy.xml b/app/src/main/res/drawable/ic_about_privacy.xml new file mode 100644 index 00000000..109f05df --- /dev/null +++ b/app/src/main/res/drawable/ic_about_privacy.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_alert_24dp.xml b/app/src/main/res/drawable/ic_alert_24dp.xml deleted file mode 100644 index 1c41b556..00000000 --- a/app/src/main/res/drawable/ic_alert_24dp.xml +++ /dev/null @@ -1,10 +0,0 @@ - - - \ No newline at end of file diff --git a/app/src/main/res/drawable/ic_all_about.xml b/app/src/main/res/drawable/ic_all_about.xml new file mode 100644 index 00000000..3dfbbda1 --- /dev/null +++ b/app/src/main/res/drawable/ic_all_about.xml @@ -0,0 +1,12 @@ + + + + diff --git a/app/src/main/res/drawable/ic_all_account.xml b/app/src/main/res/drawable/ic_all_account.xml new file mode 100644 index 00000000..0e917d5f --- /dev/null +++ b/app/src/main/res/drawable/ic_all_account.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_all_add.xml b/app/src/main/res/drawable/ic_all_add.xml new file mode 100644 index 00000000..e4566293 --- /dev/null +++ b/app/src/main/res/drawable/ic_all_add.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_all_close_circle.xml b/app/src/main/res/drawable/ic_all_close_circle.xml new file mode 100644 index 00000000..3f89a8fa --- /dev/null +++ b/app/src/main/res/drawable/ic_all_close_circle.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_border.xml b/app/src/main/res/drawable/ic_all_divider.xml similarity index 81% rename from app/src/main/res/drawable/ic_border.xml rename to app/src/main/res/drawable/ic_all_divider.xml index dc33b8aa..61e96497 100644 --- a/app/src/main/res/drawable/ic_border.xml +++ b/app/src/main/res/drawable/ic_all_divider.xml @@ -5,5 +5,5 @@ android:angle="270" android:centerColor="@android:color/transparent" android:centerX="0.01" - android:startColor="#60606060" /> - \ No newline at end of file + android:startColor="@color/colorDivider" /> + diff --git a/app/src/main/res/drawable/ic_all_done.xml b/app/src/main/res/drawable/ic_all_done.xml new file mode 100644 index 00000000..bb657f6e --- /dev/null +++ b/app/src/main/res/drawable/ic_all_done.xml @@ -0,0 +1,10 @@ + + + diff --git a/app/src/main/res/drawable/ic_all_done_all.xml b/app/src/main/res/drawable/ic_all_done_all.xml new file mode 100644 index 00000000..e27672ef --- /dev/null +++ b/app/src/main/res/drawable/ic_all_done_all.xml @@ -0,0 +1,10 @@ + + + diff --git a/app/src/main/res/drawable/ic_exclamation_24dp.xml b/app/src/main/res/drawable/ic_all_mark.xml similarity index 55% rename from app/src/main/res/drawable/ic_exclamation_24dp.xml rename to app/src/main/res/drawable/ic_all_mark.xml index 4d3c91cf..12721649 100644 --- a/app/src/main/res/drawable/ic_exclamation_24dp.xml +++ b/app/src/main/res/drawable/ic_all_mark.xml @@ -1,10 +1,9 @@ - + android:viewportWidth="24" + android:viewportHeight="24"> - \ No newline at end of file + diff --git a/app/src/main/res/drawable/ic_all_round_mark.xml b/app/src/main/res/drawable/ic_all_round_mark.xml new file mode 100644 index 00000000..91afb233 --- /dev/null +++ b/app/src/main/res/drawable/ic_all_round_mark.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_attachment.xml b/app/src/main/res/drawable/ic_attachment.xml new file mode 100644 index 00000000..c18714f5 --- /dev/null +++ b/app/src/main/res/drawable/ic_attachment.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_check.xml b/app/src/main/res/drawable/ic_check.xml new file mode 100644 index 00000000..3c728c59 --- /dev/null +++ b/app/src/main/res/drawable/ic_check.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_chevron_left.xml b/app/src/main/res/drawable/ic_chevron_left.xml new file mode 100644 index 00000000..ee3ff4be --- /dev/null +++ b/app/src/main/res/drawable/ic_chevron_left.xml @@ -0,0 +1,5 @@ + + + diff --git a/app/src/main/res/drawable/ic_chevron_right.xml b/app/src/main/res/drawable/ic_chevron_right.xml new file mode 100644 index 00000000..a6d73497 --- /dev/null +++ b/app/src/main/res/drawable/ic_chevron_right.xml @@ -0,0 +1,5 @@ + + + diff --git a/app/src/main/res/drawable/ic_error.xml b/app/src/main/res/drawable/ic_error.xml new file mode 100644 index 00000000..bb4cb302 --- /dev/null +++ b/app/src/main/res/drawable/ic_error.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_excuse_denied.xml b/app/src/main/res/drawable/ic_excuse_denied.xml new file mode 100644 index 00000000..218cfbdc --- /dev/null +++ b/app/src/main/res/drawable/ic_excuse_denied.xml @@ -0,0 +1,10 @@ + + + diff --git a/app/src/main/res/drawable/ic_excuse_waiting.xml b/app/src/main/res/drawable/ic_excuse_waiting.xml new file mode 100644 index 00000000..863418b7 --- /dev/null +++ b/app/src/main/res/drawable/ic_excuse_waiting.xml @@ -0,0 +1,10 @@ + + + diff --git a/app/src/main/res/drawable/ic_fullscreen.xml b/app/src/main/res/drawable/ic_fullscreen.xml new file mode 100644 index 00000000..86b7649b --- /dev/null +++ b/app/src/main/res/drawable/ic_fullscreen.xml @@ -0,0 +1,5 @@ + + + diff --git a/app/src/main/res/drawable/ic_fullscreen_exit.xml b/app/src/main/res/drawable/ic_fullscreen_exit.xml new file mode 100644 index 00000000..bb7140f2 --- /dev/null +++ b/app/src/main/res/drawable/ic_fullscreen_exit.xml @@ -0,0 +1,5 @@ + + + diff --git a/app/src/main/res/drawable/ic_launcher_foreground.xml b/app/src/main/res/drawable/ic_launcher_foreground.xml index c5ecc747..ee11f89d 100644 --- a/app/src/main/res/drawable/ic_launcher_foreground.xml +++ b/app/src/main/res/drawable/ic_launcher_foreground.xml @@ -1,17 +1,15 @@ - - - + android:viewportWidth="1926" + android:viewportHeight="1926"> + + + diff --git a/app/src/main/res/drawable/ic_main_attendance.xml b/app/src/main/res/drawable/ic_main_attendance.xml new file mode 100644 index 00000000..c42a17b3 --- /dev/null +++ b/app/src/main/res/drawable/ic_main_attendance.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_main_exam.xml b/app/src/main/res/drawable/ic_main_exam.xml new file mode 100644 index 00000000..a705c0a4 --- /dev/null +++ b/app/src/main/res/drawable/ic_main_exam.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_main_grade.xml b/app/src/main/res/drawable/ic_main_grade.xml new file mode 100644 index 00000000..bf4c2cf2 --- /dev/null +++ b/app/src/main/res/drawable/ic_main_grade.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_main_more.xml b/app/src/main/res/drawable/ic_main_more.xml new file mode 100644 index 00000000..f57a7245 --- /dev/null +++ b/app/src/main/res/drawable/ic_main_more.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_main_timetable.xml b/app/src/main/res/drawable/ic_main_timetable.xml new file mode 100644 index 00000000..b8f5cb85 --- /dev/null +++ b/app/src/main/res/drawable/ic_main_timetable.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_menu_attendance_24dp.xml b/app/src/main/res/drawable/ic_menu_attendance_24dp.xml deleted file mode 100644 index fdef7322..00000000 --- a/app/src/main/res/drawable/ic_menu_attendance_24dp.xml +++ /dev/null @@ -1,12 +0,0 @@ - - - - \ No newline at end of file diff --git a/app/src/main/res/drawable/ic_menu_attendance_summary.xml b/app/src/main/res/drawable/ic_menu_attendance_summary.xml new file mode 100644 index 00000000..f0dab549 --- /dev/null +++ b/app/src/main/res/drawable/ic_menu_attendance_summary.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_menu_dashboard_24dp.xml b/app/src/main/res/drawable/ic_menu_dashboard_24dp.xml deleted file mode 100644 index 50726abd..00000000 --- a/app/src/main/res/drawable/ic_menu_dashboard_24dp.xml +++ /dev/null @@ -1,9 +0,0 @@ - - - diff --git a/app/src/main/res/drawable/ic_menu_grade_26dp.xml b/app/src/main/res/drawable/ic_menu_grade_26dp.xml deleted file mode 100644 index 61506dad..00000000 --- a/app/src/main/res/drawable/ic_menu_grade_26dp.xml +++ /dev/null @@ -1,11 +0,0 @@ - - - \ No newline at end of file diff --git a/app/src/main/res/drawable/ic_menu_grade_semester.xml b/app/src/main/res/drawable/ic_menu_grade_semester.xml new file mode 100644 index 00000000..8eb86922 --- /dev/null +++ b/app/src/main/res/drawable/ic_menu_grade_semester.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_menu_message_delete.xml b/app/src/main/res/drawable/ic_menu_message_delete.xml new file mode 100644 index 00000000..e60947c8 --- /dev/null +++ b/app/src/main/res/drawable/ic_menu_message_delete.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_menu_message_forward.xml b/app/src/main/res/drawable/ic_menu_message_forward.xml new file mode 100644 index 00000000..97e34dda --- /dev/null +++ b/app/src/main/res/drawable/ic_menu_message_forward.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_menu_message_print.xml b/app/src/main/res/drawable/ic_menu_message_print.xml new file mode 100644 index 00000000..204b0f6e --- /dev/null +++ b/app/src/main/res/drawable/ic_menu_message_print.xml @@ -0,0 +1,13 @@ + + + + diff --git a/app/src/main/res/drawable/ic_menu_message_reply.xml b/app/src/main/res/drawable/ic_menu_message_reply.xml new file mode 100644 index 00000000..d9c66711 --- /dev/null +++ b/app/src/main/res/drawable/ic_menu_message_reply.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_menu_message_send.xml b/app/src/main/res/drawable/ic_menu_message_send.xml new file mode 100644 index 00000000..fe72265f --- /dev/null +++ b/app/src/main/res/drawable/ic_menu_message_send.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_menu_message_share.xml b/app/src/main/res/drawable/ic_menu_message_share.xml new file mode 100644 index 00000000..67a8ee49 --- /dev/null +++ b/app/src/main/res/drawable/ic_menu_message_share.xml @@ -0,0 +1,10 @@ + + + diff --git a/app/src/main/res/drawable/ic_menu_message_write.xml b/app/src/main/res/drawable/ic_menu_message_write.xml new file mode 100644 index 00000000..7068aa5f --- /dev/null +++ b/app/src/main/res/drawable/ic_menu_message_write.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_menu_other_24dp.xml b/app/src/main/res/drawable/ic_menu_other_24dp.xml deleted file mode 100644 index 9fed586b..00000000 --- a/app/src/main/res/drawable/ic_menu_other_24dp.xml +++ /dev/null @@ -1,16 +0,0 @@ - - - - \ No newline at end of file diff --git a/app/src/main/res/drawable/ic_menu_timetable_24dp.xml b/app/src/main/res/drawable/ic_menu_timetable_24dp.xml deleted file mode 100644 index a689dc06..00000000 --- a/app/src/main/res/drawable/ic_menu_timetable_24dp.xml +++ /dev/null @@ -1,11 +0,0 @@ - - - - \ No newline at end of file diff --git a/app/src/main/res/drawable/ic_menu_timetable_lessons_completed.xml b/app/src/main/res/drawable/ic_menu_timetable_lessons_completed.xml new file mode 100644 index 00000000..a521adee --- /dev/null +++ b/app/src/main/res/drawable/ic_menu_timetable_lessons_completed.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_more_homework.xml b/app/src/main/res/drawable/ic_more_homework.xml new file mode 100644 index 00000000..9641ff70 --- /dev/null +++ b/app/src/main/res/drawable/ic_more_homework.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_more_lucky_number.xml b/app/src/main/res/drawable/ic_more_lucky_number.xml new file mode 100644 index 00000000..d644288c --- /dev/null +++ b/app/src/main/res/drawable/ic_more_lucky_number.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_more_messages.xml b/app/src/main/res/drawable/ic_more_messages.xml new file mode 100644 index 00000000..20c54e01 --- /dev/null +++ b/app/src/main/res/drawable/ic_more_messages.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_more_mobile_devices.xml b/app/src/main/res/drawable/ic_more_mobile_devices.xml new file mode 100644 index 00000000..6adeb6cf --- /dev/null +++ b/app/src/main/res/drawable/ic_more_mobile_devices.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_more_note.xml b/app/src/main/res/drawable/ic_more_note.xml new file mode 100644 index 00000000..47ba29cb --- /dev/null +++ b/app/src/main/res/drawable/ic_more_note.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_more_schoolandteachers.xml b/app/src/main/res/drawable/ic_more_schoolandteachers.xml new file mode 100644 index 00000000..9cb9aee0 --- /dev/null +++ b/app/src/main/res/drawable/ic_more_schoolandteachers.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_more_settings.xml b/app/src/main/res/drawable/ic_more_settings.xml new file mode 100644 index 00000000..334eb11f --- /dev/null +++ b/app/src/main/res/drawable/ic_more_settings.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_refresh.xml b/app/src/main/res/drawable/ic_refresh.xml new file mode 100644 index 00000000..cc2d1e04 --- /dev/null +++ b/app/src/main/res/drawable/ic_refresh.xml @@ -0,0 +1,5 @@ + + + diff --git a/app/src/main/res/drawable/ic_school_directions.xml b/app/src/main/res/drawable/ic_school_directions.xml new file mode 100644 index 00000000..c48db1da --- /dev/null +++ b/app/src/main/res/drawable/ic_school_directions.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_school_phone.xml b/app/src/main/res/drawable/ic_school_phone.xml new file mode 100644 index 00000000..7e3d7991 --- /dev/null +++ b/app/src/main/res/drawable/ic_school_phone.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_search.xml b/app/src/main/res/drawable/ic_search.xml new file mode 100644 index 00000000..cd9985cb --- /dev/null +++ b/app/src/main/res/drawable/ic_search.xml @@ -0,0 +1,9 @@ + + + diff --git a/app/src/main/res/drawable/ic_share.xml b/app/src/main/res/drawable/ic_share.xml new file mode 100644 index 00000000..045bbc0c --- /dev/null +++ b/app/src/main/res/drawable/ic_share.xml @@ -0,0 +1,5 @@ + + + diff --git a/app/src/main/res/drawable/ic_swap_30dp.xml b/app/src/main/res/drawable/ic_timetable_swap.xml similarity index 85% rename from app/src/main/res/drawable/ic_swap_30dp.xml rename to app/src/main/res/drawable/ic_timetable_swap.xml index 01eee893..4055623a 100644 --- a/app/src/main/res/drawable/ic_swap_30dp.xml +++ b/app/src/main/res/drawable/ic_timetable_swap.xml @@ -4,6 +4,6 @@ android:viewportHeight="24.0" android:viewportWidth="24.0"> diff --git a/app/src/main/res/drawable/ic_widget_chevron.png b/app/src/main/res/drawable/ic_widget_chevron.png new file mode 100644 index 00000000..34345521 Binary files /dev/null and b/app/src/main/res/drawable/ic_widget_chevron.png differ diff --git a/app/src/main/res/drawable/ic_widget_clover.png b/app/src/main/res/drawable/ic_widget_clover.png new file mode 100644 index 00000000..b1a7832a Binary files /dev/null and b/app/src/main/res/drawable/ic_widget_clover.png differ diff --git a/app/src/main/res/drawable/ic_wrench_24dp.xml b/app/src/main/res/drawable/ic_wrench_24dp.xml deleted file mode 100644 index 8f3a86fa..00000000 --- a/app/src/main/res/drawable/ic_wrench_24dp.xml +++ /dev/null @@ -1,12 +0,0 @@ - - - - - \ No newline at end of file diff --git a/app/src/main/res/drawable/img_luckynumber_widget_preview.png b/app/src/main/res/drawable/img_luckynumber_widget_preview.png new file mode 100644 index 00000000..539b0a59 Binary files /dev/null and b/app/src/main/res/drawable/img_luckynumber_widget_preview.png differ diff --git a/app/src/main/res/drawable/img_splash_512px.png b/app/src/main/res/drawable/img_splash_512px.png deleted file mode 100644 index 9d8f403c..00000000 Binary files a/app/src/main/res/drawable/img_splash_512px.png and /dev/null differ diff --git a/app/src/main/res/drawable/img_splash_logo.png b/app/src/main/res/drawable/img_splash_logo.png new file mode 100644 index 00000000..fb521bf6 Binary files /dev/null and b/app/src/main/res/drawable/img_splash_logo.png differ diff --git a/app/src/main/res/drawable/img_timetable_widget_preview.png b/app/src/main/res/drawable/img_timetable_widget_preview.png new file mode 100644 index 00000000..55026025 Binary files /dev/null and b/app/src/main/res/drawable/img_timetable_widget_preview.png differ diff --git a/app/src/main/res/drawable-v15/splash_background.xml b/app/src/main/res/drawable/layer_splash_background.xml similarity index 51% rename from app/src/main/res/drawable-v15/splash_background.xml rename to app/src/main/res/drawable/layer_splash_background.xml index c58c374a..2cf46d1d 100644 --- a/app/src/main/res/drawable-v15/splash_background.xml +++ b/app/src/main/res/drawable/layer_splash_background.xml @@ -1,14 +1,12 @@ - - + - + android:gravity="left|right|top|bottom" + android:src="@drawable/img_splash_logo" /> diff --git a/app/src/main/res/drawable/splash_background.xml b/app/src/main/res/drawable/splash_background.xml deleted file mode 100644 index 0b79b672..00000000 --- a/app/src/main/res/drawable/splash_background.xml +++ /dev/null @@ -1,8 +0,0 @@ - - - - - - - - diff --git a/app/src/main/res/layout/activity_login.xml b/app/src/main/res/layout/activity_login.xml index 67095982..3841b25c 100644 --- a/app/src/main/res/layout/activity_login.xml +++ b/app/src/main/res/layout/activity_login.xml @@ -1,138 +1,17 @@ - + android:orientation="vertical"> - - + android:layout_height="wrap_content" /> - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -