[Actions] Rename changelog output name.

.github/utils/extract_changelogs.py

@@ -23,11 +23,11 @@ if __name__ == "__main__":
     (title, changelog) = get_changelog(project_dir, format="plain")
 
     # plain text changelog - Firebase App Distribution
-    with open(dir + "whatsnew-titled.txt", "w", encoding="utf-8") as f:
+    with open(dir + "whatsnew_titled.txt", "w", encoding="utf-8") as f:
         f.write(title)
         f.write("\n")
         f.write(changelog)
-    print("::set-output name=changelogPlainTitledFile::" + dir + "whatsnew-titled.txt")
+    print("::set-output name=changelogPlainTitledFile::" + dir + "whatsnew_titled.txt")
 
     print("::set-output name=changelogTitle::" + title)
 

.github/workflows/build-release-aab-play.yml

@@ -113,10 +113,11 @@ jobs:
         with:
           serviceAccountJsonPlainText: ${{ secrets.PLAY_SERVICE_ACCOUNT_JSON }}
           packageName: pl.szczodrzynski.edziennik
-          releaseFile: ${{ needs.sign.outputs.signedReleaseFile }}
+          releaseFiles: ${{ needs.sign.outputs.signedReleaseFile }}
           releaseName: ${{ steps.changelog.outputs.appVersionName }}
           track: ${{ secrets.PLAY_RELEASE_TRACK }}
           whatsNewDirectory: ${{ steps.changelog.outputs.changelogDir }}
+          status: completed
 
       - name: Upload workflow artifact
         uses: actions/upload-artifact@v2

app/build.gradle

@@ -156,6 +156,7 @@ dependencies {
     implementation "androidx.navigation:navigation-fragment-ktx:2.5.2"
     implementation "androidx.recyclerview:recyclerview:1.2.1"
     implementation "androidx.room:room-runtime:2.4.3"
+    implementation "androidx.room:room-ktx:2.4.3"
     implementation "androidx.work:work-runtime-ktx:2.7.1"
     kapt "androidx.room:room-compiler:2.4.3"
 

app/src/main/AndroidManifest.xml

@@ -160,7 +160,11 @@
         <activity android:name=".ui.login.oauth.OAuthLoginActivity"
             android:configChanges="orientation|keyboardHidden"
             android:exported="false"
-            android:theme="@style/AppTheme.Light" />
+            android:theme="@style/Theme.MaterialComponents.Light.DarkActionBar" />
+        <activity android:name=".ui.login.recaptcha.RecaptchaActivity"
+            android:configChanges="orientation|keyboardHidden"
+            android:exported="false"
+            android:theme="@style/Theme.MaterialComponents.Light.DarkActionBar" />
         <activity android:name=".ui.base.BuildInvalidActivity" android:exported="false" />
         <activity android:name=".ui.settings.contributors.ContributorsActivity" android:exported="false" />
 

app/src/main/assets/pl-changelog.html

@@ -1,11 +1,10 @@
-<h3>Wersja 4.13.1, 2022-11-03</h3>
+<h3>Wersja 4.13.6, 2023-03-24</h3>
 <ul>
-    <li>Edycja kart na stronie głównej znowu działa.</li>
-    <li>Poprawiono pobieranie nauczyciela w zakładce Uwagi. @BxOxSxS</li>
-    <li>Poprawiono oznaczanie daty przeczytania wiadomości wysłanych. @BxOxSxS</li>
-    <li>Dodano tłumaczenie karty planu lekcji. @MedzikUser</li>
+    <li>Naprawiono pobieranie załączników na Androidzie 13 i nowszym.</li>
+    <li>Dodano opcję odświeżenia planu lekcji na wybrany tydzień.</li>
+    <li>Usunięto błędy logowania. @BxOxSxS</li>
 </ul>
 <br>
 <br>
 Dzięki za korzystanie ze Szkolnego!<br>
-<i>&copy; [Kuba Szczodrzyński](@kuba2k2) 2022</i>
+<i>&copy; [Kuba Szczodrzyński](@kuba2k2) 2023</i>

app/src/main/cpp/szkolny-signing.cpp

@@ -9,7 +9,7 @@
 
 /*secret password - removed for source code publication*/
 static toys AES_IV[16] = {
-	0xe8, 0x2b, 0x2c, 0xd8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff  };
+	0x6d, 0xa5, 0x32, 0xe6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff  };
 
 unsigned char *agony(unsigned int laugh, unsigned char *box, unsigned char *heat);
 

app/src/main/java/pl/szczodrzynski/edziennik/App.kt

@@ -235,6 +235,7 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         }
 
         Signing.getCert(this)
+        Utils.initializeStorageDir(this)
 
         launch {
             withContext(Dispatchers.Default) {
@@ -422,6 +423,12 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         try {
             App.data = AppData.get(profile.loginStoreType)
             d("App", "Loaded AppData: ${App.data}")
+            // apply newly-added config overrides, if not changed by the user yet
+            for ((key, value) in App.data.configOverrides) {
+                val config = App.profile.config
+                if (!config.has(key))
+                    config.set(key, value)
+            }
         } catch (e: Exception) {
             Log.e("App", "Cannot load AppData", e)
             Toast.makeText(this, R.string.app_cannot_load_data, Toast.LENGTH_LONG).show()

app/src/main/java/pl/szczodrzynski/edziennik/MainActivity.kt

@@ -322,7 +322,7 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
 
         // IT'S WINTER MY DUDES
         val today = Date.getToday()
-        if ((today.month % 11 == 1) && app.config.ui.snowfall) {
+        if ((today.month / 3 % 4 == 0) && app.config.ui.snowfall) {
             b.rootFrame.addView(layoutInflater.inflate(R.layout.snowfall, b.rootFrame, false))
         } else if (app.config.ui.eggfall && BigNightUtil().isDataWielkanocyNearDzisiaj()) {
             val eggfall = layoutInflater.inflate(

app/src/main/java/pl/szczodrzynski/edziennik/config/AppData.kt

@@ -59,10 +59,11 @@ data class AppData(
         val lessonHeight: Int,
         val enableMarkAsReadAnnouncements: Boolean,
         val enableNoticePoints: Boolean,
+        val eventManualShowSubjectDropdown: Boolean,
     )
 
     data class EventType(
-        val id: Int,
+        val id: Long,
         val color: String,
         val name: String,
     )

app/src/main/java/pl/szczodrzynski/edziennik/config/BaseConfig.kt

@@ -43,4 +43,6 @@ abstract class BaseConfig(
             db.configDao().add(ConfigEntry(profileId ?: -1, key, value))
         }
     }
+
+    fun has(key: String) = values.containsKey(key)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfig.kt

@@ -15,7 +15,7 @@ class ProfileConfig(
     entries: List<ConfigEntry>?,
 ) : BaseConfig(db, profileId, entries) {
     companion object {
-        const val DATA_VERSION = 4
+        const val DATA_VERSION = 5
     }
 
     val grades by lazy { ProfileConfigGrades(this) }

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfigUI.kt

@@ -15,6 +15,7 @@ class ProfileConfigUI(base: ProfileConfig) {
     var agendaGroupByType by base.config<Boolean>(false)
     var agendaLessonChanges by base.config<Boolean>(true)
     var agendaTeacherAbsence by base.config<Boolean>(true)
+    var agendaSubjectImportant by base.config<Boolean>(false)
     var agendaElearningMark by base.config<Boolean>(false)
     var agendaElearningGroup by base.config<Boolean>(true)
 

app/src/main/java/pl/szczodrzynski/edziennik/config/utils/ProfileConfigMigration.kt

@@ -16,6 +16,8 @@ import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.YEAR_AL
 class ProfileConfigMigration(config: ProfileConfig) {
     init { config.apply {
 
+        val profile = db.profileDao().getByIdNow(profileId ?: -1)
+
         if (dataVersion < 2) {
             sync.notificationFilter = sync.notificationFilter + NotificationType.TEACHER_ABSENCE
 
@@ -37,11 +39,23 @@ class ProfileConfigMigration(config: ProfileConfig) {
             // switch to new event types (USOS)
             dataVersion = 4
 
-            val profile = db.profileDao().getByIdNow(profileId ?: -1)
             if (profile?.loginStoreType?.schoolType == SchoolType.UNIVERSITY) {
                 db.eventTypeDao().clear(profileId ?: -1)
                 db.eventTypeDao().addDefaultTypes(profile)
             }
         }
+
+        if (dataVersion < 5) {
+            // update USOS event types and the appropriate events (2022-12-25)
+            dataVersion = 5
+
+            if (profile?.loginStoreType?.schoolType == SchoolType.UNIVERSITY) {
+                db.eventTypeDao().getAllWithDefaults(profile)
+                // wejściówka (4) -> kartkówka (3)
+                db.eventDao().getRawNow("UPDATE events SET eventType = 3 WHERE profileId = $profileId AND eventType = 4;")
+                // zadanie (6) -> zadanie domowe (-1)
+                db.eventDao().getRawNow("UPDATE events SET eventType = -1 WHERE profileId = $profileId AND eventType = 6;")
+            }
+        }
     }}
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/Constants.kt

@@ -26,9 +26,10 @@ val LIBRUS_USER_AGENT = "${SYSTEM_USER_AGENT}LibrusMobileApp"
 const val SYNERGIA_USER_AGENT = "Mozilla/5.0 (Windows NT 10.0; Win64; x64) Gecko/20100101 Firefox/62.0"
 const val LIBRUS_CLIENT_ID = "VaItV6oRutdo8fnjJwysnTjVlvaswf52ZqmXsJGP"
 const val LIBRUS_REDIRECT_URL = "app://librus"
-const val LIBRUS_AUTHORIZE_URL = "https://portal.librus.pl/oauth2/authorize?client_id=$LIBRUS_CLIENT_ID&redirect_uri=$LIBRUS_REDIRECT_URL&response_type=code"
-const val LIBRUS_LOGIN_URL = "https://portal.librus.pl/rodzina/login/action"
+const val LIBRUS_AUTHORIZE_URL = "https://portal.librus.pl/konto-librus/redirect/dru"
+const val LIBRUS_LOGIN_URL = "https://portal.librus.pl/konto-librus/login/action"
 const val LIBRUS_TOKEN_URL = "https://portal.librus.pl/oauth2/access_token"
+const val LIBRUS_HEADER = "pl.librus.synergiaDru2"
 
 const val LIBRUS_ACCOUNT_URL = "/v3/SynergiaAccounts/fresh/" // + login
 const val LIBRUS_ACCOUNTS_URL = "/v3/SynergiaAccounts"
@@ -59,9 +60,6 @@ const val LIBRUS_SANDBOX_URL = "https://sandbox.librus.pl/index.php?action="
 const val LIBRUS_SYNERGIA_HOMEWORK_ATTACHMENT_URL = "https://synergia.librus.pl/homework/downloadFile"
 const val LIBRUS_SYNERGIA_MESSAGES_ATTACHMENT_URL = "https://synergia.librus.pl/wiadomosci/pobierz_zalacznik"
 
-const val LIBRUS_PORTAL_RECAPTCHA_KEY = "6Lf48moUAAAAAB9ClhdvHr46gRWR"
-const val LIBRUS_PORTAL_RECAPTCHA_REFERER = "https://portal.librus.pl/rodzina/login"
-
 
 val MOBIDZIENNIK_USER_AGENT = SYSTEM_USER_AGENT
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/Regexes.kt

@@ -24,6 +24,25 @@ object Regexes {
         """^\[META:([A-z0-9-&=]+)]""".toRegex()
     }
 
+    val HTML_INPUT_HIDDEN by lazy {
+        """<input .*?type="hidden".+?>""".toRegex()
+    }
+    val HTML_INPUT_NAME by lazy {
+        """name="(.+?)"""".toRegex()
+    }
+    val HTML_INPUT_VALUE by lazy {
+        """value="(.+?)"""".toRegex()
+    }
+    val HTML_CSRF_TOKEN by lazy {
+        """name="csrf-token" content="([A-z0-9=+/\-_]+?)"""".toRegex()
+    }
+    val HTML_FORM_ACTION by lazy {
+        """<form .*?action="(.+?)"""".toRegex()
+    }
+    val HTML_RECAPTCHA_KEY by lazy {
+        """data-sitekey="(.+?)"""".toRegex()
+    }
+
 
 
     val MOBIDZIENNIK_GRADES_SUBJECT_NAME by lazy {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/login/LibrusLoginPortal.kt

@@ -24,6 +24,9 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
         private const val TAG = "LoginLibrusPortal"
     }
 
+    // loop failsafe
+    private var loginPerformed = false
+
     init { run {
         if (data.loginStore.mode != LoginMode.LIBRUS_EMAIL) {
             data.error(ApiError(TAG, ERROR_INVALID_LOGIN_MODE))
@@ -33,6 +36,7 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
             data.error(ApiError(TAG, ERROR_LOGIN_DATA_MISSING))
             return@run
         }
+        loginPerformed = false
 
         // succeed having a non-expired access token and a refresh token
         if (data.isPortalLoginValid()) {
@@ -58,18 +62,23 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
         }
     }}
 
-    private fun authorize(url: String?) {
+    private fun authorize(url: String, referer: String? = null) {
         d(TAG, "Request: Librus/Login/Portal - $url")
 
         Request.builder()
                 .url(url)
                 .userAgent(LIBRUS_USER_AGENT)
+                .also {
+                    if (referer != null)
+                        it.addHeader("Referer", referer)
+                }
+                .addHeader("X-Requested-With", LIBRUS_HEADER)
                 .withClient(data.app.httpLazy)
                 .callback(object : TextCallbackHandler() {
                     override fun onSuccess(text: String, response: Response) {
                         val location = response.headers().get("Location")
                         if (location != null) {
-                            val authMatcher = Pattern.compile("$LIBRUS_REDIRECT_URL\\?code=([A-z0-9]+?)$", Pattern.DOTALL or Pattern.MULTILINE).matcher(location)
+                            val authMatcher = Pattern.compile("$LIBRUS_REDIRECT_URL\\?code=([^&?]+)", Pattern.DOTALL or Pattern.MULTILINE).matcher(location)
                             when {
                                 authMatcher.find() -> {
                                     accessToken(authMatcher.group(1), null)
@@ -83,16 +92,31 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
                                     authorize(location)
                                 }
                             }
-                        } else {
-                            val csrfMatcher = Pattern.compile("name=\"csrf-token\" content=\"([A-z0-9=+/\\-_]+?)\"", Pattern.DOTALL).matcher(text)
-                            if (csrfMatcher.find()) {
-                                login(csrfMatcher.group(1) ?: "")
-                            } else {
-                                data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_CSRF_MISSING)
-                                        .withResponse(response)
-                                        .withApiResponse(text))
+                            return
+                        }
+
+                        if (checkError(text, response))
+                            return
+
+                        var loginUrl = if (data.fakeLogin) FAKE_LIBRUS_LOGIN else LIBRUS_LOGIN_URL
+                        val csrfToken = Regexes.HTML_CSRF_TOKEN.find(text)?.get(1) ?: ""
+
+                        for (match in Regexes.HTML_FORM_ACTION.findAll(text)) {
+                            val form = match.value.lowercase()
+                            if ("login" in form && "post" in form) {
+                                loginUrl = match[1]
                             }
                         }
+
+                        val params = mutableMapOf<String, String>()
+                        for (match in Regexes.HTML_INPUT_HIDDEN.findAll(text)) {
+                            val input = match.value
+                            val name = Regexes.HTML_INPUT_NAME.find(input)?.get(1) ?: continue
+                            val value = Regexes.HTML_INPUT_VALUE.find(input)?.get(1) ?: continue
+                            params[name] = value
+                        }
+
+                        login(url = loginUrl, referer = url, csrfToken, params)
                     }
 
                     override fun onFailure(response: Response, throwable: Throwable) {
@@ -105,8 +129,54 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
                 .enqueue()
     }
 
-    private fun login(csrfToken: String) {
-        d(TAG, "Request: Librus/Login/Portal - ${if (data.fakeLogin) FAKE_LIBRUS_LOGIN else LIBRUS_LOGIN_URL}")
+    private fun checkError(text: String, response: Response): Boolean {
+        when {
+            text.contains("librus_account_settings_main") -> return false
+            text.contains("Sesja logowania wygasła") -> ERROR_LOGIN_LIBRUS_PORTAL_CSRF_EXPIRED
+            text.contains("Upewnij się, że nie") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
+            text.contains("Podany adres e-mail jest nieprawidłowy.") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
+            else -> null // no error for now
+        }?.let { errorCode ->
+            data.error(ApiError(TAG, errorCode)
+                .withApiResponse(text)
+                .withResponse(response))
+            return true
+        }
+
+        if ("robotem" in text || "g-recaptcha" in text || "captchaValidate" in text) {
+            val siteKey = Regexes.HTML_RECAPTCHA_KEY.find(text)?.get(1)
+            if (siteKey == null) {
+                data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_ACTION_ERROR)
+                    .withApiResponse(text)
+                    .withResponse(response))
+                return true
+            }
+            data.requireUserAction(
+                type = UserActionRequiredEvent.Type.RECAPTCHA,
+                params = Bundle(
+                    "siteKey" to siteKey,
+                    "referer" to response.request().url().toString(),
+                    "userAgent" to LIBRUS_USER_AGENT,
+                ),
+                errorText = R.string.notification_user_action_required_captcha_librus,
+            )
+            return true
+        }
+        return false
+    }
+
+    private fun login(
+        url: String,
+        referer: String,
+        csrfToken: String?,
+        params: Map<String, String>,
+    ) {
+        if (loginPerformed) {
+            data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_ACTION_ERROR))
+            return
+        }
+
+        d(TAG, "Request: Librus/Login/Portal - $url")
 
         val recaptchaCode = data.arguments?.getString("recaptchaCode") ?: data.loginStore.getLoginData("recaptchaCode", null)
         val recaptchaTime = data.arguments?.getLong("recaptchaTime") ?: data.loginStore.getLoginData("recaptchaTime", 0L)
@@ -116,67 +186,46 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
         Request.builder()
                 .url(if (data.fakeLogin) FAKE_LIBRUS_LOGIN else LIBRUS_LOGIN_URL)
                 .userAgent(LIBRUS_USER_AGENT)
+                .addHeader("X-Requested-With", LIBRUS_HEADER)
+                .addHeader("Referer", referer)
+                .withClient(data.app.httpLazy)
                 .addParameter("email", data.portalEmail)
                 .addParameter("password", data.portalPassword)
                 .also {
                     if (recaptchaCode != null && System.currentTimeMillis() - recaptchaTime < 2*60*1000 /* 2 minutes */)
                         it.addParameter("g-recaptcha-response", recaptchaCode)
+                    if (csrfToken != null)
+                        it.addHeader("X-CSRF-TOKEN", csrfToken)
+                    for ((key, value) in params) {
+                        it.addParameter(key, value)
+                    }
                 }
-                .addHeader("X-CSRF-TOKEN", csrfToken)
-                .allowErrorCode(HTTP_BAD_REQUEST)
-                .allowErrorCode(HTTP_FORBIDDEN)
-                .contentType(MediaTypeUtils.APPLICATION_JSON)
+                .contentType(MediaTypeUtils.APPLICATION_FORM)
                 .post()
-                .callback(object : JsonCallbackHandler() {
-                    override fun onSuccess(json: JsonObject?, response: Response) {
+                .callback(object : TextCallbackHandler() {
+                    override fun onSuccess(text: String?, response: Response) {
+                        loginPerformed = true
                         val location = response.headers()?.get("Location")
                         if (location == "$LIBRUS_REDIRECT_URL?command=close") {
                             data.error(ApiError(TAG, ERROR_LIBRUS_PORTAL_MAINTENANCE)
-                                    .withApiResponse(json)
+                                    .withApiResponse(text)
                                     .withResponse(response))
                             return
                         }
-
-                        if (json == null) {
-                            if (response.parserErrorBody?.contains("wciąż nieaktywne") == true) {
-                                data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_NOT_ACTIVATED)
-                                        .withResponse(response))
-                                return
-                            }
+                        if (text == null) {
                             data.error(ApiError(TAG, ERROR_RESPONSE_EMPTY)
                                     .withResponse(response))
                             return
                         }
-                        val error = if (response.code() == 200) null else
-                            json.getJsonArray("errors")?.getString(0)
-                                    ?: json.getJsonObject("errors")?.entrySet()?.firstOrNull()?.value?.asString
 
-                        if (error?.contains("robotem") == true || json.getBoolean("captchaRequired") == true) {
-                            data.requireUserAction(
-                                type = UserActionRequiredEvent.Type.RECAPTCHA,
-                                params = Bundle(
-                                    "siteKey" to LIBRUS_PORTAL_RECAPTCHA_KEY,
-                                    "referer" to LIBRUS_PORTAL_RECAPTCHA_REFERER,
-                                ),
-                                errorText = R.string.notification_user_action_required_captcha_librus,
-                            )
-                            return
-                        }
-
-                        error?.let { code ->
-                            when {
-                                code.contains("Sesja logowania wygasła") -> ERROR_LOGIN_LIBRUS_PORTAL_CSRF_EXPIRED
-                                code.contains("Upewnij się, że nie") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
-                                code.contains("Podany adres e-mail jest nieprawidłowy.") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
-                                else -> ERROR_LOGIN_LIBRUS_PORTAL_ACTION_ERROR
-                            }.let { errorCode ->
-                                data.error(ApiError(TAG, errorCode)
-                                        .withApiResponse(json)
-                                        .withResponse(response))
-                                return
-                            }
-                        }
-                        authorize(json.getString("redirect", LIBRUS_AUTHORIZE_URL))
+                        authorize(
+                            url = location
+                                ?: if (data.fakeLogin)
+                                    FAKE_LIBRUS_AUTHORIZE
+                                else
+                                    LIBRUS_AUTHORIZE_URL,
+                            referer = referer,
+                        )
                     }
 
                     override fun onFailure(response: Response, throwable: Throwable) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebAccountEmail.kt

@@ -10,6 +10,7 @@ import pl.szczodrzynski.edziennik.data.api.edziennik.mobidziennik.ENDPOINT_MOBID
 import pl.szczodrzynski.edziennik.data.api.edziennik.mobidziennik.data.MobidziennikWeb
 import pl.szczodrzynski.edziennik.ext.DAY
 import pl.szczodrzynski.edziennik.ext.get
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 
 class MobidziennikWebAccountEmail(override val data: DataMobidziennik,
                                   override val lastSync: Long?,
@@ -24,7 +25,8 @@ class MobidziennikWebAccountEmail(override val data: DataMobidziennik,
             MobidziennikLuckyNumberExtractor(data, text)
 
             val email = Regexes.MOBIDZIENNIK_ACCOUNT_EMAIL.find(text)?.let { it[1] }
-            data.loginEmail = email
+            if (email.isNotNullNorBlank())
+                data.loginEmail = email
 
             data.setSyncNext(ENDPOINT_MOBIDZIENNIK_WEB_ACCOUNT_EMAIL, if (email == null) 3* DAY else 7* DAY)
             onSuccess(ENDPOINT_MOBIDZIENNIK_WEB_ACCOUNT_EMAIL)

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/login/MobidziennikLoginApi2.kt

@@ -16,6 +16,7 @@ import pl.szczodrzynski.edziennik.data.api.models.ApiError
 import pl.szczodrzynski.edziennik.ext.JsonObject
 import pl.szczodrzynski.edziennik.ext.getJsonObject
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
 import pl.szczodrzynski.edziennik.utils.Utils
 
@@ -77,7 +78,9 @@ class MobidziennikLoginApi2(val data: DataMobidziennik, val onSuccess: () -> Uni
                     }
                 }
 
-                data.loginEmail = json.getString("email")
+                val email = json.getString("email")
+                if (email.isNotNullNorBlank())
+                    data.loginEmail = email
                 data.globalId = json.getString("id_global")
                 data.loginId = json.getString("login")
                 onSuccess()

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/VulcanHebe.kt

@@ -26,6 +26,7 @@ import pl.szczodrzynski.edziennik.utils.Utils.d
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
 import java.net.HttpURLConnection
+import java.net.HttpURLConnection.HTTP_NOT_FOUND
 import java.net.URLEncoder
 import java.time.Instant
 import java.time.LocalDateTime
@@ -183,6 +184,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         payload: JsonElement? = null,
         baseUrl: Boolean = false,
         firebaseToken: String? = null,
+        allow404: Boolean = false,
         crossinline onSuccess: (json: T, response: Response?) -> Unit
     ) {
         val url = "${if (baseUrl) data.apiUrl else data.fullApiUrl}$endpoint"
@@ -295,6 +297,19 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             }
 
             override fun onFailure(response: Response?, throwable: Throwable?) {
+                if (allow404 && response?.code() == HTTP_NOT_FOUND) {
+                    try {
+                        onSuccess(null as T, response)
+                    } catch (e: Exception) {
+                        data.error(
+                            ApiError(tag, EXCEPTION_VULCAN_HEBE_REQUEST)
+                                .withResponse(response)
+                                .withThrowable(e)
+                        )
+                    }
+                    return
+                }
+
                 data.error(
                     ApiError(tag, ERROR_REQUEST_FAILURE)
                         .withResponse(response)
@@ -338,6 +353,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         query: Map<String, String> = mapOf(),
         baseUrl: Boolean = false,
         firebaseToken: String? = null,
+        allow404: Boolean = false,
         crossinline onSuccess: (json: T, response: Response?) -> Unit
     ) {
         val queryPath = query.map {
@@ -348,6 +364,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             if (query.isNotEmpty()) "$endpoint?$queryPath" else endpoint,
             baseUrl = baseUrl,
             firebaseToken = firebaseToken,
+            allow404 = allow404,
             onSuccess = onSuccess
         )
     }
@@ -382,6 +399,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         messageBox: String? = null,
         params: Map<String, String> = mapOf(),
         includeFilterType: Boolean = true,
+        allow404: Boolean = false,
         onSuccess: (data: List<JsonObject>, response: Response?) -> Unit
     ) {
         val url = if (includeFilterType && filterType != null)
@@ -427,8 +445,8 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             )
             .format(DateTimeFormatter.ofPattern("yyyy-MM-dd HH:mm:ss"))
 
-        apiGet(tag, url, query) { json: JsonArray, response ->
-            onSuccess(json.map { it.asJsonObject }, response)
+        apiGet(tag, url, query, allow404 = allow404) { json: JsonArray?, response ->
+            onSuccess(json?.map { it.asJsonObject } ?: listOf(), response)
         }
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/hebe/VulcanHebeAddressbook.kt

@@ -19,6 +19,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_PARENTS_
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_STUDENT
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_TEACHER
 import pl.szczodrzynski.edziennik.ext.*
+import java.net.HttpURLConnection.HTTP_NOT_FOUND
 
 class VulcanHebeAddressbook(
     override val data: DataVulcan,
@@ -41,8 +42,15 @@ class VulcanHebeAddressbook(
             VULCAN_HEBE_ENDPOINT_ADDRESSBOOK,
             HebeFilterType.BY_PERSON,
             lastSync = lastSync,
-            includeFilterType = false
-        ) { list, _ ->
+            includeFilterType = false,
+            allow404 = true,
+        ) { list, response ->
+            if (response?.code() == HTTP_NOT_FOUND) {
+                data.setSyncNext(ENDPOINT_VULCAN_HEBE_ADDRESSBOOK, 2 * DAY)
+                onSuccess(ENDPOINT_VULCAN_HEBE_ADDRESSBOOK)
+                return@apiGetList
+            }
+
             list.forEach { person ->
                 val id = person.getString("Id") ?: return@forEach
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/interceptor/SignatureInterceptor.kt

@@ -29,11 +29,12 @@ class SignatureInterceptor(val app: App) : Interceptor {
         return chain.proceed(
                 request.newBuilder()
                         .header("X-ApiKey", app.config.apiKeyCustom?.takeValue() ?: API_KEY)
-                        .header("X-AppVersion", BuildConfig.VERSION_CODE.toString())
-                        .header("X-Timestamp", timestamp.toString())
-                        .header("X-Signature", sign(timestamp, body, url))
                         .header("X-AppBuild", BuildConfig.BUILD_TYPE)
                         .header("X-AppFlavor", BuildConfig.FLAVOR)
+                        .header("X-AppVersion", BuildConfig.VERSION_CODE.toString())
+                        .header("X-DeviceId", app.deviceId)
+                        .header("X-Signature", sign(timestamp, body, url))
+                        .header("X-Timestamp", timestamp.toString())
                         .build())
     }
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/interceptor/Signing.kt

@@ -46,6 +46,6 @@ object Signing {
 
     /*fun provideKey(param1: String, param2: Long): ByteArray {*/
     fun pleaseStopRightNow(param1: String, param2: Long): ByteArray {
-        return "$param1.MTIzNDU2Nzg5MDsJslqno5===.$param2".sha256()
+        return "$param1.MTIzNDU2Nzg5MD01uMP7oW===.$param2".sha256()
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/EventTypeDao.kt

@@ -25,6 +25,9 @@ abstract class EventTypeDao {
     @Query("DELETE FROM eventTypes WHERE profileId = :profileId")
     abstract fun clear(profileId: Int)
 
+    @Query("DELETE FROM eventTypes WHERE profileId = :profileId AND eventTypeSource = :source")
+    abstract fun clearBySource(profileId: Int, source: Int)
+
     @Query("SELECT * FROM eventTypes WHERE profileId = :profileId AND eventType = :typeId")
     abstract fun getByIdNow(profileId: Int, typeId: Long): EventType?
 
@@ -43,7 +46,7 @@ abstract class EventTypeDao {
         val typeList = data.eventTypes.map {
             EventType(
                 profileId = profile.id,
-                id = it.id.toLong(),
+                id = it.id,
                 name = it.name,
                 color = Color.parseColor(it.color),
                 order = order++,
@@ -53,4 +56,21 @@ abstract class EventTypeDao {
         addAll(typeList)
         return typeList
     }
+
+    fun getAllWithDefaults(profile: Profile): List<EventType> {
+        val eventTypes = getAllNow(profile.id)
+
+        val defaultIdsExpected = AppData.get(profile.loginStoreType).eventTypes
+            .map { it.id }
+        val defaultIdsFound = eventTypes.filter { it.source == SOURCE_DEFAULT }
+            .sortedBy { it.order }
+            .map { it.id }
+
+        if (defaultIdsExpected == defaultIdsFound)
+            return eventTypes
+
+        clearBySource(profile.id, SOURCE_DEFAULT)
+        addDefaultTypes(profile)
+        return eventTypes
+    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/ProfileDao.kt

@@ -28,6 +28,9 @@ interface ProfileDao {
     @Query("SELECT * FROM profiles WHERE profileId = :profileId")
     fun getByIdNow(profileId: Int): Profile?
 
+    @Query("SELECT * FROM profiles WHERE profileId = :profileId")
+    suspend fun getByIdSuspend(profileId: Int): Profile?
+
     @get:Query("SELECT * FROM profiles WHERE profileId >= 0 ORDER BY profileId")
     val all: LiveData<List<Profile>>
 

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/EventType.kt

@@ -5,31 +5,6 @@ package pl.szczodrzynski.edziennik.data.db.entity
 
 import androidx.room.ColumnInfo
 import androidx.room.Entity
-import pl.szczodrzynski.edziennik.R
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_CLASS_EVENT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_DEFAULT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_ELEARNING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_ESSAY
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_EXAM
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_EXCURSION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_HOMEWORK
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_INFORMATION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_PROJECT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_PT_MEETING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_READING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_SHORT_QUIZ
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_CLASS_EVENT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_DEFAULT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_ELEARNING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_ESSAY
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_EXAM
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_EXCURSION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_HOMEWORK
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_INFORMATION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_PROJECT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_PT_MEETING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_READING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_SHORT_QUIZ
 
 @Entity(
     tableName = "eventTypes",
@@ -55,35 +30,5 @@ class EventType(
         const val SOURCE_REGISTER = 1
         const val SOURCE_CUSTOM = 2
         const val SOURCE_SHARED = 3
-
-        fun getTypeColorMap() = mapOf(
-            TYPE_ELEARNING to COLOR_ELEARNING,
-            TYPE_HOMEWORK to COLOR_HOMEWORK,
-            TYPE_DEFAULT to COLOR_DEFAULT,
-            TYPE_EXAM to COLOR_EXAM,
-            TYPE_SHORT_QUIZ to COLOR_SHORT_QUIZ,
-            TYPE_ESSAY to COLOR_ESSAY,
-            TYPE_PROJECT to COLOR_PROJECT,
-            TYPE_PT_MEETING to COLOR_PT_MEETING,
-            TYPE_EXCURSION to COLOR_EXCURSION,
-            TYPE_READING to COLOR_READING,
-            TYPE_CLASS_EVENT to COLOR_CLASS_EVENT,
-            TYPE_INFORMATION to COLOR_INFORMATION
-        )
-
-        fun getTypeNameMap() = mapOf(
-            TYPE_ELEARNING to R.string.event_type_elearning,
-            TYPE_HOMEWORK to R.string.event_type_homework,
-            TYPE_DEFAULT to R.string.event_other,
-            TYPE_EXAM to R.string.event_exam,
-            TYPE_SHORT_QUIZ to R.string.event_short_quiz,
-            TYPE_ESSAY to R.string.event_essay,
-            TYPE_PROJECT to R.string.event_project,
-            TYPE_PT_MEETING to R.string.event_pt_meeting,
-            TYPE_EXCURSION to R.string.event_excursion,
-            TYPE_READING to R.string.event_reading,
-            TYPE_CLASS_EVENT to R.string.event_class_event,
-            TYPE_INFORMATION to R.string.event_information
-        )
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/enums/LoginMethod.kt

@@ -6,6 +6,8 @@ package pl.szczodrzynski.edziennik.data.db.enums
 
 import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
+import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 
 enum class LoginMethod(
     val loginType: LoginType,
@@ -26,7 +28,7 @@ enum class LoginMethod(
     MOBIDZIENNIK_API2(
         loginType = LoginType.MOBIDZIENNIK,
         id = 1300,
-        isPossible = { profile, _ -> profile?.studentData?.has("email") ?: false },
+        isPossible = { profile, _ -> profile?.studentData?.getString("email").isNotNullNorBlank() },
     ),
     LIBRUS_PORTAL(
         loginType = LoginType.LIBRUS,
@@ -57,7 +59,7 @@ enum class LoginMethod(
     VULCAN_WEB_MAIN(
         loginType = LoginType.VULCAN,
         id = 4100,
-        isPossible = { _, loginStore -> loginStore.hasLoginData("webHost") },
+        isPossible = { _, loginStore -> loginStore.getLoginData("webHost", null).isNotNullNorBlank() },
     ),
     VULCAN_HEBE(
         loginType = LoginType.VULCAN,

app/src/main/java/pl/szczodrzynski/edziennik/ext/JsonExtensions.kt

@@ -73,7 +73,8 @@ fun JsonObject(vararg properties: Pair<String, Any?>): JsonObject {
                 is Number -> addProperty(key, value)
                 is Boolean -> addProperty(key, value)
                 is Enum<*> -> addProperty(key, value.toInt())
-                else -> add(key, property.toJsonElement())
+                null -> add(key, null)
+                else -> add(key, value.toJsonElement())
             }
         }
     }

app/src/main/java/pl/szczodrzynski/edziennik/ext/MiscExtensions.kt

@@ -73,6 +73,12 @@ fun pendingIntentFlag(): Int {
     return 0
 }
 
+fun pendingIntentMutable(): Int {
+    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S)
+        return PendingIntent.FLAG_MUTABLE
+    return 0
+}
+
 fun Int?.takeValue() = if (this == -1) null else this
 fun Int?.takePositive() = if (this == -1 || this == 0) null else this
 

app/src/main/java/pl/szczodrzynski/edziennik/ext/TextExtensions.kt

@@ -15,6 +15,7 @@ import android.text.style.CharacterStyle
 import android.text.style.ForegroundColorSpan
 import android.text.style.StrikethroughSpan
 import android.text.style.StyleSpan
+import android.text.style.UnderlineSpan
 import androidx.annotation.PluralsRes
 import androidx.annotation.StringRes
 import com.mikepenz.materialdrawer.holder.StringHolder
@@ -160,6 +161,11 @@ fun CharSequence?.asBoldSpannable(): Spannable {
     spannable.setSpan(StyleSpan(Typeface.BOLD), 0, spannable.length, Spannable.SPAN_EXCLUSIVE_EXCLUSIVE)
     return spannable
 }
+fun CharSequence?.asUnderlineSpannable(): Spannable {
+    val spannable = SpannableString(this)
+    spannable.setSpan(UnderlineSpan(), 0, spannable.length, Spannable.SPAN_EXCLUSIVE_EXCLUSIVE)
+    return spannable
+}
 fun CharSequence.asSpannable(
     vararg spans: CharacterStyle,
     substring: CharSequence? = null,

app/src/main/java/pl/szczodrzynski/edziennik/ext/ViewExtensions.kt

@@ -8,6 +8,7 @@ import android.content.Context
 import android.content.res.Resources
 import android.graphics.Rect
 import android.view.View
+import android.view.ViewGroup
 import android.view.WindowManager
 import android.widget.*
 import androidx.annotation.StringRes
@@ -161,3 +162,12 @@ val SwipeRefreshLayout.onScrollListener: RecyclerView.OnScrollListener
         }
     }
 
+fun View.removeFromParent() {
+    (parent as? ViewGroup)?.removeView(this)
+}
+
+fun View.appendView(child: View) {
+    val parent = parent as? ViewGroup ?: return
+    val index = parent.indexOfChild(this)
+    parent.addView(child, index + 1)
+}

app/src/main/java/pl/szczodrzynski/edziennik/network/cookie/DumbCookie.kt

@@ -5,8 +5,20 @@
 package pl.szczodrzynski.edziennik.network.cookie
 
 import okhttp3.Cookie
+import okhttp3.HttpUrl
 
 class DumbCookie(var cookie: Cookie) {
+    companion object {
+        fun deserialize(key: String, value: String): DumbCookie? {
+            val (domain, _) = key.split('|', limit = 2)
+            val url = HttpUrl.Builder()
+                .scheme("https")
+                .host(domain)
+                .build()
+            val cookie = Cookie.parse(url, value) ?: return null
+            return DumbCookie(cookie)
+        }
+    }
 
     constructor(domain: String, name: String, value: String, expiresAt: Long? = null) : this(
             Cookie.Builder()
@@ -21,7 +33,10 @@ class DumbCookie(var cookie: Cookie) {
         cookie = Cookie.Builder()
                 .name(cookie.name())
                 .value(cookie.value())
-                .expiresAt(cookie.expiresAt())
+                .also {
+                    if (cookie.persistent())
+                        it.expiresAt(cookie.expiresAt())
+                }
                 .domain(cookie.domain())
                 .build()
     }
@@ -45,4 +60,7 @@ class DumbCookie(var cookie: Cookie) {
         hash = 31 * hash + cookie.domain().hashCode()
         return hash
     }
+
+    fun serializeKey() = cookie.domain() + "|" + cookie.name()
+    fun serialize() = serializeKey() to cookie.toString()
 }

app/src/main/java/pl/szczodrzynski/edziennik/network/cookie/DumbCookieJar.kt

@@ -5,6 +5,7 @@
 package pl.szczodrzynski.edziennik.network.cookie
 
 import android.content.Context
+import androidx.core.content.edit
 import okhttp3.Cookie
 import okhttp3.CookieJar
 import okhttp3.HttpUrl
@@ -26,22 +27,48 @@ class DumbCookieJar(
 ) : CookieJar {
 
     private val prefs = context.getSharedPreferences("cookies", Context.MODE_PRIVATE)
-    val sessionCookies = mutableSetOf<DumbCookie>()
-    private val savedCookies = mutableSetOf<DumbCookie>()
+    private val sessionCookies = mutableSetOf<DumbCookie>()
+
+    init {
+        val toRemove = mutableListOf<String>()
+        prefs.all.forEach { (key, value) ->
+            if (value !is String)
+                return@forEach
+            val dc = DumbCookie.deserialize(key, value) ?: return@forEach
+            if (dc.cookie.expiresAt() > System.currentTimeMillis())
+                sessionCookies.add(dc)
+            else
+                toRemove.add(key)
+        }
+        prefs.edit {
+            for (key in toRemove) {
+                remove(key)
+            }
+        }
+    }
+
     private fun save(dc: DumbCookie) {
         sessionCookies.remove(dc)
         sessionCookies.add(dc)
         if (dc.cookie.persistent() || persistAll) {
-            savedCookies.remove(dc)
-            savedCookies.add(dc)
+            prefs.edit {
+                val (key, value) = dc.serialize()
+                putString(key, value)
+            }
         }
     }
     private fun delete(vararg toRemove: DumbCookie) {
-        sessionCookies.removeAll(toRemove)
-        savedCookies.removeAll(toRemove)
+        sessionCookies.removeAll(toRemove.toSet())
+        prefs.edit {
+            for (dc in toRemove) {
+                val key = dc.serializeKey()
+                if (prefs.contains(key))
+                    remove(key)
+            }
+        }
     }
 
-    override fun saveFromResponse(url: HttpUrl?, cookies: List<Cookie>) {
+    override fun saveFromResponse(url: HttpUrl, cookies: MutableList<Cookie>) {
         for (cookie in cookies) {
             val dc = DumbCookie(cookie)
             save(dc)
@@ -54,6 +81,10 @@ class DumbCookieJar(
         }.map { it.cookie }
     }
 
+    fun getAllDomains(): List<Cookie> {
+        return sessionCookies.map { it.cookie }
+    }
+
     fun get(domain: String, name: String): String? {
         return sessionCookies.firstOrNull {
             it.domainMatches(domain) && it.cookie.name() == name
@@ -84,7 +115,7 @@ class DumbCookieJar(
     fun getAll(domain: String): Map<String, String> {
         return sessionCookies.filter {
             it.domainMatches(domain)
-        }.map { it.cookie.name() to it.cookie.value() }.toMap()
+        }.associate { it.cookie.name() to it.cookie.value() }
     }
 
     fun remove(domain: String, name: String) {
@@ -100,4 +131,11 @@ class DumbCookieJar(
         }
         delete(*toRemove.toTypedArray())
     }
+
+    fun clearAllDomains() {
+        sessionCookies.clear()
+        prefs.edit {
+            clear()
+        }
+    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/ui/agenda/AgendaFragment.kt

@@ -142,13 +142,7 @@ class AgendaFragment : Fragment(), CoroutineScope {
 
     private suspend fun checkEventTypes() {
         withContext(Dispatchers.Default) {
-            val eventTypes = app.db.eventTypeDao().getAllNow(app.profileId).map {
-                it.id
-            }
-            val defaultEventTypes = EventType.getTypeColorMap().keys
-            if (!eventTypes.containsAll(defaultEventTypes)) {
-                app.db.eventTypeDao().addDefaultTypes(app.profile)
-            }
+            app.db.eventTypeDao().getAllWithDefaults(app.profile)
         }
     }
 

app/src/main/java/pl/szczodrzynski/edziennik/ui/agenda/event/AgendaEventRenderer.kt

@@ -11,6 +11,7 @@ import android.widget.TextView
 import androidx.core.view.isVisible
 import com.github.tibolte.agendacalendarview.render.EventRenderer
 import com.mikepenz.iconics.view.IconicsTextView
+import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.databinding.AgendaWrappedEventBinding
 import pl.szczodrzynski.edziennik.databinding.AgendaWrappedEventCompactBinding
@@ -53,16 +54,24 @@ class AgendaEventRenderer(
         else
             event.time!!.stringHM
 
+        val agendaSubjectImportant = App.profile.config.ui.agendaSubjectImportant
         val eventSubtitle = listOfNotNull(
             timeText,
-            event.subjectLongName,
+            event.subjectLongName.takeIf { !agendaSubjectImportant },
+            event.typeName.takeIf { agendaSubjectImportant },
             event.teacherName,
             event.teamName
         ).join(", ")
 
         card.foreground.setTintColor(event.eventColor)
         card.background.setTintColor(event.eventColor)
-        manager.setEventTopic(title, event, doneIconColor = textColor)
+        manager.setEventTopic(
+            title = title,
+            event = event,
+            doneIconColor = textColor,
+            showType = !agendaSubjectImportant,
+            showSubject = agendaSubjectImportant,
+        )
         title.setTextColor(textColor)
         subtitle?.text = eventSubtitle
         subtitle?.setTextColor(textColor)

app/src/main/java/pl/szczodrzynski/edziennik/ui/base/enums/NavTarget.kt

@@ -217,6 +217,7 @@ enum class NavTarget(
         location = NavTargetLocation.BOTTOM_SHEET,
         nameRes = R.string.menu_debug,
         icon = CommunityMaterial.Icon.cmd_android_debug_bridge,
+        devModeOnly = true,
     ),
     GRADES_EDITOR(
         id = 501,

app/src/main/java/pl/szczodrzynski/edziennik/ui/captcha/RecaptchaDialog.kt

@@ -25,6 +25,7 @@ class RecaptchaDialog(
     private val autoRetry: Boolean = true,
     private val onSuccess: (recaptchaCode: String) -> Unit,
     private val onFailure: (() -> Unit)? = null,
+    private val onServerError: (() -> Unit)? = null,
     onShowListener: ((tag: String) -> Unit)? = null,
     onDismissListener: ((tag: String) -> Unit)? = null,
 ) : BindingDialog<RecaptchaDialogBinding>(activity, onShowListener, onDismissListener) {
@@ -44,7 +45,11 @@ class RecaptchaDialog(
 
     override suspend fun onBeforeShow(): Boolean {
         val (title, text, bitmap) = withContext(Dispatchers.Default) {
-            val html = loadCaptchaHtml() ?: return@withContext null
+            val html = loadCaptchaHtml()
+            if (html == null) {
+                onServerError?.invoke()
+                return@withContext null
+            }
             return@withContext loadCaptchaData(html)
         } ?: run {
             onFailure?.invoke()

app/src/main/java/pl/szczodrzynski/edziennik/ui/captcha/RecaptchaPromptDialog.kt

@@ -19,6 +19,7 @@ class RecaptchaPromptDialog(
     private val referer: String,
     private val onSuccess: (recaptchaCode: String) -> Unit,
     private val onCancel: (() -> Unit)?,
+    private val onServerError: (() -> Unit)? = null,
     onShowListener: ((tag: String) -> Unit)? = null,
     onDismissListener: ((tag: String) -> Unit)? = null,
 ) : BindingDialog<RecaptchaViewBinding>(activity, onShowListener, onDismissListener) {
@@ -62,7 +63,8 @@ class RecaptchaPromptDialog(
                     b.checkbox.background = checkboxBackground
                     b.checkbox.foreground = checkboxForeground
                     b.progress.visibility = View.GONE
-                }
+                },
+                onServerError = onServerError,
             ).show()
         }
     }

app/src/main/java/pl/szczodrzynski/edziennik/ui/debug/LabPageFragment.kt

@@ -23,6 +23,7 @@ import kotlinx.coroutines.launch
 import pl.szczodrzynski.edziennik.*
 import pl.szczodrzynski.edziennik.config.Config
 import pl.szczodrzynski.edziennik.data.api.szkolny.interceptor.SignatureInterceptor
+import pl.szczodrzynski.edziennik.data.db.entity.EventType.Companion.SOURCE_DEFAULT
 import pl.szczodrzynski.edziennik.databinding.LabFragmentBinding
 import pl.szczodrzynski.edziennik.ext.*
 import pl.szczodrzynski.edziennik.ui.base.lazypager.LazyFragment
@@ -65,6 +66,7 @@ class LabPageFragment : LazyFragment(), CoroutineScope {
             b.clearEndpointTimers.isVisible = false
             b.rodo.isVisible = false
             b.removeHomework.isVisible = false
+            b.resetEventTypes.isVisible = false
             b.unarchive.isVisible = false
             b.profile.isVisible = false
         }
@@ -100,6 +102,11 @@ class LabPageFragment : LazyFragment(), CoroutineScope {
             app.db.eventDao().getRawNow("UPDATE events SET homeworkBody = NULL WHERE profileId = ${App.profileId}")
         }
 
+        b.resetEventTypes.onClick {
+            app.db.eventTypeDao().clearBySource(App.profileId, SOURCE_DEFAULT)
+            app.db.eventTypeDao().getAllWithDefaults(App.profile)
+        }
+
         b.chucker.isChecked = App.enableChucker
         b.chucker.onChange { _, isChecked ->
             app.config.enableChucker = isChecked
@@ -172,28 +179,39 @@ class LabPageFragment : LazyFragment(), CoroutineScope {
             return@setOnChangeListener true
         }
 
+        b.clearCookies.onClick {
+            app.cookieJar.clearAllDomains()
+        }
+
         val colorSecondary = android.R.attr.textColorSecondary.resolveAttr(activity)
         startCoroutineTimer(500L, 300L) {
-            val text = app.cookieJar.sessionCookies
-                    .map { it.cookie }
-                    .sortedBy { it.domain() }
-                    .groupBy { it.domain() }
-                    .map {
-                        listOf(
-                                it.key.asBoldSpannable(),
-                                ":\n",
-                                it.value
-                                        .sortedBy { it.name() }
-                                        .map {
-                                            listOf(
-                                                    "    ",
-                                                    it.name(),
-                                                    "=",
-                                                    it.value().decode().take(40).asItalicSpannable().asColoredSpannable(colorSecondary)
-                                            ).concat("")
-                                        }.concat("\n")
-                        ).concat("")
-                    }.concat("\n\n")
+            val text = app.cookieJar.getAllDomains()
+                .sortedBy { it.domain() }
+                .groupBy { it.domain() }
+                .map { pair ->
+                    listOf(
+                        pair.key.asBoldSpannable(),
+                        ":\n",
+                        pair.value
+                            .sortedBy { it.name() }
+                            .map { cookie ->
+                                listOf(
+                                    "    ",
+                                    if (cookie.persistent())
+                                        cookie.name()
+                                            .asUnderlineSpannable()
+                                    else
+                                        cookie.name(),
+                                    "=",
+                                    cookie.value()
+                                        .decode()
+                                        .take(40)
+                                        .asItalicSpannable()
+                                        .asColoredSpannable(colorSecondary),
+                                ).concat("")
+                            }.concat("\n")
+                    ).concat("")
+                }.concat("\n\n")
             b.cookies.text = text
         }
 

app/src/main/java/pl/szczodrzynski/edziennik/ui/event/EventDetailsDialog.kt

@@ -113,9 +113,20 @@ class EventDetailsDialog(
 
         b.typeColor.background?.setTintColor(event.eventColor)
 
-        b.details = mutableListOf(
+        val agendaSubjectImportant = event.subjectLongName != null
+                && App.config[event.profileId].ui.agendaSubjectImportant
+
+        b.name = if (agendaSubjectImportant)
+            event.subjectLongName
+        else
+            event.typeName
+
+        b.details = listOfNotNull(
+            if (agendaSubjectImportant)
+                event.typeName
+            else
                 event.subjectLongName,
-                event.teamName?.asColoredSpannable(colorSecondary)
+            event.teamName?.asColoredSpannable(colorSecondary)
         ).concat(bullet)
 
         b.addedBy.setText(

app/src/main/java/pl/szczodrzynski/edziennik/ui/event/EventListAdapter.kt

@@ -24,6 +24,7 @@ class EventListAdapter(
     val showDate: Boolean = false,
     val showColor: Boolean = true,
     val showType: Boolean = true,
+    val showTypeColor: Boolean = showType,
     val showTime: Boolean = true,
     val showSubject: Boolean = true,
     val markAsSeen: Boolean = true,

app/src/main/java/pl/szczodrzynski/edziennik/ui/event/EventManualDialog.kt

@@ -19,7 +19,9 @@ import kotlinx.coroutines.withContext
 import org.greenrobot.eventbus.EventBus
 import org.greenrobot.eventbus.Subscribe
 import org.greenrobot.eventbus.ThreadMode
+import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.R
+import pl.szczodrzynski.edziennik.config.AppData
 import pl.szczodrzynski.edziennik.data.api.edziennik.EdziennikTask
 import pl.szczodrzynski.edziennik.data.api.events.ApiTaskAllFinishedEvent
 import pl.szczodrzynski.edziennik.data.api.events.ApiTaskErrorEvent
@@ -35,9 +37,11 @@ import pl.szczodrzynski.edziennik.data.db.full.EventFull
 import pl.szczodrzynski.edziennik.data.db.full.LessonFull
 import pl.szczodrzynski.edziennik.databinding.DialogEventManualV2Binding
 import pl.szczodrzynski.edziennik.ext.JsonObject
+import pl.szczodrzynski.edziennik.ext.appendView
 import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.onChange
 import pl.szczodrzynski.edziennik.ext.onClick
+import pl.szczodrzynski.edziennik.ext.removeFromParent
 import pl.szczodrzynski.edziennik.ext.setText
 import pl.szczodrzynski.edziennik.ext.setTintColor
 import pl.szczodrzynski.edziennik.ui.dialogs.base.BindingDialog
@@ -117,6 +121,15 @@ class EventManualDialog(
     }
 
     override suspend fun onShow() {
+        val data = withContext(Dispatchers.IO) {
+            val profile = app.db.profileDao().getByIdSuspend(profileId) ?: return@withContext null
+            AppData.get(profile.loginStoreType)
+        }
+        if (data?.uiConfig?.eventManualShowSubjectDropdown == true) {
+            b.subjectDropdownLayout.removeFromParent()
+            b.timeDropdownLayout.appendView(b.subjectDropdownLayout)
+        }
+
         b.showMore.onClick { // TODO iconics is broken
             it.apply {
                 refreshDrawableState()

app/src/main/java/pl/szczodrzynski/edziennik/ui/event/EventViewHolder.kt

@@ -113,7 +113,7 @@ class EventViewHolder(
         b.attachmentIcon.isVisible = item.hasAttachments
 
         b.typeColor.background?.setTintColor(item.eventColor)
-        b.typeColor.isVisible = adapter.showType && adapter.showColor
+        b.typeColor.isVisible = adapter.showTypeColor
 
         b.editButton.isVisible = !adapter.simpleMode
                 && item.addedManually

app/src/main/java/pl/szczodrzynski/edziennik/ui/home/CounterActivity.kt

@@ -4,8 +4,10 @@
 
 package pl.szczodrzynski.edziennik.ui.home
 
+import android.graphics.BitmapFactory
 import android.os.Bundle
 import androidx.appcompat.app.AppCompatActivity
+import com.jetradarmobile.snowfall.SnowfallView
 import com.mikepenz.iconics.IconicsDrawable
 import com.mikepenz.iconics.utils.colorInt
 import com.mikepenz.iconics.utils.sizeDp
@@ -20,6 +22,7 @@ import pl.szczodrzynski.edziennik.ext.startCoroutineTimer
 import pl.szczodrzynski.edziennik.ext.timeLeft
 import pl.szczodrzynski.edziennik.ext.timeTill
 import pl.szczodrzynski.edziennik.ui.dialogs.BellSyncTimeChooseDialog
+import pl.szczodrzynski.edziennik.utils.BigNightUtil
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
 import kotlin.coroutines.CoroutineContext
@@ -61,6 +64,7 @@ class CounterActivity : AppCompatActivity(), CoroutineScope {
                                     it.type != Lesson.TYPE_SHIFTED_SOURCE
                         })
             }
+            lessonList.onEach { it.filterNotes() }
         }
 
         b.bellSync.setImageDrawable(
@@ -81,6 +85,27 @@ class CounterActivity : AppCompatActivity(), CoroutineScope {
         counterJob = startCoroutineTimer(repeatMillis = 500) {
             update()
         }
+
+        // IT'S WINTER MY DUDES
+        val today = Date.getToday()
+        if ((today.month / 3 % 4 == 0) && app.config.ui.snowfall) {
+            b.rootFrame.addView(layoutInflater.inflate(R.layout.snowfall, b.rootFrame, false))
+        } else if (app.config.ui.eggfall && BigNightUtil().isDataWielkanocyNearDzisiaj()) {
+            val eggfall = layoutInflater.inflate(
+                R.layout.eggfall,
+                b.rootFrame,
+                false
+            ) as SnowfallView
+            eggfall.setSnowflakeBitmaps(listOf(
+                BitmapFactory.decodeResource(resources, R.drawable.egg1),
+                BitmapFactory.decodeResource(resources, R.drawable.egg2),
+                BitmapFactory.decodeResource(resources, R.drawable.egg3),
+                BitmapFactory.decodeResource(resources, R.drawable.egg4),
+                BitmapFactory.decodeResource(resources, R.drawable.egg5),
+                BitmapFactory.decodeResource(resources, R.drawable.egg6)
+            ))
+            b.rootFrame.addView(eggfall)
+        }
     }}
 
     private fun update() {
@@ -101,13 +126,15 @@ class CounterActivity : AppCompatActivity(), CoroutineScope {
 
             when {
                 actual != null -> {
-                    b.lessonName.text = actual.displaySubjectName
+                    b.lessonName.text = actual.getNoteSubstituteText(showNotes = true)
+                        ?: actual.displaySubjectName
 
                     val left = actual.displayEndTime!! - now
                     b.timeLeft.text = timeLeft(left.toInt(), "\n", countInSeconds)
                 }
                 next != null -> {
-                    b.lessonName.text = next.displaySubjectName
+                    b.lessonName.text = next.getNoteSubstituteText(showNotes = true)
+                        ?: next.displaySubjectName
 
                     val till = next.displayStartTime!! - now
                     b.timeLeft.text = timeTill(till.toInt(), "\n", countInSeconds)

app/src/main/java/pl/szczodrzynski/edziennik/ui/home/cards/HomeEventsCard.kt

@@ -63,9 +63,10 @@ class HomeEventsCard(
                 simpleMode = true,
                 showWeekDay = true,
                 showDate = true,
-                showType = true,
+                showType = !profile.config.ui.agendaSubjectImportant,
+                showTypeColor = true,
                 showTime = false,
-                showSubject = false,
+                showSubject = profile.config.ui.agendaSubjectImportant,
                 markAsSeen = false,
                 onEventClick = {
                     EventDetailsDialog(

app/src/main/java/pl/szczodrzynski/edziennik/ui/home/cards/HomeTimetableCard.kt

@@ -232,6 +232,7 @@ class HomeTimetableCard(
         }
 
         lessons = lessons.filter { it.type != Lesson.TYPE_NO_LESSONS }
+        lessons.onEach { it.filterNotes() }
 
         b.timetableLayout.visibility = View.VISIBLE
         b.noTimetableLayout.visibility = View.GONE
@@ -344,6 +345,7 @@ class HomeTimetableCard(
 
     private val LessonFull?.subjectSpannable: CharSequence
         get() = if (this == null) "?" else when {
+            hasReplacingNotes() -> getNoteSubstituteText(showNotes = true) ?: "?"
             isCancelled -> displaySubjectName?.asStrikethroughSpannable() ?: "?"
             isChange -> displaySubjectName?.asItalicSpannable() ?: "?"
             else -> displaySubjectName ?: "?"

app/src/main/java/pl/szczodrzynski/edziennik/ui/login/recaptcha/RecaptchaActivity.kt

@@ -0,0 +1,132 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2023-3-24.
+ */
+
+package pl.szczodrzynski.edziennik.ui.login.recaptcha
+
+import android.annotation.SuppressLint
+import android.graphics.Color
+import android.os.Build
+import android.os.Bundle
+import android.util.Base64
+import android.view.ViewGroup.LayoutParams.MATCH_PARENT
+import android.webkit.JavascriptInterface
+import android.webkit.WebView
+import android.widget.FrameLayout
+import androidx.appcompat.app.AppCompatActivity
+import org.greenrobot.eventbus.EventBus
+import pl.szczodrzynski.edziennik.R
+import pl.szczodrzynski.edziennik.data.api.SYSTEM_USER_AGENT
+import pl.szczodrzynski.edziennik.utils.Themes
+import java.nio.charset.Charset
+
+class RecaptchaActivity : AppCompatActivity() {
+    companion object {
+        private const val TAG = "RecaptchaActivity"
+
+        private const val CODE = """
+            PCFET0NUWVBFIGh0bWw+PGh0bWw+PGhlYWQ+PHNjcmlwdCBzcmM9Imh0dHBzOi8vd3d3Lmdvb2ds
+            ZS5jb20vcmVjYXB0Y2hhL2FwaS5qcz9vbmxvYWQ9cmVhZHkmcmVuZGVyPWV4cGxpY2l0Ij48L3Nj
+            cmlwdD48L2hlYWQ+PGJvZHk+PGJyPjxkaXYgaWQ9ImdyIiBzdHlsZT0icG9zaXRpb246YWJzb2x1
+            dGU7dG9wOjUwJTt0cmFuc2Zvcm06dHJhbnNsYXRlKDAsLTUwJSk7Ij48L2Rpdj48YnI+PHNjcmlw
+            dD5mdW5jdGlvbiByZWFkeSgpe2dyZWNhcHRjaGEucmVuZGVyKCJnciIse3NpdGVrZXk6IlNJVEVL
+            RVkiLHRoZW1lOiJUSEVNRSIsY2FsbGJhY2s6ZnVuY3Rpb24oZSl7d2luZG93LmlmLmNhbGxiYWNr
+            KGUpO30sImV4cGlyZWQtY2FsbGJhY2siOndpbmRvdy5pZi5leHBpcmVkQ2FsbGJhY2ssImVycm9y
+            LWNhbGxiYWNrIjp3aW5kb3cuaWYuZXJyb3JDYWxsYmFja30pO308L3NjcmlwdD48L2JvZHk+PC9o
+            dG1sPg==
+        """
+    }
+
+    private var isSuccessful = false
+    private lateinit var jsInterface: CaptchaCallbackInterface
+
+    interface CaptchaCallbackInterface {
+        @JavascriptInterface
+        fun callback(recaptchaResponse: String)
+
+        @JavascriptInterface
+        fun expiredCallback()
+
+        @JavascriptInterface
+        fun errorCallback()
+    }
+
+    @SuppressLint("AddJavascriptInterface", "SetJavaScriptEnabled")
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+
+        setTitle(R.string.recaptcha_dialog_title)
+
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT) {
+            WebView.setWebContentsDebuggingEnabled(true)
+        }
+
+        val siteKey = intent.getStringExtra("siteKey") ?: return
+        val referer = intent.getStringExtra("referer") ?: return
+        val userAgent = intent.getStringExtra("userAgent") ?: SYSTEM_USER_AGENT
+
+        val htmlContent = Base64.decode(CODE, Base64.DEFAULT)
+            .toString(Charset.defaultCharset())
+            .replace("THEME", if (Themes.isDark) "dark" else "light")
+            .replace("SITEKEY", siteKey)
+
+        jsInterface = object : CaptchaCallbackInterface {
+            @JavascriptInterface
+            override fun callback(recaptchaResponse: String) {
+                isSuccessful = true
+                EventBus.getDefault().post(
+                    RecaptchaResult(
+                        isError = false,
+                        code = recaptchaResponse,
+                    )
+                )
+                finish()
+            }
+
+            @JavascriptInterface
+            override fun expiredCallback() {
+                isSuccessful = false
+            }
+
+            @JavascriptInterface
+            override fun errorCallback() {
+                isSuccessful = false
+                EventBus.getDefault().post(
+                    RecaptchaResult(
+                        isError = true,
+                        code = null,
+                    )
+                )
+                finish()
+            }
+        }
+
+        val webView = WebView(this).apply {
+            setBackgroundColor(Color.TRANSPARENT)
+            settings.javaScriptEnabled = true
+            settings.userAgentString = userAgent
+            addJavascriptInterface(jsInterface, "if")
+            loadDataWithBaseURL(
+                referer,
+                htmlContent,
+                "text/html",
+                "UTF-8",
+                null,
+            )
+            // setLayerType(WebView.LAYER_TYPE_SOFTWARE, null)
+            layoutParams = FrameLayout.LayoutParams(MATCH_PARENT, MATCH_PARENT)
+        }
+        setContentView(webView)
+    }
+
+    override fun onDestroy() {
+        super.onDestroy()
+        if (!isSuccessful)
+            EventBus.getDefault().post(
+                RecaptchaResult(
+                    isError = false,
+                    code = null,
+                )
+            )
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/ui/login/recaptcha/RecaptchaResult.kt

@@ -0,0 +1,10 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2023-3-24.
+ */
+
+package pl.szczodrzynski.edziennik.ui.login.recaptcha
+
+data class RecaptchaResult(
+    val isError: Boolean,
+    val code: String?,
+)

app/src/main/java/pl/szczodrzynski/edziennik/ui/timetable/GenerateBlockTimetableDialog.kt

@@ -109,12 +109,10 @@ class GenerateBlockTimetableDialog(
                 .show()
 
         dialog.getButton(AlertDialog.BUTTON_POSITIVE)?.onClick {
-            app.permissionManager.requestStoragePermission(activity, permissionMessage = R.string.permissions_generate_timetable) {
-                when (b.weekSelectionRadioGroup.checkedRadioButtonId) {
-                    R.id.withChangesCurrentWeekRadio -> generateBlockTimetable(weekCurrentStart, weekCurrentEnd)
-                    R.id.withChangesNextWeekRadio -> generateBlockTimetable(weekNextStart, weekNextEnd)
-                    R.id.forSelectedWeekRadio -> selectDate()
-                }
+            when (b.weekSelectionRadioGroup.checkedRadioButtonId) {
+                R.id.withChangesCurrentWeekRadio -> generateBlockTimetable(weekCurrentStart, weekCurrentEnd)
+                R.id.withChangesNextWeekRadio -> generateBlockTimetable(weekNextStart, weekNextEnd)
+                R.id.forSelectedWeekRadio -> selectDate()
             }
         }
     }}

app/src/main/java/pl/szczodrzynski/edziennik/ui/timetable/TimetableDayFragment.kt

@@ -40,6 +40,7 @@ import pl.szczodrzynski.edziennik.data.db.full.EventFull
 import pl.szczodrzynski.edziennik.data.db.full.LessonFull
 import pl.szczodrzynski.edziennik.databinding.TimetableDayFragmentBinding
 import pl.szczodrzynski.edziennik.databinding.TimetableLessonBinding
+import pl.szczodrzynski.edziennik.databinding.TimetableNoLessonsBinding
 import pl.szczodrzynski.edziennik.databinding.TimetableNoTimetableBinding
 import pl.szczodrzynski.edziennik.ext.Intent
 import pl.szczodrzynski.edziennik.ext.JsonObject
@@ -63,6 +64,7 @@ import pl.szczodrzynski.edziennik.utils.Colors
 import pl.szczodrzynski.edziennik.utils.managers.NoteManager
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
+import pl.szczodrzynski.edziennik.utils.models.Week
 import pl.szczodrzynski.edziennik.utils.mutableLazy
 import kotlin.coroutines.CoroutineContext
 import kotlin.math.max
@@ -182,6 +184,20 @@ class TimetableDayFragment : LazyFragment(), CoroutineScope {
                 b.root.removeAllViews()
                 b.root.addView(view)
                 viewsRemoved = true
+
+                val b = TimetableNoLessonsBinding.bind(view)
+                val weekStart = date.weekStart.stringY_m_d
+                b.noLessonsSync.onClick {
+                    it.isEnabled = false
+                    EdziennikTask.syncProfile(
+                        profileId = App.profileId,
+                        featureTypes = setOf(FeatureType.TIMETABLE),
+                        arguments = JsonObject(
+                            "weekStart" to weekStart
+                        )
+                    ).enqueue(activity)
+                }
+                b.noLessonsSync.isVisible = date.weekDay !in Week.SATURDAY..Week.SUNDAY
             }
             return
         }

app/src/main/java/pl/szczodrzynski/edziennik/ui/timetable/TimetableFragment.kt

@@ -27,8 +27,11 @@ import kotlinx.coroutines.launch
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.MainActivity
 import pl.szczodrzynski.edziennik.R
+import pl.szczodrzynski.edziennik.data.api.edziennik.EdziennikTask
+import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.databinding.FragmentTimetableV2Binding
+import pl.szczodrzynski.edziennik.ext.JsonObject
 import pl.szczodrzynski.edziennik.ext.getSchoolYearConstrains
 import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ui.dialogs.settings.TimetableConfigDialog
@@ -178,6 +181,21 @@ class TimetableFragment : Fragment(), CoroutineScope {
         b.tabLayout.setCurrentItem(items.indexOfFirst { it.value == selectedDate?.value ?: today }, false)
 
         activity.navView.bottomSheet.prependItems(
+                BottomSheetPrimaryItem(true)
+                        .withTitle(R.string.menu_timetable_sync)
+                        .withIcon(CommunityMaterial.Icon.cmd_calendar_sync_outline)
+                        .withOnClickListener {
+                            activity.bottomSheet.close()
+                            val date = pageSelection ?: Date.getToday()
+                            val weekStart = date.weekStart.stringY_m_d
+                            EdziennikTask.syncProfile(
+                                profileId = App.profileId,
+                                featureTypes = setOf(FeatureType.TIMETABLE),
+                                arguments = JsonObject(
+                                    "weekStart" to weekStart
+                                )
+                            ).enqueue(activity)
+                        },
                 BottomSheetPrimaryItem(true)
                         .withTitle(R.string.timetable_select_day)
                         .withIcon(SzkolnyFont.Icon.szf_calendar_today_outline)

app/src/main/java/pl/szczodrzynski/edziennik/ui/views/AttachmentsView.kt

@@ -5,6 +5,7 @@
 package pl.szczodrzynski.edziennik.ui.views
 
 import android.content.Context
+import android.os.Build
 import android.os.Bundle
 import android.util.AttributeSet
 import androidx.appcompat.app.AppCompatActivity
@@ -50,6 +51,10 @@ class AttachmentsView @JvmOverloads constructor(
         val attachmentSizes = arguments.getLongArray("attachmentSizes")
 
         val adapter = AttachmentAdapter(context, onAttachmentClick = { item ->
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
+                downloadAttachment(item)
+                return@AttachmentAdapter
+            }
             app.permissionManager.requestStoragePermission(activity, R.string.permissions_attachment) {
                 downloadAttachment(item)
             }
@@ -57,6 +62,10 @@ class AttachmentsView @JvmOverloads constructor(
             val popupMenu = PopupMenu(chip.context, chip)
             popupMenu.menu.add(0, 1, 0, R.string.messages_attachment_download_again)
             popupMenu.setOnMenuItemClickListener {
+                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
+                    downloadAttachment(item)
+                    return@setOnMenuItemClickListener true
+                }
                 app.permissionManager.requestStoragePermission(activity, R.string.permissions_attachment) {
                     downloadAttachment(item, forceDownload = true)
                 }

app/src/main/java/pl/szczodrzynski/edziennik/ui/views/EventTypeDropdown.kt

@@ -33,13 +33,8 @@ class EventTypeDropdown : TextInputDropDown {
     suspend fun loadItems() {
         val types = withContext(Dispatchers.Default) {
             val list = mutableListOf<Item>()
-
-            var types = db.eventTypeDao().getAllNow(profileId)
-
-            if (types.none { it.id in -1L..10L }) {
-                val profile = db.profileDao().getByIdNow(profileId) ?: return@withContext listOf()
-                types = db.eventTypeDao().addDefaultTypes(profile)
-            }
+            val types = db.eventTypeDao().getAllNow(profileId)
+                .sortedBy { it.order }
 
             list += types.map {
                 Item(it.id, it.name, tag = it, icon = IconicsDrawable(context).apply {

app/src/main/java/pl/szczodrzynski/edziennik/ui/widgets/notifications/WidgetNotificationsProvider.kt

@@ -23,6 +23,7 @@ import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.ext.Bundle
 import pl.szczodrzynski.edziennik.ext.getJsonObject
 import pl.szczodrzynski.edziennik.ext.pendingIntentFlag
+import pl.szczodrzynski.edziennik.ext.pendingIntentMutable
 import pl.szczodrzynski.edziennik.ext.putExtras
 import pl.szczodrzynski.edziennik.receivers.SzkolnyReceiver
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
@@ -50,7 +51,7 @@ class WidgetNotificationsProvider : AppWidgetProvider() {
             val syncIntent = SzkolnyReceiver.getIntent(context, Bundle(
                     "task" to "SyncRequest"
             ))
-            val syncPendingIntent = PendingIntent.getBroadcast(context, 0, syncIntent, pendingIntentFlag())
+            val syncPendingIntent = PendingIntent.getBroadcast(context, 0, syncIntent, pendingIntentMutable())
             views.setOnClickPendingIntent(R.id.widgetNotificationsSync, syncPendingIntent)
 
             views.setImageViewBitmap(
@@ -71,13 +72,13 @@ class WidgetNotificationsProvider : AppWidgetProvider() {
 
             val itemIntent = Intent(context, MainActivity::class.java)
             itemIntent.action = Intent.ACTION_MAIN
-            val itemPendingIntent = PendingIntent.getActivity(context, 0, itemIntent, pendingIntentFlag())
+            val itemPendingIntent = PendingIntent.getActivity(context, appWidgetId, itemIntent, pendingIntentMutable())
             views.setPendingIntentTemplate(R.id.widgetNotificationsListView, itemPendingIntent)
 
             val headerIntent = Intent(context, MainActivity::class.java)
             headerIntent.action = Intent.ACTION_MAIN
             headerIntent.putExtras("fragmentId" to NavTarget.NOTIFICATIONS)
-            val headerPendingIntent = PendingIntent.getActivity(context, 0, headerIntent, pendingIntentFlag())
+            val headerPendingIntent = PendingIntent.getActivity(context, appWidgetId, headerIntent, pendingIntentMutable())
             views.setOnClickPendingIntent(R.id.widgetNotificationsHeader, headerPendingIntent)
 
             appWidgetManager.updateAppWidget(appWidgetId, views)

app/src/main/java/pl/szczodrzynski/edziennik/ui/widgets/timetable/WidgetTimetableProvider.kt

@@ -34,6 +34,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Lesson.Companion.TYPE_NO_LESSON
 import pl.szczodrzynski.edziennik.ext.filterOutArchived
 import pl.szczodrzynski.edziennik.ext.getJsonObject
 import pl.szczodrzynski.edziennik.ext.pendingIntentFlag
+import pl.szczodrzynski.edziennik.ext.pendingIntentMutable
 import pl.szczodrzynski.edziennik.ext.putExtras
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
 import pl.szczodrzynski.edziennik.ui.widgets.LessonDialogActivity
@@ -119,7 +120,7 @@ class WidgetTimetableProvider : AppWidgetProvider() {
                     0, refreshIntent, PendingIntent.FLAG_UPDATE_CURRENT or pendingIntentFlag())
             views.setOnClickPendingIntent(R.id.widgetTimetableRefresh, refreshPendingIntent)
 
-            views.setOnClickPendingIntent(R.id.widgetTimetableSync, getPendingSelfIntent(context, ACTION_SYNC_DATA))
+            views.setViewVisibility(R.id.widgetTimetableSync, View.GONE)
 
             views.setImageViewBitmap(
                 R.id.widgetTimetableRefresh,
@@ -129,14 +130,6 @@ class WidgetTimetableProvider : AppWidgetProvider() {
                 }.toBitmap()
             )
 
-            views.setImageViewBitmap(
-                R.id.widgetTimetableSync,
-                IconicsDrawable(context, CommunityMaterial.Icon.cmd_download_outline).apply {
-                    colorInt = Color.WHITE
-                    sizeDp = if (config.bigStyle) 28 else 20
-                }.toBitmap()
-            )
-
             prepareAppWidget(app, appWidgetId, views, config, bellSyncDiffMillis)
 
             appWidgetManager.updateAppWidget(appWidgetId, views)
@@ -337,8 +330,11 @@ class WidgetTimetableProvider : AppWidgetProvider() {
                     scrollPos = pos + 1
                 }
 
+                // remove notes from other profiles
+                lesson.filterNotes()
                 // set the subject and classroom name
-                model.subjectName = lesson.displaySubjectName
+                model.subjectName = lesson.getNoteSubstituteText(showNotes = true)
+                    ?: lesson.displaySubjectName
                 model.classroomName = lesson.displayClassroom
 
                 // set the bell sync to calculate progress in ListProvider
@@ -399,7 +395,7 @@ class WidgetTimetableProvider : AppWidgetProvider() {
             }
         }
         headerIntent.putExtras("fragmentId" to NavTarget.TIMETABLE)
-        val headerPendingIntent = PendingIntent.getActivity(app, appWidgetId, headerIntent, pendingIntentFlag())
+        val headerPendingIntent = PendingIntent.getActivity(app, appWidgetId, headerIntent, pendingIntentMutable())
         views.setOnClickPendingIntent(R.id.widgetTimetableHeader, headerPendingIntent)
 
         timetables!!.put(appWidgetId, models)
@@ -413,7 +409,7 @@ class WidgetTimetableProvider : AppWidgetProvider() {
         // create an intent used to display the lesson details dialog
         val itemIntent = Intent(app, LessonDialogActivity::class.java)
         itemIntent.addFlags(Intent.FLAG_ACTIVITY_NEW_TASK/* or Intent.FLAG_ACTIVITY_CLEAR_TASK*/)
-        val itemPendingIntent = PendingIntent.getActivity(app, appWidgetId, itemIntent, PendingIntent.FLAG_MUTABLE)
+        val itemPendingIntent = PendingIntent.getActivity(app, appWidgetId, itemIntent, pendingIntentMutable())
         views.setPendingIntentTemplate(R.id.widgetTimetableListView, itemPendingIntent)
 
         if (!unified)

app/src/main/java/pl/szczodrzynski/edziennik/utils/Utils.java

@@ -774,14 +774,21 @@ public class Utils {
 
     private static File storageDir = null;
     public static File getStorageDir() {
-        if (storageDir != null)
-            return storageDir;
-        storageDir = Environment.getExternalStoragePublicDirectory(Environment.DIRECTORY_DOWNLOADS);
-        storageDir = new File(storageDir, "Szkolny.eu");
-        storageDir.mkdirs();
         return storageDir;
     }
 
+    public static void initializeStorageDir(Context context) {
+        if (storageDir != null)
+            return;
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
+            storageDir = context.getExternalFilesDir(null);
+        } else {
+            storageDir = Environment.getExternalStoragePublicDirectory(Environment.DIRECTORY_DOWNLOADS);
+            storageDir = new File(storageDir, "Szkolny.eu");
+        }
+        storageDir.mkdirs();
+    }
+
     public static void writeStringToFile(File file, String data) throws IOException {
         OutputStreamWriter outputStreamWriter = new OutputStreamWriter(new FileOutputStream(file));
         outputStreamWriter.write(data);

app/src/main/java/pl/szczodrzynski/edziennik/utils/managers/EventManager.kt

@@ -48,6 +48,7 @@ class EventManager(val app: App) : CoroutineScope {
         title: TextView,
         event: EventFull,
         showType: Boolean = true,
+        showSubject: Boolean = false,
         showNotes: Boolean = true,
         doneIconColor: Int? = null
     ) {
@@ -60,6 +61,7 @@ class EventManager(val app: App) : CoroutineScope {
             if (event.hasNotes() && hasReplacingNotes && showNotes) "{cmd-swap-horizontal} " else null,
             if (event.hasNotes() && !hasReplacingNotes && showNotes) "{cmd-playlist-edit} " else null,
             if (showType) "${event.typeName ?: "wydarzenie"} - " else null,
+            if (showSubject) event.subjectLongName?.plus(" - ") else null,
             topicSpan,
         ).concat()
 

app/src/main/java/pl/szczodrzynski/edziennik/utils/managers/NoteManager.kt

@@ -171,7 +171,7 @@ class NoteManager(private val app: App) {
                 activity = activity,
                 simpleMode = true,
                 showDate = true,
-                showColor = false,
+                showTypeColor = false,
                 showTime = false,
                 markAsSeen = false,
                 showNotes = false,

app/src/main/java/pl/szczodrzynski/edziennik/utils/managers/UserActionManager.kt

@@ -22,6 +22,8 @@ import pl.szczodrzynski.edziennik.ext.*
 import pl.szczodrzynski.edziennik.ui.captcha.RecaptchaPromptDialog
 import pl.szczodrzynski.edziennik.ui.login.oauth.OAuthLoginActivity
 import pl.szczodrzynski.edziennik.ui.login.oauth.OAuthLoginResult
+import pl.szczodrzynski.edziennik.ui.login.recaptcha.RecaptchaActivity
+import pl.szczodrzynski.edziennik.ui.login.recaptcha.RecaptchaResult
 import pl.szczodrzynski.edziennik.utils.Utils.d
 
 class UserActionManager(val app: App) {
@@ -107,10 +109,45 @@ class UserActionManager(val app: App) {
                 ))
             },
             onCancel = callback.onCancel,
+            onServerError = {
+                executeRecaptchaActivity(activity, event, callback)
+            },
         ).show()
         return true
     }
 
+    private fun executeRecaptchaActivity(
+        activity: AppCompatActivity,
+        event: UserActionRequiredEvent,
+        callback: UserActionCallback,
+    ): Boolean {
+        event.params.getString("siteKey") ?: return false
+        event.params.getString("referer") ?: return false
+
+        var listener: Any? = null
+        listener = object {
+            @Subscribe(threadMode = ThreadMode.MAIN)
+            fun onRecaptchaResult(result: RecaptchaResult) {
+                EventBus.getDefault().unregister(listener)
+                when {
+                    result.isError -> callback.onFailure?.invoke()
+                    result.code != null -> {
+                        finishAction(activity, event, callback, Bundle(
+                            "recaptchaCode" to result.code,
+                            "recaptchaTime" to System.currentTimeMillis(),
+                        ))
+                    }
+                    else -> callback.onCancel?.invoke()
+                }
+            }
+        }
+        EventBus.getDefault().register(listener)
+
+        val intent = Intent(activity, RecaptchaActivity::class.java).putExtras(event.params)
+        activity.startActivity(intent)
+        return true
+    }
+
     private fun executeOauth(
         activity: AppCompatActivity,
         event: UserActionRequiredEvent,

app/src/main/java/pl/szczodrzynski/edziennik/utils/models/ItemWidgetTimetableModel.java

@@ -19,7 +19,7 @@ public class ItemWidgetTimetableModel {
     public Time endTime;
     public boolean lessonPassed;
     public boolean lessonCurrent;
-    public String subjectName = "";
+    public CharSequence subjectName = "";
     public String classroomName = "";
     public boolean lessonChange = false;
     public boolean lessonChangeNoClassroom = false;

app/src/main/res/layout/activity_counter.xml

@@ -1,6 +1,9 @@
 <?xml version="1.0" encoding="utf-8"?>
-<layout xmlns:tools="http://schemas.android.com/tools"
-    xmlns:android="http://schemas.android.com/apk/res/android">
+<FrameLayout xmlns:android="http://schemas.android.com/apk/res/android"
+    xmlns:tools="http://schemas.android.com/tools"
+    android:id="@+id/rootFrame"
+    android:layout_width="match_parent"
+    android:layout_height="match_parent">
 
     <LinearLayout
         android:layout_width="match_parent"
@@ -50,4 +53,4 @@
             android:textSize="48sp"
             tools:text="Zostało 2341 sekund" />
     </LinearLayout>
-</layout>
+</FrameLayout>

app/src/main/res/layout/dialog_config_agenda.xml

@@ -50,6 +50,14 @@
                 android:minHeight="32dp"
                 android:text="@string/agenda_config_teacher_absence" />
 
+            <com.google.android.material.checkbox.MaterialCheckBox
+                android:layout_width="match_parent"
+                android:layout_height="wrap_content"
+                android:layout_marginTop="8dp"
+                android:checked="@={config.ui.agendaSubjectImportant}"
+                android:minHeight="32dp"
+                android:text="@string/agenda_config_subject_important" />
+
             <com.google.android.material.checkbox.MaterialCheckBox
                 android:layout_width="match_parent"
                 android:layout_height="wrap_content"

app/src/main/res/layout/dialog_event_details.xml

@@ -17,6 +17,7 @@
             type="pl.szczodrzynski.edziennik.data.db.full.EventFull" />
         <variable name="eventShared" type="boolean" />
         <variable name="eventOwn" type="boolean" />
+        <variable name="name" type="java.lang.CharSequence" />
         <variable name="details" type="java.lang.CharSequence" />
         <variable name="monthName" type="String" />
     </data>
@@ -55,7 +56,7 @@
                     <TextView
                         android:layout_width="wrap_content"
                         android:layout_height="wrap_content"
-                        android:text="@{event.typeName}"
+                        android:text="@{name}"
                         android:textIsSelectable="true"
                         android:textAppearance="@style/NavView.TextView.Title"
                         android:visibility="@{event.typeName == null ? View.GONE : View.VISIBLE}"

app/src/main/res/layout/dialog_event_manual_v2.xml

@@ -13,6 +13,7 @@
         android:layout_height="match_parent">
 
     <LinearLayout
+        android:id="@+id/mainLayout"
         android:orientation="vertical"
         android:layout_width="match_parent"
         android:layout_height="wrap_content"
@@ -34,6 +35,7 @@
         </com.google.android.material.textfield.TextInputLayout>
 
         <com.google.android.material.textfield.TextInputLayout
+            android:id="@+id/timeDropdownLayout"
             style="@style/Widget.MaterialComponents.TextInputLayout.FilledBox.Dense"
             android:layout_width="match_parent"
             android:layout_height="wrap_content"
@@ -163,6 +165,7 @@
             tools:visibility="visible">
 
             <com.google.android.material.textfield.TextInputLayout
+                android:id="@+id/subjectDropdownLayout"
                 style="@style/Widget.MaterialComponents.TextInputLayout.OutlinedBox.Dense"
                 android:layout_width="match_parent"
                 android:layout_height="wrap_content"

app/src/main/res/layout/lab_fragment.xml

@@ -100,6 +100,21 @@
                 android:text="Remove all homework body (null)"
                 android:textAllCaps="false" />
 
+            <Button
+                android:id="@+id/resetEventTypes"
+                android:layout_width="match_parent"
+                android:layout_height="wrap_content"
+                android:text="Reset event types"
+                android:textAllCaps="false" />
+
+            <Button
+                android:id="@+id/clearCookies"
+                android:layout_width="match_parent"
+                android:layout_height="wrap_content"
+                android:layout_marginTop="24dp"
+                android:text="Clear all cookies"
+                android:textAllCaps="false" />
+
             <TextView
                 android:id="@+id/cookies"
                 android:layout_width="match_parent"

app/src/main/res/layout/timetable_no_lessons.xml

@@ -2,13 +2,29 @@
   ~ Copyright (c) Kuba Szczodrzyński 2019-11-15.
   -->
 
-<androidx.appcompat.widget.AppCompatTextView xmlns:android="http://schemas.android.com/apk/res/android"
+<LinearLayout
+    xmlns:android="http://schemas.android.com/apk/res/android"
     xmlns:app="http://schemas.android.com/apk/res-auto"
-    android:layout_width="wrap_content"
-    android:layout_height="wrap_content"
-    android:layout_gravity="center"
-    android:drawablePadding="16dp"
-    android:fontFamily="sans-serif-light"
-    android:text="@string/timetable_no_lessons_title"
-    android:textSize="24sp"
-    app:drawableTopCompat="@drawable/ic_timetable" />
+    android:id="@+id/noTimetableLayout"
+    android:layout_width="match_parent"
+    android:layout_height="match_parent"
+    android:gravity="center"
+    android:orientation="vertical">
+
+    <androidx.appcompat.widget.AppCompatTextView
+        android:layout_width="wrap_content"
+        android:layout_height="wrap_content"
+        android:layout_gravity="center"
+        android:drawablePadding="16dp"
+        android:fontFamily="sans-serif-light"
+        android:text="@string/timetable_no_lessons_title"
+        android:textSize="24sp"
+        app:drawableTopCompat="@drawable/ic_timetable" />
+
+    <com.google.android.material.button.MaterialButton
+        android:id="@+id/noLessonsSync"
+        android:layout_width="wrap_content"
+        android:layout_height="wrap_content"
+        android:layout_marginTop="16dp"
+        android:text="@string/refresh" />
+</LinearLayout>

app/src/main/res/raw/app_data.json

@@ -12,7 +12,8 @@
 		"uiConfig": {
 			"lessonHeight": 60,
 			"enableMarkAsReadAnnouncements": true,
-			"enableNoticePoints": false
+			"enableNoticePoints": false,
+			"eventManualShowSubjectDropdown": false
 		},
 		"eventTypes": [
 			{
@@ -83,43 +84,40 @@
 	},
 	"university": {
 		"configOverrides": {
+			"agendaSubjectImportant": true,
 			"shareByDefault": true,
 			"timetableColorSubjectName": true,
 			"timetableTrimHourRange": true
 		},
 		"uiConfig": {
-			"lessonHeight": 45
+			"lessonHeight": 45,
+			"eventManualShowSubjectDropdown": true
 		},
 		"eventTypes": [
 			{
-				"id": 1,
-				"color": "#f44336",
-				"name": "egzamin"
+				"id": 3,
+				"color": "#76ff03",
+				"name": "kartkówka"
 			},
 			{
 				"id": 2,
 				"color": "#e91e63",
 				"name": "kolokwium"
 			},
-			{
-				"id": 3,
-				"color": "#76ff03",
-				"name": "kartkówka"
-			},
-			{
-				"id": 4,
-				"color": "#ffeb3b",
-				"name": "wejściówka"
-			},
 			{
 				"id": 5,
 				"color": "#90caf9",
 				"name": "zaliczenie"
 			},
 			{
-				"id": 6,
-				"color": "#4050b5",
-				"name": "zadanie"
+				"id": 1,
+				"color": "#f44336",
+				"name": "egzamin"
+			},
+			{
+				"id": 11,
+				"color": "#3d5afe",
+				"name": "poprawka"
 			},
 			{
 				"id": 7,

app/src/main/res/values-de/strings.xml

@@ -847,7 +847,7 @@
     <string name="settings_about_licenses_text">Open-Source-Lizenzen</string>
     <string name="settings_about_privacy_policy_text">Datenschutzrichtlinie</string>
     <string name="settings_card_register_title">E-Klassenbuch</string>
-    <string name="settings_about_title_subtext">© Kuba Szczodrzyński, September 2018 - 2022</string>
+    <string name="settings_about_title_subtext">© Kuba Szczodrzyński, September 2018 - 2023</string>
     <string name="settings_about_update_subtext">Klicken Sie hier, um nach Aktualisierungen zu suchen</string>
     <string name="settings_about_update_text">Aktualisierung</string>
     <string name="settings_about_version_text">Version</string>

app/src/main/res/values-en/strings.xml

@@ -849,7 +849,7 @@
     <string name="settings_about_licenses_text">Open-source licenses</string>
     <string name="settings_about_privacy_policy_text">Privacy policy</string>
     <string name="settings_card_register_title">E-register</string>
-    <string name="settings_about_title_subtext">© Kuba Szczodrzyński, September 2018 – 2022</string>
+    <string name="settings_about_title_subtext">© Kuba Szczodrzyński, September 2018 – 2023</string>
     <string name="settings_about_update_subtext">Click to check for updates</string>
     <string name="settings_about_update_text">Update</string>
     <string name="settings_about_version_text">Version</string>
@@ -1353,7 +1353,6 @@
     <string name="home_archive_close_no_target_text">Child %s does not have a profile on this account in the current school year. Probably this profile has been deleted or the student no longer attends this class.\n\nTo go to the current profile, select a student from the list or log in to their account with the Add student button.</string>
     <string name="build_invalid_no_remote_repo">A reference to a remote repository was not found. Make sure you are using the official repository fork and verify your Gradle configuration.</string>
     <string name="login_mode_mobidziennik_web_guide">"Enter the data you use to log in to the MobiDziennik website. As the server address, you can enter the address of the website where you have MobiDziennik. "</string>
-    <string name="permissions_generate_timetable">In order to be able to save the generated timetable, you must grant access rights to the device\'s memory.\n\nClick OK to grant permissions.</string>
     <string name="login_summary_account_child">(Child)</string>
     <string name="login_summary_account_parent">(Parent)</string>
     <string name="menu_teachers">Teachers</string>

app/src/main/res/values/strings.xml

@@ -916,7 +916,7 @@
     <string name="settings_about_licenses_text">Licencje open-source</string>
     <string name="settings_about_privacy_policy_text">Polityka prywatności</string>
     <string name="settings_card_register_title">E-dziennik</string>
-    <string name="settings_about_title_subtext">© Kuba Szczodrzyński, wrzesień 2018 - 2022</string>
+    <string name="settings_about_title_subtext">© Kuba Szczodrzyński, wrzesień 2018 - 2023</string>
     <string name="settings_about_update_subtext">Kliknij, aby sprawdzić aktualizacje</string>
     <string name="settings_about_update_text">Aktualizacja</string>
     <string name="settings_about_version_text">Wersja</string>
@@ -1241,7 +1241,7 @@
     <string name="timetable_not_public_hint">Skontaktuj się z wychowawcą w celu udostępnienia planu lekcji.</string>
     <string name="timetable_not_public_text">Plan lekcji nie został opublikowany przez szkołę.</string>
     <string name="timetable_not_public_title">Brak planu lekcji</string>
-    <string name="timetable_select_day">Wybierz dzień</string>
+    <string name="timetable_select_day">Przejdź do daty</string>
     <string name="timetable_syncing_text">Pobieranie planu lekcji na wybrany tydzień…</string>
     <string name="timetable_today">Dzisiaj</string>
     <string name="title_all">Synchronizuj wszystko</string>
@@ -1416,7 +1416,6 @@
     <string name="build_dialog_open_repo">Sprawdź kod</string>
     <string name="error_no_api_access">Brak dostępu do API</string>
     <string name="build_date">Data kompilacji</string>
-    <string name="permissions_generate_timetable">Aby móc zapisać wygenerowany plan lekcji musisz przyznać uprawnienia dostępu do pamięci urządzenia.\n\nKliknij OK, aby przyznać uprawnienia.</string>
     <string name="privacy_policy_dialog_html"><![CDATA[Korzystając z aplikacji potwierdzasz <a href="https://szkolny.eu/privacy-policy">przeczytanie Polityki prywatności</a> i akceptujesz jej postanowienia.<br /><br />Autorzy aplikacji nie biorą odpowiedzialności za korzystanie z aplikacji Szkolny.eu.]]></string>
     <string name="login_chooser_version_format">Szkolny.eu v%s\n%s</string>
     <string name="menu_agenda_config">Ustawienia terminarza</string>
@@ -1544,6 +1543,7 @@
     <string name="login_mode_usos_oauth_guide">TODO</string>
     <string name="notification_user_action_required_oauth_usos">USOS - wymagane logowanie z użyciem przeglądarki</string>
     <string name="oauth_dialog_title">Zaloguj się</string>
+    <string name="recaptcha_dialog_title">reCAPTCHA</string>
     <string name="app_cannot_load_data">Nie można załadować danych aplikacji</string>
     <string name="legend_event_shared_received">{cmd-share-variant} udostępnione w klasie</string>
     <string name="legend_event_shared_sent">{cmd-share-variant} udostępnione przez Ciebie</string>
@@ -1551,4 +1551,6 @@
     <string name="settings_register_share_by_default_subtext">Ustaw tworzone wydarzenia domyślnie jako udostępnione</string>
     <string name="settings_registration_section">Rejestracja</string>
     <string name="home_timetable_all_lessons">Wszystkie lekcje:</string>
+    <string name="agenda_config_subject_important">Wyświetl nazwę przedmiotu zamiast rodzaju</string>
+    <string name="menu_timetable_sync">Odśwież wybrany tydzień</string>
 </resources>

build.gradle

@@ -5,8 +5,8 @@ buildscript {
         kotlin_version = '1.6.10'
 
         release = [
-                versionName: "4.13.1",
-                versionCode: 4130199
+                versionName: "4.13.6",
+                versionCode: 4130699
         ]
 
         setup = [