[4.14.2] Update build.gradle, signing and changelog

* [Librus] Fix TeacherFreeDays API problems

* [Librus] Small Teacher Free Days Bug fix & improvement

* [Librus] Implementation fix

* Apply suggestions from code review

---------

Co-authored-by: Kuba Szczodrzyński <kuba@szczodrzynski.pl>

.github/utils/_get_password.py

@@ -23,8 +23,6 @@ def get_password(
         auth_plugin="mysql_native_password",
     )
 
-    print(f"Generating passwords for version {version_name} ({version_code})")
-
     password = base64.b64encode(secrets.token_bytes(16)).decode()
     iv = secrets.token_bytes(16)
 

.github/utils/_utils.py

@@ -102,7 +102,9 @@ def get_commit_log(project_dir: str, format: str, max_lines: int = None) -> str:
     )
 
     log = subprocess.run(
-        args=f"git log {last_tag}..HEAD --format=%an%x00%at%x00%h%x00%s%x00%D".split(" "),
+        args=f"git log {last_tag}..HEAD --format=%an%x00%at%x00%h%x00%s%x00%D".split(
+            " "
+        ),
         cwd=project_dir,
         stdout=subprocess.PIPE,
     )

.github/utils/bump_nightly.py

@@ -1,11 +1,8 @@
-import json
 import os
 import re
 import sys
 from datetime import datetime, timedelta
 
-import requests
-
 from _utils import (
     get_commit_log,
     get_project_dir,
@@ -25,17 +22,6 @@ if __name__ == "__main__":
         print("Missing GitHub environment variables.")
         exit(-1)
 
-    with requests.get(
-        f"https://api.github.com/repos/{repo}/actions/runs?per_page=5&status=success"
-    ) as r:
-        data = json.loads(r.text)
-        runs = [run for run in data["workflow_runs"] if run["head_sha"] == sha]
-        if runs:
-            print("::set-output name=hasNewChanges::false")
-            exit(0)
-
-    print("::set-output name=hasNewChanges::true")
-
     project_dir = get_project_dir()
 
     (version_code, version_name) = read_gradle_version(project_dir)
@@ -48,8 +34,8 @@ if __name__ == "__main__":
         date -= timedelta(days=1)
         version_name += "+nightly." + date.strftime("%Y%m%d")
 
-    print("::set-output name=appVersionName::" + version_name)
-    print("::set-output name=appVersionCode::" + str(version_code))
+    print("appVersionName=" + version_name)
+    print("appVersionCode=" + str(version_code))
 
     write_gradle_version(project_dir, version_code, version_name)
 

.github/utils/check_nightly.py

@@ -0,0 +1,23 @@
+import json
+import os
+
+import requests
+
+if __name__ == "__main__":
+    repo = os.getenv("GITHUB_REPOSITORY")
+    sha = os.getenv("GITHUB_SHA")
+
+    if not repo or not sha:
+        print("Missing GitHub environment variables.")
+        exit(-1)
+
+    with requests.get(
+        f"https://api.github.com/repos/{repo}/actions/runs?per_page=5&status=success"
+    ) as r:
+        data = json.loads(r.text)
+        runs = [run for run in data["workflow_runs"] if run["head_sha"] == sha]
+        if runs:
+            print("hasNewChanges=false")
+            exit(0)
+
+    print("hasNewChanges=true")

.github/utils/extract_changelogs.py

@@ -12,24 +12,24 @@ if __name__ == "__main__":
 
     (version_code, version_name) = read_gradle_version(project_dir)
 
-    print("::set-output name=appVersionName::" + version_name)
-    print("::set-output name=appVersionCode::" + str(version_code))
+    print("appVersionName=" + version_name)
+    print("appVersionCode=" + str(version_code))
 
     dir = f"{project_dir}/app/release/whatsnew-{version_name}/"
     os.makedirs(dir, exist_ok=True)
 
-    print("::set-output name=changelogDir::" + dir)
+    print("changelogDir=" + dir)
 
     (title, changelog) = get_changelog(project_dir, format="plain")
 
     # plain text changelog - Firebase App Distribution
-    with open(dir + "whatsnew-titled.txt", "w", encoding="utf-8") as f:
+    with open(dir + "whatsnew_titled.txt", "w", encoding="utf-8") as f:
         f.write(title)
         f.write("\n")
         f.write(changelog)
-    print("::set-output name=changelogPlainTitledFile::" + dir + "whatsnew-titled.txt")
+    print("changelogPlainTitledFile=" + dir + "whatsnew_titled.txt")
 
-    print("::set-output name=changelogTitle::" + title)
+    print("changelogTitle=" + title)
 
     # plain text changelog, max 500 chars - Google Play
     with open(dir + "whatsnew-pl-PL", "w", encoding="utf-8") as f:
@@ -41,32 +41,31 @@ if __name__ == "__main__":
         changelog = changelog.strip()
         f.write(changelog)
 
-    print("::set-output name=changelogPlainFile::" + dir + "whatsnew-pl-PL")
+    print("changelogPlainFile=" + dir + "whatsnew-pl-PL")
 
     # markdown changelog - Discord webhook
     (_, changelog) = get_changelog(project_dir, format="markdown")
     with open(dir + "whatsnew.md", "w", encoding="utf-8") as f:
         f.write(changelog)
-    print("::set-output name=changelogMarkdownFile::" + dir + "whatsnew.md")
+    print("changelogMarkdownFile=" + dir + "whatsnew.md")
 
     # html changelog - version info in DB
     (_, changelog) = get_changelog(project_dir, format="html")
     with open(dir + "whatsnew.html", "w", encoding="utf-8") as f:
         f.write(changelog)
-    print("::set-output name=changelogHtmlFile::" + dir + "whatsnew.html")
-
+    print("changelogHtmlFile=" + dir + "whatsnew.html")
 
     changelog = get_commit_log(project_dir, format="plain", max_lines=10)
     with open(dir + "commit_log.txt", "w", encoding="utf-8") as f:
         f.write(changelog)
-    print("::set-output name=commitLogPlainFile::" + dir + "commit_log.txt")
+    print("commitLogPlainFile=" + dir + "commit_log.txt")
 
     changelog = get_commit_log(project_dir, format="markdown", max_lines=10)
     with open(dir + "commit_log.md", "w", encoding="utf-8") as f:
         f.write(changelog)
-    print("::set-output name=commitLogMarkdownFile::" + dir + "commit_log.md")
+    print("commitLogMarkdownFile=" + dir + "commit_log.md")
 
     changelog = get_commit_log(project_dir, format="html", max_lines=10)
     with open(dir + "commit_log.html", "w", encoding="utf-8") as f:
         f.write(changelog)
-    print("::set-output name=commitLogHtmlFile::" + dir + "commit_log.html")
+    print("commitLogHtmlFile=" + dir + "commit_log.html")

.github/utils/find_artifacts.py

@@ -13,7 +13,7 @@ if __name__ == "__main__":
 
     files = glob.glob(f"{project_dir}/app/release/*.*")
     for file in files:
-        file_relative = file.replace(os.getenv("GITHUB_WORKSPACE") + "/", "")
+        file_relative = file.replace(project_dir + "/", "")
         if "-aligned.apk" in file:
             os.unlink(file)
         elif "-signed.apk" in file:
@@ -22,5 +22,5 @@ if __name__ == "__main__":
                 os.unlink(new_file)
             os.rename(file, new_file)
         elif ".apk" in file or ".aab" in file:
-            print("::set-output name=signedReleaseFile::" + file)
-            print("::set-output name=signedReleaseFileRelative::" + file_relative)
+            print("signedReleaseFile=" + file)
+            print("signedReleaseFileRelative=" + file_relative)

.github/utils/save_version.py

@@ -64,7 +64,14 @@ def save_version(
     if build_type in ["nightly", "daily"]:
         download_url = apk_server_nightly + apk_name if apk_name else None
     else:
-        download_url = apk_server_release + apk_name if apk_name else None
+        # download_url = apk_server_release + apk_name if apk_name else None
+        download_url = (
+            f"https://github.com/szkolny-eu/szkolny-android/releases/download/v{version_name}/{apk_name}"
+            if apk_name
+            else None
+        )
+    if download_url:
+        print("downloadUrl=" + download_url)
 
     cols = [
         "versionCode",
@@ -119,4 +126,12 @@ if __name__ == "__main__":
     APK_SERVER_RELEASE = os.getenv("APK_SERVER_RELEASE")
     APK_SERVER_NIGHTLY = os.getenv("APK_SERVER_NIGHTLY")
 
-    save_version(project_dir, DB_HOST, DB_USER, DB_PASS, DB_NAME, APK_SERVER_RELEASE, APK_SERVER_NIGHTLY)
+    save_version(
+        project_dir,
+        DB_HOST,
+        DB_USER,
+        DB_PASS,
+        DB_NAME,
+        APK_SERVER_RELEASE,
+        APK_SERVER_NIGHTLY,
+    )

.github/utils/sign.py

@@ -31,8 +31,6 @@ def sign(
     SIGNING_FORMAT = "$param1.{}.$param2"
     CPP_FORMAT = "/*{}*/\nstatic toys AES_IV[16] = {{\n\t{} }};"
 
-    print(f"Writing passwords for version {version_name} ({version_code})")
-
     iv_hex = " ".join(["{:02x}".format(x) for x in iv])
     iv_cpp = ", ".join(["0x{:02x}".format(x) for x in iv])
 
@@ -71,8 +69,8 @@ if __name__ == "__main__":
         version_name, version_code, DB_HOST, DB_USER, DB_PASS, DB_NAME
     )
 
-    print("::set-output name=appVersionName::" + version_name)
-    print("::set-output name=appVersionCode::" + str(version_code))
+    print("appVersionName=" + version_name)
+    print("appVersionCode=" + str(version_code))
 
     sign(
         project_dir,

.github/utils/webhook_discord.py

@@ -11,8 +11,7 @@ from _utils import get_changelog, get_commit_log, get_project_dir, read_gradle_v
 def post_webhook(
     project_dir: str,
     apk_file: str,
-    apk_server_release: str,
-    apk_server_nightly: str,
+    download_url: str,
     webhook_release: str,
     webhook_testing: str,
 ):
@@ -25,12 +24,6 @@ def post_webhook(
     testing = ["dev", "beta", "nightly", "daily"]
     testing = build_type in testing
 
-    apk_name = os.path.basename(apk_file)
-    if build_type in ["nightly", "daily"]:
-        download_url = apk_server_nightly + apk_name
-    else:
-        download_url = apk_server_release + apk_name
-
     if testing:
         build_date = int(os.stat(apk_file).st_mtime)
         if build_date:
@@ -48,13 +41,17 @@ def post_webhook(
         requests.post(url=webhook_testing, json=webhook)
     else:
         changelog = get_changelog(project_dir, format="markdown")
-        webhook = get_webhook_release(changelog, download_url)
+        webhook = get_webhook_release(version_name, changelog, download_url)
         requests.post(url=webhook_release, json=webhook)
 
 
-def get_webhook_release(changelog: str, download_url: str):
+def get_webhook_release(version_name: str, changelog: str, download_url: str):
     (title, content) = changelog
-    return {"content": f"__**{title}**__\n{content}\n{download_url}"}
+    return {
+        "content": (
+            f"__**{title}**__\n{content}\n[Szkolny.eu {version_name}]({download_url})"
+        ),
+    }
 
 
 def get_webhook_testing(
@@ -73,9 +70,11 @@ def get_webhook_testing(
                 "fields": [
                     {
                         "name": f"Wersja `{version_name}`",
-                        "value": f"[Pobierz .APK]({download_url})"
-                        if download_url
-                        else "*Pobieranie niedostępne*",
+                        "value": (
+                            f"[Pobierz .APK]({download_url})"
+                            if download_url
+                            else "*Pobieranie niedostępne*"
+                        ),
                         "inline": False,
                     },
                     {
@@ -103,16 +102,14 @@ if __name__ == "__main__":
 
     load_dotenv()
     APK_FILE = os.getenv("APK_FILE")
-    APK_SERVER_RELEASE = os.getenv("APK_SERVER_RELEASE")
-    APK_SERVER_NIGHTLY = os.getenv("APK_SERVER_NIGHTLY")
+    DOWNLOAD_URL = os.getenv("DOWNLOAD_URL")
     WEBHOOK_RELEASE = os.getenv("WEBHOOK_RELEASE")
     WEBHOOK_TESTING = os.getenv("WEBHOOK_TESTING")
 
     post_webhook(
         project_dir,
         APK_FILE,
-        APK_SERVER_RELEASE,
-        APK_SERVER_NIGHTLY,
+        DOWNLOAD_URL,
         WEBHOOK_RELEASE,
         WEBHOOK_TESTING,
     )

.github/workflows/_build.yml

@@ -0,0 +1,195 @@
+name: "[reusable] Szkolny.eu Build"
+
+on:
+  workflow_call:
+    inputs:
+      nightly:
+        type: boolean
+        default: false
+      build-apk:
+        type: boolean
+        default: false
+      build-aab:
+        type: boolean
+        default: false
+
+      release-ssh:
+        type: boolean
+        default: false
+      release-github:
+        type: boolean
+        default: false
+      release-firebase:
+        type: boolean
+        default: false
+      release-google-play:
+        type: boolean
+        default: false
+      release-discord:
+        type: boolean
+        default: false
+    secrets:
+      APK_SERVER_NIGHTLY:
+      APK_SERVER_RELEASE:
+      DB_HOST:
+      DB_NAME:
+      DB_PASS:
+      DB_USER:
+      FIREBASE_APP_ID:
+      FIREBASE_GROUPS_NIGHTLY:
+      FIREBASE_GROUPS_RELEASE:
+      FIREBASE_SERVICE_ACCOUNT_JSON:
+      KEY_ALIAS_PASSWORD:
+      KEY_ALIAS:
+      KEY_STORE_PASSWORD:
+      KEY_STORE:
+      PLAY_RELEASE_TRACK:
+      PLAY_SERVICE_ACCOUNT_JSON:
+      SSH_IP:
+      SSH_KEY:
+      SSH_PATH_NIGHTLY:
+      SSH_PATH_RELEASE:
+      SSH_USERNAME:
+      WEBHOOK_RELEASE:
+      WEBHOOK_TESTING:
+
+permissions:
+  contents: write
+
+jobs:
+  build:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout repository
+        uses: actions/checkout@v3
+        with:
+          fetch-depth: 0
+          clean: false
+      - name: Setup JDK 17
+        uses: actions/setup-java@v3
+        with:
+          distribution: "temurin"
+          java-version: "17"
+      - name: Setup Python
+        uses: actions/setup-python@v4
+      - name: Install Python packages
+        uses: BSFishy/pip-action@v1
+        with:
+          packages: |
+            python-dotenv
+            pycryptodome
+            mysql-connector-python
+            requests
+      - name: Setup Gradle
+        uses: gradle/actions/setup-gradle@v3
+
+      - name: Bump nightly version
+        if: ${{ inputs.nightly }}
+        run: python $GITHUB_WORKSPACE/.github/utils/bump_nightly.py $GITHUB_WORKSPACE >> $GITHUB_OUTPUT
+      - name: Write signing passwords and keystore
+        env:
+          DB_HOST: ${{ secrets.DB_HOST }}
+          DB_USER: ${{ secrets.DB_USER }}
+          DB_PASS: ${{ secrets.DB_PASS }}
+          DB_NAME: ${{ secrets.DB_NAME }}
+          KEY_STORE: ${{ secrets.KEY_STORE }}
+        run: |
+          python $GITHUB_WORKSPACE/.github/utils/sign.py $GITHUB_WORKSPACE commit >> $GITHUB_OUTPUT
+          echo $KEY_STORE | base64 --decode > keystore.jks
+      - name: Clean build artifacts
+        run: |
+          rm -rf app/release/*
+          rm -rf app/build/outputs/apk/*
+          rm -rf app/build/outputs/bundle/*
+
+      - name: Build app with Gradle
+        if: ${{ inputs.build-apk || inputs.build-aab }}
+        run: |
+          chmod +x ./gradlew
+          ./gradlew \
+            ${{ inputs.build-apk && 'assembleOfficialRelease' || '' }} \
+            ${{ inputs.build-aab && 'bundlePlayRelease' || '' }} \
+            -P android.injected.signing.store.file=${{ github.workspace }}/keystore.jks \
+            -P android.injected.signing.store.password=${{ secrets.KEY_STORE_PASSWORD }} \
+            -P android.injected.signing.key.alias=${{ secrets.KEY_ALIAS }} \
+            -P android.injected.signing.key.password=${{ secrets.KEY_ALIAS_PASSWORD }}
+
+      - name: Upload release to server
+        if: ${{ inputs.release-ssh }}
+        uses: easingthemes/ssh-deploy@v2.1.6
+        env:
+          REMOTE_HOST: ${{ secrets.SSH_IP }}
+          REMOTE_USER: ${{ secrets.SSH_USERNAME }}
+          SSH_PRIVATE_KEY: ${{ secrets.SSH_KEY }}
+          SOURCE: app/release/
+          TARGET: ${{ inputs.nightly && secrets.SSH_PATH_NIGHTLY || secrets.SSH_PATH_RELEASE }}
+
+      - name: Find signed artifacts
+        id: artifacts
+        run: python $GITHUB_WORKSPACE/.github/utils/find_artifacts.py $GITHUB_WORKSPACE >> $GITHUB_OUTPUT
+      - name: Extract release changelogs
+        id: changelog
+        run: python $GITHUB_WORKSPACE/.github/utils/extract_changelogs.py $GITHUB_WORKSPACE >> $GITHUB_OUTPUT
+      - name: Save version to database
+        id: save
+        env:
+          DB_HOST: ${{ secrets.DB_HOST }}
+          DB_USER: ${{ secrets.DB_USER }}
+          DB_PASS: ${{ secrets.DB_PASS }}
+          DB_NAME: ${{ secrets.DB_NAME }}
+          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
+          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
+        run: python $GITHUB_WORKSPACE/.github/utils/save_version.py $GITHUB_WORKSPACE >> $GITHUB_OUTPUT
+
+      - name: Release on GitHub
+        if: ${{ inputs.release-github }}
+        uses: softprops/action-gh-release@v1
+        with:
+          name: ${{ steps.changelog.outputs.changelogTitle }}
+          body_path: ${{ steps.changelog.outputs.changelogMarkdownFile }}
+          files: ${{ steps.artifacts.outputs.signedReleaseFile }}
+        env:
+          GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+
+      - name: Distribute to App Distribution
+        if: ${{ inputs.release-firebase }}
+        uses: wzieba/Firebase-Distribution-Github-Action@v1
+        with:
+          appId: ${{ secrets.FIREBASE_APP_ID }}
+          serviceCredentialsFileContent: ${{ secrets.FIREBASE_SERVICE_ACCOUNT_JSON }}
+          file: ${{ steps.artifacts.outputs.signedReleaseFile }}
+          groups: ${{ inputs.nightly && secrets.FIREBASE_GROUPS_NIGHTLY || secrets.FIREBASE_GROUPS_RELEASE }}
+          releaseNotesFile: ${{ inputs.nightly && steps.changelog.outputs.commitLogPlainFile || steps.changelog.outputs.changelogPlainTitledFile }}
+
+      - name: Publish AAB to Google Play
+        if: ${{ inputs.release-google-play }}
+        uses: r0adkll/upload-google-play@v1
+        with:
+          serviceAccountJsonPlainText: ${{ secrets.PLAY_SERVICE_ACCOUNT_JSON }}
+          packageName: pl.szczodrzynski.edziennik
+          releaseFiles: ${{ steps.artifacts.outputs.signedReleaseFile }}
+          releaseName: ${{ steps.changelog.outputs.appVersionName }}
+          track: ${{ secrets.PLAY_RELEASE_TRACK }}
+          whatsNewDirectory: ${{ steps.changelog.outputs.changelogDir }}
+          status: completed
+
+      - name: Post Discord webhook
+        if: ${{ inputs.release-discord }}
+        env:
+          APK_FILE: ${{ steps.artifacts.outputs.signedReleaseFile }}
+          DOWNLOAD_URL: ${{ steps.save.outputs.downloadUrl }}
+          WEBHOOK_RELEASE: ${{ secrets.WEBHOOK_RELEASE }}
+          WEBHOOK_TESTING: ${{ secrets.WEBHOOK_TESTING }}
+        run: python $GITHUB_WORKSPACE/.github/utils/webhook_discord.py $GITHUB_WORKSPACE >> $GITHUB_OUTPUT
+
+      - name: Upload workflow artifact
+        uses: actions/upload-artifact@v4
+        if: always()
+        with:
+          name: ${{ steps.changelog.outputs.appVersionName }}
+          path: |
+            app/release/whatsnew*/
+            app/release/*.apk
+            app/release/*.aab
+            app/release/*.json
+            app/release/*.txt

.github/workflows/build-nightly-apk.yml

@@ -1,154 +0,0 @@
-name: Nightly build
-
-on:
-  schedule:
-    # 23:30 UTC, 0:30 or 1:30 CET/CEST
-    - cron: "30 23 * * *"
-  workflow_dispatch:
-
-jobs:
-  prepare:
-    name: Prepare build environment
-    runs-on: self-hosted
-    outputs:
-      hasNewChanges: ${{ steps.nightly.outputs.hasNewChanges }}
-    steps:
-      - name: Checkout repository
-        uses: actions/checkout@v2
-        with:
-          fetch-depth: 0
-          clean: false
-      - name: Set executable permissions to gradlew
-        run: chmod +x ./gradlew
-      - name: Setup Python
-        uses: actions/setup-python@v2
-      - name: Install packages
-        uses: BSFishy/pip-action@v1
-        with:
-          packages: |
-            python-dotenv
-            pycryptodome
-            mysql-connector-python
-            requests
-      - name: Bump nightly version
-        id: nightly
-        run: python $GITHUB_WORKSPACE/.github/utils/bump_nightly.py $GITHUB_WORKSPACE
-      - name: Write signing passwords
-        if: steps.nightly.outputs.hasNewChanges
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-        run: python $GITHUB_WORKSPACE/.github/utils/sign.py $GITHUB_WORKSPACE commit
-  build:
-    name: Build APK
-    runs-on: self-hosted
-    needs:
-      - prepare
-    if: ${{ needs.prepare.outputs.hasNewChanges == 'true' }}
-    outputs:
-      androidHome: ${{ env.ANDROID_HOME }}
-      androidSdkRoot: ${{ env.ANDROID_SDK_ROOT }}
-    steps:
-      - name: Setup JDK 11
-        uses: actions/setup-java@v2
-        with:
-          distribution: 'temurin'
-          java-version: '11'
-      - name: Setup Android SDK
-        uses: android-actions/setup-android@v2
-      - name: Clean build artifacts
-        run: |
-          rm -rf app/release/*
-          rm -rf app/build/outputs/apk/*
-          rm -rf app/build/outputs/bundle/*
-      - name: Assemble official release with Gradle
-        uses: gradle/gradle-build-action@v2
-        with:
-          arguments: assembleOfficialRelease
-  sign:
-    name: Sign APK
-    runs-on: self-hosted
-    needs:
-      - build
-    outputs:
-      signedReleaseFile: ${{ steps.artifacts.outputs.signedReleaseFile }}
-      signedReleaseFileRelative: ${{ steps.artifacts.outputs.signedReleaseFileRelative }}
-    steps:
-      - name: Sign build artifacts
-        id: sign_app
-        uses: r0adkll/sign-android-release@v1
-        with:
-          releaseDirectory: app/release
-          signingKeyBase64: ${{ secrets.KEY_STORE }}
-          alias: ${{ secrets.KEY_ALIAS }}
-          keyStorePassword: ${{ secrets.KEY_STORE_PASSWORD }}
-          keyPassword: ${{ secrets.KEY_ALIAS_PASSWORD }}
-        env:
-          ANDROID_HOME: ${{ needs.build.outputs.androidHome }}
-          ANDROID_SDK_ROOT: ${{ needs.build.outputs.androidSdkRoot }}
-          BUILD_TOOLS_VERSION: "30.0.2"
-      - name: Rename signed artifacts
-        id: artifacts
-        run: python $GITHUB_WORKSPACE/.github/utils/rename_artifacts.py $GITHUB_WORKSPACE
-  publish:
-    name: Publish APK
-    runs-on: self-hosted
-    needs:
-      - sign
-    steps:
-      - name: Setup Python
-        uses: actions/setup-python@v2
-
-      - name: Extract changelogs
-        id: changelog
-        run: python $GITHUB_WORKSPACE/.github/utils/extract_changelogs.py $GITHUB_WORKSPACE
-
-      - name: Upload APK to SFTP
-        uses: easingthemes/ssh-deploy@v2.1.6
-        env:
-          REMOTE_HOST: ${{ secrets.SSH_IP }}
-          REMOTE_USER: ${{ secrets.SSH_USERNAME }}
-          SSH_PRIVATE_KEY: ${{ secrets.SSH_KEY }}
-          SOURCE: ${{ needs.sign.outputs.signedReleaseFileRelative }}
-          TARGET: ${{ secrets.SSH_PATH_NIGHTLY }}
-      - name: Save version metadata
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
-          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
-        run: python $GITHUB_WORKSPACE/.github/utils/save_version.py $GITHUB_WORKSPACE
-
-      - name: Distribute to App Distribution
-        uses: wzieba/Firebase-Distribution-Github-Action@v1
-        with:
-          appId: ${{ secrets.FIREBASE_APP_ID }}
-          token: ${{ secrets.FIREBASE_TOKEN }}
-          groups: ${{ secrets.FIREBASE_GROUPS_NIGHTLY }}
-          file: ${{ needs.sign.outputs.signedReleaseFile }}
-          releaseNotesFile: ${{ steps.changelog.outputs.commitLogPlainFile }}
-
-      - name: Post Discord webhook
-        env:
-          APK_FILE: ${{ needs.sign.outputs.signedReleaseFile }}
-          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
-          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
-          WEBHOOK_RELEASE: ${{ secrets.WEBHOOK_RELEASE }}
-          WEBHOOK_TESTING: ${{ secrets.WEBHOOK_TESTING }}
-        run: python $GITHUB_WORKSPACE/.github/utils/webhook_discord.py $GITHUB_WORKSPACE
-
-      - name: Upload workflow artifact
-        uses: actions/upload-artifact@v2
-        if: true
-        with:
-          name: ${{ steps.changelog.outputs.appVersionName }}
-          path: |
-            app/release/whatsnew*/
-            app/release/*.apk
-            app/release/*.aab
-            app/release/*.json
-            app/release/*.txt

.github/workflows/build-release-aab-play.yml

@@ -1,131 +0,0 @@
-name: Release build - Google Play [AAB]
-
-on:
-  push:
-    branches:
-      - "master"
-
-jobs:
-  prepare:
-    name: Prepare build environment
-    runs-on: self-hosted
-    steps:
-      - name: Checkout repository
-        uses: actions/checkout@v2
-        with:
-          fetch-depth: 0
-          clean: false
-      - name: Set executable permissions to gradlew
-        run: chmod +x ./gradlew
-      - name: Setup Python
-        uses: actions/setup-python@v2
-      - name: Install packages
-        uses: BSFishy/pip-action@v1
-        with:
-          packages: |
-            python-dotenv
-            pycryptodome
-            mysql-connector-python
-            requests
-      - name: Write signing passwords
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-        run: python $GITHUB_WORKSPACE/.github/utils/sign.py $GITHUB_WORKSPACE commit
-  build:
-    name: Build App Bundle
-    runs-on: self-hosted
-    needs:
-      - prepare
-    outputs:
-      androidHome: ${{ env.ANDROID_HOME }}
-      androidSdkRoot: ${{ env.ANDROID_SDK_ROOT }}
-    steps:
-      - name: Setup JDK 11
-        uses: actions/setup-java@v2
-        with:
-          distribution: 'temurin'
-          java-version: '11'
-      - name: Setup Android SDK
-        uses: android-actions/setup-android@v2
-      - name: Clean build artifacts
-        run: |
-          rm -rf app/release/*
-          rm -rf app/build/outputs/apk/*
-          rm -rf app/build/outputs/bundle/*
-      - name: Bundle play release with Gradle
-        uses: gradle/gradle-build-action@v2
-        with:
-          arguments: bundlePlayRelease
-  sign:
-    name: Sign App Bundle
-    runs-on: self-hosted
-    needs:
-      - build
-    outputs:
-      signedReleaseFile: ${{ steps.artifacts.outputs.signedReleaseFile }}
-      signedReleaseFileRelative: ${{ steps.artifacts.outputs.signedReleaseFileRelative }}
-    steps:
-      - name: Sign build artifacts
-        id: sign_app
-        uses: r0adkll/sign-android-release@v1
-        with:
-          releaseDirectory: app/release
-          signingKeyBase64: ${{ secrets.KEY_STORE }}
-          alias: ${{ secrets.KEY_ALIAS }}
-          keyStorePassword: ${{ secrets.KEY_STORE_PASSWORD }}
-          keyPassword: ${{ secrets.KEY_ALIAS_PASSWORD }}
-        env:
-          ANDROID_HOME: ${{ needs.build.outputs.androidHome }}
-          ANDROID_SDK_ROOT: ${{ needs.build.outputs.androidSdkRoot }}
-          BUILD_TOOLS_VERSION: "30.0.2"
-      - name: Rename signed artifacts
-        id: artifacts
-        run: python $GITHUB_WORKSPACE/.github/utils/rename_artifacts.py $GITHUB_WORKSPACE
-  publish:
-    name: Publish App Bundle
-    runs-on: self-hosted
-    needs:
-      - sign
-    steps:
-      - name: Setup Python
-        uses: actions/setup-python@v2
-
-      - name: Extract changelogs
-        id: changelog
-        run: python $GITHUB_WORKSPACE/.github/utils/extract_changelogs.py $GITHUB_WORKSPACE
-
-      - name: Save version metadata
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
-          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
-        run: python $GITHUB_WORKSPACE/.github/utils/save_version.py $GITHUB_WORKSPACE
-
-      - name: Publish AAB to Google Play
-        uses: r0adkll/upload-google-play@v1
-        if: ${{ endsWith(needs.sign.outputs.signedReleaseFile, '.aab') }}
-        with:
-          serviceAccountJsonPlainText: ${{ secrets.PLAY_SERVICE_ACCOUNT_JSON }}
-          packageName: pl.szczodrzynski.edziennik
-          releaseFile: ${{ needs.sign.outputs.signedReleaseFile }}
-          releaseName: ${{ steps.changelog.outputs.appVersionName }}
-          track: ${{ secrets.PLAY_RELEASE_TRACK }}
-          whatsNewDirectory: ${{ steps.changelog.outputs.changelogDir }}
-
-      - name: Upload workflow artifact
-        uses: actions/upload-artifact@v2
-        if: always()
-        with:
-          name: ${{ steps.changelog.outputs.appVersionName }}
-          path: |
-            app/release/whatsnew*/
-            app/release/*.apk
-            app/release/*.aab
-            app/release/*.json
-            app/release/*.txt

.github/workflows/build-release-apk.yml

@@ -1,154 +0,0 @@
-name: Release build - official
-
-on:
-  push:
-    tags:
-      - "*"
-
-jobs:
-  prepare:
-    name: Prepare build environment
-    runs-on: self-hosted
-    steps:
-      - name: Checkout repository
-        uses: actions/checkout@v2
-        with:
-          fetch-depth: 0
-          clean: false
-      - name: Set executable permissions to gradlew
-        run: chmod +x ./gradlew
-      - name: Setup Python
-        uses: actions/setup-python@v2
-      - name: Install packages
-        uses: BSFishy/pip-action@v1
-        with:
-          packages: |
-            python-dotenv
-            pycryptodome
-            mysql-connector-python
-            requests
-      - name: Write signing passwords
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-        run: python $GITHUB_WORKSPACE/.github/utils/sign.py $GITHUB_WORKSPACE commit
-  build:
-    name: Build APK
-    runs-on: self-hosted
-    needs:
-      - prepare
-    outputs:
-      androidHome: ${{ env.ANDROID_HOME }}
-      androidSdkRoot: ${{ env.ANDROID_SDK_ROOT }}
-    steps:
-      - name: Setup JDK 11
-        uses: actions/setup-java@v2
-        with:
-          distribution: 'temurin'
-          java-version: '11'
-      - name: Setup Android SDK
-        uses: android-actions/setup-android@v2
-      - name: Clean build artifacts
-        run: |
-          rm -rf app/release/*
-          rm -rf app/build/outputs/apk/*
-          rm -rf app/build/outputs/bundle/*
-      - name: Assemble official release with Gradle
-        uses: gradle/gradle-build-action@v2
-        with:
-          arguments: assembleOfficialRelease
-  sign:
-    name: Sign APK
-    runs-on: self-hosted
-    needs:
-      - build
-    outputs:
-      signedReleaseFile: ${{ steps.artifacts.outputs.signedReleaseFile }}
-      signedReleaseFileRelative: ${{ steps.artifacts.outputs.signedReleaseFileRelative }}
-    steps:
-      - name: Sign build artifacts
-        id: sign_app
-        uses: r0adkll/sign-android-release@v1
-        with:
-          releaseDirectory: app/release
-          signingKeyBase64: ${{ secrets.KEY_STORE }}
-          alias: ${{ secrets.KEY_ALIAS }}
-          keyStorePassword: ${{ secrets.KEY_STORE_PASSWORD }}
-          keyPassword: ${{ secrets.KEY_ALIAS_PASSWORD }}
-        env:
-          ANDROID_HOME: ${{ needs.build.outputs.androidHome }}
-          ANDROID_SDK_ROOT: ${{ needs.build.outputs.androidSdkRoot }}
-          BUILD_TOOLS_VERSION: "30.0.2"
-      - name: Rename signed artifacts
-        id: artifacts
-        run: python $GITHUB_WORKSPACE/.github/utils/rename_artifacts.py $GITHUB_WORKSPACE
-  publish:
-    name: Publish APK
-    runs-on: self-hosted
-    needs:
-      - sign
-    steps:
-      - name: Setup Python
-        uses: actions/setup-python@v2
-
-      - name: Extract changelogs
-        id: changelog
-        run: python $GITHUB_WORKSPACE/.github/utils/extract_changelogs.py $GITHUB_WORKSPACE
-
-      - name: Upload APK to SFTP
-        uses: easingthemes/ssh-deploy@v2.1.6
-        env:
-          REMOTE_HOST: ${{ secrets.SSH_IP }}
-          REMOTE_USER: ${{ secrets.SSH_USERNAME }}
-          SSH_PRIVATE_KEY: ${{ secrets.SSH_KEY }}
-          SOURCE: ${{ needs.sign.outputs.signedReleaseFileRelative }}
-          TARGET: ${{ secrets.SSH_PATH_RELEASE }}
-      - name: Save version metadata
-        env:
-          DB_HOST: ${{ secrets.DB_HOST }}
-          DB_USER: ${{ secrets.DB_USER }}
-          DB_PASS: ${{ secrets.DB_PASS }}
-          DB_NAME: ${{ secrets.DB_NAME }}
-          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
-          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
-        run: python $GITHUB_WORKSPACE/.github/utils/save_version.py $GITHUB_WORKSPACE
-
-      - name: Distribute to App Distribution
-        uses: wzieba/Firebase-Distribution-Github-Action@v1
-        with:
-          appId: ${{ secrets.FIREBASE_APP_ID }}
-          token: ${{ secrets.FIREBASE_TOKEN }}
-          groups: ${{ secrets.FIREBASE_GROUPS_RELEASE }}
-          file: ${{ needs.sign.outputs.signedReleaseFile }}
-          releaseNotesFile: ${{ steps.changelog.outputs.changelogPlainTitledFile }}
-      - name: Release on GitHub
-        uses: softprops/action-gh-release@v1
-        with:
-          name: ${{ steps.changelog.outputs.changelogTitle }}
-          body_path: ${{ steps.changelog.outputs.changelogMarkdownFile }}
-          files: ${{ needs.sign.outputs.signedReleaseFile }}
-        env:
-          GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
-
-      - name: Post Discord webhook
-        env:
-          APK_FILE: ${{ needs.sign.outputs.signedReleaseFile }}
-          APK_SERVER_RELEASE: ${{ secrets.APK_SERVER_RELEASE }}
-          APK_SERVER_NIGHTLY: ${{ secrets.APK_SERVER_NIGHTLY }}
-          WEBHOOK_RELEASE: ${{ secrets.WEBHOOK_RELEASE }}
-          WEBHOOK_TESTING: ${{ secrets.WEBHOOK_TESTING }}
-        run: python $GITHUB_WORKSPACE/.github/utils/webhook_discord.py $GITHUB_WORKSPACE
-
-      - name: Upload workflow artifact
-        uses: actions/upload-artifact@v2
-        if: true
-        with:
-          name: ${{ steps.changelog.outputs.appVersionName }}
-          path: |
-            app/release/whatsnew*/
-            app/release/*.apk
-            app/release/*.aab
-            app/release/*.json
-            app/release/*.txt

.github/workflows/push-master.yml

@@ -0,0 +1,13 @@
+name: Push (master)
+on:
+  push:
+    branches: ["master"]
+jobs:
+  build:
+    name: Build for Google Play (AAB)
+    uses: szkolny-eu/szkolny-android/.github/workflows/_build.yml@develop
+    with:
+      build-aab: true
+      release-ssh: true
+      release-google-play: true
+    secrets: inherit

.github/workflows/release.yml

@@ -0,0 +1,15 @@
+name: Release
+on:
+  push:
+    tags: ["v*.*"]
+jobs:
+  build:
+    name: Build release (APK)
+    uses: szkolny-eu/szkolny-android/.github/workflows/_build.yml@develop
+    with:
+      build-apk: true
+      release-ssh: true
+      release-github: true
+      release-firebase: true
+      release-discord: true
+    secrets: inherit

.github/workflows/schedule-dispatch.yml

@@ -0,0 +1,42 @@
+name: Schedule/dispatch
+on:
+  schedule:
+    # 23:30 UTC, 0:30 or 1:30 CET/CEST
+    - cron: "30 23 * * *"
+  workflow_dispatch:
+jobs:
+  check:
+    name: Check new changes
+    runs-on: ubuntu-latest
+    outputs:
+      hasNewChanges: ${{ steps.nightly.outputs.hasNewChanges }}
+    steps:
+      - name: Checkout repository
+        uses: actions/checkout@v3
+        with:
+          fetch-depth: 0
+          clean: false
+      - name: Setup Python
+        uses: actions/setup-python@v4
+      - name: Install packages
+        uses: BSFishy/pip-action@v1
+        with:
+          packages: |
+            requests
+      - name: Check new changes
+        id: nightly
+        run: python $GITHUB_WORKSPACE/.github/utils/check_nightly.py $GITHUB_WORKSPACE >> $GITHUB_OUTPUT
+
+  build:
+    name: Build nightly release (APK)
+    needs:
+      - check
+    if: ${{ needs.check.outputs.hasNewChanges == 'true' }}
+    uses: szkolny-eu/szkolny-android/.github/workflows/_build.yml@develop
+    with:
+      nightly: true
+      build-apk: true
+      release-ssh: true
+      release-firebase: true
+      release-discord: true
+    secrets: inherit

app/build.gradle

@@ -104,7 +104,6 @@ android {
     externalNativeBuild {
         cmake {
             path "src/main/cpp/CMakeLists.txt"
-            version "3.10.2"
         }
     }
     lint {
@@ -113,8 +112,9 @@ android {
 }
 
 tasks.whenTaskAdded { task ->
-    if (!task.name.endsWith("Release") && !task.name.endsWith("ReleaseWithR8"))
+    if (!(task.name == "assembleUnofficialRelease" || task.name == "assembleOfficialRelease" || task.name == "signPlayReleaseBundle"))
         return
+
     def renameTaskName = "rename${task.name.capitalize()}"
 
     def flavor = ""
@@ -124,17 +124,22 @@ tasks.whenTaskAdded { task ->
         flavor = task.name.substring("assemble".length(), task.name.indexOf("Release")).uncapitalize()
     if (task.name.startsWith("minify"))
         flavor = task.name.substring("minify".length(), task.name.indexOf("Release")).uncapitalize()
+    if (task.name.startsWith("sign"))
+        flavor = task.name.substring("sign".length(), task.name.indexOf("Release")).uncapitalize()
 
     if (flavor != "") {
-        tasks.create(renameTaskName, Copy) {
+        tasks.register(renameTaskName, Copy) {
+            dependsOn(task.name)
+            duplicatesStrategy DuplicatesStrategy.FAIL
             from file("${projectDir}/${flavor}/release/"),
-                    file("${buildDir}/outputs/mapping/${flavor}Release/"),
-                    file("${buildDir}/outputs/apk/${flavor}/release/"),
-                    file("${buildDir}/outputs/bundle/${flavor}Release/")
-            include "*.aab", "*.apk", "mapping.txt", "output-metadata.json"
+                    file("${projectDir}/build/outputs/apk/${flavor}/release/"),
+                    file("${projectDir}/build/outputs/mapping/${flavor}Release/"),
+                    file("${projectDir}/build/outputs/bundle/${flavor}Release/")
+            include "*-release.aab", "*-release.apk", "mapping.txt", "output-metadata.json"
             destinationDir file("${projectDir}/release/")
             rename ".+?\\.(.+)", "Edziennik_${android.defaultConfig.versionName}_${flavor}." + '$1'
         }
+
         task.finalizedBy(renameTaskName)
     }
 }
@@ -156,6 +161,7 @@ dependencies {
     implementation "androidx.navigation:navigation-fragment-ktx:2.5.2"
     implementation "androidx.recyclerview:recyclerview:1.2.1"
     implementation "androidx.room:room-runtime:2.4.3"
+    implementation "androidx.room:room-ktx:2.4.3"
     implementation "androidx.work:work-runtime-ktx:2.7.1"
     kapt "androidx.room:room-compiler:2.4.3"
 
@@ -208,7 +214,7 @@ dependencies {
     implementation "com.daimajia.swipelayout:library:1.2.0@aar"
     implementation "com.github.Applandeo:Material-Calendar-View:15de569cbc" // https://github.com/Applandeo/Material-Calendar-View
     implementation "com.github.CanHub:Android-Image-Cropper:2.2.2" // https://github.com/CanHub/Android-Image-Cropper
-    implementation "com.github.ChuckerTeam.Chucker:library:3.0.1" // https://github.com/ChuckerTeam/chucker
+    implementation "com.github.ChuckerTeam.Chucker:library:3.5.2" // https://github.com/ChuckerTeam/chucker
     implementation "com.github.antonKozyriatskyi:CircularProgressIndicator:1.2.2" // https://github.com/antonKozyriatskyi/CircularProgressIndicator
     implementation "com.github.bassaer:chatmessageview:2.0.1" // https://github.com/bassaer/ChatMessageView
     implementation "com.github.hypertrack:hyperlog-android:0.0.10" // https://github.com/hypertrack/hyperlog-android

app/src/main/AndroidManifest.xml

@@ -13,6 +13,7 @@
     <uses-permission android:name="android.permission.CAMERA" />
     <uses-permission android:name="android.permission.FOREGROUND_SERVICE" />
     <uses-permission android:name="android.permission.POST_NOTIFICATIONS"/>
+    <uses-permission android:name="android.permission.FOREGROUND_SERVICE_DATA_SYNC" />
     <!-- PowerPermission uses minSdk 21, it's safe to override as it is used only in >= 23 -->
     <uses-sdk tools:overrideLibrary="com.qifan.powerpermission.coroutines, com.qifan.powerpermission.core" />
 
@@ -84,7 +85,7 @@
                 android:resource="@xml/widget_timetable_info" />
         </receiver>
         <service android:name=".ui.widgets.timetable.WidgetTimetableService"
-            android:permission="android.permission.BIND_REMOTEVIEWS" />
+            android:permission="android.permission.BIND_REMOTEVIEWS" android:foregroundServiceType="dataSync" />
         <activity android:name=".ui.widgets.LessonDialogActivity"
             android:label=""
             android:configChanges="orientation|keyboardHidden"
@@ -105,7 +106,7 @@
                 android:resource="@xml/widget_notifications_info" />
         </receiver>
         <service android:name=".ui.widgets.notifications.WidgetNotificationsService"
-            android:permission="android.permission.BIND_REMOTEVIEWS" />
+            android:permission="android.permission.BIND_REMOTEVIEWS" android:foregroundServiceType="dataSync" />
         <!-- LUCKY NUMBER -->
         <receiver android:name=".ui.widgets.luckynumber.WidgetLuckyNumberProvider"
             android:label="@string/widget_lucky_number_title"
@@ -160,7 +161,11 @@
         <activity android:name=".ui.login.oauth.OAuthLoginActivity"
             android:configChanges="orientation|keyboardHidden"
             android:exported="false"
-            android:theme="@style/AppTheme.Light" />
+            android:theme="@style/Theme.MaterialComponents.Light.DarkActionBar" />
+        <activity android:name=".ui.login.recaptcha.RecaptchaActivity"
+            android:configChanges="orientation|keyboardHidden"
+            android:exported="false"
+            android:theme="@style/Theme.MaterialComponents.Light.DarkActionBar" />
         <activity android:name=".ui.base.BuildInvalidActivity" android:exported="false" />
         <activity android:name=".ui.settings.contributors.ContributorsActivity" android:exported="false" />
 
@@ -198,15 +203,15 @@
               ____) |  __/ |   \ V /| | (_|  __/\__ \
              |_____/ \___|_|    \_/ |_|\___\___||___/
         -->
-        <service android:name=".data.api.ApiService" />
+        <service android:name=".data.api.ApiService" android:foregroundServiceType="dataSync" />
         <service android:name=".data.firebase.MyFirebaseService"
-            android:exported="false">
+            android:exported="false" android:foregroundServiceType="dataSync">
             <intent-filter android:priority="10000000">
                 <action android:name="com.google.firebase.MESSAGING_EVENT" />
                 <action android:name="com.google.firebase.INSTANCE_ID_EVENT" />
             </intent-filter>
         </service>
-        <service android:name=".sync.UpdateDownloaderService" />
+        <service android:name=".sync.UpdateDownloaderService" android:foregroundServiceType="dataSync" />
 
         <!--
               _____                _     _

app/src/main/assets/pl-changelog.html

@@ -1,13 +1,14 @@
-<h3>Wersja 4.13-rc.2, 2022-10-22</h3>
+<h3>Wersja 4.14.2, 2025-02-25</h3>
 <ul>
-    <li>Poprawione powiadomienia na Androidzie 13. @santoni0</li>
-    <li>Możliwość dostosowania wyświetlania planu lekcji.</li>
-    <li>Opcja kolorowania bloków w planie lekcji.</li>
-    <li><b>USOS</b> - pierwsza wersja obsługi systemu. Osobne rodzaje wydarzeń (oraz wygląd niektórych części aplikacji) lepiej dostosowany do nauki na studiach.</li>
-    <li>Poprawione opcje filtrowania powiadomień i wyboru przycisków menu bocznego.</li>
-    <li>Ulepszony system pobierania aktualizacji aplikacji.</li>
+    <li>USOS: <b>dodano obsługę ocen</b>.</li>
+    <li>USOS: obliczanie średniej za studia oraz punktów ECTS.</li>
+    <li>USOS: poprawiono brak planu zajęć po rozpoczęciu roku.</li>
+    <li>Wyłączono archiwizator profili.</li>
+    <li>Naprawiono zatrzymanie aplikacji na Androidzie 14.</li>
+    <li>Udostępniono opcję wyłączania śniegu również w lutym.</li>
+    <li>Poprawiono błędy synchronizacji. @KrystianQur</li>
 </ul>
 <br>
 <br>
 Dzięki za korzystanie ze Szkolnego!<br>
-<i>&copy; [Kuba Szczodrzyński](@kuba2k2), [Kacper Ziubryniewicz](@kapi2289) 2022</i>
+<i>&copy; [Kuba Szczodrzyński](@kuba2k2) 2025</i>

app/src/main/cpp/CMakeLists.txt

@@ -5,6 +5,8 @@
 
 cmake_minimum_required(VERSION 3.4.1)
 
+project(szkolny-signing)
+
 # Creates and names a library, sets it as either STATIC
 # or SHARED, and provides the relative paths to its source code.
 # You can define multiple libraries, and CMake builds them for you.
@@ -41,4 +43,4 @@ target_link_libraries( # Specifies the target library.
 
                        # Links the target library to the log library
                        # included in the NDK.
-                       ${log-lib} )
+                       ${log-lib} )

app/src/main/cpp/szkolny-signing.cpp

@@ -9,7 +9,7 @@
 
 /*secret password - removed for source code publication*/
 static toys AES_IV[16] = {
-	0x54, 0xe7, 0x2a, 0xdd, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff  };
+	0x3e, 0x4b, 0xe4, 0xc4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff  };
 
 unsigned char *agony(unsigned int laugh, unsigned char *box, unsigned char *heat);
 

app/src/main/java/pl/szczodrzynski/edziennik/App.kt

@@ -235,11 +235,20 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         }
 
         Signing.getCert(this)
+        Utils.initializeStorageDir(this)
 
         launch {
             withContext(Dispatchers.Default) {
                 config.migrate(this@App)
 
+                if (config.appVersionCore < BuildConfig.VERSION_CODE) {
+                    // force syncing all endpoints on update
+                    db.endpointTimerDao().clear()
+                    config.sync.lastAppSync = 0L
+                    config.hash = "invalid"
+                    config.appVersionCore = BuildConfig.VERSION_CODE
+                }
+
                 SSLProviderInstaller.install(applicationContext, this@App::buildHttp)
 
                 if (config.devModePassword != null)
@@ -422,6 +431,12 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         try {
             App.data = AppData.get(profile.loginStoreType)
             d("App", "Loaded AppData: ${App.data}")
+            // apply newly-added config overrides, if not changed by the user yet
+            for ((key, value) in App.data.configOverrides) {
+                val config = App.profile.config
+                if (!config.has(key))
+                    config.set(key, value)
+            }
         } catch (e: Exception) {
             Log.e("App", "Cannot load AppData", e)
             Toast.makeText(this, R.string.app_cannot_load_data, Toast.LENGTH_LONG).show()
@@ -462,6 +477,8 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
     }
     fun profileSave() = profileSave(profile)
     fun profileSave(profile: Profile) {
+        if (profile.id == profileId)
+            App.profile = profile
         launch(Dispatchers.Default) {
             App.db.profileDao().add(profile)
         }

app/src/main/java/pl/szczodrzynski/edziennik/MainActivity.kt

@@ -15,6 +15,8 @@ import android.view.Gravity
 import android.view.View
 import android.widget.Toast
 import androidx.appcompat.app.AppCompatActivity
+import androidx.core.app.ActivityCompat
+import androidx.core.content.ContextCompat
 import androidx.core.graphics.ColorUtils
 import androidx.core.view.isVisible
 import androidx.navigation.NavOptions
@@ -322,7 +324,7 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
 
         // IT'S WINTER MY DUDES
         val today = Date.getToday()
-        if ((today.month % 11 == 1) && app.config.ui.snowfall) {
+        if ((today.month / 3 % 4 == 0) && app.config.ui.snowfall) {
             b.rootFrame.addView(layoutInflater.inflate(R.layout.snowfall, b.rootFrame, false))
         } else if (app.config.ui.eggfall && BigNightUtil().isDataWielkanocyNearDzisiaj()) {
             val eggfall = layoutInflater.inflate(
@@ -829,7 +831,12 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
         d(TAG, "Activity resumed")
         val filter = IntentFilter()
         filter.addAction(Intent.ACTION_MAIN)
-        registerReceiver(intentReceiver, filter)
+        ActivityCompat.registerReceiver(
+            this,
+            intentReceiver,
+            filter,
+            ContextCompat.RECEIVER_EXPORTED,
+        )
         EventBus.getDefault().register(this)
         super.onResume()
     }

app/src/main/java/pl/szczodrzynski/edziennik/config/AppData.kt

@@ -59,10 +59,11 @@ data class AppData(
         val lessonHeight: Int,
         val enableMarkAsReadAnnouncements: Boolean,
         val enableNoticePoints: Boolean,
+        val eventManualShowSubjectDropdown: Boolean,
     )
 
     data class EventType(
-        val id: Int,
+        val id: Long,
         val color: String,
         val name: String,
     )

app/src/main/java/pl/szczodrzynski/edziennik/config/BaseConfig.kt

@@ -14,6 +14,7 @@ import pl.szczodrzynski.edziennik.ext.takePositive
 import kotlin.coroutines.CoroutineContext
 
 abstract class BaseConfig(
+    @Transient
     val db: AppDb,
     val profileId: Int? = null,
     protected var entries: List<ConfigEntry>? = null,
@@ -42,4 +43,6 @@ abstract class BaseConfig(
             db.configDao().add(ConfigEntry(profileId ?: -1, key, value))
         }
     }
+
+    fun has(key: String) = values.containsKey(key)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/Config.kt

@@ -33,7 +33,7 @@ class Config(db: AppDb) : BaseConfig(db) {
     var update by config<Update?>(null)
     var updatesChannel by config<String>("release")
 
-    var devMode by config<Boolean?>(null)
+    var devMode by config<Boolean?>("debugMode", null)
     var devModePassword by config<String?>(null)
     var enableChucker by config<Boolean?>(null)
 
@@ -43,6 +43,7 @@ class Config(db: AppDb) : BaseConfig(db) {
     var appInstalledTime by config<Long>(0L)
     var appRateSnackbarTime by config<Long>(0L)
     var appVersion by config<Int>(BuildConfig.VERSION_CODE)
+    var appVersionCore by config<Int>(0)
     var validation by config<String?>(null, "buildValidation")
 
     var archiverEnabled by config<Boolean>(true)
@@ -55,11 +56,9 @@ class Config(db: AppDb) : BaseConfig(db) {
             ConfigMigration(app, this)
     }
 
-    fun getFor(profileId: Int): ProfileConfig {
+    operator fun get(profileId: Int): ProfileConfig {
         return profileConfigs[profileId] ?: ProfileConfig(db, profileId, entries).also {
             profileConfigs[profileId] = it
         }
     }
-
-    fun forProfile() = getFor(App.profileId)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/DelegateConfig.kt

@@ -115,9 +115,9 @@ class ConfigDelegate<T>(
             is Boolean -> value
             // enums, maps & collections
             is Enum<*> -> value.toInt()
-            is Collection<*> -> JsonArray(value.map {
+            is Collection<*> -> value.map {
                 if (it is Number || it is Boolean) it else serialize(it, serializeObjects = false)
-            })
+            }.toJsonElement()
             is Map<*, *> -> gson.toJson(value.mapValues { (_, it) ->
                 if (it is Number || it is Boolean) it else serialize(it, serializeObjects = false)
             })

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfig.kt

@@ -15,7 +15,7 @@ class ProfileConfig(
     entries: List<ConfigEntry>?,
 ) : BaseConfig(db, profileId, entries) {
     companion object {
-        const val DATA_VERSION = 4
+        const val DATA_VERSION = 5
     }
 
     val grades by lazy { ProfileConfigGrades(this) }
@@ -29,6 +29,8 @@ class ProfileConfig(
     var dataVersion by config<Int>(DATA_VERSION)
     var hash by config<String>("")
 
+    var shareByDefault by config<Boolean>(false)
+
     init {
         if (dataVersion < DATA_VERSION)
             ProfileConfigMigration(this)

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfigGrades.kt

@@ -4,6 +4,7 @@
 
 package pl.szczodrzynski.edziennik.config
 
+import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.UNIVERSITY_AVERAGE_MODE_ECTS
 import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.COLOR_MODE_WEIGHTED
 import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.YEAR_ALL_GRADES
 
@@ -15,8 +16,11 @@ class ProfileConfigGrades(base: ProfileConfig) {
     var dontCountEnabled by base.config<Boolean>(false)
     var dontCountGrades by base.config<List<String>> { listOf() }
     var hideImproved by base.config<Boolean>(false)
+    var hideNoGrade by base.config<Boolean>(false)
     var hideSticksFromOld by base.config<Boolean>(false)
     var minusValue by base.config<Float?>(null)
     var plusValue by base.config<Float?>(null)
     var yearAverageMode by base.config<Int>(YEAR_ALL_GRADES)
+    var universityAverageMode by base.config<Int>(UNIVERSITY_AVERAGE_MODE_ECTS)
+    var countEctsInProgress by base.config<Boolean>(false)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfigUI.kt

@@ -15,6 +15,7 @@ class ProfileConfigUI(base: ProfileConfig) {
     var agendaGroupByType by base.config<Boolean>(false)
     var agendaLessonChanges by base.config<Boolean>(true)
     var agendaTeacherAbsence by base.config<Boolean>(true)
+    var agendaSubjectImportant by base.config<Boolean>(false)
     var agendaElearningMark by base.config<Boolean>(false)
     var agendaElearningGroup by base.config<Boolean>(true)
 

app/src/main/java/pl/szczodrzynski/edziennik/config/utils/ProfileConfigMigration.kt

@@ -16,6 +16,8 @@ import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.YEAR_AL
 class ProfileConfigMigration(config: ProfileConfig) {
     init { config.apply {
 
+        val profile = db.profileDao().getByIdNow(profileId ?: -1)
+
         if (dataVersion < 2) {
             sync.notificationFilter = sync.notificationFilter + NotificationType.TEACHER_ABSENCE
 
@@ -37,11 +39,23 @@ class ProfileConfigMigration(config: ProfileConfig) {
             // switch to new event types (USOS)
             dataVersion = 4
 
-            val profile = db.profileDao().getByIdNow(profileId ?: -1)
             if (profile?.loginStoreType?.schoolType == SchoolType.UNIVERSITY) {
                 db.eventTypeDao().clear(profileId ?: -1)
                 db.eventTypeDao().addDefaultTypes(profile)
             }
         }
+
+        if (dataVersion < 5) {
+            // update USOS event types and the appropriate events (2022-12-25)
+            dataVersion = 5
+
+            if (profile?.loginStoreType?.schoolType == SchoolType.UNIVERSITY) {
+                db.eventTypeDao().getAllWithDefaults(profile)
+                // wejściówka (4) -> kartkówka (3)
+                db.eventDao().getRawNow("UPDATE events SET eventType = 3 WHERE profileId = $profileId AND eventType = 4;")
+                // zadanie (6) -> zadanie domowe (-1)
+                db.eventDao().getRawNow("UPDATE events SET eventType = -1 WHERE profileId = $profileId AND eventType = 6;")
+            }
+        }
     }}
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/Constants.kt

@@ -26,9 +26,10 @@ val LIBRUS_USER_AGENT = "${SYSTEM_USER_AGENT}LibrusMobileApp"
 const val SYNERGIA_USER_AGENT = "Mozilla/5.0 (Windows NT 10.0; Win64; x64) Gecko/20100101 Firefox/62.0"
 const val LIBRUS_CLIENT_ID = "VaItV6oRutdo8fnjJwysnTjVlvaswf52ZqmXsJGP"
 const val LIBRUS_REDIRECT_URL = "app://librus"
-const val LIBRUS_AUTHORIZE_URL = "https://portal.librus.pl/oauth2/authorize?client_id=$LIBRUS_CLIENT_ID&redirect_uri=$LIBRUS_REDIRECT_URL&response_type=code"
-const val LIBRUS_LOGIN_URL = "https://portal.librus.pl/rodzina/login/action"
+const val LIBRUS_AUTHORIZE_URL = "https://portal.librus.pl/konto-librus/redirect/dru"
+const val LIBRUS_LOGIN_URL = "https://portal.librus.pl/konto-librus/login/action"
 const val LIBRUS_TOKEN_URL = "https://portal.librus.pl/oauth2/access_token"
+const val LIBRUS_HEADER = "pl.librus.synergiaDru2"
 
 const val LIBRUS_ACCOUNT_URL = "/v3/SynergiaAccounts/fresh/" // + login
 const val LIBRUS_ACCOUNTS_URL = "/v3/SynergiaAccounts"
@@ -59,9 +60,6 @@ const val LIBRUS_SANDBOX_URL = "https://sandbox.librus.pl/index.php?action="
 const val LIBRUS_SYNERGIA_HOMEWORK_ATTACHMENT_URL = "https://synergia.librus.pl/homework/downloadFile"
 const val LIBRUS_SYNERGIA_MESSAGES_ATTACHMENT_URL = "https://synergia.librus.pl/wiadomosci/pobierz_zalacznik"
 
-const val LIBRUS_PORTAL_RECAPTCHA_KEY = "6Lf48moUAAAAAB9ClhdvHr46gRWR"
-const val LIBRUS_PORTAL_RECAPTCHA_REFERER = "https://portal.librus.pl/rodzina/login"
-
 
 val MOBIDZIENNIK_USER_AGENT = SYSTEM_USER_AGENT
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/Errors.kt

@@ -148,6 +148,7 @@ const val ERROR_LIBRUS_MESSAGES_NOT_FOUND                   = 186
 const val ERROR_LOGIN_LIBRUS_API_INVALID_REQUEST            = 187
 const val ERROR_LIBRUS_MESSAGES_ATTACHMENT_NOT_FOUND        = 188
 const val ERROR_LOGIN_LIBRUS_MESSAGES_TIMEOUT               = 189
+const val ERROR_LIBRUS_API_TEACHER_FREE_DAYS_NOT_PUBLIC     = 190
 
 const val ERROR_LOGIN_MOBIDZIENNIK_WEB_INVALID_LOGIN        = 201
 const val ERROR_LOGIN_MOBIDZIENNIK_WEB_OLD_PASSWORD         = 202

app/src/main/java/pl/szczodrzynski/edziennik/data/api/Regexes.kt

@@ -24,6 +24,25 @@ object Regexes {
         """^\[META:([A-z0-9-&=]+)]""".toRegex()
     }
 
+    val HTML_INPUT_HIDDEN by lazy {
+        """<input .*?type="hidden".+?>""".toRegex()
+    }
+    val HTML_INPUT_NAME by lazy {
+        """name="(.+?)"""".toRegex()
+    }
+    val HTML_INPUT_VALUE by lazy {
+        """value="(.+?)"""".toRegex()
+    }
+    val HTML_CSRF_TOKEN by lazy {
+        """name="csrf-token" content="([A-z0-9=+/\-_]+?)"""".toRegex()
+    }
+    val HTML_FORM_ACTION by lazy {
+        """<form .*?action="(.+?)"""".toRegex()
+    }
+    val HTML_RECAPTCHA_KEY by lazy {
+        """data-sitekey="(.+?)"""".toRegex()
+    }
+
 
 
     val MOBIDZIENNIK_GRADES_SUBJECT_NAME by lazy {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/EdziennikTask.kt

@@ -9,6 +9,7 @@ import org.greenrobot.eventbus.EventBus
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.data.api.ERROR_PROFILE_ARCHIVED
+import pl.szczodrzynski.edziennik.data.api.edziennik.demo.Demo
 import pl.szczodrzynski.edziennik.data.api.edziennik.librus.Librus
 import pl.szczodrzynski.edziennik.data.api.edziennik.mobidziennik.Mobidziennik
 import pl.szczodrzynski.edziennik.data.api.edziennik.podlasie.Podlasie
@@ -28,6 +29,8 @@ import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.data.db.full.AnnouncementFull
 import pl.szczodrzynski.edziennik.data.db.full.EventFull
 import pl.szczodrzynski.edziennik.data.db.full.MessageFull
+import pl.szczodrzynski.edziennik.ext.isBeforeYear
+import pl.szczodrzynski.edziennik.ext.shouldArchive
 import pl.szczodrzynski.edziennik.utils.Utils.d
 import pl.szczodrzynski.edziennik.utils.managers.AvailabilityManager.Error.Type
 
@@ -111,6 +114,11 @@ open class EdziennikTask(override val profileId: Int, val request: Any) : IApiTa
             }
         }
 
+        if (profile?.empty == true) {
+            // force app sync on first login
+            app.config.sync.lastAppSync = 0L
+        }
+
         edziennikInterface = when (loginStore.type) {
             LoginType.LIBRUS -> Librus(app, profile, loginStore, taskCallback)
             LoginType.MOBIDZIENNIK -> Mobidziennik(app, profile, loginStore, taskCallback)
@@ -118,6 +126,7 @@ open class EdziennikTask(override val profileId: Int, val request: Any) : IApiTa
             LoginType.PODLASIE -> Podlasie(app, profile, loginStore, taskCallback)
             LoginType.TEMPLATE -> Template(app, profile, loginStore, taskCallback)
             LoginType.USOS -> Usos(app, profile, loginStore, taskCallback)
+            LoginType.DEMO -> Demo(app, profile, loginStore, taskCallback)
             else -> null
         }
         if (edziennikInterface == null) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/ProfileArchiver.kt

@@ -52,28 +52,29 @@ class ProfileArchiver(val app: App, val profile: Profile) {
 
         when (profile.loginStoreType) {
             LoginType.LIBRUS -> {
-                profile.removeStudentData("isPremium")
-                profile.removeStudentData("pushDeviceId")
-                profile.removeStudentData("startPointsSemester1")
-                profile.removeStudentData("startPointsSemester2")
-                profile.removeStudentData("enablePointGrades")
-                profile.removeStudentData("enableDescriptiveGrades")
+                profile.studentData.remove("isPremium")
+                profile.studentData.remove("pushDeviceId")
+                profile.studentData.remove("startPointsSemester1")
+                profile.studentData.remove("startPointsSemester2")
+                profile.studentData.remove("enablePointGrades")
+                profile.studentData.remove("enableDescriptiveGrades")
             }
             LoginType.MOBIDZIENNIK -> {}
             LoginType.VULCAN -> {
                 // DataVulcan.isApiLoginValid() returns false so it will update the semester
-                profile.removeStudentData("currentSemesterEndDate")
-                profile.removeStudentData("studentSemesterId")
-                profile.removeStudentData("studentSemesterNumber")
-                profile.removeStudentData("semester1Id")
-                profile.removeStudentData("semester2Id")
-                profile.removeStudentData("studentClassId")
+                profile.studentData.remove("currentSemesterEndDate")
+                profile.studentData.remove("studentSemesterId")
+                profile.studentData.remove("studentSemesterNumber")
+                profile.studentData.remove("semester1Id")
+                profile.studentData.remove("semester2Id")
+                profile.studentData.remove("studentClassId")
             }
             LoginType.IDZIENNIK -> {
-                profile.removeStudentData("schoolYearId")
+                profile.studentData.remove("schoolYearId")
             }
             LoginType.EDUDZIENNIK -> {}
             LoginType.PODLASIE -> {}
+            LoginType.USOS -> {}
             LoginType.DEMO -> {}
             LoginType.TEMPLATE -> {}
         }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/demo/Demo.kt

@@ -0,0 +1,84 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2024-7-8.
+ */
+
+package pl.szczodrzynski.edziennik.data.api.edziennik.demo
+
+import com.google.gson.JsonObject
+import org.greenrobot.eventbus.EventBus
+import pl.szczodrzynski.edziennik.App
+import pl.szczodrzynski.edziennik.data.api.events.FirstLoginFinishedEvent
+import pl.szczodrzynski.edziennik.data.api.interfaces.EdziennikCallback
+import pl.szczodrzynski.edziennik.data.api.interfaces.EdziennikInterface
+import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
+import pl.szczodrzynski.edziennik.data.db.entity.Profile
+import pl.szczodrzynski.edziennik.data.db.entity.Teacher
+import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
+import pl.szczodrzynski.edziennik.data.db.enums.LoginType
+import pl.szczodrzynski.edziennik.data.db.full.AnnouncementFull
+import pl.szczodrzynski.edziennik.data.db.full.EventFull
+import pl.szczodrzynski.edziennik.data.db.full.MessageFull
+
+class Demo(
+    val app: App,
+    val profile: Profile?,
+    val loginStore: LoginStore,
+    val callback: EdziennikCallback,
+) : EdziennikInterface {
+
+    private fun completed() {
+        callback.onCompleted()
+    }
+
+    override fun sync(
+        featureTypes: Set<FeatureType>?,
+        onlyEndpoints: Set<Int>?,
+        arguments: JsonObject?,
+    ) = completed()
+
+    override fun getMessage(message: MessageFull) =
+        completed()
+
+    override fun sendMessage(recipients: Set<Teacher>, subject: String, text: String) =
+        completed()
+
+    override fun markAllAnnouncementsAsRead() =
+        completed()
+
+    override fun getAnnouncement(announcement: AnnouncementFull) =
+        completed()
+
+    override fun getAttachment(owner: Any, attachmentId: Long, attachmentName: String) =
+        completed()
+
+    override fun getRecipientList() =
+        completed()
+
+    override fun getEvent(eventFull: EventFull) =
+        completed()
+
+    override fun firstLogin() {
+        val profile = Profile(
+            id = loginStore.id,
+            loginStoreId = loginStore.id,
+            loginStoreType = LoginType.DEMO,
+            name = "Jan Szkolny",
+            subname = "Szkolny.eu",
+            studentNameLong = "Jan Szkolny",
+            studentNameShort = "Jan S.",
+            accountName = null,
+        )
+        profile.apply {
+            empty = false
+            syncEnabled = false
+            registration = Profile.REGISTRATION_DISABLED
+            studentClassName = "1A"
+            userCode = "nologin:1234"
+            dateYearEnd.month = 8
+        }
+        EventBus.getDefault().postSticky(FirstLoginFinishedEvent(listOf(profile), loginStore))
+        completed()
+    }
+
+    override fun cancel() {}
+}

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/DataLibrus.kt

@@ -10,7 +10,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 
 class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app, profile, loginStore) {
 
@@ -117,7 +119,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiLogin: String? = null
     var apiLogin: String?
         get() { mApiLogin = mApiLogin ?: profile?.getStudentData("accountLogin", null); return mApiLogin }
-        set(value) { profile?.putStudentData("accountLogin", value); mApiLogin = value }
+        set(value) { profile["accountLogin"] = value; mApiLogin = value }
     /**
      * A Synergia password.
      * Used: for login (API Login Method) in Synergia mode.
@@ -126,7 +128,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiPassword: String? = null
     var apiPassword: String?
         get() { mApiPassword = mApiPassword ?: profile?.getStudentData("accountPassword", null); return mApiPassword }
-        set(value) { profile?.putStudentData("accountPassword", value); mApiPassword = value }
+        set(value) { profile["accountPassword"] = value; mApiPassword = value }
 
     /**
      * A JST login Code.
@@ -135,7 +137,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiCode: String? = null
     var apiCode: String?
         get() { mApiCode = mApiCode ?: loginStore.getLoginData("accountCode", null); return mApiCode }
-        set(value) { profile?.putStudentData("accountCode", value); mApiCode = value }
+        set(value) { profile["accountCode"] = value; mApiCode = value }
     /**
      * A JST login PIN.
      * Used only during first login in JST mode.
@@ -143,7 +145,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiPin: String? = null
     var apiPin: String?
         get() { mApiPin = mApiPin ?: loginStore.getLoginData("accountPin", null); return mApiPin }
-        set(value) { profile?.putStudentData("accountPin", value); mApiPin = value }
+        set(value) { profile["accountPin"] = value; mApiPin = value }
 
     /**
      * A Synergia API access token.
@@ -154,7 +156,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiAccessToken: String? = null
     var apiAccessToken: String?
         get() { mApiAccessToken = mApiAccessToken ?: profile?.getStudentData("accountToken", null); return mApiAccessToken }
-        set(value) { mApiAccessToken = value; profile?.putStudentData("accountToken", value) ?: return; }
+        set(value) { mApiAccessToken = value; profile["accountToken"] = value ?: return; }
     /**
      * A Synergia API refresh token.
      * Used when refreshing the [apiAccessToken] in JST, Synergia modes.
@@ -162,7 +164,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiRefreshToken: String? = null
     var apiRefreshToken: String?
         get() { mApiRefreshToken = mApiRefreshToken ?: profile?.getStudentData("accountRefreshToken", null); return mApiRefreshToken }
-        set(value) { mApiRefreshToken = value; profile?.putStudentData("accountRefreshToken", value) ?: return; }
+        set(value) { mApiRefreshToken = value; profile["accountRefreshToken"] = value ?: return; }
     /**
      * The expiry time for [apiAccessToken], as a UNIX timestamp.
      * Used when refreshing the [apiAccessToken] in JST, Synergia modes.
@@ -171,7 +173,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiTokenExpiryTime: Long? = null
     var apiTokenExpiryTime: Long
         get() { mApiTokenExpiryTime = mApiTokenExpiryTime ?: profile?.getStudentData("accountTokenTime", 0L); return mApiTokenExpiryTime ?: 0L }
-        set(value) { mApiTokenExpiryTime = value; profile?.putStudentData("accountTokenTime", value) ?: return; }
+        set(value) { mApiTokenExpiryTime = value; profile["accountTokenTime"] = value; }
 
     /**
      * A push device ID, generated by Librus when registering
@@ -181,7 +183,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mPushDeviceId: Int? = null
     var pushDeviceId: Int
         get() { mPushDeviceId = mPushDeviceId ?: profile?.getStudentData("pushDeviceId", 0); return mPushDeviceId ?: 0 }
-        set(value) { mPushDeviceId = value; profile?.putStudentData("pushDeviceId", value) ?: return; }
+        set(value) { mPushDeviceId = value; profile["pushDeviceId"] = value; }
 
     /*     _____                            _
           / ____|                          (_)
@@ -198,7 +200,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSynergiaSessionId: String? = null
     var synergiaSessionId: String?
         get() { mSynergiaSessionId = mSynergiaSessionId ?: profile?.getStudentData("accountSID", null); return mSynergiaSessionId }
-        set(value) { profile?.putStudentData("accountSID", value) ?: return; mSynergiaSessionId = value }
+        set(value) { profile["accountSID"] = value; mSynergiaSessionId = value }
     /**
      * The expiry time for [synergiaSessionId], as a UNIX timestamp.
      * Used in endpoints with Synergia login method.
@@ -207,7 +209,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSynergiaSessionIdExpiryTime: Long? = null
     var synergiaSessionIdExpiryTime: Long
         get() { mSynergiaSessionIdExpiryTime = mSynergiaSessionIdExpiryTime ?: profile?.getStudentData("accountSIDTime", 0L); return mSynergiaSessionIdExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("accountSIDTime", value) ?: return; mSynergiaSessionIdExpiryTime = value }
+        set(value) { profile["accountSIDTime"] = value; mSynergiaSessionIdExpiryTime = value }
 
 
     /**
@@ -217,7 +219,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mMessagesSessionId: String? = null
     var messagesSessionId: String?
         get() { mMessagesSessionId = mMessagesSessionId ?: profile?.getStudentData("messagesSID", null); return mMessagesSessionId }
-        set(value) { profile?.putStudentData("messagesSID", value) ?: return; mMessagesSessionId = value }
+        set(value) { profile["messagesSID"] = value; mMessagesSessionId = value }
     /**
      * The expiry time for [messagesSessionId], as a UNIX timestamp.
      * Used in endpoints with Messages login method.
@@ -226,7 +228,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mMessagesSessionIdExpiryTime: Long? = null
     var messagesSessionIdExpiryTime: Long
         get() { mMessagesSessionIdExpiryTime = mMessagesSessionIdExpiryTime ?: profile?.getStudentData("messagesSIDTime", 0L); return mMessagesSessionIdExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("messagesSIDTime", value) ?: return; mMessagesSessionIdExpiryTime = value }
+        set(value) { profile["messagesSIDTime"] = value; mMessagesSessionIdExpiryTime = value }
 
     /*     ____  _   _
           / __ \| | | |
@@ -236,42 +238,42 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
           \____/ \__|_| |_|\___|*/
     var isPremium
         get() = profile?.getStudentData("isPremium", false) ?: false
-        set(value) { profile?.putStudentData("isPremium", value) }
+        set(value) { profile["isPremium"] = value }
 
     private var mSchoolName: String? = null
     var schoolName: String?
         get() { mSchoolName = mSchoolName ?: profile?.getStudentData("schoolName", null); return mSchoolName }
-        set(value) { profile?.putStudentData("schoolName", value) ?: return; mSchoolName = value }
+        set(value) { profile["schoolName"] = value; mSchoolName = value }
 
     private var mUnitId: Long? = null
     var unitId: Long
         get() { mUnitId = mUnitId ?: profile?.getStudentData("unitId", 0L); return mUnitId ?: 0L }
-        set(value) { profile?.putStudentData("unitId", value) ?: return; mUnitId = value }
+        set(value) { profile["unitId"] = value; mUnitId = value }
 
     private var mStartPointsSemester1: Int? = null
     var startPointsSemester1: Int
         get() { mStartPointsSemester1 = mStartPointsSemester1 ?: profile?.getStudentData("startPointsSemester1", 0); return mStartPointsSemester1 ?: 0 }
-        set(value) { profile?.putStudentData("startPointsSemester1", value) ?: return; mStartPointsSemester1 = value }
+        set(value) { profile["startPointsSemester1"] = value; mStartPointsSemester1 = value }
 
     private var mStartPointsSemester2: Int? = null
     var startPointsSemester2: Int
         get() { mStartPointsSemester2 = mStartPointsSemester2 ?: profile?.getStudentData("startPointsSemester2", 0); return mStartPointsSemester2 ?: 0 }
-        set(value) { profile?.putStudentData("startPointsSemester2", value) ?: return; mStartPointsSemester2 = value }
+        set(value) { profile["startPointsSemester2"] = value; mStartPointsSemester2 = value }
 
     private var mEnablePointGrades: Boolean? = null
     var enablePointGrades: Boolean
         get() { mEnablePointGrades = mEnablePointGrades ?: profile?.getStudentData("enablePointGrades", true); return mEnablePointGrades ?: true }
-        set(value) { profile?.putStudentData("enablePointGrades", value) ?: return; mEnablePointGrades = value }
+        set(value) { profile["enablePointGrades"] = value; mEnablePointGrades = value }
 
     private var mEnableDescriptiveGrades: Boolean? = null
     var enableDescriptiveGrades: Boolean
         get() { mEnableDescriptiveGrades = mEnableDescriptiveGrades ?: profile?.getStudentData("enableDescriptiveGrades", true); return mEnableDescriptiveGrades ?: true }
-        set(value) { profile?.putStudentData("enableDescriptiveGrades", value) ?: return; mEnableDescriptiveGrades = value }
+        set(value) { profile["enableDescriptiveGrades"] = value; mEnableDescriptiveGrades = value }
 
     private var mTimetableNotPublic: Boolean? = null
     var timetableNotPublic: Boolean
         get() { mTimetableNotPublic = mTimetableNotPublic ?: profile?.getStudentData("timetableNotPublic", false); return mTimetableNotPublic ?: false }
-        set(value) { profile?.putStudentData("timetableNotPublic", value) ?: return; mTimetableNotPublic = value }
+        set(value) { profile["timetableNotPublic"] = value; mTimetableNotPublic = value }
 
     /**
      * Set to false when Recaptcha helper doesn't provide a working token.

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/Librus.kt

@@ -29,6 +29,9 @@ import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.data.db.full.AnnouncementFull
 import pl.szczodrzynski.edziennik.data.db.full.EventFull
 import pl.szczodrzynski.edziennik.data.db.full.MessageFull
+import pl.szczodrzynski.edziennik.ext.DAY
+import pl.szczodrzynski.edziennik.ext.HOUR
+import pl.szczodrzynski.edziennik.ext.WEEK
 import pl.szczodrzynski.edziennik.utils.Utils.d
 
 class Librus(val app: App, val profile: Profile?, val loginStore: LoginStore, val callback: EdziennikCallback) : EdziennikInterface {
@@ -235,6 +238,11 @@ class Librus(val app: App, val profile: Profile?, val loginStore: LoginStore, va
                                 data.app.config.sync.tokenLibrusList + data.profileId
                         data()
                     }
+                    ERROR_LIBRUS_API_TEACHER_FREE_DAYS_NOT_PUBLIC -> {
+                        d(TAG, "Student not have access to Teacher Free Days resource")
+                        data.setSyncNext(ENDPOINT_LIBRUS_API_TEACHER_FREE_DAYS, 1 * WEEK, FeatureType.AGENDA)
+                        data()
+                    }
                     else -> callback.onError(apiError)
                 }
             }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/LibrusApi.kt

@@ -69,6 +69,7 @@ open class LibrusApi(open val data: DataLibrus, open val lastSync: Long?) {
                         "NoticeboardProblem" -> ERROR_LIBRUS_API_NOTICEBOARD_PROBLEM
                         "DeviceRegistered" -> ERROR_LIBRUS_API_DEVICE_REGISTERED
                         "Maintenance" -> ERROR_LIBRUS_API_MAINTENANCE
+                        "TeacherFreeDaysIsNotActive" -> ERROR_LIBRUS_API_TEACHER_FREE_DAYS_NOT_PUBLIC
                         else -> ERROR_LIBRUS_API_OTHER
                     }.let { errorCode ->
                         if (errorCode !in ignoreErrors) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/api/LibrusApiNotices.kt

@@ -36,7 +36,7 @@ class LibrusApiNotices(override val data: DataLibrus,
                 val id = note.getLong("Id") ?: return@forEach
                 val text = note.getString("Text") ?: ""
                 val categoryId = note.getJsonObject("Category")?.getLong("Id") ?: -1
-                val teacherId = note.getJsonObject("AddedBy")?.getLong("Id") ?: -1
+                val teacherId = note.getJsonObject("Teacher")?.getLong("Id") ?: -1
                 val addedDate = note.getString("Date")?.let { Date.fromY_m_d(it) } ?: return@forEach
 
                 val type = when (note.getInt("Positive")) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/api/LibrusApiTeacherFreeDays.kt

@@ -29,7 +29,7 @@ class LibrusApiTeacherFreeDays(override val data: DataLibrus,
             data.db.teacherAbsenceTypeDao().getAllNow(profileId).toSparseArray(data.teacherAbsenceTypes) { it.id }
         }
 
-        apiGet(TAG, "TeacherFreeDays") { json ->
+        apiGet(TAG, "Calendars/TeacherFreeDays") { json ->
             val teacherAbsences = json.getJsonArray("TeacherFreeDays")?.asJsonObjectList()
 
             teacherAbsences?.forEach { teacherAbsence ->

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/api/LibrusApiTimetables.kt

@@ -190,6 +190,7 @@ class LibrusApiTimetables(override val data: DataLibrus,
         }
 
         lessonObject.id = lessonObject.buildId()
+        lessonObject.ownerId = lessonObject.buildOwnerId()
 
         val seen = profile.empty || lessonDate < Date.getToday()
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/messages/LibrusMessagesGetMessage.kt

@@ -125,7 +125,7 @@ class LibrusMessagesGetMessage(override val data: DataLibrus,
                         val receiverId = teacher?.id ?: -1
                         teacher?.loginId = receiverLoginId
 
-                        val readDateText = message.select("readed").text()
+                        val readDateText = receiver.select("readed").text()
                         val readDate = when (readDateText.isNotNullNorEmpty()) {
                             true -> Date.fromIso(readDateText)
                             else -> 0

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/synergia/LibrusSynergiaHomework.kt

@@ -16,6 +16,7 @@ import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.ext.HOUR
 import pl.szczodrzynski.edziennik.ext.get
+import pl.szczodrzynski.edziennik.ext.getSemesterStart
 import pl.szczodrzynski.edziennik.ext.singleOrNull
 import pl.szczodrzynski.edziennik.utils.models.Date
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/login/LibrusLoginPortal.kt

@@ -24,6 +24,9 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
         private const val TAG = "LoginLibrusPortal"
     }
 
+    // loop failsafe
+    private var loginPerformed = false
+
     init { run {
         if (data.loginStore.mode != LoginMode.LIBRUS_EMAIL) {
             data.error(ApiError(TAG, ERROR_INVALID_LOGIN_MODE))
@@ -33,6 +36,7 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
             data.error(ApiError(TAG, ERROR_LOGIN_DATA_MISSING))
             return@run
         }
+        loginPerformed = false
 
         // succeed having a non-expired access token and a refresh token
         if (data.isPortalLoginValid()) {
@@ -58,18 +62,23 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
         }
     }}
 
-    private fun authorize(url: String?) {
+    private fun authorize(url: String, referer: String? = null) {
         d(TAG, "Request: Librus/Login/Portal - $url")
 
         Request.builder()
                 .url(url)
                 .userAgent(LIBRUS_USER_AGENT)
+                .also {
+                    if (referer != null)
+                        it.addHeader("Referer", referer)
+                }
+                .addHeader("X-Requested-With", LIBRUS_HEADER)
                 .withClient(data.app.httpLazy)
                 .callback(object : TextCallbackHandler() {
                     override fun onSuccess(text: String, response: Response) {
                         val location = response.headers().get("Location")
                         if (location != null) {
-                            val authMatcher = Pattern.compile("$LIBRUS_REDIRECT_URL\\?code=([A-z0-9]+?)$", Pattern.DOTALL or Pattern.MULTILINE).matcher(location)
+                            val authMatcher = Pattern.compile("$LIBRUS_REDIRECT_URL\\?code=([^&?]+)", Pattern.DOTALL or Pattern.MULTILINE).matcher(location)
                             when {
                                 authMatcher.find() -> {
                                     accessToken(authMatcher.group(1), null)
@@ -83,16 +92,31 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
                                     authorize(location)
                                 }
                             }
-                        } else {
-                            val csrfMatcher = Pattern.compile("name=\"csrf-token\" content=\"([A-z0-9=+/\\-_]+?)\"", Pattern.DOTALL).matcher(text)
-                            if (csrfMatcher.find()) {
-                                login(csrfMatcher.group(1) ?: "")
-                            } else {
-                                data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_CSRF_MISSING)
-                                        .withResponse(response)
-                                        .withApiResponse(text))
+                            return
+                        }
+
+                        if (checkError(text, response))
+                            return
+
+                        var loginUrl = if (data.fakeLogin) FAKE_LIBRUS_LOGIN else LIBRUS_LOGIN_URL
+                        val csrfToken = Regexes.HTML_CSRF_TOKEN.find(text)?.get(1) ?: ""
+
+                        for (match in Regexes.HTML_FORM_ACTION.findAll(text)) {
+                            val form = match.value.lowercase()
+                            if ("login" in form && "post" in form) {
+                                loginUrl = match[1]
                             }
                         }
+
+                        val params = mutableMapOf<String, String>()
+                        for (match in Regexes.HTML_INPUT_HIDDEN.findAll(text)) {
+                            val input = match.value
+                            val name = Regexes.HTML_INPUT_NAME.find(input)?.get(1) ?: continue
+                            val value = Regexes.HTML_INPUT_VALUE.find(input)?.get(1) ?: continue
+                            params[name] = value
+                        }
+
+                        login(url = loginUrl, referer = url, csrfToken, params)
                     }
 
                     override fun onFailure(response: Response, throwable: Throwable) {
@@ -105,8 +129,54 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
                 .enqueue()
     }
 
-    private fun login(csrfToken: String) {
-        d(TAG, "Request: Librus/Login/Portal - ${if (data.fakeLogin) FAKE_LIBRUS_LOGIN else LIBRUS_LOGIN_URL}")
+    private fun checkError(text: String, response: Response): Boolean {
+        when {
+            text.contains("librus_account_settings_main") -> return false
+            text.contains("Sesja logowania wygasła") -> ERROR_LOGIN_LIBRUS_PORTAL_CSRF_EXPIRED
+            text.contains("Upewnij się, że nie") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
+            text.contains("Podany adres e-mail jest nieprawidłowy.") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
+            else -> null // no error for now
+        }?.let { errorCode ->
+            data.error(ApiError(TAG, errorCode)
+                .withApiResponse(text)
+                .withResponse(response))
+            return true
+        }
+
+        if ("robotem" in text || "g-recaptcha" in text || "captchaValidate" in text) {
+            val siteKey = Regexes.HTML_RECAPTCHA_KEY.find(text)?.get(1)
+            if (siteKey == null) {
+                data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_ACTION_ERROR)
+                    .withApiResponse(text)
+                    .withResponse(response))
+                return true
+            }
+            data.requireUserAction(
+                type = UserActionRequiredEvent.Type.RECAPTCHA,
+                params = Bundle(
+                    "siteKey" to siteKey,
+                    "referer" to response.request().url().toString(),
+                    "userAgent" to LIBRUS_USER_AGENT,
+                ),
+                errorText = R.string.notification_user_action_required_captcha_librus,
+            )
+            return true
+        }
+        return false
+    }
+
+    private fun login(
+        url: String,
+        referer: String,
+        csrfToken: String?,
+        params: Map<String, String>,
+    ) {
+        if (loginPerformed) {
+            data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_ACTION_ERROR))
+            return
+        }
+
+        d(TAG, "Request: Librus/Login/Portal - $url")
 
         val recaptchaCode = data.arguments?.getString("recaptchaCode") ?: data.loginStore.getLoginData("recaptchaCode", null)
         val recaptchaTime = data.arguments?.getLong("recaptchaTime") ?: data.loginStore.getLoginData("recaptchaTime", 0L)
@@ -116,67 +186,46 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
         Request.builder()
                 .url(if (data.fakeLogin) FAKE_LIBRUS_LOGIN else LIBRUS_LOGIN_URL)
                 .userAgent(LIBRUS_USER_AGENT)
+                .addHeader("X-Requested-With", LIBRUS_HEADER)
+                .addHeader("Referer", referer)
+                .withClient(data.app.httpLazy)
                 .addParameter("email", data.portalEmail)
                 .addParameter("password", data.portalPassword)
                 .also {
                     if (recaptchaCode != null && System.currentTimeMillis() - recaptchaTime < 2*60*1000 /* 2 minutes */)
                         it.addParameter("g-recaptcha-response", recaptchaCode)
+                    if (csrfToken != null)
+                        it.addHeader("X-CSRF-TOKEN", csrfToken)
+                    for ((key, value) in params) {
+                        it.addParameter(key, value)
+                    }
                 }
-                .addHeader("X-CSRF-TOKEN", csrfToken)
-                .allowErrorCode(HTTP_BAD_REQUEST)
-                .allowErrorCode(HTTP_FORBIDDEN)
-                .contentType(MediaTypeUtils.APPLICATION_JSON)
+                .contentType(MediaTypeUtils.APPLICATION_FORM)
                 .post()
-                .callback(object : JsonCallbackHandler() {
-                    override fun onSuccess(json: JsonObject?, response: Response) {
+                .callback(object : TextCallbackHandler() {
+                    override fun onSuccess(text: String?, response: Response) {
+                        loginPerformed = true
                         val location = response.headers()?.get("Location")
                         if (location == "$LIBRUS_REDIRECT_URL?command=close") {
                             data.error(ApiError(TAG, ERROR_LIBRUS_PORTAL_MAINTENANCE)
-                                    .withApiResponse(json)
+                                    .withApiResponse(text)
                                     .withResponse(response))
                             return
                         }
-
-                        if (json == null) {
-                            if (response.parserErrorBody?.contains("wciąż nieaktywne") == true) {
-                                data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_NOT_ACTIVATED)
-                                        .withResponse(response))
-                                return
-                            }
+                        if (text == null) {
                             data.error(ApiError(TAG, ERROR_RESPONSE_EMPTY)
                                     .withResponse(response))
                             return
                         }
-                        val error = if (response.code() == 200) null else
-                            json.getJsonArray("errors")?.getString(0)
-                                    ?: json.getJsonObject("errors")?.entrySet()?.firstOrNull()?.value?.asString
 
-                        if (error?.contains("robotem") == true || json.getBoolean("captchaRequired") == true) {
-                            data.requireUserAction(
-                                type = UserActionRequiredEvent.Type.RECAPTCHA,
-                                params = Bundle(
-                                    "siteKey" to LIBRUS_PORTAL_RECAPTCHA_KEY,
-                                    "referer" to LIBRUS_PORTAL_RECAPTCHA_REFERER,
-                                ),
-                                errorText = R.string.notification_user_action_required_captcha_librus,
-                            )
-                            return
-                        }
-
-                        error?.let { code ->
-                            when {
-                                code.contains("Sesja logowania wygasła") -> ERROR_LOGIN_LIBRUS_PORTAL_CSRF_EXPIRED
-                                code.contains("Upewnij się, że nie") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
-                                code.contains("Podany adres e-mail jest nieprawidłowy.") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
-                                else -> ERROR_LOGIN_LIBRUS_PORTAL_ACTION_ERROR
-                            }.let { errorCode ->
-                                data.error(ApiError(TAG, errorCode)
-                                        .withApiResponse(json)
-                                        .withResponse(response))
-                                return
-                            }
-                        }
-                        authorize(json.getString("redirect", LIBRUS_AUTHORIZE_URL))
+                        authorize(
+                            url = location
+                                ?: if (data.fakeLogin)
+                                    FAKE_LIBRUS_AUTHORIZE
+                                else
+                                    LIBRUS_AUTHORIZE_URL,
+                            referer = referer,
+                        )
                     }
 
                     override fun onFailure(response: Response, throwable: Throwable) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/DataMobidziennik.kt

@@ -11,7 +11,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
 
@@ -85,7 +87,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
     private var mStudentId: Int? = null
     var studentId: Int
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", 0); return mStudentId ?: 0 }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
 
     /*   __          __  _
          \ \        / / | |
@@ -125,7 +127,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var globalId: String?
         get() { mGlobalId = mGlobalId ?: profile?.getStudentData("globalId", null); return mGlobalId }
-        set(value) { profile?.putStudentData("globalId", value) ?: return; mGlobalId = value }
+        set(value) { profile["globalId"] = value; mGlobalId = value }
     private var mGlobalId: String? = null
 
     /**
@@ -135,7 +137,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var loginEmail: String?
         get() { mLoginEmail = mLoginEmail ?: profile?.getStudentData("email", null); return mLoginEmail }
-        set(value) { profile?.putStudentData("email", value); mLoginEmail = value }
+        set(value) { profile["email"] = value; mLoginEmail = value }
     private var mLoginEmail: String? = null
 
     /**
@@ -144,7 +146,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var loginId: String?
         get() { mLoginId = mLoginId ?: profile?.getStudentData("loginId", null); return mLoginId }
-        set(value) { profile?.putStudentData("loginId", value) ?: return; mLoginId = value }
+        set(value) { profile["loginId"] = value; mLoginId = value }
     private var mLoginId: String? = null
 
     /**
@@ -152,7 +154,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var ciasteczkoAutoryzacji: String?
         get() { mCiasteczkoAutoryzacji = mCiasteczkoAutoryzacji ?: profile?.getStudentData("ciasteczkoAutoryzacji", null); return mCiasteczkoAutoryzacji }
-        set(value) { profile?.putStudentData("ciasteczkoAutoryzacji", value) ?: return; mCiasteczkoAutoryzacji = value }
+        set(value) { profile["ciasteczkoAutoryzacji"] = value; mCiasteczkoAutoryzacji = value }
     private var mCiasteczkoAutoryzacji: String? = null
 
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/api/MobidziennikApiAttendance.kt

@@ -12,6 +12,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Attendance.Companion.TYPE_PRESE
 import pl.szczodrzynski.edziennik.data.db.entity.Attendance.Companion.TYPE_RELEASED
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.ext.dateToSemester
 
 class MobidziennikApiAttendance(val data: DataMobidziennik, rows: List<String>) {
     init { run {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/api/MobidziennikApiTimetable.kt

@@ -88,6 +88,7 @@ class MobidziennikApiTimetable(val data: DataMobidziennik, rows: List<String>) {
                 }
 
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
 
                 val seen = profile.empty || date < Date.getToday()
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebAccountEmail.kt

@@ -10,6 +10,7 @@ import pl.szczodrzynski.edziennik.data.api.edziennik.mobidziennik.ENDPOINT_MOBID
 import pl.szczodrzynski.edziennik.data.api.edziennik.mobidziennik.data.MobidziennikWeb
 import pl.szczodrzynski.edziennik.ext.DAY
 import pl.szczodrzynski.edziennik.ext.get
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 
 class MobidziennikWebAccountEmail(override val data: DataMobidziennik,
                                   override val lastSync: Long?,
@@ -24,7 +25,8 @@ class MobidziennikWebAccountEmail(override val data: DataMobidziennik,
             MobidziennikLuckyNumberExtractor(data, text)
 
             val email = Regexes.MOBIDZIENNIK_ACCOUNT_EMAIL.find(text)?.let { it[1] }
-            data.loginEmail = email
+            if (email.isNotNullNorBlank())
+                data.loginEmail = email
 
             data.setSyncNext(ENDPOINT_MOBIDZIENNIK_WEB_ACCOUNT_EMAIL, if (email == null) 3* DAY else 7* DAY)
             onSuccess(ENDPOINT_MOBIDZIENNIK_WEB_ACCOUNT_EMAIL)

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebAttendance.kt

@@ -21,6 +21,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Attendance.Companion.TYPE_UNKNO
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.entity.SYNC_ALWAYS
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.ext.dateToSemester
 import pl.szczodrzynski.edziennik.ext.fixName
 import pl.szczodrzynski.edziennik.ext.get
 import pl.szczodrzynski.edziennik.ext.singleOrNull

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebGrades.kt

@@ -15,6 +15,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Grade.Companion.TYPE_NORMAL
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.entity.SYNC_ALWAYS
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.ext.dateToSemester
 import pl.szczodrzynski.edziennik.ext.fixWhiteSpaces
 import pl.szczodrzynski.edziennik.ext.get
 import pl.szczodrzynski.edziennik.ext.singleOrNull

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebTimetable.kt

@@ -336,6 +336,7 @@ class MobidziennikWebTimetable(
                 }
 
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
                 it.isExtra = isExtra
 
                 val seen = profile?.empty == false || lessonDate < Date.getToday()

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/login/MobidziennikLoginApi2.kt

@@ -16,6 +16,7 @@ import pl.szczodrzynski.edziennik.data.api.models.ApiError
 import pl.szczodrzynski.edziennik.ext.JsonObject
 import pl.szczodrzynski.edziennik.ext.getJsonObject
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
 import pl.szczodrzynski.edziennik.utils.Utils
 
@@ -77,7 +78,9 @@ class MobidziennikLoginApi2(val data: DataMobidziennik, val onSuccess: () -> Uni
                     }
                 }
 
-                data.loginEmail = json.getString("email")
+                val email = json.getString("email")
+                if (email.isNotNullNorBlank())
+                    data.loginEmail = email
                 data.globalId = json.getString("id_global")
                 data.loginId = json.getString("login")
                 onSuccess()

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/podlasie/DataPodlasie.kt

@@ -10,7 +10,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.crc32
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 
 class DataPodlasie(app: App, profile: Profile?, loginStore: LoginStore) : Data(app, profile, loginStore) {
 
@@ -40,7 +42,7 @@ class DataPodlasie(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mApiUrl: String? = null
     var apiUrl: String?
         get() { mApiUrl = mApiUrl ?: profile?.getStudentData("apiUrl", null); return mApiUrl }
-        set(value) { profile?.putStudentData("apiUrl", value) ?: return; mApiUrl = value }
+        set(value) { profile["apiUrl"] = value; mApiUrl = value }
 
     /*     ____  _   _
           / __ \| | | |
@@ -51,32 +53,32 @@ class DataPodlasie(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mStudentId: String? = null
     var studentId: String?
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", null); return mStudentId }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
 
     private var mStudentLogin: String? = null
     var studentLogin: String?
         get() { mStudentLogin = mStudentLogin ?: profile?.getStudentData("studentLogin", null); return mStudentLogin }
-        set(value) { profile?.putStudentData("studentLogin", value) ?: return; mStudentLogin = value }
+        set(value) { profile["studentLogin"] = value; mStudentLogin = value }
 
     private var mSchoolName: String? = null
     var schoolName: String?
         get() { mSchoolName = mSchoolName ?: profile?.getStudentData("schoolName", null); return mSchoolName }
-        set(value) { profile?.putStudentData("schoolName", value) ?: return; mSchoolName = value }
+        set(value) { profile["schoolName"] = value; mSchoolName = value }
 
     private var mClassName: String? = null
     var className: String?
         get() { mClassName = mClassName ?: profile?.getStudentData("className", null); return mClassName }
-        set(value) { profile?.putStudentData("className", value) ?: return; mClassName = value }
+        set(value) { profile["className"] = value; mClassName = value }
 
     private var mSchoolYear: String? = null
     var schoolYear: String?
         get() { mSchoolYear = mSchoolYear ?: profile?.getStudentData("schoolYear", null); return mSchoolYear }
-        set(value) { profile?.putStudentData("schoolYear", value) ?: return; mSchoolYear = value }
+        set(value) { profile["schoolYear"] = value; mSchoolYear = value }
 
     private var mCurrentSemester: Int? = null
     var currentSemester: Int
         get() { mCurrentSemester = mCurrentSemester ?: profile?.getStudentData("currentSemester", 0); return mCurrentSemester ?: 0 }
-        set(value) { profile?.putStudentData("currentSemester", value) ?: return; mCurrentSemester = value }
+        set(value) { profile["currentSemester"] = value; mCurrentSemester = value }
 
     val schoolShortName: String?
         get() = studentLogin?.split('@')?.get(1)?.replace(".podlaskie.pl", "")

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/podlasie/data/api/PodlasieApiFinalGrades.kt

@@ -17,6 +17,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Grade.Companion.TYPE_YEAR_PROPO
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.ext.getLong
+import pl.szczodrzynski.edziennik.ext.getSemesterStart
 import pl.szczodrzynski.edziennik.ext.getString
 
 class PodlasieApiFinalGrades(val data: DataPodlasie, val rows: List<JsonObject>) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/podlasie/data/api/PodlasieApiTimetable.kt

@@ -72,6 +72,7 @@ class PodlasieApiTimetable(val data: DataPodlasie, rows: List<JsonObject>) {
                 it.classroom = classroom
 
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
                 data.lessonList += it
             }
         }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/template/DataTemplate.kt

@@ -10,7 +10,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 
 /**
  * Use http://patorjk.com/software/taag/#p=display&f=Big for the ascii art
@@ -43,12 +45,12 @@ class DataTemplate(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mWebCookie: String? = null
     var webCookie: String?
         get() { mWebCookie = mWebCookie ?: profile?.getStudentData("webCookie", null); return mWebCookie }
-        set(value) { profile?.putStudentData("webCookie", value) ?: return; mWebCookie = value }
+        set(value) { profile["webCookie"] = value; mWebCookie = value }
 
     private var mWebExpiryTime: Long? = null
     var webExpiryTime: Long
         get() { mWebExpiryTime = mWebExpiryTime ?: profile?.getStudentData("webExpiryTime", 0L); return mWebExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("webExpiryTime", value) ?: return; mWebExpiryTime = value }
+        set(value) { profile["webExpiryTime"] = value; mWebExpiryTime = value }
 
     /*                   _
              /\         (_)
@@ -61,10 +63,10 @@ class DataTemplate(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mApiToken: String? = null
     var apiToken: String?
         get() { mApiToken = mApiToken ?: profile?.getStudentData("apiToken", null); return mApiToken }
-        set(value) { profile?.putStudentData("apiToken", value) ?: return; mApiToken = value }
+        set(value) { profile["apiToken"] = value; mApiToken = value }
 
     private var mApiExpiryTime: Long? = null
     var apiExpiryTime: Long
         get() { mApiExpiryTime = mApiExpiryTime ?: profile?.getStudentData("apiExpiryTime", 0L); return mApiExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("apiExpiryTime", value) ?: return; mApiExpiryTime = value }
+        set(value) { profile["apiExpiryTime"] = value; mApiExpiryTime = value }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/DataUsos.kt

@@ -4,11 +4,14 @@
 
 package pl.szczodrzynski.edziennik.data.api.edziennik.usos
 
+import com.google.gson.JsonObject
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.api.models.Data
 import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
+import pl.szczodrzynski.edziennik.ext.getStudentData
+import pl.szczodrzynski.edziennik.ext.set
 
 class DataUsos(
     app: App,
@@ -69,6 +72,11 @@ class DataUsos(
 
     var studentId: Int
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", 0); return mStudentId ?: 0 }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
     private var mStudentId: Int? = null
+
+    var termNames: Map<String, String> = mapOf()
+        get() { mTermNames = mTermNames ?: profile?.getStudentData("termNames", null)?.let { app.gson.fromJson(it, field.toMutableMap()::class.java) }; return mTermNames ?: mapOf() }
+        set(value) { profile["termNames"] = app.gson.toJson(value); mTermNames = value }
+    private var mTermNames: Map<String, String>? = null
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/UsosFeatures.kt

@@ -10,10 +10,12 @@ import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 
-const val ENDPOINT_USOS_API_USER        = 7000
-const val ENDPOINT_USOS_API_TERMS       = 7010
-const val ENDPOINT_USOS_API_COURSES     = 7020
-const val ENDPOINT_USOS_API_TIMETABLE   = 7030
+const val ENDPOINT_USOS_API_USER            = 7000
+const val ENDPOINT_USOS_API_TERMS           = 7010
+const val ENDPOINT_USOS_API_COURSES         = 7020
+const val ENDPOINT_USOS_API_TIMETABLE       = 7030
+const val ENDPOINT_USOS_API_ECTS_POINTS     = 7040
+const val ENDPOINT_USOS_API_EXAM_REPORTS    = 7050
 
 val UsosFeatures = listOf(
     /*
@@ -39,4 +41,12 @@ val UsosFeatures = listOf(
     Feature(LoginType.USOS, FeatureType.TIMETABLE, listOf(
         ENDPOINT_USOS_API_TIMETABLE to LoginMethod.USOS_API,
     )),
+
+    /*
+     * Grades
+     */
+    Feature(LoginType.USOS, FeatureType.GRADES, listOf(
+        ENDPOINT_USOS_API_ECTS_POINTS to LoginMethod.USOS_API,
+        ENDPOINT_USOS_API_EXAM_REPORTS to LoginMethod.USOS_API,
+    )),
 )

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/UsosData.kt

@@ -8,6 +8,8 @@ import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.data.api.edziennik.template.data.web.TemplateWebSample
 import pl.szczodrzynski.edziennik.data.api.edziennik.usos.*
 import pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.api.UsosApiCourses
+import pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.api.UsosApiEctsPoints
+import pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.api.UsosApiExamReports
 import pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.api.UsosApiTerms
 import pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.api.UsosApiTimetable
 import pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.api.UsosApiUser
@@ -58,6 +60,14 @@ class UsosData(val data: DataUsos, val onSuccess: () -> Unit) {
                 data.startProgress(R.string.edziennik_progress_endpoint_timetable)
                 UsosApiTimetable(data, lastSync, onSuccess)
             }
+            ENDPOINT_USOS_API_ECTS_POINTS -> {
+                data.startProgress(R.string.edziennik_progress_endpoint_grade_categories)
+                UsosApiEctsPoints(data, lastSync, onSuccess)
+            }
+            ENDPOINT_USOS_API_EXAM_REPORTS -> {
+                data.startProgress(R.string.edziennik_progress_endpoint_grades)
+                UsosApiExamReports(data, lastSync, onSuccess)
+            }
             else -> onSuccess(endpointId)
         }
     }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/api/UsosApiCourses.kt

@@ -9,6 +9,7 @@ import pl.szczodrzynski.edziennik.data.api.ERROR_USOS_API_INCOMPLETE_RESPONSE
 import pl.szczodrzynski.edziennik.data.api.edziennik.usos.DataUsos
 import pl.szczodrzynski.edziennik.data.api.edziennik.usos.ENDPOINT_USOS_API_COURSES
 import pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.UsosApi
+import pl.szczodrzynski.edziennik.data.db.entity.GradeCategory
 import pl.szczodrzynski.edziennik.data.db.entity.Team
 import pl.szczodrzynski.edziennik.ext.*
 
@@ -25,17 +26,20 @@ class UsosApiCourses(
         apiRequest<JsonObject>(
             tag = TAG,
             service = "courses/user",
+            params = mapOf(
+                "active_terms_only" to false,
+            ),
             fields = listOf(
                 // "terms" to listOf("id", "name", "start_date", "end_date"),
                 "course_editions" to listOf(
                     "course_id",
                     "course_name",
-                    // "term_id",
                     "user_groups" to listOf(
                         "course_unit_id",
                         "group_number",
-                        // "class_type",
+                        "class_type",
                         "class_type_id",
+                        "term_id",
                         "lecturers",
                     ),
                 ),
@@ -63,22 +67,38 @@ class UsosApiCourses(
         for (courseEdition in courseEditions) {
             val courseId = courseEdition.getString("course_id") ?: continue
             val courseName = courseEdition.getLangString("course_name") ?: continue
-            val userGroups = courseEdition.getJsonArray("user_groups")?.asJsonObjectList() ?: continue
+            val userGroups =
+                courseEdition.getJsonArray("user_groups")?.asJsonObjectList() ?: continue
             for (userGroup in userGroups) {
                 val courseUnitId = userGroup.getLong("course_unit_id") ?: continue
                 val groupNumber = userGroup.getInt("group_number") ?: continue
-                // val classType = userGroup.getLangString("class_type") ?: continue
+                val classType = userGroup.getLangString("class_type") ?: continue
                 val classTypeId = userGroup.getString("class_type_id") ?: continue
+                val termId = userGroup.getString("term_id") ?: continue
                 val lecturers = userGroup.getLecturerIds("lecturers")
 
-                data.teamList.put(courseUnitId, Team(
-                    profileId,
-                    courseUnitId,
-                    "${profile?.studentClassName} $classTypeId$groupNumber - $courseName",
-                    2,
-                    "${data.schoolId}:${courseId} $classTypeId$groupNumber",
-                    lecturers.firstOrNull() ?: -1L,
-                ))
+                data.teamList.put(
+                    courseUnitId, Team(
+                        profileId,
+                        courseUnitId,
+                        "${profile?.studentClassName} $courseName ($classTypeId$groupNumber)",
+                        2,
+                        "${data.schoolId}:${termId}:${courseId} $classTypeId$groupNumber",
+                        lecturers.firstOrNull() ?: -1L,
+                    )
+                )
+
+                val gradeCategory = data.gradeCategories[courseUnitId]
+                data.gradeCategories.put(
+                    courseUnitId, GradeCategory(
+                        profileId,
+                        courseUnitId,
+                        gradeCategory?.weight ?: -1.0f,
+                        0,
+                        courseId,
+                    ).addColumn(classType)
+                )
+
                 hasValidTeam = true
             }
         }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/api/UsosApiEctsPoints.kt

@@ -0,0 +1,56 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2025-1-31.
+ */
+
+package pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.api
+
+import com.google.gson.JsonObject
+import pl.szczodrzynski.edziennik.data.api.ERROR_USOS_API_INCOMPLETE_RESPONSE
+import pl.szczodrzynski.edziennik.data.api.edziennik.usos.DataUsos
+import pl.szczodrzynski.edziennik.data.api.edziennik.usos.ENDPOINT_USOS_API_ECTS_POINTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.UsosApi
+import pl.szczodrzynski.edziennik.ext.DAY
+import pl.szczodrzynski.edziennik.ext.filter
+
+class UsosApiEctsPoints(
+    override val data: DataUsos,
+    override val lastSync: Long?,
+    val onSuccess: (endpointId: Int) -> Unit,
+) : UsosApi(data, lastSync) {
+    companion object {
+        const val TAG = "UsosApiEctsPoints"
+    }
+
+    init {
+        apiRequest<JsonObject>(
+            tag = TAG,
+            service = "courses/user_ects_points",
+            responseType = ResponseType.OBJECT,
+        ) { json, response ->
+            if (!processResponse(json)) {
+                data.error(TAG, ERROR_USOS_API_INCOMPLETE_RESPONSE, response)
+                return@apiRequest
+            }
+
+            data.setSyncNext(ENDPOINT_USOS_API_ECTS_POINTS, 2 * DAY)
+            onSuccess(ENDPOINT_USOS_API_ECTS_POINTS)
+        }
+    }
+
+    private fun processResponse(json: JsonObject): Boolean {
+        for ((_, coursePointsEl) in json.entrySet()) {
+            if (!coursePointsEl.isJsonObject)
+                continue
+            for ((courseId, pointsEl) in coursePointsEl.asJsonObject.entrySet()) {
+                if (!pointsEl.isJsonPrimitive)
+                    continue
+                val gradeCategories = data.gradeCategories
+                    .filter { it.text == courseId }
+                gradeCategories.forEach {
+                    it.weight = pointsEl.asString.toFloatOrNull() ?: -1.0f
+                }
+            }
+        }
+        return true
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/api/UsosApiExamReports.kt

@@ -0,0 +1,212 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2025-1-31.
+ */
+
+package pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.api
+
+import com.google.gson.JsonObject
+import pl.szczodrzynski.edziennik.data.api.ERROR_USOS_API_INCOMPLETE_RESPONSE
+import pl.szczodrzynski.edziennik.data.api.edziennik.usos.DataUsos
+import pl.szczodrzynski.edziennik.data.api.edziennik.usos.ENDPOINT_USOS_API_EXAM_REPORTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.UsosApi
+import pl.szczodrzynski.edziennik.data.api.models.DataRemoveModel
+import pl.szczodrzynski.edziennik.data.db.entity.Grade
+import pl.szczodrzynski.edziennik.data.db.entity.Grade.Companion.TYPE_NORMAL
+import pl.szczodrzynski.edziennik.data.db.entity.Grade.Companion.TYPE_NO_GRADE
+import pl.szczodrzynski.edziennik.data.db.entity.Metadata
+import pl.szczodrzynski.edziennik.data.db.entity.SYNC_ALWAYS
+import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.ext.getBoolean
+import pl.szczodrzynski.edziennik.ext.getInt
+import pl.szczodrzynski.edziennik.ext.getJsonArray
+import pl.szczodrzynski.edziennik.ext.getJsonObject
+import pl.szczodrzynski.edziennik.ext.getLong
+import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.join
+import pl.szczodrzynski.edziennik.utils.models.Date
+
+class UsosApiExamReports(
+    override val data: DataUsos,
+    override val lastSync: Long?,
+    val onSuccess: (endpointId: Int) -> Unit,
+) : UsosApi(data, lastSync) {
+    companion object {
+        const val TAG = "UsosApiExamReports"
+    }
+
+    private val missingTermNames = mutableSetOf<String>()
+
+    init {
+        apiRequest<JsonObject>(
+            tag = TAG,
+            service = "examrep/user2",
+            fields = listOf(
+                "id",
+                "type_description",
+                "course_unit" to listOf("id", "course_name"),
+                "sessions" to listOf(
+                    "number",
+                    "description",
+                    "issuer_grades" to listOf(
+                        "value_symbol",
+                        // "value_description",
+                        "passes",
+                        "counts_into_average",
+                        "date_modified",
+                        "modification_author",
+                        "comment",
+                    ),
+                ),
+            ),
+            responseType = ResponseType.OBJECT,
+        ) { json, response ->
+            if (!processResponse(json)) {
+                data.error(TAG, ERROR_USOS_API_INCOMPLETE_RESPONSE, response)
+                return@apiRequest
+            }
+
+            data.toRemove.add(DataRemoveModel.Grades.all())
+            data.setSyncNext(ENDPOINT_USOS_API_EXAM_REPORTS, SYNC_ALWAYS)
+
+            if (missingTermNames.isEmpty())
+                onSuccess(ENDPOINT_USOS_API_EXAM_REPORTS)
+            else
+                UsosApiTerms(data, lastSync, onSuccess, missingTermNames)
+        }
+    }
+
+    private fun processResponse(json: JsonObject): Boolean {
+        for ((termId, courseEditionEl) in json.entrySet()) {
+            if (!courseEditionEl.isJsonObject)
+                continue
+            for ((courseId, examReportsEl) in courseEditionEl.asJsonObject.entrySet()) {
+                if (!examReportsEl.isJsonArray)
+                    continue
+                for (examReportEl in examReportsEl.asJsonArray) {
+                    if (!examReportEl.isJsonObject)
+                        continue
+                    val examReport = examReportEl.asJsonObject
+                    processExamReport(termId, courseId, examReport)
+                }
+            }
+        }
+        return true
+    }
+
+    private fun processExamReport(termId: String, courseId: String, examReport: JsonObject) {
+        val examId = examReport.getString("id")?.toIntOrNull()
+            ?: return
+        val typeDescription = examReport.getLangString("type_description")
+        val courseUnit = examReport.getJsonObject("course_unit")
+            ?: return
+        val courseUnitId = courseUnit.getString("id")?.toLongOrNull()
+            ?: return
+        val courseName = courseUnit.getLangString("course_name")
+            ?: return
+        val sessions = examReport.getJsonArray("sessions")
+            ?: return
+
+        val gradeCategory = data.gradeCategories[courseUnitId]
+        val classType = gradeCategory?.columns?.get(0)
+
+        val subject = data.getSubject(
+            id = null,
+            name = courseName,
+            shortName = courseId,
+        )
+
+        var hasGrade = false
+
+        for (sessionEl in sessions) {
+            if (!sessionEl.isJsonObject)
+                continue
+            val session = sessionEl.asJsonObject
+
+            val sessionNumber = session.getInt("number") ?: continue
+            val sessionDescription = session.getLangString("description")
+            val issuerGrade = session.getJsonObject("issuer_grades")
+
+            val valueSymbol = issuerGrade.getString("value_symbol") ?: continue
+            val passes = issuerGrade.getBoolean("passes")
+            val countsIntoAverage = issuerGrade.getString("counts_into_average") ?: "T"
+            val dateModified = issuerGrade.getString("date_modified")
+            val modificationAuthorId = issuerGrade.getJsonObject("modification_author")
+                ?.getLong("id") ?: -1L
+            val comment = issuerGrade.getString("comment")
+
+            val value = valueSymbol.toFloatOrNull() ?: 0.0f
+
+            if (termId !in data.termNames) {
+                missingTermNames.add(termId)
+            }
+
+            val gradeObject = Grade(
+                profileId = profileId,
+                id = examId * 10L + sessionNumber,
+                name = valueSymbol,
+                type = TYPE_NORMAL,
+                value = value,
+                weight = if (countsIntoAverage == "T") gradeCategory?.weight ?: 0.0f else 0.0f,
+                color = (if (passes == true) 0xFF465FB3 else 0xFFB71C1C).toInt(),
+                category = typeDescription,
+                description = listOfNotNull(classType, sessionDescription, comment).join(" - "),
+                comment = termId,
+                semester = 1,
+                teacherId = modificationAuthorId,
+                subjectId = subject.id,
+                addedDate = Date.fromIso(dateModified),
+            )
+            hasGrade = true
+
+            if (sessionNumber > 1) {
+                val origId = examId * 10L + sessionNumber - 1
+                val grades = data.gradeList.filter { it.id == origId }
+                val improvedGrade = grades.firstOrNull()
+                improvedGrade?.parentId = gradeObject.id
+                improvedGrade?.weight = 0.0f
+                gradeObject.isImprovement = true
+            }
+
+            data.gradeList.add(gradeObject)
+            data.metadataList.add(
+                Metadata(
+                    profileId,
+                    MetadataType.GRADE,
+                    gradeObject.id,
+                    profile?.empty ?: false,
+                    profile?.empty ?: false,
+                )
+            )
+        }
+
+        if (!hasGrade) {
+            // add an "empty" grade for the exam
+            val gradeObject = Grade(
+                profileId = profileId,
+                id = examId * 10L,
+                name = "...",
+                type = TYPE_NO_GRADE,
+                value = 0.0f,
+                weight = 0.0f,
+                color = 0xFFBABABD.toInt(),
+                category = typeDescription,
+                description = classType,
+                comment = termId,
+                semester = 1,
+                teacherId = -1L,
+                subjectId = subject.id,
+                addedDate = 0,
+            )
+            data.gradeList.add(gradeObject)
+            data.metadataList.add(
+                Metadata(
+                    profileId,
+                    MetadataType.GRADE,
+                    gradeObject.id,
+                    true,
+                    true,
+                )
+            )
+        }
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/api/UsosApiTerms.kt

@@ -5,6 +5,7 @@
 package pl.szczodrzynski.edziennik.data.api.edziennik.usos.data.api
 
 import com.google.gson.JsonArray
+import com.google.gson.JsonObject
 import pl.szczodrzynski.edziennik.data.api.ERROR_USOS_API_INCOMPLETE_RESPONSE
 import pl.szczodrzynski.edziennik.data.api.edziennik.usos.DataUsos
 import pl.szczodrzynski.edziennik.data.api.edziennik.usos.ENDPOINT_USOS_API_TERMS
@@ -16,49 +17,81 @@ class UsosApiTerms(
     override val data: DataUsos,
     override val lastSync: Long?,
     val onSuccess: (endpointId: Int) -> Unit,
+    names: Set<String>? = null,
 ) : UsosApi(data, lastSync) {
     companion object {
         const val TAG = "UsosApiTerms"
     }
 
     init {
-        apiRequest<JsonArray>(
-            tag = TAG,
-            service = "terms/search",
-            params = mapOf(
-                "query" to Date.getToday().year.toString(),
-            ),
-            responseType = ResponseType.ARRAY,
-        ) { json, response ->
-            if (!processResponse(json)) {
-                data.error(TAG, ERROR_USOS_API_INCOMPLETE_RESPONSE, response)
-                return@apiRequest
-            }
+        if (names != null) {
+            apiRequest<JsonObject>(
+                tag = TAG,
+                service = "terms/terms",
+                params = mapOf("term_ids" to names.joinToString("|")),
+                responseType = ResponseType.OBJECT,
+            ) { json, response ->
+                if (!processResponse(json.entrySet().map { it.value.asJsonObject })) {
+                    data.error(TAG, ERROR_USOS_API_INCOMPLETE_RESPONSE, response)
+                    return@apiRequest
+                }
 
-            data.setSyncNext(ENDPOINT_USOS_API_TERMS, 7 * DAY)
-            onSuccess(ENDPOINT_USOS_API_TERMS)
+                data.setSyncNext(ENDPOINT_USOS_API_TERMS, 2 * DAY)
+                onSuccess(ENDPOINT_USOS_API_TERMS)
+            }
+        } else {
+            apiRequest<JsonArray>(
+                tag = TAG,
+                service = "terms/search",
+                params = mapOf("query" to Date.getToday().year.toString()),
+                responseType = ResponseType.ARRAY,
+            ) { json, response ->
+                if (!processResponse(json.asJsonObjectList())) {
+                    data.error(TAG, ERROR_USOS_API_INCOMPLETE_RESPONSE, response)
+                    return@apiRequest
+                }
+
+                data.setSyncNext(ENDPOINT_USOS_API_TERMS, 2 * DAY)
+                onSuccess(ENDPOINT_USOS_API_TERMS)
+            }
         }
     }
 
-    private fun processResponse(json: JsonArray): Boolean {
-        val dates = mutableSetOf<Date>()
-        for (term in json.asJsonObjectList()) {
+    private fun processResponse(terms: List<JsonObject>): Boolean {
+        val profile = profile ?: return false
+        val termNames = data.termNames.toMutableMap()
+        val today = Date.getToday()
+        for (term in terms) {
+            val id = term.getString("id")
+            val name = term.getLangString("name")
+            val orderKey = term.getInt("order_key")
+            if (id != null && name != null)
+                termNames[id] = "$orderKey$$name"
+
             if (!term.getBoolean("is_active", false))
                 continue
-            val startDate = term.getString("start_date")?.let { Date.fromY_m_d(it) }
-            val finishDate = term.getString("finish_date")?.let { Date.fromY_m_d(it) }
-            if (startDate != null)
-                dates += startDate
-            if (finishDate != null)
-                dates += finishDate
+            val startDate = term.getString("start_date")?.let { Date.fromY_m_d(it) } ?: continue
+            val finishDate = term.getString("finish_date")?.let { Date.fromY_m_d(it) } ?: continue
+            if (today !in startDate..finishDate)
+                continue
+
+            if (startDate.month >= 8)
+                profile.dateSemester1Start = startDate
+            else
+                profile.dateSemester2Start = startDate
+
+            if (finishDate.month >= 8)
+                profile.dateYearEnd = finishDate
+            else
+                profile.dateSemester2Start = finishDate
         }
-        val datesSorted = dates.sorted()
-        if (datesSorted.size != 3)
-            return false
-        profile?.studentSchoolYearStart = datesSorted[0].year
-        profile?.dateSemester1Start = datesSorted[0]
-        profile?.dateSemester2Start = datesSorted[1]
-        profile?.dateYearEnd = datesSorted[2]
+        // update school year start
+        profile.studentSchoolYearStart = profile.dateSemester1Start.year
+        // update year end date if there is a new year
+        if (profile.dateYearEnd <= profile.dateSemester1Start)
+            profile.dateYearEnd =
+                profile.dateSemester1Start.clone().setYear(profile.dateSemester1Start.year + 1)
+        data.termNames = termNames
         return true
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/api/UsosApiTimetable.kt

@@ -104,8 +104,9 @@ class UsosApiTimetable(
                 it.teacherId = lecturerIds?.firstOrNull() ?: -1L
                 it.teamId = unitId
                 val groupName = classTypeId?.plus(groupNumber)?.let { s -> "($s)" }
-                it.classroom = "$buildingId / $roomNumber ${groupName ?: ""}"
+                it.classroom = "Sala $roomNumber / bud. $buildingId ${groupName ?: ""}"
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
 
                 it.color = when (classTypeId) {
                     "WYK" -> 0xff0d6091

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/api/UsosApiUser.kt

@@ -32,7 +32,8 @@ class UsosApiUser(
                     "last_name",
                     "student_number",
                     "student_programmes" to listOf(
-                        "programme" to listOf("id"),
+                        "id",
+                        "programme" to listOf("id", "description"),
                     ),
                 ),
             ),
@@ -40,9 +41,11 @@ class UsosApiUser(
         ) { json, response ->
             val programmes = json.getJsonArray("student_programmes")
             if (programmes.isNullOrEmpty()) {
-                data.error(ApiError(TAG, ERROR_USOS_NO_STUDENT_PROGRAMMES)
-                    .withApiResponse(json)
-                    .withResponse(response))
+                data.error(
+                    ApiError(TAG, ERROR_USOS_NO_STUDENT_PROGRAMMES)
+                        .withApiResponse(json)
+                        .withResponse(response)
+                )
                 return@apiRequest
             }
 
@@ -50,13 +53,19 @@ class UsosApiUser(
             val lastName = json.getString("last_name")
             val studentName = buildFullName(firstName, lastName)
 
+            val studentProgrammeId = programmes.getJsonObject(0)
+                .getString("id")
+            val programmeId = programmes.getJsonObject(0)
+                .getJsonObject("programme")
+                .getString("id")
+
             data.studentId = json.getInt("id") ?: data.studentId
             profile?.studentNameLong = studentName
             profile?.studentNameShort = studentName.getShortName()
             profile?.studentNumber = json.getInt("student_number", -1)
-            profile?.studentClassName = programmes.getJsonObject(0).getJsonObject("programme").getString("id")
+            profile?.studentClassName = programmeId
 
-            profile?.studentClassName?.let {
+            val team = programmeId?.let {
                 data.getTeam(
                     id = null,
                     name = it,
@@ -64,6 +73,7 @@ class UsosApiUser(
                     isTeamClass = true,
                 )
             }
+            team?.code = "${data.schoolId}:${studentProgrammeId}:${programmeId}"
 
             data.setSyncNext(ENDPOINT_USOS_API_USER, 4 * DAY)
             onSuccess(ENDPOINT_USOS_API_USER)

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/DataVulcan.kt

@@ -12,7 +12,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.crc16
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 import pl.szczodrzynski.fslogin.realm.RealmData
 
 class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app, profile, loginStore) {
@@ -57,7 +59,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSymbol: String? = null
     var symbol: String?
         get() { mSymbol = mSymbol ?: profile?.getStudentData("symbol", null); return mSymbol }
-        set(value) { profile?.putStudentData("symbol", value); mSymbol = value }
+        set(value) { profile["symbol"] = value; mSymbol = value }
 
     /**
      * Group symbol/number of the student's school.
@@ -69,7 +71,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSchoolSymbol: String? = null
     var schoolSymbol: String?
         get() { mSchoolSymbol = mSchoolSymbol ?: profile?.getStudentData("schoolSymbol", null); return mSchoolSymbol }
-        set(value) { profile?.putStudentData("schoolSymbol", value) ?: return; mSchoolSymbol = value }
+        set(value) { profile["schoolSymbol"] = value; mSchoolSymbol = value }
 
     /**
      * Short name of the school, used in some places.
@@ -79,7 +81,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSchoolShort: String? = null
     var schoolShort: String?
         get() { mSchoolShort = mSchoolShort ?: profile?.getStudentData("schoolShort", null); return mSchoolShort }
-        set(value) { profile?.putStudentData("schoolShort", value) ?: return; mSchoolShort = value }
+        set(value) { profile["schoolShort"] = value; mSchoolShort = value }
 
     /**
      * A school code consisting of the [symbol] and [schoolSymbol].
@@ -91,7 +93,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSchoolCode: String? = null
     var schoolCode: String?
         get() { mSchoolCode = mSchoolCode ?: profile?.getStudentData("schoolName", null); return mSchoolCode }
-        set(value) { profile?.putStudentData("schoolName", value) ?: return; mSchoolCode = value }
+        set(value) { profile["schoolName"] = value; mSchoolCode = value }
 
     /**
      * ID of the student.
@@ -101,7 +103,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentId: Int? = null
     var studentId: Int
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", 0); return mStudentId ?: 0 }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
 
     /**
      * ID of the student's account.
@@ -111,7 +113,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentLoginId: Int? = null
     var studentLoginId: Int
         get() { mStudentLoginId = mStudentLoginId ?: profile?.getStudentData("studentLoginId", 0); return mStudentLoginId ?: 0 }
-        set(value) { profile?.putStudentData("studentLoginId", value) ?: return; mStudentLoginId = value }
+        set(value) { profile["studentLoginId"] = value; mStudentLoginId = value }
 
     /**
      * ID of the student's class.
@@ -121,7 +123,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentClassId: Int? = null
     var studentClassId: Int
         get() { mStudentClassId = mStudentClassId ?: profile?.getStudentData("studentClassId", 0); return mStudentClassId ?: 0 }
-        set(value) { profile?.putStudentData("studentClassId", value) ?: return; mStudentClassId = value }
+        set(value) { profile["studentClassId"] = value; mStudentClassId = value }
 
     /**
      * ListaUczniow/IdOkresKlasyfikacyjny, e.g. 321
@@ -129,26 +131,26 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentSemesterId: Int? = null
     var studentSemesterId: Int
         get() { mStudentSemesterId = mStudentSemesterId ?: profile?.getStudentData("studentSemesterId", 0); return mStudentSemesterId ?: 0 }
-        set(value) { profile?.putStudentData("studentSemesterId", value) ?: return; mStudentSemesterId = value }
+        set(value) { profile["studentSemesterId"] = value; mStudentSemesterId = value }
 
     private var mStudentUnitId: Int? = null
     var studentUnitId: Int
         get() { mStudentUnitId = mStudentUnitId ?: profile?.getStudentData("studentUnitId", 0); return mStudentUnitId ?: 0 }
-        set(value) { profile?.putStudentData("studentUnitId", value) ?: return; mStudentUnitId = value }
+        set(value) { profile["studentUnitId"] = value; mStudentUnitId = value }
 
     private var mStudentConstituentId: Int? = null
     var studentConstituentId: Int
         get() { mStudentConstituentId = mStudentConstituentId ?: profile?.getStudentData("studentConstituentId", 0); return mStudentConstituentId ?: 0 }
-        set(value) { profile?.putStudentData("studentConstituentId", value) ?: return; mStudentConstituentId = value }
+        set(value) { profile["studentConstituentId"] = value; mStudentConstituentId = value }
 
     private var mSemester1Id: Int? = null
     var semester1Id: Int
         get() { mSemester1Id = mSemester1Id ?: profile?.getStudentData("semester1Id", 0); return mSemester1Id ?: 0 }
-        set(value) { profile?.putStudentData("semester1Id", value) ?: return; mSemester1Id = value }
+        set(value) { profile["semester1Id"] = value; mSemester1Id = value }
     private var mSemester2Id: Int? = null
     var semester2Id: Int
         get() { mSemester2Id = mSemester2Id ?: profile?.getStudentData("semester2Id", 0); return mSemester2Id ?: 0 }
-        set(value) { profile?.putStudentData("semester2Id", value) ?: return; mSemester2Id = value }
+        set(value) { profile["semester2Id"] = value; mSemester2Id = value }
 
     /**
      * ListaUczniow/OkresNumer, e.g. 1 or 2
@@ -156,7 +158,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentSemesterNumber: Int? = null
     var studentSemesterNumber: Int
         get() { mStudentSemesterNumber = mStudentSemesterNumber ?: profile?.getStudentData("studentSemesterNumber", 0); return mStudentSemesterNumber ?: 0 }
-        set(value) { profile?.putStudentData("studentSemesterNumber", value) ?: return; mStudentSemesterNumber = value }
+        set(value) { profile["studentSemesterNumber"] = value; mStudentSemesterNumber = value }
 
     /**
      * Date of the end of the current semester ([studentSemesterNumber]).
@@ -166,7 +168,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mCurrentSemesterEndDate: Long? = null
     var currentSemesterEndDate: Long
         get() { mCurrentSemesterEndDate = mCurrentSemesterEndDate ?: profile?.getStudentData("currentSemesterEndDate", 0L); return mCurrentSemesterEndDate ?: 0L }
-        set(value) { profile?.putStudentData("currentSemesterEndDate", value) ?: return; mCurrentSemesterEndDate = value }
+        set(value) { profile["currentSemesterEndDate"] = value; mCurrentSemesterEndDate = value }
 
     /*             _____ _____        ____
              /\   |  __ \_   _|      |___ \
@@ -219,17 +221,17 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mHebeContext: String? = null
     var hebeContext: String?
         get() { mHebeContext = mHebeContext ?: profile?.getStudentData("hebeContext", null); return mHebeContext }
-        set(value) { profile?.putStudentData("hebeContext", value) ?: return; mHebeContext = value }
+        set(value) { profile["hebeContext"] = value; mHebeContext = value }
 
     private var mMessageBoxKey: String? = null
     var messageBoxKey: String?
         get() { mMessageBoxKey = mMessageBoxKey ?: profile?.getStudentData("messageBoxKey", null); return mMessageBoxKey }
-        set(value) { profile?.putStudentData("messageBoxKey", value) ?: return; mMessageBoxKey = value }
+        set(value) { profile["messageBoxKey"] = value; mMessageBoxKey = value }
 
     private var mMessageBoxName: String? = null
     var messageBoxName: String?
         get() { mMessageBoxName = mMessageBoxName ?: profile?.getStudentData("messageBoxName", null); return mMessageBoxName }
-        set(value) { profile?.putStudentData("messageBoxName", value) ?: return; mMessageBoxName = value }
+        set(value) { profile["messageBoxName"] = value; mMessageBoxName = value }
 
     val apiUrl: String?
         get() {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/VulcanHebe.kt

@@ -26,6 +26,7 @@ import pl.szczodrzynski.edziennik.utils.Utils.d
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
 import java.net.HttpURLConnection
+import java.net.HttpURLConnection.HTTP_NOT_FOUND
 import java.net.URLEncoder
 import java.time.Instant
 import java.time.LocalDateTime
@@ -183,6 +184,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         payload: JsonElement? = null,
         baseUrl: Boolean = false,
         firebaseToken: String? = null,
+        allow404: Boolean = false,
         crossinline onSuccess: (json: T, response: Response?) -> Unit
     ) {
         val url = "${if (baseUrl) data.apiUrl else data.fullApiUrl}$endpoint"
@@ -295,6 +297,19 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             }
 
             override fun onFailure(response: Response?, throwable: Throwable?) {
+                if (allow404 && response?.code() == HTTP_NOT_FOUND) {
+                    try {
+                        onSuccess(null as T, response)
+                    } catch (e: Exception) {
+                        data.error(
+                            ApiError(tag, EXCEPTION_VULCAN_HEBE_REQUEST)
+                                .withResponse(response)
+                                .withThrowable(e)
+                        )
+                    }
+                    return
+                }
+
                 data.error(
                     ApiError(tag, ERROR_REQUEST_FAILURE)
                         .withResponse(response)
@@ -338,6 +353,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         query: Map<String, String> = mapOf(),
         baseUrl: Boolean = false,
         firebaseToken: String? = null,
+        allow404: Boolean = false,
         crossinline onSuccess: (json: T, response: Response?) -> Unit
     ) {
         val queryPath = query.map {
@@ -348,6 +364,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             if (query.isNotEmpty()) "$endpoint?$queryPath" else endpoint,
             baseUrl = baseUrl,
             firebaseToken = firebaseToken,
+            allow404 = allow404,
             onSuccess = onSuccess
         )
     }
@@ -382,6 +399,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         messageBox: String? = null,
         params: Map<String, String> = mapOf(),
         includeFilterType: Boolean = true,
+        allow404: Boolean = false,
         onSuccess: (data: List<JsonObject>, response: Response?) -> Unit
     ) {
         val url = if (includeFilterType && filterType != null)
@@ -427,8 +445,8 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             )
             .format(DateTimeFormatter.ofPattern("yyyy-MM-dd HH:mm:ss"))
 
-        apiGet(tag, url, query) { json: JsonArray, response ->
-            onSuccess(json.map { it.asJsonObject }, response)
+        apiGet(tag, url, query, allow404 = allow404) { json: JsonArray?, response ->
+            onSuccess(json?.map { it.asJsonObject } ?: listOf(), response)
         }
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/hebe/VulcanHebeAddressbook.kt

@@ -19,6 +19,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_PARENTS_
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_STUDENT
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_TEACHER
 import pl.szczodrzynski.edziennik.ext.*
+import java.net.HttpURLConnection.HTTP_NOT_FOUND
 
 class VulcanHebeAddressbook(
     override val data: DataVulcan,
@@ -41,8 +42,15 @@ class VulcanHebeAddressbook(
             VULCAN_HEBE_ENDPOINT_ADDRESSBOOK,
             HebeFilterType.BY_PERSON,
             lastSync = lastSync,
-            includeFilterType = false
-        ) { list, _ ->
+            includeFilterType = false,
+            allow404 = true,
+        ) { list, response ->
+            if (response?.code() == HTTP_NOT_FOUND) {
+                data.setSyncNext(ENDPOINT_VULCAN_HEBE_ADDRESSBOOK, 2 * DAY)
+                onSuccess(ENDPOINT_VULCAN_HEBE_ADDRESSBOOK)
+                return@apiGetList
+            }
+
             list.forEach { person ->
                 val id = person.getString("Id") ?: return@forEach
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/hebe/VulcanHebeTimetable.kt

@@ -247,7 +247,9 @@ class VulcanHebeTimetable(
             }
 
             lessonObject.id = lessonObject.buildId()
+            lessonObject.ownerId = lessonObject.buildOwnerId()
             lessonShift?.id = lessonShift?.buildId() ?: -1
+            lessonShift?.ownerId = lessonShift?.buildOwnerId() ?: -1
 
             lessonList.add(lessonObject)
             lessonShift?.let { lessonList.add(it) }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/SzkolnyApi.kt

@@ -198,7 +198,6 @@ class SzkolnyApi(val app: App) : CoroutineScope {
         val teams = app.db.teamDao().allNow
 
         val users = profiles.mapNotNull { profile ->
-            val config = app.config.getFor(profile.id)
             val user = ServerSyncRequest.User(
                 profile.userCode,
                 profile.studentNameLong,
@@ -207,9 +206,9 @@ class SzkolnyApi(val app: App) : CoroutineScope {
                 teams.filter { it.profileId == profile.id }.map { it.code }
             )
             val hash = user.toString().md5()
-            if (hash == config.hash)
+            if (hash == profile.config.hash && app.config.hash != "invalid")
                 return@mapNotNull null
-            return@mapNotNull user to config
+            return@mapNotNull user to profile.config
         }
 
         val response = api.serverSync(ServerSyncRequest(
@@ -258,12 +257,10 @@ class SzkolnyApi(val app: App) : CoroutineScope {
                     seen = profile.empty
                     notified = profile.empty
 
-                    if (profile.userCode == event.sharedBy) {
-                        sharedBy = "self"
-                        addedManually = true
-                    } else {
-                        sharedBy = eventSharedBy
-                    }
+                    sharedBy = if (profile.userCode == event.sharedBy)
+                        "self"
+                    else
+                        eventSharedBy
                 }
             }
         }
@@ -327,11 +324,14 @@ class SzkolnyApi(val app: App) : CoroutineScope {
     }
 
     @Throws(Exception::class)
-    fun shareNote(note: Note) {
+    fun shareNote(note: Note, teamId: Long? = null) {
         val profile = app.db.profileDao().getByIdNow(note.profileId)
             ?: throw NullPointerException("Profile is not found")
-        val team = app.db.teamDao().getClassNow(note.profileId)
-            ?: throw NullPointerException("TeamClass is not found")
+        val team = if (teamId == null)
+            app.db.teamDao().getClassNow(note.profileId)
+        else
+            app.db.teamDao().getByIdNow(note.profileId, teamId)
+        team ?: throw NullPointerException("TeamClass is not found")
 
         val response = api.shareNote(NoteShareRequest(
             deviceId = app.deviceId,

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/interceptor/SignatureInterceptor.kt

@@ -29,11 +29,12 @@ class SignatureInterceptor(val app: App) : Interceptor {
         return chain.proceed(
                 request.newBuilder()
                         .header("X-ApiKey", app.config.apiKeyCustom?.takeValue() ?: API_KEY)
-                        .header("X-AppVersion", BuildConfig.VERSION_CODE.toString())
-                        .header("X-Timestamp", timestamp.toString())
-                        .header("X-Signature", sign(timestamp, body, url))
                         .header("X-AppBuild", BuildConfig.BUILD_TYPE)
                         .header("X-AppFlavor", BuildConfig.FLAVOR)
+                        .header("X-AppVersion", BuildConfig.VERSION_CODE.toString())
+                        .header("X-DeviceId", app.deviceId)
+                        .header("X-Signature", sign(timestamp, body, url))
+                        .header("X-Timestamp", timestamp.toString())
                         .build())
     }
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/interceptor/Signing.kt

@@ -46,6 +46,6 @@ object Signing {
 
     /*fun provideKey(param1: String, param2: Long): ByteArray {*/
     fun pleaseStopRightNow(param1: String, param2: Long): ByteArray {
-        return "$param1.MTIzNDU2Nzg5MDCOnsIOWR===.$param2".sha256()
+        return "$param1.MTIzNDU2Nzg5MDn0HBlu/h===.$param2".sha256()
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/task/SzkolnyTask.kt

@@ -55,7 +55,7 @@ class SzkolnyTask(val app: App, val syncingProfiles: List<Profile>) : IApiTask(-
         notificationList
                 .mapNotNull { it.profileId }
                 .distinct()
-                .map { app.config.getFor(it).sync.notificationFilter }
+                .map { app.config[it].sync.notificationFilter }
                 .forEach { filter ->
                     filter.forEach { type ->
                         notificationList.removeAll { it.type == type }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/AppDb.kt

@@ -44,7 +44,7 @@ import pl.szczodrzynski.edziennik.data.db.migration.*
     TimetableManual::class,
     Note::class,
     Metadata::class
-], version = 99)
+], version = 100)
 @TypeConverters(
         ConverterTime::class,
         ConverterDate::class,
@@ -188,6 +188,7 @@ abstract class AppDb : RoomDatabase() {
                 Migration97(),
                 Migration98(),
                 Migration99(),
+                Migration100(),
         ).allowMainThreadQueries().build()
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/converter/ConverterEnums.kt

@@ -5,13 +5,37 @@
 package pl.szczodrzynski.edziennik.data.db.converter
 
 import androidx.room.TypeConverter
+import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
+import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
+import pl.szczodrzynski.edziennik.data.db.enums.LoginMode
+import pl.szczodrzynski.edziennik.data.db.enums.LoginType
+import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.data.db.enums.NotificationType
 import pl.szczodrzynski.edziennik.ext.*
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
 
 class ConverterEnums {
 
     @TypeConverter
-    fun fromEnum(value: Enum<*>?) = value?.toInt()
+    fun fromFeatureType(value: FeatureType?) = value?.id
+
+    @TypeConverter
+    fun fromLoginMethod(value: LoginMethod?) = value?.id
+
+    @TypeConverter
+    fun fromLoginMode(value: LoginMode?) = value?.id
+
+    @TypeConverter
+    fun fromLoginType(value: LoginType?) = value?.id
+
+    @TypeConverter
+    fun fromMetadataType(value: MetadataType?) = value?.id
+
+    @TypeConverter
+    fun fromNotificationType(value: NotificationType?) = value?.id
+
+    @TypeConverter
+    fun fromNavTarget(value: NavTarget?) = value?.id
 
     @TypeConverter
     fun toFeatureType(value: Int?) = value.asFeatureTypeOrNull()

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/EndpointTimerDao.kt

@@ -24,4 +24,7 @@ interface EndpointTimerDao {
 
     @Query("DELETE FROM endpointTimers WHERE profileId = :profileId")
     fun clear(profileId: Int)
+
+    @Query("DELETE FROM endpointTimers")
+    fun clear()
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/EventTypeDao.kt

@@ -25,6 +25,9 @@ abstract class EventTypeDao {
     @Query("DELETE FROM eventTypes WHERE profileId = :profileId")
     abstract fun clear(profileId: Int)
 
+    @Query("DELETE FROM eventTypes WHERE profileId = :profileId AND eventTypeSource = :source")
+    abstract fun clearBySource(profileId: Int, source: Int)
+
     @Query("SELECT * FROM eventTypes WHERE profileId = :profileId AND eventType = :typeId")
     abstract fun getByIdNow(profileId: Int, typeId: Long): EventType?
 
@@ -43,7 +46,7 @@ abstract class EventTypeDao {
         val typeList = data.eventTypes.map {
             EventType(
                 profileId = profile.id,
-                id = it.id.toLong(),
+                id = it.id,
                 name = it.name,
                 color = Color.parseColor(it.color),
                 order = order++,
@@ -53,4 +56,21 @@ abstract class EventTypeDao {
         addAll(typeList)
         return typeList
     }
+
+    fun getAllWithDefaults(profile: Profile): List<EventType> {
+        val eventTypes = getAllNow(profile.id)
+
+        val defaultIdsExpected = AppData.get(profile.loginStoreType).eventTypes
+            .map { it.id }
+        val defaultIdsFound = eventTypes.filter { it.source == SOURCE_DEFAULT }
+            .sortedBy { it.order }
+            .map { it.id }
+
+        if (defaultIdsExpected == defaultIdsFound)
+            return eventTypes
+
+        clearBySource(profile.id, SOURCE_DEFAULT)
+        addDefaultTypes(profile)
+        return eventTypes
+    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/ProfileDao.kt

@@ -28,6 +28,9 @@ interface ProfileDao {
     @Query("SELECT * FROM profiles WHERE profileId = :profileId")
     fun getByIdNow(profileId: Int): Profile?
 
+    @Query("SELECT * FROM profiles WHERE profileId = :profileId")
+    suspend fun getByIdSuspend(profileId: Int): Profile?
+
     @get:Query("SELECT * FROM profiles WHERE profileId >= 0 ORDER BY profileId")
     val all: LiveData<List<Profile>>
 
@@ -49,7 +52,7 @@ interface ProfileDao {
     @get:Query("SELECT profileId FROM profiles WHERE profileId >= 0 ORDER BY profileId")
     val idsNow: List<Int>
 
-    @Query("SELECT profiles.* FROM teams JOIN profiles USING(profileId) WHERE teamCode = :teamCode AND registration = " + Profile.REGISTRATION_ENABLED + " AND enableSharedEvents = 1")
+    @Query("SELECT profiles.* FROM teams JOIN profiles USING(profileId) WHERE teamCode = :teamCode AND registration = " + Profile.REGISTRATION_ENABLED)
     fun getByTeamCodeNowWithRegistration(teamCode: String?): List<Profile>
 
     @get:Query("SELECT profileId FROM profiles WHERE profileId > 0 ORDER BY profileId ASC LIMIT 1")

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/TimetableDao.kt

@@ -107,6 +107,9 @@ abstract class TimetableDao : BaseDao<Lesson, LessonFull> {
     fun getByIdNow(profileId: Int, id: Long) =
             getOneNow("$QUERY WHERE timetable.profileId = $profileId AND timetable.id = $id")
 
+    fun getByOwnerIdNow(profileId: Int, ownerId: Long) =
+            getOneNow("$QUERY WHERE timetable.profileId = $profileId AND timetable.ownerId = $ownerId")
+
     @Query("UPDATE timetable SET keep = 0 WHERE profileId = :profileId AND isExtra = :isExtra AND type != -1 AND ((type != 3 AND date >= :dateFrom) OR ((type = 3 OR type = 1) AND oldDate >= :dateFrom))")
     abstract fun dontKeepFromDate(profileId: Int, dateFrom: Date, isExtra: Boolean)
 

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Event.kt

@@ -73,13 +73,22 @@ open class Event(
         const val COLOR_INFORMATION = 0xff039be5.toInt()
     }
 
+    /**
+     * Added manually - added by self, shared by self, or shared by someone else.
+     */
     @ColumnInfo(name = "eventAddedManually")
     var addedManually: Boolean = false
-        get() = field || sharedBy == "self"
+        get() = field || isShared
+
+    /**
+     * Shared by - user code who shared the event. Null if not shared.
+     * "Self" if shared by this app user.
+     */
     @ColumnInfo(name = "eventSharedBy")
     var sharedBy: String? = null
     @ColumnInfo(name = "eventSharedByName")
     var sharedByName: String? = null
+
     @ColumnInfo(name = "eventBlacklisted")
     var blacklisted: Boolean = false
     @ColumnInfo(name = "eventIsDone")
@@ -104,6 +113,27 @@ open class Event(
     var attachmentIds: MutableList<Long>? = null
     var attachmentNames: MutableList<String>? = null
 
+    val isHomework
+        get() = type == TYPE_HOMEWORK
+
+    /**
+     * Whether the event is shared by anyone. Note that this implies [addedManually].
+     */
+    val isShared
+        get() = sharedBy != null
+
+    /**
+     * Whether the event is shared by "self" (this app user).
+     */
+    val isSharedSent
+        get() = sharedBy == "self"
+
+    /**
+     * Whether the event is shared by someone else from the class group.
+     */
+    val isSharedReceived
+        get() = sharedBy != null && sharedBy != "self"
+
     /**
      * Add an attachment
      * @param id attachment ID
@@ -134,9 +164,6 @@ open class Event(
             it.timeInMillis += 45 * MINUTE * 1000
         }
 
-    val isHomework
-        get() = type == TYPE_HOMEWORK
-
     @Ignore
     fun withMetadata(metadata: Metadata) = EventFull(this, metadata)
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/EventType.kt

@@ -5,31 +5,6 @@ package pl.szczodrzynski.edziennik.data.db.entity
 
 import androidx.room.ColumnInfo
 import androidx.room.Entity
-import pl.szczodrzynski.edziennik.R
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_CLASS_EVENT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_DEFAULT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_ELEARNING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_ESSAY
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_EXAM
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_EXCURSION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_HOMEWORK
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_INFORMATION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_PROJECT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_PT_MEETING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_READING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_SHORT_QUIZ
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_CLASS_EVENT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_DEFAULT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_ELEARNING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_ESSAY
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_EXAM
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_EXCURSION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_HOMEWORK
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_INFORMATION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_PROJECT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_PT_MEETING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_READING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_SHORT_QUIZ
 
 @Entity(
     tableName = "eventTypes",
@@ -55,35 +30,5 @@ class EventType(
         const val SOURCE_REGISTER = 1
         const val SOURCE_CUSTOM = 2
         const val SOURCE_SHARED = 3
-
-        fun getTypeColorMap() = mapOf(
-            TYPE_ELEARNING to COLOR_ELEARNING,
-            TYPE_HOMEWORK to COLOR_HOMEWORK,
-            TYPE_DEFAULT to COLOR_DEFAULT,
-            TYPE_EXAM to COLOR_EXAM,
-            TYPE_SHORT_QUIZ to COLOR_SHORT_QUIZ,
-            TYPE_ESSAY to COLOR_ESSAY,
-            TYPE_PROJECT to COLOR_PROJECT,
-            TYPE_PT_MEETING to COLOR_PT_MEETING,
-            TYPE_EXCURSION to COLOR_EXCURSION,
-            TYPE_READING to COLOR_READING,
-            TYPE_CLASS_EVENT to COLOR_CLASS_EVENT,
-            TYPE_INFORMATION to COLOR_INFORMATION
-        )
-
-        fun getTypeNameMap() = mapOf(
-            TYPE_ELEARNING to R.string.event_type_elearning,
-            TYPE_HOMEWORK to R.string.event_type_homework,
-            TYPE_DEFAULT to R.string.event_other,
-            TYPE_EXAM to R.string.event_exam,
-            TYPE_SHORT_QUIZ to R.string.event_short_quiz,
-            TYPE_ESSAY to R.string.event_essay,
-            TYPE_PROJECT to R.string.event_project,
-            TYPE_PT_MEETING to R.string.event_pt_meeting,
-            TYPE_EXCURSION to R.string.event_excursion,
-            TYPE_READING to R.string.event_reading,
-            TYPE_CLASS_EVENT to R.string.event_class_event,
-            TYPE_INFORMATION to R.string.event_information
-        )
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Grade.kt

@@ -55,6 +55,7 @@ open class Grade(
         const val TYPE_DESCRIPTIVE = 30
         const val TYPE_DESCRIPTIVE_TEXT = 31
         const val TYPE_TEXT = 40
+        const val TYPE_NO_GRADE = 100
     }
 
     @ColumnInfo(name = "gradeValueMax")

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Lesson.kt

@@ -50,6 +50,13 @@ open class Lesson(
 
     var isExtra: Boolean = false
 
+    /**
+     * Stable ID denoting this lesson, used for note sharing (i.e. [profileId]-independent).
+     *
+     * This is simply the Unix timestamp of the lesson (in seconds).
+     */
+    var ownerId: Long = id
+
     val displayDate: Date?
         get() {
             if (type == TYPE_SHIFTED_SOURCE)
@@ -69,7 +76,12 @@ open class Lesson(
     val isChange
         get() = type == TYPE_CHANGE || type == TYPE_SHIFTED_TARGET
 
-    fun buildId(): Long = (displayDate?.combineWith(displayStartTime) ?: 0L) / 6L * 10L + (hashCode() and 0xFFFF)
+    fun buildId(): Long =
+        (displayDate?.combineWith(displayStartTime) ?: 0L) / 6L * 10L +
+                (hashCode() and 0xFFFF)
+
+    fun buildOwnerId(): Long =
+        (displayDate?.combineWith(displayStartTime) ?: 0L)
 
     @Ignore
     var showAsUnseen = false

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Noteable.kt

@@ -9,6 +9,7 @@ interface Noteable {
     fun getNoteType(): Note.OwnerType
     fun getNoteOwnerProfileId(): Int
     fun getNoteOwnerId(): Long
+    fun getNoteShareTeamId(): Long? = null
 
     var notes: MutableList<Note>
 

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Profile.kt

@@ -5,25 +5,18 @@
 package pl.szczodrzynski.edziennik.data.db.entity
 
 import android.content.Context
-import android.graphics.PorterDuff
-import android.graphics.PorterDuffColorFilter
-import android.graphics.drawable.Drawable
 import android.widget.ImageView
-import androidx.core.graphics.drawable.RoundedBitmapDrawableFactory
 import androidx.room.ColumnInfo
 import androidx.room.Entity
 import androidx.room.Ignore
 import com.google.gson.JsonObject
-import pl.droidsonroids.gif.GifDrawable
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
-import pl.szczodrzynski.edziennik.ext.*
-import pl.szczodrzynski.edziennik.utils.ProfileImageHolder
+import pl.szczodrzynski.edziennik.ext.dateToSemester
+import pl.szczodrzynski.edziennik.ext.getDrawable
+import pl.szczodrzynski.edziennik.ext.getHolder
 import pl.szczodrzynski.edziennik.utils.models.Date
-import pl.szczodrzynski.navlib.ImageHolder
-import pl.szczodrzynski.navlib.R
 import pl.szczodrzynski.navlib.drawer.IDrawerProfile
-import pl.szczodrzynski.navlib.getDrawableFromRes
 
 @Entity(tableName = "profiles", primaryKeys = ["profileId"])
 open class Profile(
@@ -60,9 +53,13 @@ open class Profile(
     }
 
     override var image: String? = null
-
     var empty = true
     var archived = false
+    var syncEnabled = true
+    @ColumnInfo(name = "enableSharedEvents")
+    var unused1 = true
+    var registration = REGISTRATION_UNSPECIFIED
+    var userCode = ""
 
     /**
      * A unique ID matching [archived] profiles with current ones
@@ -70,117 +67,35 @@ open class Profile(
      */
     var archiveId: Int? = null
 
-    var syncEnabled = true
-    var enableSharedEvents = true
-    var registration = REGISTRATION_UNSPECIFIED
-    var userCode = ""
-
     /**
      * The student's number in the class register.
      */
     var studentNumber = -1
     var studentClassName: String? = null
     var studentSchoolYearStart = Date.getToday().let { if (it.month < 9) it.year - 1 else it.year }
-
     var dateSemester1Start = Date(studentSchoolYearStart, 9, 1)
     var dateSemester2Start = Date(studentSchoolYearStart + 1, 2, 1)
     var dateYearEnd = Date(studentSchoolYearStart + 1, 6, 30)
-    fun getSemesterStart(semester: Int) = if (semester == 1) dateSemester1Start else dateSemester2Start
-    fun getSemesterEnd(semester: Int) = if (semester == 1) dateSemester2Start.clone().stepForward(0, 0, -1) else dateYearEnd
-    fun dateToSemester(date: Date) = if (date >= dateSemester2Start) 2 else 1
-    @delegate:Ignore
-    val currentSemester by lazy { dateToSemester(Date.getToday()) }
-
-    fun shouldArchive(): Boolean {
-        // vulcan hotfix
-        if (dateYearEnd.month > 6) {
-            dateYearEnd.month = 6
-            dateYearEnd.day = 30
-        }
-        // fix for when versions <4.3 synced 2020/2021 year dates to older profiles during 2020 Jun-Aug
-        if (dateSemester1Start.year > studentSchoolYearStart) {
-            val diff = dateSemester1Start.year - studentSchoolYearStart
-            dateSemester1Start.year -= diff
-            dateSemester2Start.year -= diff
-            dateYearEnd.year -= diff
-        }
-        return App.config.archiverEnabled
-                && Date.getToday() >= dateYearEnd
-                && Date.getToday().year > studentSchoolYearStart
-    }
-    fun isBeforeYear() = false && Date.getToday() < dateSemester1Start
-
     var disabledNotifications: List<Long>? = null
-
     var lastReceiversSync: Long = 0
 
-    fun hasStudentData(key: String) = studentData.has(key)
-    fun getStudentData(key: String, defaultValue: Boolean) = studentData.getBoolean(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: String?) = studentData.getString(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Int) = studentData.getInt(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Long) = studentData.getLong(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Float) = studentData.getFloat(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Char) = studentData.getChar(key) ?: defaultValue
-    fun putStudentData(key: String, value: Boolean) { studentData[key] = value }
-    fun putStudentData(key: String, value: String?) { studentData[key] = value }
-    fun putStudentData(key: String, value: Number) { studentData[key] = value }
-    fun putStudentData(key: String, value: Char) { studentData[key] = value }
-    fun removeStudentData(key: String) { studentData.remove(key) }
-
+    val currentSemester
+        get() = dateToSemester(Date.getToday())
     val isParent
         get() = accountName != null
-
     val accountOwnerName
         get() = accountName ?: studentNameLong
-
-    @Ignore
-    val registerName = loginStoreType.name.lowercase()
-
+    val registerName
+        get() = loginStoreType.name.lowercase()
     val canShare
         get() = registration == REGISTRATION_ENABLED && !archived
 
-    override fun getImageDrawable(context: Context): Drawable {
-        if (archived) {
-            return context.getDrawableFromRes(pl.szczodrzynski.edziennik.R.drawable.profile_archived).also {
-                it.colorFilter = PorterDuffColorFilter(colorFromName(name), PorterDuff.Mode.DST_OVER)
-            }
-        }
+    @delegate:Ignore
+    @delegate:Transient
+    val config by lazy { App.config[this.id] }
 
-        if (!image.isNullOrEmpty()) {
-            try {
-                return if (image?.endsWith(".gif", true) == true) {
-                    GifDrawable(image ?: "")
-                } else {
-                    RoundedBitmapDrawableFactory.create(context.resources, image ?: "")
-                    //return Drawable.createFromPath(image ?: "") ?: throw Exception()
-                }
-            }
-            catch (e: Exception) {
-                e.printStackTrace()
-            }
-        }
-
-        return context.getDrawableFromRes(R.drawable.profile).also {
-            it.colorFilter = PorterDuffColorFilter(colorFromName(name), PorterDuff.Mode.DST_OVER)
-        }
-    }
-
-    override fun getImageHolder(context: Context): ImageHolder {
-        if (archived) {
-            return ImageHolder(pl.szczodrzynski.edziennik.R.drawable.profile_archived, colorFromName(name))
-        }
-
-        return if (!image.isNullOrEmpty()) {
-            try {
-                ProfileImageHolder(image ?: "")
-            } catch (_: Exception) {
-                ImageHolder(R.drawable.profile, colorFromName(name))
-            }
-        }
-        else {
-            ImageHolder(R.drawable.profile, colorFromName(name))
-        }
-    }
+    override fun getImageDrawable(context: Context) = this.getDrawable(context)
+    override fun getImageHolder(context: Context) = this.getHolder()
     override fun applyImageTo(imageView: ImageView) {
         getImageHolder(imageView.context).applyTo(imageView)
     }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/enums/LoginMethod.kt

@@ -6,6 +6,8 @@ package pl.szczodrzynski.edziennik.data.db.enums
 
 import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
+import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 
 enum class LoginMethod(
     val loginType: LoginType,
@@ -26,7 +28,7 @@ enum class LoginMethod(
     MOBIDZIENNIK_API2(
         loginType = LoginType.MOBIDZIENNIK,
         id = 1300,
-        isPossible = { profile, _ -> profile?.studentData?.has("email") ?: false },
+        isPossible = { profile, _ -> profile?.studentData?.getString("email").isNotNullNorBlank() },
     ),
     LIBRUS_PORTAL(
         loginType = LoginType.LIBRUS,
@@ -57,7 +59,7 @@ enum class LoginMethod(
     VULCAN_WEB_MAIN(
         loginType = LoginType.VULCAN,
         id = 4100,
-        isPossible = { _, loginStore -> loginStore.hasLoginData("webHost") },
+        isPossible = { _, loginStore -> loginStore.getLoginData("webHost", null).isNotNullNorBlank() },
     ),
     VULCAN_HEBE(
         loginType = LoginType.VULCAN,

app/src/main/java/pl/szczodrzynski/edziennik/data/db/enums/LoginMode.kt

@@ -17,4 +17,5 @@ enum class LoginMode(
     VULCAN_HEBE(LoginType.VULCAN, id = 402),
     PODLASIE_API(LoginType.PODLASIE, id = 600),
     USOS_OAUTH(LoginType.USOS, id = 700),
+    DEMO(LoginType.DEMO, id = 800),
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/enums/LoginType.kt

@@ -14,7 +14,7 @@ enum class LoginType(
     VULCAN(id = 4, features = FEATURES_VULCAN),
     PODLASIE(id = 6, features = FEATURES_PODLASIE),
     USOS(id = 7, features = FEATURES_USOS, schoolType = SchoolType.UNIVERSITY),
-    DEMO(id = 20, features = setOf()),
+    DEMO(id = 8, features = setOf()),
     TEMPLATE(id = 21, features = setOf()),
 
     // the graveyard

app/src/main/java/pl/szczodrzynski/edziennik/data/db/enums/LoginTypeFeatures.kt

@@ -93,6 +93,7 @@ internal val FEATURES_PODLASIE = setOf(
 internal val FEATURES_USOS = setOf(
     TIMETABLE,
     AGENDA,
+    GRADES,
 
     STUDENT_INFO,
     STUDENT_NUMBER,

app/src/main/java/pl/szczodrzynski/edziennik/data/db/full/EventFull.kt

@@ -9,6 +9,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Event
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.entity.Note
 import pl.szczodrzynski.edziennik.data.db.entity.Noteable
+import pl.szczodrzynski.edziennik.ext.takePositive
 import pl.szczodrzynski.edziennik.ui.search.Searchable
 import pl.szczodrzynski.edziennik.utils.html.BetterHtml
 import pl.szczodrzynski.edziennik.utils.models.Date
@@ -118,4 +119,5 @@ class EventFull(
     override fun getNoteType() = Note.OwnerType.EVENT
     override fun getNoteOwnerProfileId() = profileId
     override fun getNoteOwnerId() = id
+    override fun getNoteShareTeamId() = teamId.takePositive()
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/full/LessonFull.kt

@@ -9,6 +9,7 @@ import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.data.db.entity.Lesson
 import pl.szczodrzynski.edziennik.data.db.entity.Note
 import pl.szczodrzynski.edziennik.data.db.entity.Noteable
+import pl.szczodrzynski.edziennik.ext.takePositive
 import pl.szczodrzynski.edziennik.utils.models.Time
 
 class LessonFull(
@@ -137,9 +138,10 @@ class LessonFull(
     var seen: Boolean = false
     var notified: Boolean = false
 
-    @Relation(parentColumn = "id", entityColumn = "noteOwnerId", entity = Note::class)
+    @Relation(parentColumn = "ownerId", entityColumn = "noteOwnerId", entity = Note::class)
     override lateinit var notes: MutableList<Note>
     override fun getNoteType() = Note.OwnerType.LESSON
     override fun getNoteOwnerProfileId() = profileId
-    override fun getNoteOwnerId() = id
+    override fun getNoteOwnerId() = ownerId
+    override fun getNoteShareTeamId() = teamId.takePositive()
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/migration/Migration100.kt

@@ -0,0 +1,25 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-25.
+ */
+
+package pl.szczodrzynski.edziennik.data.db.migration
+
+import androidx.room.migration.Migration
+import androidx.sqlite.db.SupportSQLiteDatabase
+
+class Migration100 : Migration(99, 100) {
+    override fun migrate(database: SupportSQLiteDatabase) {
+        // add Note Owner ID to Lesson, to make it profileId-independent
+        // calculate the new owner ID based on the old ID
+        database.execSQL("ALTER TABLE timetable ADD COLUMN ownerId INT NOT NULL DEFAULT 0;")
+        // set new ID for actual lessons
+        database.execSQL("UPDATE timetable SET ownerId = ROUND((id & ~65535) / 500000.0) * 300000;")
+        // copy the old ID (date value) for NO_LESSONS
+        database.execSQL("UPDATE timetable SET ownerId = id WHERE type = -1;")
+        // update ID for notes as well
+        database.execSQL("UPDATE notes SET noteOwnerId = ROUND((noteOwnerId & ~65535) / 500000.0) * 300000 WHERE noteOwnerType = 'LESSON' AND noteOwnerId > 2000000000000;")
+        // force full app sync to download notes with new IDs
+        database.execSQL("DELETE FROM config WHERE `key` = 'hash';")
+        database.execSQL("DELETE FROM config WHERE `key` = 'lastAppSync';")
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyAppFirebase.kt

@@ -160,11 +160,11 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
             if (event.color == -1)
                 event.color = null
 
+            event.addedManually = true
             event.sharedBy = json.getString("sharedBy")
             event.sharedByName = json.getString("sharedByName")
             if (profile.userCode == event.sharedBy) {
                 event.sharedBy = "self"
-                event.addedManually = true
             }
 
             val metadata = Metadata(
@@ -176,7 +176,7 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
             )
 
             val type = if (event.isHomework) NotificationType.SHARED_HOMEWORK else NotificationType.SHARED_EVENT
-            val notificationFilter = app.config.getFor(event.profileId).sync.notificationFilter
+            val notificationFilter = app.config[event.profileId].sync.notificationFilter
 
             if (!notificationFilter.contains(type) && event.sharedBy != "self" && event.date >= Date.getToday()) {
                 val notification = Notification(
@@ -211,7 +211,7 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
             val profile = profiles.firstOrNull { it.id == team.profileId } ?: return@forEach
             if (!profile.canShare)
                 return@forEach
-            val notificationFilter = app.config.getFor(team.profileId).sync.notificationFilter
+            val notificationFilter = app.config[team.profileId].sync.notificationFilter
 
             if (!notificationFilter.contains(NotificationType.REMOVED_SHARED_EVENT)) {
                 val notification = Notification(
@@ -265,7 +265,7 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
                 return@forEach
 
             val type = NotificationType.SHARED_NOTE
-            val notificationFilter = app.config.getFor(note.profileId).sync.notificationFilter
+            val notificationFilter = app.config[note.profileId].sync.notificationFilter
 
             if (!notificationFilter.contains(type) && note.sharedBy != "self") {
                 val notification = Notification(

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyLibrusFirebase.kt

@@ -6,12 +6,37 @@ package pl.szczodrzynski.edziennik.data.firebase
 
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.api.edziennik.EdziennikTask
-import pl.szczodrzynski.edziennik.data.api.edziennik.librus.*
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_ANNOUNCEMENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_ATTENDANCES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_BEHAVIOUR_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_BEHAVIOUR_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_BEHAVIOUR_GRADE_COMMENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_CLASS_FREE_DAYS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_DESCRIPTIVE_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_DESCRIPTIVE_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_DESCRIPTIVE_TEXT_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_EVENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_HOMEWORK
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_LUCKY_NUMBER
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NORMAL_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NORMAL_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NORMAL_GRADE_COMMENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NOTICES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_POINT_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_POINT_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_PT_MEETINGS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_SCHOOL_FREE_DAYS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_TEACHER_FREE_DAYS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_TEXT_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_TIMETABLES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_MESSAGES_RECEIVED
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_SYNERGIA_HOMEWORK
 import pl.szczodrzynski.edziennik.data.api.task.IApiTask
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.getStudentData
 
 class SzkolnyLibrusFirebase(val app: App, val profiles: List<Profile>, val message: FirebaseService.Message) {
     /*{

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyMobidziennikFirebase.kt

@@ -12,6 +12,7 @@ import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.ext.getLong
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.getStudentData
 
 class SzkolnyMobidziennikFirebase(val app: App, val profiles: List<Profile>, val message: FirebaseService.Message) {
     /*{

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyVulcanFirebase.kt

@@ -4,15 +4,15 @@
 
 package pl.szczodrzynski.edziennik.data.firebase
 
-import pl.szczodrzynski.edziennik.*
+import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.api.edziennik.EdziennikTask
 import pl.szczodrzynski.edziennik.data.api.task.IApiTask
-import pl.szczodrzynski.edziennik.data.db.entity.Message
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.ext.getInt
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.toJsonObject
 
 class SzkolnyVulcanFirebase(val app: App, val profiles: List<Profile>, val message: FirebaseService.Message) {

app/src/main/java/pl/szczodrzynski/edziennik/ext/DataExtensions.kt

@@ -6,14 +6,9 @@ package pl.szczodrzynski.edziennik.ext
 
 import android.util.LongSparseArray
 import androidx.core.util.forEach
-import com.google.android.material.datepicker.CalendarConstraints
-import com.google.gson.JsonElement
-import pl.szczodrzynski.edziennik.App
-import pl.szczodrzynski.edziennik.config.AppData
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher
 import pl.szczodrzynski.edziennik.data.db.entity.Team
-import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 
 fun List<Teacher>.byId(id: Long) = firstOrNull { it.id == id }
 fun List<Teacher>.byNameFirstLast(nameFirstLast: String) = firstOrNull { it.name + " " + it.surname == nameFirstLast }
@@ -34,22 +29,3 @@ fun LongSparseArray<Team>.getById(id: Long): Team? {
     }
     return null
 }
-
-operator fun Profile.set(key: String, value: JsonElement) = this.studentData.add(key, value)
-operator fun Profile.set(key: String, value: Boolean) = this.studentData.addProperty(key, value)
-operator fun Profile.set(key: String, value: String?) = this.studentData.addProperty(key, value)
-operator fun Profile.set(key: String, value: Number) = this.studentData.addProperty(key, value)
-operator fun Profile.set(key: String, value: Char) = this.studentData.addProperty(key, value)
-
-fun Profile.getSchoolYearConstrains(): CalendarConstraints {
-    return CalendarConstraints.Builder()
-        .setStart(dateSemester1Start.inMillisUtc)
-        .setEnd(dateYearEnd.inMillisUtc)
-        .build()
-}
-
-fun Profile.hasFeature(featureType: FeatureType) = featureType in this.loginStoreType.features
-fun Profile.hasUIFeature(featureType: FeatureType) = featureType.isUIAlwaysAvailable || hasFeature(featureType)
-
-fun Profile.getAppData() =
-    if (App.profileId == this.id) App.data else AppData.get(this.loginStoreType)