[Actions] Rename changelog output name.

* [App] Add base for AppData loading.

* [UI] Fix timetable widget date navigation.

* [UI] Migrate register-specific behavior to use AppData.

* [App] Implement new delegate-based config base.

* [Config] Migrate config and profile config.

* [Config] Remove defaults from migrations.

* [App] Apply event types and config overrides from AppData.

* [Events] Change default event types for university type school.

.github/utils/extract_changelogs.py

@@ -23,11 +23,11 @@ if __name__ == "__main__":
     (title, changelog) = get_changelog(project_dir, format="plain")
 
     # plain text changelog - Firebase App Distribution
-    with open(dir + "whatsnew-titled.txt", "w", encoding="utf-8") as f:
+    with open(dir + "whatsnew_titled.txt", "w", encoding="utf-8") as f:
         f.write(title)
         f.write("\n")
         f.write(changelog)
-    print("::set-output name=changelogPlainTitledFile::" + dir + "whatsnew-titled.txt")
+    print("::set-output name=changelogPlainTitledFile::" + dir + "whatsnew_titled.txt")
 
     print("::set-output name=changelogTitle::" + title)
 

.github/workflows/build-release-aab-play.yml

@@ -113,10 +113,11 @@ jobs:
         with:
           serviceAccountJsonPlainText: ${{ secrets.PLAY_SERVICE_ACCOUNT_JSON }}
           packageName: pl.szczodrzynski.edziennik
-          releaseFile: ${{ needs.sign.outputs.signedReleaseFile }}
+          releaseFiles: ${{ needs.sign.outputs.signedReleaseFile }}
           releaseName: ${{ steps.changelog.outputs.appVersionName }}
           track: ${{ secrets.PLAY_RELEASE_TRACK }}
           whatsNewDirectory: ${{ steps.changelog.outputs.changelogDir }}
+          status: completed
 
       - name: Upload workflow artifact
         uses: actions/upload-artifact@v2

.idea/codeStyles/Project.xml

@@ -1,9 +1,17 @@
 <component name="ProjectCodeStyleConfiguration">
   <code_scheme name="Project" version="173">
     <JetCodeStyleSettings>
+      <option name="NAME_COUNT_TO_USE_STAR_IMPORT" value="2147483647" />
       <option name="ALLOW_TRAILING_COMMA" value="true" />
       <option name="CODE_STYLE_DEFAULTS" value="KOTLIN_OFFICIAL" />
     </JetCodeStyleSettings>
+    <codeStyleSettings language="JSON">
+      <indentOptions>
+        <option name="INDENT_SIZE" value="4" />
+        <option name="USE_TAB_CHARACTER" value="true" />
+        <option name="SMART_TABS" value="true" />
+      </indentOptions>
+    </codeStyleSettings>
     <codeStyleSettings language="XML">
       <option name="FORCE_REARRANGE_MODE" value="1" />
       <indentOptions>

.idea/dictionaries/Kuba.xml

@@ -5,6 +5,7 @@
       <w>ciasteczko</w>
       <w>csrf</w>
       <w>edziennik</w>
+      <w>eggfall</w>
       <w>elearning</w>
       <w>gson</w>
       <w>hebe</w>

app/build.gradle

@@ -156,6 +156,7 @@ dependencies {
     implementation "androidx.navigation:navigation-fragment-ktx:2.5.2"
     implementation "androidx.recyclerview:recyclerview:1.2.1"
     implementation "androidx.room:room-runtime:2.4.3"
+    implementation "androidx.room:room-ktx:2.4.3"
     implementation "androidx.work:work-runtime-ktx:2.7.1"
     kapt "androidx.room:room-compiler:2.4.3"
 
@@ -208,7 +209,7 @@ dependencies {
     implementation "com.daimajia.swipelayout:library:1.2.0@aar"
     implementation "com.github.Applandeo:Material-Calendar-View:15de569cbc" // https://github.com/Applandeo/Material-Calendar-View
     implementation "com.github.CanHub:Android-Image-Cropper:2.2.2" // https://github.com/CanHub/Android-Image-Cropper
-    implementation "com.github.ChuckerTeam.Chucker:library:3.0.1" // https://github.com/ChuckerTeam/chucker
+    implementation "com.github.ChuckerTeam.Chucker:library:3.5.2" // https://github.com/ChuckerTeam/chucker
     implementation "com.github.antonKozyriatskyi:CircularProgressIndicator:1.2.2" // https://github.com/antonKozyriatskyi/CircularProgressIndicator
     implementation "com.github.bassaer:chatmessageview:2.0.1" // https://github.com/bassaer/ChatMessageView
     implementation "com.github.hypertrack:hyperlog-android:0.0.10" // https://github.com/hypertrack/hyperlog-android

app/proguard-rules.pro

@@ -22,6 +22,7 @@
 -keep class android.support.v7.widget.** { *; }
 
 -keep class pl.szczodrzynski.edziennik.utils.models.** { *; }
+-keep class pl.szczodrzynski.edziennik.data.db.enums.* { *; }
 -keep class pl.szczodrzynski.edziennik.data.db.entity.Event { *; }
 -keep class pl.szczodrzynski.edziennik.data.db.full.EventFull { *; }
 -keep class pl.szczodrzynski.edziennik.data.db.entity.FeedbackMessage { *; }
@@ -31,6 +32,9 @@
 -keepnames class pl.szczodrzynski.edziennik.ui.widgets.timetable.WidgetTimetableProvider
 -keepnames class pl.szczodrzynski.edziennik.ui.widgets.notifications.WidgetNotificationsProvider
 -keepnames class pl.szczodrzynski.edziennik.ui.widgets.luckynumber.WidgetLuckyNumberProvider
+-keep class pl.szczodrzynski.edziennik.config.AppData { *; }
+-keep class pl.szczodrzynski.edziennik.config.AppData$** { *; }
+-keep class pl.szczodrzynski.edziennik.utils.managers.TextStylingManager$HtmlMode { *; }
 
 -keepnames class androidx.appcompat.view.menu.MenuBuilder { setHeaderTitleInt(java.lang.CharSequence); }
 -keepnames class androidx.appcompat.view.menu.MenuPopupHelper { showPopup(int, int, boolean, boolean); }

app/src/main/AndroidManifest.xml

@@ -160,7 +160,11 @@
         <activity android:name=".ui.login.oauth.OAuthLoginActivity"
             android:configChanges="orientation|keyboardHidden"
             android:exported="false"
-            android:theme="@style/AppTheme.Light" />
+            android:theme="@style/Theme.MaterialComponents.Light.DarkActionBar" />
+        <activity android:name=".ui.login.recaptcha.RecaptchaActivity"
+            android:configChanges="orientation|keyboardHidden"
+            android:exported="false"
+            android:theme="@style/Theme.MaterialComponents.Light.DarkActionBar" />
         <activity android:name=".ui.base.BuildInvalidActivity" android:exported="false" />
         <activity android:name=".ui.settings.contributors.ContributorsActivity" android:exported="false" />
 

app/src/main/assets/pl-changelog.html

@@ -1,12 +1,10 @@
-<h3>Wersja 4.13-beta.3, 2022-10-20</h3>
+<h3>Wersja 4.13.6, 2023-03-24</h3>
 <ul>
-    <li>Poprawione powiadomienia na Androidzie 13. @santoni0</li>
-    <li>Możliwość dostosowania wyświetlania planu lekcji</li>
-    <li>Opcja kolorowania bloków w planie lekcji</li>
-    <li><b>USOS</b> - pierwsza wersja obsługi systemu</li>
-    <li>Poprawione opcje filtrowania powiadomień i wyboru przycisków menu bocznego.</li>
+    <li>Naprawiono pobieranie załączników na Androidzie 13 i nowszym.</li>
+    <li>Dodano opcję odświeżenia planu lekcji na wybrany tydzień.</li>
+    <li>Usunięto błędy logowania. @BxOxSxS</li>
 </ul>
 <br>
 <br>
 Dzięki za korzystanie ze Szkolnego!<br>
-<i>&copy; [Kuba Szczodrzyński](@kuba2k2), [Kacper Ziubryniewicz](@kapi2289) 2022</i>
+<i>&copy; [Kuba Szczodrzyński](@kuba2k2) 2023</i>

app/src/main/cpp/szkolny-signing.cpp

@@ -9,7 +9,7 @@
 
 /*secret password - removed for source code publication*/
 static toys AES_IV[16] = {
-	0x74, 0xc9, 0x77, 0x6d, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff  };
+	0x6d, 0xa5, 0x32, 0xe6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff  };
 
 unsigned char *agony(unsigned int laugh, unsigned char *box, unsigned char *heat);
 

app/src/main/java/pl/szczodrzynski/edziennik/App.kt

@@ -12,6 +12,7 @@ import android.graphics.drawable.Icon
 import android.os.Build
 import android.provider.Settings
 import android.util.Log
+import android.widget.Toast
 import androidx.appcompat.app.AppCompatDelegate
 import androidx.multidex.MultiDexApplication
 import androidx.work.Configuration
@@ -27,10 +28,15 @@ import com.google.gson.Gson
 import com.hypertrack.hyperlog.HyperLog
 import com.mikepenz.iconics.Iconics
 import im.wangchao.mhttp.MHttp
-import kotlinx.coroutines.*
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.Job
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 import me.leolin.shortcutbadger.ShortcutBadger
 import okhttp3.OkHttpClient
 import org.greenrobot.eventbus.EventBus
+import pl.szczodrzynski.edziennik.config.AppData
 import pl.szczodrzynski.edziennik.config.Config
 import pl.szczodrzynski.edziennik.data.api.events.ProfileListEmptyEvent
 import pl.szczodrzynski.edziennik.data.api.szkolny.SzkolnyApi
@@ -48,18 +54,39 @@ import pl.szczodrzynski.edziennik.sync.SyncWorker
 import pl.szczodrzynski.edziennik.sync.UpdateWorker
 import pl.szczodrzynski.edziennik.ui.base.CrashActivity
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
-import pl.szczodrzynski.edziennik.utils.*
+import pl.szczodrzynski.edziennik.utils.DebugLogFormat
+import pl.szczodrzynski.edziennik.utils.PermissionChecker
+import pl.szczodrzynski.edziennik.utils.Themes
+import pl.szczodrzynski.edziennik.utils.Utils
 import pl.szczodrzynski.edziennik.utils.Utils.d
-import pl.szczodrzynski.edziennik.utils.managers.*
+import pl.szczodrzynski.edziennik.utils.managers.AttendanceManager
+import pl.szczodrzynski.edziennik.utils.managers.AvailabilityManager
+import pl.szczodrzynski.edziennik.utils.managers.BuildManager
+import pl.szczodrzynski.edziennik.utils.managers.EventManager
+import pl.szczodrzynski.edziennik.utils.managers.GradesManager
+import pl.szczodrzynski.edziennik.utils.managers.MessageManager
+import pl.szczodrzynski.edziennik.utils.managers.NoteManager
+import pl.szczodrzynski.edziennik.utils.managers.NotificationChannelsManager
+import pl.szczodrzynski.edziennik.utils.managers.PermissionManager
+import pl.szczodrzynski.edziennik.utils.managers.TextStylingManager
+import pl.szczodrzynski.edziennik.utils.managers.TimetableManager
+import pl.szczodrzynski.edziennik.utils.managers.UpdateManager
+import pl.szczodrzynski.edziennik.utils.managers.UserActionManager
 import java.util.concurrent.TimeUnit
 import kotlin.coroutines.CoroutineContext
+import kotlin.system.exitProcess
 
 class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
     companion object {
         @Volatile
         lateinit var db: AppDb
+            private set
         lateinit var config: Config
+            // private set // for LabFragment
         lateinit var profile: Profile
+            private set
+        lateinit var data: AppData
+            private set
         val profileId
             get() = profile.id
 
@@ -69,18 +96,19 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
     }
 
     val api by lazy { SzkolnyApi(this) }
-    val notificationChannelsManager by lazy { NotificationChannelsManager(this) }
-    val userActionManager by lazy { UserActionManager(this) }
-    val gradesManager by lazy { GradesManager(this) }
-    val timetableManager by lazy { TimetableManager(this) }
-    val eventManager by lazy { EventManager(this) }
-    val permissionManager by lazy { PermissionManager(this) }
     val attendanceManager by lazy { AttendanceManager(this) }
-    val buildManager by lazy { BuildManager(this) }
     val availabilityManager by lazy { AvailabilityManager(this) }
-    val textStylingManager by lazy { TextStylingManager(this) }
+    val buildManager by lazy { BuildManager(this) }
+    val eventManager by lazy { EventManager(this) }
+    val gradesManager by lazy { GradesManager(this) }
     val messageManager by lazy { MessageManager(this) }
     val noteManager by lazy { NoteManager(this) }
+    val notificationChannelsManager by lazy { NotificationChannelsManager(this) }
+    val permissionManager by lazy { PermissionManager(this) }
+    val textStylingManager by lazy { TextStylingManager(this) }
+    val timetableManager by lazy { TimetableManager(this) }
+    val updateManager by lazy { UpdateManager(this) }
+    val userActionManager by lazy { UserActionManager(this) }
 
     val db
         get() = App.db
@@ -90,6 +118,8 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         get() = App.profile
     val profileId
         get() = App.profileId
+    val data
+        get() = App.data
 
     private val job = Job()
     override val coroutineContext: CoroutineContext
@@ -124,9 +154,6 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         SSLProviderInstaller.enableSupportedTls(builder, enableCleartext = true)
 
         if (devMode) {
-            HyperLog.initialize(this)
-            HyperLog.setLogLevel(Log.VERBOSE)
-            HyperLog.setLogFormat(DebugLogFormat(this))
             if (enableChucker) {
                 val chuckerCollector = ChuckerCollector(this, true, RetentionManager.Period.ONE_HOUR)
                 val chuckerInterceptor = ChuckerInterceptor(this, chuckerCollector)
@@ -181,15 +208,23 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         Iconics.respectFontBoundsDefault = true
 
         // initialize companion object values
+        AppData.read(this)
         App.db = AppDb(this)
         App.config = Config(App.db)
-        App.profile = Profile(0, 0, LoginType.TEMPLATE, "")
         debugMode = BuildConfig.DEBUG
         devMode = config.devMode ?: debugMode
         enableChucker = config.enableChucker ?: devMode
 
+        if (devMode) {
+            HyperLog.initialize(this)
+            HyperLog.setLogLevel(Log.VERBOSE)
+            HyperLog.setLogFormat(DebugLogFormat(this))
+        }
+
         if (!profileLoadById(config.lastProfileId)) {
-            db.profileDao().firstId?.let { profileLoadById(it) }
+            val success = db.profileDao().firstId?.let { profileLoadById(it) }
+            if (success != true)
+                profileLoad(Profile(0, 0, LoginType.TEMPLATE, ""))
         }
 
         buildHttp()
@@ -200,6 +235,7 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         }
 
         Signing.getCert(this)
+        Utils.initializeStorageDir(this)
 
         launch {
             withContext(Dispatchers.Default) {
@@ -381,10 +417,28 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
         }
     }
 
+    fun profileLoad(profile: Profile) {
+        App.profile = profile
+        App.config.lastProfileId = profile.id
+        try {
+            App.data = AppData.get(profile.loginStoreType)
+            d("App", "Loaded AppData: ${App.data}")
+            // apply newly-added config overrides, if not changed by the user yet
+            for ((key, value) in App.data.configOverrides) {
+                val config = App.profile.config
+                if (!config.has(key))
+                    config.set(key, value)
+            }
+        } catch (e: Exception) {
+            Log.e("App", "Cannot load AppData", e)
+            Toast.makeText(this, R.string.app_cannot_load_data, Toast.LENGTH_LONG).show()
+            exitProcess(0)
+        }
+    }
+
     private fun profileLoadById(profileId: Int): Boolean {
         db.profileDao().getByIdNow(profileId)?.also {
-            App.profile = it
-            App.config.lastProfileId = it.id
+            profileLoad(it)
             return true
         }
         return false
@@ -415,6 +469,8 @@ class App : MultiDexApplication(), Configuration.Provider, CoroutineScope {
     }
     fun profileSave() = profileSave(profile)
     fun profileSave(profile: Profile) {
+        if (profile.id == profileId)
+            App.profile = profile
         launch(Dispatchers.Default) {
             App.db.profileDao().add(profile)
         }

app/src/main/java/pl/szczodrzynski/edziennik/MainActivity.kt

@@ -42,11 +42,11 @@ import pl.szczodrzynski.edziennik.data.db.entity.Message
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata.*
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
-import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.databinding.ActivitySzkolnyBinding
 import pl.szczodrzynski.edziennik.ext.*
 import pl.szczodrzynski.edziennik.sync.AppManagerDetectedEvent
 import pl.szczodrzynski.edziennik.sync.SyncWorker
+import pl.szczodrzynski.edziennik.sync.UpdateStateEvent
 import pl.szczodrzynski.edziennik.sync.UpdateWorker
 import pl.szczodrzynski.edziennik.ui.base.MainSnackbar
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
@@ -57,6 +57,7 @@ import pl.szczodrzynski.edziennik.ui.dialogs.sync.RegisterUnavailableDialog
 import pl.szczodrzynski.edziennik.ui.dialogs.sync.ServerMessageDialog
 import pl.szczodrzynski.edziennik.ui.dialogs.sync.SyncViewListDialog
 import pl.szczodrzynski.edziennik.ui.dialogs.sync.UpdateAvailableDialog
+import pl.szczodrzynski.edziennik.ui.dialogs.sync.UpdateProgressDialog
 import pl.szczodrzynski.edziennik.ui.error.ErrorDetailsDialog
 import pl.szczodrzynski.edziennik.ui.error.ErrorSnackbar
 import pl.szczodrzynski.edziennik.ui.event.EventManualDialog
@@ -321,7 +322,7 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
 
         // IT'S WINTER MY DUDES
         val today = Date.getToday()
-        if ((today.month % 11 == 1) && app.config.ui.snowfall) {
+        if ((today.month / 3 % 4 == 0) && app.config.ui.snowfall) {
             b.rootFrame.addView(layoutInflater.inflate(R.layout.snowfall, b.rootFrame, false))
         } else if (app.config.ui.eggfall && BigNightUtil().isDataWielkanocyNearDzisiaj()) {
             val eggfall = layoutInflater.inflate(
@@ -427,7 +428,7 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
                 launch {
                     withContext(Dispatchers.Default) {
                         app.db.profileDao().allNow.forEach { profile ->
-                            if (profile.loginStoreType != LoginType.LIBRUS)
+                            if (!profile.getAppData().uiConfig.enableMarkAsReadAnnouncements)
                                 app.db.metadataDao()
                                     .setAllSeenExceptMessagesAndAnnouncements(profile.id, true)
                             else
@@ -537,6 +538,14 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
         UpdateAvailableDialog(this, event).show()
     }
 
+    @Subscribe(threadMode = ThreadMode.MAIN, sticky = true)
+    fun onUpdateStateEvent(event: UpdateStateEvent) {
+        if (!event.running)
+            return
+        EventBus.getDefault().removeStickyEvent(event)
+        UpdateProgressDialog(this, event.update ?: return, event.downloadId).show()
+    }
+
     @Subscribe(threadMode = ThreadMode.MAIN, sticky = true)
     fun onRegisterAvailabilityEvent(event: RegisterAvailabilityEvent) {
         EventBus.getDefault().removeStickyEvent(event)
@@ -695,11 +704,15 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
         }
         d(TAG, "}")
 
-        val intentProfileId = extras.getIntOrNull("profileId")
+        val intentProfileId = extras.getIntOrNull("profileId").takePositive()
         var intentNavTarget = extras.getIntOrNull("fragmentId").asNavTargetOrNull()
 
         if (extras?.containsKey("action") == true) {
             val handled = when (extras.getString("action")) {
+                "updateRequest" -> {
+                    UpdateAvailableDialog(this, app.config.update).show()
+                    true
+                }
                 "serverMessage" -> {
                     ServerMessageDialog(
                         this,
@@ -743,8 +756,8 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
         }
 
         if (extras?.containsKey("reloadProfileId") == true) {
-            val reloadProfileId = extras.getIntOrNull("reloadProfileId")
-            if (reloadProfileId == -1 || app.profile.id == reloadProfileId) {
+            val reloadProfileId = extras.getIntOrNull("reloadProfileId").takePositive()
+            if (reloadProfileId == null || app.profile.id == reloadProfileId) {
                 reloadTarget()
                 return
             }
@@ -767,7 +780,7 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
                 navTarget = intentNavTarget,
                 args = extras,
             )
-            intentProfileId != -1 -> navigate(
+            intentProfileId != null -> navigate(
                 profileId = intentProfileId,
                 navTarget = intentNavTarget,
                 args = extras,
@@ -776,6 +789,7 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
                 navTarget = intentNavTarget,
                 args = extras,
             )
+            navLoading -> navigate()
             else -> drawer.currentProfile = app.profile.id
         }
         navLoading = false
@@ -923,7 +937,8 @@ class MainActivity : AppCompatActivity(), CoroutineScope {
         }
 
         if (profileChanged) {
-            App.profile = profile
+            if (App.profileId != profile.id)
+                app.profileLoad(profile)
             MessagesFragment.pageSelection = -1
             // set new drawer items for this profile
             setDrawerItems()

app/src/main/java/pl/szczodrzynski/edziennik/config/AbstractConfig.kt

@@ -1,9 +0,0 @@
-/*
- * Copyright (c) Kuba Szczodrzyński 2019-11-27.
- */
-
-package pl.szczodrzynski.edziennik.config
-
-interface AbstractConfig {
-    fun set(key: String, value: String?)
-}

app/src/main/java/pl/szczodrzynski/edziennik/config/AppData.kt

@@ -0,0 +1,70 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-21.
+ */
+
+package pl.szczodrzynski.edziennik.config
+
+import com.google.gson.Gson
+import com.google.gson.JsonObject
+import com.google.gson.JsonParser
+import com.google.gson.stream.JsonReader
+import pl.szczodrzynski.edziennik.App
+import pl.szczodrzynski.edziennik.R
+import pl.szczodrzynski.edziennik.data.db.enums.LoginType
+import pl.szczodrzynski.edziennik.ext.getJsonObject
+import pl.szczodrzynski.edziennik.ext.mergeWith
+import pl.szczodrzynski.edziennik.utils.managers.TextStylingManager.HtmlMode
+
+data class AppData(
+    val configOverrides: Map<String, String>,
+    val messagesConfig: MessagesConfig,
+    val uiConfig: UIConfig,
+    val eventTypes: List<EventType>,
+) {
+    companion object {
+        private var data: JsonObject? = null
+        private val appData = mutableMapOf<LoginType, AppData>()
+
+        fun read(app: App) {
+            val res = app.resources.openRawResource(R.raw.app_data)
+            data = JsonParser.parseReader(JsonReader(res.reader())).asJsonObject
+        }
+
+        fun get(loginType: LoginType): AppData {
+            if (loginType in appData)
+                return appData.getValue(loginType)
+            val json = data?.getJsonObject("base")?.deepCopy()
+                ?: throw NoSuchElementException("Base data not found")
+            val overrides = setOf(loginType, loginType.schoolType)
+            for (overrideType in overrides) {
+                val override = data?.getJsonObject(overrideType.name.lowercase()) ?: continue
+                json.mergeWith(override)
+            }
+            val value = Gson().fromJson(json, AppData::class.java)
+            appData[loginType] = value
+            return value
+        }
+    }
+
+    data class MessagesConfig(
+        val subjectLength: Int?,
+        val bodyLength: Int?,
+        val textStyling: Boolean,
+        val syncRecipientList: Boolean,
+        val htmlMode: HtmlMode,
+        val needsReadStatus: Boolean,
+    )
+
+    data class UIConfig(
+        val lessonHeight: Int,
+        val enableMarkAsReadAnnouncements: Boolean,
+        val enableNoticePoints: Boolean,
+        val eventManualShowSubjectDropdown: Boolean,
+    )
+
+    data class EventType(
+        val id: Long,
+        val color: String,
+        val name: String,
+    )
+}

app/src/main/java/pl/szczodrzynski/edziennik/config/BaseConfig.kt

@@ -0,0 +1,48 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2019-11-27.
+ */
+
+package pl.szczodrzynski.edziennik.config
+
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.Job
+import kotlinx.coroutines.launch
+import pl.szczodrzynski.edziennik.config.db.ConfigEntry
+import pl.szczodrzynski.edziennik.data.db.AppDb
+import pl.szczodrzynski.edziennik.ext.takePositive
+import kotlin.coroutines.CoroutineContext
+
+abstract class BaseConfig(
+    @Transient
+    val db: AppDb,
+    val profileId: Int? = null,
+    protected var entries: List<ConfigEntry>? = null,
+) : CoroutineScope {
+
+    private val job = Job()
+    override val coroutineContext: CoroutineContext
+        get() = job + Dispatchers.Default
+
+    val values = hashMapOf<String, String?>()
+
+    init {
+        if (entries == null)
+            entries = db.configDao().getAllNow()
+        values.clear()
+        for ((profileId, key, value) in entries!!) {
+            if (profileId.takePositive() != this.profileId)
+                continue
+            values[key] = value
+        }
+    }
+
+    fun set(key: String, value: String?) {
+        values[key] = value
+        launch(Dispatchers.IO) {
+            db.configDao().add(ConfigEntry(profileId ?: -1, key, value))
+        }
+    }
+
+    fun has(key: String) = values.containsKey(key)
+}

app/src/main/java/pl/szczodrzynski/edziennik/config/Config.kt

@@ -5,151 +5,59 @@
 package pl.szczodrzynski.edziennik.config
 
 import com.google.gson.JsonObject
-import kotlinx.coroutines.CoroutineScope
-import kotlinx.coroutines.Dispatchers
-import kotlinx.coroutines.Job
-import kotlinx.coroutines.launch
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.BuildConfig
-import pl.szczodrzynski.edziennik.config.db.ConfigEntry
 import pl.szczodrzynski.edziennik.config.utils.*
 import pl.szczodrzynski.edziennik.data.api.szkolny.response.Update
 import pl.szczodrzynski.edziennik.data.db.AppDb
-import kotlin.coroutines.CoroutineContext
 
-class Config(val db: AppDb) : CoroutineScope, AbstractConfig {
+@Suppress("RemoveExplicitTypeArguments")
+class Config(db: AppDb) : BaseConfig(db) {
     companion object {
         const val DATA_VERSION = 12
     }
 
-    private val job = Job()
-    override val coroutineContext: CoroutineContext
-        get() = job + Dispatchers.Default
-
-    val values: HashMap<String, String?> = hashMapOf()
+    private val profileConfigs: HashMap<Int, ProfileConfig> = hashMapOf()
 
     val ui by lazy { ConfigUI(this) }
     val sync by lazy { ConfigSync(this) }
     val timetable by lazy { ConfigTimetable(this) }
     val grades by lazy { ConfigGrades(this) }
 
-    private var mDataVersion: Int? = null
-    var dataVersion: Int
-        get() { mDataVersion = mDataVersion ?: values.get("dataVersion", 0); return mDataVersion ?: 0 }
-        set(value) { set("dataVersion", value); mDataVersion = value }
+    var dataVersion by config<Int>(DATA_VERSION)
+    var hash by config<String>("")
 
-    private var mHash: String? = null
-    var hash: String
-        get() { mHash = mHash ?: values.get("hash", ""); return mHash ?: "" }
-        set(value) { set("hash", value); mHash = value }
+    var lastProfileId by config<Int>(0)
+    var loginFinished by config<Boolean>(false)
+    var privacyPolicyAccepted by config<Boolean>(false)
+    var update by config<Update?>(null)
+    var updatesChannel by config<String>("release")
 
-    private var mLastProfileId: Int? = null
-    var lastProfileId: Int
-        get() { mLastProfileId = mLastProfileId ?: values.get("lastProfileId", 0); return mLastProfileId ?: 0 }
-        set(value) { set("lastProfileId", value); mLastProfileId = value }
+    var devMode by config<Boolean?>("debugMode", null)
+    var devModePassword by config<String?>(null)
+    var enableChucker by config<Boolean?>(null)
 
-    private var mUpdatesChannel: String? = null
-    var updatesChannel: String
-        get() { mUpdatesChannel = mUpdatesChannel ?: values.get("updatesChannel", "release"); return mUpdatesChannel ?: "release" }
-        set(value) { set("updatesChannel", value); mUpdatesChannel = value }
-    private var mUpdate: Update? = null
-    var update: Update?
-        get() { mUpdate = mUpdate ?: values.get("update", null as Update?); return mUpdate ?: null as Update? }
-        set(value) { set("update", value); mUpdate = value }
+    var apiAvailabilityCheck by config<Boolean>(true)
+    var apiInvalidCert by config<String?>(null)
+    var apiKeyCustom by config<String?>(null)
+    var appInstalledTime by config<Long>(0L)
+    var appRateSnackbarTime by config<Long>(0L)
+    var appVersion by config<Int>(BuildConfig.VERSION_CODE)
+    var validation by config<String?>(null, "buildValidation")
 
-    private var mAppVersion: Int? = null
-    var appVersion: Int
-        get() { mAppVersion = mAppVersion ?: values.get("appVersion", BuildConfig.VERSION_CODE); return mAppVersion ?: BuildConfig.VERSION_CODE }
-        set(value) { set("appVersion", value); mAppVersion = value }
+    var archiverEnabled by config<Boolean>(true)
+    var runSync by config<Boolean>(false)
+    var widgetConfigs by config<JsonObject> { JsonObject() }
 
-    private var mLoginFinished: Boolean? = null
-    var loginFinished: Boolean
-        get() { mLoginFinished = mLoginFinished ?: values.get("loginFinished", false); return mLoginFinished ?: false }
-        set(value) { set("loginFinished", value); mLoginFinished = value }
-
-    private var mPrivacyPolicyAccepted: Boolean? = null
-    var privacyPolicyAccepted: Boolean
-        get() { mPrivacyPolicyAccepted = mPrivacyPolicyAccepted ?: values.get("privacyPolicyAccepted", false); return mPrivacyPolicyAccepted ?: false }
-        set(value) { set("privacyPolicyAccepted", value); mPrivacyPolicyAccepted = value }
-
-    private var mDevMode: Boolean? = null
-    var devMode: Boolean?
-        get() { mDevMode = mDevMode ?: values.getBooleanOrNull("debugMode"); return mDevMode }
-        set(value) { set("debugMode", value?.toString()); mDevMode = value }
-
-    private var mEnableChucker: Boolean? = null
-    var enableChucker: Boolean?
-        get() { mEnableChucker = mEnableChucker ?: values.getBooleanOrNull("enableChucker"); return mEnableChucker }
-        set(value) { set("enableChucker", value?.toString()); mEnableChucker = value }
-
-    private var mDevModePassword: String? = null
-    var devModePassword: String?
-        get() { mDevModePassword = mDevModePassword ?: values.get("devModePassword", null as String?); return mDevModePassword }
-        set(value) { set("devModePassword", value); mDevModePassword = value }
-
-    private var mAppInstalledTime: Long? = null
-    var appInstalledTime: Long
-        get() { mAppInstalledTime = mAppInstalledTime ?: values.get("appInstalledTime", 0L); return mAppInstalledTime ?: 0L }
-        set(value) { set("appInstalledTime", value); mAppInstalledTime = value }
-
-    private var mAppRateSnackbarTime: Long? = null
-    var appRateSnackbarTime: Long
-        get() { mAppRateSnackbarTime = mAppRateSnackbarTime ?: values.get("appRateSnackbarTime", 0L); return mAppRateSnackbarTime ?: 0L }
-        set(value) { set("appRateSnackbarTime", value); mAppRateSnackbarTime = value }
-
-    private var mRunSync: Boolean? = null
-    var runSync: Boolean
-        get() { mRunSync = mRunSync ?: values.get("runSync", false); return mRunSync ?: false }
-        set(value) { set("runSync", value); mRunSync = value }
-
-    private var mWidgetConfigs: JsonObject? = null
-    var widgetConfigs: JsonObject
-        get() { mWidgetConfigs = mWidgetConfigs ?: values.get("widgetConfigs", JsonObject()); return mWidgetConfigs ?: JsonObject() }
-        set(value) { set("widgetConfigs", value); mWidgetConfigs = value }
-
-    private var mArchiverEnabled: Boolean? = null
-    var archiverEnabled: Boolean
-        get() { mArchiverEnabled = mArchiverEnabled ?: values.get("archiverEnabled", true); return mArchiverEnabled ?: true }
-        set(value) { set("archiverEnabled", value); mArchiverEnabled = value }
-
-    private var mValidation: String? = null
-    var validation: String?
-        get() { mValidation = mValidation ?: values["buildValidation"]; return mValidation }
-        set(value) { set("buildValidation", value); mValidation = value }
-
-    private var mApiInvalidCert: String? = null
-    var apiInvalidCert: String?
-        get() { mApiInvalidCert = mApiInvalidCert ?: values["apiInvalidCert"]; return mApiInvalidCert }
-        set(value) { set("apiInvalidCert", value); mApiInvalidCert = value }
-
-    private var mApiAvailabilityCheck: Boolean? = null
-    var apiAvailabilityCheck: Boolean
-        get() { mApiAvailabilityCheck = mApiAvailabilityCheck ?: values.get("apiAvailabilityCheck", true); return mApiAvailabilityCheck ?: true }
-        set(value) { set("apiAvailabilityCheck", value); mApiAvailabilityCheck = value }
-
-    private var rawEntries: List<ConfigEntry> = db.configDao().getAllNow()
-    private val profileConfigs: HashMap<Int, ProfileConfig> = hashMapOf()
-    init {
-        rawEntries.toHashMap(-1, values)
-    }
     fun migrate(app: App) {
-        if (dataVersion < DATA_VERSION)
+        if (dataVersion < DATA_VERSION || hash == "")
+            // migrate old data version OR freshly installed app (or updated from 3.x)
             ConfigMigration(app, this)
     }
-    fun getFor(profileId: Int): ProfileConfig {
-        return profileConfigs[profileId] ?: ProfileConfig(db, profileId, db.configDao().getAllNow(profileId)).also {
+
+    operator fun get(profileId: Int): ProfileConfig {
+        return profileConfigs[profileId] ?: ProfileConfig(db, profileId, entries).also {
             profileConfigs[profileId] = it
         }
     }
-    fun forProfile() = getFor(App.profileId)
-
-    fun setProfile(profileId: Int) {
-    }
-
-    override fun set(key: String, value: String?) {
-        values[key] = value
-        launch {
-            db.configDao().add(ConfigEntry(-1, key, value))
-        }
-    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/ConfigGrades.kt

@@ -4,13 +4,10 @@
 
 package pl.szczodrzynski.edziennik.config
 
-import pl.szczodrzynski.edziennik.config.utils.get
-import pl.szczodrzynski.edziennik.config.utils.set
-import pl.szczodrzynski.edziennik.utils.managers.GradesManager
+import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.ORDER_BY_DATE_DESC
 
-class ConfigGrades(private val config: Config) {
-    private var mOrderBy: Int? = null
-    var orderBy: Int
-        get() { mOrderBy = mOrderBy ?: config.values.get("gradesOrderBy", 0); return mOrderBy ?: GradesManager.ORDER_BY_DATE_DESC }
-        set(value) { config.set("gradesOrderBy", value); mOrderBy = value }
+@Suppress("RemoveExplicitTypeArguments")
+class ConfigGrades(base: Config) {
+
+    var orderBy by base.config<Int>("gradesOrderBy", ORDER_BY_DATE_DESC)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/ConfigSync.kt

@@ -4,139 +4,53 @@
 
 package pl.szczodrzynski.edziennik.config
 
-import com.google.gson.Gson
-import com.google.gson.reflect.TypeToken
 import pl.szczodrzynski.edziennik.BuildConfig
-import pl.szczodrzynski.edziennik.config.utils.get
-import pl.szczodrzynski.edziennik.config.utils.getIntList
-import pl.szczodrzynski.edziennik.config.utils.set
-import pl.szczodrzynski.edziennik.config.utils.setMap
 import pl.szczodrzynski.edziennik.data.api.szkolny.response.RegisterAvailabilityStatus
+import pl.szczodrzynski.edziennik.ext.HOUR
 import pl.szczodrzynski.edziennik.utils.models.Time
 
-class ConfigSync(private val config: Config) {
-    private val gson = Gson()
+@Suppress("RemoveExplicitTypeArguments")
+class ConfigSync(base: Config) {
 
-    private var mDontShowAppManagerDialog: Boolean? = null
-    var dontShowAppManagerDialog: Boolean
-        get() { mDontShowAppManagerDialog = mDontShowAppManagerDialog ?: config.values.get("dontShowAppManagerDialog", false); return mDontShowAppManagerDialog ?: false }
-        set(value) { config.set("dontShowAppManagerDialog", value); mDontShowAppManagerDialog = value }
+    var enabled by base.config<Boolean>("syncEnabled", true)
+    var interval by base.config<Int>("syncInterval", 1 * HOUR.toInt())
+    var onlyWifi by base.config<Boolean>("syncOnlyWifi", false)
 
-    private var mSyncEnabled: Boolean? = null
-    var enabled: Boolean
-        get() { mSyncEnabled = mSyncEnabled ?: config.values.get("syncEnabled", true); return mSyncEnabled ?: true }
-        set(value) { config.set("syncEnabled", value); mSyncEnabled = value }
+    var dontShowAppManagerDialog by base.config<Boolean>(false)
+    var lastAppSync by base.config<Long>(0L)
+    var notifyAboutUpdates by base.config<Boolean>(true)
+    var webPushEnabled by base.config<Boolean>(true)
 
-    private var mWebPushEnabled: Boolean? = null
-    var webPushEnabled: Boolean
-        get() { mWebPushEnabled = mWebPushEnabled ?: config.values.get("webPushEnabled", true); return mWebPushEnabled ?: true }
-        set(value) { config.set("webPushEnabled", value); mWebPushEnabled = value }
+    // Quiet Hours
+    var quietHoursEnabled by base.config<Boolean>(false)
+    var quietHoursStart by base.config<Time?>(null)
+    var quietHoursEnd by base.config<Time?>(null)
+    var quietDuringLessons by base.config<Boolean>(false)
 
-    private var mSyncOnlyWifi: Boolean? = null
-    var onlyWifi: Boolean
-        get() { mSyncOnlyWifi = mSyncOnlyWifi ?: config.values.get("syncOnlyWifi", false); return mSyncOnlyWifi ?: notifyAboutUpdates }
-        set(value) { config.set("syncOnlyWifi", value); mSyncOnlyWifi = value }
+    // FCM Tokens
+    var tokenApp by base.config<String?>(null)
+    var tokenMobidziennik by base.config<String?>(null)
+    var tokenLibrus by base.config<String?>(null)
+    var tokenVulcan by base.config<String?>(null)
+    var tokenVulcanHebe by base.config<String?>(null)
 
-    private var mSyncInterval: Int? = null
-    var interval: Int
-        get() { mSyncInterval = mSyncInterval ?: config.values.get("syncInterval", 60*60); return mSyncInterval ?: 60*60 }
-        set(value) { config.set("syncInterval", value); mSyncInterval = value }
+    var tokenMobidziennikList by base.config<List<Int>> { listOf() }
+    var tokenLibrusList by base.config<List<Int>> { listOf() }
+    var tokenVulcanList by base.config<List<Int>> { listOf() }
+    var tokenVulcanHebeList by base.config<List<Int>> { listOf() }
 
-    private var mNotifyAboutUpdates: Boolean? = null
-    var notifyAboutUpdates: Boolean
-        get() { mNotifyAboutUpdates = mNotifyAboutUpdates ?: config.values.get("notifyAboutUpdates", true); return mNotifyAboutUpdates ?: true }
-        set(value) { config.set("notifyAboutUpdates", value); mNotifyAboutUpdates = value }
+    // Register Availability
+    private var registerAvailabilityMap by base.config<Map<String, RegisterAvailabilityStatus>>("registerAvailability") { mapOf() }
+    private var registerAvailabilityFlavor by base.config<String?>(null)
 
-    private var mLastAppSync: Long? = null
-    var lastAppSync: Long
-        get() { mLastAppSync = mLastAppSync ?: config.values.get("lastAppSync", 0L); return mLastAppSync ?: 0L }
-        set(value) { config.set("lastAppSync", value); mLastAppSync = value }
-
-    /*     ____        _      _     _
-          / __ \      (_)    | |   | |
-         | |  | |_   _ _  ___| |_  | |__   ___  _   _ _ __ ___
-         | |  | | | | | |/ _ \ __| | '_ \ / _ \| | | | '__/ __|
-         | |__| | |_| | |  __/ |_  | | | | (_) | |_| | |  \__ \
-          \___\_\\__,_|_|\___|\__| |_| |_|\___/ \__,_|_|  |__*/
-    private var mQuietHoursEnabled: Boolean? = null
-    var quietHoursEnabled: Boolean
-        get() { mQuietHoursEnabled = mQuietHoursEnabled ?: config.values.get("quietHoursEnabled", false); return mQuietHoursEnabled ?: false }
-        set(value) { config.set("quietHoursEnabled", value); mQuietHoursEnabled = value }
-
-    private var mQuietHoursStart: Time? = null
-    var quietHoursStart: Time?
-        get() { mQuietHoursStart = mQuietHoursStart ?: config.values.get("quietHoursStart", null as Time?); return mQuietHoursStart }
-        set(value) { config.set("quietHoursStart", value); mQuietHoursStart = value }
-
-    private var mQuietHoursEnd: Time? = null
-    var quietHoursEnd: Time?
-        get() { mQuietHoursEnd = mQuietHoursEnd ?: config.values.get("quietHoursEnd", null as Time?); return mQuietHoursEnd }
-        set(value) { config.set("quietHoursEnd", value); mQuietHoursEnd = value }
-
-    private var mQuietDuringLessons: Boolean? = null
-    var quietDuringLessons: Boolean
-        get() { mQuietDuringLessons = mQuietDuringLessons ?: config.values.get("quietDuringLessons", false); return mQuietDuringLessons ?: false }
-        set(value) { config.set("quietDuringLessons", value); mQuietDuringLessons = value }
-
-    /*    ______ _____ __  __   _______    _
-         |  ____/ ____|  \/  | |__   __|  | |
-         | |__ | |    | \  / |    | | ___ | | _____ _ __  ___
-         |  __|| |    | |\/| |    | |/ _ \| |/ / _ \ '_ \/ __|
-         | |   | |____| |  | |    | | (_) |   <  __/ | | \__ \
-         |_|    \_____|_|  |_|    |_|\___/|_|\_\___|_| |_|__*/
-    private var mTokenApp: String? = null
-    var tokenApp: String?
-        get() { mTokenApp = mTokenApp ?: config.values.get("tokenApp", null as String?); return mTokenApp }
-        set(value) { config.set("tokenApp", value); mTokenApp = value }
-    private var mTokenMobidziennik: String? = null
-    var tokenMobidziennik: String?
-        get() { mTokenMobidziennik = mTokenMobidziennik ?: config.values.get("tokenMobidziennik", null as String?); return mTokenMobidziennik }
-        set(value) { config.set("tokenMobidziennik", value); mTokenMobidziennik = value }
-    private var mTokenLibrus: String? = null
-    var tokenLibrus: String?
-        get() { mTokenLibrus = mTokenLibrus ?: config.values.get("tokenLibrus", null as String?); return mTokenLibrus }
-        set(value) { config.set("tokenLibrus", value); mTokenLibrus = value }
-    private var mTokenVulcan: String? = null
-    var tokenVulcan: String?
-        get() { mTokenVulcan = mTokenVulcan ?: config.values.get("tokenVulcan", null as String?); return mTokenVulcan }
-        set(value) { config.set("tokenVulcan", value); mTokenVulcan = value }
-    private var mTokenVulcanHebe: String? = null
-    var tokenVulcanHebe: String?
-        get() { mTokenVulcanHebe = mTokenVulcanHebe ?: config.values.get("tokenVulcanHebe", null as String?); return mTokenVulcanHebe }
-        set(value) { config.set("tokenVulcanHebe", value); mTokenVulcanHebe = value }
-
-    private var mTokenMobidziennikList: List<Int>? = null
-    var tokenMobidziennikList: List<Int>
-        get() { mTokenMobidziennikList = mTokenMobidziennikList ?: config.values.getIntList("tokenMobidziennikList", listOf()); return mTokenMobidziennikList ?: listOf() }
-        set(value) { config.set("tokenMobidziennikList", value); mTokenMobidziennikList = value }
-    private var mTokenLibrusList: List<Int>? = null
-    var tokenLibrusList: List<Int>
-        get() { mTokenLibrusList = mTokenLibrusList ?: config.values.getIntList("tokenLibrusList", listOf()); return mTokenLibrusList ?: listOf() }
-        set(value) { config.set("tokenLibrusList", value); mTokenLibrusList = value }
-    private var mTokenVulcanList: List<Int>? = null
-    var tokenVulcanList: List<Int>
-        get() { mTokenVulcanList = mTokenVulcanList ?: config.values.getIntList("tokenVulcanList", listOf()); return mTokenVulcanList ?: listOf() }
-        set(value) { config.set("tokenVulcanList", value); mTokenVulcanList = value }
-    private var mTokenVulcanHebeList: List<Int>? = null
-    var tokenVulcanHebeList: List<Int>
-        get() { mTokenVulcanHebeList = mTokenVulcanHebeList ?: config.values.getIntList("tokenVulcanHebeList", listOf()); return mTokenVulcanHebeList ?: listOf() }
-        set(value) { config.set("tokenVulcanHebeList", value); mTokenVulcanHebeList = value }
-
-    private var mRegisterAvailability: Map<String, RegisterAvailabilityStatus>? = null
     var registerAvailability: Map<String, RegisterAvailabilityStatus>
         get() {
-            val flavor = config.values.get("registerAvailabilityFlavor", null as String?)
-            if (BuildConfig.FLAVOR != flavor)
+            if (BuildConfig.FLAVOR != registerAvailabilityFlavor)
                 return mapOf()
-
-            mRegisterAvailability = mRegisterAvailability ?: config.values.get("registerAvailability", null as String?)?.let { it ->
-                gson.fromJson(it, object: TypeToken<Map<String, RegisterAvailabilityStatus>>(){}.type)
-            }
-            return mRegisterAvailability ?: mapOf()
+            return registerAvailabilityMap
         }
         set(value) {
-            config.setMap("registerAvailability", value)
-            config.set("registerAvailabilityFlavor", BuildConfig.FLAVOR)
-            mRegisterAvailability = value
+            registerAvailabilityMap = value
+            registerAvailabilityFlavor = BuildConfig.FLAVOR
         }
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/ConfigTimetable.kt

@@ -4,23 +4,12 @@
 
 package pl.szczodrzynski.edziennik.config
 
-import pl.szczodrzynski.edziennik.config.utils.get
-import pl.szczodrzynski.edziennik.config.utils.set
 import pl.szczodrzynski.edziennik.utils.models.Time
 
-class ConfigTimetable(private val config: Config) {
-    private var mBellSyncMultiplier: Int? = null
-    var bellSyncMultiplier: Int
-        get() { mBellSyncMultiplier = mBellSyncMultiplier ?: config.values.get("bellSyncMultiplier", 0); return mBellSyncMultiplier ?: 0 }
-        set(value) { config.set("bellSyncMultiplier", value); mBellSyncMultiplier = value }
+@Suppress("RemoveExplicitTypeArguments")
+class ConfigTimetable(base: Config) {
 
-    private var mBellSyncDiff: Time? = null
-    var bellSyncDiff: Time?
-        get() { mBellSyncDiff = mBellSyncDiff ?: config.values.get("bellSyncDiff", null as Time?); return mBellSyncDiff }
-        set(value) { config.set("bellSyncDiff", value); mBellSyncDiff = value }
-
-    private var mCountInSeconds: Boolean? = null
-    var countInSeconds: Boolean
-        get() { mCountInSeconds = mCountInSeconds ?: config.values.get("countInSeconds", false); return mCountInSeconds ?: false }
-        set(value) { config.set("countInSeconds", value); mCountInSeconds = value }
-}
+    var bellSyncMultiplier by base.config<Int>(0)
+    var bellSyncDiff by base.config<Time?>(null)
+    var countInSeconds by base.config<Boolean>(false)
+}

app/src/main/java/pl/szczodrzynski/edziennik/config/ConfigUI.kt

@@ -4,60 +4,32 @@
 
 package pl.szczodrzynski.edziennik.config
 
-import pl.szczodrzynski.edziennik.config.utils.get
-import pl.szczodrzynski.edziennik.config.utils.getIntList
-import pl.szczodrzynski.edziennik.config.utils.set
-import pl.szczodrzynski.edziennik.ext.asNavTargetOrNull
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
 
-class ConfigUI(private val config: Config) {
-    private var mTheme: Int? = null
-    var theme: Int
-        get() { mTheme = mTheme ?: config.values.get("theme", 1); return mTheme ?: 1 }
-        set(value) { config.set("theme", value); mTheme = value }
+@Suppress("RemoveExplicitTypeArguments")
+class ConfigUI(base: Config) {
 
-    private var mLanguage: String? = null
-    var language: String?
-        get() { mLanguage = mLanguage ?: config.values.get("language", null as String?); return mLanguage }
-        set(value) { config.set("language", value); mLanguage = value }
+    var theme by base.config<Int>(1)
+    var language by base.config<String?>(null)
 
-    private var mHeaderBackground: String? = null
-    var headerBackground: String?
-        get() { mHeaderBackground = mHeaderBackground ?: config.values.get("headerBg", null as String?); return mHeaderBackground }
-        set(value) { config.set("headerBg", value); mHeaderBackground = value }
+    var appBackground by base.config<String?>("appBg", null)
+    var headerBackground by base.config<String?>("headerBg", null)
 
-    private var mAppBackground: String? = null
-    var appBackground: String?
-        get() { mAppBackground = mAppBackground ?: config.values.get("appBg", null as String?); return mAppBackground }
-        set(value) { config.set("appBg", value); mAppBackground = value }
+    var miniMenuVisible by base.config<Boolean>(false)
+    var miniMenuButtons by base.config<Set<NavTarget>> {
+        setOf(
+            NavTarget.HOME,
+            NavTarget.TIMETABLE,
+            NavTarget.AGENDA,
+            NavTarget.GRADES,
+            NavTarget.MESSAGES,
+            NavTarget.HOMEWORK,
+            NavTarget.SETTINGS
+        )
+    }
+    var openDrawerOnBackPressed by base.config<Boolean>(false)
 
-    private var mMiniMenuVisible: Boolean? = null
-    var miniMenuVisible: Boolean
-        get() { mMiniMenuVisible = mMiniMenuVisible ?: config.values.get("miniMenuVisible", false); return mMiniMenuVisible ?: false }
-        set(value) { config.set("miniMenuVisible", value); mMiniMenuVisible = value }
-
-    private var mMiniMenuButtons: Set<NavTarget>? = null
-    var miniMenuButtons: Set<NavTarget>
-        get() { mMiniMenuButtons = mMiniMenuButtons ?: config.values.getIntList("miniMenuButtons", listOf())?.mapNotNull { it.asNavTargetOrNull() }?.toSet(); return mMiniMenuButtons ?: setOf() }
-        set(value) { config.set("miniMenuButtons", value.map { it.id }); mMiniMenuButtons = value }
-
-    private var mOpenDrawerOnBackPressed: Boolean? = null
-    var openDrawerOnBackPressed: Boolean
-        get() { mOpenDrawerOnBackPressed = mOpenDrawerOnBackPressed ?: config.values.get("openDrawerOnBackPressed", false); return mOpenDrawerOnBackPressed ?: false }
-        set(value) { config.set("openDrawerOnBackPressed", value); mOpenDrawerOnBackPressed = value }
-
-    private var mSnowfall: Boolean? = null
-    var snowfall: Boolean
-        get() { mSnowfall = mSnowfall ?: config.values.get("snowfall", false); return mSnowfall ?: false }
-        set(value) { config.set("snowfall", value); mSnowfall = value }
-
-    private var mEggfall: Boolean? = null
-    var eggfall: Boolean
-        get() { mEggfall = mEggfall ?: config.values.get("eggfall", false); return mEggfall ?: false }
-        set(value) { config.set("eggfall", value); mEggfall = value }
-
-    private var mBottomSheetOpened: Boolean? = null
-    var bottomSheetOpened: Boolean
-        get() { mBottomSheetOpened = mBottomSheetOpened ?: config.values.get("bottomSheetOpened", false); return mBottomSheetOpened ?: false }
-        set(value) { config.set("bottomSheetOpened", value); mBottomSheetOpened = value }
+    var bottomSheetOpened by base.config<Boolean>(false)
+    var snowfall by base.config<Boolean>(false)
+    var eggfall by base.config<Boolean>(false)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/DelegateConfig.kt

@@ -0,0 +1,175 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-21.
+ */
+
+package pl.szczodrzynski.edziennik.config
+
+import com.google.gson.Gson
+import com.google.gson.JsonArray
+import com.google.gson.JsonObject
+import com.google.gson.reflect.TypeToken
+import pl.szczodrzynski.edziennik.ext.*
+import pl.szczodrzynski.edziennik.utils.models.Date
+import pl.szczodrzynski.edziennik.utils.models.Time
+import java.lang.reflect.ParameterizedType
+import java.lang.reflect.WildcardType
+import kotlin.reflect.KProperty
+
+private val gson = Gson()
+
+inline fun <reified T> BaseConfig.config(name: String? = null, noinline default: () -> T) = ConfigDelegate(
+    config = this,
+    type = T::class.java,
+    nullable = null is T,
+    typeToken = object : TypeToken<T>() {},
+    defaultFunc = default,
+    defaultValue = null,
+    fieldName = name,
+)
+
+inline fun <reified T> BaseConfig.config(default: T) = ConfigDelegate(
+    config = this,
+    type = T::class.java,
+    nullable = null is T,
+    typeToken = object : TypeToken<T>() {},
+    defaultFunc = null,
+    defaultValue = default,
+    fieldName = null,
+)
+
+inline fun <reified T> BaseConfig.config(name: String? = null, default: T) = ConfigDelegate(
+    config = this,
+    type = T::class.java,
+    nullable = null is T,
+    typeToken = object : TypeToken<T>() {},
+    defaultFunc = null,
+    defaultValue = default,
+    fieldName = name,
+)
+
+@Suppress("UNCHECKED_CAST")
+class ConfigDelegate<T>(
+    private val config: BaseConfig,
+    private val type: Class<T>,
+    private val nullable: Boolean,
+    private val typeToken: TypeToken<T>,
+    private val defaultFunc: (() -> T)?,
+    private val defaultValue: T?,
+    private val fieldName: String?,
+) {
+    private var value: T? = null
+    private var isInitialized = false
+
+    private fun getDefault(): T = when {
+        defaultFunc != null -> defaultFunc.invoke()
+        else -> defaultValue as T
+    }
+
+    private fun getGenericType(index: Int = 0): Class<*> {
+        val parameterizedType = typeToken.type as ParameterizedType
+        val typeArgument = parameterizedType.actualTypeArguments[index] as WildcardType
+        return typeArgument.upperBounds[0] as Class<*>
+    }
+
+    operator fun setValue(_thisRef: Any, property: KProperty<*>, newValue: T) {
+        value = newValue
+        isInitialized = true
+        config.set(fieldName ?: property.name, serialize(newValue)?.toString())
+    }
+
+    operator fun getValue(_thisRef: Any, property: KProperty<*>): T {
+        if (isInitialized)
+            return value as T
+        val key = fieldName ?: property.name
+
+        if (key !in config.values) {
+            value = getDefault()
+            isInitialized = true
+            return value as T
+        }
+        val str = config.values[key]
+
+        value = if (str == null && nullable)
+            null as T
+        else if (str == null)
+            getDefault()
+        else
+            deserialize(str)
+
+        isInitialized = true
+        return value as T
+    }
+
+    private fun <I> serialize(value: I?, serializeObjects: Boolean = true): Any? {
+        if (value == null)
+            return null
+
+        return when (value) {
+            is String -> value
+            is Date -> value.stringY_m_d
+            is Time -> value.stringValue
+            is JsonObject -> value
+            is JsonArray -> value
+            // primitives
+            is Number -> value
+            is Boolean -> value
+            // enums, maps & collections
+            is Enum<*> -> value.toInt()
+            is Collection<*> -> value.map {
+                if (it is Number || it is Boolean) it else serialize(it, serializeObjects = false)
+            }.toJsonElement()
+            is Map<*, *> -> gson.toJson(value.mapValues { (_, it) ->
+                if (it is Number || it is Boolean) it else serialize(it, serializeObjects = false)
+            })
+            // objects or else
+            else -> if (serializeObjects) gson.toJson(value) else value
+        }
+    }
+
+    private fun <I> deserialize(value: String?, type: Class<*> = this.type): I? {
+        if (value == null)
+            return null
+
+        @Suppress("TYPE_MISMATCH_WARNING")
+        return when (type) {
+            String::class.java -> value
+            Date::class.java -> Date.fromY_m_d(value)
+            Time::class.java -> Time.fromHms(value)
+            JsonObject::class.java -> value.toJsonObject()
+            JsonArray::class.java -> value.toJsonArray()
+            // primitives
+            java.lang.Integer::class.java -> value.toIntOrNull()
+            java.lang.Boolean::class.java -> value.toBooleanStrictOrNull()
+            java.lang.Long::class.java -> value.toLongOrNull()
+            java.lang.Float::class.java -> value.toFloatOrNull()
+            // enums, maps & collections
+            else -> when {
+                Enum::class.java.isAssignableFrom(type) -> value.toIntOrNull()?.toEnum(type) as Enum<*>
+                Collection::class.java.isAssignableFrom(type) -> {
+                    val array = value.toJsonArray()
+                    val genericType = getGenericType()
+                    val list = array?.map {
+                        val str = if (it.isJsonPrimitive) it.asString else it.toString()
+                        deserialize<Any>(str, genericType)
+                    }
+                    when {
+                        List::class.java.isAssignableFrom(type) -> list
+                        Set::class.java.isAssignableFrom(type) -> list?.toSet()
+                        else -> list?.toTypedArray()
+                    }
+                }
+                Map::class.java.isAssignableFrom(type) -> {
+                    val obj = value.toJsonObject()
+                    val genericType = getGenericType(index = 1)
+                    val map = obj?.entrySet()?.associate { (key, it) ->
+                        val str = if (it.isJsonPrimitive) it.asString else it.toString()
+                        key to deserialize<Any>(str, genericType)
+                    }
+                    map
+                }
+                // objects or else
+                else -> gson.fromJson(value, type)
+            }
+        } as? I
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfig.kt

@@ -4,29 +4,20 @@
 
 package pl.szczodrzynski.edziennik.config
 
-import kotlinx.coroutines.CoroutineScope
-import kotlinx.coroutines.Dispatchers
-import kotlinx.coroutines.Job
-import kotlinx.coroutines.launch
 import pl.szczodrzynski.edziennik.config.db.ConfigEntry
 import pl.szczodrzynski.edziennik.config.utils.ProfileConfigMigration
-import pl.szczodrzynski.edziennik.config.utils.get
-import pl.szczodrzynski.edziennik.config.utils.set
-import pl.szczodrzynski.edziennik.config.utils.toHashMap
 import pl.szczodrzynski.edziennik.data.db.AppDb
-import kotlin.coroutines.CoroutineContext
 
-class ProfileConfig(val db: AppDb, val profileId: Int, rawEntries: List<ConfigEntry>) : CoroutineScope, AbstractConfig {
+@Suppress("RemoveExplicitTypeArguments")
+class ProfileConfig(
+    db: AppDb,
+    profileId: Int,
+    entries: List<ConfigEntry>?,
+) : BaseConfig(db, profileId, entries) {
     companion object {
-        const val DATA_VERSION = 3
+        const val DATA_VERSION = 5
     }
 
-    private val job = Job()
-    override val coroutineContext: CoroutineContext
-        get() = job + Dispatchers.Default
-
-    val values: HashMap<String, String?> = hashMapOf()
-
     val grades by lazy { ProfileConfigGrades(this) }
     val ui by lazy { ProfileConfigUI(this) }
     val sync by lazy { ProfileConfigSync(this) }
@@ -35,26 +26,13 @@ class ProfileConfig(val db: AppDb, val profileId: Int, rawEntries: List<ConfigEn
     val timetable by lazy { ConfigTimetable(this) }
     val grades by lazy { ConfigGrades(this) }*/
 
-    private var mDataVersion: Int? = null
-    var dataVersion: Int
-        get() { mDataVersion = mDataVersion ?: values.get("dataVersion", 0); return mDataVersion ?: 0 }
-        set(value) { set("dataVersion", value); mDataVersion = value }
+    var dataVersion by config<Int>(DATA_VERSION)
+    var hash by config<String>("")
 
-    private var mHash: String? = null
-    var hash: String
-        get() { mHash = mHash ?: values.get("hash", ""); return mHash ?: "" }
-        set(value) { set("hash", value); mHash = value }
+    var shareByDefault by config<Boolean>(false)
 
     init {
-        rawEntries.toHashMap(profileId, values)
         if (dataVersion < DATA_VERSION)
             ProfileConfigMigration(this)
     }
-
-    override fun set(key: String, value: String?) {
-        values[key] = value
-        launch {
-            db.configDao().add(ConfigEntry(profileId, key, value))
-        }
-    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfigAttendance.kt

@@ -4,27 +4,11 @@
 
 package pl.szczodrzynski.edziennik.config
 
-import pl.szczodrzynski.edziennik.config.utils.get
-import pl.szczodrzynski.edziennik.config.utils.set
+@Suppress("RemoveExplicitTypeArguments")
+class ProfileConfigAttendance(base: ProfileConfig) {
 
-class ProfileConfigAttendance(private val config: ProfileConfig) {
-    private var mAttendancePageSelection: Int? = null
-    var attendancePageSelection: Int
-        get() { mAttendancePageSelection = mAttendancePageSelection ?: config.values.get("attendancePageSelection", 1); return mAttendancePageSelection ?: 1 }
-        set(value) { config.set("attendancePageSelection", value); mAttendancePageSelection = value }
-
-    private var mUseSymbols: Boolean? = null
-    var useSymbols: Boolean
-        get() { mUseSymbols = mUseSymbols ?: config.values.get("useSymbols", false); return mUseSymbols ?: false }
-        set(value) { config.set("useSymbols", value); mUseSymbols = value }
-
-    private var mGroupConsecutiveDays: Boolean? = null
-    var groupConsecutiveDays: Boolean
-        get() { mGroupConsecutiveDays = mGroupConsecutiveDays ?: config.values.get("groupConsecutiveDays", true); return mGroupConsecutiveDays ?: true }
-        set(value) { config.set("groupConsecutiveDays", value); mGroupConsecutiveDays = value }
-
-    private var mShowPresenceInMonth: Boolean? = null
-    var showPresenceInMonth: Boolean
-        get() { mShowPresenceInMonth = mShowPresenceInMonth ?: config.values.get("showPresenceInMonth", false); return mShowPresenceInMonth ?: false }
-        set(value) { config.set("showPresenceInMonth", value); mShowPresenceInMonth = value }
+    var attendancePageSelection by base.config<Int>(1)
+    var groupConsecutiveDays by base.config<Boolean>(true)
+    var showPresenceInMonth by base.config<Boolean>(false)
+    var useSymbols by base.config<Boolean>(false)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfigGrades.kt

@@ -4,54 +4,19 @@
 
 package pl.szczodrzynski.edziennik.config
 
-import pl.szczodrzynski.edziennik.config.utils.get
-import pl.szczodrzynski.edziennik.config.utils.getFloat
-import pl.szczodrzynski.edziennik.config.utils.set
 import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.COLOR_MODE_WEIGHTED
 import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.YEAR_ALL_GRADES
 
-class ProfileConfigGrades(private val config: ProfileConfig) {
-    private var mColorMode: Int? = null
-    var colorMode: Int
-        get() { mColorMode = mColorMode ?: config.values.get("gradesColorMode", COLOR_MODE_WEIGHTED); return mColorMode ?: COLOR_MODE_WEIGHTED }
-        set(value) { config.set("gradesColorMode", value); mColorMode = value }
+@Suppress("RemoveExplicitTypeArguments")
+class ProfileConfigGrades(base: ProfileConfig) {
 
-    private var mYearAverageMode: Int? = null
-    var yearAverageMode: Int
-        get() { mYearAverageMode = mYearAverageMode ?: config.values.get("yearAverageMode", YEAR_ALL_GRADES); return mYearAverageMode ?: YEAR_ALL_GRADES }
-        set(value) { config.set("yearAverageMode", value); mYearAverageMode = value }
-
-    private var mHideImproved: Boolean? = null
-    var hideImproved: Boolean
-        get() { mHideImproved = mHideImproved ?: config.values.get("hideImproved", false); return mHideImproved ?: false }
-        set(value) { config.set("hideImproved", value); mHideImproved = value }
-
-    private var mAverageWithoutWeight: Boolean? = null
-    var averageWithoutWeight: Boolean
-        get() { mAverageWithoutWeight = mAverageWithoutWeight ?: config.values.get("averageWithoutWeight", true); return mAverageWithoutWeight ?: true }
-        set(value) { config.set("averageWithoutWeight", value); mAverageWithoutWeight = value }
-
-    private var mPlusValue: Float? = null
-    var plusValue: Float?
-        get() { mPlusValue = mPlusValue ?: config.values.getFloat("plusValue"); return mPlusValue }
-        set(value) { config.set("plusValue", value); mPlusValue = value }
-    private var mMinusValue: Float? = null
-    var minusValue: Float?
-        get() { mMinusValue = mMinusValue ?: config.values.getFloat("minusValue"); return mMinusValue }
-        set(value) { config.set("minusValue", value); mMinusValue = value }
-
-    private var mDontCountEnabled: Boolean? = null
-    var dontCountEnabled: Boolean
-        get() { mDontCountEnabled = mDontCountEnabled ?: config.values.get("dontCountEnabled", false); return mDontCountEnabled ?: false }
-        set(value) { config.set("dontCountEnabled", value); mDontCountEnabled = value }
-    
-    private var mDontCountGrades: List<String>? = null
-    var dontCountGrades: List<String>
-        get() { mDontCountGrades = mDontCountGrades ?: config.values.get("dontCountGrades", listOf()); return mDontCountGrades ?: listOf() }
-        set(value) { config.set("dontCountGrades", value); mDontCountGrades = value }
-
-    private var mHideSticksFromOld: Boolean? = null
-    var hideSticksFromOld: Boolean
-        get() { mHideSticksFromOld = mHideSticksFromOld ?: config.values.get("hideSticksFromOld", false); return mHideSticksFromOld ?: false }
-        set(value) { config.set("hideSticksFromOld", value); mHideSticksFromOld = value }
+    var averageWithoutWeight by base.config<Boolean>(true)
+    var colorMode by base.config<Int>(COLOR_MODE_WEIGHTED)
+    var dontCountEnabled by base.config<Boolean>(false)
+    var dontCountGrades by base.config<List<String>> { listOf() }
+    var hideImproved by base.config<Boolean>(false)
+    var hideSticksFromOld by base.config<Boolean>(false)
+    var minusValue by base.config<Float?>(null)
+    var plusValue by base.config<Float?>(null)
+    var yearAverageMode by base.config<Int>(YEAR_ALL_GRADES)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfigSync.kt

@@ -4,14 +4,14 @@
 
 package pl.szczodrzynski.edziennik.config
 
-import pl.szczodrzynski.edziennik.config.utils.getIntList
-import pl.szczodrzynski.edziennik.config.utils.set
 import pl.szczodrzynski.edziennik.data.db.enums.NotificationType
-import pl.szczodrzynski.edziennik.ext.asNotificationTypeOrNull
 
-class ProfileConfigSync(private val config: ProfileConfig) {
-    private var mNotificationFilter: Set<NotificationType>? = null
-    var notificationFilter: Set<NotificationType>
-        get() { mNotificationFilter = mNotificationFilter ?: config.values.getIntList("notificationFilter", listOf())?.mapNotNull { it.asNotificationTypeOrNull() }?.toSet(); return mNotificationFilter ?: setOf() }
-        set(value) { config.set("notificationFilter", value.map { it.id }); mNotificationFilter = value }
+@Suppress("RemoveExplicitTypeArguments")
+class ProfileConfigSync(base: ProfileConfig) {
+
+    var notificationFilter by base.config<Set<NotificationType>> {
+        NotificationType.values()
+            .filter { it.enabledByDefault == false }
+            .toSet()
+    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/ProfileConfigUI.kt

@@ -4,89 +4,30 @@
 
 package pl.szczodrzynski.edziennik.config
 
-import pl.szczodrzynski.edziennik.config.utils.get
-import pl.szczodrzynski.edziennik.config.utils.set
 import pl.szczodrzynski.edziennik.data.db.entity.Profile.Companion.AGENDA_DEFAULT
 import pl.szczodrzynski.edziennik.ui.home.HomeCardModel
 
-class ProfileConfigUI(private val config: ProfileConfig) {
-    private var mAgendaViewType: Int? = null
-    var agendaViewType: Int
-        get() { mAgendaViewType = mAgendaViewType ?: config.values.get("agendaViewType", 0); return mAgendaViewType ?: AGENDA_DEFAULT }
-        set(value) { config.set("agendaViewType", value); mAgendaViewType = value }
+@Suppress("RemoveExplicitTypeArguments")
+class ProfileConfigUI(base: ProfileConfig) {
 
-    private var mAgendaCompactMode: Boolean? = null
-    var agendaCompactMode: Boolean
-        get() { mAgendaCompactMode = mAgendaCompactMode ?: config.values.get("agendaCompactMode", false); return mAgendaCompactMode ?: false }
-        set(value) { config.set("agendaCompactMode", value); mAgendaCompactMode = value }
+    var agendaViewType by base.config<Int>(AGENDA_DEFAULT)
+    var agendaCompactMode by base.config<Boolean>(false)
+    var agendaGroupByType by base.config<Boolean>(false)
+    var agendaLessonChanges by base.config<Boolean>(true)
+    var agendaTeacherAbsence by base.config<Boolean>(true)
+    var agendaSubjectImportant by base.config<Boolean>(false)
+    var agendaElearningMark by base.config<Boolean>(false)
+    var agendaElearningGroup by base.config<Boolean>(true)
 
-    private var mAgendaGroupByType: Boolean? = null
-    var agendaGroupByType: Boolean
-        get() { mAgendaGroupByType = mAgendaGroupByType ?: config.values.get("agendaGroupByType", false); return mAgendaGroupByType ?: false }
-        set(value) { config.set("agendaGroupByType", value); mAgendaGroupByType = value }
+    var homeCards by base.config<List<HomeCardModel>> { listOf() }
 
-    private var mAgendaLessonChanges: Boolean? = null
-    var agendaLessonChanges: Boolean
-        get() { mAgendaLessonChanges = mAgendaLessonChanges ?: config.values.get("agendaLessonChanges", true); return mAgendaLessonChanges ?: true }
-        set(value) { config.set("agendaLessonChanges", value); mAgendaLessonChanges = value }
+    var messagesGreetingOnCompose by base.config<Boolean>(true)
+    var messagesGreetingOnReply by base.config<Boolean>(true)
+    var messagesGreetingOnForward by base.config<Boolean>(false)
+    var messagesGreetingText by base.config<String?>(null)
 
-    private var mAgendaTeacherAbsence: Boolean? = null
-    var agendaTeacherAbsence: Boolean
-        get() { mAgendaTeacherAbsence = mAgendaTeacherAbsence ?: config.values.get("agendaTeacherAbsence", true); return mAgendaTeacherAbsence ?: true }
-        set(value) { config.set("agendaTeacherAbsence", value); mAgendaTeacherAbsence = value }
-
-    private var mAgendaElearningMark: Boolean? = null
-    var agendaElearningMark: Boolean
-        get() { mAgendaElearningMark = mAgendaElearningMark ?: config.values.get("agendaElearningMark", false); return mAgendaElearningMark ?: false }
-        set(value) { config.set("agendaElearningMark", value); mAgendaElearningMark = value }
-
-    private var mAgendaElearningGroup: Boolean? = null
-    var agendaElearningGroup: Boolean
-        get() { mAgendaElearningGroup = mAgendaElearningGroup ?: config.values.get("agendaElearningGroup", true); return mAgendaElearningGroup ?: true }
-        set(value) { config.set("agendaElearningGroup", value); mAgendaElearningGroup = value }
-
-    private var mHomeCards: List<HomeCardModel>? = null
-    var homeCards: List<HomeCardModel>
-        get() { mHomeCards = mHomeCards ?: config.values.get("homeCards", listOf(), HomeCardModel::class.java); return mHomeCards ?: listOf() }
-        set(value) { config.set("homeCards", value); mHomeCards = value }
-
-    private var mMessagesGreetingOnCompose: Boolean? = null
-    var messagesGreetingOnCompose: Boolean
-        get() { mMessagesGreetingOnCompose = mMessagesGreetingOnCompose ?: config.values.get("messagesGreetingOnCompose", true); return mMessagesGreetingOnCompose ?: true }
-        set(value) { config.set("messagesGreetingOnCompose", value); mMessagesGreetingOnCompose = value }
-
-    private var mMessagesGreetingOnReply: Boolean? = null
-    var messagesGreetingOnReply: Boolean
-        get() { mMessagesGreetingOnReply = mMessagesGreetingOnReply ?: config.values.get("messagesGreetingOnReply", true); return mMessagesGreetingOnReply ?: true }
-        set(value) { config.set("messagesGreetingOnReply", value); mMessagesGreetingOnReply = value }
-
-    private var mMessagesGreetingOnForward: Boolean? = null
-    var messagesGreetingOnForward: Boolean
-        get() { mMessagesGreetingOnForward = mMessagesGreetingOnForward ?: config.values.get("messagesGreetingOnForward", false); return mMessagesGreetingOnForward ?: false }
-        set(value) { config.set("messagesGreetingOnForward", value); mMessagesGreetingOnForward = value }
-
-    private var mMessagesGreetingText: String? = null
-    var messagesGreetingText: String?
-        get() { mMessagesGreetingText = mMessagesGreetingText ?: config.values["messagesGreetingText"]; return mMessagesGreetingText }
-        set(value) { config.set("messagesGreetingText", value); mMessagesGreetingText = value }
-
-    private var mTimetableShowAttendance: Boolean? = null
-    var timetableShowAttendance: Boolean
-        get() { mTimetableShowAttendance = mTimetableShowAttendance ?: config.values.get("timetableShowAttendance", true); return mTimetableShowAttendance ?: true }
-        set(value) { config.set("timetableShowAttendance", value); mTimetableShowAttendance = value }
-
-    private var mTimetableShowEvents: Boolean? = null
-    var timetableShowEvents: Boolean
-        get() { mTimetableShowEvents = mTimetableShowEvents ?: config.values.get("timetableShowEvents", true); return mTimetableShowEvents ?: true }
-        set(value) { config.set("timetableShowEvents", value); mTimetableShowEvents = value }
-
-    private var mTimetableTrimHourRange: Boolean? = null
-    var timetableTrimHourRange: Boolean
-        get() { mTimetableTrimHourRange = mTimetableTrimHourRange ?: config.values.get("timetableTrimHourRange", false); return mTimetableTrimHourRange ?: false }
-        set(value) { config.set("timetableTrimHourRange", value); mTimetableTrimHourRange = value }
-    
-    private var mTimetableColorSubjectName: Boolean? = null
-    var timetableColorSubjectName: Boolean
-        get() { mTimetableColorSubjectName = mTimetableColorSubjectName ?: config.values.get("timetableColorSubjectName", false); return mTimetableColorSubjectName ?: false }
-        set(value) { config.set("timetableColorSubjectName", value); mTimetableColorSubjectName = value }
+    var timetableShowAttendance by base.config<Boolean>(true)
+    var timetableShowEvents by base.config<Boolean>(true)
+    var timetableTrimHourRange by base.config<Boolean>(false)
+    var timetableColorSubjectName by base.config<Boolean>(false)
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/db/ConfigDao.kt

@@ -17,7 +17,7 @@ interface ConfigDao {
     @Insert(onConflict = OnConflictStrategy.REPLACE)
     fun addAll(list: List<ConfigEntry>)
 
-    @Query("SELECT * FROM config WHERE profileId = -1")
+    @Query("SELECT * FROM config")
     fun getAllNow(): List<ConfigEntry>
 
     @Query("SELECT * FROM config WHERE profileId = :profileId")
@@ -25,4 +25,4 @@ interface ConfigDao {
 
     @Query("DELETE FROM config WHERE profileId = :profileId")
     fun clear(profileId: Int)
-}
+}

app/src/main/java/pl/szczodrzynski/edziennik/config/utils/AppConfigMigrationV3.kt

@@ -16,9 +16,9 @@ import pl.szczodrzynski.edziennik.utils.models.Time
 import kotlin.math.abs
 
 class AppConfigMigrationV3(p: SharedPreferences, config: Config) {
-    init { config.apply {
+    init {
         val s = "app.appConfig"
-        if (dataVersion < 1) {
+        config.apply {
             ui.theme = p.getString("$s.appTheme", null)?.toIntOrNull() ?: 1
             sync.enabled = p.getString("$s.registerSyncEnabled", null)?.toBoolean() ?: true
             sync.interval = p.getString("$s.registerSyncInterval", null)?.toIntOrNull() ?: 3600
@@ -37,9 +37,6 @@ class AppConfigMigrationV3(p: SharedPreferences, config: Config) {
                     NavTarget.HOMEWORK,
                     NavTarget.SETTINGS
             )
-            dataVersion = 1
-        }
-        if (dataVersion < 2) {
             devModePassword = p.getString("$s.devModePassword", null).fix()
             sync.tokenApp = p.getString("$s.fcmToken", null).fix()
             timetable.bellSyncMultiplier = p.getString("$s.bellSyncMultiplier", null)?.toIntOrNull() ?: 0
@@ -86,9 +83,8 @@ class AppConfigMigrationV3(p: SharedPreferences, config: Config) {
                     LoginType.LIBRUS.id -> sync.tokenLibrus = token
                 }
             }
-            dataVersion = 2
         }
-    }}
+    }
 
     private fun String?.fix(): String? {
         return this?.replace("\"", "")?.let { if (it == "null") null else it }

app/src/main/java/pl/szczodrzynski/edziennik/config/utils/ConfigExtensions.kt

@@ -1,113 +0,0 @@
-/*
- * Copyright (c) Kuba Szczodrzyński 2019-11-27.
- */
-
-package pl.szczodrzynski.edziennik.config.utils
-
-import com.google.gson.*
-import com.google.gson.reflect.TypeToken
-import pl.szczodrzynski.edziennik.config.AbstractConfig
-import pl.szczodrzynski.edziennik.config.db.ConfigEntry
-import pl.szczodrzynski.edziennik.utils.models.Date
-import pl.szczodrzynski.edziennik.utils.models.Time
-
-private val gson = Gson()
-
-fun AbstractConfig.set(key: String, value: Int) {
-    set(key, value.toString())
-}
-fun AbstractConfig.set(key: String, value: Boolean) {
-    set(key, value.toString())
-}
-fun AbstractConfig.set(key: String, value: Long) {
-    set(key, value.toString())
-}
-fun AbstractConfig.set(key: String, value: Float) {
-    set(key, value.toString())
-}
-fun AbstractConfig.set(key: String, value: Date?) {
-    set(key, value?.stringY_m_d)
-}
-fun AbstractConfig.set(key: String, value: Time?) {
-    set(key, value?.stringValue)
-}
-fun AbstractConfig.set(key: String, value: JsonElement?) {
-    set(key, value?.toString())
-}
-fun AbstractConfig.set(key: String, value: List<Any>?) {
-    set(key, value?.let { gson.toJson(it) })
-}
-fun AbstractConfig.set(key: String, value: Any?) {
-    set(key, value?.let { gson.toJson(it) })
-}
-fun AbstractConfig.setStringList(key: String, value: List<String>?) {
-    set(key, value?.let { gson.toJson(it) })
-}
-fun AbstractConfig.setIntList(key: String, value: List<Int>?) {
-    set(key, value?.let { gson.toJson(it) })
-}
-fun AbstractConfig.setLongList(key: String, value: List<Long>?) {
-    set(key, value?.let { gson.toJson(it) })
-}
-fun <K, V> AbstractConfig.setMap(key: String, value: Map<K, V>?) {
-    set(key, value?.let { gson.toJson(it) })
-}
-
-fun HashMap<String, String?>.get(key: String, default: String?): String? {
-    return this[key] ?: default
-}
-fun HashMap<String, String?>.get(key: String, default: Boolean): Boolean {
-    return this[key]?.toBoolean() ?: default
-}
-fun HashMap<String, String?>.getBooleanOrNull(key: String): Boolean? {
-    return this[key]?.toBooleanStrictOrNull()
-}
-fun HashMap<String, String?>.get(key: String, default: Int): Int {
-    return this[key]?.toIntOrNull() ?: default
-}
-fun HashMap<String, String?>.get(key: String, default: Long): Long {
-    return this[key]?.toLongOrNull() ?: default
-}
-fun HashMap<String, String?>.get(key: String, default: Float): Float {
-    return this[key]?.toFloatOrNull() ?: default
-}
-fun HashMap<String, String?>.get(key: String, default: Date?): Date? {
-    return this[key]?.let { Date.fromY_m_d(it) } ?: default
-}
-fun HashMap<String, String?>.get(key: String, default: Time?): Time? {
-    return this[key]?.let { Time.fromHms(it) } ?: default
-}
-fun HashMap<String, String?>.get(key: String, default: JsonObject?): JsonObject? {
-    return this[key]?.let { JsonParser().parse(it)?.asJsonObject } ?: default
-}
-fun HashMap<String, String?>.get(key: String, default: JsonArray?): JsonArray? {
-    return this[key]?.let { JsonParser().parse(it)?.asJsonArray } ?: default
-}
-inline fun <reified T> HashMap<String, String?>.get(key: String, default: T?): T? {
-    return this[key]?.let { Gson().fromJson(it, T::class.java) } ?: default
-}
-/* !!! cannot use mutable list here - modifying it will not update the DB */
-fun <T> HashMap<String, String?>.get(key: String, default: List<T>?, classOfT: Class<T>): List<T>? {
-    return this[key]?.let { ConfigGsonUtils().deserializeList<T>(gson, it, classOfT) } ?: default
-}
-fun HashMap<String, String?>.getStringList(key: String, default: List<String>?): List<String>? {
-    return this[key]?.let { gson.fromJson<List<String>>(it, object: TypeToken<List<String>>(){}.type) } ?: default
-}
-fun HashMap<String, String?>.getIntList(key: String, default: List<Int>?): List<Int>? {
-    return this[key]?.let { gson.fromJson<List<Int>>(it, object: TypeToken<List<Int>>(){}.type) } ?: default
-}
-fun HashMap<String, String?>.getLongList(key: String, default: List<Long>?): List<Long>? {
-    return this[key]?.let { gson.fromJson<List<Long>>(it, object: TypeToken<List<Long>>(){}.type) } ?: default
-}
-
-fun HashMap<String, String?>.getFloat(key: String): Float? {
-    return this[key]?.toFloatOrNull()
-}
-
-fun List<ConfigEntry>.toHashMap(profileId: Int, map: HashMap<String, String?>) {
-    map.clear()
-    forEach {
-        if (it.profileId == profileId)
-            map[it.key] = it.value
-    }
-}

app/src/main/java/pl/szczodrzynski/edziennik/config/utils/ConfigGsonUtils.kt

@@ -1,45 +0,0 @@
-/*
- * Copyright (c) Kuba Szczodrzyński 2019-12-2.
- */
-package pl.szczodrzynski.edziennik.config.utils
-
-import com.google.gson.Gson
-import com.google.gson.JsonParser
-import pl.szczodrzynski.edziennik.ext.getInt
-import pl.szczodrzynski.edziennik.ui.home.HomeCardModel
-import pl.szczodrzynski.edziennik.utils.models.Time
-
-class ConfigGsonUtils {
-    @Suppress("UNCHECKED_CAST")
-    fun <T> deserializeList(gson: Gson, str: String?, classOfT: Class<T>): List<T> {
-        val json = JsonParser.parseString(str)
-        val list: MutableList<T> = mutableListOf()
-        if (!json.isJsonArray)
-            return list
-
-        json.asJsonArray.forEach { e ->
-            when (classOfT) {
-                String::class.java -> {
-                    list += e.asString as T
-                }
-                HomeCardModel::class.java -> {
-                    val o = e.asJsonObject
-                    list += HomeCardModel(
-                            o.getInt("profileId", 0),
-                            o.getInt("cardId", 0)
-                    ) as T
-                }
-                Time::class.java -> {
-                    val o = e.asJsonObject
-                    list += Time(
-                            o.getInt("hour", 0),
-                            o.getInt("minute", 0),
-                            o.getInt("second", 0)
-                    ) as T
-                }
-            }
-        }
-
-        return list
-    }
-}

app/src/main/java/pl/szczodrzynski/edziennik/config/utils/ConfigMigration.kt

@@ -5,13 +5,9 @@
 package pl.szczodrzynski.edziennik.config.utils
 
 import android.content.Context
+import androidx.core.content.edit
 import pl.szczodrzynski.edziennik.App
-import pl.szczodrzynski.edziennik.BuildConfig
-import pl.szczodrzynski.edziennik.MainActivity
 import pl.szczodrzynski.edziennik.config.Config
-import pl.szczodrzynski.edziennik.ext.HOUR
-import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
-import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.ORDER_BY_DATE_DESC
 import pl.szczodrzynski.edziennik.utils.models.Time
 import kotlin.math.abs
 
@@ -23,74 +19,14 @@ class ConfigMigration(app: App, config: Config) {
             // migrate appConfig from app version 3.x and lower.
             // Updates dataVersion to level 2.
             AppConfigMigrationV3(p, config)
-        }
-
-        if (dataVersion < 2) {
-            appVersion = BuildConfig.VERSION_CODE
-            loginFinished = false
-            ui.language = null
-            ui.theme = 1
-            ui.appBackground = null
-            ui.headerBackground = null
-            ui.miniMenuVisible = false
-            ui.miniMenuButtons = setOf(
-                    NavTarget.HOME,
-                    NavTarget.TIMETABLE,
-                    NavTarget.AGENDA,
-                    NavTarget.GRADES,
-                    NavTarget.MESSAGES,
-                    NavTarget.HOMEWORK,
-                    NavTarget.SETTINGS
-            )
-            sync.enabled = true
-            sync.interval = 1* HOUR.toInt()
-            sync.notifyAboutUpdates = true
-            sync.onlyWifi = false
-            sync.quietHoursEnabled = false
-            sync.quietHoursStart = null
-            sync.quietHoursEnd = null
-            sync.quietDuringLessons = false
-            sync.tokenApp = null
-            sync.tokenMobidziennik = null
-            sync.tokenMobidziennikList = listOf()
-            sync.tokenLibrus = null
-            sync.tokenLibrusList = listOf()
-            sync.tokenVulcan = null
-            sync.tokenVulcanList = listOf()
-            timetable.bellSyncMultiplier = 0
-            timetable.bellSyncDiff = null
-            timetable.countInSeconds = false
-            grades.orderBy = ORDER_BY_DATE_DESC
-
-            dataVersion = 2
-        }
-
-        if (dataVersion < 3) {
-            update = null
-            privacyPolicyAccepted = false
-            devMode = null
-            devModePassword = null
-            appInstalledTime = 0L
-            appRateSnackbarTime = 0L
-
-            dataVersion = 3
-        }
-
-        if (dataVersion < 10) {
-            ui.openDrawerOnBackPressed = false
-            ui.snowfall = false
-            ui.bottomSheetOpened = false
-            sync.dontShowAppManagerDialog = false
-            sync.webPushEnabled = true
-            sync.lastAppSync = 0L
-
-
-            dataVersion = 10
+            p.edit {
+                remove("app.appConfig.appTheme")
+            }
         }
 
         if (dataVersion < 11) {
-            val startMillis = config.values.get("quietHoursStart", 0L)
-            val endMillis = config.values.get("quietHoursEnd", 0L)
+            val startMillis = config.values["quietHoursStart"]?.toLongOrNull() ?: 0L
+            val endMillis = config.values["quietHoursEnd"]?.toLongOrNull() ?: 0L
             if (startMillis > 0) {
                 try {
                     sync.quietHoursStart = Time.fromMillis(abs(startMillis))
@@ -107,5 +43,7 @@ class ConfigMigration(app: App, config: Config) {
 
             dataVersion = 11
         }
+
+        hash = "invalid"
     }}
 }

app/src/main/java/pl/szczodrzynski/edziennik/config/utils/ProfileConfigMigration.kt

@@ -7,6 +7,7 @@ package pl.szczodrzynski.edziennik.config.utils
 import pl.szczodrzynski.edziennik.config.ProfileConfig
 import pl.szczodrzynski.edziennik.data.db.entity.Profile.Companion.AGENDA_DEFAULT
 import pl.szczodrzynski.edziennik.data.db.enums.NotificationType
+import pl.szczodrzynski.edziennik.data.db.enums.SchoolType
 import pl.szczodrzynski.edziennik.ui.home.HomeCard
 import pl.szczodrzynski.edziennik.ui.home.HomeCardModel
 import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.COLOR_MODE_WEIGHTED
@@ -15,20 +16,7 @@ import pl.szczodrzynski.edziennik.utils.managers.GradesManager.Companion.YEAR_AL
 class ProfileConfigMigration(config: ProfileConfig) {
     init { config.apply {
 
-        if (dataVersion < 1) {
-            grades.colorMode = COLOR_MODE_WEIGHTED
-            grades.yearAverageMode = YEAR_ALL_GRADES
-            grades.hideImproved = false
-            grades.averageWithoutWeight = true
-            grades.plusValue = null
-            grades.minusValue = null
-            grades.dontCountEnabled = false
-            grades.dontCountGrades = listOf()
-            ui.agendaViewType = AGENDA_DEFAULT
-            // no migration for ui.homeCards
-
-            dataVersion = 1
-        }
+        val profile = db.profileDao().getByIdNow(profileId ?: -1)
 
         if (dataVersion < 2) {
             sync.notificationFilter = sync.notificationFilter + NotificationType.TEACHER_ABSENCE
@@ -38,12 +26,36 @@ class ProfileConfigMigration(config: ProfileConfig) {
 
         if (dataVersion < 3) {
             if (ui.homeCards.isNotEmpty()) {
-                ui.homeCards = ui.homeCards.toMutableList().also {
-                    it.add(HomeCardModel(config.profileId, HomeCard.CARD_NOTES))
-                }
+                ui.homeCards = ui.homeCards + HomeCardModel(
+                    profileId = config.profileId ?: -1,
+                    cardId = HomeCard.CARD_NOTES,
+                )
             }
 
             dataVersion = 3
         }
+
+        if (dataVersion < 4) {
+            // switch to new event types (USOS)
+            dataVersion = 4
+
+            if (profile?.loginStoreType?.schoolType == SchoolType.UNIVERSITY) {
+                db.eventTypeDao().clear(profileId ?: -1)
+                db.eventTypeDao().addDefaultTypes(profile)
+            }
+        }
+
+        if (dataVersion < 5) {
+            // update USOS event types and the appropriate events (2022-12-25)
+            dataVersion = 5
+
+            if (profile?.loginStoreType?.schoolType == SchoolType.UNIVERSITY) {
+                db.eventTypeDao().getAllWithDefaults(profile)
+                // wejściówka (4) -> kartkówka (3)
+                db.eventDao().getRawNow("UPDATE events SET eventType = 3 WHERE profileId = $profileId AND eventType = 4;")
+                // zadanie (6) -> zadanie domowe (-1)
+                db.eventDao().getRawNow("UPDATE events SET eventType = -1 WHERE profileId = $profileId AND eventType = 6;")
+            }
+        }
     }}
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/Constants.kt

@@ -26,9 +26,10 @@ val LIBRUS_USER_AGENT = "${SYSTEM_USER_AGENT}LibrusMobileApp"
 const val SYNERGIA_USER_AGENT = "Mozilla/5.0 (Windows NT 10.0; Win64; x64) Gecko/20100101 Firefox/62.0"
 const val LIBRUS_CLIENT_ID = "VaItV6oRutdo8fnjJwysnTjVlvaswf52ZqmXsJGP"
 const val LIBRUS_REDIRECT_URL = "app://librus"
-const val LIBRUS_AUTHORIZE_URL = "https://portal.librus.pl/oauth2/authorize?client_id=$LIBRUS_CLIENT_ID&redirect_uri=$LIBRUS_REDIRECT_URL&response_type=code"
-const val LIBRUS_LOGIN_URL = "https://portal.librus.pl/rodzina/login/action"
+const val LIBRUS_AUTHORIZE_URL = "https://portal.librus.pl/konto-librus/redirect/dru"
+const val LIBRUS_LOGIN_URL = "https://portal.librus.pl/konto-librus/login/action"
 const val LIBRUS_TOKEN_URL = "https://portal.librus.pl/oauth2/access_token"
+const val LIBRUS_HEADER = "pl.librus.synergiaDru2"
 
 const val LIBRUS_ACCOUNT_URL = "/v3/SynergiaAccounts/fresh/" // + login
 const val LIBRUS_ACCOUNTS_URL = "/v3/SynergiaAccounts"
@@ -59,9 +60,6 @@ const val LIBRUS_SANDBOX_URL = "https://sandbox.librus.pl/index.php?action="
 const val LIBRUS_SYNERGIA_HOMEWORK_ATTACHMENT_URL = "https://synergia.librus.pl/homework/downloadFile"
 const val LIBRUS_SYNERGIA_MESSAGES_ATTACHMENT_URL = "https://synergia.librus.pl/wiadomosci/pobierz_zalacznik"
 
-const val LIBRUS_PORTAL_RECAPTCHA_KEY = "6Lf48moUAAAAAB9ClhdvHr46gRWR"
-const val LIBRUS_PORTAL_RECAPTCHA_REFERER = "https://portal.librus.pl/rodzina/login"
-
 
 val MOBIDZIENNIK_USER_AGENT = SYSTEM_USER_AGENT
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/Regexes.kt

@@ -24,6 +24,25 @@ object Regexes {
         """^\[META:([A-z0-9-&=]+)]""".toRegex()
     }
 
+    val HTML_INPUT_HIDDEN by lazy {
+        """<input .*?type="hidden".+?>""".toRegex()
+    }
+    val HTML_INPUT_NAME by lazy {
+        """name="(.+?)"""".toRegex()
+    }
+    val HTML_INPUT_VALUE by lazy {
+        """value="(.+?)"""".toRegex()
+    }
+    val HTML_CSRF_TOKEN by lazy {
+        """name="csrf-token" content="([A-z0-9=+/\-_]+?)"""".toRegex()
+    }
+    val HTML_FORM_ACTION by lazy {
+        """<form .*?action="(.+?)"""".toRegex()
+    }
+    val HTML_RECAPTCHA_KEY by lazy {
+        """data-sitekey="(.+?)"""".toRegex()
+    }
+
 
 
     val MOBIDZIENNIK_GRADES_SUBJECT_NAME by lazy {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/EdziennikTask.kt

@@ -28,6 +28,8 @@ import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.data.db.full.AnnouncementFull
 import pl.szczodrzynski.edziennik.data.db.full.EventFull
 import pl.szczodrzynski.edziennik.data.db.full.MessageFull
+import pl.szczodrzynski.edziennik.ext.isBeforeYear
+import pl.szczodrzynski.edziennik.ext.shouldArchive
 import pl.szczodrzynski.edziennik.utils.Utils.d
 import pl.szczodrzynski.edziennik.utils.managers.AvailabilityManager.Error.Type
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/ProfileArchiver.kt

@@ -52,28 +52,29 @@ class ProfileArchiver(val app: App, val profile: Profile) {
 
         when (profile.loginStoreType) {
             LoginType.LIBRUS -> {
-                profile.removeStudentData("isPremium")
-                profile.removeStudentData("pushDeviceId")
-                profile.removeStudentData("startPointsSemester1")
-                profile.removeStudentData("startPointsSemester2")
-                profile.removeStudentData("enablePointGrades")
-                profile.removeStudentData("enableDescriptiveGrades")
+                profile.studentData.remove("isPremium")
+                profile.studentData.remove("pushDeviceId")
+                profile.studentData.remove("startPointsSemester1")
+                profile.studentData.remove("startPointsSemester2")
+                profile.studentData.remove("enablePointGrades")
+                profile.studentData.remove("enableDescriptiveGrades")
             }
             LoginType.MOBIDZIENNIK -> {}
             LoginType.VULCAN -> {
                 // DataVulcan.isApiLoginValid() returns false so it will update the semester
-                profile.removeStudentData("currentSemesterEndDate")
-                profile.removeStudentData("studentSemesterId")
-                profile.removeStudentData("studentSemesterNumber")
-                profile.removeStudentData("semester1Id")
-                profile.removeStudentData("semester2Id")
-                profile.removeStudentData("studentClassId")
+                profile.studentData.remove("currentSemesterEndDate")
+                profile.studentData.remove("studentSemesterId")
+                profile.studentData.remove("studentSemesterNumber")
+                profile.studentData.remove("semester1Id")
+                profile.studentData.remove("semester2Id")
+                profile.studentData.remove("studentClassId")
             }
             LoginType.IDZIENNIK -> {
-                profile.removeStudentData("schoolYearId")
+                profile.studentData.remove("schoolYearId")
             }
             LoginType.EDUDZIENNIK -> {}
             LoginType.PODLASIE -> {}
+            LoginType.USOS -> {}
             LoginType.DEMO -> {}
             LoginType.TEMPLATE -> {}
         }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/DataLibrus.kt

@@ -10,7 +10,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 
 class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app, profile, loginStore) {
 
@@ -117,7 +119,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiLogin: String? = null
     var apiLogin: String?
         get() { mApiLogin = mApiLogin ?: profile?.getStudentData("accountLogin", null); return mApiLogin }
-        set(value) { profile?.putStudentData("accountLogin", value); mApiLogin = value }
+        set(value) { profile["accountLogin"] = value; mApiLogin = value }
     /**
      * A Synergia password.
      * Used: for login (API Login Method) in Synergia mode.
@@ -126,7 +128,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiPassword: String? = null
     var apiPassword: String?
         get() { mApiPassword = mApiPassword ?: profile?.getStudentData("accountPassword", null); return mApiPassword }
-        set(value) { profile?.putStudentData("accountPassword", value); mApiPassword = value }
+        set(value) { profile["accountPassword"] = value; mApiPassword = value }
 
     /**
      * A JST login Code.
@@ -135,7 +137,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiCode: String? = null
     var apiCode: String?
         get() { mApiCode = mApiCode ?: loginStore.getLoginData("accountCode", null); return mApiCode }
-        set(value) { profile?.putStudentData("accountCode", value); mApiCode = value }
+        set(value) { profile["accountCode"] = value; mApiCode = value }
     /**
      * A JST login PIN.
      * Used only during first login in JST mode.
@@ -143,7 +145,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiPin: String? = null
     var apiPin: String?
         get() { mApiPin = mApiPin ?: loginStore.getLoginData("accountPin", null); return mApiPin }
-        set(value) { profile?.putStudentData("accountPin", value); mApiPin = value }
+        set(value) { profile["accountPin"] = value; mApiPin = value }
 
     /**
      * A Synergia API access token.
@@ -154,7 +156,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiAccessToken: String? = null
     var apiAccessToken: String?
         get() { mApiAccessToken = mApiAccessToken ?: profile?.getStudentData("accountToken", null); return mApiAccessToken }
-        set(value) { mApiAccessToken = value; profile?.putStudentData("accountToken", value) ?: return; }
+        set(value) { mApiAccessToken = value; profile["accountToken"] = value ?: return; }
     /**
      * A Synergia API refresh token.
      * Used when refreshing the [apiAccessToken] in JST, Synergia modes.
@@ -162,7 +164,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiRefreshToken: String? = null
     var apiRefreshToken: String?
         get() { mApiRefreshToken = mApiRefreshToken ?: profile?.getStudentData("accountRefreshToken", null); return mApiRefreshToken }
-        set(value) { mApiRefreshToken = value; profile?.putStudentData("accountRefreshToken", value) ?: return; }
+        set(value) { mApiRefreshToken = value; profile["accountRefreshToken"] = value ?: return; }
     /**
      * The expiry time for [apiAccessToken], as a UNIX timestamp.
      * Used when refreshing the [apiAccessToken] in JST, Synergia modes.
@@ -171,7 +173,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mApiTokenExpiryTime: Long? = null
     var apiTokenExpiryTime: Long
         get() { mApiTokenExpiryTime = mApiTokenExpiryTime ?: profile?.getStudentData("accountTokenTime", 0L); return mApiTokenExpiryTime ?: 0L }
-        set(value) { mApiTokenExpiryTime = value; profile?.putStudentData("accountTokenTime", value) ?: return; }
+        set(value) { mApiTokenExpiryTime = value; profile["accountTokenTime"] = value; }
 
     /**
      * A push device ID, generated by Librus when registering
@@ -181,7 +183,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mPushDeviceId: Int? = null
     var pushDeviceId: Int
         get() { mPushDeviceId = mPushDeviceId ?: profile?.getStudentData("pushDeviceId", 0); return mPushDeviceId ?: 0 }
-        set(value) { mPushDeviceId = value; profile?.putStudentData("pushDeviceId", value) ?: return; }
+        set(value) { mPushDeviceId = value; profile["pushDeviceId"] = value; }
 
     /*     _____                            _
           / ____|                          (_)
@@ -198,7 +200,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSynergiaSessionId: String? = null
     var synergiaSessionId: String?
         get() { mSynergiaSessionId = mSynergiaSessionId ?: profile?.getStudentData("accountSID", null); return mSynergiaSessionId }
-        set(value) { profile?.putStudentData("accountSID", value) ?: return; mSynergiaSessionId = value }
+        set(value) { profile["accountSID"] = value; mSynergiaSessionId = value }
     /**
      * The expiry time for [synergiaSessionId], as a UNIX timestamp.
      * Used in endpoints with Synergia login method.
@@ -207,7 +209,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSynergiaSessionIdExpiryTime: Long? = null
     var synergiaSessionIdExpiryTime: Long
         get() { mSynergiaSessionIdExpiryTime = mSynergiaSessionIdExpiryTime ?: profile?.getStudentData("accountSIDTime", 0L); return mSynergiaSessionIdExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("accountSIDTime", value) ?: return; mSynergiaSessionIdExpiryTime = value }
+        set(value) { profile["accountSIDTime"] = value; mSynergiaSessionIdExpiryTime = value }
 
 
     /**
@@ -217,7 +219,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mMessagesSessionId: String? = null
     var messagesSessionId: String?
         get() { mMessagesSessionId = mMessagesSessionId ?: profile?.getStudentData("messagesSID", null); return mMessagesSessionId }
-        set(value) { profile?.putStudentData("messagesSID", value) ?: return; mMessagesSessionId = value }
+        set(value) { profile["messagesSID"] = value; mMessagesSessionId = value }
     /**
      * The expiry time for [messagesSessionId], as a UNIX timestamp.
      * Used in endpoints with Messages login method.
@@ -226,7 +228,7 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mMessagesSessionIdExpiryTime: Long? = null
     var messagesSessionIdExpiryTime: Long
         get() { mMessagesSessionIdExpiryTime = mMessagesSessionIdExpiryTime ?: profile?.getStudentData("messagesSIDTime", 0L); return mMessagesSessionIdExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("messagesSIDTime", value) ?: return; mMessagesSessionIdExpiryTime = value }
+        set(value) { profile["messagesSIDTime"] = value; mMessagesSessionIdExpiryTime = value }
 
     /*     ____  _   _
           / __ \| | | |
@@ -236,42 +238,42 @@ class DataLibrus(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
           \____/ \__|_| |_|\___|*/
     var isPremium
         get() = profile?.getStudentData("isPremium", false) ?: false
-        set(value) { profile?.putStudentData("isPremium", value) }
+        set(value) { profile["isPremium"] = value }
 
     private var mSchoolName: String? = null
     var schoolName: String?
         get() { mSchoolName = mSchoolName ?: profile?.getStudentData("schoolName", null); return mSchoolName }
-        set(value) { profile?.putStudentData("schoolName", value) ?: return; mSchoolName = value }
+        set(value) { profile["schoolName"] = value; mSchoolName = value }
 
     private var mUnitId: Long? = null
     var unitId: Long
         get() { mUnitId = mUnitId ?: profile?.getStudentData("unitId", 0L); return mUnitId ?: 0L }
-        set(value) { profile?.putStudentData("unitId", value) ?: return; mUnitId = value }
+        set(value) { profile["unitId"] = value; mUnitId = value }
 
     private var mStartPointsSemester1: Int? = null
     var startPointsSemester1: Int
         get() { mStartPointsSemester1 = mStartPointsSemester1 ?: profile?.getStudentData("startPointsSemester1", 0); return mStartPointsSemester1 ?: 0 }
-        set(value) { profile?.putStudentData("startPointsSemester1", value) ?: return; mStartPointsSemester1 = value }
+        set(value) { profile["startPointsSemester1"] = value; mStartPointsSemester1 = value }
 
     private var mStartPointsSemester2: Int? = null
     var startPointsSemester2: Int
         get() { mStartPointsSemester2 = mStartPointsSemester2 ?: profile?.getStudentData("startPointsSemester2", 0); return mStartPointsSemester2 ?: 0 }
-        set(value) { profile?.putStudentData("startPointsSemester2", value) ?: return; mStartPointsSemester2 = value }
+        set(value) { profile["startPointsSemester2"] = value; mStartPointsSemester2 = value }
 
     private var mEnablePointGrades: Boolean? = null
     var enablePointGrades: Boolean
         get() { mEnablePointGrades = mEnablePointGrades ?: profile?.getStudentData("enablePointGrades", true); return mEnablePointGrades ?: true }
-        set(value) { profile?.putStudentData("enablePointGrades", value) ?: return; mEnablePointGrades = value }
+        set(value) { profile["enablePointGrades"] = value; mEnablePointGrades = value }
 
     private var mEnableDescriptiveGrades: Boolean? = null
     var enableDescriptiveGrades: Boolean
         get() { mEnableDescriptiveGrades = mEnableDescriptiveGrades ?: profile?.getStudentData("enableDescriptiveGrades", true); return mEnableDescriptiveGrades ?: true }
-        set(value) { profile?.putStudentData("enableDescriptiveGrades", value) ?: return; mEnableDescriptiveGrades = value }
+        set(value) { profile["enableDescriptiveGrades"] = value; mEnableDescriptiveGrades = value }
 
     private var mTimetableNotPublic: Boolean? = null
     var timetableNotPublic: Boolean
         get() { mTimetableNotPublic = mTimetableNotPublic ?: profile?.getStudentData("timetableNotPublic", false); return mTimetableNotPublic ?: false }
-        set(value) { profile?.putStudentData("timetableNotPublic", value) ?: return; mTimetableNotPublic = value }
+        set(value) { profile["timetableNotPublic"] = value; mTimetableNotPublic = value }
 
     /**
      * Set to false when Recaptcha helper doesn't provide a working token.

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/api/LibrusApiNotices.kt

@@ -36,7 +36,7 @@ class LibrusApiNotices(override val data: DataLibrus,
                 val id = note.getLong("Id") ?: return@forEach
                 val text = note.getString("Text") ?: ""
                 val categoryId = note.getJsonObject("Category")?.getLong("Id") ?: -1
-                val teacherId = note.getJsonObject("AddedBy")?.getLong("Id") ?: -1
+                val teacherId = note.getJsonObject("Teacher")?.getLong("Id") ?: -1
                 val addedDate = note.getString("Date")?.let { Date.fromY_m_d(it) } ?: return@forEach
 
                 val type = when (note.getInt("Positive")) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/api/LibrusApiTimetables.kt

@@ -190,6 +190,7 @@ class LibrusApiTimetables(override val data: DataLibrus,
         }
 
         lessonObject.id = lessonObject.buildId()
+        lessonObject.ownerId = lessonObject.buildOwnerId()
 
         val seen = profile.empty || lessonDate < Date.getToday()
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/messages/LibrusMessagesGetMessage.kt

@@ -125,7 +125,7 @@ class LibrusMessagesGetMessage(override val data: DataLibrus,
                         val receiverId = teacher?.id ?: -1
                         teacher?.loginId = receiverLoginId
 
-                        val readDateText = message.select("readed").text()
+                        val readDateText = receiver.select("readed").text()
                         val readDate = when (readDateText.isNotNullNorEmpty()) {
                             true -> Date.fromIso(readDateText)
                             else -> 0

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/data/synergia/LibrusSynergiaHomework.kt

@@ -16,6 +16,7 @@ import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.ext.HOUR
 import pl.szczodrzynski.edziennik.ext.get
+import pl.szczodrzynski.edziennik.ext.getSemesterStart
 import pl.szczodrzynski.edziennik.ext.singleOrNull
 import pl.szczodrzynski.edziennik.utils.models.Date
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/librus/login/LibrusLoginPortal.kt

@@ -24,6 +24,9 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
         private const val TAG = "LoginLibrusPortal"
     }
 
+    // loop failsafe
+    private var loginPerformed = false
+
     init { run {
         if (data.loginStore.mode != LoginMode.LIBRUS_EMAIL) {
             data.error(ApiError(TAG, ERROR_INVALID_LOGIN_MODE))
@@ -33,6 +36,7 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
             data.error(ApiError(TAG, ERROR_LOGIN_DATA_MISSING))
             return@run
         }
+        loginPerformed = false
 
         // succeed having a non-expired access token and a refresh token
         if (data.isPortalLoginValid()) {
@@ -58,18 +62,23 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
         }
     }}
 
-    private fun authorize(url: String?) {
+    private fun authorize(url: String, referer: String? = null) {
         d(TAG, "Request: Librus/Login/Portal - $url")
 
         Request.builder()
                 .url(url)
                 .userAgent(LIBRUS_USER_AGENT)
+                .also {
+                    if (referer != null)
+                        it.addHeader("Referer", referer)
+                }
+                .addHeader("X-Requested-With", LIBRUS_HEADER)
                 .withClient(data.app.httpLazy)
                 .callback(object : TextCallbackHandler() {
                     override fun onSuccess(text: String, response: Response) {
                         val location = response.headers().get("Location")
                         if (location != null) {
-                            val authMatcher = Pattern.compile("$LIBRUS_REDIRECT_URL\\?code=([A-z0-9]+?)$", Pattern.DOTALL or Pattern.MULTILINE).matcher(location)
+                            val authMatcher = Pattern.compile("$LIBRUS_REDIRECT_URL\\?code=([^&?]+)", Pattern.DOTALL or Pattern.MULTILINE).matcher(location)
                             when {
                                 authMatcher.find() -> {
                                     accessToken(authMatcher.group(1), null)
@@ -83,16 +92,31 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
                                     authorize(location)
                                 }
                             }
-                        } else {
-                            val csrfMatcher = Pattern.compile("name=\"csrf-token\" content=\"([A-z0-9=+/\\-_]+?)\"", Pattern.DOTALL).matcher(text)
-                            if (csrfMatcher.find()) {
-                                login(csrfMatcher.group(1) ?: "")
-                            } else {
-                                data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_CSRF_MISSING)
-                                        .withResponse(response)
-                                        .withApiResponse(text))
+                            return
+                        }
+
+                        if (checkError(text, response))
+                            return
+
+                        var loginUrl = if (data.fakeLogin) FAKE_LIBRUS_LOGIN else LIBRUS_LOGIN_URL
+                        val csrfToken = Regexes.HTML_CSRF_TOKEN.find(text)?.get(1) ?: ""
+
+                        for (match in Regexes.HTML_FORM_ACTION.findAll(text)) {
+                            val form = match.value.lowercase()
+                            if ("login" in form && "post" in form) {
+                                loginUrl = match[1]
                             }
                         }
+
+                        val params = mutableMapOf<String, String>()
+                        for (match in Regexes.HTML_INPUT_HIDDEN.findAll(text)) {
+                            val input = match.value
+                            val name = Regexes.HTML_INPUT_NAME.find(input)?.get(1) ?: continue
+                            val value = Regexes.HTML_INPUT_VALUE.find(input)?.get(1) ?: continue
+                            params[name] = value
+                        }
+
+                        login(url = loginUrl, referer = url, csrfToken, params)
                     }
 
                     override fun onFailure(response: Response, throwable: Throwable) {
@@ -105,8 +129,54 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
                 .enqueue()
     }
 
-    private fun login(csrfToken: String) {
-        d(TAG, "Request: Librus/Login/Portal - ${if (data.fakeLogin) FAKE_LIBRUS_LOGIN else LIBRUS_LOGIN_URL}")
+    private fun checkError(text: String, response: Response): Boolean {
+        when {
+            text.contains("librus_account_settings_main") -> return false
+            text.contains("Sesja logowania wygasła") -> ERROR_LOGIN_LIBRUS_PORTAL_CSRF_EXPIRED
+            text.contains("Upewnij się, że nie") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
+            text.contains("Podany adres e-mail jest nieprawidłowy.") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
+            else -> null // no error for now
+        }?.let { errorCode ->
+            data.error(ApiError(TAG, errorCode)
+                .withApiResponse(text)
+                .withResponse(response))
+            return true
+        }
+
+        if ("robotem" in text || "g-recaptcha" in text || "captchaValidate" in text) {
+            val siteKey = Regexes.HTML_RECAPTCHA_KEY.find(text)?.get(1)
+            if (siteKey == null) {
+                data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_ACTION_ERROR)
+                    .withApiResponse(text)
+                    .withResponse(response))
+                return true
+            }
+            data.requireUserAction(
+                type = UserActionRequiredEvent.Type.RECAPTCHA,
+                params = Bundle(
+                    "siteKey" to siteKey,
+                    "referer" to response.request().url().toString(),
+                    "userAgent" to LIBRUS_USER_AGENT,
+                ),
+                errorText = R.string.notification_user_action_required_captcha_librus,
+            )
+            return true
+        }
+        return false
+    }
+
+    private fun login(
+        url: String,
+        referer: String,
+        csrfToken: String?,
+        params: Map<String, String>,
+    ) {
+        if (loginPerformed) {
+            data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_ACTION_ERROR))
+            return
+        }
+
+        d(TAG, "Request: Librus/Login/Portal - $url")
 
         val recaptchaCode = data.arguments?.getString("recaptchaCode") ?: data.loginStore.getLoginData("recaptchaCode", null)
         val recaptchaTime = data.arguments?.getLong("recaptchaTime") ?: data.loginStore.getLoginData("recaptchaTime", 0L)
@@ -116,67 +186,46 @@ class LibrusLoginPortal(val data: DataLibrus, val onSuccess: () -> Unit) {
         Request.builder()
                 .url(if (data.fakeLogin) FAKE_LIBRUS_LOGIN else LIBRUS_LOGIN_URL)
                 .userAgent(LIBRUS_USER_AGENT)
+                .addHeader("X-Requested-With", LIBRUS_HEADER)
+                .addHeader("Referer", referer)
+                .withClient(data.app.httpLazy)
                 .addParameter("email", data.portalEmail)
                 .addParameter("password", data.portalPassword)
                 .also {
                     if (recaptchaCode != null && System.currentTimeMillis() - recaptchaTime < 2*60*1000 /* 2 minutes */)
                         it.addParameter("g-recaptcha-response", recaptchaCode)
+                    if (csrfToken != null)
+                        it.addHeader("X-CSRF-TOKEN", csrfToken)
+                    for ((key, value) in params) {
+                        it.addParameter(key, value)
+                    }
                 }
-                .addHeader("X-CSRF-TOKEN", csrfToken)
-                .allowErrorCode(HTTP_BAD_REQUEST)
-                .allowErrorCode(HTTP_FORBIDDEN)
-                .contentType(MediaTypeUtils.APPLICATION_JSON)
+                .contentType(MediaTypeUtils.APPLICATION_FORM)
                 .post()
-                .callback(object : JsonCallbackHandler() {
-                    override fun onSuccess(json: JsonObject?, response: Response) {
+                .callback(object : TextCallbackHandler() {
+                    override fun onSuccess(text: String?, response: Response) {
+                        loginPerformed = true
                         val location = response.headers()?.get("Location")
                         if (location == "$LIBRUS_REDIRECT_URL?command=close") {
                             data.error(ApiError(TAG, ERROR_LIBRUS_PORTAL_MAINTENANCE)
-                                    .withApiResponse(json)
+                                    .withApiResponse(text)
                                     .withResponse(response))
                             return
                         }
-
-                        if (json == null) {
-                            if (response.parserErrorBody?.contains("wciąż nieaktywne") == true) {
-                                data.error(ApiError(TAG, ERROR_LOGIN_LIBRUS_PORTAL_NOT_ACTIVATED)
-                                        .withResponse(response))
-                                return
-                            }
+                        if (text == null) {
                             data.error(ApiError(TAG, ERROR_RESPONSE_EMPTY)
                                     .withResponse(response))
                             return
                         }
-                        val error = if (response.code() == 200) null else
-                            json.getJsonArray("errors")?.getString(0)
-                                    ?: json.getJsonObject("errors")?.entrySet()?.firstOrNull()?.value?.asString
 
-                        if (error?.contains("robotem") == true || json.getBoolean("captchaRequired") == true) {
-                            data.requireUserAction(
-                                type = UserActionRequiredEvent.Type.RECAPTCHA,
-                                params = Bundle(
-                                    "siteKey" to LIBRUS_PORTAL_RECAPTCHA_KEY,
-                                    "referer" to LIBRUS_PORTAL_RECAPTCHA_REFERER,
-                                ),
-                                errorText = R.string.notification_user_action_required_captcha_librus,
-                            )
-                            return
-                        }
-
-                        error?.let { code ->
-                            when {
-                                code.contains("Sesja logowania wygasła") -> ERROR_LOGIN_LIBRUS_PORTAL_CSRF_EXPIRED
-                                code.contains("Upewnij się, że nie") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
-                                code.contains("Podany adres e-mail jest nieprawidłowy.") -> ERROR_LOGIN_LIBRUS_PORTAL_INVALID_LOGIN
-                                else -> ERROR_LOGIN_LIBRUS_PORTAL_ACTION_ERROR
-                            }.let { errorCode ->
-                                data.error(ApiError(TAG, errorCode)
-                                        .withApiResponse(json)
-                                        .withResponse(response))
-                                return
-                            }
-                        }
-                        authorize(json.getString("redirect", LIBRUS_AUTHORIZE_URL))
+                        authorize(
+                            url = location
+                                ?: if (data.fakeLogin)
+                                    FAKE_LIBRUS_AUTHORIZE
+                                else
+                                    LIBRUS_AUTHORIZE_URL,
+                            referer = referer,
+                        )
                     }
 
                     override fun onFailure(response: Response, throwable: Throwable) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/DataMobidziennik.kt

@@ -11,7 +11,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
 
@@ -85,7 +87,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
     private var mStudentId: Int? = null
     var studentId: Int
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", 0); return mStudentId ?: 0 }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
 
     /*   __          __  _
          \ \        / / | |
@@ -125,7 +127,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var globalId: String?
         get() { mGlobalId = mGlobalId ?: profile?.getStudentData("globalId", null); return mGlobalId }
-        set(value) { profile?.putStudentData("globalId", value) ?: return; mGlobalId = value }
+        set(value) { profile["globalId"] = value; mGlobalId = value }
     private var mGlobalId: String? = null
 
     /**
@@ -135,7 +137,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var loginEmail: String?
         get() { mLoginEmail = mLoginEmail ?: profile?.getStudentData("email", null); return mLoginEmail }
-        set(value) { profile?.putStudentData("email", value); mLoginEmail = value }
+        set(value) { profile["email"] = value; mLoginEmail = value }
     private var mLoginEmail: String? = null
 
     /**
@@ -144,7 +146,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var loginId: String?
         get() { mLoginId = mLoginId ?: profile?.getStudentData("loginId", null); return mLoginId }
-        set(value) { profile?.putStudentData("loginId", value) ?: return; mLoginId = value }
+        set(value) { profile["loginId"] = value; mLoginId = value }
     private var mLoginId: String? = null
 
     /**
@@ -152,7 +154,7 @@ class DataMobidziennik(app: App, profile: Profile?, loginStore: LoginStore) : Da
      */
     var ciasteczkoAutoryzacji: String?
         get() { mCiasteczkoAutoryzacji = mCiasteczkoAutoryzacji ?: profile?.getStudentData("ciasteczkoAutoryzacji", null); return mCiasteczkoAutoryzacji }
-        set(value) { profile?.putStudentData("ciasteczkoAutoryzacji", value) ?: return; mCiasteczkoAutoryzacji = value }
+        set(value) { profile["ciasteczkoAutoryzacji"] = value; mCiasteczkoAutoryzacji = value }
     private var mCiasteczkoAutoryzacji: String? = null
 
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/api/MobidziennikApiAttendance.kt

@@ -12,6 +12,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Attendance.Companion.TYPE_PRESE
 import pl.szczodrzynski.edziennik.data.db.entity.Attendance.Companion.TYPE_RELEASED
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.ext.dateToSemester
 
 class MobidziennikApiAttendance(val data: DataMobidziennik, rows: List<String>) {
     init { run {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/api/MobidziennikApiTimetable.kt

@@ -88,6 +88,7 @@ class MobidziennikApiTimetable(val data: DataMobidziennik, rows: List<String>) {
                 }
 
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
 
                 val seen = profile.empty || date < Date.getToday()
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebAccountEmail.kt

@@ -10,6 +10,7 @@ import pl.szczodrzynski.edziennik.data.api.edziennik.mobidziennik.ENDPOINT_MOBID
 import pl.szczodrzynski.edziennik.data.api.edziennik.mobidziennik.data.MobidziennikWeb
 import pl.szczodrzynski.edziennik.ext.DAY
 import pl.szczodrzynski.edziennik.ext.get
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 
 class MobidziennikWebAccountEmail(override val data: DataMobidziennik,
                                   override val lastSync: Long?,
@@ -24,7 +25,8 @@ class MobidziennikWebAccountEmail(override val data: DataMobidziennik,
             MobidziennikLuckyNumberExtractor(data, text)
 
             val email = Regexes.MOBIDZIENNIK_ACCOUNT_EMAIL.find(text)?.let { it[1] }
-            data.loginEmail = email
+            if (email.isNotNullNorBlank())
+                data.loginEmail = email
 
             data.setSyncNext(ENDPOINT_MOBIDZIENNIK_WEB_ACCOUNT_EMAIL, if (email == null) 3* DAY else 7* DAY)
             onSuccess(ENDPOINT_MOBIDZIENNIK_WEB_ACCOUNT_EMAIL)

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebAttendance.kt

@@ -21,6 +21,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Attendance.Companion.TYPE_UNKNO
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.entity.SYNC_ALWAYS
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.ext.dateToSemester
 import pl.szczodrzynski.edziennik.ext.fixName
 import pl.szczodrzynski.edziennik.ext.get
 import pl.szczodrzynski.edziennik.ext.singleOrNull

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebGrades.kt

@@ -15,6 +15,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Grade.Companion.TYPE_NORMAL
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.entity.SYNC_ALWAYS
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.ext.dateToSemester
 import pl.szczodrzynski.edziennik.ext.fixWhiteSpaces
 import pl.szczodrzynski.edziennik.ext.get
 import pl.szczodrzynski.edziennik.ext.singleOrNull

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/data/web/MobidziennikWebTimetable.kt

@@ -336,6 +336,7 @@ class MobidziennikWebTimetable(
                 }
 
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
                 it.isExtra = isExtra
 
                 val seen = profile?.empty == false || lessonDate < Date.getToday()

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/mobidziennik/login/MobidziennikLoginApi2.kt

@@ -16,6 +16,7 @@ import pl.szczodrzynski.edziennik.data.api.models.ApiError
 import pl.szczodrzynski.edziennik.ext.JsonObject
 import pl.szczodrzynski.edziennik.ext.getJsonObject
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
 import pl.szczodrzynski.edziennik.utils.Utils
 
@@ -77,7 +78,9 @@ class MobidziennikLoginApi2(val data: DataMobidziennik, val onSuccess: () -> Uni
                     }
                 }
 
-                data.loginEmail = json.getString("email")
+                val email = json.getString("email")
+                if (email.isNotNullNorBlank())
+                    data.loginEmail = email
                 data.globalId = json.getString("id_global")
                 data.loginId = json.getString("login")
                 onSuccess()

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/podlasie/DataPodlasie.kt

@@ -10,7 +10,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.crc32
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 
 class DataPodlasie(app: App, profile: Profile?, loginStore: LoginStore) : Data(app, profile, loginStore) {
 
@@ -40,7 +42,7 @@ class DataPodlasie(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mApiUrl: String? = null
     var apiUrl: String?
         get() { mApiUrl = mApiUrl ?: profile?.getStudentData("apiUrl", null); return mApiUrl }
-        set(value) { profile?.putStudentData("apiUrl", value) ?: return; mApiUrl = value }
+        set(value) { profile["apiUrl"] = value; mApiUrl = value }
 
     /*     ____  _   _
           / __ \| | | |
@@ -51,32 +53,32 @@ class DataPodlasie(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mStudentId: String? = null
     var studentId: String?
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", null); return mStudentId }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
 
     private var mStudentLogin: String? = null
     var studentLogin: String?
         get() { mStudentLogin = mStudentLogin ?: profile?.getStudentData("studentLogin", null); return mStudentLogin }
-        set(value) { profile?.putStudentData("studentLogin", value) ?: return; mStudentLogin = value }
+        set(value) { profile["studentLogin"] = value; mStudentLogin = value }
 
     private var mSchoolName: String? = null
     var schoolName: String?
         get() { mSchoolName = mSchoolName ?: profile?.getStudentData("schoolName", null); return mSchoolName }
-        set(value) { profile?.putStudentData("schoolName", value) ?: return; mSchoolName = value }
+        set(value) { profile["schoolName"] = value; mSchoolName = value }
 
     private var mClassName: String? = null
     var className: String?
         get() { mClassName = mClassName ?: profile?.getStudentData("className", null); return mClassName }
-        set(value) { profile?.putStudentData("className", value) ?: return; mClassName = value }
+        set(value) { profile["className"] = value; mClassName = value }
 
     private var mSchoolYear: String? = null
     var schoolYear: String?
         get() { mSchoolYear = mSchoolYear ?: profile?.getStudentData("schoolYear", null); return mSchoolYear }
-        set(value) { profile?.putStudentData("schoolYear", value) ?: return; mSchoolYear = value }
+        set(value) { profile["schoolYear"] = value; mSchoolYear = value }
 
     private var mCurrentSemester: Int? = null
     var currentSemester: Int
         get() { mCurrentSemester = mCurrentSemester ?: profile?.getStudentData("currentSemester", 0); return mCurrentSemester ?: 0 }
-        set(value) { profile?.putStudentData("currentSemester", value) ?: return; mCurrentSemester = value }
+        set(value) { profile["currentSemester"] = value; mCurrentSemester = value }
 
     val schoolShortName: String?
         get() = studentLogin?.split('@')?.get(1)?.replace(".podlaskie.pl", "")

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/podlasie/data/api/PodlasieApiFinalGrades.kt

@@ -17,6 +17,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Grade.Companion.TYPE_YEAR_PROPO
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.ext.getLong
+import pl.szczodrzynski.edziennik.ext.getSemesterStart
 import pl.szczodrzynski.edziennik.ext.getString
 
 class PodlasieApiFinalGrades(val data: DataPodlasie, val rows: List<JsonObject>) {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/podlasie/data/api/PodlasieApiTimetable.kt

@@ -72,6 +72,7 @@ class PodlasieApiTimetable(val data: DataPodlasie, rows: List<JsonObject>) {
                 it.classroom = classroom
 
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
                 data.lessonList += it
             }
         }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/template/DataTemplate.kt

@@ -10,7 +10,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 
 /**
  * Use http://patorjk.com/software/taag/#p=display&f=Big for the ascii art
@@ -43,12 +45,12 @@ class DataTemplate(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mWebCookie: String? = null
     var webCookie: String?
         get() { mWebCookie = mWebCookie ?: profile?.getStudentData("webCookie", null); return mWebCookie }
-        set(value) { profile?.putStudentData("webCookie", value) ?: return; mWebCookie = value }
+        set(value) { profile["webCookie"] = value; mWebCookie = value }
 
     private var mWebExpiryTime: Long? = null
     var webExpiryTime: Long
         get() { mWebExpiryTime = mWebExpiryTime ?: profile?.getStudentData("webExpiryTime", 0L); return mWebExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("webExpiryTime", value) ?: return; mWebExpiryTime = value }
+        set(value) { profile["webExpiryTime"] = value; mWebExpiryTime = value }
 
     /*                   _
              /\         (_)
@@ -61,10 +63,10 @@ class DataTemplate(app: App, profile: Profile?, loginStore: LoginStore) : Data(a
     private var mApiToken: String? = null
     var apiToken: String?
         get() { mApiToken = mApiToken ?: profile?.getStudentData("apiToken", null); return mApiToken }
-        set(value) { profile?.putStudentData("apiToken", value) ?: return; mApiToken = value }
+        set(value) { profile["apiToken"] = value; mApiToken = value }
 
     private var mApiExpiryTime: Long? = null
     var apiExpiryTime: Long
         get() { mApiExpiryTime = mApiExpiryTime ?: profile?.getStudentData("apiExpiryTime", 0L); return mApiExpiryTime ?: 0L }
-        set(value) { profile?.putStudentData("apiExpiryTime", value) ?: return; mApiExpiryTime = value }
+        set(value) { profile["apiExpiryTime"] = value; mApiExpiryTime = value }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/DataUsos.kt

@@ -9,6 +9,8 @@ import pl.szczodrzynski.edziennik.data.api.models.Data
 import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
+import pl.szczodrzynski.edziennik.ext.getStudentData
+import pl.szczodrzynski.edziennik.ext.set
 
 class DataUsos(
     app: App,
@@ -69,6 +71,6 @@ class DataUsos(
 
     var studentId: Int
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", 0); return mStudentId ?: 0 }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
     private var mStudentId: Int? = null
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/api/UsosApiTerms.kt

@@ -41,24 +41,18 @@ class UsosApiTerms(
     }
 
     private fun processResponse(json: JsonArray): Boolean {
-        val dates = mutableSetOf<Date>()
+        val today = Date.getToday()
         for (term in json.asJsonObjectList()) {
             if (!term.getBoolean("is_active", false))
                 continue
-            val startDate = term.getString("start_date")?.let { Date.fromY_m_d(it) }
-            val finishDate = term.getString("finish_date")?.let { Date.fromY_m_d(it) }
-            if (startDate != null)
-                dates += startDate
-            if (finishDate != null)
-                dates += finishDate
+            val startDate = term.getString("start_date")?.let { Date.fromY_m_d(it) } ?: continue
+            val finishDate = term.getString("finish_date")?.let { Date.fromY_m_d(it) } ?: continue
+            if (today in startDate..finishDate) {
+                profile?.studentSchoolYearStart = startDate.year
+                profile?.dateSemester1Start = startDate
+                profile?.dateSemester2Start = finishDate
+            }
         }
-        val datesSorted = dates.sorted()
-        if (datesSorted.size != 3)
-            return false
-        profile?.studentSchoolYearStart = datesSorted[0].year
-        profile?.dateSemester1Start = datesSorted[0]
-        profile?.dateSemester2Start = datesSorted[1]
-        profile?.dateYearEnd = datesSorted[2]
         return true
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/usos/data/api/UsosApiTimetable.kt

@@ -104,8 +104,9 @@ class UsosApiTimetable(
                 it.teacherId = lecturerIds?.firstOrNull() ?: -1L
                 it.teamId = unitId
                 val groupName = classTypeId?.plus(groupNumber)?.let { s -> "($s)" }
-                it.classroom = "$buildingId / $roomNumber ${groupName ?: ""}"
+                it.classroom = "Sala $roomNumber / bud. $buildingId ${groupName ?: ""}"
                 it.id = it.buildId()
+                it.ownerId = it.buildOwnerId()
 
                 it.color = when (classTypeId) {
                     "WYK" -> 0xff0d6091

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/DataVulcan.kt

@@ -12,7 +12,9 @@ import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
 import pl.szczodrzynski.edziennik.ext.crc16
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.isNotNullNorEmpty
+import pl.szczodrzynski.edziennik.ext.set
 import pl.szczodrzynski.fslogin.realm.RealmData
 
 class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app, profile, loginStore) {
@@ -57,7 +59,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSymbol: String? = null
     var symbol: String?
         get() { mSymbol = mSymbol ?: profile?.getStudentData("symbol", null); return mSymbol }
-        set(value) { profile?.putStudentData("symbol", value); mSymbol = value }
+        set(value) { profile["symbol"] = value; mSymbol = value }
 
     /**
      * Group symbol/number of the student's school.
@@ -69,7 +71,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSchoolSymbol: String? = null
     var schoolSymbol: String?
         get() { mSchoolSymbol = mSchoolSymbol ?: profile?.getStudentData("schoolSymbol", null); return mSchoolSymbol }
-        set(value) { profile?.putStudentData("schoolSymbol", value) ?: return; mSchoolSymbol = value }
+        set(value) { profile["schoolSymbol"] = value; mSchoolSymbol = value }
 
     /**
      * Short name of the school, used in some places.
@@ -79,7 +81,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSchoolShort: String? = null
     var schoolShort: String?
         get() { mSchoolShort = mSchoolShort ?: profile?.getStudentData("schoolShort", null); return mSchoolShort }
-        set(value) { profile?.putStudentData("schoolShort", value) ?: return; mSchoolShort = value }
+        set(value) { profile["schoolShort"] = value; mSchoolShort = value }
 
     /**
      * A school code consisting of the [symbol] and [schoolSymbol].
@@ -91,7 +93,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mSchoolCode: String? = null
     var schoolCode: String?
         get() { mSchoolCode = mSchoolCode ?: profile?.getStudentData("schoolName", null); return mSchoolCode }
-        set(value) { profile?.putStudentData("schoolName", value) ?: return; mSchoolCode = value }
+        set(value) { profile["schoolName"] = value; mSchoolCode = value }
 
     /**
      * ID of the student.
@@ -101,7 +103,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentId: Int? = null
     var studentId: Int
         get() { mStudentId = mStudentId ?: profile?.getStudentData("studentId", 0); return mStudentId ?: 0 }
-        set(value) { profile?.putStudentData("studentId", value) ?: return; mStudentId = value }
+        set(value) { profile["studentId"] = value; mStudentId = value }
 
     /**
      * ID of the student's account.
@@ -111,7 +113,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentLoginId: Int? = null
     var studentLoginId: Int
         get() { mStudentLoginId = mStudentLoginId ?: profile?.getStudentData("studentLoginId", 0); return mStudentLoginId ?: 0 }
-        set(value) { profile?.putStudentData("studentLoginId", value) ?: return; mStudentLoginId = value }
+        set(value) { profile["studentLoginId"] = value; mStudentLoginId = value }
 
     /**
      * ID of the student's class.
@@ -121,7 +123,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentClassId: Int? = null
     var studentClassId: Int
         get() { mStudentClassId = mStudentClassId ?: profile?.getStudentData("studentClassId", 0); return mStudentClassId ?: 0 }
-        set(value) { profile?.putStudentData("studentClassId", value) ?: return; mStudentClassId = value }
+        set(value) { profile["studentClassId"] = value; mStudentClassId = value }
 
     /**
      * ListaUczniow/IdOkresKlasyfikacyjny, e.g. 321
@@ -129,26 +131,26 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentSemesterId: Int? = null
     var studentSemesterId: Int
         get() { mStudentSemesterId = mStudentSemesterId ?: profile?.getStudentData("studentSemesterId", 0); return mStudentSemesterId ?: 0 }
-        set(value) { profile?.putStudentData("studentSemesterId", value) ?: return; mStudentSemesterId = value }
+        set(value) { profile["studentSemesterId"] = value; mStudentSemesterId = value }
 
     private var mStudentUnitId: Int? = null
     var studentUnitId: Int
         get() { mStudentUnitId = mStudentUnitId ?: profile?.getStudentData("studentUnitId", 0); return mStudentUnitId ?: 0 }
-        set(value) { profile?.putStudentData("studentUnitId", value) ?: return; mStudentUnitId = value }
+        set(value) { profile["studentUnitId"] = value; mStudentUnitId = value }
 
     private var mStudentConstituentId: Int? = null
     var studentConstituentId: Int
         get() { mStudentConstituentId = mStudentConstituentId ?: profile?.getStudentData("studentConstituentId", 0); return mStudentConstituentId ?: 0 }
-        set(value) { profile?.putStudentData("studentConstituentId", value) ?: return; mStudentConstituentId = value }
+        set(value) { profile["studentConstituentId"] = value; mStudentConstituentId = value }
 
     private var mSemester1Id: Int? = null
     var semester1Id: Int
         get() { mSemester1Id = mSemester1Id ?: profile?.getStudentData("semester1Id", 0); return mSemester1Id ?: 0 }
-        set(value) { profile?.putStudentData("semester1Id", value) ?: return; mSemester1Id = value }
+        set(value) { profile["semester1Id"] = value; mSemester1Id = value }
     private var mSemester2Id: Int? = null
     var semester2Id: Int
         get() { mSemester2Id = mSemester2Id ?: profile?.getStudentData("semester2Id", 0); return mSemester2Id ?: 0 }
-        set(value) { profile?.putStudentData("semester2Id", value) ?: return; mSemester2Id = value }
+        set(value) { profile["semester2Id"] = value; mSemester2Id = value }
 
     /**
      * ListaUczniow/OkresNumer, e.g. 1 or 2
@@ -156,7 +158,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mStudentSemesterNumber: Int? = null
     var studentSemesterNumber: Int
         get() { mStudentSemesterNumber = mStudentSemesterNumber ?: profile?.getStudentData("studentSemesterNumber", 0); return mStudentSemesterNumber ?: 0 }
-        set(value) { profile?.putStudentData("studentSemesterNumber", value) ?: return; mStudentSemesterNumber = value }
+        set(value) { profile["studentSemesterNumber"] = value; mStudentSemesterNumber = value }
 
     /**
      * Date of the end of the current semester ([studentSemesterNumber]).
@@ -166,7 +168,7 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mCurrentSemesterEndDate: Long? = null
     var currentSemesterEndDate: Long
         get() { mCurrentSemesterEndDate = mCurrentSemesterEndDate ?: profile?.getStudentData("currentSemesterEndDate", 0L); return mCurrentSemesterEndDate ?: 0L }
-        set(value) { profile?.putStudentData("currentSemesterEndDate", value) ?: return; mCurrentSemesterEndDate = value }
+        set(value) { profile["currentSemesterEndDate"] = value; mCurrentSemesterEndDate = value }
 
     /*             _____ _____        ____
              /\   |  __ \_   _|      |___ \
@@ -219,17 +221,17 @@ class DataVulcan(app: App, profile: Profile?, loginStore: LoginStore) : Data(app
     private var mHebeContext: String? = null
     var hebeContext: String?
         get() { mHebeContext = mHebeContext ?: profile?.getStudentData("hebeContext", null); return mHebeContext }
-        set(value) { profile?.putStudentData("hebeContext", value) ?: return; mHebeContext = value }
+        set(value) { profile["hebeContext"] = value; mHebeContext = value }
 
     private var mMessageBoxKey: String? = null
     var messageBoxKey: String?
         get() { mMessageBoxKey = mMessageBoxKey ?: profile?.getStudentData("messageBoxKey", null); return mMessageBoxKey }
-        set(value) { profile?.putStudentData("messageBoxKey", value) ?: return; mMessageBoxKey = value }
+        set(value) { profile["messageBoxKey"] = value; mMessageBoxKey = value }
 
     private var mMessageBoxName: String? = null
     var messageBoxName: String?
         get() { mMessageBoxName = mMessageBoxName ?: profile?.getStudentData("messageBoxName", null); return mMessageBoxName }
-        set(value) { profile?.putStudentData("messageBoxName", value) ?: return; mMessageBoxName = value }
+        set(value) { profile["messageBoxName"] = value; mMessageBoxName = value }
 
     val apiUrl: String?
         get() {

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/VulcanHebe.kt

@@ -26,6 +26,7 @@ import pl.szczodrzynski.edziennik.utils.Utils.d
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
 import java.net.HttpURLConnection
+import java.net.HttpURLConnection.HTTP_NOT_FOUND
 import java.net.URLEncoder
 import java.time.Instant
 import java.time.LocalDateTime
@@ -183,6 +184,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         payload: JsonElement? = null,
         baseUrl: Boolean = false,
         firebaseToken: String? = null,
+        allow404: Boolean = false,
         crossinline onSuccess: (json: T, response: Response?) -> Unit
     ) {
         val url = "${if (baseUrl) data.apiUrl else data.fullApiUrl}$endpoint"
@@ -295,6 +297,19 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             }
 
             override fun onFailure(response: Response?, throwable: Throwable?) {
+                if (allow404 && response?.code() == HTTP_NOT_FOUND) {
+                    try {
+                        onSuccess(null as T, response)
+                    } catch (e: Exception) {
+                        data.error(
+                            ApiError(tag, EXCEPTION_VULCAN_HEBE_REQUEST)
+                                .withResponse(response)
+                                .withThrowable(e)
+                        )
+                    }
+                    return
+                }
+
                 data.error(
                     ApiError(tag, ERROR_REQUEST_FAILURE)
                         .withResponse(response)
@@ -338,6 +353,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         query: Map<String, String> = mapOf(),
         baseUrl: Boolean = false,
         firebaseToken: String? = null,
+        allow404: Boolean = false,
         crossinline onSuccess: (json: T, response: Response?) -> Unit
     ) {
         val queryPath = query.map {
@@ -348,6 +364,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             if (query.isNotEmpty()) "$endpoint?$queryPath" else endpoint,
             baseUrl = baseUrl,
             firebaseToken = firebaseToken,
+            allow404 = allow404,
             onSuccess = onSuccess
         )
     }
@@ -382,6 +399,7 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
         messageBox: String? = null,
         params: Map<String, String> = mapOf(),
         includeFilterType: Boolean = true,
+        allow404: Boolean = false,
         onSuccess: (data: List<JsonObject>, response: Response?) -> Unit
     ) {
         val url = if (includeFilterType && filterType != null)
@@ -427,8 +445,8 @@ open class VulcanHebe(open val data: DataVulcan, open val lastSync: Long?) {
             )
             .format(DateTimeFormatter.ofPattern("yyyy-MM-dd HH:mm:ss"))
 
-        apiGet(tag, url, query) { json: JsonArray, response ->
-            onSuccess(json.map { it.asJsonObject }, response)
+        apiGet(tag, url, query, allow404 = allow404) { json: JsonArray?, response ->
+            onSuccess(json?.map { it.asJsonObject } ?: listOf(), response)
         }
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/hebe/VulcanHebeAddressbook.kt

@@ -19,6 +19,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_PARENTS_
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_STUDENT
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher.Companion.TYPE_TEACHER
 import pl.szczodrzynski.edziennik.ext.*
+import java.net.HttpURLConnection.HTTP_NOT_FOUND
 
 class VulcanHebeAddressbook(
     override val data: DataVulcan,
@@ -41,8 +42,15 @@ class VulcanHebeAddressbook(
             VULCAN_HEBE_ENDPOINT_ADDRESSBOOK,
             HebeFilterType.BY_PERSON,
             lastSync = lastSync,
-            includeFilterType = false
-        ) { list, _ ->
+            includeFilterType = false,
+            allow404 = true,
+        ) { list, response ->
+            if (response?.code() == HTTP_NOT_FOUND) {
+                data.setSyncNext(ENDPOINT_VULCAN_HEBE_ADDRESSBOOK, 2 * DAY)
+                onSuccess(ENDPOINT_VULCAN_HEBE_ADDRESSBOOK)
+                return@apiGetList
+            }
+
             list.forEach { person ->
                 val id = person.getString("Id") ?: return@forEach
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/edziennik/vulcan/data/hebe/VulcanHebeTimetable.kt

@@ -247,7 +247,9 @@ class VulcanHebeTimetable(
             }
 
             lessonObject.id = lessonObject.buildId()
+            lessonObject.ownerId = lessonObject.buildOwnerId()
             lessonShift?.id = lessonShift?.buildId() ?: -1
+            lessonShift?.ownerId = lessonShift?.buildOwnerId() ?: -1
 
             lessonList.add(lessonObject)
             lessonShift?.let { lessonList.add(it) }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/SzkolnyApi.kt

@@ -13,7 +13,6 @@ import kotlinx.coroutines.Dispatchers
 import kotlinx.coroutines.Job
 import kotlinx.coroutines.withContext
 import okhttp3.OkHttpClient
-import org.greenrobot.eventbus.EventBus
 import pl.szczodrzynski.edziennik.*
 import pl.szczodrzynski.edziennik.data.api.ERROR_API_INVALID_SIGNATURE
 import pl.szczodrzynski.edziennik.data.api.szkolny.adapter.DateAdapter
@@ -128,16 +127,10 @@ class SzkolnyApi(val app: App) : CoroutineScope {
         response: Response<ApiResponse<T>>,
         updateDeviceHash: Boolean = false,
     ): T {
-        app.config.update = response.body()?.update?.let { update ->
-            if (update.versionCode > BuildConfig.VERSION_CODE) {
-                if (update.updateMandatory
-                        && EventBus.getDefault().hasSubscriberForEvent(update::class.java)) {
-                    EventBus.getDefault().postSticky(update)
-                }
-                update
-            }
-            else
-                null
+        response.body()?.update?.let { update ->
+            // do not process "null" update, as it might not mean there's no update
+            // do not notify; silently check and show the home update card
+            app.updateManager.process(update, notify = false)
         }
 
         response.body()?.registerAvailability?.let { registerAvailability ->
@@ -205,7 +198,6 @@ class SzkolnyApi(val app: App) : CoroutineScope {
         val teams = app.db.teamDao().allNow
 
         val users = profiles.mapNotNull { profile ->
-            val config = app.config.getFor(profile.id)
             val user = ServerSyncRequest.User(
                 profile.userCode,
                 profile.studentNameLong,
@@ -214,9 +206,9 @@ class SzkolnyApi(val app: App) : CoroutineScope {
                 teams.filter { it.profileId == profile.id }.map { it.code }
             )
             val hash = user.toString().md5()
-            if (hash == config.hash)
+            if (hash == profile.config.hash)
                 return@mapNotNull null
-            return@mapNotNull user to config
+            return@mapNotNull user to profile.config
         }
 
         val response = api.serverSync(ServerSyncRequest(
@@ -265,12 +257,10 @@ class SzkolnyApi(val app: App) : CoroutineScope {
                     seen = profile.empty
                     notified = profile.empty
 
-                    if (profile.userCode == event.sharedBy) {
-                        sharedBy = "self"
-                        addedManually = true
-                    } else {
-                        sharedBy = eventSharedBy
-                    }
+                    sharedBy = if (profile.userCode == event.sharedBy)
+                        "self"
+                    else
+                        eventSharedBy
                 }
             }
         }
@@ -334,11 +324,14 @@ class SzkolnyApi(val app: App) : CoroutineScope {
     }
 
     @Throws(Exception::class)
-    fun shareNote(note: Note) {
+    fun shareNote(note: Note, teamId: Long? = null) {
         val profile = app.db.profileDao().getByIdNow(note.profileId)
             ?: throw NullPointerException("Profile is not found")
-        val team = app.db.teamDao().getClassNow(note.profileId)
-            ?: throw NullPointerException("TeamClass is not found")
+        val team = if (teamId == null)
+            app.db.teamDao().getClassNow(note.profileId)
+        else
+            app.db.teamDao().getByIdNow(note.profileId, teamId)
+        team ?: throw NullPointerException("TeamClass is not found")
 
         val response = api.shareNote(NoteShareRequest(
             deviceId = app.deviceId,
@@ -431,8 +424,8 @@ class SzkolnyApi(val app: App) : CoroutineScope {
     }
 
     @Throws(Exception::class)
-    fun getUpdate(channel: String): List<Update> {
-        val response = api.updates(channel).execute()
+    fun getUpdate(channel: Update.Type): List<Update> {
+        val response = api.updates(channel.name.lowercase()).execute()
         return parseResponse(response)
     }
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/interceptor/SignatureInterceptor.kt

@@ -12,10 +12,11 @@ import pl.szczodrzynski.edziennik.ext.bodyToString
 import pl.szczodrzynski.edziennik.ext.currentTimeUnix
 import pl.szczodrzynski.edziennik.ext.hmacSHA1
 import pl.szczodrzynski.edziennik.ext.md5
+import pl.szczodrzynski.edziennik.ext.takeValue
 
 class SignatureInterceptor(val app: App) : Interceptor {
     companion object {
-        private const val API_KEY = "szkolny_android_42a66f0842fc7da4e37c66732acf705a"
+        const val API_KEY = "szkolny_android_42a66f0842fc7da4e37c66732acf705a"
     }
 
     override fun intercept(chain: Interceptor.Chain): Response {
@@ -27,12 +28,13 @@ class SignatureInterceptor(val app: App) : Interceptor {
 
         return chain.proceed(
                 request.newBuilder()
-                        .header("X-ApiKey", API_KEY)
-                        .header("X-AppVersion", BuildConfig.VERSION_CODE.toString())
-                        .header("X-Timestamp", timestamp.toString())
-                        .header("X-Signature", sign(timestamp, body, url))
+                        .header("X-ApiKey", app.config.apiKeyCustom?.takeValue() ?: API_KEY)
                         .header("X-AppBuild", BuildConfig.BUILD_TYPE)
                         .header("X-AppFlavor", BuildConfig.FLAVOR)
+                        .header("X-AppVersion", BuildConfig.VERSION_CODE.toString())
+                        .header("X-DeviceId", app.deviceId)
+                        .header("X-Signature", sign(timestamp, body, url))
+                        .header("X-Timestamp", timestamp.toString())
                         .build())
     }
 

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/interceptor/Signing.kt

@@ -46,6 +46,6 @@ object Signing {
 
     /*fun provideKey(param1: String, param2: Long): ByteArray {*/
     fun pleaseStopRightNow(param1: String, param2: Long): ByteArray {
-        return "$param1.MTIzNDU2Nzg5MDoKyw75d3===.$param2".sha256()
+        return "$param1.MTIzNDU2Nzg5MD01uMP7oW===.$param2".sha256()
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/api/szkolny/response/UpdateResponse.kt

@@ -5,12 +5,21 @@
 package pl.szczodrzynski.edziennik.data.api.szkolny.response
 
 data class Update(
-        val versionCode: Int,
-        val versionName: String,
-        val releaseDate: String,
-        val releaseNotes: String?,
-        val releaseType: String,
-        val isOnGooglePlay: Boolean,
-        val downloadUrl: String?,
-        val updateMandatory: Boolean
-)
+    val versionCode: Int,
+    val versionName: String,
+    val releaseDate: String,
+    val releaseNotes: String?,
+    val releaseType: String,
+    val isOnGooglePlay: Boolean,
+    val downloadUrl: String?,
+    val updateMandatory: Boolean,
+) {
+
+    enum class Type {
+        NIGHTLY,
+        DEV,
+        BETA,
+        RC,
+        RELEASE,
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/data/api/task/SzkolnyTask.kt

@@ -55,7 +55,7 @@ class SzkolnyTask(val app: App, val syncingProfiles: List<Profile>) : IApiTask(-
         notificationList
                 .mapNotNull { it.profileId }
                 .distinct()
-                .map { app.config.getFor(it).sync.notificationFilter }
+                .map { app.config[it].sync.notificationFilter }
                 .forEach { filter ->
                     filter.forEach { type ->
                         notificationList.removeAll { it.type == type }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/AppDb.kt

@@ -44,7 +44,7 @@ import pl.szczodrzynski.edziennik.data.db.migration.*
     TimetableManual::class,
     Note::class,
     Metadata::class
-], version = 99)
+], version = 100)
 @TypeConverters(
         ConverterTime::class,
         ConverterDate::class,
@@ -188,6 +188,7 @@ abstract class AppDb : RoomDatabase() {
                 Migration97(),
                 Migration98(),
                 Migration99(),
+                Migration100(),
         ).allowMainThreadQueries().build()
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/converter/ConverterEnums.kt

@@ -5,13 +5,37 @@
 package pl.szczodrzynski.edziennik.data.db.converter
 
 import androidx.room.TypeConverter
+import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
+import pl.szczodrzynski.edziennik.data.db.enums.LoginMethod
+import pl.szczodrzynski.edziennik.data.db.enums.LoginMode
+import pl.szczodrzynski.edziennik.data.db.enums.LoginType
+import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
+import pl.szczodrzynski.edziennik.data.db.enums.NotificationType
 import pl.szczodrzynski.edziennik.ext.*
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
 
 class ConverterEnums {
 
     @TypeConverter
-    fun fromEnum(value: Enum<*>?) = value?.toInt()
+    fun fromFeatureType(value: FeatureType?) = value?.id
+
+    @TypeConverter
+    fun fromLoginMethod(value: LoginMethod?) = value?.id
+
+    @TypeConverter
+    fun fromLoginMode(value: LoginMode?) = value?.id
+
+    @TypeConverter
+    fun fromLoginType(value: LoginType?) = value?.id
+
+    @TypeConverter
+    fun fromMetadataType(value: MetadataType?) = value?.id
+
+    @TypeConverter
+    fun fromNotificationType(value: NotificationType?) = value?.id
+
+    @TypeConverter
+    fun fromNavTarget(value: NavTarget?) = value?.id
 
     @TypeConverter
     fun toFeatureType(value: Int?) = value.asFeatureTypeOrNull()

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/EventTypeDao.kt

@@ -3,15 +3,16 @@
  */
 package pl.szczodrzynski.edziennik.data.db.dao
 
-import android.content.Context
+import android.graphics.Color
 import androidx.lifecycle.LiveData
 import androidx.room.Dao
 import androidx.room.Insert
 import androidx.room.OnConflictStrategy
 import androidx.room.Query
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_DEFAULT
+import pl.szczodrzynski.edziennik.config.AppData
 import pl.szczodrzynski.edziennik.data.db.entity.EventType
 import pl.szczodrzynski.edziennik.data.db.entity.EventType.Companion.SOURCE_DEFAULT
+import pl.szczodrzynski.edziennik.data.db.entity.Profile
 
 @Dao
 abstract class EventTypeDao {
@@ -24,6 +25,9 @@ abstract class EventTypeDao {
     @Query("DELETE FROM eventTypes WHERE profileId = :profileId")
     abstract fun clear(profileId: Int)
 
+    @Query("DELETE FROM eventTypes WHERE profileId = :profileId AND eventTypeSource = :source")
+    abstract fun clearBySource(profileId: Int, source: Int)
+
     @Query("SELECT * FROM eventTypes WHERE profileId = :profileId AND eventType = :typeId")
     abstract fun getByIdNow(profileId: Int, typeId: Long): EventType?
 
@@ -36,20 +40,37 @@ abstract class EventTypeDao {
     @get:Query("SELECT * FROM eventTypes")
     abstract val allNow: List<EventType>
 
-    fun addDefaultTypes(context: Context, profileId: Int): List<EventType> {
+    fun addDefaultTypes(profile: Profile): List<EventType> {
+        val data = AppData.get(profile.loginStoreType)
         var order = 100
-        val colorMap = EventType.getTypeColorMap()
-        val typeList = EventType.getTypeNameMap().map { (id, name) ->
+        val typeList = data.eventTypes.map {
             EventType(
-                profileId = profileId,
-                id = id,
-                name = context.getString(name),
-                color = colorMap[id] ?: COLOR_DEFAULT,
+                profileId = profile.id,
+                id = it.id,
+                name = it.name,
+                color = Color.parseColor(it.color),
                 order = order++,
-                source = SOURCE_DEFAULT
+                source = SOURCE_DEFAULT,
             )
         }
         addAll(typeList)
         return typeList
     }
+
+    fun getAllWithDefaults(profile: Profile): List<EventType> {
+        val eventTypes = getAllNow(profile.id)
+
+        val defaultIdsExpected = AppData.get(profile.loginStoreType).eventTypes
+            .map { it.id }
+        val defaultIdsFound = eventTypes.filter { it.source == SOURCE_DEFAULT }
+            .sortedBy { it.order }
+            .map { it.id }
+
+        if (defaultIdsExpected == defaultIdsFound)
+            return eventTypes
+
+        clearBySource(profile.id, SOURCE_DEFAULT)
+        addDefaultTypes(profile)
+        return eventTypes
+    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/ProfileDao.kt

@@ -28,6 +28,9 @@ interface ProfileDao {
     @Query("SELECT * FROM profiles WHERE profileId = :profileId")
     fun getByIdNow(profileId: Int): Profile?
 
+    @Query("SELECT * FROM profiles WHERE profileId = :profileId")
+    suspend fun getByIdSuspend(profileId: Int): Profile?
+
     @get:Query("SELECT * FROM profiles WHERE profileId >= 0 ORDER BY profileId")
     val all: LiveData<List<Profile>>
 
@@ -49,7 +52,7 @@ interface ProfileDao {
     @get:Query("SELECT profileId FROM profiles WHERE profileId >= 0 ORDER BY profileId")
     val idsNow: List<Int>
 
-    @Query("SELECT profiles.* FROM teams JOIN profiles USING(profileId) WHERE teamCode = :teamCode AND registration = " + Profile.REGISTRATION_ENABLED + " AND enableSharedEvents = 1")
+    @Query("SELECT profiles.* FROM teams JOIN profiles USING(profileId) WHERE teamCode = :teamCode AND registration = " + Profile.REGISTRATION_ENABLED)
     fun getByTeamCodeNowWithRegistration(teamCode: String?): List<Profile>
 
     @get:Query("SELECT profileId FROM profiles WHERE profileId > 0 ORDER BY profileId ASC LIMIT 1")

app/src/main/java/pl/szczodrzynski/edziennik/data/db/dao/TimetableDao.kt

@@ -107,6 +107,9 @@ abstract class TimetableDao : BaseDao<Lesson, LessonFull> {
     fun getByIdNow(profileId: Int, id: Long) =
             getOneNow("$QUERY WHERE timetable.profileId = $profileId AND timetable.id = $id")
 
+    fun getByOwnerIdNow(profileId: Int, ownerId: Long) =
+            getOneNow("$QUERY WHERE timetable.profileId = $profileId AND timetable.ownerId = $ownerId")
+
     @Query("UPDATE timetable SET keep = 0 WHERE profileId = :profileId AND isExtra = :isExtra AND type != -1 AND ((type != 3 AND date >= :dateFrom) OR ((type = 3 OR type = 1) AND oldDate >= :dateFrom))")
     abstract fun dontKeepFromDate(profileId: Int, dateFrom: Date, isExtra: Boolean)
 

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Event.kt

@@ -73,13 +73,22 @@ open class Event(
         const val COLOR_INFORMATION = 0xff039be5.toInt()
     }
 
+    /**
+     * Added manually - added by self, shared by self, or shared by someone else.
+     */
     @ColumnInfo(name = "eventAddedManually")
     var addedManually: Boolean = false
-        get() = field || sharedBy == "self"
+        get() = field || isShared
+
+    /**
+     * Shared by - user code who shared the event. Null if not shared.
+     * "Self" if shared by this app user.
+     */
     @ColumnInfo(name = "eventSharedBy")
     var sharedBy: String? = null
     @ColumnInfo(name = "eventSharedByName")
     var sharedByName: String? = null
+
     @ColumnInfo(name = "eventBlacklisted")
     var blacklisted: Boolean = false
     @ColumnInfo(name = "eventIsDone")
@@ -104,6 +113,27 @@ open class Event(
     var attachmentIds: MutableList<Long>? = null
     var attachmentNames: MutableList<String>? = null
 
+    val isHomework
+        get() = type == TYPE_HOMEWORK
+
+    /**
+     * Whether the event is shared by anyone. Note that this implies [addedManually].
+     */
+    val isShared
+        get() = sharedBy != null
+
+    /**
+     * Whether the event is shared by "self" (this app user).
+     */
+    val isSharedSent
+        get() = sharedBy == "self"
+
+    /**
+     * Whether the event is shared by someone else from the class group.
+     */
+    val isSharedReceived
+        get() = sharedBy != null && sharedBy != "self"
+
     /**
      * Add an attachment
      * @param id attachment ID
@@ -134,9 +164,6 @@ open class Event(
             it.timeInMillis += 45 * MINUTE * 1000
         }
 
-    val isHomework
-        get() = type == TYPE_HOMEWORK
-
     @Ignore
     fun withMetadata(metadata: Metadata) = EventFull(this, metadata)
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/EventType.kt

@@ -5,31 +5,6 @@ package pl.szczodrzynski.edziennik.data.db.entity
 
 import androidx.room.ColumnInfo
 import androidx.room.Entity
-import pl.szczodrzynski.edziennik.R
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_CLASS_EVENT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_DEFAULT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_ELEARNING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_ESSAY
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_EXAM
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_EXCURSION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_HOMEWORK
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_INFORMATION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_PROJECT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_PT_MEETING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_READING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.COLOR_SHORT_QUIZ
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_CLASS_EVENT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_DEFAULT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_ELEARNING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_ESSAY
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_EXAM
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_EXCURSION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_HOMEWORK
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_INFORMATION
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_PROJECT
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_PT_MEETING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_READING
-import pl.szczodrzynski.edziennik.data.db.entity.Event.Companion.TYPE_SHORT_QUIZ
 
 @Entity(
     tableName = "eventTypes",
@@ -55,35 +30,5 @@ class EventType(
         const val SOURCE_REGISTER = 1
         const val SOURCE_CUSTOM = 2
         const val SOURCE_SHARED = 3
-
-        fun getTypeColorMap() = mapOf(
-            TYPE_ELEARNING to COLOR_ELEARNING,
-            TYPE_HOMEWORK to COLOR_HOMEWORK,
-            TYPE_DEFAULT to COLOR_DEFAULT,
-            TYPE_EXAM to COLOR_EXAM,
-            TYPE_SHORT_QUIZ to COLOR_SHORT_QUIZ,
-            TYPE_ESSAY to COLOR_ESSAY,
-            TYPE_PROJECT to COLOR_PROJECT,
-            TYPE_PT_MEETING to COLOR_PT_MEETING,
-            TYPE_EXCURSION to COLOR_EXCURSION,
-            TYPE_READING to COLOR_READING,
-            TYPE_CLASS_EVENT to COLOR_CLASS_EVENT,
-            TYPE_INFORMATION to COLOR_INFORMATION
-        )
-
-        fun getTypeNameMap() = mapOf(
-            TYPE_ELEARNING to R.string.event_type_elearning,
-            TYPE_HOMEWORK to R.string.event_type_homework,
-            TYPE_DEFAULT to R.string.event_other,
-            TYPE_EXAM to R.string.event_exam,
-            TYPE_SHORT_QUIZ to R.string.event_short_quiz,
-            TYPE_ESSAY to R.string.event_essay,
-            TYPE_PROJECT to R.string.event_project,
-            TYPE_PT_MEETING to R.string.event_pt_meeting,
-            TYPE_EXCURSION to R.string.event_excursion,
-            TYPE_READING to R.string.event_reading,
-            TYPE_CLASS_EVENT to R.string.event_class_event,
-            TYPE_INFORMATION to R.string.event_information
-        )
     }
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Lesson.kt

@@ -50,6 +50,13 @@ open class Lesson(
 
     var isExtra: Boolean = false
 
+    /**
+     * Stable ID denoting this lesson, used for note sharing (i.e. [profileId]-independent).
+     *
+     * This is simply the Unix timestamp of the lesson (in seconds).
+     */
+    var ownerId: Long = id
+
     val displayDate: Date?
         get() {
             if (type == TYPE_SHIFTED_SOURCE)
@@ -69,7 +76,12 @@ open class Lesson(
     val isChange
         get() = type == TYPE_CHANGE || type == TYPE_SHIFTED_TARGET
 
-    fun buildId(): Long = (displayDate?.combineWith(displayStartTime) ?: 0L) / 6L * 10L + (hashCode() and 0xFFFF)
+    fun buildId(): Long =
+        (displayDate?.combineWith(displayStartTime) ?: 0L) / 6L * 10L +
+                (hashCode() and 0xFFFF)
+
+    fun buildOwnerId(): Long =
+        (displayDate?.combineWith(displayStartTime) ?: 0L)
 
     @Ignore
     var showAsUnseen = false

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Noteable.kt

@@ -9,6 +9,7 @@ interface Noteable {
     fun getNoteType(): Note.OwnerType
     fun getNoteOwnerProfileId(): Int
     fun getNoteOwnerId(): Long
+    fun getNoteShareTeamId(): Long? = null
 
     var notes: MutableList<Note>
 

app/src/main/java/pl/szczodrzynski/edziennik/data/db/entity/Profile.kt

@@ -5,25 +5,18 @@
 package pl.szczodrzynski.edziennik.data.db.entity
 
 import android.content.Context
-import android.graphics.PorterDuff
-import android.graphics.PorterDuffColorFilter
-import android.graphics.drawable.Drawable
 import android.widget.ImageView
-import androidx.core.graphics.drawable.RoundedBitmapDrawableFactory
 import androidx.room.ColumnInfo
 import androidx.room.Entity
 import androidx.room.Ignore
 import com.google.gson.JsonObject
-import pl.droidsonroids.gif.GifDrawable
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
-import pl.szczodrzynski.edziennik.ext.*
-import pl.szczodrzynski.edziennik.utils.ProfileImageHolder
+import pl.szczodrzynski.edziennik.ext.dateToSemester
+import pl.szczodrzynski.edziennik.ext.getDrawable
+import pl.szczodrzynski.edziennik.ext.getHolder
 import pl.szczodrzynski.edziennik.utils.models.Date
-import pl.szczodrzynski.navlib.ImageHolder
-import pl.szczodrzynski.navlib.R
 import pl.szczodrzynski.navlib.drawer.IDrawerProfile
-import pl.szczodrzynski.navlib.getDrawableFromRes
 
 @Entity(tableName = "profiles", primaryKeys = ["profileId"])
 open class Profile(
@@ -60,9 +53,13 @@ open class Profile(
     }
 
     override var image: String? = null
-
     var empty = true
     var archived = false
+    var syncEnabled = true
+    @ColumnInfo(name = "enableSharedEvents")
+    var unused1 = true
+    var registration = REGISTRATION_UNSPECIFIED
+    var userCode = ""
 
     /**
      * A unique ID matching [archived] profiles with current ones
@@ -70,117 +67,35 @@ open class Profile(
      */
     var archiveId: Int? = null
 
-    var syncEnabled = true
-    var enableSharedEvents = true
-    var registration = REGISTRATION_UNSPECIFIED
-    var userCode = ""
-
     /**
      * The student's number in the class register.
      */
     var studentNumber = -1
     var studentClassName: String? = null
     var studentSchoolYearStart = Date.getToday().let { if (it.month < 9) it.year - 1 else it.year }
-
     var dateSemester1Start = Date(studentSchoolYearStart, 9, 1)
     var dateSemester2Start = Date(studentSchoolYearStart + 1, 2, 1)
     var dateYearEnd = Date(studentSchoolYearStart + 1, 6, 30)
-    fun getSemesterStart(semester: Int) = if (semester == 1) dateSemester1Start else dateSemester2Start
-    fun getSemesterEnd(semester: Int) = if (semester == 1) dateSemester2Start.clone().stepForward(0, 0, -1) else dateYearEnd
-    fun dateToSemester(date: Date) = if (date >= dateSemester2Start) 2 else 1
-    @delegate:Ignore
-    val currentSemester by lazy { dateToSemester(Date.getToday()) }
-
-    fun shouldArchive(): Boolean {
-        // vulcan hotfix
-        if (dateYearEnd.month > 6) {
-            dateYearEnd.month = 6
-            dateYearEnd.day = 30
-        }
-        // fix for when versions <4.3 synced 2020/2021 year dates to older profiles during 2020 Jun-Aug
-        if (dateSemester1Start.year > studentSchoolYearStart) {
-            val diff = dateSemester1Start.year - studentSchoolYearStart
-            dateSemester1Start.year -= diff
-            dateSemester2Start.year -= diff
-            dateYearEnd.year -= diff
-        }
-        return App.config.archiverEnabled
-                && Date.getToday() >= dateYearEnd
-                && Date.getToday().year > studentSchoolYearStart
-    }
-    fun isBeforeYear() = false && Date.getToday() < dateSemester1Start
-
     var disabledNotifications: List<Long>? = null
-
     var lastReceiversSync: Long = 0
 
-    fun hasStudentData(key: String) = studentData.has(key)
-    fun getStudentData(key: String, defaultValue: Boolean) = studentData.getBoolean(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: String?) = studentData.getString(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Int) = studentData.getInt(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Long) = studentData.getLong(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Float) = studentData.getFloat(key) ?: defaultValue
-    fun getStudentData(key: String, defaultValue: Char) = studentData.getChar(key) ?: defaultValue
-    fun putStudentData(key: String, value: Boolean) { studentData[key] = value }
-    fun putStudentData(key: String, value: String?) { studentData[key] = value }
-    fun putStudentData(key: String, value: Number) { studentData[key] = value }
-    fun putStudentData(key: String, value: Char) { studentData[key] = value }
-    fun removeStudentData(key: String) { studentData.remove(key) }
-
+    val currentSemester
+        get() = dateToSemester(Date.getToday())
     val isParent
         get() = accountName != null
-
     val accountOwnerName
         get() = accountName ?: studentNameLong
-
-    @Ignore
-    val registerName = loginStoreType.name.lowercase()
-
+    val registerName
+        get() = loginStoreType.name.lowercase()
     val canShare
         get() = registration == REGISTRATION_ENABLED && !archived
 
-    override fun getImageDrawable(context: Context): Drawable {
-        if (archived) {
-            return context.getDrawableFromRes(pl.szczodrzynski.edziennik.R.drawable.profile_archived).also {
-                it.colorFilter = PorterDuffColorFilter(colorFromName(name), PorterDuff.Mode.DST_OVER)
-            }
-        }
+    @delegate:Ignore
+    @delegate:Transient
+    val config by lazy { App.config[this.id] }
 
-        if (!image.isNullOrEmpty()) {
-            try {
-                return if (image?.endsWith(".gif", true) == true) {
-                    GifDrawable(image ?: "")
-                } else {
-                    RoundedBitmapDrawableFactory.create(context.resources, image ?: "")
-                    //return Drawable.createFromPath(image ?: "") ?: throw Exception()
-                }
-            }
-            catch (e: Exception) {
-                e.printStackTrace()
-            }
-        }
-
-        return context.getDrawableFromRes(R.drawable.profile).also {
-            it.colorFilter = PorterDuffColorFilter(colorFromName(name), PorterDuff.Mode.DST_OVER)
-        }
-    }
-
-    override fun getImageHolder(context: Context): ImageHolder {
-        if (archived) {
-            return ImageHolder(pl.szczodrzynski.edziennik.R.drawable.profile_archived, colorFromName(name))
-        }
-
-        return if (!image.isNullOrEmpty()) {
-            try {
-                ProfileImageHolder(image ?: "")
-            } catch (_: Exception) {
-                ImageHolder(R.drawable.profile, colorFromName(name))
-            }
-        }
-        else {
-            ImageHolder(R.drawable.profile, colorFromName(name))
-        }
-    }
+    override fun getImageDrawable(context: Context) = this.getDrawable(context)
+    override fun getImageHolder(context: Context) = this.getHolder()
     override fun applyImageTo(imageView: ImageView) {
         getImageHolder(imageView.context).applyTo(imageView)
     }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/enums/LoginMethod.kt

@@ -6,6 +6,8 @@ package pl.szczodrzynski.edziennik.data.db.enums
 
 import pl.szczodrzynski.edziennik.data.db.entity.LoginStore
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
+import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.isNotNullNorBlank
 
 enum class LoginMethod(
     val loginType: LoginType,
@@ -26,7 +28,7 @@ enum class LoginMethod(
     MOBIDZIENNIK_API2(
         loginType = LoginType.MOBIDZIENNIK,
         id = 1300,
-        isPossible = { profile, _ -> profile?.studentData?.has("email") ?: false },
+        isPossible = { profile, _ -> profile?.studentData?.getString("email").isNotNullNorBlank() },
     ),
     LIBRUS_PORTAL(
         loginType = LoginType.LIBRUS,
@@ -57,7 +59,7 @@ enum class LoginMethod(
     VULCAN_WEB_MAIN(
         loginType = LoginType.VULCAN,
         id = 4100,
-        isPossible = { _, loginStore -> loginStore.hasLoginData("webHost") },
+        isPossible = { _, loginStore -> loginStore.getLoginData("webHost", null).isNotNullNorBlank() },
     ),
     VULCAN_HEBE(
         loginType = LoginType.VULCAN,

app/src/main/java/pl/szczodrzynski/edziennik/data/db/enums/LoginType.kt

@@ -7,12 +7,13 @@ package pl.szczodrzynski.edziennik.data.db.enums
 enum class LoginType(
     val id: Int,
     val features: Set<FeatureType>,
+    val schoolType: SchoolType = SchoolType.STANDARD,
 ) {
     MOBIDZIENNIK(id = 1, features = FEATURES_MOBIDZIENNIK),
     LIBRUS(id = 2, features = FEATURES_LIBRUS),
     VULCAN(id = 4, features = FEATURES_VULCAN),
     PODLASIE(id = 6, features = FEATURES_PODLASIE),
-    USOS(id = 7, features = FEATURES_USOS),
+    USOS(id = 7, features = FEATURES_USOS, schoolType = SchoolType.UNIVERSITY),
     DEMO(id = 20, features = setOf()),
     TEMPLATE(id = 21, features = setOf()),
 

app/src/main/java/pl/szczodrzynski/edziennik/data/db/enums/SchoolType.kt

@@ -0,0 +1,10 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-21.
+ */
+
+package pl.szczodrzynski.edziennik.data.db.enums
+
+enum class SchoolType {
+    STANDARD,
+    UNIVERSITY,
+}

app/src/main/java/pl/szczodrzynski/edziennik/data/db/full/EventFull.kt

@@ -9,6 +9,7 @@ import pl.szczodrzynski.edziennik.data.db.entity.Event
 import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.entity.Note
 import pl.szczodrzynski.edziennik.data.db.entity.Noteable
+import pl.szczodrzynski.edziennik.ext.takePositive
 import pl.szczodrzynski.edziennik.ui.search.Searchable
 import pl.szczodrzynski.edziennik.utils.html.BetterHtml
 import pl.szczodrzynski.edziennik.utils.models.Date
@@ -118,4 +119,5 @@ class EventFull(
     override fun getNoteType() = Note.OwnerType.EVENT
     override fun getNoteOwnerProfileId() = profileId
     override fun getNoteOwnerId() = id
+    override fun getNoteShareTeamId() = teamId.takePositive()
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/full/LessonFull.kt

@@ -9,6 +9,7 @@ import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.data.db.entity.Lesson
 import pl.szczodrzynski.edziennik.data.db.entity.Note
 import pl.szczodrzynski.edziennik.data.db.entity.Noteable
+import pl.szczodrzynski.edziennik.ext.takePositive
 import pl.szczodrzynski.edziennik.utils.models.Time
 
 class LessonFull(
@@ -137,9 +138,10 @@ class LessonFull(
     var seen: Boolean = false
     var notified: Boolean = false
 
-    @Relation(parentColumn = "id", entityColumn = "noteOwnerId", entity = Note::class)
+    @Relation(parentColumn = "ownerId", entityColumn = "noteOwnerId", entity = Note::class)
     override lateinit var notes: MutableList<Note>
     override fun getNoteType() = Note.OwnerType.LESSON
     override fun getNoteOwnerProfileId() = profileId
-    override fun getNoteOwnerId() = id
+    override fun getNoteOwnerId() = ownerId
+    override fun getNoteShareTeamId() = teamId.takePositive()
 }

app/src/main/java/pl/szczodrzynski/edziennik/data/db/migration/Migration100.kt

@@ -0,0 +1,25 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-25.
+ */
+
+package pl.szczodrzynski.edziennik.data.db.migration
+
+import androidx.room.migration.Migration
+import androidx.sqlite.db.SupportSQLiteDatabase
+
+class Migration100 : Migration(99, 100) {
+    override fun migrate(database: SupportSQLiteDatabase) {
+        // add Note Owner ID to Lesson, to make it profileId-independent
+        // calculate the new owner ID based on the old ID
+        database.execSQL("ALTER TABLE timetable ADD COLUMN ownerId INT NOT NULL DEFAULT 0;")
+        // set new ID for actual lessons
+        database.execSQL("UPDATE timetable SET ownerId = ROUND((id & ~65535) / 500000.0) * 300000;")
+        // copy the old ID (date value) for NO_LESSONS
+        database.execSQL("UPDATE timetable SET ownerId = id WHERE type = -1;")
+        // update ID for notes as well
+        database.execSQL("UPDATE notes SET noteOwnerId = ROUND((noteOwnerId & ~65535) / 500000.0) * 300000 WHERE noteOwnerType = 'LESSON' AND noteOwnerId > 2000000000000;")
+        // force full app sync to download notes with new IDs
+        database.execSQL("DELETE FROM config WHERE `key` = 'hash';")
+        database.execSQL("DELETE FROM config WHERE `key` = 'lastAppSync';")
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyAppFirebase.kt

@@ -6,7 +6,11 @@ package pl.szczodrzynski.edziennik.data.firebase
 
 import com.google.gson.JsonParser
 import com.google.gson.reflect.TypeToken
-import kotlinx.coroutines.*
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.Job
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 import org.greenrobot.eventbus.EventBus
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.api.events.FeedbackMessageEvent
@@ -14,14 +18,18 @@ import pl.szczodrzynski.edziennik.data.api.events.RegisterAvailabilityEvent
 import pl.szczodrzynski.edziennik.data.api.szkolny.response.RegisterAvailabilityStatus
 import pl.szczodrzynski.edziennik.data.api.szkolny.response.Update
 import pl.szczodrzynski.edziennik.data.api.task.PostNotifications
-import pl.szczodrzynski.edziennik.data.db.entity.*
+import pl.szczodrzynski.edziennik.data.db.entity.Event
+import pl.szczodrzynski.edziennik.data.db.entity.FeedbackMessage
+import pl.szczodrzynski.edziennik.data.db.entity.Metadata
+import pl.szczodrzynski.edziennik.data.db.entity.Note
+import pl.szczodrzynski.edziennik.data.db.entity.Notification
+import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.data.db.enums.NotificationType
 import pl.szczodrzynski.edziennik.ext.getInt
 import pl.szczodrzynski.edziennik.ext.getLong
 import pl.szczodrzynski.edziennik.ext.getString
 import pl.szczodrzynski.edziennik.ext.resolveString
-import pl.szczodrzynski.edziennik.sync.UpdateWorker
 import pl.szczodrzynski.edziennik.ui.base.enums.NavTarget
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.edziennik.utils.models.Time
@@ -64,7 +72,10 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
                         message.data.getString("title") ?: "",
                         message.data.getString("message") ?: ""
                 )
-                "appUpdate" -> launch { UpdateWorker.runNow(app, app.gson.fromJson(message.data.getString("update"), Update::class.java)) }
+                "appUpdate" -> {
+                    val update = app.gson.fromJson(message.data.getString("update"), Update::class.java)
+                    app.updateManager.process(update, notify = true)
+                }
                 "feedbackMessage" -> launch {
                     val message = app.gson.fromJson(message.data.getString("message"), FeedbackMessage::class.java) ?: return@launch
                     feedbackMessage(message)
@@ -149,11 +160,11 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
             if (event.color == -1)
                 event.color = null
 
+            event.addedManually = true
             event.sharedBy = json.getString("sharedBy")
             event.sharedByName = json.getString("sharedByName")
             if (profile.userCode == event.sharedBy) {
                 event.sharedBy = "self"
-                event.addedManually = true
             }
 
             val metadata = Metadata(
@@ -165,7 +176,7 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
             )
 
             val type = if (event.isHomework) NotificationType.SHARED_HOMEWORK else NotificationType.SHARED_EVENT
-            val notificationFilter = app.config.getFor(event.profileId).sync.notificationFilter
+            val notificationFilter = app.config[event.profileId].sync.notificationFilter
 
             if (!notificationFilter.contains(type) && event.sharedBy != "self" && event.date >= Date.getToday()) {
                 val notification = Notification(
@@ -200,7 +211,7 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
             val profile = profiles.firstOrNull { it.id == team.profileId } ?: return@forEach
             if (!profile.canShare)
                 return@forEach
-            val notificationFilter = app.config.getFor(team.profileId).sync.notificationFilter
+            val notificationFilter = app.config[team.profileId].sync.notificationFilter
 
             if (!notificationFilter.contains(NotificationType.REMOVED_SHARED_EVENT)) {
                 val notification = Notification(
@@ -254,7 +265,7 @@ class SzkolnyAppFirebase(val app: App, val profiles: List<Profile>, val message:
                 return@forEach
 
             val type = NotificationType.SHARED_NOTE
-            val notificationFilter = app.config.getFor(note.profileId).sync.notificationFilter
+            val notificationFilter = app.config[note.profileId].sync.notificationFilter
 
             if (!notificationFilter.contains(type) && note.sharedBy != "self") {
                 val notification = Notification(

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyLibrusFirebase.kt

@@ -6,12 +6,37 @@ package pl.szczodrzynski.edziennik.data.firebase
 
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.api.edziennik.EdziennikTask
-import pl.szczodrzynski.edziennik.data.api.edziennik.librus.*
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_ANNOUNCEMENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_ATTENDANCES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_BEHAVIOUR_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_BEHAVIOUR_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_BEHAVIOUR_GRADE_COMMENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_CLASS_FREE_DAYS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_DESCRIPTIVE_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_DESCRIPTIVE_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_DESCRIPTIVE_TEXT_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_EVENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_HOMEWORK
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_LUCKY_NUMBER
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NORMAL_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NORMAL_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NORMAL_GRADE_COMMENTS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_NOTICES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_POINT_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_POINT_GRADE_CATEGORIES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_PT_MEETINGS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_SCHOOL_FREE_DAYS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_TEACHER_FREE_DAYS
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_TEXT_GRADES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_API_TIMETABLES
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_MESSAGES_RECEIVED
+import pl.szczodrzynski.edziennik.data.api.edziennik.librus.ENDPOINT_LIBRUS_SYNERGIA_HOMEWORK
 import pl.szczodrzynski.edziennik.data.api.task.IApiTask
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.getStudentData
 
 class SzkolnyLibrusFirebase(val app: App, val profiles: List<Profile>, val message: FirebaseService.Message) {
     /*{

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyMobidziennikFirebase.kt

@@ -12,6 +12,7 @@ import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.ext.getLong
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.getStudentData
 
 class SzkolnyMobidziennikFirebase(val app: App, val profiles: List<Profile>, val message: FirebaseService.Message) {
     /*{

app/src/main/java/pl/szczodrzynski/edziennik/data/firebase/SzkolnyVulcanFirebase.kt

@@ -4,15 +4,15 @@
 
 package pl.szczodrzynski.edziennik.data.firebase
 
-import pl.szczodrzynski.edziennik.*
+import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.data.api.edziennik.EdziennikTask
 import pl.szczodrzynski.edziennik.data.api.task.IApiTask
-import pl.szczodrzynski.edziennik.data.db.entity.Message
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 import pl.szczodrzynski.edziennik.data.db.enums.LoginType
 import pl.szczodrzynski.edziennik.ext.getInt
 import pl.szczodrzynski.edziennik.ext.getString
+import pl.szczodrzynski.edziennik.ext.getStudentData
 import pl.szczodrzynski.edziennik.ext.toJsonObject
 
 class SzkolnyVulcanFirebase(val app: App, val profiles: List<Profile>, val message: FirebaseService.Message) {

app/src/main/java/pl/szczodrzynski/edziennik/ext/DataExtensions.kt

@@ -6,12 +6,9 @@ package pl.szczodrzynski.edziennik.ext
 
 import android.util.LongSparseArray
 import androidx.core.util.forEach
-import com.google.android.material.datepicker.CalendarConstraints
-import com.google.gson.JsonElement
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.entity.Teacher
 import pl.szczodrzynski.edziennik.data.db.entity.Team
-import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
 
 fun List<Teacher>.byId(id: Long) = firstOrNull { it.id == id }
 fun List<Teacher>.byNameFirstLast(nameFirstLast: String) = firstOrNull { it.name + " " + it.surname == nameFirstLast }
@@ -32,19 +29,3 @@ fun LongSparseArray<Team>.getById(id: Long): Team? {
     }
     return null
 }
-
-operator fun Profile.set(key: String, value: JsonElement) = this.studentData.add(key, value)
-operator fun Profile.set(key: String, value: Boolean) = this.studentData.addProperty(key, value)
-operator fun Profile.set(key: String, value: String?) = this.studentData.addProperty(key, value)
-operator fun Profile.set(key: String, value: Number) = this.studentData.addProperty(key, value)
-operator fun Profile.set(key: String, value: Char) = this.studentData.addProperty(key, value)
-
-fun Profile.getSchoolYearConstrains(): CalendarConstraints {
-    return CalendarConstraints.Builder()
-        .setStart(dateSemester1Start.inMillisUtc)
-        .setEnd(dateYearEnd.inMillisUtc)
-        .build()
-}
-
-fun Profile.hasFeature(featureType: FeatureType) = featureType in this.loginStoreType.features
-fun Profile.hasUIFeature(featureType: FeatureType) = featureType.isUIAlwaysAvailable || hasFeature(featureType)

app/src/main/java/pl/szczodrzynski/edziennik/ext/EnumExtensions.kt

@@ -50,13 +50,13 @@ inline fun <reified E : Enum<E>> Int.toEnum() = when (E::class.java) {
 } as E
 
 fun <E : Enum<E>> Int.toEnum(type: Class<*>) = when (type) {
-    // enums commented out are not really used in Bundles
+    // this is used for Config so all enums are here
     FeatureType::class.java -> this.asFeatureType()
-    // LoginMethod::class.java -> this.asLoginMethod()
+    LoginMethod::class.java -> this.asLoginMethod()
     LoginMode::class.java -> this.asLoginMode()
     LoginType::class.java -> this.asLoginType()
-    // MetadataType::class.java -> this.asMetadataType()
-    // NotificationType::class.java -> this.asNotificationType()
+    MetadataType::class.java -> this.asMetadataType()
+    NotificationType::class.java -> this.asNotificationType()
     NavTarget::class.java -> this.asNavTarget()
     else -> throw IllegalArgumentException("Unknown type $type")
 } as E

app/src/main/java/pl/szczodrzynski/edziennik/ext/JsonExtensions.kt

@@ -5,6 +5,7 @@
 package pl.szczodrzynski.edziennik.ext
 
 import android.os.Bundle
+import com.google.gson.Gson
 import com.google.gson.JsonArray
 import com.google.gson.JsonElement
 import com.google.gson.JsonObject
@@ -46,6 +47,12 @@ inline fun <reified E : Enum<E>> JsonObject?.getEnum(key: String) = this?.getInt
 fun JsonObject.putEnum(key: String, value: Enum<*>) = addProperty(key, value.toInt())
 
 fun String.toJsonObject(): JsonObject? = try { JsonParser.parseString(this).asJsonObject } catch (ignore: Exception) { null }
+fun String.toJsonArray(): JsonArray? = try { JsonParser.parseString(this).asJsonArray } catch (ignore: Exception) { null }
+
+fun Any?.toJsonElement(): JsonElement = when (this) {
+    is Collection<*> -> JsonArray(this)
+    else -> Gson().toJsonTree(this)
+}
 
 operator fun JsonObject.set(key: String, value: JsonElement) = this.add(key, value)
 operator fun JsonObject.set(key: String, value: Boolean) = this.addProperty(key, value)
@@ -66,6 +73,8 @@ fun JsonObject(vararg properties: Pair<String, Any?>): JsonObject {
                 is Number -> addProperty(key, value)
                 is Boolean -> addProperty(key, value)
                 is Enum<*> -> addProperty(key, value.toInt())
+                null -> add(key, null)
+                else -> add(key, value.toJsonElement())
             }
         }
     }
@@ -86,7 +95,9 @@ fun JsonObject.toBundle(): Bundle {
     }
 }
 
-fun JsonArray(vararg properties: Any?): JsonArray {
+fun JsonArray(vararg properties: Any?) = JsonArray(properties.toList())
+
+fun JsonArray(properties: Collection<Any?>): JsonArray {
     return JsonArray().apply {
         for (property in properties) {
             when (property) {
@@ -95,6 +106,8 @@ fun JsonArray(vararg properties: Any?): JsonArray {
                 is Char -> add(property as Char?)
                 is Number -> add(property as Number?)
                 is Boolean -> add(property as Boolean?)
+                is Enum<*> -> add(property.toInt())
+                else -> add(property.toJsonElement())
             }
         }
     }
@@ -112,3 +125,20 @@ operator fun JsonArray.plusAssign(o: String) = this.add(o)
 operator fun JsonArray.plusAssign(o: Char) = this.add(o)
 operator fun JsonArray.plusAssign(o: Number) = this.add(o)
 operator fun JsonArray.plusAssign(o: Boolean) = this.add(o)
+
+fun JsonObject.mergeWith(other: JsonObject): JsonObject {
+    for ((key, value) in other.entrySet()) {
+        when (value) {
+            is JsonObject -> when {
+                this.has(key) -> this.getJsonObject(key)?.mergeWith(value)
+                else -> this.add(key, value)
+            }
+            is JsonArray -> when {
+                this.has(key) -> this.getJsonArray(key)?.addAll(value)
+                else -> this.add(key, value)
+            }
+            else -> this.add(key, value)
+        }
+    }
+    return this
+}

app/src/main/java/pl/szczodrzynski/edziennik/ext/MiscExtensions.kt

@@ -72,3 +72,19 @@ fun pendingIntentFlag(): Int {
         return PendingIntent.FLAG_IMMUTABLE
     return 0
 }
+
+fun pendingIntentMutable(): Int {
+    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S)
+        return PendingIntent.FLAG_MUTABLE
+    return 0
+}
+
+fun Int?.takeValue() = if (this == -1) null else this
+fun Int?.takePositive() = if (this == -1 || this == 0) null else this
+
+fun Long?.takeValue() = if (this == -1L) null else this
+fun Long?.takePositive() = if (this == -1L || this == 0L) null else this
+
+fun String?.takeValue() = if (this.isNullOrBlank()) null else this
+
+fun Any?.ignore() = Unit

app/src/main/java/pl/szczodrzynski/edziennik/ext/ProfileExtensions.kt

@@ -0,0 +1,127 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-25.
+ */
+
+package pl.szczodrzynski.edziennik.ext
+
+import android.content.Context
+import android.graphics.PorterDuff
+import android.graphics.PorterDuffColorFilter
+import android.graphics.drawable.Drawable
+import androidx.core.graphics.drawable.RoundedBitmapDrawableFactory
+import com.google.android.material.datepicker.CalendarConstraints
+import com.google.gson.JsonElement
+import pl.droidsonroids.gif.GifDrawable
+import pl.szczodrzynski.edziennik.App
+import pl.szczodrzynski.edziennik.R
+import pl.szczodrzynski.edziennik.config.AppData
+import pl.szczodrzynski.edziennik.data.db.entity.Profile
+import pl.szczodrzynski.edziennik.data.db.enums.FeatureType
+import pl.szczodrzynski.edziennik.utils.ProfileImageHolder
+import pl.szczodrzynski.edziennik.utils.models.Date
+import pl.szczodrzynski.navlib.ImageHolder
+import pl.szczodrzynski.navlib.getDrawableFromRes
+
+// TODO refactor Data* fields and make the receiver non-nullable
+operator fun Profile?.set(key: String, value: JsonElement) = this?.studentData?.add(key, value)
+operator fun Profile?.set(key: String, value: Boolean) = this?.studentData?.addProperty(key, value)
+operator fun Profile?.set(key: String, value: String?) = this?.studentData?.addProperty(key, value)
+operator fun Profile?.set(key: String, value: Number) = this?.studentData?.addProperty(key, value)
+operator fun Profile?.set(key: String, value: Char) = this?.studentData?.addProperty(key, value)
+
+fun Profile.getStudentData(key: String, defaultValue: Boolean) =
+    studentData.getBoolean(key) ?: defaultValue
+
+fun Profile.getStudentData(key: String, defaultValue: String?) =
+    studentData.getString(key) ?: defaultValue
+
+fun Profile.getStudentData(key: String, defaultValue: Int) =
+    studentData.getInt(key) ?: defaultValue
+
+fun Profile.getStudentData(key: String, defaultValue: Long) =
+    studentData.getLong(key) ?: defaultValue
+
+fun Profile.getStudentData(key: String, defaultValue: Float) =
+    studentData.getFloat(key) ?: defaultValue
+
+fun Profile.getStudentData(key: String, defaultValue: Char) =
+    studentData.getChar(key) ?: defaultValue
+
+fun Profile.getSemesterStart(semester: Int) =
+    if (semester == 1) dateSemester1Start else dateSemester2Start
+
+fun Profile.getSemesterEnd(semester: Int) =
+    if (semester == 1) dateSemester2Start.clone().stepForward(0, 0, -1) else dateYearEnd
+
+fun Profile.dateToSemester(date: Date) = if (date >= dateSemester2Start) 2 else 1
+fun Profile.isBeforeYear() = false && Date.getToday() < dateSemester1Start
+
+fun Profile.getSchoolYearConstrains(): CalendarConstraints {
+    return CalendarConstraints.Builder()
+        .setStart(dateSemester1Start.inMillisUtc)
+        .setEnd(dateYearEnd.inMillisUtc)
+        .build()
+}
+
+fun Profile.hasFeature(featureType: FeatureType) = featureType in this.loginStoreType.features
+fun Profile.hasUIFeature(featureType: FeatureType) =
+    featureType.isUIAlwaysAvailable || hasFeature(featureType)
+
+fun Profile.getAppData() =
+    if (App.profileId == this.id) App.data else AppData.get(this.loginStoreType)
+
+fun Profile.shouldArchive(): Boolean {
+    // vulcan hotfix
+    if (dateYearEnd.month > 6) {
+        dateYearEnd.month = 6
+        dateYearEnd.day = 30
+    }
+    // fix for when versions <4.3 synced 2020/2021 year dates to older profiles during 2020 Jun-Aug
+    if (dateSemester1Start.year > studentSchoolYearStart) {
+        val diff = dateSemester1Start.year - studentSchoolYearStart
+        dateSemester1Start.year -= diff
+        dateSemester2Start.year -= diff
+        dateYearEnd.year -= diff
+    }
+    return App.config.archiverEnabled && Date.getToday() >= dateYearEnd && Date.getToday().year > studentSchoolYearStart
+}
+
+fun Profile.getDrawable(context: Context): Drawable {
+    if (archived) {
+        return context.getDrawableFromRes(R.drawable.profile_archived).also {
+            it.colorFilter = PorterDuffColorFilter(colorFromName(name), PorterDuff.Mode.DST_OVER)
+        }
+    }
+
+    if (!image.isNullOrEmpty()) {
+        try {
+            return if (image?.endsWith(".gif", true) == true) {
+                GifDrawable(image ?: "")
+            } else {
+                RoundedBitmapDrawableFactory.create(context.resources, image ?: "")
+            }
+        } catch (e: Exception) {
+            e.printStackTrace()
+        }
+    }
+
+    return context.getDrawableFromRes(R.drawable.profile).also {
+        it.colorFilter = PorterDuffColorFilter(colorFromName(name), PorterDuff.Mode.DST_OVER)
+    }
+}
+
+fun Profile.getHolder(): ImageHolder {
+    if (archived) {
+        return ImageHolder(R.drawable.profile_archived, colorFromName(name))
+    }
+
+    return if (!image.isNullOrEmpty()) {
+        try {
+            ProfileImageHolder(image ?: "")
+        } catch (_: Exception) {
+            ImageHolder(R.drawable.profile, colorFromName(name))
+        }
+    } else {
+        ImageHolder(R.drawable.profile, colorFromName(name))
+    }
+}

app/src/main/java/pl/szczodrzynski/edziennik/ext/TextExtensions.kt

@@ -15,6 +15,7 @@ import android.text.style.CharacterStyle
 import android.text.style.ForegroundColorSpan
 import android.text.style.StrikethroughSpan
 import android.text.style.StyleSpan
+import android.text.style.UnderlineSpan
 import androidx.annotation.PluralsRes
 import androidx.annotation.StringRes
 import com.mikepenz.materialdrawer.holder.StringHolder
@@ -160,6 +161,11 @@ fun CharSequence?.asBoldSpannable(): Spannable {
     spannable.setSpan(StyleSpan(Typeface.BOLD), 0, spannable.length, Spannable.SPAN_EXCLUSIVE_EXCLUSIVE)
     return spannable
 }
+fun CharSequence?.asUnderlineSpannable(): Spannable {
+    val spannable = SpannableString(this)
+    spannable.setSpan(UnderlineSpan(), 0, spannable.length, Spannable.SPAN_EXCLUSIVE_EXCLUSIVE)
+    return spannable
+}
 fun CharSequence.asSpannable(
     vararg spans: CharacterStyle,
     substring: CharSequence? = null,

app/src/main/java/pl/szczodrzynski/edziennik/ext/ViewExtensions.kt

@@ -8,6 +8,7 @@ import android.content.Context
 import android.content.res.Resources
 import android.graphics.Rect
 import android.view.View
+import android.view.ViewGroup
 import android.view.WindowManager
 import android.widget.*
 import androidx.annotation.StringRes
@@ -161,3 +162,12 @@ val SwipeRefreshLayout.onScrollListener: RecyclerView.OnScrollListener
         }
     }
 
+fun View.removeFromParent() {
+    (parent as? ViewGroup)?.removeView(this)
+}
+
+fun View.appendView(child: View) {
+    val parent = parent as? ViewGroup ?: return
+    val index = parent.indexOfChild(this)
+    parent.addView(child, index + 1)
+}

app/src/main/java/pl/szczodrzynski/edziennik/network/cookie/DumbCookie.kt

@@ -5,8 +5,20 @@
 package pl.szczodrzynski.edziennik.network.cookie
 
 import okhttp3.Cookie
+import okhttp3.HttpUrl
 
 class DumbCookie(var cookie: Cookie) {
+    companion object {
+        fun deserialize(key: String, value: String): DumbCookie? {
+            val (domain, _) = key.split('|', limit = 2)
+            val url = HttpUrl.Builder()
+                .scheme("https")
+                .host(domain)
+                .build()
+            val cookie = Cookie.parse(url, value) ?: return null
+            return DumbCookie(cookie)
+        }
+    }
 
     constructor(domain: String, name: String, value: String, expiresAt: Long? = null) : this(
             Cookie.Builder()
@@ -21,7 +33,10 @@ class DumbCookie(var cookie: Cookie) {
         cookie = Cookie.Builder()
                 .name(cookie.name())
                 .value(cookie.value())
-                .expiresAt(cookie.expiresAt())
+                .also {
+                    if (cookie.persistent())
+                        it.expiresAt(cookie.expiresAt())
+                }
                 .domain(cookie.domain())
                 .build()
     }
@@ -45,4 +60,7 @@ class DumbCookie(var cookie: Cookie) {
         hash = 31 * hash + cookie.domain().hashCode()
         return hash
     }
+
+    fun serializeKey() = cookie.domain() + "|" + cookie.name()
+    fun serialize() = serializeKey() to cookie.toString()
 }

app/src/main/java/pl/szczodrzynski/edziennik/network/cookie/DumbCookieJar.kt

@@ -5,6 +5,7 @@
 package pl.szczodrzynski.edziennik.network.cookie
 
 import android.content.Context
+import androidx.core.content.edit
 import okhttp3.Cookie
 import okhttp3.CookieJar
 import okhttp3.HttpUrl
@@ -26,22 +27,48 @@ class DumbCookieJar(
 ) : CookieJar {
 
     private val prefs = context.getSharedPreferences("cookies", Context.MODE_PRIVATE)
-    val sessionCookies = mutableSetOf<DumbCookie>()
-    private val savedCookies = mutableSetOf<DumbCookie>()
+    private val sessionCookies = mutableSetOf<DumbCookie>()
+
+    init {
+        val toRemove = mutableListOf<String>()
+        prefs.all.forEach { (key, value) ->
+            if (value !is String)
+                return@forEach
+            val dc = DumbCookie.deserialize(key, value) ?: return@forEach
+            if (dc.cookie.expiresAt() > System.currentTimeMillis())
+                sessionCookies.add(dc)
+            else
+                toRemove.add(key)
+        }
+        prefs.edit {
+            for (key in toRemove) {
+                remove(key)
+            }
+        }
+    }
+
     private fun save(dc: DumbCookie) {
         sessionCookies.remove(dc)
         sessionCookies.add(dc)
         if (dc.cookie.persistent() || persistAll) {
-            savedCookies.remove(dc)
-            savedCookies.add(dc)
+            prefs.edit {
+                val (key, value) = dc.serialize()
+                putString(key, value)
+            }
         }
     }
     private fun delete(vararg toRemove: DumbCookie) {
-        sessionCookies.removeAll(toRemove)
-        savedCookies.removeAll(toRemove)
+        sessionCookies.removeAll(toRemove.toSet())
+        prefs.edit {
+            for (dc in toRemove) {
+                val key = dc.serializeKey()
+                if (prefs.contains(key))
+                    remove(key)
+            }
+        }
     }
 
-    override fun saveFromResponse(url: HttpUrl?, cookies: List<Cookie>) {
+    override fun saveFromResponse(url: HttpUrl, cookies: MutableList<Cookie>) {
         for (cookie in cookies) {
             val dc = DumbCookie(cookie)
             save(dc)
@@ -54,6 +81,10 @@ class DumbCookieJar(
         }.map { it.cookie }
     }
 
+    fun getAllDomains(): List<Cookie> {
+        return sessionCookies.map { it.cookie }
+    }
+
     fun get(domain: String, name: String): String? {
         return sessionCookies.firstOrNull {
             it.domainMatches(domain) && it.cookie.name() == name
@@ -84,7 +115,7 @@ class DumbCookieJar(
     fun getAll(domain: String): Map<String, String> {
         return sessionCookies.filter {
             it.domainMatches(domain)
-        }.map { it.cookie.name() to it.cookie.value() }.toMap()
+        }.associate { it.cookie.name() to it.cookie.value() }
     }
 
     fun remove(domain: String, name: String) {
@@ -100,4 +131,11 @@ class DumbCookieJar(
         }
         delete(*toRemove.toTypedArray())
     }
+
+    fun clearAllDomains() {
+        sessionCookies.clear()
+        prefs.edit {
+            clear()
+        }
+    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/sync/UpdateStateEvent.kt

@@ -0,0 +1,9 @@
+/*
+ * Copyright (c) Kuba Szczodrzyński 2022-10-22.
+ */
+
+package pl.szczodrzynski.edziennik.sync
+
+import pl.szczodrzynski.edziennik.data.api.szkolny.response.Update
+
+class UpdateStateEvent(val running: Boolean, val update: Update?, val downloadId: Long)

app/src/main/java/pl/szczodrzynski/edziennik/sync/UpdateWorker.kt

@@ -5,25 +5,14 @@
 package pl.szczodrzynski.edziennik.sync
 
 import android.annotation.SuppressLint
-import android.app.NotificationManager
-import android.app.PendingIntent
 import android.content.Context
-import android.content.Intent
-import android.widget.Toast
-import androidx.core.app.NotificationCompat
 import androidx.work.*
 import kotlinx.coroutines.*
-import org.greenrobot.eventbus.EventBus
 import pl.szczodrzynski.edziennik.*
-import pl.szczodrzynski.edziennik.R
-import pl.szczodrzynski.edziennik.data.api.szkolny.SzkolnyApi
 import pl.szczodrzynski.edziennik.data.api.szkolny.response.Update
 import pl.szczodrzynski.edziennik.ext.DAY
-import pl.szczodrzynski.edziennik.ext.concat
 import pl.szczodrzynski.edziennik.ext.formatDate
-import pl.szczodrzynski.edziennik.ext.pendingIntentFlag
 import pl.szczodrzynski.edziennik.utils.Utils
-import pl.szczodrzynski.edziennik.utils.html.BetterHtml
 import java.util.concurrent.TimeUnit
 import kotlin.coroutines.CoroutineContext
 
@@ -76,63 +65,6 @@ class UpdateWorker(val context: Context, val params: WorkerParameters) : Worker(
             Utils.d(TAG, "Cancelling work by tag $TAG")
             WorkManager.getInstance(app).cancelAllWorkByTag(TAG)
         }
-
-        suspend fun runNow(app: App, overrideUpdate: Update? = null) {
-            try {
-                val update = overrideUpdate
-                        ?: run {
-                            withContext(Dispatchers.Default) {
-                                SzkolnyApi(app).runCatching({
-                                    getUpdate("beta")
-                                }, {
-                                    Toast.makeText(app, app.getString(R.string.notification_cant_check_update), Toast.LENGTH_SHORT).show()
-                                })
-                            } ?: return@run null
-
-                            if (app.config.update == null
-                                    || app.config.update?.versionCode ?: BuildConfig.VERSION_CODE <= BuildConfig.VERSION_CODE) {
-                                app.config.update = null
-                                Toast.makeText(app, app.getString(R.string.notification_no_update), Toast.LENGTH_SHORT).show()
-                                return@run null
-                            }
-                            app.config.update
-                        } ?: return
-
-                if (update.versionCode <= BuildConfig.VERSION_CODE) {
-                    app.config.update = null
-                    return
-                }
-
-                if (EventBus.getDefault().hasSubscriberForEvent(update::class.java)) {
-                    if (!update.updateMandatory) // mandatory updates are posted by the SzkolnyApi
-                        EventBus.getDefault().postSticky(update)
-                    return
-                }
-
-                val notificationIntent = Intent(app, UpdateDownloaderService::class.java)
-                val pendingIntent = PendingIntent.getService(app, 0, notificationIntent, PendingIntent.FLAG_UPDATE_CURRENT or pendingIntentFlag())
-                val notification = NotificationCompat.Builder(app, app.notificationChannelsManager.updates.key)
-                        .setContentTitle(app.getString(R.string.notification_updates_title))
-                        .setContentText(app.getString(R.string.notification_updates_text, update.versionName))
-                        .setTicker(app.getString(R.string.notification_updates_summary))
-                        .setSmallIcon(R.drawable.ic_notification)
-                        .setStyle(NotificationCompat.BigTextStyle()
-                                .bigText(listOf(
-                                        app.getString(R.string.notification_updates_text, update.versionName),
-                                        update.releaseNotes?.let { BetterHtml.fromHtml(context = null, it) }
-                                ).concat("\n")))
-                        .setColor(0xff2196f3.toInt())
-                        .setLights(0xFF00FFFF.toInt(), 2000, 2000)
-                        .setPriority(NotificationCompat.PRIORITY_HIGH)
-                        .setDefaults(NotificationCompat.DEFAULT_ALL)
-                        .setGroup(app.notificationChannelsManager.updates.key)
-                        .setContentIntent(pendingIntent)
-                        .setAutoCancel(false)
-                        .build()
-                (app.getSystemService(Context.NOTIFICATION_SERVICE) as NotificationManager).notify(app.notificationChannelsManager.updates.id, notification)
-
-            } catch (ignore: Exception) { }
-        }
     }
 
     private val job = Job()
@@ -146,22 +78,13 @@ class UpdateWorker(val context: Context, val params: WorkerParameters) : Worker(
             return Result.success()
         }
 
-        launch {
-            runNow(app)
-        }
+        val channel = if (App.devMode)
+            Update.Type.BETA
+        else
+            Update.Type.RELEASE
+        app.updateManager.checkNowSync(channel, notify = true)
 
         rescheduleNext(this.context)
         return Result.success()
     }
-
-    class JavaWrapper(app: App) : CoroutineScope {
-        private val job = Job()
-        override val coroutineContext: CoroutineContext
-            get() = job + Dispatchers.Main
-        init {
-            launch {
-                runNow(app)
-            }
-        }
-    }
 }

app/src/main/java/pl/szczodrzynski/edziennik/ui/agenda/AgendaFragment.kt

@@ -17,12 +17,16 @@ import com.mikepenz.iconics.typeface.library.community.material.CommunityMateria
 import com.mikepenz.iconics.utils.colorInt
 import com.mikepenz.iconics.utils.sizeDp
 import eu.szkolny.font.SzkolnyFont
-import kotlinx.coroutines.*
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.Job
+import kotlinx.coroutines.delay
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.MainActivity
 import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.data.db.entity.EventType
-import pl.szczodrzynski.edziennik.data.db.entity.Metadata
 import pl.szczodrzynski.edziennik.data.db.entity.Profile
 import pl.szczodrzynski.edziennik.data.db.enums.MetadataType
 import pl.szczodrzynski.edziennik.databinding.FragmentAgendaCalendarBinding
@@ -33,7 +37,6 @@ import pl.szczodrzynski.edziennik.utils.Themes
 import pl.szczodrzynski.edziennik.utils.models.Date
 import pl.szczodrzynski.navlib.bottomsheet.items.BottomSheetPrimaryItem
 import pl.szczodrzynski.navlib.bottomsheet.items.BottomSheetSeparatorItem
-import java.util.*
 import kotlin.coroutines.CoroutineContext
 
 class AgendaFragment : Fragment(), CoroutineScope {
@@ -55,7 +58,7 @@ class AgendaFragment : Fragment(), CoroutineScope {
         if (getActivity() == null || context == null) return null
         activity = getActivity() as MainActivity
         context?.theme?.applyStyle(Themes.appTheme, true)
-        type = app.config.forProfile().ui.agendaViewType
+        type = app.profile.config.ui.agendaViewType
         b = when (type) {
             Profile.AGENDA_DEFAULT -> FragmentAgendaDefaultBinding.inflate(inflater, container, false)
             Profile.AGENDA_CALENDAR -> FragmentAgendaCalendarBinding.inflate(inflater, container, false)
@@ -94,7 +97,7 @@ class AgendaFragment : Fragment(), CoroutineScope {
                             activity.bottomSheet.close()
                             type =
                                 if (type == Profile.AGENDA_DEFAULT) Profile.AGENDA_CALENDAR else Profile.AGENDA_DEFAULT
-                            app.config.forProfile().ui.agendaViewType = type
+                            app.profile.config.ui.agendaViewType = type
                             activity.reloadTarget()
                         },
                 BottomSheetSeparatorItem(true),
@@ -139,13 +142,7 @@ class AgendaFragment : Fragment(), CoroutineScope {
 
     private suspend fun checkEventTypes() {
         withContext(Dispatchers.Default) {
-            val eventTypes = app.db.eventTypeDao().getAllNow(app.profileId).map {
-                it.id
-            }
-            val defaultEventTypes = EventType.getTypeColorMap().keys
-            if (!eventTypes.containsAll(defaultEventTypes)) {
-                app.db.eventTypeDao().addDefaultTypes(activity, app.profileId)
-            }
+            app.db.eventTypeDao().getAllWithDefaults(app.profile)
         }
     }
 

app/src/main/java/pl/szczodrzynski/edziennik/ui/agenda/AgendaFragmentDefault.kt

@@ -16,7 +16,12 @@ import com.github.tibolte.agendacalendarview.agenda.AgendaAdapter
 import com.github.tibolte.agendacalendarview.models.BaseCalendarEvent
 import com.github.tibolte.agendacalendarview.models.CalendarEvent
 import com.github.tibolte.agendacalendarview.models.IDayItem
-import kotlinx.coroutines.*
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.Job
+import kotlinx.coroutines.delay
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.MainActivity
 import pl.szczodrzynski.edziennik.data.db.full.EventFull
@@ -49,7 +54,6 @@ class AgendaFragmentDefault(
     private val unreadDates = mutableSetOf<Int>()
     private val events = mutableListOf<CalendarEvent>()
     private var isInitialized = false
-    private val profileConfig by lazy { app.config.forProfile().ui }
 
     private val listView
         get() = b.agendaDefaultView.agendaView.agendaListView
@@ -107,10 +111,10 @@ class AgendaFragmentDefault(
         isInitialized = false
 
         withContext(Dispatchers.Default) {
-            if (profileConfig.agendaLessonChanges)
+            if (app.profile.config.ui.agendaLessonChanges)
                 addLessonChanges(events)
 
-            if (profileConfig.agendaTeacherAbsence)
+            if (app.profile.config.ui.agendaTeacherAbsence)
                 addTeacherAbsence(events)
         }
 
@@ -127,7 +131,7 @@ class AgendaFragmentDefault(
         val dateStart = app.profile.dateSemester1Start.asCalendar
         val dateEnd = app.profile.dateYearEnd.asCalendar
 
-        val isCompactMode = profileConfig.agendaCompactMode
+        val isCompactMode = app.profile.config.ui.agendaCompactMode
 
         b.agendaDefaultView.init(
             events,
@@ -247,7 +251,7 @@ class AgendaFragmentDefault(
     ) {
         events.removeAll { it is AgendaEvent || it is AgendaEventGroup }
 
-        if (!profileConfig.agendaGroupByType) {
+        if (!app.profile.config.ui.agendaGroupByType) {
             events += eventList.map {
                 if (!it.seen)
                     unreadDates.add(it.date.value)

app/src/main/java/pl/szczodrzynski/edziennik/ui/agenda/event/AgendaEventRenderer.kt

@@ -11,6 +11,7 @@ import android.widget.TextView
 import androidx.core.view.isVisible
 import com.github.tibolte.agendacalendarview.render.EventRenderer
 import com.mikepenz.iconics.view.IconicsTextView
+import pl.szczodrzynski.edziennik.App
 import pl.szczodrzynski.edziennik.R
 import pl.szczodrzynski.edziennik.databinding.AgendaWrappedEventBinding
 import pl.szczodrzynski.edziennik.databinding.AgendaWrappedEventCompactBinding
@@ -53,16 +54,24 @@ class AgendaEventRenderer(
         else
             event.time!!.stringHM
 
+        val agendaSubjectImportant = App.profile.config.ui.agendaSubjectImportant
         val eventSubtitle = listOfNotNull(
             timeText,
-            event.subjectLongName,
+            event.subjectLongName.takeIf { !agendaSubjectImportant },
+            event.typeName.takeIf { agendaSubjectImportant },
             event.teacherName,
             event.teamName
         ).join(", ")
 
         card.foreground.setTintColor(event.eventColor)
         card.background.setTintColor(event.eventColor)
-        manager.setEventTopic(title, event, doneIconColor = textColor)
+        manager.setEventTopic(
+            title = title,
+            event = event,
+            doneIconColor = textColor,
+            showType = !agendaSubjectImportant,
+            showSubject = agendaSubjectImportant,
+        )
         title.setTextColor(textColor)
         subtitle?.text = eventSubtitle
         subtitle?.setTextColor(textColor)